From dd552b5f46ae9127f38b160a230776f0c3638f5d Mon Sep 17 00:00:00 2001 From: Anton Ilin <48175203+Anton-Rampage@users.noreply.github.com> Date: Tue, 21 Nov 2023 12:34:23 +0300 Subject: [PATCH] Add snapshot storage (#1215) * Added types * Renamed a file * Changed asset- and waves balances structures * Commented a function * Changed addresses types * Changed balanceAsset * Added a constructor * Added decimals to asset snapshot * Changed uint8 to int8 * Added a field for asset reissuability * Changed the type of total quantity * removed the pointer * Changed the type of orderID * Make 'SnapshotManager' as an interface type. * Replace 'proto.assetID' to 'crypto.Digest'. * Replace 'proto.Address' to 'proto.WavesAddress'. * Changed leaseID type * changed types of leaseIn and leaseOut * Removed the pointer types from AliasSnapshot * Change a bit 'AtomicSnapshot' interface. * Update snapshot types. * Removed unnecessary fields in 'AccountScriptSnapshot' struct. * Remove unnecessary types. * Change 'StaticAssetInfoSnapshot.Issuer' field to 'StaticAssetInfoSnapshot.IssuerPublicKey'. * Rename 'AssetReissuabilitySnapshot' to 'AssetVolumeSnapshot'. * Add feature block reward distribution (#1082) * add feature BlockRewardDistribution * fix tests * Improvement of the test on reward distribution to check that remainder of division goes to miner. * refactor after rewiev * fix feature info and add reward addresses in testnet and stagenet configs * DAO and buyback addresses added for MainNet. Formatting of settings files fixed. --------- Co-authored-by: Alexey Kiselev Co-authored-by: Nikolay Eskov * change actions count with feature BlockRewardDistribution activated (#1088) * change count actions with feature BlockRewardDistribution activated * fix comment in script * Merge fix. * Fix version in comment * Eth transaction refactoring and tests --------- Co-authored-by: Alexey Kiselev Co-authored-by: Nikolay Eskov * Ride add rewards to block info (#1096) * add feature BlockRewardDistribution * fix tests * Improvement of the test on reward distribution to check that remainder of division goes to miner. * refactor after rewiev * fix feature info and add reward addresses in testnet and stagenet configs * change count actions with feature BlockRewardDistribution activated * Ride version 7 added. Extended version of BlockInfo ride object added. Ride types representation in objects stdlib description changed to simple string. Parsing of types added to code generation and updated in compiler. Code generation updated to support Tuple types. * Fixed code generation for RideV7. Fixed compilation of V7 scripts. Added rewards structure and function to SmartState to get the block rewards. Added test on script accessing new rewards field on BlockInfo. * Fixed FunctionCall usage in tests * Fixed sorting of rewards with stable sort. * Script activation check added for RideV7. * Code improvements * Restored recursive check of list types in generated code. * Generation of simplified code for tuple type checks. * Duplicated tests removed * Fixed lib version check in Ride compiler --------- Co-authored-by: Anton Ilin Co-authored-by: Anton Ilin <48175203+Anton-Rampage@users.noreply.github.com> * Fix clear-text logging of sensitive information. (#1128) * Bump golang.org/x/sync from 0.2.0 to 0.3.0 (#1129) Bumps [golang.org/x/sync](https://github.com/golang/sync) from 0.2.0 to 0.3.0. - [Commits](https://github.com/golang/sync/compare/v0.2.0...v0.3.0) --- updated-dependencies: - dependency-name: golang.org/x/sync dependency-type: direct:production update-type: version-update:semver-minor ... Signed-off-by: dependabot[bot] Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Co-authored-by: Alexey Kiselev * Added 'LeaseStateStatus'. Changed types in 'LeaseStateSnapshot'. * Rename 'LeaseStateStatus.Status' to 'LeaseStateStatus.Value'. * Add methods to 'SnapshotManager' interface. Changed 'AtomicSnapshot' interface. * Snapshot applier (#1145) * Create marshal/unmarshal methods for 'leasing' structure in 'pkg/state'. * WIP: rollbackable map. * Return 'balanceProfile' and 'wavesBalanceRecord' by value. * Started 'snapshotApplier.' * Add apply methods for assets snapshot applying. * Add 'snapshotApplier.applySponsorship' method. * Add 'snapshotApplier.applyAccountScript' method. * Refactor 'ordersVolumes'. * Add 'snapshotApplier.applyFilledVolumeAndFee' method. * Add 'snapshotApplier.applyDataEntry' method. * Add 'snapshotApplier.applyLeaseState' method. * Revert "WIP: rollbackable map." This reverts commit cb3496915e101cd683f8174c5e801cbe924d6bca. * Created and used 'SnapshotApplierInfo' interface in 'state' package. * Create 'SnapshotApplier' interface in 'state' package. * Refactor 'SnapshotApplier' interface. * Remove 'SnapshotApplierInfo' interface. * Extracted 'snapshotApplierStorages'. * Rename 'ApplyDataEntry' to 'ApplyDataEntries'. * Replace 'SnapshotManager' to 'SnapshotApplier'. * Node transaction snapshots (#1078) * Added a conversion function * Added payment transaction conversion * Added transfer tx conversion * Transfer tx conversion changed * Added issue and reissue tx conversions * Issue * Issue, reissue, burn, exchange * Hanled lease transactions * Finished performers * Added snapshots for all types of transactions * Fixed types after merging * Fixed issue snapshot mistake * Added rewards snapshot in append block * Changed functions to newest * Added snapshots from actions * Removed todos * Deleted useless code * Fixed a mistake with leasing cancel * Added tests for issue and reissue transactions * Fixed tests * fixed implicit memory aliasing * Added tests for burn, lease, lease cancel, exchange and create alias transactions * Added tests for data, sponsorship, set account and asset script transactions * Added a test for the invoke transaction snapshots * Fixed after merge * Fixed a function * Moved snapshot generation * Remove 'SnapshotManager' interface. * Added a todo * Refactored perfomerInfo * Refactored performer info again * Moved generation to snapshot generator * Fixed some linter issues * Added an asset atomic snapshot for issue transaction * Replaced current recording to storage to snapshot applier * Replaced to snapshot applier, except balances * Fixed a comment * Removed the comment * Removed unnecessary code * Returned the linter command back * Replaced current recording to storage to snapshot applier (#1162) * Replaced current recording to storage to snapshot applier * Replaced to snapshot applier, except balances * Fixed a comment * Removed the comment * Removed unnecessary code * Returned the linter command back * Revert "Replaced current recording to storage to snapshot applier (#1162)" (#1164) This reverts commit 51904b2ff66e4de39d5668461676b9415f879f2d. * Added asset script atomic snapshot to the issue script actions * Fixed some linter issues * Fixed a few more linter issues * Fixed all linter issues * Fixed err shadowing * Fixed a mistake with issue counter * removed a useless line * Fixed applying order transactions * Fixed applying order transactions * Added lising snapshot to the tx diff generated group * Moved complexity saving into transaction performer * Moved complexity saving into transaction performer * removed a line * Fixed a bug with an empty sender * Used error.Is * Set an empty script for issue with sig * add snapshot storage * fix some linter issues * move snapshots types to proto * fix linter issues * Fixed a bug with wrong action sender * Fixed a bug with wrong action sender * use vtproto * Add 'TransactionStatusSnapshot'. * Implemented 'AtomicSnapshot' interface for 'TransactionStatusSnapshot'. * Changed 'AssetScriptSnapshot' and 'scriptStorageState.setAssetScript'. Removed 'pk' arg from 'setAssetScript'. Removed two fields from 'AssetScriptSnapshot': - 'SenderPK' - 'Complexity' * * Commented invoke snapshots, import ok (#1165) * Replaced current recording to storage to snapshot applier * Replaced to snapshot applier, except balances * Fixed a comment * Removed the comment * Removed unnecessary code * Returned the linter command back * Added asset script atomic snapshot to the issue script actions * Fixed some linter issues * Fixed a few more linter issues * Fixed all linter issues * Fixed err shadowing * Fixed a mistake with issue counter * removed a useless line * Fixed applying order transactions * Fixed applying order transactions * Added lising snapshot to the tx diff generated group * Moved complexity saving into transaction performer * Moved complexity saving into transaction performer * removed a line * Fixed a bug with an empty sender * Used error.Is * Set an empty script for issue with sig * move snapshots types to proto * Fixed a bug with wrong action sender * Fixed a bug with wrong action sender * Add 'TransactionStatusSnapshot'. * Implemented 'AtomicSnapshot' interface for 'TransactionStatusSnapshot'. * Changed 'AssetScriptSnapshot' and 'scriptStorageState.setAssetScript'. Removed 'pk' arg from 'setAssetScript'. Removed two fields from 'AssetScriptSnapshot': - 'SenderPK' - 'Complexity' * * Commented invoke snapshots, import ok * moved setting complexity and set script to snapshot applier * Fixed a test and a mistake * Fixed renaming * Fixed a comment * Moved dapp complexity to applier * Added dapp complexity to set script as well * Fixed a check mistake * Fixed a test * removed empty script check * removed a todo * Removed useless code * Modified a test * Fixed same keys issue for data entry actions * Remove invoke snapshot (#1235) * moved complexity back * Reverted some changes, import ok * Returned account script and asset script txs, import ? * Uncommented internal snapshot, import ok * Fixed height problem with issue action and issue tx, import NO * Issue action reverted * Added log and issueCounter for issue action * Commented invoke snapshots, import ok --------- Co-authored-by: Nikolay Eskov --------- Co-authored-by: Anton Ilin Co-authored-by: Nikolay Eskov * Added asset script special snapshot * Added internal snapshot for script for issue tx * add tx status snapshot to proto func * remove unnecessary changes * fix test * Separated internal tx snapshots. * Reduced 'internalSnapshot' interface, removed unnecessary code. * add block snapshot * remove some changes * inc state version and fix some bugs * fix marshall block snapshot * Properly used 'binary.BigEndian.AppendUint32' in 'BlockSnapshot.MarshallBinary'. --------- Signed-off-by: dependabot[bot] Co-authored-by: esuwu Co-authored-by: Nikolay Eskov Co-authored-by: Alexey Kiselev Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Co-authored-by: Alexandr Dolgavin <41806871+esuwu@users.noreply.github.com> --- pkg/grpc/generated/waves/amount.pb.go | 2 +- pkg/grpc/generated/waves/amount_vtproto.pb.go | 2 +- pkg/grpc/generated/waves/block.pb.go | 286 +- pkg/grpc/generated/waves/block_vtproto.pb.go | 646 ++- pkg/grpc/generated/waves/events/events.pb.go | 1027 +++-- .../events/grpc/blockchain_updates.pb.go | 2 +- .../events/grpc/blockchain_updates_grpc.pb.go | 2 +- .../waves/invoke_script_result.pb.go | 2 +- .../waves/invoke_script_result_vtproto.pb.go | 2 +- .../waves/node/grpc/accounts_api.pb.go | 236 +- .../waves/node/grpc/accounts_api_grpc.pb.go | 12 +- .../waves/node/grpc/assets_api.pb.go | 59 +- .../waves/node/grpc/assets_api_grpc.pb.go | 2 +- .../waves/node/grpc/blockchain_api.pb.go | 2 +- .../waves/node/grpc/blockchain_api_grpc.pb.go | 2 +- .../waves/node/grpc/blocks_api.pb.go | 168 +- .../waves/node/grpc/blocks_api_grpc.pb.go | 2 +- .../waves/node/grpc/transactions_api.pb.go | 86 +- .../node/grpc/transactions_api_grpc.pb.go | 2 +- pkg/grpc/generated/waves/order.pb.go | 16 +- pkg/grpc/generated/waves/order_vtproto.pb.go | 47 +- pkg/grpc/generated/waves/recipient.pb.go | 2 +- .../generated/waves/recipient_vtproto.pb.go | 2 +- pkg/grpc/generated/waves/reward_share.pb.go | 157 + .../waves/reward_share_vtproto.pb.go | 185 + pkg/grpc/generated/waves/state_snapshot.pb.go | 243 ++ .../waves/state_snapshot_vtproto.pb.go | 401 ++ pkg/grpc/generated/waves/transaction.pb.go | 2 +- .../waves/transaction_state_snapshot.pb.go | 1532 +++++++ .../transaction_state_snapshot_vtproto.pb.go | 3640 +++++++++++++++++ .../generated/waves/transaction_vtproto.pb.go | 2 +- pkg/grpc/protobuf-schemas | 2 +- pkg/grpc/server/accounts_api.go | 9 +- pkg/mock/grpc.go | 4 +- pkg/mock/state.go | 30 + pkg/proto/block_snapshot.go | 68 + pkg/proto/protobuf_converters.go | 225 + pkg/proto/snapshot_types.go | 488 ++- pkg/proto/types.go | 13 + pkg/ride/meta/generated/dapp_meta.pb.go | 2 +- pkg/state/api.go | 8 +- pkg/state/appender.go | 207 +- pkg/state/constants.go | 2 +- pkg/state/fee_validation.go | 1 + pkg/state/history_storage.go | 6 + pkg/state/keys.go | 16 + pkg/state/snapshot_generator_internal_test.go | 1 + pkg/state/snapshot_storage.go | 40 + pkg/state/snapshot_storage_internal_test.go | 32 + pkg/state/state.go | 6 + pkg/state/threadsafe_wrapper.go | 6 + 51 files changed, 9106 insertions(+), 831 deletions(-) create mode 100644 pkg/grpc/generated/waves/reward_share.pb.go create mode 100644 pkg/grpc/generated/waves/reward_share_vtproto.pb.go create mode 100644 pkg/grpc/generated/waves/state_snapshot.pb.go create mode 100644 pkg/grpc/generated/waves/state_snapshot_vtproto.pb.go create mode 100644 pkg/grpc/generated/waves/transaction_state_snapshot.pb.go create mode 100644 pkg/grpc/generated/waves/transaction_state_snapshot_vtproto.pb.go create mode 100644 pkg/proto/block_snapshot.go create mode 100644 pkg/state/snapshot_storage.go create mode 100644 pkg/state/snapshot_storage_internal_test.go diff --git a/pkg/grpc/generated/waves/amount.pb.go b/pkg/grpc/generated/waves/amount.pb.go index e5c81b873..c4510bc6a 100644 --- a/pkg/grpc/generated/waves/amount.pb.go +++ b/pkg/grpc/generated/waves/amount.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: // protoc-gen-go v1.27.1 -// protoc v3.21.12 +// protoc v4.24.4 // source: waves/amount.proto package waves diff --git a/pkg/grpc/generated/waves/amount_vtproto.pb.go b/pkg/grpc/generated/waves/amount_vtproto.pb.go index 4ea244d90..5e24e53ea 100644 --- a/pkg/grpc/generated/waves/amount_vtproto.pb.go +++ b/pkg/grpc/generated/waves/amount_vtproto.pb.go @@ -1,5 +1,5 @@ // Code generated by protoc-gen-go-vtproto. DO NOT EDIT. -// protoc-gen-go-vtproto version: v0.4.0 +// protoc-gen-go-vtproto version: v0.5.0 // source: waves/amount.proto package waves diff --git a/pkg/grpc/generated/waves/block.pb.go b/pkg/grpc/generated/waves/block.pb.go index 0ba51372d..b2f711bde 100644 --- a/pkg/grpc/generated/waves/block.pb.go +++ b/pkg/grpc/generated/waves/block.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: // protoc-gen-go v1.27.1 -// protoc v3.21.12 +// protoc v4.24.4 // source: waves/block.proto package waves @@ -93,6 +93,7 @@ type MicroBlock struct { UpdatedBlockSignature []byte `protobuf:"bytes,3,opt,name=updated_block_signature,json=updatedBlockSignature,proto3" json:"updated_block_signature,omitempty"` SenderPublicKey []byte `protobuf:"bytes,4,opt,name=sender_public_key,json=senderPublicKey,proto3" json:"sender_public_key,omitempty"` Transactions []*SignedTransaction `protobuf:"bytes,5,rep,name=transactions,proto3" json:"transactions,omitempty"` + StateHash []byte `protobuf:"bytes,6,opt,name=state_hash,json=stateHash,proto3" json:"state_hash,omitempty"` } func (x *MicroBlock) Reset() { @@ -162,6 +163,13 @@ func (x *MicroBlock) GetTransactions() []*SignedTransaction { return nil } +func (x *MicroBlock) GetStateHash() []byte { + if x != nil { + return x.StateHash + } + return nil +} + type SignedMicroBlock struct { state protoimpl.MessageState sizeCache protoimpl.SizeCache @@ -230,16 +238,18 @@ type Block_Header struct { sizeCache protoimpl.SizeCache unknownFields protoimpl.UnknownFields - ChainId int32 `protobuf:"varint,1,opt,name=chain_id,json=chainId,proto3" json:"chain_id,omitempty"` - Reference []byte `protobuf:"bytes,2,opt,name=reference,proto3" json:"reference,omitempty"` - BaseTarget int64 `protobuf:"varint,3,opt,name=base_target,json=baseTarget,proto3" json:"base_target,omitempty"` - GenerationSignature []byte `protobuf:"bytes,4,opt,name=generation_signature,json=generationSignature,proto3" json:"generation_signature,omitempty"` - FeatureVotes []uint32 `protobuf:"varint,5,rep,packed,name=feature_votes,json=featureVotes,proto3" json:"feature_votes,omitempty"` - Timestamp int64 `protobuf:"varint,6,opt,name=timestamp,proto3" json:"timestamp,omitempty"` - Version int32 `protobuf:"varint,7,opt,name=version,proto3" json:"version,omitempty"` - Generator []byte `protobuf:"bytes,8,opt,name=generator,proto3" json:"generator,omitempty"` - RewardVote int64 `protobuf:"varint,9,opt,name=reward_vote,json=rewardVote,proto3" json:"reward_vote,omitempty"` - TransactionsRoot []byte `protobuf:"bytes,10,opt,name=transactions_root,json=transactionsRoot,proto3" json:"transactions_root,omitempty"` + ChainId int32 `protobuf:"varint,1,opt,name=chain_id,json=chainId,proto3" json:"chain_id,omitempty"` + Reference []byte `protobuf:"bytes,2,opt,name=reference,proto3" json:"reference,omitempty"` + BaseTarget int64 `protobuf:"varint,3,opt,name=base_target,json=baseTarget,proto3" json:"base_target,omitempty"` + GenerationSignature []byte `protobuf:"bytes,4,opt,name=generation_signature,json=generationSignature,proto3" json:"generation_signature,omitempty"` + FeatureVotes []uint32 `protobuf:"varint,5,rep,packed,name=feature_votes,json=featureVotes,proto3" json:"feature_votes,omitempty"` + Timestamp int64 `protobuf:"varint,6,opt,name=timestamp,proto3" json:"timestamp,omitempty"` + Version int32 `protobuf:"varint,7,opt,name=version,proto3" json:"version,omitempty"` + Generator []byte `protobuf:"bytes,8,opt,name=generator,proto3" json:"generator,omitempty"` + RewardVote int64 `protobuf:"varint,9,opt,name=reward_vote,json=rewardVote,proto3" json:"reward_vote,omitempty"` + TransactionsRoot []byte `protobuf:"bytes,10,opt,name=transactions_root,json=transactionsRoot,proto3" json:"transactions_root,omitempty"` + StateHash []byte `protobuf:"bytes,11,opt,name=state_hash,json=stateHash,proto3" json:"state_hash,omitempty"` + ChallengedHeader *Block_Header_ChallengedHeader `protobuf:"bytes,12,opt,name=challenged_header,json=challengedHeader,proto3" json:"challenged_header,omitempty"` } func (x *Block_Header) Reset() { @@ -344,13 +354,130 @@ func (x *Block_Header) GetTransactionsRoot() []byte { return nil } +func (x *Block_Header) GetStateHash() []byte { + if x != nil { + return x.StateHash + } + return nil +} + +func (x *Block_Header) GetChallengedHeader() *Block_Header_ChallengedHeader { + if x != nil { + return x.ChallengedHeader + } + return nil +} + +type Block_Header_ChallengedHeader struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + BaseTarget int64 `protobuf:"varint,1,opt,name=base_target,json=baseTarget,proto3" json:"base_target,omitempty"` + GenerationSignature []byte `protobuf:"bytes,2,opt,name=generation_signature,json=generationSignature,proto3" json:"generation_signature,omitempty"` + FeatureVotes []uint32 `protobuf:"varint,3,rep,packed,name=feature_votes,json=featureVotes,proto3" json:"feature_votes,omitempty"` + Timestamp int64 `protobuf:"varint,4,opt,name=timestamp,proto3" json:"timestamp,omitempty"` + Generator []byte `protobuf:"bytes,5,opt,name=generator,proto3" json:"generator,omitempty"` + RewardVote int64 `protobuf:"varint,6,opt,name=reward_vote,json=rewardVote,proto3" json:"reward_vote,omitempty"` + StateHash []byte `protobuf:"bytes,7,opt,name=state_hash,json=stateHash,proto3" json:"state_hash,omitempty"` + HeaderSignature []byte `protobuf:"bytes,8,opt,name=header_signature,json=headerSignature,proto3" json:"header_signature,omitempty"` +} + +func (x *Block_Header_ChallengedHeader) Reset() { + *x = Block_Header_ChallengedHeader{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_block_proto_msgTypes[4] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *Block_Header_ChallengedHeader) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*Block_Header_ChallengedHeader) ProtoMessage() {} + +func (x *Block_Header_ChallengedHeader) ProtoReflect() protoreflect.Message { + mi := &file_waves_block_proto_msgTypes[4] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use Block_Header_ChallengedHeader.ProtoReflect.Descriptor instead. +func (*Block_Header_ChallengedHeader) Descriptor() ([]byte, []int) { + return file_waves_block_proto_rawDescGZIP(), []int{0, 0, 0} +} + +func (x *Block_Header_ChallengedHeader) GetBaseTarget() int64 { + if x != nil { + return x.BaseTarget + } + return 0 +} + +func (x *Block_Header_ChallengedHeader) GetGenerationSignature() []byte { + if x != nil { + return x.GenerationSignature + } + return nil +} + +func (x *Block_Header_ChallengedHeader) GetFeatureVotes() []uint32 { + if x != nil { + return x.FeatureVotes + } + return nil +} + +func (x *Block_Header_ChallengedHeader) GetTimestamp() int64 { + if x != nil { + return x.Timestamp + } + return 0 +} + +func (x *Block_Header_ChallengedHeader) GetGenerator() []byte { + if x != nil { + return x.Generator + } + return nil +} + +func (x *Block_Header_ChallengedHeader) GetRewardVote() int64 { + if x != nil { + return x.RewardVote + } + return 0 +} + +func (x *Block_Header_ChallengedHeader) GetStateHash() []byte { + if x != nil { + return x.StateHash + } + return nil +} + +func (x *Block_Header_ChallengedHeader) GetHeaderSignature() []byte { + if x != nil { + return x.HeaderSignature + } + return nil +} + var File_waves_block_proto protoreflect.FileDescriptor var file_waves_block_proto_rawDesc = []byte{ 0x0a, 0x11, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x05, 0x77, 0x61, 0x76, 0x65, 0x73, 0x1a, 0x17, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x70, 0x72, - 0x6f, 0x74, 0x6f, 0x22, 0xf1, 0x03, 0x0a, 0x05, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x12, 0x2b, 0x0a, + 0x6f, 0x74, 0x6f, 0x22, 0x98, 0x07, 0x0a, 0x05, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x12, 0x2b, 0x0a, 0x06, 0x68, 0x65, 0x61, 0x64, 0x65, 0x72, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x13, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x2e, 0x48, 0x65, 0x61, 0x64, 0x65, 0x72, 0x52, 0x06, 0x68, 0x65, 0x61, 0x64, 0x65, 0x72, 0x12, 0x1c, 0x0a, 0x09, 0x73, 0x69, @@ -359,7 +486,7 @@ var file_waves_block_proto_rawDesc = []byte{ 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x18, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x53, 0x69, 0x67, 0x6e, 0x65, 0x64, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x0c, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, - 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x1a, 0xde, 0x02, 0x0a, 0x06, 0x48, 0x65, 0x61, 0x64, 0x65, + 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x1a, 0x85, 0x06, 0x0a, 0x06, 0x48, 0x65, 0x61, 0x64, 0x65, 0x72, 0x12, 0x19, 0x0a, 0x08, 0x63, 0x68, 0x61, 0x69, 0x6e, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x05, 0x52, 0x07, 0x63, 0x68, 0x61, 0x69, 0x6e, 0x49, 0x64, 0x12, 0x1c, 0x0a, 0x09, 0x72, 0x65, 0x66, 0x65, 0x72, 0x65, 0x6e, 0x63, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0c, 0x52, @@ -381,37 +508,66 @@ var file_waves_block_proto_rawDesc = []byte{ 0x72, 0x65, 0x77, 0x61, 0x72, 0x64, 0x56, 0x6f, 0x74, 0x65, 0x12, 0x2b, 0x0a, 0x11, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x5f, 0x72, 0x6f, 0x6f, 0x74, 0x18, 0x0a, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x10, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, - 0x6f, 0x6e, 0x73, 0x52, 0x6f, 0x6f, 0x74, 0x22, 0xe6, 0x01, 0x0a, 0x0a, 0x4d, 0x69, 0x63, 0x72, - 0x6f, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x12, 0x18, 0x0a, 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, - 0x6e, 0x18, 0x01, 0x20, 0x01, 0x28, 0x05, 0x52, 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, - 0x12, 0x1c, 0x0a, 0x09, 0x72, 0x65, 0x66, 0x65, 0x72, 0x65, 0x6e, 0x63, 0x65, 0x18, 0x02, 0x20, - 0x01, 0x28, 0x0c, 0x52, 0x09, 0x72, 0x65, 0x66, 0x65, 0x72, 0x65, 0x6e, 0x63, 0x65, 0x12, 0x36, - 0x0a, 0x17, 0x75, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, 0x5f, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x5f, - 0x73, 0x69, 0x67, 0x6e, 0x61, 0x74, 0x75, 0x72, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0c, 0x52, - 0x15, 0x75, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x53, 0x69, 0x67, - 0x6e, 0x61, 0x74, 0x75, 0x72, 0x65, 0x12, 0x2a, 0x0a, 0x11, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, - 0x5f, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x5f, 0x6b, 0x65, 0x79, 0x18, 0x04, 0x20, 0x01, 0x28, - 0x0c, 0x52, 0x0f, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x50, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x4b, - 0x65, 0x79, 0x12, 0x3c, 0x0a, 0x0c, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, - 0x6e, 0x73, 0x18, 0x05, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x18, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, - 0x2e, 0x53, 0x69, 0x67, 0x6e, 0x65, 0x64, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, - 0x6f, 0x6e, 0x52, 0x0c, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, - 0x22, 0x8a, 0x01, 0x0a, 0x10, 0x53, 0x69, 0x67, 0x6e, 0x65, 0x64, 0x4d, 0x69, 0x63, 0x72, 0x6f, - 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x12, 0x32, 0x0a, 0x0b, 0x6d, 0x69, 0x63, 0x72, 0x6f, 0x5f, 0x62, - 0x6c, 0x6f, 0x63, 0x6b, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x11, 0x2e, 0x77, 0x61, 0x76, - 0x65, 0x73, 0x2e, 0x4d, 0x69, 0x63, 0x72, 0x6f, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x52, 0x0a, 0x6d, - 0x69, 0x63, 0x72, 0x6f, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x12, 0x1c, 0x0a, 0x09, 0x73, 0x69, 0x67, - 0x6e, 0x61, 0x74, 0x75, 0x72, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x09, 0x73, 0x69, - 0x67, 0x6e, 0x61, 0x74, 0x75, 0x72, 0x65, 0x12, 0x24, 0x0a, 0x0e, 0x74, 0x6f, 0x74, 0x61, 0x6c, - 0x5f, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x5f, 0x69, 0x64, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0c, 0x52, - 0x0c, 0x74, 0x6f, 0x74, 0x61, 0x6c, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x49, 0x64, 0x42, 0x65, 0x0a, - 0x20, 0x63, 0x6f, 0x6d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, - 0x72, 0x6d, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x62, 0x6c, 0x6f, 0x63, - 0x6b, 0x5a, 0x39, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x77, 0x61, - 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, 0x72, 0x6d, 0x2f, 0x67, 0x6f, 0x77, 0x61, - 0x76, 0x65, 0x73, 0x2f, 0x70, 0x6b, 0x67, 0x2f, 0x67, 0x72, 0x70, 0x63, 0x2f, 0x67, 0x65, 0x6e, - 0x65, 0x72, 0x61, 0x74, 0x65, 0x64, 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, 0xaa, 0x02, 0x05, 0x57, - 0x61, 0x76, 0x65, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33, + 0x6f, 0x6e, 0x73, 0x52, 0x6f, 0x6f, 0x74, 0x12, 0x1d, 0x0a, 0x0a, 0x73, 0x74, 0x61, 0x74, 0x65, + 0x5f, 0x68, 0x61, 0x73, 0x68, 0x18, 0x0b, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x09, 0x73, 0x74, 0x61, + 0x74, 0x65, 0x48, 0x61, 0x73, 0x68, 0x12, 0x51, 0x0a, 0x11, 0x63, 0x68, 0x61, 0x6c, 0x6c, 0x65, + 0x6e, 0x67, 0x65, 0x64, 0x5f, 0x68, 0x65, 0x61, 0x64, 0x65, 0x72, 0x18, 0x0c, 0x20, 0x01, 0x28, + 0x0b, 0x32, 0x24, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x2e, + 0x48, 0x65, 0x61, 0x64, 0x65, 0x72, 0x2e, 0x43, 0x68, 0x61, 0x6c, 0x6c, 0x65, 0x6e, 0x67, 0x65, + 0x64, 0x48, 0x65, 0x61, 0x64, 0x65, 0x72, 0x52, 0x10, 0x63, 0x68, 0x61, 0x6c, 0x6c, 0x65, 0x6e, + 0x67, 0x65, 0x64, 0x48, 0x65, 0x61, 0x64, 0x65, 0x72, 0x1a, 0xb2, 0x02, 0x0a, 0x10, 0x43, 0x68, + 0x61, 0x6c, 0x6c, 0x65, 0x6e, 0x67, 0x65, 0x64, 0x48, 0x65, 0x61, 0x64, 0x65, 0x72, 0x12, 0x1f, + 0x0a, 0x0b, 0x62, 0x61, 0x73, 0x65, 0x5f, 0x74, 0x61, 0x72, 0x67, 0x65, 0x74, 0x18, 0x01, 0x20, + 0x01, 0x28, 0x03, 0x52, 0x0a, 0x62, 0x61, 0x73, 0x65, 0x54, 0x61, 0x72, 0x67, 0x65, 0x74, 0x12, + 0x31, 0x0a, 0x14, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x73, 0x69, + 0x67, 0x6e, 0x61, 0x74, 0x75, 0x72, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x13, 0x67, + 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x69, 0x67, 0x6e, 0x61, 0x74, 0x75, + 0x72, 0x65, 0x12, 0x23, 0x0a, 0x0d, 0x66, 0x65, 0x61, 0x74, 0x75, 0x72, 0x65, 0x5f, 0x76, 0x6f, + 0x74, 0x65, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0d, 0x52, 0x0c, 0x66, 0x65, 0x61, 0x74, 0x75, + 0x72, 0x65, 0x56, 0x6f, 0x74, 0x65, 0x73, 0x12, 0x1c, 0x0a, 0x09, 0x74, 0x69, 0x6d, 0x65, 0x73, + 0x74, 0x61, 0x6d, 0x70, 0x18, 0x04, 0x20, 0x01, 0x28, 0x03, 0x52, 0x09, 0x74, 0x69, 0x6d, 0x65, + 0x73, 0x74, 0x61, 0x6d, 0x70, 0x12, 0x1c, 0x0a, 0x09, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, + 0x6f, 0x72, 0x18, 0x05, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x09, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, + 0x74, 0x6f, 0x72, 0x12, 0x1f, 0x0a, 0x0b, 0x72, 0x65, 0x77, 0x61, 0x72, 0x64, 0x5f, 0x76, 0x6f, + 0x74, 0x65, 0x18, 0x06, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0a, 0x72, 0x65, 0x77, 0x61, 0x72, 0x64, + 0x56, 0x6f, 0x74, 0x65, 0x12, 0x1d, 0x0a, 0x0a, 0x73, 0x74, 0x61, 0x74, 0x65, 0x5f, 0x68, 0x61, + 0x73, 0x68, 0x18, 0x07, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x09, 0x73, 0x74, 0x61, 0x74, 0x65, 0x48, + 0x61, 0x73, 0x68, 0x12, 0x29, 0x0a, 0x10, 0x68, 0x65, 0x61, 0x64, 0x65, 0x72, 0x5f, 0x73, 0x69, + 0x67, 0x6e, 0x61, 0x74, 0x75, 0x72, 0x65, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x0f, 0x68, + 0x65, 0x61, 0x64, 0x65, 0x72, 0x53, 0x69, 0x67, 0x6e, 0x61, 0x74, 0x75, 0x72, 0x65, 0x22, 0x85, + 0x02, 0x0a, 0x0a, 0x4d, 0x69, 0x63, 0x72, 0x6f, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x12, 0x18, 0x0a, + 0x07, 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x18, 0x01, 0x20, 0x01, 0x28, 0x05, 0x52, 0x07, + 0x76, 0x65, 0x72, 0x73, 0x69, 0x6f, 0x6e, 0x12, 0x1c, 0x0a, 0x09, 0x72, 0x65, 0x66, 0x65, 0x72, + 0x65, 0x6e, 0x63, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x09, 0x72, 0x65, 0x66, 0x65, + 0x72, 0x65, 0x6e, 0x63, 0x65, 0x12, 0x36, 0x0a, 0x17, 0x75, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, + 0x5f, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x5f, 0x73, 0x69, 0x67, 0x6e, 0x61, 0x74, 0x75, 0x72, 0x65, + 0x18, 0x03, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x15, 0x75, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, 0x42, + 0x6c, 0x6f, 0x63, 0x6b, 0x53, 0x69, 0x67, 0x6e, 0x61, 0x74, 0x75, 0x72, 0x65, 0x12, 0x2a, 0x0a, + 0x11, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x5f, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x5f, 0x6b, + 0x65, 0x79, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x0f, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, + 0x50, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x4b, 0x65, 0x79, 0x12, 0x3c, 0x0a, 0x0c, 0x74, 0x72, 0x61, + 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x18, 0x05, 0x20, 0x03, 0x28, 0x0b, 0x32, + 0x18, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x53, 0x69, 0x67, 0x6e, 0x65, 0x64, 0x54, 0x72, + 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x0c, 0x74, 0x72, 0x61, 0x6e, 0x73, + 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x12, 0x1d, 0x0a, 0x0a, 0x73, 0x74, 0x61, 0x74, 0x65, + 0x5f, 0x68, 0x61, 0x73, 0x68, 0x18, 0x06, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x09, 0x73, 0x74, 0x61, + 0x74, 0x65, 0x48, 0x61, 0x73, 0x68, 0x22, 0x8a, 0x01, 0x0a, 0x10, 0x53, 0x69, 0x67, 0x6e, 0x65, + 0x64, 0x4d, 0x69, 0x63, 0x72, 0x6f, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x12, 0x32, 0x0a, 0x0b, 0x6d, + 0x69, 0x63, 0x72, 0x6f, 0x5f, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, + 0x32, 0x11, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x4d, 0x69, 0x63, 0x72, 0x6f, 0x42, 0x6c, + 0x6f, 0x63, 0x6b, 0x52, 0x0a, 0x6d, 0x69, 0x63, 0x72, 0x6f, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x12, + 0x1c, 0x0a, 0x09, 0x73, 0x69, 0x67, 0x6e, 0x61, 0x74, 0x75, 0x72, 0x65, 0x18, 0x02, 0x20, 0x01, + 0x28, 0x0c, 0x52, 0x09, 0x73, 0x69, 0x67, 0x6e, 0x61, 0x74, 0x75, 0x72, 0x65, 0x12, 0x24, 0x0a, + 0x0e, 0x74, 0x6f, 0x74, 0x61, 0x6c, 0x5f, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x5f, 0x69, 0x64, 0x18, + 0x03, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x0c, 0x74, 0x6f, 0x74, 0x61, 0x6c, 0x42, 0x6c, 0x6f, 0x63, + 0x6b, 0x49, 0x64, 0x42, 0x65, 0x0a, 0x20, 0x63, 0x6f, 0x6d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, + 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, 0x72, 0x6d, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, + 0x66, 0x2e, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x5a, 0x39, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, + 0x63, 0x6f, 0x6d, 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, 0x72, + 0x6d, 0x2f, 0x67, 0x6f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x70, 0x6b, 0x67, 0x2f, 0x67, 0x72, + 0x70, 0x63, 0x2f, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x64, 0x2f, 0x77, 0x61, 0x76, + 0x65, 0x73, 0xaa, 0x02, 0x05, 0x57, 0x61, 0x76, 0x65, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, + 0x6f, 0x33, } var ( @@ -426,24 +582,26 @@ func file_waves_block_proto_rawDescGZIP() []byte { return file_waves_block_proto_rawDescData } -var file_waves_block_proto_msgTypes = make([]protoimpl.MessageInfo, 4) +var file_waves_block_proto_msgTypes = make([]protoimpl.MessageInfo, 5) var file_waves_block_proto_goTypes = []interface{}{ - (*Block)(nil), // 0: waves.Block - (*MicroBlock)(nil), // 1: waves.MicroBlock - (*SignedMicroBlock)(nil), // 2: waves.SignedMicroBlock - (*Block_Header)(nil), // 3: waves.Block.Header - (*SignedTransaction)(nil), // 4: waves.SignedTransaction + (*Block)(nil), // 0: waves.Block + (*MicroBlock)(nil), // 1: waves.MicroBlock + (*SignedMicroBlock)(nil), // 2: waves.SignedMicroBlock + (*Block_Header)(nil), // 3: waves.Block.Header + (*Block_Header_ChallengedHeader)(nil), // 4: waves.Block.Header.ChallengedHeader + (*SignedTransaction)(nil), // 5: waves.SignedTransaction } var file_waves_block_proto_depIdxs = []int32{ 3, // 0: waves.Block.header:type_name -> waves.Block.Header - 4, // 1: waves.Block.transactions:type_name -> waves.SignedTransaction - 4, // 2: waves.MicroBlock.transactions:type_name -> waves.SignedTransaction + 5, // 1: waves.Block.transactions:type_name -> waves.SignedTransaction + 5, // 2: waves.MicroBlock.transactions:type_name -> waves.SignedTransaction 1, // 3: waves.SignedMicroBlock.micro_block:type_name -> waves.MicroBlock - 4, // [4:4] is the sub-list for method output_type - 4, // [4:4] is the sub-list for method input_type - 4, // [4:4] is the sub-list for extension type_name - 4, // [4:4] is the sub-list for extension extendee - 0, // [0:4] is the sub-list for field type_name + 4, // 4: waves.Block.Header.challenged_header:type_name -> waves.Block.Header.ChallengedHeader + 5, // [5:5] is the sub-list for method output_type + 5, // [5:5] is the sub-list for method input_type + 5, // [5:5] is the sub-list for extension type_name + 5, // [5:5] is the sub-list for extension extendee + 0, // [0:5] is the sub-list for field type_name } func init() { file_waves_block_proto_init() } @@ -501,6 +659,18 @@ func file_waves_block_proto_init() { return nil } } + file_waves_block_proto_msgTypes[4].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*Block_Header_ChallengedHeader); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } } type x struct{} out := protoimpl.TypeBuilder{ @@ -508,7 +678,7 @@ func file_waves_block_proto_init() { GoPackagePath: reflect.TypeOf(x{}).PkgPath(), RawDescriptor: file_waves_block_proto_rawDesc, NumEnums: 0, - NumMessages: 4, + NumMessages: 5, NumExtensions: 0, NumServices: 0, }, diff --git a/pkg/grpc/generated/waves/block_vtproto.pb.go b/pkg/grpc/generated/waves/block_vtproto.pb.go index 2fe938802..62702b70c 100644 --- a/pkg/grpc/generated/waves/block_vtproto.pb.go +++ b/pkg/grpc/generated/waves/block_vtproto.pb.go @@ -1,5 +1,5 @@ // Code generated by protoc-gen-go-vtproto. DO NOT EDIT. -// protoc-gen-go-vtproto version: v0.4.0 +// protoc-gen-go-vtproto version: v0.5.0 // source: waves/block.proto package waves @@ -17,6 +17,102 @@ const ( _ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20) ) +func (m *Block_Header_ChallengedHeader) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Block_Header_ChallengedHeader) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *Block_Header_ChallengedHeader) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + if len(m.HeaderSignature) > 0 { + i -= len(m.HeaderSignature) + copy(dAtA[i:], m.HeaderSignature) + i = encodeVarint(dAtA, i, uint64(len(m.HeaderSignature))) + i-- + dAtA[i] = 0x42 + } + if len(m.StateHash) > 0 { + i -= len(m.StateHash) + copy(dAtA[i:], m.StateHash) + i = encodeVarint(dAtA, i, uint64(len(m.StateHash))) + i-- + dAtA[i] = 0x3a + } + if m.RewardVote != 0 { + i = encodeVarint(dAtA, i, uint64(m.RewardVote)) + i-- + dAtA[i] = 0x30 + } + if len(m.Generator) > 0 { + i -= len(m.Generator) + copy(dAtA[i:], m.Generator) + i = encodeVarint(dAtA, i, uint64(len(m.Generator))) + i-- + dAtA[i] = 0x2a + } + if m.Timestamp != 0 { + i = encodeVarint(dAtA, i, uint64(m.Timestamp)) + i-- + dAtA[i] = 0x20 + } + if len(m.FeatureVotes) > 0 { + var pksize2 int + for _, num := range m.FeatureVotes { + pksize2 += sov(uint64(num)) + } + i -= pksize2 + j1 := i + for _, num := range m.FeatureVotes { + for num >= 1<<7 { + dAtA[j1] = uint8(uint64(num)&0x7f | 0x80) + num >>= 7 + j1++ + } + dAtA[j1] = uint8(num) + j1++ + } + i = encodeVarint(dAtA, i, uint64(pksize2)) + i-- + dAtA[i] = 0x1a + } + if len(m.GenerationSignature) > 0 { + i -= len(m.GenerationSignature) + copy(dAtA[i:], m.GenerationSignature) + i = encodeVarint(dAtA, i, uint64(len(m.GenerationSignature))) + i-- + dAtA[i] = 0x12 + } + if m.BaseTarget != 0 { + i = encodeVarint(dAtA, i, uint64(m.BaseTarget)) + i-- + dAtA[i] = 0x8 + } + return len(dAtA) - i, nil +} + func (m *Block_Header) MarshalVTStrict() (dAtA []byte, err error) { if m == nil { return nil, nil @@ -47,6 +143,23 @@ func (m *Block_Header) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { i -= len(m.unknownFields) copy(dAtA[i:], m.unknownFields) } + if m.ChallengedHeader != nil { + size, err := m.ChallengedHeader.MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0x62 + } + if len(m.StateHash) > 0 { + i -= len(m.StateHash) + copy(dAtA[i:], m.StateHash) + i = encodeVarint(dAtA, i, uint64(len(m.StateHash))) + i-- + dAtA[i] = 0x5a + } if len(m.TransactionsRoot) > 0 { i -= len(m.TransactionsRoot) copy(dAtA[i:], m.TransactionsRoot) @@ -215,6 +328,13 @@ func (m *MicroBlock) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { i -= len(m.unknownFields) copy(dAtA[i:], m.unknownFields) } + if len(m.StateHash) > 0 { + i -= len(m.StateHash) + copy(dAtA[i:], m.StateHash) + i = encodeVarint(dAtA, i, uint64(len(m.StateHash))) + i-- + dAtA[i] = 0x32 + } if len(m.Transactions) > 0 { for iNdEx := len(m.Transactions) - 1; iNdEx >= 0; iNdEx-- { size, err := m.Transactions[iNdEx].MarshalToSizedBufferVTStrict(dAtA[:i]) @@ -313,6 +433,48 @@ func (m *SignedMicroBlock) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error return len(dAtA) - i, nil } +func (m *Block_Header_ChallengedHeader) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.BaseTarget != 0 { + n += 1 + sov(uint64(m.BaseTarget)) + } + l = len(m.GenerationSignature) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + if len(m.FeatureVotes) > 0 { + l = 0 + for _, e := range m.FeatureVotes { + l += sov(uint64(e)) + } + n += 1 + sov(uint64(l)) + l + } + if m.Timestamp != 0 { + n += 1 + sov(uint64(m.Timestamp)) + } + l = len(m.Generator) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + if m.RewardVote != 0 { + n += 1 + sov(uint64(m.RewardVote)) + } + l = len(m.StateHash) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + l = len(m.HeaderSignature) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + n += len(m.unknownFields) + return n +} + func (m *Block_Header) SizeVT() (n int) { if m == nil { return 0 @@ -357,6 +519,14 @@ func (m *Block_Header) SizeVT() (n int) { if l > 0 { n += 1 + l + sov(uint64(l)) } + l = len(m.StateHash) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + if m.ChallengedHeader != nil { + l = m.ChallengedHeader.SizeVT() + n += 1 + l + sov(uint64(l)) + } n += len(m.unknownFields) return n } @@ -412,32 +582,356 @@ func (m *MicroBlock) SizeVT() (n int) { n += 1 + l + sov(uint64(l)) } } - n += len(m.unknownFields) - return n -} + l = len(m.StateHash) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + n += len(m.unknownFields) + return n +} + +func (m *SignedMicroBlock) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.MicroBlock != nil { + l = m.MicroBlock.SizeVT() + n += 1 + l + sov(uint64(l)) + } + l = len(m.Signature) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + l = len(m.TotalBlockId) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + n += len(m.unknownFields) + return n +} + +func (m *Block_Header_ChallengedHeader) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Block_Header_ChallengedHeader: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Block_Header_ChallengedHeader: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field BaseTarget", wireType) + } + m.BaseTarget = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.BaseTarget |= int64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field GenerationSignature", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.GenerationSignature = append(m.GenerationSignature[:0], dAtA[iNdEx:postIndex]...) + if m.GenerationSignature == nil { + m.GenerationSignature = []byte{} + } + iNdEx = postIndex + case 3: + if wireType == 0 { + var v uint32 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= uint32(b&0x7F) << shift + if b < 0x80 { + break + } + } + m.FeatureVotes = append(m.FeatureVotes, v) + } else if wireType == 2 { + var packedLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + packedLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if packedLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + packedLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + var elementCount int + var count int + for _, integer := range dAtA[iNdEx:postIndex] { + if integer < 128 { + count++ + } + } + elementCount = count + if elementCount != 0 && len(m.FeatureVotes) == 0 { + m.FeatureVotes = make([]uint32, 0, elementCount) + } + for iNdEx < postIndex { + var v uint32 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= uint32(b&0x7F) << shift + if b < 0x80 { + break + } + } + m.FeatureVotes = append(m.FeatureVotes, v) + } + } else { + return fmt.Errorf("proto: wrong wireType = %d for field FeatureVotes", wireType) + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Timestamp", wireType) + } + m.Timestamp = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Timestamp |= int64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Generator", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Generator = append(m.Generator[:0], dAtA[iNdEx:postIndex]...) + if m.Generator == nil { + m.Generator = []byte{} + } + iNdEx = postIndex + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field RewardVote", wireType) + } + m.RewardVote = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.RewardVote |= int64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field StateHash", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.StateHash = append(m.StateHash[:0], dAtA[iNdEx:postIndex]...) + if m.StateHash == nil { + m.StateHash = []byte{} + } + iNdEx = postIndex + case 8: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field HeaderSignature", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.HeaderSignature = append(m.HeaderSignature[:0], dAtA[iNdEx:postIndex]...) + if m.HeaderSignature == nil { + m.HeaderSignature = []byte{} + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } -func (m *SignedMicroBlock) SizeVT() (n int) { - if m == nil { - return 0 - } - var l int - _ = l - if m.MicroBlock != nil { - l = m.MicroBlock.SizeVT() - n += 1 + l + sov(uint64(l)) - } - l = len(m.Signature) - if l > 0 { - n += 1 + l + sov(uint64(l)) - } - l = len(m.TotalBlockId) - if l > 0 { - n += 1 + l + sov(uint64(l)) + if iNdEx > l { + return io.ErrUnexpectedEOF } - n += len(m.unknownFields) - return n + return nil } - func (m *Block_Header) UnmarshalVT(dAtA []byte) error { l := len(dAtA) iNdEx := 0 @@ -774,6 +1268,76 @@ func (m *Block_Header) UnmarshalVT(dAtA []byte) error { m.TransactionsRoot = []byte{} } iNdEx = postIndex + case 11: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field StateHash", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.StateHash = append(m.StateHash[:0], dAtA[iNdEx:postIndex]...) + if m.StateHash == nil { + m.StateHash = []byte{} + } + iNdEx = postIndex + case 12: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ChallengedHeader", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.ChallengedHeader == nil { + m.ChallengedHeader = &Block_Header_ChallengedHeader{} + } + if err := m.ChallengedHeader.UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex default: iNdEx = preIndex skippy, err := skip(dAtA[iNdEx:]) @@ -1135,6 +1699,40 @@ func (m *MicroBlock) UnmarshalVT(dAtA []byte) error { return err } iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field StateHash", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.StateHash = append(m.StateHash[:0], dAtA[iNdEx:postIndex]...) + if m.StateHash == nil { + m.StateHash = []byte{} + } + iNdEx = postIndex default: iNdEx = preIndex skippy, err := skip(dAtA[iNdEx:]) diff --git a/pkg/grpc/generated/waves/events/events.pb.go b/pkg/grpc/generated/waves/events/events.pb.go index 1b7f9c933..33c49e490 100644 --- a/pkg/grpc/generated/waves/events/events.pb.go +++ b/pkg/grpc/generated/waves/events/events.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: // protoc-gen-go v1.27.1 -// protoc v3.21.12 +// protoc v4.24.4 // source: waves/events/events.proto package events @@ -228,6 +228,8 @@ type StateUpdate struct { DataEntries []*StateUpdate_DataEntryUpdate `protobuf:"bytes,3,rep,name=data_entries,json=dataEntries,proto3" json:"data_entries,omitempty"` Assets []*StateUpdate_AssetStateUpdate `protobuf:"bytes,4,rep,name=assets,proto3" json:"assets,omitempty"` IndividualLeases []*StateUpdate_LeaseUpdate `protobuf:"bytes,5,rep,name=individual_leases,json=individualLeases,proto3" json:"individual_leases,omitempty"` + Scripts []*StateUpdate_ScriptUpdate `protobuf:"bytes,6,rep,name=scripts,proto3" json:"scripts,omitempty"` + DeletedAliases []string `protobuf:"bytes,7,rep,name=deleted_aliases,json=deletedAliases,proto3" json:"deleted_aliases,omitempty"` } func (x *StateUpdate) Reset() { @@ -297,6 +299,20 @@ func (x *StateUpdate) GetIndividualLeases() []*StateUpdate_LeaseUpdate { return nil } +func (x *StateUpdate) GetScripts() []*StateUpdate_ScriptUpdate { + if x != nil { + return x.Scripts + } + return nil +} + +func (x *StateUpdate) GetDeletedAliases() []string { + if x != nil { + return x.DeletedAliases + } + return nil +} + type TransactionMetadata struct { state protoimpl.MessageState sizeCache protoimpl.SizeCache @@ -564,6 +580,7 @@ type BlockchainUpdated_Rollback struct { RemovedTransactionIds [][]byte `protobuf:"bytes,2,rep,name=removed_transaction_ids,json=removedTransactionIds,proto3" json:"removed_transaction_ids,omitempty"` RemovedBlocks []*waves.Block `protobuf:"bytes,3,rep,name=removed_blocks,json=removedBlocks,proto3" json:"removed_blocks,omitempty"` RollbackStateUpdate *StateUpdate `protobuf:"bytes,4,opt,name=rollback_state_update,json=rollbackStateUpdate,proto3" json:"rollback_state_update,omitempty"` + DeactivatedFeatures []int32 `protobuf:"varint,5,rep,packed,name=deactivated_features,json=deactivatedFeatures,proto3" json:"deactivated_features,omitempty"` } func (x *BlockchainUpdated_Rollback) Reset() { @@ -626,13 +643,23 @@ func (x *BlockchainUpdated_Rollback) GetRollbackStateUpdate() *StateUpdate { return nil } +func (x *BlockchainUpdated_Rollback) GetDeactivatedFeatures() []int32 { + if x != nil { + return x.DeactivatedFeatures + } + return nil +} + type BlockchainUpdated_Append_BlockAppend struct { state protoimpl.MessageState sizeCache protoimpl.SizeCache unknownFields protoimpl.UnknownFields - Block *waves.Block `protobuf:"bytes,1,opt,name=block,proto3" json:"block,omitempty"` - UpdatedWavesAmount int64 `protobuf:"varint,2,opt,name=updated_waves_amount,json=updatedWavesAmount,proto3" json:"updated_waves_amount,omitempty"` + Block *waves.Block `protobuf:"bytes,1,opt,name=block,proto3" json:"block,omitempty"` + UpdatedWavesAmount int64 `protobuf:"varint,2,opt,name=updated_waves_amount,json=updatedWavesAmount,proto3" json:"updated_waves_amount,omitempty"` + ActivatedFeatures []int32 `protobuf:"varint,3,rep,packed,name=activated_features,json=activatedFeatures,proto3" json:"activated_features,omitempty"` + Vrf []byte `protobuf:"bytes,4,opt,name=vrf,proto3" json:"vrf,omitempty"` + RewardShares []*waves.RewardShare `protobuf:"bytes,5,rep,name=reward_shares,json=rewardShares,proto3" json:"reward_shares,omitempty"` } func (x *BlockchainUpdated_Append_BlockAppend) Reset() { @@ -681,6 +708,27 @@ func (x *BlockchainUpdated_Append_BlockAppend) GetUpdatedWavesAmount() int64 { return 0 } +func (x *BlockchainUpdated_Append_BlockAppend) GetActivatedFeatures() []int32 { + if x != nil { + return x.ActivatedFeatures + } + return nil +} + +func (x *BlockchainUpdated_Append_BlockAppend) GetVrf() []byte { + if x != nil { + return x.Vrf + } + return nil +} + +func (x *BlockchainUpdated_Append_BlockAppend) GetRewardShares() []*waves.RewardShare { + if x != nil { + return x.RewardShares + } + return nil +} + type BlockchainUpdated_Append_MicroBlockAppend struct { state protoimpl.MessageState sizeCache protoimpl.SizeCache @@ -1088,22 +1136,25 @@ type StateUpdate_AssetDetails struct { sizeCache protoimpl.SizeCache unknownFields protoimpl.UnknownFields - AssetId []byte `protobuf:"bytes,1,opt,name=asset_id,json=assetId,proto3" json:"asset_id,omitempty"` - Issuer []byte `protobuf:"bytes,2,opt,name=issuer,proto3" json:"issuer,omitempty"` - Decimals int32 `protobuf:"varint,3,opt,name=decimals,proto3" json:"decimals,omitempty"` - Name string `protobuf:"bytes,4,opt,name=name,proto3" json:"name,omitempty"` - Description string `protobuf:"bytes,5,opt,name=description,proto3" json:"description,omitempty"` - Reissuable bool `protobuf:"varint,6,opt,name=reissuable,proto3" json:"reissuable,omitempty"` - Volume int64 `protobuf:"varint,7,opt,name=volume,proto3" json:"volume,omitempty"` - ScriptInfo *StateUpdate_AssetDetails_AssetScriptInfo `protobuf:"bytes,8,opt,name=script_info,json=scriptInfo,proto3" json:"script_info,omitempty"` - Sponsorship int64 `protobuf:"varint,9,opt,name=sponsorship,proto3" json:"sponsorship,omitempty"` - Nft bool `protobuf:"varint,10,opt,name=nft,proto3" json:"nft,omitempty"` - LastUpdated int32 `protobuf:"varint,11,opt,name=last_updated,json=lastUpdated,proto3" json:"last_updated,omitempty"` - // Related to a past behavior in the blockchain when it was possible to reissue - // assets so that the total volume became more then int64 max value. - // This field represents accurate volume even for those assets. - // Can be ignored if the target system does not need such accuracy. - // Encoding: like Java BigInteger, https://docs.oracle.com/javase/7/docs/api/java/math/BigInteger.html#toByteArray() + AssetId []byte `protobuf:"bytes,1,opt,name=asset_id,json=assetId,proto3" json:"asset_id,omitempty"` + Issuer []byte `protobuf:"bytes,2,opt,name=issuer,proto3" json:"issuer,omitempty"` + Decimals int32 `protobuf:"varint,3,opt,name=decimals,proto3" json:"decimals,omitempty"` + Name string `protobuf:"bytes,4,opt,name=name,proto3" json:"name,omitempty"` + Description string `protobuf:"bytes,5,opt,name=description,proto3" json:"description,omitempty"` + Reissuable bool `protobuf:"varint,6,opt,name=reissuable,proto3" json:"reissuable,omitempty"` + Volume int64 `protobuf:"varint,7,opt,name=volume,proto3" json:"volume,omitempty"` + ScriptInfo *StateUpdate_AssetDetails_AssetScriptInfo `protobuf:"bytes,8,opt,name=script_info,json=scriptInfo,proto3" json:"script_info,omitempty"` + Sponsorship int64 `protobuf:"varint,9,opt,name=sponsorship,proto3" json:"sponsorship,omitempty"` + Nft bool `protobuf:"varint,10,opt,name=nft,proto3" json:"nft,omitempty"` + LastUpdated int32 `protobuf:"varint,11,opt,name=last_updated,json=lastUpdated,proto3" json:"last_updated,omitempty"` + SequenceInBlock int32 `protobuf:"varint,12,opt,name=sequence_in_block,json=sequenceInBlock,proto3" json:"sequence_in_block,omitempty"` + IssueHeight int32 `protobuf:"varint,13,opt,name=issue_height,json=issueHeight,proto3" json:"issue_height,omitempty"` + // + //Related to a past behavior in the blockchain when it was possible to reissue + //assets so that the total volume became more then int64 max value. + //This field represents accurate volume even for those assets. + //Can be ignored if the target system does not need such accuracy. + //Encoding: like Java BigInteger, https://docs.oracle.com/javase/7/docs/api/java/math/BigInteger.html#toByteArray() SafeVolume []byte `protobuf:"bytes,20,opt,name=safe_volume,json=safeVolume,proto3" json:"safe_volume,omitempty"` } @@ -1216,6 +1267,20 @@ func (x *StateUpdate_AssetDetails) GetLastUpdated() int32 { return 0 } +func (x *StateUpdate_AssetDetails) GetSequenceInBlock() int32 { + if x != nil { + return x.SequenceInBlock + } + return 0 +} + +func (x *StateUpdate_AssetDetails) GetIssueHeight() int32 { + if x != nil { + return x.IssueHeight + } + return 0 +} + func (x *StateUpdate_AssetDetails) GetSafeVolume() []byte { if x != nil { return x.SafeVolume @@ -1286,6 +1351,69 @@ func (x *StateUpdate_AssetInfo) GetName() string { return "" } +type StateUpdate_ScriptUpdate struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + Address []byte `protobuf:"bytes,1,opt,name=address,proto3" json:"address,omitempty"` + Before []byte `protobuf:"bytes,2,opt,name=before,proto3" json:"before,omitempty"` + After []byte `protobuf:"bytes,3,opt,name=after,proto3" json:"after,omitempty"` +} + +func (x *StateUpdate_ScriptUpdate) Reset() { + *x = StateUpdate_ScriptUpdate{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_events_events_proto_msgTypes[14] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *StateUpdate_ScriptUpdate) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*StateUpdate_ScriptUpdate) ProtoMessage() {} + +func (x *StateUpdate_ScriptUpdate) ProtoReflect() protoreflect.Message { + mi := &file_waves_events_events_proto_msgTypes[14] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use StateUpdate_ScriptUpdate.ProtoReflect.Descriptor instead. +func (*StateUpdate_ScriptUpdate) Descriptor() ([]byte, []int) { + return file_waves_events_events_proto_rawDescGZIP(), []int{1, 7} +} + +func (x *StateUpdate_ScriptUpdate) GetAddress() []byte { + if x != nil { + return x.Address + } + return nil +} + +func (x *StateUpdate_ScriptUpdate) GetBefore() []byte { + if x != nil { + return x.Before + } + return nil +} + +func (x *StateUpdate_ScriptUpdate) GetAfter() []byte { + if x != nil { + return x.After + } + return nil +} + type StateUpdate_AssetDetails_AssetScriptInfo struct { state protoimpl.MessageState sizeCache protoimpl.SizeCache @@ -1298,7 +1426,7 @@ type StateUpdate_AssetDetails_AssetScriptInfo struct { func (x *StateUpdate_AssetDetails_AssetScriptInfo) Reset() { *x = StateUpdate_AssetDetails_AssetScriptInfo{} if protoimpl.UnsafeEnabled { - mi := &file_waves_events_events_proto_msgTypes[14] + mi := &file_waves_events_events_proto_msgTypes[15] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -1311,7 +1439,7 @@ func (x *StateUpdate_AssetDetails_AssetScriptInfo) String() string { func (*StateUpdate_AssetDetails_AssetScriptInfo) ProtoMessage() {} func (x *StateUpdate_AssetDetails_AssetScriptInfo) ProtoReflect() protoreflect.Message { - mi := &file_waves_events_events_proto_msgTypes[14] + mi := &file_waves_events_events_proto_msgTypes[15] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -1352,7 +1480,7 @@ type TransactionMetadata_TransferMetadata struct { func (x *TransactionMetadata_TransferMetadata) Reset() { *x = TransactionMetadata_TransferMetadata{} if protoimpl.UnsafeEnabled { - mi := &file_waves_events_events_proto_msgTypes[15] + mi := &file_waves_events_events_proto_msgTypes[16] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -1365,7 +1493,7 @@ func (x *TransactionMetadata_TransferMetadata) String() string { func (*TransactionMetadata_TransferMetadata) ProtoMessage() {} func (x *TransactionMetadata_TransferMetadata) ProtoReflect() protoreflect.Message { - mi := &file_waves_events_events_proto_msgTypes[15] + mi := &file_waves_events_events_proto_msgTypes[16] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -1399,7 +1527,7 @@ type TransactionMetadata_MassTransferMetadata struct { func (x *TransactionMetadata_MassTransferMetadata) Reset() { *x = TransactionMetadata_MassTransferMetadata{} if protoimpl.UnsafeEnabled { - mi := &file_waves_events_events_proto_msgTypes[16] + mi := &file_waves_events_events_proto_msgTypes[17] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -1412,7 +1540,7 @@ func (x *TransactionMetadata_MassTransferMetadata) String() string { func (*TransactionMetadata_MassTransferMetadata) ProtoMessage() {} func (x *TransactionMetadata_MassTransferMetadata) ProtoReflect() protoreflect.Message { - mi := &file_waves_events_events_proto_msgTypes[16] + mi := &file_waves_events_events_proto_msgTypes[17] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -1440,9 +1568,10 @@ type TransactionMetadata_ExchangeMetadata struct { sizeCache protoimpl.SizeCache unknownFields protoimpl.UnknownFields - // Fields starting with `order_*` represent order metadata. - // Each of them is a collection of exactly 2 elements. - // Element indexes correspond to their parent order indexes in the exchange transaction. + // + //Fields starting with `order_*` represent order metadata. + //Each of them is a collection of exactly 2 elements. + //Element indexes correspond to their parent order indexes in the exchange transaction. OrderIds [][]byte `protobuf:"bytes,1,rep,name=order_ids,json=orderIds,proto3" json:"order_ids,omitempty"` OrderSenderAddresses [][]byte `protobuf:"bytes,2,rep,name=order_sender_addresses,json=orderSenderAddresses,proto3" json:"order_sender_addresses,omitempty"` OrderSenderPublicKeys [][]byte `protobuf:"bytes,3,rep,name=order_sender_public_keys,json=orderSenderPublicKeys,proto3" json:"order_sender_public_keys,omitempty"` @@ -1451,7 +1580,7 @@ type TransactionMetadata_ExchangeMetadata struct { func (x *TransactionMetadata_ExchangeMetadata) Reset() { *x = TransactionMetadata_ExchangeMetadata{} if protoimpl.UnsafeEnabled { - mi := &file_waves_events_events_proto_msgTypes[17] + mi := &file_waves_events_events_proto_msgTypes[18] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -1464,7 +1593,7 @@ func (x *TransactionMetadata_ExchangeMetadata) String() string { func (*TransactionMetadata_ExchangeMetadata) ProtoMessage() {} func (x *TransactionMetadata_ExchangeMetadata) ProtoReflect() protoreflect.Message { - mi := &file_waves_events_events_proto_msgTypes[17] + mi := &file_waves_events_events_proto_msgTypes[18] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -1516,7 +1645,7 @@ type TransactionMetadata_InvokeScriptMetadata struct { func (x *TransactionMetadata_InvokeScriptMetadata) Reset() { *x = TransactionMetadata_InvokeScriptMetadata{} if protoimpl.UnsafeEnabled { - mi := &file_waves_events_events_proto_msgTypes[18] + mi := &file_waves_events_events_proto_msgTypes[19] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -1529,7 +1658,7 @@ func (x *TransactionMetadata_InvokeScriptMetadata) String() string { func (*TransactionMetadata_InvokeScriptMetadata) ProtoMessage() {} func (x *TransactionMetadata_InvokeScriptMetadata) ProtoReflect() protoreflect.Message { - mi := &file_waves_events_events_proto_msgTypes[18] + mi := &file_waves_events_events_proto_msgTypes[19] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -1591,7 +1720,7 @@ type TransactionMetadata_LeaseMetadata struct { func (x *TransactionMetadata_LeaseMetadata) Reset() { *x = TransactionMetadata_LeaseMetadata{} if protoimpl.UnsafeEnabled { - mi := &file_waves_events_events_proto_msgTypes[19] + mi := &file_waves_events_events_proto_msgTypes[20] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -1604,7 +1733,7 @@ func (x *TransactionMetadata_LeaseMetadata) String() string { func (*TransactionMetadata_LeaseMetadata) ProtoMessage() {} func (x *TransactionMetadata_LeaseMetadata) ProtoReflect() protoreflect.Message { - mi := &file_waves_events_events_proto_msgTypes[19] + mi := &file_waves_events_events_proto_msgTypes[20] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -1639,7 +1768,7 @@ type TransactionMetadata_EthereumTransferMetadata struct { func (x *TransactionMetadata_EthereumTransferMetadata) Reset() { *x = TransactionMetadata_EthereumTransferMetadata{} if protoimpl.UnsafeEnabled { - mi := &file_waves_events_events_proto_msgTypes[20] + mi := &file_waves_events_events_proto_msgTypes[21] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -1652,7 +1781,7 @@ func (x *TransactionMetadata_EthereumTransferMetadata) String() string { func (*TransactionMetadata_EthereumTransferMetadata) ProtoMessage() {} func (x *TransactionMetadata_EthereumTransferMetadata) ProtoReflect() protoreflect.Message { - mi := &file_waves_events_events_proto_msgTypes[20] + mi := &file_waves_events_events_proto_msgTypes[21] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -1701,7 +1830,7 @@ type TransactionMetadata_EthereumMetadata struct { func (x *TransactionMetadata_EthereumMetadata) Reset() { *x = TransactionMetadata_EthereumMetadata{} if protoimpl.UnsafeEnabled { - mi := &file_waves_events_events_proto_msgTypes[21] + mi := &file_waves_events_events_proto_msgTypes[22] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -1714,7 +1843,7 @@ func (x *TransactionMetadata_EthereumMetadata) String() string { func (*TransactionMetadata_EthereumMetadata) ProtoMessage() {} func (x *TransactionMetadata_EthereumMetadata) ProtoReflect() protoreflect.Message { - mi := &file_waves_events_events_proto_msgTypes[21] + mi := &file_waves_events_events_proto_msgTypes[22] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -1807,7 +1936,7 @@ type TransactionMetadata_InvokeScriptMetadata_Argument struct { func (x *TransactionMetadata_InvokeScriptMetadata_Argument) Reset() { *x = TransactionMetadata_InvokeScriptMetadata_Argument{} if protoimpl.UnsafeEnabled { - mi := &file_waves_events_events_proto_msgTypes[22] + mi := &file_waves_events_events_proto_msgTypes[23] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -1820,7 +1949,7 @@ func (x *TransactionMetadata_InvokeScriptMetadata_Argument) String() string { func (*TransactionMetadata_InvokeScriptMetadata_Argument) ProtoMessage() {} func (x *TransactionMetadata_InvokeScriptMetadata_Argument) ProtoReflect() protoreflect.Message { - mi := &file_waves_events_events_proto_msgTypes[22] + mi := &file_waves_events_events_proto_msgTypes[23] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -1928,7 +2057,7 @@ type TransactionMetadata_InvokeScriptMetadata_Argument_List struct { func (x *TransactionMetadata_InvokeScriptMetadata_Argument_List) Reset() { *x = TransactionMetadata_InvokeScriptMetadata_Argument_List{} if protoimpl.UnsafeEnabled { - mi := &file_waves_events_events_proto_msgTypes[23] + mi := &file_waves_events_events_proto_msgTypes[24] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -1941,7 +2070,7 @@ func (x *TransactionMetadata_InvokeScriptMetadata_Argument_List) String() string func (*TransactionMetadata_InvokeScriptMetadata_Argument_List) ProtoMessage() {} func (x *TransactionMetadata_InvokeScriptMetadata_Argument_List) ProtoReflect() protoreflect.Message { - mi := &file_waves_events_events_proto_msgTypes[23] + mi := &file_waves_events_events_proto_msgTypes[24] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -1975,339 +2104,369 @@ var file_waves_events_events_proto_rawDesc = []byte{ 0x1a, 0x17, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x1a, 0x20, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x69, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x5f, 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, 0x5f, 0x72, - 0x65, 0x73, 0x75, 0x6c, 0x74, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0xa1, 0x0a, 0x0a, 0x11, - 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x63, 0x68, 0x61, 0x69, 0x6e, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, - 0x64, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x02, 0x69, - 0x64, 0x12, 0x16, 0x0a, 0x06, 0x68, 0x65, 0x69, 0x67, 0x68, 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, - 0x05, 0x52, 0x06, 0x68, 0x65, 0x69, 0x67, 0x68, 0x74, 0x12, 0x40, 0x0a, 0x06, 0x61, 0x70, 0x70, - 0x65, 0x6e, 0x64, 0x18, 0x0b, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x26, 0x2e, 0x77, 0x61, 0x76, 0x65, + 0x65, 0x73, 0x75, 0x6c, 0x74, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x1a, 0x18, 0x77, 0x61, 0x76, + 0x65, 0x73, 0x2f, 0x72, 0x65, 0x77, 0x61, 0x72, 0x64, 0x5f, 0x73, 0x68, 0x61, 0x72, 0x65, 0x2e, + 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0xcf, 0x0b, 0x0a, 0x11, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x63, + 0x68, 0x61, 0x69, 0x6e, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, 0x12, 0x0e, 0x0a, 0x02, 0x69, + 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x02, 0x69, 0x64, 0x12, 0x16, 0x0a, 0x06, 0x68, + 0x65, 0x69, 0x67, 0x68, 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, 0x05, 0x52, 0x06, 0x68, 0x65, 0x69, + 0x67, 0x68, 0x74, 0x12, 0x40, 0x0a, 0x06, 0x61, 0x70, 0x70, 0x65, 0x6e, 0x64, 0x18, 0x0b, 0x20, + 0x01, 0x28, 0x0b, 0x32, 0x26, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, + 0x74, 0x73, 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x63, 0x68, 0x61, 0x69, 0x6e, 0x55, 0x70, 0x64, + 0x61, 0x74, 0x65, 0x64, 0x2e, 0x41, 0x70, 0x70, 0x65, 0x6e, 0x64, 0x48, 0x00, 0x52, 0x06, 0x61, + 0x70, 0x70, 0x65, 0x6e, 0x64, 0x12, 0x46, 0x0a, 0x08, 0x72, 0x6f, 0x6c, 0x6c, 0x62, 0x61, 0x63, + 0x6b, 0x18, 0x0c, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x28, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, + 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x63, 0x68, 0x61, 0x69, + 0x6e, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, 0x2e, 0x52, 0x6f, 0x6c, 0x6c, 0x62, 0x61, 0x63, + 0x6b, 0x48, 0x00, 0x52, 0x08, 0x72, 0x6f, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x12, 0x50, 0x0a, + 0x11, 0x72, 0x65, 0x66, 0x65, 0x72, 0x65, 0x6e, 0x63, 0x65, 0x64, 0x5f, 0x61, 0x73, 0x73, 0x65, + 0x74, 0x73, 0x18, 0x15, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x23, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, + 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, + 0x61, 0x74, 0x65, 0x2e, 0x41, 0x73, 0x73, 0x65, 0x74, 0x49, 0x6e, 0x66, 0x6f, 0x52, 0x10, 0x72, + 0x65, 0x66, 0x65, 0x72, 0x65, 0x6e, 0x63, 0x65, 0x64, 0x41, 0x73, 0x73, 0x65, 0x74, 0x73, 0x1a, + 0xb9, 0x06, 0x0a, 0x06, 0x41, 0x70, 0x70, 0x65, 0x6e, 0x64, 0x12, 0x4a, 0x0a, 0x05, 0x62, 0x6c, + 0x6f, 0x63, 0x6b, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x32, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x63, 0x68, 0x61, 0x69, 0x6e, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, 0x2e, 0x41, 0x70, 0x70, 0x65, 0x6e, - 0x64, 0x48, 0x00, 0x52, 0x06, 0x61, 0x70, 0x70, 0x65, 0x6e, 0x64, 0x12, 0x46, 0x0a, 0x08, 0x72, - 0x6f, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x18, 0x0c, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x28, 0x2e, - 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x42, 0x6c, 0x6f, - 0x63, 0x6b, 0x63, 0x68, 0x61, 0x69, 0x6e, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, 0x2e, 0x52, - 0x6f, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x48, 0x00, 0x52, 0x08, 0x72, 0x6f, 0x6c, 0x6c, 0x62, - 0x61, 0x63, 0x6b, 0x12, 0x50, 0x0a, 0x11, 0x72, 0x65, 0x66, 0x65, 0x72, 0x65, 0x6e, 0x63, 0x65, - 0x64, 0x5f, 0x61, 0x73, 0x73, 0x65, 0x74, 0x73, 0x18, 0x15, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x23, - 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x53, 0x74, - 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x2e, 0x41, 0x73, 0x73, 0x65, 0x74, 0x49, - 0x6e, 0x66, 0x6f, 0x52, 0x10, 0x72, 0x65, 0x66, 0x65, 0x72, 0x65, 0x6e, 0x63, 0x65, 0x64, 0x41, - 0x73, 0x73, 0x65, 0x74, 0x73, 0x1a, 0xbe, 0x05, 0x0a, 0x06, 0x41, 0x70, 0x70, 0x65, 0x6e, 0x64, - 0x12, 0x4a, 0x0a, 0x05, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, - 0x32, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x42, - 0x6c, 0x6f, 0x63, 0x6b, 0x63, 0x68, 0x61, 0x69, 0x6e, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, - 0x2e, 0x41, 0x70, 0x70, 0x65, 0x6e, 0x64, 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x41, 0x70, 0x70, - 0x65, 0x6e, 0x64, 0x48, 0x00, 0x52, 0x05, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x12, 0x5a, 0x0a, 0x0b, - 0x6d, 0x69, 0x63, 0x72, 0x6f, 0x5f, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x18, 0x02, 0x20, 0x01, 0x28, - 0x0b, 0x32, 0x37, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, - 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x63, 0x68, 0x61, 0x69, 0x6e, 0x55, 0x70, 0x64, 0x61, 0x74, - 0x65, 0x64, 0x2e, 0x41, 0x70, 0x70, 0x65, 0x6e, 0x64, 0x2e, 0x4d, 0x69, 0x63, 0x72, 0x6f, 0x42, - 0x6c, 0x6f, 0x63, 0x6b, 0x41, 0x70, 0x70, 0x65, 0x6e, 0x64, 0x48, 0x00, 0x52, 0x0a, 0x6d, 0x69, - 0x63, 0x72, 0x6f, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x12, 0x27, 0x0a, 0x0f, 0x74, 0x72, 0x61, 0x6e, - 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x69, 0x64, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, - 0x0c, 0x52, 0x0e, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x49, 0x64, - 0x73, 0x12, 0x56, 0x0a, 0x15, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, - 0x73, 0x5f, 0x6d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, - 0x32, 0x21, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, - 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, 0x74, 0x61, 0x64, - 0x61, 0x74, 0x61, 0x52, 0x14, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, - 0x73, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x12, 0x3c, 0x0a, 0x0c, 0x73, 0x74, 0x61, - 0x74, 0x65, 0x5f, 0x75, 0x70, 0x64, 0x61, 0x74, 0x65, 0x18, 0x0b, 0x20, 0x01, 0x28, 0x0b, 0x32, + 0x64, 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x41, 0x70, 0x70, 0x65, 0x6e, 0x64, 0x48, 0x00, 0x52, + 0x05, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x12, 0x5a, 0x0a, 0x0b, 0x6d, 0x69, 0x63, 0x72, 0x6f, 0x5f, + 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x37, 0x2e, 0x77, 0x61, + 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, + 0x63, 0x68, 0x61, 0x69, 0x6e, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, 0x2e, 0x41, 0x70, 0x70, + 0x65, 0x6e, 0x64, 0x2e, 0x4d, 0x69, 0x63, 0x72, 0x6f, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x41, 0x70, + 0x70, 0x65, 0x6e, 0x64, 0x48, 0x00, 0x52, 0x0a, 0x6d, 0x69, 0x63, 0x72, 0x6f, 0x42, 0x6c, 0x6f, + 0x63, 0x6b, 0x12, 0x27, 0x0a, 0x0f, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, + 0x6e, 0x5f, 0x69, 0x64, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0c, 0x52, 0x0e, 0x74, 0x72, 0x61, + 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x49, 0x64, 0x73, 0x12, 0x56, 0x0a, 0x15, 0x74, + 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x5f, 0x6d, 0x65, 0x74, 0x61, + 0x64, 0x61, 0x74, 0x61, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x21, 0x2e, 0x77, 0x61, 0x76, + 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, + 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x52, 0x14, 0x74, + 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x4d, 0x65, 0x74, 0x61, 0x64, + 0x61, 0x74, 0x61, 0x12, 0x3c, 0x0a, 0x0c, 0x73, 0x74, 0x61, 0x74, 0x65, 0x5f, 0x75, 0x70, 0x64, + 0x61, 0x74, 0x65, 0x18, 0x0b, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x77, 0x61, 0x76, 0x65, + 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, + 0x64, 0x61, 0x74, 0x65, 0x52, 0x0b, 0x73, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, + 0x65, 0x12, 0x55, 0x0a, 0x19, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, + 0x5f, 0x73, 0x74, 0x61, 0x74, 0x65, 0x5f, 0x75, 0x70, 0x64, 0x61, 0x74, 0x65, 0x73, 0x18, 0x0c, + 0x20, 0x03, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, + 0x6e, 0x74, 0x73, 0x2e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x52, + 0x17, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x61, 0x74, + 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x73, 0x1a, 0xdd, 0x01, 0x0a, 0x0b, 0x42, 0x6c, 0x6f, + 0x63, 0x6b, 0x41, 0x70, 0x70, 0x65, 0x6e, 0x64, 0x12, 0x22, 0x0a, 0x05, 0x62, 0x6c, 0x6f, 0x63, + 0x6b, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x0c, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, + 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x52, 0x05, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x12, 0x30, 0x0a, 0x14, + 0x75, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, 0x5f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x5f, 0x61, 0x6d, + 0x6f, 0x75, 0x6e, 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x12, 0x75, 0x70, 0x64, 0x61, + 0x74, 0x65, 0x64, 0x57, 0x61, 0x76, 0x65, 0x73, 0x41, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x2d, + 0x0a, 0x12, 0x61, 0x63, 0x74, 0x69, 0x76, 0x61, 0x74, 0x65, 0x64, 0x5f, 0x66, 0x65, 0x61, 0x74, + 0x75, 0x72, 0x65, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x05, 0x52, 0x11, 0x61, 0x63, 0x74, 0x69, + 0x76, 0x61, 0x74, 0x65, 0x64, 0x46, 0x65, 0x61, 0x74, 0x75, 0x72, 0x65, 0x73, 0x12, 0x10, 0x0a, + 0x03, 0x76, 0x72, 0x66, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x03, 0x76, 0x72, 0x66, 0x12, + 0x37, 0x0a, 0x0d, 0x72, 0x65, 0x77, 0x61, 0x72, 0x64, 0x5f, 0x73, 0x68, 0x61, 0x72, 0x65, 0x73, + 0x18, 0x05, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x12, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x52, + 0x65, 0x77, 0x61, 0x72, 0x64, 0x53, 0x68, 0x61, 0x72, 0x65, 0x52, 0x0c, 0x72, 0x65, 0x77, 0x61, + 0x72, 0x64, 0x53, 0x68, 0x61, 0x72, 0x65, 0x73, 0x1a, 0x88, 0x01, 0x0a, 0x10, 0x4d, 0x69, 0x63, + 0x72, 0x6f, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x41, 0x70, 0x70, 0x65, 0x6e, 0x64, 0x12, 0x38, 0x0a, + 0x0b, 0x6d, 0x69, 0x63, 0x72, 0x6f, 0x5f, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x18, 0x01, 0x20, 0x01, + 0x28, 0x0b, 0x32, 0x17, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x53, 0x69, 0x67, 0x6e, 0x65, + 0x64, 0x4d, 0x69, 0x63, 0x72, 0x6f, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x52, 0x0a, 0x6d, 0x69, 0x63, + 0x72, 0x6f, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x12, 0x3a, 0x0a, 0x19, 0x75, 0x70, 0x64, 0x61, 0x74, + 0x65, 0x64, 0x5f, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x5f, + 0x72, 0x6f, 0x6f, 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x17, 0x75, 0x70, 0x64, 0x61, + 0x74, 0x65, 0x64, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x52, + 0x6f, 0x6f, 0x74, 0x42, 0x06, 0x0a, 0x04, 0x62, 0x6f, 0x64, 0x79, 0x1a, 0xef, 0x02, 0x0a, 0x08, + 0x52, 0x6f, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x12, 0x49, 0x0a, 0x04, 0x74, 0x79, 0x70, 0x65, + 0x18, 0x01, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x35, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, + 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x63, 0x68, 0x61, 0x69, 0x6e, + 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, 0x2e, 0x52, 0x6f, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, + 0x2e, 0x52, 0x6f, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x54, 0x79, 0x70, 0x65, 0x52, 0x04, 0x74, + 0x79, 0x70, 0x65, 0x12, 0x36, 0x0a, 0x17, 0x72, 0x65, 0x6d, 0x6f, 0x76, 0x65, 0x64, 0x5f, 0x74, + 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x69, 0x64, 0x73, 0x18, 0x02, + 0x20, 0x03, 0x28, 0x0c, 0x52, 0x15, 0x72, 0x65, 0x6d, 0x6f, 0x76, 0x65, 0x64, 0x54, 0x72, 0x61, + 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x49, 0x64, 0x73, 0x12, 0x33, 0x0a, 0x0e, 0x72, + 0x65, 0x6d, 0x6f, 0x76, 0x65, 0x64, 0x5f, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x73, 0x18, 0x03, 0x20, + 0x03, 0x28, 0x0b, 0x32, 0x0c, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x42, 0x6c, 0x6f, 0x63, + 0x6b, 0x52, 0x0d, 0x72, 0x65, 0x6d, 0x6f, 0x76, 0x65, 0x64, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x73, + 0x12, 0x4d, 0x0a, 0x15, 0x72, 0x6f, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x5f, 0x73, 0x74, 0x61, + 0x74, 0x65, 0x5f, 0x75, 0x70, 0x64, 0x61, 0x74, 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x53, - 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x52, 0x0b, 0x73, 0x74, 0x61, 0x74, - 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x12, 0x55, 0x0a, 0x19, 0x74, 0x72, 0x61, 0x6e, 0x73, - 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x73, 0x74, 0x61, 0x74, 0x65, 0x5f, 0x75, 0x70, 0x64, - 0x61, 0x74, 0x65, 0x73, 0x18, 0x0c, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x77, 0x61, 0x76, - 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, - 0x70, 0x64, 0x61, 0x74, 0x65, 0x52, 0x17, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, - 0x6f, 0x6e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x73, 0x1a, 0x63, - 0x0a, 0x0b, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x41, 0x70, 0x70, 0x65, 0x6e, 0x64, 0x12, 0x22, 0x0a, - 0x05, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x0c, 0x2e, 0x77, - 0x61, 0x76, 0x65, 0x73, 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x52, 0x05, 0x62, 0x6c, 0x6f, 0x63, - 0x6b, 0x12, 0x30, 0x0a, 0x14, 0x75, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, 0x5f, 0x77, 0x61, 0x76, - 0x65, 0x73, 0x5f, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, - 0x12, 0x75, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, 0x57, 0x61, 0x76, 0x65, 0x73, 0x41, 0x6d, 0x6f, - 0x75, 0x6e, 0x74, 0x1a, 0x88, 0x01, 0x0a, 0x10, 0x4d, 0x69, 0x63, 0x72, 0x6f, 0x42, 0x6c, 0x6f, - 0x63, 0x6b, 0x41, 0x70, 0x70, 0x65, 0x6e, 0x64, 0x12, 0x38, 0x0a, 0x0b, 0x6d, 0x69, 0x63, 0x72, - 0x6f, 0x5f, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x17, 0x2e, - 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x53, 0x69, 0x67, 0x6e, 0x65, 0x64, 0x4d, 0x69, 0x63, 0x72, - 0x6f, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x52, 0x0a, 0x6d, 0x69, 0x63, 0x72, 0x6f, 0x42, 0x6c, 0x6f, - 0x63, 0x6b, 0x12, 0x3a, 0x0a, 0x19, 0x75, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, 0x5f, 0x74, 0x72, - 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x5f, 0x72, 0x6f, 0x6f, 0x74, 0x18, - 0x02, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x17, 0x75, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, 0x54, 0x72, - 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x52, 0x6f, 0x6f, 0x74, 0x42, 0x06, - 0x0a, 0x04, 0x62, 0x6f, 0x64, 0x79, 0x1a, 0xbc, 0x02, 0x0a, 0x08, 0x52, 0x6f, 0x6c, 0x6c, 0x62, - 0x61, 0x63, 0x6b, 0x12, 0x49, 0x0a, 0x04, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, - 0x0e, 0x32, 0x35, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, - 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x63, 0x68, 0x61, 0x69, 0x6e, 0x55, 0x70, 0x64, 0x61, 0x74, - 0x65, 0x64, 0x2e, 0x52, 0x6f, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x2e, 0x52, 0x6f, 0x6c, 0x6c, - 0x62, 0x61, 0x63, 0x6b, 0x54, 0x79, 0x70, 0x65, 0x52, 0x04, 0x74, 0x79, 0x70, 0x65, 0x12, 0x36, - 0x0a, 0x17, 0x72, 0x65, 0x6d, 0x6f, 0x76, 0x65, 0x64, 0x5f, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, - 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x69, 0x64, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0c, 0x52, - 0x15, 0x72, 0x65, 0x6d, 0x6f, 0x76, 0x65, 0x64, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, - 0x69, 0x6f, 0x6e, 0x49, 0x64, 0x73, 0x12, 0x33, 0x0a, 0x0e, 0x72, 0x65, 0x6d, 0x6f, 0x76, 0x65, - 0x64, 0x5f, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x0c, - 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x52, 0x0d, 0x72, 0x65, - 0x6d, 0x6f, 0x76, 0x65, 0x64, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x73, 0x12, 0x4d, 0x0a, 0x15, 0x72, - 0x6f, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x5f, 0x73, 0x74, 0x61, 0x74, 0x65, 0x5f, 0x75, 0x70, - 0x64, 0x61, 0x74, 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x77, 0x61, 0x76, - 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, - 0x70, 0x64, 0x61, 0x74, 0x65, 0x52, 0x13, 0x72, 0x6f, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x53, - 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x22, 0x29, 0x0a, 0x0c, 0x52, 0x6f, - 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x54, 0x79, 0x70, 0x65, 0x12, 0x09, 0x0a, 0x05, 0x42, 0x4c, - 0x4f, 0x43, 0x4b, 0x10, 0x00, 0x12, 0x0e, 0x0a, 0x0a, 0x4d, 0x49, 0x43, 0x52, 0x4f, 0x42, 0x4c, - 0x4f, 0x43, 0x4b, 0x10, 0x01, 0x42, 0x08, 0x0a, 0x06, 0x75, 0x70, 0x64, 0x61, 0x74, 0x65, 0x22, - 0xef, 0x0e, 0x0a, 0x0b, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x12, - 0x43, 0x0a, 0x08, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x65, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, - 0x0b, 0x32, 0x27, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, - 0x2e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x2e, 0x42, 0x61, 0x6c, - 0x61, 0x6e, 0x63, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x52, 0x08, 0x62, 0x61, 0x6c, 0x61, - 0x6e, 0x63, 0x65, 0x73, 0x12, 0x57, 0x0a, 0x13, 0x6c, 0x65, 0x61, 0x73, 0x69, 0x6e, 0x67, 0x5f, - 0x66, 0x6f, 0x72, 0x5f, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, - 0x0b, 0x32, 0x27, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, - 0x2e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x2e, 0x4c, 0x65, 0x61, - 0x73, 0x69, 0x6e, 0x67, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x52, 0x11, 0x6c, 0x65, 0x61, 0x73, - 0x69, 0x6e, 0x67, 0x46, 0x6f, 0x72, 0x41, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x4c, 0x0a, - 0x0c, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x65, 0x6e, 0x74, 0x72, 0x69, 0x65, 0x73, 0x18, 0x03, 0x20, - 0x03, 0x28, 0x0b, 0x32, 0x29, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, - 0x74, 0x73, 0x2e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x2e, 0x44, - 0x61, 0x74, 0x61, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x52, 0x0b, - 0x64, 0x61, 0x74, 0x61, 0x45, 0x6e, 0x74, 0x72, 0x69, 0x65, 0x73, 0x12, 0x42, 0x0a, 0x06, 0x61, - 0x73, 0x73, 0x65, 0x74, 0x73, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x2a, 0x2e, 0x77, 0x61, + 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x52, 0x13, 0x72, 0x6f, 0x6c, 0x6c, + 0x62, 0x61, 0x63, 0x6b, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x12, + 0x31, 0x0a, 0x14, 0x64, 0x65, 0x61, 0x63, 0x74, 0x69, 0x76, 0x61, 0x74, 0x65, 0x64, 0x5f, 0x66, + 0x65, 0x61, 0x74, 0x75, 0x72, 0x65, 0x73, 0x18, 0x05, 0x20, 0x03, 0x28, 0x05, 0x52, 0x13, 0x64, + 0x65, 0x61, 0x63, 0x74, 0x69, 0x76, 0x61, 0x74, 0x65, 0x64, 0x46, 0x65, 0x61, 0x74, 0x75, 0x72, + 0x65, 0x73, 0x22, 0x29, 0x0a, 0x0c, 0x52, 0x6f, 0x6c, 0x6c, 0x62, 0x61, 0x63, 0x6b, 0x54, 0x79, + 0x70, 0x65, 0x12, 0x09, 0x0a, 0x05, 0x42, 0x4c, 0x4f, 0x43, 0x4b, 0x10, 0x00, 0x12, 0x0e, 0x0a, + 0x0a, 0x4d, 0x49, 0x43, 0x52, 0x4f, 0x42, 0x4c, 0x4f, 0x43, 0x4b, 0x10, 0x01, 0x42, 0x08, 0x0a, + 0x06, 0x75, 0x70, 0x64, 0x61, 0x74, 0x65, 0x22, 0x81, 0x11, 0x0a, 0x0b, 0x53, 0x74, 0x61, 0x74, + 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x12, 0x43, 0x0a, 0x08, 0x62, 0x61, 0x6c, 0x61, 0x6e, + 0x63, 0x65, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x27, 0x2e, 0x77, 0x61, 0x76, 0x65, + 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, + 0x64, 0x61, 0x74, 0x65, 0x2e, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x65, 0x55, 0x70, 0x64, 0x61, + 0x74, 0x65, 0x52, 0x08, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x65, 0x73, 0x12, 0x57, 0x0a, 0x13, + 0x6c, 0x65, 0x61, 0x73, 0x69, 0x6e, 0x67, 0x5f, 0x66, 0x6f, 0x72, 0x5f, 0x61, 0x64, 0x64, 0x72, + 0x65, 0x73, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x27, 0x2e, 0x77, 0x61, 0x76, 0x65, + 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, + 0x64, 0x61, 0x74, 0x65, 0x2e, 0x4c, 0x65, 0x61, 0x73, 0x69, 0x6e, 0x67, 0x55, 0x70, 0x64, 0x61, + 0x74, 0x65, 0x52, 0x11, 0x6c, 0x65, 0x61, 0x73, 0x69, 0x6e, 0x67, 0x46, 0x6f, 0x72, 0x41, 0x64, + 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x4c, 0x0a, 0x0c, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x65, 0x6e, + 0x74, 0x72, 0x69, 0x65, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x29, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x53, 0x74, 0x61, 0x74, 0x65, - 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x2e, 0x41, 0x73, 0x73, 0x65, 0x74, 0x53, 0x74, 0x61, 0x74, - 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x52, 0x06, 0x61, 0x73, 0x73, 0x65, 0x74, 0x73, 0x12, - 0x52, 0x0a, 0x11, 0x69, 0x6e, 0x64, 0x69, 0x76, 0x69, 0x64, 0x75, 0x61, 0x6c, 0x5f, 0x6c, 0x65, - 0x61, 0x73, 0x65, 0x73, 0x18, 0x05, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x77, 0x61, 0x76, + 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x2e, 0x44, 0x61, 0x74, 0x61, 0x45, 0x6e, 0x74, 0x72, 0x79, + 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x52, 0x0b, 0x64, 0x61, 0x74, 0x61, 0x45, 0x6e, 0x74, 0x72, + 0x69, 0x65, 0x73, 0x12, 0x42, 0x0a, 0x06, 0x61, 0x73, 0x73, 0x65, 0x74, 0x73, 0x18, 0x04, 0x20, + 0x03, 0x28, 0x0b, 0x32, 0x2a, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, + 0x74, 0x73, 0x2e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x2e, 0x41, + 0x73, 0x73, 0x65, 0x74, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x52, + 0x06, 0x61, 0x73, 0x73, 0x65, 0x74, 0x73, 0x12, 0x52, 0x0a, 0x11, 0x69, 0x6e, 0x64, 0x69, 0x76, + 0x69, 0x64, 0x75, 0x61, 0x6c, 0x5f, 0x6c, 0x65, 0x61, 0x73, 0x65, 0x73, 0x18, 0x05, 0x20, 0x03, + 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, + 0x73, 0x2e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x2e, 0x4c, 0x65, + 0x61, 0x73, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x52, 0x10, 0x69, 0x6e, 0x64, 0x69, 0x76, + 0x69, 0x64, 0x75, 0x61, 0x6c, 0x4c, 0x65, 0x61, 0x73, 0x65, 0x73, 0x12, 0x40, 0x0a, 0x07, 0x73, + 0x63, 0x72, 0x69, 0x70, 0x74, 0x73, 0x18, 0x06, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x26, 0x2e, 0x77, + 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x53, 0x74, 0x61, 0x74, + 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x2e, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x55, 0x70, + 0x64, 0x61, 0x74, 0x65, 0x52, 0x07, 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, 0x73, 0x12, 0x27, 0x0a, + 0x0f, 0x64, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x64, 0x5f, 0x61, 0x6c, 0x69, 0x61, 0x73, 0x65, 0x73, + 0x18, 0x07, 0x20, 0x03, 0x28, 0x09, 0x52, 0x0e, 0x64, 0x65, 0x6c, 0x65, 0x74, 0x65, 0x64, 0x41, + 0x6c, 0x69, 0x61, 0x73, 0x65, 0x73, 0x1a, 0x80, 0x01, 0x0a, 0x0d, 0x42, 0x61, 0x6c, 0x61, 0x6e, + 0x63, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x12, 0x18, 0x0a, 0x07, 0x61, 0x64, 0x64, 0x72, + 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, + 0x73, 0x73, 0x12, 0x30, 0x0a, 0x0c, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x5f, 0x61, 0x66, 0x74, + 0x65, 0x72, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x0d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, + 0x2e, 0x41, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x52, 0x0b, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x41, + 0x66, 0x74, 0x65, 0x72, 0x12, 0x23, 0x0a, 0x0d, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x5f, 0x62, + 0x65, 0x66, 0x6f, 0x72, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0c, 0x61, 0x6d, 0x6f, + 0x75, 0x6e, 0x74, 0x42, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x1a, 0x9d, 0x01, 0x0a, 0x0d, 0x4c, 0x65, + 0x61, 0x73, 0x69, 0x6e, 0x67, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x12, 0x18, 0x0a, 0x07, 0x61, + 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x61, 0x64, + 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x19, 0x0a, 0x08, 0x69, 0x6e, 0x5f, 0x61, 0x66, 0x74, 0x65, + 0x72, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x07, 0x69, 0x6e, 0x41, 0x66, 0x74, 0x65, 0x72, + 0x12, 0x1b, 0x0a, 0x09, 0x6f, 0x75, 0x74, 0x5f, 0x61, 0x66, 0x74, 0x65, 0x72, 0x18, 0x03, 0x20, + 0x01, 0x28, 0x03, 0x52, 0x08, 0x6f, 0x75, 0x74, 0x41, 0x66, 0x74, 0x65, 0x72, 0x12, 0x1b, 0x0a, + 0x09, 0x69, 0x6e, 0x5f, 0x62, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x03, + 0x52, 0x08, 0x69, 0x6e, 0x42, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x12, 0x1d, 0x0a, 0x0a, 0x6f, 0x75, + 0x74, 0x5f, 0x62, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x18, 0x05, 0x20, 0x01, 0x28, 0x03, 0x52, 0x09, + 0x6f, 0x75, 0x74, 0x42, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x1a, 0xa9, 0x02, 0x0a, 0x0b, 0x4c, 0x65, + 0x61, 0x73, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x12, 0x19, 0x0a, 0x08, 0x6c, 0x65, 0x61, + 0x73, 0x65, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x6c, 0x65, 0x61, + 0x73, 0x65, 0x49, 0x64, 0x12, 0x54, 0x0a, 0x0c, 0x73, 0x74, 0x61, 0x74, 0x75, 0x73, 0x5f, 0x61, + 0x66, 0x74, 0x65, 0x72, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x31, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x2e, 0x4c, 0x65, 0x61, 0x73, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, - 0x65, 0x52, 0x10, 0x69, 0x6e, 0x64, 0x69, 0x76, 0x69, 0x64, 0x75, 0x61, 0x6c, 0x4c, 0x65, 0x61, - 0x73, 0x65, 0x73, 0x1a, 0x80, 0x01, 0x0a, 0x0d, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x65, 0x55, - 0x70, 0x64, 0x61, 0x74, 0x65, 0x12, 0x18, 0x0a, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, - 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, - 0x30, 0x0a, 0x0c, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x5f, 0x61, 0x66, 0x74, 0x65, 0x72, 0x18, - 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x0d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x41, 0x6d, - 0x6f, 0x75, 0x6e, 0x74, 0x52, 0x0b, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x41, 0x66, 0x74, 0x65, - 0x72, 0x12, 0x23, 0x0a, 0x0d, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x5f, 0x62, 0x65, 0x66, 0x6f, - 0x72, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0c, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, - 0x42, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x1a, 0x9d, 0x01, 0x0a, 0x0d, 0x4c, 0x65, 0x61, 0x73, 0x69, - 0x6e, 0x67, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x12, 0x18, 0x0a, 0x07, 0x61, 0x64, 0x64, 0x72, - 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, - 0x73, 0x73, 0x12, 0x19, 0x0a, 0x08, 0x69, 0x6e, 0x5f, 0x61, 0x66, 0x74, 0x65, 0x72, 0x18, 0x02, - 0x20, 0x01, 0x28, 0x03, 0x52, 0x07, 0x69, 0x6e, 0x41, 0x66, 0x74, 0x65, 0x72, 0x12, 0x1b, 0x0a, - 0x09, 0x6f, 0x75, 0x74, 0x5f, 0x61, 0x66, 0x74, 0x65, 0x72, 0x18, 0x03, 0x20, 0x01, 0x28, 0x03, - 0x52, 0x08, 0x6f, 0x75, 0x74, 0x41, 0x66, 0x74, 0x65, 0x72, 0x12, 0x1b, 0x0a, 0x09, 0x69, 0x6e, - 0x5f, 0x62, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x03, 0x52, 0x08, 0x69, - 0x6e, 0x42, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x12, 0x1d, 0x0a, 0x0a, 0x6f, 0x75, 0x74, 0x5f, 0x62, - 0x65, 0x66, 0x6f, 0x72, 0x65, 0x18, 0x05, 0x20, 0x01, 0x28, 0x03, 0x52, 0x09, 0x6f, 0x75, 0x74, - 0x42, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x1a, 0xa9, 0x02, 0x0a, 0x0b, 0x4c, 0x65, 0x61, 0x73, 0x65, - 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x12, 0x19, 0x0a, 0x08, 0x6c, 0x65, 0x61, 0x73, 0x65, 0x5f, - 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x6c, 0x65, 0x61, 0x73, 0x65, 0x49, - 0x64, 0x12, 0x54, 0x0a, 0x0c, 0x73, 0x74, 0x61, 0x74, 0x75, 0x73, 0x5f, 0x61, 0x66, 0x74, 0x65, - 0x72, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x31, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, - 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, - 0x74, 0x65, 0x2e, 0x4c, 0x65, 0x61, 0x73, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x2e, 0x4c, - 0x65, 0x61, 0x73, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x0b, 0x73, 0x74, 0x61, 0x74, - 0x75, 0x73, 0x41, 0x66, 0x74, 0x65, 0x72, 0x12, 0x16, 0x0a, 0x06, 0x61, 0x6d, 0x6f, 0x75, 0x6e, - 0x74, 0x18, 0x0a, 0x20, 0x01, 0x28, 0x03, 0x52, 0x06, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x12, - 0x16, 0x0a, 0x06, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x18, 0x0b, 0x20, 0x01, 0x28, 0x0c, 0x52, - 0x06, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x12, 0x1c, 0x0a, 0x09, 0x72, 0x65, 0x63, 0x69, 0x70, - 0x69, 0x65, 0x6e, 0x74, 0x18, 0x0c, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x09, 0x72, 0x65, 0x63, 0x69, - 0x70, 0x69, 0x65, 0x6e, 0x74, 0x12, 0x32, 0x0a, 0x15, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x5f, - 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x69, 0x64, 0x18, 0x0d, - 0x20, 0x01, 0x28, 0x0c, 0x52, 0x13, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x54, 0x72, 0x61, 0x6e, - 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x49, 0x64, 0x22, 0x27, 0x0a, 0x0b, 0x4c, 0x65, 0x61, - 0x73, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x12, 0x0c, 0x0a, 0x08, 0x49, 0x4e, 0x41, 0x43, - 0x54, 0x49, 0x56, 0x45, 0x10, 0x00, 0x12, 0x0a, 0x0a, 0x06, 0x41, 0x43, 0x54, 0x49, 0x56, 0x45, - 0x10, 0x01, 0x1a, 0xc2, 0x01, 0x0a, 0x0f, 0x44, 0x61, 0x74, 0x61, 0x45, 0x6e, 0x74, 0x72, 0x79, - 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x12, 0x18, 0x0a, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, - 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, - 0x12, 0x43, 0x0a, 0x0a, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x65, 0x6e, 0x74, 0x72, 0x79, 0x18, 0x02, - 0x20, 0x01, 0x28, 0x0b, 0x32, 0x24, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x44, 0x61, 0x74, - 0x61, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x44, 0x61, 0x74, 0x61, - 0x2e, 0x44, 0x61, 0x74, 0x61, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x52, 0x09, 0x64, 0x61, 0x74, 0x61, - 0x45, 0x6e, 0x74, 0x72, 0x79, 0x12, 0x50, 0x0a, 0x11, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x65, 0x6e, - 0x74, 0x72, 0x79, 0x5f, 0x62, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x18, 0x0a, 0x20, 0x01, 0x28, 0x0b, - 0x32, 0x24, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x44, 0x61, 0x74, 0x61, 0x54, 0x72, 0x61, - 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x44, 0x61, 0x74, 0x61, 0x2e, 0x44, 0x61, 0x74, - 0x61, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x52, 0x0f, 0x64, 0x61, 0x74, 0x61, 0x45, 0x6e, 0x74, 0x72, - 0x79, 0x42, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x1a, 0x90, 0x01, 0x0a, 0x10, 0x41, 0x73, 0x73, 0x65, - 0x74, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x12, 0x3e, 0x0a, 0x06, - 0x62, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x26, 0x2e, 0x77, - 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x53, 0x74, 0x61, 0x74, - 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x2e, 0x41, 0x73, 0x73, 0x65, 0x74, 0x44, 0x65, 0x74, - 0x61, 0x69, 0x6c, 0x73, 0x52, 0x06, 0x62, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x12, 0x3c, 0x0a, 0x05, - 0x61, 0x66, 0x74, 0x65, 0x72, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x26, 0x2e, 0x77, 0x61, - 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x53, 0x74, 0x61, 0x74, 0x65, - 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x2e, 0x41, 0x73, 0x73, 0x65, 0x74, 0x44, 0x65, 0x74, 0x61, - 0x69, 0x6c, 0x73, 0x52, 0x05, 0x61, 0x66, 0x74, 0x65, 0x72, 0x1a, 0xe7, 0x03, 0x0a, 0x0c, 0x41, - 0x73, 0x73, 0x65, 0x74, 0x44, 0x65, 0x74, 0x61, 0x69, 0x6c, 0x73, 0x12, 0x19, 0x0a, 0x08, 0x61, - 0x73, 0x73, 0x65, 0x74, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x61, - 0x73, 0x73, 0x65, 0x74, 0x49, 0x64, 0x12, 0x16, 0x0a, 0x06, 0x69, 0x73, 0x73, 0x75, 0x65, 0x72, - 0x18, 0x02, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x06, 0x69, 0x73, 0x73, 0x75, 0x65, 0x72, 0x12, 0x1a, - 0x0a, 0x08, 0x64, 0x65, 0x63, 0x69, 0x6d, 0x61, 0x6c, 0x73, 0x18, 0x03, 0x20, 0x01, 0x28, 0x05, - 0x52, 0x08, 0x64, 0x65, 0x63, 0x69, 0x6d, 0x61, 0x6c, 0x73, 0x12, 0x12, 0x0a, 0x04, 0x6e, 0x61, - 0x6d, 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x12, 0x20, - 0x0a, 0x0b, 0x64, 0x65, 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x05, 0x20, - 0x01, 0x28, 0x09, 0x52, 0x0b, 0x64, 0x65, 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, 0x69, 0x6f, 0x6e, - 0x12, 0x1e, 0x0a, 0x0a, 0x72, 0x65, 0x69, 0x73, 0x73, 0x75, 0x61, 0x62, 0x6c, 0x65, 0x18, 0x06, - 0x20, 0x01, 0x28, 0x08, 0x52, 0x0a, 0x72, 0x65, 0x69, 0x73, 0x73, 0x75, 0x61, 0x62, 0x6c, 0x65, - 0x12, 0x16, 0x0a, 0x06, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x18, 0x07, 0x20, 0x01, 0x28, 0x03, - 0x52, 0x06, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x12, 0x57, 0x0a, 0x0b, 0x73, 0x63, 0x72, 0x69, - 0x70, 0x74, 0x5f, 0x69, 0x6e, 0x66, 0x6f, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x36, 0x2e, - 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x53, 0x74, 0x61, - 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x2e, 0x41, 0x73, 0x73, 0x65, 0x74, 0x44, 0x65, - 0x74, 0x61, 0x69, 0x6c, 0x73, 0x2e, 0x41, 0x73, 0x73, 0x65, 0x74, 0x53, 0x63, 0x72, 0x69, 0x70, - 0x74, 0x49, 0x6e, 0x66, 0x6f, 0x52, 0x0a, 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, 0x49, 0x6e, 0x66, - 0x6f, 0x12, 0x20, 0x0a, 0x0b, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x6f, 0x72, 0x73, 0x68, 0x69, 0x70, - 0x18, 0x09, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0b, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x6f, 0x72, 0x73, - 0x68, 0x69, 0x70, 0x12, 0x10, 0x0a, 0x03, 0x6e, 0x66, 0x74, 0x18, 0x0a, 0x20, 0x01, 0x28, 0x08, - 0x52, 0x03, 0x6e, 0x66, 0x74, 0x12, 0x21, 0x0a, 0x0c, 0x6c, 0x61, 0x73, 0x74, 0x5f, 0x75, 0x70, - 0x64, 0x61, 0x74, 0x65, 0x64, 0x18, 0x0b, 0x20, 0x01, 0x28, 0x05, 0x52, 0x0b, 0x6c, 0x61, 0x73, - 0x74, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, 0x12, 0x1f, 0x0a, 0x0b, 0x73, 0x61, 0x66, 0x65, - 0x5f, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x18, 0x14, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x0a, 0x73, - 0x61, 0x66, 0x65, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x1a, 0x49, 0x0a, 0x0f, 0x41, 0x73, 0x73, - 0x65, 0x74, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x49, 0x6e, 0x66, 0x6f, 0x12, 0x16, 0x0a, 0x06, - 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x06, 0x73, 0x63, - 0x72, 0x69, 0x70, 0x74, 0x12, 0x1e, 0x0a, 0x0a, 0x63, 0x6f, 0x6d, 0x70, 0x6c, 0x65, 0x78, 0x69, - 0x74, 0x79, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0a, 0x63, 0x6f, 0x6d, 0x70, 0x6c, 0x65, - 0x78, 0x69, 0x74, 0x79, 0x1a, 0x4b, 0x0a, 0x09, 0x41, 0x73, 0x73, 0x65, 0x74, 0x49, 0x6e, 0x66, - 0x6f, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x02, 0x69, - 0x64, 0x12, 0x1a, 0x0a, 0x08, 0x64, 0x65, 0x63, 0x69, 0x6d, 0x61, 0x6c, 0x73, 0x18, 0x02, 0x20, + 0x65, 0x2e, 0x4c, 0x65, 0x61, 0x73, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x0b, 0x73, + 0x74, 0x61, 0x74, 0x75, 0x73, 0x41, 0x66, 0x74, 0x65, 0x72, 0x12, 0x16, 0x0a, 0x06, 0x61, 0x6d, + 0x6f, 0x75, 0x6e, 0x74, 0x18, 0x0a, 0x20, 0x01, 0x28, 0x03, 0x52, 0x06, 0x61, 0x6d, 0x6f, 0x75, + 0x6e, 0x74, 0x12, 0x16, 0x0a, 0x06, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x18, 0x0b, 0x20, 0x01, + 0x28, 0x0c, 0x52, 0x06, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x12, 0x1c, 0x0a, 0x09, 0x72, 0x65, + 0x63, 0x69, 0x70, 0x69, 0x65, 0x6e, 0x74, 0x18, 0x0c, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x09, 0x72, + 0x65, 0x63, 0x69, 0x70, 0x69, 0x65, 0x6e, 0x74, 0x12, 0x32, 0x0a, 0x15, 0x6f, 0x72, 0x69, 0x67, + 0x69, 0x6e, 0x5f, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x69, + 0x64, 0x18, 0x0d, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x13, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x54, + 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x49, 0x64, 0x22, 0x27, 0x0a, 0x0b, + 0x4c, 0x65, 0x61, 0x73, 0x65, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x12, 0x0c, 0x0a, 0x08, 0x49, + 0x4e, 0x41, 0x43, 0x54, 0x49, 0x56, 0x45, 0x10, 0x00, 0x12, 0x0a, 0x0a, 0x06, 0x41, 0x43, 0x54, + 0x49, 0x56, 0x45, 0x10, 0x01, 0x1a, 0xc2, 0x01, 0x0a, 0x0f, 0x44, 0x61, 0x74, 0x61, 0x45, 0x6e, + 0x74, 0x72, 0x79, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x12, 0x18, 0x0a, 0x07, 0x61, 0x64, 0x64, + 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x61, 0x64, 0x64, 0x72, + 0x65, 0x73, 0x73, 0x12, 0x43, 0x0a, 0x0a, 0x64, 0x61, 0x74, 0x61, 0x5f, 0x65, 0x6e, 0x74, 0x72, + 0x79, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x24, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, + 0x44, 0x61, 0x74, 0x61, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x44, + 0x61, 0x74, 0x61, 0x2e, 0x44, 0x61, 0x74, 0x61, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x52, 0x09, 0x64, + 0x61, 0x74, 0x61, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x12, 0x50, 0x0a, 0x11, 0x64, 0x61, 0x74, 0x61, + 0x5f, 0x65, 0x6e, 0x74, 0x72, 0x79, 0x5f, 0x62, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x18, 0x0a, 0x20, + 0x01, 0x28, 0x0b, 0x32, 0x24, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x44, 0x61, 0x74, 0x61, + 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x44, 0x61, 0x74, 0x61, 0x2e, + 0x44, 0x61, 0x74, 0x61, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x52, 0x0f, 0x64, 0x61, 0x74, 0x61, 0x45, + 0x6e, 0x74, 0x72, 0x79, 0x42, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x1a, 0x90, 0x01, 0x0a, 0x10, 0x41, + 0x73, 0x73, 0x65, 0x74, 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x12, + 0x3e, 0x0a, 0x06, 0x62, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, + 0x26, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x53, + 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x2e, 0x41, 0x73, 0x73, 0x65, 0x74, + 0x44, 0x65, 0x74, 0x61, 0x69, 0x6c, 0x73, 0x52, 0x06, 0x62, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x12, + 0x3c, 0x0a, 0x05, 0x61, 0x66, 0x74, 0x65, 0x72, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x26, + 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x53, 0x74, + 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x2e, 0x41, 0x73, 0x73, 0x65, 0x74, 0x44, + 0x65, 0x74, 0x61, 0x69, 0x6c, 0x73, 0x52, 0x05, 0x61, 0x66, 0x74, 0x65, 0x72, 0x1a, 0xb6, 0x04, + 0x0a, 0x0c, 0x41, 0x73, 0x73, 0x65, 0x74, 0x44, 0x65, 0x74, 0x61, 0x69, 0x6c, 0x73, 0x12, 0x19, + 0x0a, 0x08, 0x61, 0x73, 0x73, 0x65, 0x74, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, + 0x52, 0x07, 0x61, 0x73, 0x73, 0x65, 0x74, 0x49, 0x64, 0x12, 0x16, 0x0a, 0x06, 0x69, 0x73, 0x73, + 0x75, 0x65, 0x72, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x06, 0x69, 0x73, 0x73, 0x75, 0x65, + 0x72, 0x12, 0x1a, 0x0a, 0x08, 0x64, 0x65, 0x63, 0x69, 0x6d, 0x61, 0x6c, 0x73, 0x18, 0x03, 0x20, 0x01, 0x28, 0x05, 0x52, 0x08, 0x64, 0x65, 0x63, 0x69, 0x6d, 0x61, 0x6c, 0x73, 0x12, 0x12, 0x0a, - 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x6e, 0x61, 0x6d, - 0x65, 0x22, 0xb8, 0x0f, 0x0a, 0x13, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, - 0x6e, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x12, 0x25, 0x0a, 0x0e, 0x73, 0x65, 0x6e, - 0x64, 0x65, 0x72, 0x5f, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, - 0x0c, 0x52, 0x0d, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x41, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, - 0x12, 0x50, 0x0a, 0x08, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x66, 0x65, 0x72, 0x18, 0x68, 0x20, 0x01, - 0x28, 0x0b, 0x32, 0x32, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, - 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, 0x74, - 0x61, 0x64, 0x61, 0x74, 0x61, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x66, 0x65, 0x72, 0x4d, 0x65, - 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x48, 0x00, 0x52, 0x08, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x66, - 0x65, 0x72, 0x12, 0x50, 0x0a, 0x08, 0x65, 0x78, 0x63, 0x68, 0x61, 0x6e, 0x67, 0x65, 0x18, 0x6b, - 0x20, 0x01, 0x28, 0x0b, 0x32, 0x32, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, - 0x6e, 0x74, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4d, - 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x2e, 0x45, 0x78, 0x63, 0x68, 0x61, 0x6e, 0x67, 0x65, - 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x48, 0x00, 0x52, 0x08, 0x65, 0x78, 0x63, 0x68, - 0x61, 0x6e, 0x67, 0x65, 0x12, 0x5d, 0x0a, 0x0d, 0x6d, 0x61, 0x73, 0x73, 0x5f, 0x74, 0x72, 0x61, - 0x6e, 0x73, 0x66, 0x65, 0x72, 0x18, 0x6f, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x36, 0x2e, 0x77, 0x61, - 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, - 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x2e, 0x4d, - 0x61, 0x73, 0x73, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x66, 0x65, 0x72, 0x4d, 0x65, 0x74, 0x61, 0x64, - 0x61, 0x74, 0x61, 0x48, 0x00, 0x52, 0x0c, 0x6d, 0x61, 0x73, 0x73, 0x54, 0x72, 0x61, 0x6e, 0x73, - 0x66, 0x65, 0x72, 0x12, 0x5d, 0x0a, 0x0d, 0x69, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x5f, 0x73, 0x63, - 0x72, 0x69, 0x70, 0x74, 0x18, 0x74, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x36, 0x2e, 0x77, 0x61, 0x76, - 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, - 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x2e, 0x49, 0x6e, - 0x76, 0x6f, 0x6b, 0x65, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, - 0x74, 0x61, 0x48, 0x00, 0x52, 0x0c, 0x69, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x53, 0x63, 0x72, 0x69, - 0x70, 0x74, 0x12, 0x47, 0x0a, 0x05, 0x6c, 0x65, 0x61, 0x73, 0x65, 0x18, 0x75, 0x20, 0x01, 0x28, - 0x0b, 0x32, 0x2f, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, - 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, 0x74, 0x61, - 0x64, 0x61, 0x74, 0x61, 0x2e, 0x4c, 0x65, 0x61, 0x73, 0x65, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, - 0x74, 0x61, 0x48, 0x00, 0x52, 0x05, 0x6c, 0x65, 0x61, 0x73, 0x65, 0x12, 0x51, 0x0a, 0x08, 0x65, - 0x74, 0x68, 0x65, 0x72, 0x65, 0x75, 0x6d, 0x18, 0xad, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x32, + 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x6e, 0x61, 0x6d, + 0x65, 0x12, 0x20, 0x0a, 0x0b, 0x64, 0x65, 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, 0x69, 0x6f, 0x6e, + 0x18, 0x05, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0b, 0x64, 0x65, 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, + 0x69, 0x6f, 0x6e, 0x12, 0x1e, 0x0a, 0x0a, 0x72, 0x65, 0x69, 0x73, 0x73, 0x75, 0x61, 0x62, 0x6c, + 0x65, 0x18, 0x06, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0a, 0x72, 0x65, 0x69, 0x73, 0x73, 0x75, 0x61, + 0x62, 0x6c, 0x65, 0x12, 0x16, 0x0a, 0x06, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x18, 0x07, 0x20, + 0x01, 0x28, 0x03, 0x52, 0x06, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x12, 0x57, 0x0a, 0x0b, 0x73, + 0x63, 0x72, 0x69, 0x70, 0x74, 0x5f, 0x69, 0x6e, 0x66, 0x6f, 0x18, 0x08, 0x20, 0x01, 0x28, 0x0b, + 0x32, 0x36, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, + 0x53, 0x74, 0x61, 0x74, 0x65, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x2e, 0x41, 0x73, 0x73, 0x65, + 0x74, 0x44, 0x65, 0x74, 0x61, 0x69, 0x6c, 0x73, 0x2e, 0x41, 0x73, 0x73, 0x65, 0x74, 0x53, 0x63, + 0x72, 0x69, 0x70, 0x74, 0x49, 0x6e, 0x66, 0x6f, 0x52, 0x0a, 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, + 0x49, 0x6e, 0x66, 0x6f, 0x12, 0x20, 0x0a, 0x0b, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x6f, 0x72, 0x73, + 0x68, 0x69, 0x70, 0x18, 0x09, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0b, 0x73, 0x70, 0x6f, 0x6e, 0x73, + 0x6f, 0x72, 0x73, 0x68, 0x69, 0x70, 0x12, 0x10, 0x0a, 0x03, 0x6e, 0x66, 0x74, 0x18, 0x0a, 0x20, + 0x01, 0x28, 0x08, 0x52, 0x03, 0x6e, 0x66, 0x74, 0x12, 0x21, 0x0a, 0x0c, 0x6c, 0x61, 0x73, 0x74, + 0x5f, 0x75, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, 0x18, 0x0b, 0x20, 0x01, 0x28, 0x05, 0x52, 0x0b, + 0x6c, 0x61, 0x73, 0x74, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, 0x12, 0x2a, 0x0a, 0x11, 0x73, + 0x65, 0x71, 0x75, 0x65, 0x6e, 0x63, 0x65, 0x5f, 0x69, 0x6e, 0x5f, 0x62, 0x6c, 0x6f, 0x63, 0x6b, + 0x18, 0x0c, 0x20, 0x01, 0x28, 0x05, 0x52, 0x0f, 0x73, 0x65, 0x71, 0x75, 0x65, 0x6e, 0x63, 0x65, + 0x49, 0x6e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x12, 0x21, 0x0a, 0x0c, 0x69, 0x73, 0x73, 0x75, 0x65, + 0x5f, 0x68, 0x65, 0x69, 0x67, 0x68, 0x74, 0x18, 0x0d, 0x20, 0x01, 0x28, 0x05, 0x52, 0x0b, 0x69, + 0x73, 0x73, 0x75, 0x65, 0x48, 0x65, 0x69, 0x67, 0x68, 0x74, 0x12, 0x1f, 0x0a, 0x0b, 0x73, 0x61, + 0x66, 0x65, 0x5f, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x18, 0x14, 0x20, 0x01, 0x28, 0x0c, 0x52, + 0x0a, 0x73, 0x61, 0x66, 0x65, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x1a, 0x49, 0x0a, 0x0f, 0x41, + 0x73, 0x73, 0x65, 0x74, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x49, 0x6e, 0x66, 0x6f, 0x12, 0x16, + 0x0a, 0x06, 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x06, + 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, 0x12, 0x1e, 0x0a, 0x0a, 0x63, 0x6f, 0x6d, 0x70, 0x6c, 0x65, + 0x78, 0x69, 0x74, 0x79, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0a, 0x63, 0x6f, 0x6d, 0x70, + 0x6c, 0x65, 0x78, 0x69, 0x74, 0x79, 0x1a, 0x4b, 0x0a, 0x09, 0x41, 0x73, 0x73, 0x65, 0x74, 0x49, + 0x6e, 0x66, 0x6f, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, + 0x02, 0x69, 0x64, 0x12, 0x1a, 0x0a, 0x08, 0x64, 0x65, 0x63, 0x69, 0x6d, 0x61, 0x6c, 0x73, 0x18, + 0x02, 0x20, 0x01, 0x28, 0x05, 0x52, 0x08, 0x64, 0x65, 0x63, 0x69, 0x6d, 0x61, 0x6c, 0x73, 0x12, + 0x12, 0x0a, 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x6e, + 0x61, 0x6d, 0x65, 0x1a, 0x56, 0x0a, 0x0c, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x55, 0x70, 0x64, + 0x61, 0x74, 0x65, 0x12, 0x18, 0x0a, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, + 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x16, 0x0a, + 0x06, 0x62, 0x65, 0x66, 0x6f, 0x72, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x06, 0x62, + 0x65, 0x66, 0x6f, 0x72, 0x65, 0x12, 0x14, 0x0a, 0x05, 0x61, 0x66, 0x74, 0x65, 0x72, 0x18, 0x03, + 0x20, 0x01, 0x28, 0x0c, 0x52, 0x05, 0x61, 0x66, 0x74, 0x65, 0x72, 0x22, 0xb8, 0x0f, 0x0a, 0x13, + 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, 0x74, 0x61, 0x64, + 0x61, 0x74, 0x61, 0x12, 0x25, 0x0a, 0x0e, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x5f, 0x61, 0x64, + 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x0d, 0x73, 0x65, 0x6e, + 0x64, 0x65, 0x72, 0x41, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x50, 0x0a, 0x08, 0x74, 0x72, + 0x61, 0x6e, 0x73, 0x66, 0x65, 0x72, 0x18, 0x68, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x32, 0x2e, 0x77, + 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, + 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x2e, + 0x54, 0x72, 0x61, 0x6e, 0x73, 0x66, 0x65, 0x72, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, + 0x48, 0x00, 0x52, 0x08, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x66, 0x65, 0x72, 0x12, 0x50, 0x0a, 0x08, + 0x65, 0x78, 0x63, 0x68, 0x61, 0x6e, 0x67, 0x65, 0x18, 0x6b, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x32, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, - 0x61, 0x2e, 0x45, 0x74, 0x68, 0x65, 0x72, 0x65, 0x75, 0x6d, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, - 0x74, 0x61, 0x48, 0x00, 0x52, 0x08, 0x65, 0x74, 0x68, 0x65, 0x72, 0x65, 0x75, 0x6d, 0x1a, 0x3f, - 0x0a, 0x10, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x66, 0x65, 0x72, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, - 0x74, 0x61, 0x12, 0x2b, 0x0a, 0x11, 0x72, 0x65, 0x63, 0x69, 0x70, 0x69, 0x65, 0x6e, 0x74, 0x5f, - 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x10, 0x72, - 0x65, 0x63, 0x69, 0x70, 0x69, 0x65, 0x6e, 0x74, 0x41, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x1a, - 0x49, 0x0a, 0x14, 0x4d, 0x61, 0x73, 0x73, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x66, 0x65, 0x72, 0x4d, - 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x12, 0x31, 0x0a, 0x14, 0x72, 0x65, 0x63, 0x69, 0x70, - 0x69, 0x65, 0x6e, 0x74, 0x73, 0x5f, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x65, 0x73, 0x18, - 0x01, 0x20, 0x03, 0x28, 0x0c, 0x52, 0x13, 0x72, 0x65, 0x63, 0x69, 0x70, 0x69, 0x65, 0x6e, 0x74, - 0x73, 0x41, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x65, 0x73, 0x1a, 0x9e, 0x01, 0x0a, 0x10, 0x45, - 0x78, 0x63, 0x68, 0x61, 0x6e, 0x67, 0x65, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x12, - 0x1b, 0x0a, 0x09, 0x6f, 0x72, 0x64, 0x65, 0x72, 0x5f, 0x69, 0x64, 0x73, 0x18, 0x01, 0x20, 0x03, - 0x28, 0x0c, 0x52, 0x08, 0x6f, 0x72, 0x64, 0x65, 0x72, 0x49, 0x64, 0x73, 0x12, 0x34, 0x0a, 0x16, - 0x6f, 0x72, 0x64, 0x65, 0x72, 0x5f, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x5f, 0x61, 0x64, 0x64, - 0x72, 0x65, 0x73, 0x73, 0x65, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0c, 0x52, 0x14, 0x6f, 0x72, - 0x64, 0x65, 0x72, 0x53, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x41, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, - 0x65, 0x73, 0x12, 0x37, 0x0a, 0x18, 0x6f, 0x72, 0x64, 0x65, 0x72, 0x5f, 0x73, 0x65, 0x6e, 0x64, - 0x65, 0x72, 0x5f, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x5f, 0x6b, 0x65, 0x79, 0x73, 0x18, 0x03, - 0x20, 0x03, 0x28, 0x0c, 0x52, 0x15, 0x6f, 0x72, 0x64, 0x65, 0x72, 0x53, 0x65, 0x6e, 0x64, 0x65, - 0x72, 0x50, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x4b, 0x65, 0x79, 0x73, 0x1a, 0xed, 0x04, 0x0a, 0x14, - 0x49, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x4d, 0x65, 0x74, 0x61, - 0x64, 0x61, 0x74, 0x61, 0x12, 0x22, 0x0a, 0x0d, 0x64, 0x5f, 0x61, 0x70, 0x70, 0x5f, 0x61, 0x64, - 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x0b, 0x64, 0x41, 0x70, - 0x70, 0x41, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x23, 0x0a, 0x0d, 0x66, 0x75, 0x6e, 0x63, - 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x6e, 0x61, 0x6d, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, - 0x0c, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4e, 0x61, 0x6d, 0x65, 0x12, 0x45, 0x0a, - 0x09, 0x61, 0x72, 0x67, 0x75, 0x6d, 0x65, 0x6e, 0x74, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, - 0x32, 0x27, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x49, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x53, - 0x63, 0x72, 0x69, 0x70, 0x74, 0x52, 0x65, 0x73, 0x75, 0x6c, 0x74, 0x2e, 0x43, 0x61, 0x6c, 0x6c, - 0x2e, 0x41, 0x72, 0x67, 0x75, 0x6d, 0x65, 0x6e, 0x74, 0x52, 0x09, 0x61, 0x72, 0x67, 0x75, 0x6d, - 0x65, 0x6e, 0x74, 0x73, 0x12, 0x29, 0x0a, 0x08, 0x70, 0x61, 0x79, 0x6d, 0x65, 0x6e, 0x74, 0x73, - 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x0d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x41, - 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x52, 0x08, 0x70, 0x61, 0x79, 0x6d, 0x65, 0x6e, 0x74, 0x73, 0x12, - 0x31, 0x0a, 0x06, 0x72, 0x65, 0x73, 0x75, 0x6c, 0x74, 0x18, 0x05, 0x20, 0x01, 0x28, 0x0b, 0x32, - 0x19, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x49, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x53, 0x63, - 0x72, 0x69, 0x70, 0x74, 0x52, 0x65, 0x73, 0x75, 0x6c, 0x74, 0x52, 0x06, 0x72, 0x65, 0x73, 0x75, - 0x6c, 0x74, 0x1a, 0xe6, 0x02, 0x0a, 0x08, 0x41, 0x72, 0x67, 0x75, 0x6d, 0x65, 0x6e, 0x74, 0x12, - 0x25, 0x0a, 0x0d, 0x69, 0x6e, 0x74, 0x65, 0x67, 0x65, 0x72, 0x5f, 0x76, 0x61, 0x6c, 0x75, 0x65, - 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x48, 0x00, 0x52, 0x0c, 0x69, 0x6e, 0x74, 0x65, 0x67, 0x65, - 0x72, 0x56, 0x61, 0x6c, 0x75, 0x65, 0x12, 0x23, 0x0a, 0x0c, 0x62, 0x69, 0x6e, 0x61, 0x72, 0x79, - 0x5f, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0c, 0x48, 0x00, 0x52, 0x0b, - 0x62, 0x69, 0x6e, 0x61, 0x72, 0x79, 0x56, 0x61, 0x6c, 0x75, 0x65, 0x12, 0x23, 0x0a, 0x0c, 0x73, - 0x74, 0x72, 0x69, 0x6e, 0x67, 0x5f, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, - 0x09, 0x48, 0x00, 0x52, 0x0b, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x56, 0x61, 0x6c, 0x75, 0x65, - 0x12, 0x25, 0x0a, 0x0d, 0x62, 0x6f, 0x6f, 0x6c, 0x65, 0x61, 0x6e, 0x5f, 0x76, 0x61, 0x6c, 0x75, - 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, 0x08, 0x48, 0x00, 0x52, 0x0c, 0x62, 0x6f, 0x6f, 0x6c, 0x65, - 0x61, 0x6e, 0x56, 0x61, 0x6c, 0x75, 0x65, 0x12, 0x5a, 0x0a, 0x04, 0x6c, 0x69, 0x73, 0x74, 0x18, - 0x0a, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x44, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, + 0x61, 0x2e, 0x45, 0x78, 0x63, 0x68, 0x61, 0x6e, 0x67, 0x65, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, + 0x74, 0x61, 0x48, 0x00, 0x52, 0x08, 0x65, 0x78, 0x63, 0x68, 0x61, 0x6e, 0x67, 0x65, 0x12, 0x5d, + 0x0a, 0x0d, 0x6d, 0x61, 0x73, 0x73, 0x5f, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x66, 0x65, 0x72, 0x18, + 0x6f, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x36, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, - 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x2e, 0x49, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x53, - 0x63, 0x72, 0x69, 0x70, 0x74, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x2e, 0x41, 0x72, - 0x67, 0x75, 0x6d, 0x65, 0x6e, 0x74, 0x2e, 0x4c, 0x69, 0x73, 0x74, 0x48, 0x00, 0x52, 0x04, 0x6c, - 0x69, 0x73, 0x74, 0x1a, 0x5d, 0x0a, 0x04, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x55, 0x0a, 0x05, 0x69, - 0x74, 0x65, 0x6d, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x3f, 0x2e, 0x77, 0x61, 0x76, - 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, - 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x2e, 0x49, 0x6e, - 0x76, 0x6f, 0x6b, 0x65, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, - 0x74, 0x61, 0x2e, 0x41, 0x72, 0x67, 0x75, 0x6d, 0x65, 0x6e, 0x74, 0x52, 0x05, 0x69, 0x74, 0x65, - 0x6d, 0x73, 0x42, 0x07, 0x0a, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x1a, 0x3c, 0x0a, 0x0d, 0x4c, - 0x65, 0x61, 0x73, 0x65, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x12, 0x2b, 0x0a, 0x11, + 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x2e, 0x4d, 0x61, 0x73, 0x73, 0x54, 0x72, 0x61, + 0x6e, 0x73, 0x66, 0x65, 0x72, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x48, 0x00, 0x52, + 0x0c, 0x6d, 0x61, 0x73, 0x73, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x66, 0x65, 0x72, 0x12, 0x5d, 0x0a, + 0x0d, 0x69, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x5f, 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, 0x18, 0x74, + 0x20, 0x01, 0x28, 0x0b, 0x32, 0x36, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, + 0x6e, 0x74, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4d, + 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x2e, 0x49, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x53, 0x63, + 0x72, 0x69, 0x70, 0x74, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x48, 0x00, 0x52, 0x0c, + 0x69, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x12, 0x47, 0x0a, 0x05, + 0x6c, 0x65, 0x61, 0x73, 0x65, 0x18, 0x75, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x2f, 0x2e, 0x77, 0x61, + 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, + 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x2e, 0x4c, + 0x65, 0x61, 0x73, 0x65, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x48, 0x00, 0x52, 0x05, + 0x6c, 0x65, 0x61, 0x73, 0x65, 0x12, 0x51, 0x0a, 0x08, 0x65, 0x74, 0x68, 0x65, 0x72, 0x65, 0x75, + 0x6d, 0x18, 0xad, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x32, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, + 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, + 0x69, 0x6f, 0x6e, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x2e, 0x45, 0x74, 0x68, 0x65, + 0x72, 0x65, 0x75, 0x6d, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x48, 0x00, 0x52, 0x08, + 0x65, 0x74, 0x68, 0x65, 0x72, 0x65, 0x75, 0x6d, 0x1a, 0x3f, 0x0a, 0x10, 0x54, 0x72, 0x61, 0x6e, + 0x73, 0x66, 0x65, 0x72, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x12, 0x2b, 0x0a, 0x11, 0x72, 0x65, 0x63, 0x69, 0x70, 0x69, 0x65, 0x6e, 0x74, 0x5f, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x10, 0x72, 0x65, 0x63, 0x69, 0x70, 0x69, 0x65, - 0x6e, 0x74, 0x41, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x1a, 0x6e, 0x0a, 0x18, 0x45, 0x74, 0x68, - 0x65, 0x72, 0x65, 0x75, 0x6d, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x66, 0x65, 0x72, 0x4d, 0x65, 0x74, - 0x61, 0x64, 0x61, 0x74, 0x61, 0x12, 0x2b, 0x0a, 0x11, 0x72, 0x65, 0x63, 0x69, 0x70, 0x69, 0x65, - 0x6e, 0x74, 0x5f, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, - 0x52, 0x10, 0x72, 0x65, 0x63, 0x69, 0x70, 0x69, 0x65, 0x6e, 0x74, 0x41, 0x64, 0x64, 0x72, 0x65, - 0x73, 0x73, 0x12, 0x25, 0x0a, 0x06, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x18, 0x02, 0x20, 0x01, - 0x28, 0x0b, 0x32, 0x0d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x41, 0x6d, 0x6f, 0x75, 0x6e, - 0x74, 0x52, 0x06, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x1a, 0xa4, 0x02, 0x0a, 0x10, 0x45, 0x74, - 0x68, 0x65, 0x72, 0x65, 0x75, 0x6d, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x12, 0x1c, - 0x0a, 0x09, 0x74, 0x69, 0x6d, 0x65, 0x73, 0x74, 0x61, 0x6d, 0x70, 0x18, 0x02, 0x20, 0x01, 0x28, - 0x03, 0x52, 0x09, 0x74, 0x69, 0x6d, 0x65, 0x73, 0x74, 0x61, 0x6d, 0x70, 0x12, 0x10, 0x0a, 0x03, - 0x66, 0x65, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x03, 0x52, 0x03, 0x66, 0x65, 0x65, 0x12, 0x2a, - 0x0a, 0x11, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x5f, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x5f, - 0x6b, 0x65, 0x79, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x0f, 0x73, 0x65, 0x6e, 0x64, 0x65, - 0x72, 0x50, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x4b, 0x65, 0x79, 0x12, 0x58, 0x0a, 0x08, 0x74, 0x72, - 0x61, 0x6e, 0x73, 0x66, 0x65, 0x72, 0x18, 0x0a, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x3a, 0x2e, 0x77, - 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, - 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x2e, - 0x45, 0x74, 0x68, 0x65, 0x72, 0x65, 0x75, 0x6d, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x66, 0x65, 0x72, - 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x48, 0x00, 0x52, 0x08, 0x74, 0x72, 0x61, 0x6e, - 0x73, 0x66, 0x65, 0x72, 0x12, 0x50, 0x0a, 0x06, 0x69, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x18, 0x0b, - 0x20, 0x01, 0x28, 0x0b, 0x32, 0x36, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, + 0x6e, 0x74, 0x41, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x1a, 0x49, 0x0a, 0x14, 0x4d, 0x61, 0x73, + 0x73, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x66, 0x65, 0x72, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, + 0x61, 0x12, 0x31, 0x0a, 0x14, 0x72, 0x65, 0x63, 0x69, 0x70, 0x69, 0x65, 0x6e, 0x74, 0x73, 0x5f, + 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x65, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0c, 0x52, + 0x13, 0x72, 0x65, 0x63, 0x69, 0x70, 0x69, 0x65, 0x6e, 0x74, 0x73, 0x41, 0x64, 0x64, 0x72, 0x65, + 0x73, 0x73, 0x65, 0x73, 0x1a, 0x9e, 0x01, 0x0a, 0x10, 0x45, 0x78, 0x63, 0x68, 0x61, 0x6e, 0x67, + 0x65, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x12, 0x1b, 0x0a, 0x09, 0x6f, 0x72, 0x64, + 0x65, 0x72, 0x5f, 0x69, 0x64, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0c, 0x52, 0x08, 0x6f, 0x72, + 0x64, 0x65, 0x72, 0x49, 0x64, 0x73, 0x12, 0x34, 0x0a, 0x16, 0x6f, 0x72, 0x64, 0x65, 0x72, 0x5f, + 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x5f, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x65, 0x73, + 0x18, 0x02, 0x20, 0x03, 0x28, 0x0c, 0x52, 0x14, 0x6f, 0x72, 0x64, 0x65, 0x72, 0x53, 0x65, 0x6e, + 0x64, 0x65, 0x72, 0x41, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x65, 0x73, 0x12, 0x37, 0x0a, 0x18, + 0x6f, 0x72, 0x64, 0x65, 0x72, 0x5f, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x5f, 0x70, 0x75, 0x62, + 0x6c, 0x69, 0x63, 0x5f, 0x6b, 0x65, 0x79, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0c, 0x52, 0x15, + 0x6f, 0x72, 0x64, 0x65, 0x72, 0x53, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x50, 0x75, 0x62, 0x6c, 0x69, + 0x63, 0x4b, 0x65, 0x79, 0x73, 0x1a, 0xed, 0x04, 0x0a, 0x14, 0x49, 0x6e, 0x76, 0x6f, 0x6b, 0x65, + 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x12, 0x22, + 0x0a, 0x0d, 0x64, 0x5f, 0x61, 0x70, 0x70, 0x5f, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, + 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x0b, 0x64, 0x41, 0x70, 0x70, 0x41, 0x64, 0x64, 0x72, 0x65, + 0x73, 0x73, 0x12, 0x23, 0x0a, 0x0d, 0x66, 0x75, 0x6e, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x6e, + 0x61, 0x6d, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0c, 0x66, 0x75, 0x6e, 0x63, 0x74, + 0x69, 0x6f, 0x6e, 0x4e, 0x61, 0x6d, 0x65, 0x12, 0x45, 0x0a, 0x09, 0x61, 0x72, 0x67, 0x75, 0x6d, + 0x65, 0x6e, 0x74, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x27, 0x2e, 0x77, 0x61, 0x76, + 0x65, 0x73, 0x2e, 0x49, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x52, + 0x65, 0x73, 0x75, 0x6c, 0x74, 0x2e, 0x43, 0x61, 0x6c, 0x6c, 0x2e, 0x41, 0x72, 0x67, 0x75, 0x6d, + 0x65, 0x6e, 0x74, 0x52, 0x09, 0x61, 0x72, 0x67, 0x75, 0x6d, 0x65, 0x6e, 0x74, 0x73, 0x12, 0x29, + 0x0a, 0x08, 0x70, 0x61, 0x79, 0x6d, 0x65, 0x6e, 0x74, 0x73, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, + 0x32, 0x0d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x41, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x52, + 0x08, 0x70, 0x61, 0x79, 0x6d, 0x65, 0x6e, 0x74, 0x73, 0x12, 0x31, 0x0a, 0x06, 0x72, 0x65, 0x73, + 0x75, 0x6c, 0x74, 0x18, 0x05, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x77, 0x61, 0x76, 0x65, + 0x73, 0x2e, 0x49, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x52, 0x65, + 0x73, 0x75, 0x6c, 0x74, 0x52, 0x06, 0x72, 0x65, 0x73, 0x75, 0x6c, 0x74, 0x1a, 0xe6, 0x02, 0x0a, + 0x08, 0x41, 0x72, 0x67, 0x75, 0x6d, 0x65, 0x6e, 0x74, 0x12, 0x25, 0x0a, 0x0d, 0x69, 0x6e, 0x74, + 0x65, 0x67, 0x65, 0x72, 0x5f, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, + 0x48, 0x00, 0x52, 0x0c, 0x69, 0x6e, 0x74, 0x65, 0x67, 0x65, 0x72, 0x56, 0x61, 0x6c, 0x75, 0x65, + 0x12, 0x23, 0x0a, 0x0c, 0x62, 0x69, 0x6e, 0x61, 0x72, 0x79, 0x5f, 0x76, 0x61, 0x6c, 0x75, 0x65, + 0x18, 0x02, 0x20, 0x01, 0x28, 0x0c, 0x48, 0x00, 0x52, 0x0b, 0x62, 0x69, 0x6e, 0x61, 0x72, 0x79, + 0x56, 0x61, 0x6c, 0x75, 0x65, 0x12, 0x23, 0x0a, 0x0c, 0x73, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x5f, + 0x76, 0x61, 0x6c, 0x75, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, 0x48, 0x00, 0x52, 0x0b, 0x73, + 0x74, 0x72, 0x69, 0x6e, 0x67, 0x56, 0x61, 0x6c, 0x75, 0x65, 0x12, 0x25, 0x0a, 0x0d, 0x62, 0x6f, + 0x6f, 0x6c, 0x65, 0x61, 0x6e, 0x5f, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x18, 0x04, 0x20, 0x01, 0x28, + 0x08, 0x48, 0x00, 0x52, 0x0c, 0x62, 0x6f, 0x6f, 0x6c, 0x65, 0x61, 0x6e, 0x56, 0x61, 0x6c, 0x75, + 0x65, 0x12, 0x5a, 0x0a, 0x04, 0x6c, 0x69, 0x73, 0x74, 0x18, 0x0a, 0x20, 0x01, 0x28, 0x0b, 0x32, + 0x44, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x54, + 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, + 0x74, 0x61, 0x2e, 0x49, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x4d, + 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x2e, 0x41, 0x72, 0x67, 0x75, 0x6d, 0x65, 0x6e, 0x74, + 0x2e, 0x4c, 0x69, 0x73, 0x74, 0x48, 0x00, 0x52, 0x04, 0x6c, 0x69, 0x73, 0x74, 0x1a, 0x5d, 0x0a, + 0x04, 0x4c, 0x69, 0x73, 0x74, 0x12, 0x55, 0x0a, 0x05, 0x69, 0x74, 0x65, 0x6d, 0x73, 0x18, 0x01, + 0x20, 0x03, 0x28, 0x0b, 0x32, 0x3f, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x2e, 0x49, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x53, 0x63, - 0x72, 0x69, 0x70, 0x74, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x48, 0x00, 0x52, 0x06, - 0x69, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x42, 0x08, 0x0a, 0x06, 0x41, 0x63, 0x74, 0x69, 0x6f, 0x6e, - 0x42, 0x0a, 0x0a, 0x08, 0x6d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x42, 0x65, 0x0a, 0x21, - 0x63, 0x6f, 0x6d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, 0x72, - 0x6d, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, - 0x66, 0x5a, 0x40, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x77, 0x61, - 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, 0x72, 0x6d, 0x2f, 0x67, 0x6f, 0x77, 0x61, - 0x76, 0x65, 0x73, 0x2f, 0x70, 0x6b, 0x67, 0x2f, 0x67, 0x72, 0x70, 0x63, 0x2f, 0x67, 0x65, 0x6e, - 0x65, 0x72, 0x61, 0x74, 0x65, 0x64, 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x65, 0x76, 0x65, - 0x6e, 0x74, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33, + 0x72, 0x69, 0x70, 0x74, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x2e, 0x41, 0x72, 0x67, + 0x75, 0x6d, 0x65, 0x6e, 0x74, 0x52, 0x05, 0x69, 0x74, 0x65, 0x6d, 0x73, 0x42, 0x07, 0x0a, 0x05, + 0x76, 0x61, 0x6c, 0x75, 0x65, 0x1a, 0x3c, 0x0a, 0x0d, 0x4c, 0x65, 0x61, 0x73, 0x65, 0x4d, 0x65, + 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x12, 0x2b, 0x0a, 0x11, 0x72, 0x65, 0x63, 0x69, 0x70, 0x69, + 0x65, 0x6e, 0x74, 0x5f, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, + 0x0c, 0x52, 0x10, 0x72, 0x65, 0x63, 0x69, 0x70, 0x69, 0x65, 0x6e, 0x74, 0x41, 0x64, 0x64, 0x72, + 0x65, 0x73, 0x73, 0x1a, 0x6e, 0x0a, 0x18, 0x45, 0x74, 0x68, 0x65, 0x72, 0x65, 0x75, 0x6d, 0x54, + 0x72, 0x61, 0x6e, 0x73, 0x66, 0x65, 0x72, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x12, + 0x2b, 0x0a, 0x11, 0x72, 0x65, 0x63, 0x69, 0x70, 0x69, 0x65, 0x6e, 0x74, 0x5f, 0x61, 0x64, 0x64, + 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x10, 0x72, 0x65, 0x63, 0x69, + 0x70, 0x69, 0x65, 0x6e, 0x74, 0x41, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x25, 0x0a, 0x06, + 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x0d, 0x2e, 0x77, + 0x61, 0x76, 0x65, 0x73, 0x2e, 0x41, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x52, 0x06, 0x61, 0x6d, 0x6f, + 0x75, 0x6e, 0x74, 0x1a, 0xa4, 0x02, 0x0a, 0x10, 0x45, 0x74, 0x68, 0x65, 0x72, 0x65, 0x75, 0x6d, + 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x12, 0x1c, 0x0a, 0x09, 0x74, 0x69, 0x6d, 0x65, + 0x73, 0x74, 0x61, 0x6d, 0x70, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x09, 0x74, 0x69, 0x6d, + 0x65, 0x73, 0x74, 0x61, 0x6d, 0x70, 0x12, 0x10, 0x0a, 0x03, 0x66, 0x65, 0x65, 0x18, 0x03, 0x20, + 0x01, 0x28, 0x03, 0x52, 0x03, 0x66, 0x65, 0x65, 0x12, 0x2a, 0x0a, 0x11, 0x73, 0x65, 0x6e, 0x64, + 0x65, 0x72, 0x5f, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x5f, 0x6b, 0x65, 0x79, 0x18, 0x04, 0x20, + 0x01, 0x28, 0x0c, 0x52, 0x0f, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x50, 0x75, 0x62, 0x6c, 0x69, + 0x63, 0x4b, 0x65, 0x79, 0x12, 0x58, 0x0a, 0x08, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x66, 0x65, 0x72, + 0x18, 0x0a, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x3a, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, + 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, + 0x6e, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x2e, 0x45, 0x74, 0x68, 0x65, 0x72, 0x65, + 0x75, 0x6d, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x66, 0x65, 0x72, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, + 0x74, 0x61, 0x48, 0x00, 0x52, 0x08, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x66, 0x65, 0x72, 0x12, 0x50, + 0x0a, 0x06, 0x69, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x18, 0x0b, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x36, + 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x2e, 0x54, 0x72, + 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x4d, 0x65, 0x74, 0x61, 0x64, 0x61, 0x74, + 0x61, 0x2e, 0x49, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x4d, 0x65, + 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x48, 0x00, 0x52, 0x06, 0x69, 0x6e, 0x76, 0x6f, 0x6b, 0x65, + 0x42, 0x08, 0x0a, 0x06, 0x41, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x42, 0x0a, 0x0a, 0x08, 0x6d, 0x65, + 0x74, 0x61, 0x64, 0x61, 0x74, 0x61, 0x42, 0x65, 0x0a, 0x21, 0x63, 0x6f, 0x6d, 0x2e, 0x77, 0x61, + 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, 0x72, 0x6d, 0x2e, 0x65, 0x76, 0x65, 0x6e, + 0x74, 0x73, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x5a, 0x40, 0x67, 0x69, 0x74, + 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, + 0x74, 0x66, 0x6f, 0x72, 0x6d, 0x2f, 0x67, 0x6f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x70, 0x6b, + 0x67, 0x2f, 0x67, 0x72, 0x70, 0x63, 0x2f, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x64, + 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x65, 0x76, 0x65, 0x6e, 0x74, 0x73, 0x62, 0x06, 0x70, + 0x72, 0x6f, 0x74, 0x6f, 0x33, } var ( @@ -2323,7 +2482,7 @@ func file_waves_events_events_proto_rawDescGZIP() []byte { } var file_waves_events_events_proto_enumTypes = make([]protoimpl.EnumInfo, 2) -var file_waves_events_events_proto_msgTypes = make([]protoimpl.MessageInfo, 24) +var file_waves_events_events_proto_msgTypes = make([]protoimpl.MessageInfo, 25) var file_waves_events_events_proto_goTypes = []interface{}{ (BlockchainUpdated_Rollback_RollbackType)(0), // 0: waves.events.BlockchainUpdated.Rollback.RollbackType (StateUpdate_LeaseUpdate_LeaseStatus)(0), // 1: waves.events.StateUpdate.LeaseUpdate.LeaseStatus @@ -2341,22 +2500,24 @@ var file_waves_events_events_proto_goTypes = []interface{}{ (*StateUpdate_AssetStateUpdate)(nil), // 13: waves.events.StateUpdate.AssetStateUpdate (*StateUpdate_AssetDetails)(nil), // 14: waves.events.StateUpdate.AssetDetails (*StateUpdate_AssetInfo)(nil), // 15: waves.events.StateUpdate.AssetInfo - (*StateUpdate_AssetDetails_AssetScriptInfo)(nil), // 16: waves.events.StateUpdate.AssetDetails.AssetScriptInfo - (*TransactionMetadata_TransferMetadata)(nil), // 17: waves.events.TransactionMetadata.TransferMetadata - (*TransactionMetadata_MassTransferMetadata)(nil), // 18: waves.events.TransactionMetadata.MassTransferMetadata - (*TransactionMetadata_ExchangeMetadata)(nil), // 19: waves.events.TransactionMetadata.ExchangeMetadata - (*TransactionMetadata_InvokeScriptMetadata)(nil), // 20: waves.events.TransactionMetadata.InvokeScriptMetadata - (*TransactionMetadata_LeaseMetadata)(nil), // 21: waves.events.TransactionMetadata.LeaseMetadata - (*TransactionMetadata_EthereumTransferMetadata)(nil), // 22: waves.events.TransactionMetadata.EthereumTransferMetadata - (*TransactionMetadata_EthereumMetadata)(nil), // 23: waves.events.TransactionMetadata.EthereumMetadata - (*TransactionMetadata_InvokeScriptMetadata_Argument)(nil), // 24: waves.events.TransactionMetadata.InvokeScriptMetadata.Argument - (*TransactionMetadata_InvokeScriptMetadata_Argument_List)(nil), // 25: waves.events.TransactionMetadata.InvokeScriptMetadata.Argument.List - (*waves.Block)(nil), // 26: waves.Block - (*waves.SignedMicroBlock)(nil), // 27: waves.SignedMicroBlock - (*waves.Amount)(nil), // 28: waves.Amount - (*waves.DataTransactionData_DataEntry)(nil), // 29: waves.DataTransactionData.DataEntry - (*waves.InvokeScriptResult_Call_Argument)(nil), // 30: waves.InvokeScriptResult.Call.Argument - (*waves.InvokeScriptResult)(nil), // 31: waves.InvokeScriptResult + (*StateUpdate_ScriptUpdate)(nil), // 16: waves.events.StateUpdate.ScriptUpdate + (*StateUpdate_AssetDetails_AssetScriptInfo)(nil), // 17: waves.events.StateUpdate.AssetDetails.AssetScriptInfo + (*TransactionMetadata_TransferMetadata)(nil), // 18: waves.events.TransactionMetadata.TransferMetadata + (*TransactionMetadata_MassTransferMetadata)(nil), // 19: waves.events.TransactionMetadata.MassTransferMetadata + (*TransactionMetadata_ExchangeMetadata)(nil), // 20: waves.events.TransactionMetadata.ExchangeMetadata + (*TransactionMetadata_InvokeScriptMetadata)(nil), // 21: waves.events.TransactionMetadata.InvokeScriptMetadata + (*TransactionMetadata_LeaseMetadata)(nil), // 22: waves.events.TransactionMetadata.LeaseMetadata + (*TransactionMetadata_EthereumTransferMetadata)(nil), // 23: waves.events.TransactionMetadata.EthereumTransferMetadata + (*TransactionMetadata_EthereumMetadata)(nil), // 24: waves.events.TransactionMetadata.EthereumMetadata + (*TransactionMetadata_InvokeScriptMetadata_Argument)(nil), // 25: waves.events.TransactionMetadata.InvokeScriptMetadata.Argument + (*TransactionMetadata_InvokeScriptMetadata_Argument_List)(nil), // 26: waves.events.TransactionMetadata.InvokeScriptMetadata.Argument.List + (*waves.Block)(nil), // 27: waves.Block + (*waves.RewardShare)(nil), // 28: waves.RewardShare + (*waves.SignedMicroBlock)(nil), // 29: waves.SignedMicroBlock + (*waves.Amount)(nil), // 30: waves.Amount + (*waves.DataTransactionData_DataEntry)(nil), // 31: waves.DataTransactionData.DataEntry + (*waves.InvokeScriptResult_Call_Argument)(nil), // 32: waves.InvokeScriptResult.Call.Argument + (*waves.InvokeScriptResult)(nil), // 33: waves.InvokeScriptResult } var file_waves_events_events_proto_depIdxs = []int32{ 5, // 0: waves.events.BlockchainUpdated.append:type_name -> waves.events.BlockchainUpdated.Append @@ -2367,42 +2528,44 @@ var file_waves_events_events_proto_depIdxs = []int32{ 12, // 5: waves.events.StateUpdate.data_entries:type_name -> waves.events.StateUpdate.DataEntryUpdate 13, // 6: waves.events.StateUpdate.assets:type_name -> waves.events.StateUpdate.AssetStateUpdate 11, // 7: waves.events.StateUpdate.individual_leases:type_name -> waves.events.StateUpdate.LeaseUpdate - 17, // 8: waves.events.TransactionMetadata.transfer:type_name -> waves.events.TransactionMetadata.TransferMetadata - 19, // 9: waves.events.TransactionMetadata.exchange:type_name -> waves.events.TransactionMetadata.ExchangeMetadata - 18, // 10: waves.events.TransactionMetadata.mass_transfer:type_name -> waves.events.TransactionMetadata.MassTransferMetadata - 20, // 11: waves.events.TransactionMetadata.invoke_script:type_name -> waves.events.TransactionMetadata.InvokeScriptMetadata - 21, // 12: waves.events.TransactionMetadata.lease:type_name -> waves.events.TransactionMetadata.LeaseMetadata - 23, // 13: waves.events.TransactionMetadata.ethereum:type_name -> waves.events.TransactionMetadata.EthereumMetadata - 7, // 14: waves.events.BlockchainUpdated.Append.block:type_name -> waves.events.BlockchainUpdated.Append.BlockAppend - 8, // 15: waves.events.BlockchainUpdated.Append.micro_block:type_name -> waves.events.BlockchainUpdated.Append.MicroBlockAppend - 4, // 16: waves.events.BlockchainUpdated.Append.transactions_metadata:type_name -> waves.events.TransactionMetadata - 3, // 17: waves.events.BlockchainUpdated.Append.state_update:type_name -> waves.events.StateUpdate - 3, // 18: waves.events.BlockchainUpdated.Append.transaction_state_updates:type_name -> waves.events.StateUpdate - 0, // 19: waves.events.BlockchainUpdated.Rollback.type:type_name -> waves.events.BlockchainUpdated.Rollback.RollbackType - 26, // 20: waves.events.BlockchainUpdated.Rollback.removed_blocks:type_name -> waves.Block - 3, // 21: waves.events.BlockchainUpdated.Rollback.rollback_state_update:type_name -> waves.events.StateUpdate - 26, // 22: waves.events.BlockchainUpdated.Append.BlockAppend.block:type_name -> waves.Block - 27, // 23: waves.events.BlockchainUpdated.Append.MicroBlockAppend.micro_block:type_name -> waves.SignedMicroBlock - 28, // 24: waves.events.StateUpdate.BalanceUpdate.amount_after:type_name -> waves.Amount - 1, // 25: waves.events.StateUpdate.LeaseUpdate.status_after:type_name -> waves.events.StateUpdate.LeaseUpdate.LeaseStatus - 29, // 26: waves.events.StateUpdate.DataEntryUpdate.data_entry:type_name -> waves.DataTransactionData.DataEntry - 29, // 27: waves.events.StateUpdate.DataEntryUpdate.data_entry_before:type_name -> waves.DataTransactionData.DataEntry - 14, // 28: waves.events.StateUpdate.AssetStateUpdate.before:type_name -> waves.events.StateUpdate.AssetDetails - 14, // 29: waves.events.StateUpdate.AssetStateUpdate.after:type_name -> waves.events.StateUpdate.AssetDetails - 16, // 30: waves.events.StateUpdate.AssetDetails.script_info:type_name -> waves.events.StateUpdate.AssetDetails.AssetScriptInfo - 30, // 31: waves.events.TransactionMetadata.InvokeScriptMetadata.arguments:type_name -> waves.InvokeScriptResult.Call.Argument - 28, // 32: waves.events.TransactionMetadata.InvokeScriptMetadata.payments:type_name -> waves.Amount - 31, // 33: waves.events.TransactionMetadata.InvokeScriptMetadata.result:type_name -> waves.InvokeScriptResult - 28, // 34: waves.events.TransactionMetadata.EthereumTransferMetadata.amount:type_name -> waves.Amount - 22, // 35: waves.events.TransactionMetadata.EthereumMetadata.transfer:type_name -> waves.events.TransactionMetadata.EthereumTransferMetadata - 20, // 36: waves.events.TransactionMetadata.EthereumMetadata.invoke:type_name -> waves.events.TransactionMetadata.InvokeScriptMetadata - 25, // 37: waves.events.TransactionMetadata.InvokeScriptMetadata.Argument.list:type_name -> waves.events.TransactionMetadata.InvokeScriptMetadata.Argument.List - 24, // 38: waves.events.TransactionMetadata.InvokeScriptMetadata.Argument.List.items:type_name -> waves.events.TransactionMetadata.InvokeScriptMetadata.Argument - 39, // [39:39] is the sub-list for method output_type - 39, // [39:39] is the sub-list for method input_type - 39, // [39:39] is the sub-list for extension type_name - 39, // [39:39] is the sub-list for extension extendee - 0, // [0:39] is the sub-list for field type_name + 16, // 8: waves.events.StateUpdate.scripts:type_name -> waves.events.StateUpdate.ScriptUpdate + 18, // 9: waves.events.TransactionMetadata.transfer:type_name -> waves.events.TransactionMetadata.TransferMetadata + 20, // 10: waves.events.TransactionMetadata.exchange:type_name -> waves.events.TransactionMetadata.ExchangeMetadata + 19, // 11: waves.events.TransactionMetadata.mass_transfer:type_name -> waves.events.TransactionMetadata.MassTransferMetadata + 21, // 12: waves.events.TransactionMetadata.invoke_script:type_name -> waves.events.TransactionMetadata.InvokeScriptMetadata + 22, // 13: waves.events.TransactionMetadata.lease:type_name -> waves.events.TransactionMetadata.LeaseMetadata + 24, // 14: waves.events.TransactionMetadata.ethereum:type_name -> waves.events.TransactionMetadata.EthereumMetadata + 7, // 15: waves.events.BlockchainUpdated.Append.block:type_name -> waves.events.BlockchainUpdated.Append.BlockAppend + 8, // 16: waves.events.BlockchainUpdated.Append.micro_block:type_name -> waves.events.BlockchainUpdated.Append.MicroBlockAppend + 4, // 17: waves.events.BlockchainUpdated.Append.transactions_metadata:type_name -> waves.events.TransactionMetadata + 3, // 18: waves.events.BlockchainUpdated.Append.state_update:type_name -> waves.events.StateUpdate + 3, // 19: waves.events.BlockchainUpdated.Append.transaction_state_updates:type_name -> waves.events.StateUpdate + 0, // 20: waves.events.BlockchainUpdated.Rollback.type:type_name -> waves.events.BlockchainUpdated.Rollback.RollbackType + 27, // 21: waves.events.BlockchainUpdated.Rollback.removed_blocks:type_name -> waves.Block + 3, // 22: waves.events.BlockchainUpdated.Rollback.rollback_state_update:type_name -> waves.events.StateUpdate + 27, // 23: waves.events.BlockchainUpdated.Append.BlockAppend.block:type_name -> waves.Block + 28, // 24: waves.events.BlockchainUpdated.Append.BlockAppend.reward_shares:type_name -> waves.RewardShare + 29, // 25: waves.events.BlockchainUpdated.Append.MicroBlockAppend.micro_block:type_name -> waves.SignedMicroBlock + 30, // 26: waves.events.StateUpdate.BalanceUpdate.amount_after:type_name -> waves.Amount + 1, // 27: waves.events.StateUpdate.LeaseUpdate.status_after:type_name -> waves.events.StateUpdate.LeaseUpdate.LeaseStatus + 31, // 28: waves.events.StateUpdate.DataEntryUpdate.data_entry:type_name -> waves.DataTransactionData.DataEntry + 31, // 29: waves.events.StateUpdate.DataEntryUpdate.data_entry_before:type_name -> waves.DataTransactionData.DataEntry + 14, // 30: waves.events.StateUpdate.AssetStateUpdate.before:type_name -> waves.events.StateUpdate.AssetDetails + 14, // 31: waves.events.StateUpdate.AssetStateUpdate.after:type_name -> waves.events.StateUpdate.AssetDetails + 17, // 32: waves.events.StateUpdate.AssetDetails.script_info:type_name -> waves.events.StateUpdate.AssetDetails.AssetScriptInfo + 32, // 33: waves.events.TransactionMetadata.InvokeScriptMetadata.arguments:type_name -> waves.InvokeScriptResult.Call.Argument + 30, // 34: waves.events.TransactionMetadata.InvokeScriptMetadata.payments:type_name -> waves.Amount + 33, // 35: waves.events.TransactionMetadata.InvokeScriptMetadata.result:type_name -> waves.InvokeScriptResult + 30, // 36: waves.events.TransactionMetadata.EthereumTransferMetadata.amount:type_name -> waves.Amount + 23, // 37: waves.events.TransactionMetadata.EthereumMetadata.transfer:type_name -> waves.events.TransactionMetadata.EthereumTransferMetadata + 21, // 38: waves.events.TransactionMetadata.EthereumMetadata.invoke:type_name -> waves.events.TransactionMetadata.InvokeScriptMetadata + 26, // 39: waves.events.TransactionMetadata.InvokeScriptMetadata.Argument.list:type_name -> waves.events.TransactionMetadata.InvokeScriptMetadata.Argument.List + 25, // 40: waves.events.TransactionMetadata.InvokeScriptMetadata.Argument.List.items:type_name -> waves.events.TransactionMetadata.InvokeScriptMetadata.Argument + 41, // [41:41] is the sub-list for method output_type + 41, // [41:41] is the sub-list for method input_type + 41, // [41:41] is the sub-list for extension type_name + 41, // [41:41] is the sub-list for extension extendee + 0, // [0:41] is the sub-list for field type_name } func init() { file_waves_events_events_proto_init() } @@ -2580,7 +2743,7 @@ func file_waves_events_events_proto_init() { } } file_waves_events_events_proto_msgTypes[14].Exporter = func(v interface{}, i int) interface{} { - switch v := v.(*StateUpdate_AssetDetails_AssetScriptInfo); i { + switch v := v.(*StateUpdate_ScriptUpdate); i { case 0: return &v.state case 1: @@ -2592,7 +2755,7 @@ func file_waves_events_events_proto_init() { } } file_waves_events_events_proto_msgTypes[15].Exporter = func(v interface{}, i int) interface{} { - switch v := v.(*TransactionMetadata_TransferMetadata); i { + switch v := v.(*StateUpdate_AssetDetails_AssetScriptInfo); i { case 0: return &v.state case 1: @@ -2604,7 +2767,7 @@ func file_waves_events_events_proto_init() { } } file_waves_events_events_proto_msgTypes[16].Exporter = func(v interface{}, i int) interface{} { - switch v := v.(*TransactionMetadata_MassTransferMetadata); i { + switch v := v.(*TransactionMetadata_TransferMetadata); i { case 0: return &v.state case 1: @@ -2616,7 +2779,7 @@ func file_waves_events_events_proto_init() { } } file_waves_events_events_proto_msgTypes[17].Exporter = func(v interface{}, i int) interface{} { - switch v := v.(*TransactionMetadata_ExchangeMetadata); i { + switch v := v.(*TransactionMetadata_MassTransferMetadata); i { case 0: return &v.state case 1: @@ -2628,7 +2791,7 @@ func file_waves_events_events_proto_init() { } } file_waves_events_events_proto_msgTypes[18].Exporter = func(v interface{}, i int) interface{} { - switch v := v.(*TransactionMetadata_InvokeScriptMetadata); i { + switch v := v.(*TransactionMetadata_ExchangeMetadata); i { case 0: return &v.state case 1: @@ -2640,7 +2803,7 @@ func file_waves_events_events_proto_init() { } } file_waves_events_events_proto_msgTypes[19].Exporter = func(v interface{}, i int) interface{} { - switch v := v.(*TransactionMetadata_LeaseMetadata); i { + switch v := v.(*TransactionMetadata_InvokeScriptMetadata); i { case 0: return &v.state case 1: @@ -2652,7 +2815,7 @@ func file_waves_events_events_proto_init() { } } file_waves_events_events_proto_msgTypes[20].Exporter = func(v interface{}, i int) interface{} { - switch v := v.(*TransactionMetadata_EthereumTransferMetadata); i { + switch v := v.(*TransactionMetadata_LeaseMetadata); i { case 0: return &v.state case 1: @@ -2664,7 +2827,7 @@ func file_waves_events_events_proto_init() { } } file_waves_events_events_proto_msgTypes[21].Exporter = func(v interface{}, i int) interface{} { - switch v := v.(*TransactionMetadata_EthereumMetadata); i { + switch v := v.(*TransactionMetadata_EthereumTransferMetadata); i { case 0: return &v.state case 1: @@ -2676,7 +2839,7 @@ func file_waves_events_events_proto_init() { } } file_waves_events_events_proto_msgTypes[22].Exporter = func(v interface{}, i int) interface{} { - switch v := v.(*TransactionMetadata_InvokeScriptMetadata_Argument); i { + switch v := v.(*TransactionMetadata_EthereumMetadata); i { case 0: return &v.state case 1: @@ -2688,6 +2851,18 @@ func file_waves_events_events_proto_init() { } } file_waves_events_events_proto_msgTypes[23].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*TransactionMetadata_InvokeScriptMetadata_Argument); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_waves_events_events_proto_msgTypes[24].Exporter = func(v interface{}, i int) interface{} { switch v := v.(*TransactionMetadata_InvokeScriptMetadata_Argument_List); i { case 0: return &v.state @@ -2716,11 +2891,11 @@ func file_waves_events_events_proto_init() { (*BlockchainUpdated_Append_Block)(nil), (*BlockchainUpdated_Append_MicroBlock)(nil), } - file_waves_events_events_proto_msgTypes[21].OneofWrappers = []interface{}{ + file_waves_events_events_proto_msgTypes[22].OneofWrappers = []interface{}{ (*TransactionMetadata_EthereumMetadata_Transfer)(nil), (*TransactionMetadata_EthereumMetadata_Invoke)(nil), } - file_waves_events_events_proto_msgTypes[22].OneofWrappers = []interface{}{ + file_waves_events_events_proto_msgTypes[23].OneofWrappers = []interface{}{ (*TransactionMetadata_InvokeScriptMetadata_Argument_IntegerValue)(nil), (*TransactionMetadata_InvokeScriptMetadata_Argument_BinaryValue)(nil), (*TransactionMetadata_InvokeScriptMetadata_Argument_StringValue)(nil), @@ -2733,7 +2908,7 @@ func file_waves_events_events_proto_init() { GoPackagePath: reflect.TypeOf(x{}).PkgPath(), RawDescriptor: file_waves_events_events_proto_rawDesc, NumEnums: 2, - NumMessages: 24, + NumMessages: 25, NumExtensions: 0, NumServices: 0, }, diff --git a/pkg/grpc/generated/waves/events/grpc/blockchain_updates.pb.go b/pkg/grpc/generated/waves/events/grpc/blockchain_updates.pb.go index b452aa82b..3e1151aed 100644 --- a/pkg/grpc/generated/waves/events/grpc/blockchain_updates.pb.go +++ b/pkg/grpc/generated/waves/events/grpc/blockchain_updates.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: // protoc-gen-go v1.27.1 -// protoc v3.21.12 +// protoc v4.24.4 // source: waves/events/grpc/blockchain_updates.proto package grpc diff --git a/pkg/grpc/generated/waves/events/grpc/blockchain_updates_grpc.pb.go b/pkg/grpc/generated/waves/events/grpc/blockchain_updates_grpc.pb.go index 7891ae082..230e81139 100644 --- a/pkg/grpc/generated/waves/events/grpc/blockchain_updates_grpc.pb.go +++ b/pkg/grpc/generated/waves/events/grpc/blockchain_updates_grpc.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go-grpc. DO NOT EDIT. // versions: // - protoc-gen-go-grpc v1.2.0 -// - protoc v3.21.12 +// - protoc v4.24.4 // source: waves/events/grpc/blockchain_updates.proto package grpc diff --git a/pkg/grpc/generated/waves/invoke_script_result.pb.go b/pkg/grpc/generated/waves/invoke_script_result.pb.go index 941ab101e..5472a3fa3 100644 --- a/pkg/grpc/generated/waves/invoke_script_result.pb.go +++ b/pkg/grpc/generated/waves/invoke_script_result.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: // protoc-gen-go v1.27.1 -// protoc v3.21.12 +// protoc v4.24.4 // source: waves/invoke_script_result.proto package waves diff --git a/pkg/grpc/generated/waves/invoke_script_result_vtproto.pb.go b/pkg/grpc/generated/waves/invoke_script_result_vtproto.pb.go index 17e1401c4..bfce98306 100644 --- a/pkg/grpc/generated/waves/invoke_script_result_vtproto.pb.go +++ b/pkg/grpc/generated/waves/invoke_script_result_vtproto.pb.go @@ -1,5 +1,5 @@ // Code generated by protoc-gen-go-vtproto. DO NOT EDIT. -// protoc-gen-go-vtproto version: v0.4.0 +// protoc-gen-go-vtproto version: v0.5.0 // source: waves/invoke_script_result.proto package waves diff --git a/pkg/grpc/generated/waves/node/grpc/accounts_api.pb.go b/pkg/grpc/generated/waves/node/grpc/accounts_api.pb.go index ac40fd41e..1d1265020 100644 --- a/pkg/grpc/generated/waves/node/grpc/accounts_api.pb.go +++ b/pkg/grpc/generated/waves/node/grpc/accounts_api.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: // protoc-gen-go v1.27.1 -// protoc v3.21.12 +// protoc v4.24.4 // source: waves/node/grpc/accounts_api.proto package grpc @@ -378,6 +378,77 @@ func (x *ScriptData) GetComplexity() int64 { return 0 } +type ScriptResponse struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + ScriptBytes []byte `protobuf:"bytes,1,opt,name=script_bytes,json=scriptBytes,proto3" json:"script_bytes,omitempty"` + ScriptText string `protobuf:"bytes,2,opt,name=script_text,json=scriptText,proto3" json:"script_text,omitempty"` + Complexity int64 `protobuf:"varint,3,opt,name=complexity,proto3" json:"complexity,omitempty"` + PublicKey []byte `protobuf:"bytes,4,opt,name=public_key,json=publicKey,proto3" json:"public_key,omitempty"` +} + +func (x *ScriptResponse) Reset() { + *x = ScriptResponse{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_node_grpc_accounts_api_proto_msgTypes[6] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *ScriptResponse) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*ScriptResponse) ProtoMessage() {} + +func (x *ScriptResponse) ProtoReflect() protoreflect.Message { + mi := &file_waves_node_grpc_accounts_api_proto_msgTypes[6] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use ScriptResponse.ProtoReflect.Descriptor instead. +func (*ScriptResponse) Descriptor() ([]byte, []int) { + return file_waves_node_grpc_accounts_api_proto_rawDescGZIP(), []int{6} +} + +func (x *ScriptResponse) GetScriptBytes() []byte { + if x != nil { + return x.ScriptBytes + } + return nil +} + +func (x *ScriptResponse) GetScriptText() string { + if x != nil { + return x.ScriptText + } + return "" +} + +func (x *ScriptResponse) GetComplexity() int64 { + if x != nil { + return x.Complexity + } + return 0 +} + +func (x *ScriptResponse) GetPublicKey() []byte { + if x != nil { + return x.PublicKey + } + return nil +} + type LeaseResponse struct { state protoimpl.MessageState sizeCache protoimpl.SizeCache @@ -394,7 +465,7 @@ type LeaseResponse struct { func (x *LeaseResponse) Reset() { *x = LeaseResponse{} if protoimpl.UnsafeEnabled { - mi := &file_waves_node_grpc_accounts_api_proto_msgTypes[6] + mi := &file_waves_node_grpc_accounts_api_proto_msgTypes[7] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -407,7 +478,7 @@ func (x *LeaseResponse) String() string { func (*LeaseResponse) ProtoMessage() {} func (x *LeaseResponse) ProtoReflect() protoreflect.Message { - mi := &file_waves_node_grpc_accounts_api_proto_msgTypes[6] + mi := &file_waves_node_grpc_accounts_api_proto_msgTypes[7] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -420,7 +491,7 @@ func (x *LeaseResponse) ProtoReflect() protoreflect.Message { // Deprecated: Use LeaseResponse.ProtoReflect.Descriptor instead. func (*LeaseResponse) Descriptor() ([]byte, []int) { - return file_waves_node_grpc_accounts_api_proto_rawDescGZIP(), []int{6} + return file_waves_node_grpc_accounts_api_proto_rawDescGZIP(), []int{7} } func (x *LeaseResponse) GetLeaseId() []byte { @@ -481,7 +552,7 @@ type BalanceResponse_WavesBalances struct { func (x *BalanceResponse_WavesBalances) Reset() { *x = BalanceResponse_WavesBalances{} if protoimpl.UnsafeEnabled { - mi := &file_waves_node_grpc_accounts_api_proto_msgTypes[7] + mi := &file_waves_node_grpc_accounts_api_proto_msgTypes[8] ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) ms.StoreMessageInfo(mi) } @@ -494,7 +565,7 @@ func (x *BalanceResponse_WavesBalances) String() string { func (*BalanceResponse_WavesBalances) ProtoMessage() {} func (x *BalanceResponse_WavesBalances) ProtoReflect() protoreflect.Message { - mi := &file_waves_node_grpc_accounts_api_proto_msgTypes[7] + mi := &file_waves_node_grpc_accounts_api_proto_msgTypes[8] if protoimpl.UnsafeEnabled && x != nil { ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) if ms.LoadMessageInfo() == nil { @@ -610,54 +681,64 @@ var file_waves_node_grpc_accounts_api_proto_rawDesc = []byte{ 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, 0x54, 0x65, 0x78, 0x74, 0x12, 0x1e, 0x0a, 0x0a, 0x63, 0x6f, 0x6d, 0x70, 0x6c, 0x65, 0x78, 0x69, 0x74, 0x79, 0x18, 0x03, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0a, 0x63, 0x6f, 0x6d, 0x70, 0x6c, 0x65, 0x78, 0x69, 0x74, 0x79, - 0x22, 0xd3, 0x01, 0x0a, 0x0d, 0x4c, 0x65, 0x61, 0x73, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, - 0x73, 0x65, 0x12, 0x18, 0x0a, 0x07, 0x6c, 0x65, 0x61, 0x73, 0x65, 0x49, 0x64, 0x18, 0x01, 0x20, - 0x01, 0x28, 0x0c, 0x52, 0x07, 0x6c, 0x65, 0x61, 0x73, 0x65, 0x49, 0x64, 0x12, 0x30, 0x0a, 0x13, - 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, - 0x6e, 0x49, 0x64, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x13, 0x6f, 0x72, 0x69, 0x67, 0x69, - 0x6e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x49, 0x64, 0x12, 0x16, - 0x0a, 0x06, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x06, - 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x12, 0x2e, 0x0a, 0x09, 0x72, 0x65, 0x63, 0x69, 0x70, 0x69, - 0x65, 0x6e, 0x74, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x10, 0x2e, 0x77, 0x61, 0x76, 0x65, - 0x73, 0x2e, 0x52, 0x65, 0x63, 0x69, 0x70, 0x69, 0x65, 0x6e, 0x74, 0x52, 0x09, 0x72, 0x65, 0x63, - 0x69, 0x70, 0x69, 0x65, 0x6e, 0x74, 0x12, 0x16, 0x0a, 0x06, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, - 0x18, 0x05, 0x20, 0x01, 0x28, 0x03, 0x52, 0x06, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x16, - 0x0a, 0x06, 0x68, 0x65, 0x69, 0x67, 0x68, 0x74, 0x18, 0x06, 0x20, 0x01, 0x28, 0x03, 0x52, 0x06, - 0x68, 0x65, 0x69, 0x67, 0x68, 0x74, 0x32, 0xa4, 0x03, 0x0a, 0x0b, 0x41, 0x63, 0x63, 0x6f, 0x75, - 0x6e, 0x74, 0x73, 0x41, 0x70, 0x69, 0x12, 0x53, 0x0a, 0x0b, 0x47, 0x65, 0x74, 0x42, 0x61, 0x6c, - 0x61, 0x6e, 0x63, 0x65, 0x73, 0x12, 0x20, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, - 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x65, 0x73, - 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x20, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, - 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, - 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x30, 0x01, 0x12, 0x49, 0x0a, 0x09, 0x47, - 0x65, 0x74, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x12, 0x1f, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, - 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x41, 0x63, 0x63, 0x6f, 0x75, - 0x6e, 0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x1b, 0x2e, 0x77, 0x61, 0x76, 0x65, - 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x53, 0x63, 0x72, 0x69, - 0x70, 0x74, 0x44, 0x61, 0x74, 0x61, 0x12, 0x54, 0x0a, 0x0f, 0x47, 0x65, 0x74, 0x41, 0x63, 0x74, - 0x69, 0x76, 0x65, 0x4c, 0x65, 0x61, 0x73, 0x65, 0x73, 0x12, 0x1f, 0x2e, 0x77, 0x61, 0x76, 0x65, - 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x41, 0x63, 0x63, 0x6f, - 0x75, 0x6e, 0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x1e, 0x2e, 0x77, 0x61, 0x76, - 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x4c, 0x65, 0x61, - 0x73, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x30, 0x01, 0x12, 0x54, 0x0a, 0x0e, - 0x47, 0x65, 0x74, 0x44, 0x61, 0x74, 0x61, 0x45, 0x6e, 0x74, 0x72, 0x69, 0x65, 0x73, 0x12, 0x1c, + 0x22, 0x93, 0x01, 0x0a, 0x0e, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, + 0x6e, 0x73, 0x65, 0x12, 0x21, 0x0a, 0x0c, 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, 0x5f, 0x62, 0x79, + 0x74, 0x65, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x0b, 0x73, 0x63, 0x72, 0x69, 0x70, + 0x74, 0x42, 0x79, 0x74, 0x65, 0x73, 0x12, 0x1f, 0x0a, 0x0b, 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, + 0x5f, 0x74, 0x65, 0x78, 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x0a, 0x73, 0x63, 0x72, + 0x69, 0x70, 0x74, 0x54, 0x65, 0x78, 0x74, 0x12, 0x1e, 0x0a, 0x0a, 0x63, 0x6f, 0x6d, 0x70, 0x6c, + 0x65, 0x78, 0x69, 0x74, 0x79, 0x18, 0x03, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0a, 0x63, 0x6f, 0x6d, + 0x70, 0x6c, 0x65, 0x78, 0x69, 0x74, 0x79, 0x12, 0x1d, 0x0a, 0x0a, 0x70, 0x75, 0x62, 0x6c, 0x69, + 0x63, 0x5f, 0x6b, 0x65, 0x79, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x09, 0x70, 0x75, 0x62, + 0x6c, 0x69, 0x63, 0x4b, 0x65, 0x79, 0x22, 0xd3, 0x01, 0x0a, 0x0d, 0x4c, 0x65, 0x61, 0x73, 0x65, + 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x18, 0x0a, 0x07, 0x6c, 0x65, 0x61, 0x73, + 0x65, 0x49, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x6c, 0x65, 0x61, 0x73, 0x65, + 0x49, 0x64, 0x12, 0x30, 0x0a, 0x13, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x54, 0x72, 0x61, 0x6e, + 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x49, 0x64, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0c, 0x52, + 0x13, 0x6f, 0x72, 0x69, 0x67, 0x69, 0x6e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, + 0x6f, 0x6e, 0x49, 0x64, 0x12, 0x16, 0x0a, 0x06, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x18, 0x03, + 0x20, 0x01, 0x28, 0x0c, 0x52, 0x06, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x12, 0x2e, 0x0a, 0x09, + 0x72, 0x65, 0x63, 0x69, 0x70, 0x69, 0x65, 0x6e, 0x74, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0b, 0x32, + 0x10, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x52, 0x65, 0x63, 0x69, 0x70, 0x69, 0x65, 0x6e, + 0x74, 0x52, 0x09, 0x72, 0x65, 0x63, 0x69, 0x70, 0x69, 0x65, 0x6e, 0x74, 0x12, 0x16, 0x0a, 0x06, + 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x18, 0x05, 0x20, 0x01, 0x28, 0x03, 0x52, 0x06, 0x61, 0x6d, + 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x16, 0x0a, 0x06, 0x68, 0x65, 0x69, 0x67, 0x68, 0x74, 0x18, 0x06, + 0x20, 0x01, 0x28, 0x03, 0x52, 0x06, 0x68, 0x65, 0x69, 0x67, 0x68, 0x74, 0x32, 0xa8, 0x03, 0x0a, + 0x0b, 0x41, 0x63, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x73, 0x41, 0x70, 0x69, 0x12, 0x53, 0x0a, 0x0b, + 0x47, 0x65, 0x74, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x65, 0x73, 0x12, 0x20, 0x2e, 0x77, 0x61, + 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x42, 0x61, + 0x6c, 0x61, 0x6e, 0x63, 0x65, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x20, 0x2e, + 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, + 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x65, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x30, + 0x01, 0x12, 0x4d, 0x0a, 0x09, 0x47, 0x65, 0x74, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x12, 0x1f, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, - 0x2e, 0x44, 0x61, 0x74, 0x61, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x22, 0x2e, 0x77, - 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x44, - 0x61, 0x74, 0x61, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, - 0x30, 0x01, 0x12, 0x49, 0x0a, 0x0c, 0x52, 0x65, 0x73, 0x6f, 0x6c, 0x76, 0x65, 0x41, 0x6c, 0x69, - 0x61, 0x73, 0x12, 0x1c, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, - 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x53, 0x74, 0x72, 0x69, 0x6e, 0x67, 0x56, 0x61, 0x6c, 0x75, 0x65, - 0x1a, 0x1b, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, - 0x75, 0x66, 0x2e, 0x42, 0x79, 0x74, 0x65, 0x73, 0x56, 0x61, 0x6c, 0x75, 0x65, 0x42, 0x73, 0x0a, - 0x1a, 0x63, 0x6f, 0x6d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, - 0x72, 0x6d, 0x2e, 0x61, 0x70, 0x69, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x5a, 0x43, 0x67, 0x69, 0x74, - 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, - 0x74, 0x66, 0x6f, 0x72, 0x6d, 0x2f, 0x67, 0x6f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x70, 0x6b, - 0x67, 0x2f, 0x67, 0x72, 0x70, 0x63, 0x2f, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x64, - 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x6e, 0x6f, 0x64, 0x65, 0x2f, 0x67, 0x72, 0x70, 0x63, - 0xaa, 0x02, 0x0f, 0x57, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x4e, 0x6f, 0x64, 0x65, 0x2e, 0x47, 0x72, - 0x70, 0x63, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33, + 0x2e, 0x41, 0x63, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, + 0x1f, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, + 0x63, 0x2e, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, + 0x12, 0x54, 0x0a, 0x0f, 0x47, 0x65, 0x74, 0x41, 0x63, 0x74, 0x69, 0x76, 0x65, 0x4c, 0x65, 0x61, + 0x73, 0x65, 0x73, 0x12, 0x1f, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, + 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x41, 0x63, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x52, 0x65, 0x71, + 0x75, 0x65, 0x73, 0x74, 0x1a, 0x1e, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, + 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x4c, 0x65, 0x61, 0x73, 0x65, 0x52, 0x65, 0x73, 0x70, + 0x6f, 0x6e, 0x73, 0x65, 0x30, 0x01, 0x12, 0x54, 0x0a, 0x0e, 0x47, 0x65, 0x74, 0x44, 0x61, 0x74, + 0x61, 0x45, 0x6e, 0x74, 0x72, 0x69, 0x65, 0x73, 0x12, 0x1c, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, + 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x44, 0x61, 0x74, 0x61, 0x52, + 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x22, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, + 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x44, 0x61, 0x74, 0x61, 0x45, 0x6e, 0x74, + 0x72, 0x79, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x30, 0x01, 0x12, 0x49, 0x0a, 0x0c, + 0x52, 0x65, 0x73, 0x6f, 0x6c, 0x76, 0x65, 0x41, 0x6c, 0x69, 0x61, 0x73, 0x12, 0x1c, 0x2e, 0x67, + 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x53, + 0x74, 0x72, 0x69, 0x6e, 0x67, 0x56, 0x61, 0x6c, 0x75, 0x65, 0x1a, 0x1b, 0x2e, 0x67, 0x6f, 0x6f, + 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x42, 0x79, 0x74, + 0x65, 0x73, 0x56, 0x61, 0x6c, 0x75, 0x65, 0x42, 0x73, 0x0a, 0x1a, 0x63, 0x6f, 0x6d, 0x2e, 0x77, + 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, 0x72, 0x6d, 0x2e, 0x61, 0x70, 0x69, + 0x2e, 0x67, 0x72, 0x70, 0x63, 0x5a, 0x43, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, + 0x6d, 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, 0x72, 0x6d, 0x2f, + 0x67, 0x6f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x70, 0x6b, 0x67, 0x2f, 0x67, 0x72, 0x70, 0x63, + 0x2f, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x64, 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, + 0x2f, 0x6e, 0x6f, 0x64, 0x65, 0x2f, 0x67, 0x72, 0x70, 0x63, 0xaa, 0x02, 0x0f, 0x57, 0x61, 0x76, + 0x65, 0x73, 0x2e, 0x4e, 0x6f, 0x64, 0x65, 0x2e, 0x47, 0x72, 0x70, 0x63, 0x62, 0x06, 0x70, 0x72, + 0x6f, 0x74, 0x6f, 0x33, } var ( @@ -672,7 +753,7 @@ func file_waves_node_grpc_accounts_api_proto_rawDescGZIP() []byte { return file_waves_node_grpc_accounts_api_proto_rawDescData } -var file_waves_node_grpc_accounts_api_proto_msgTypes = make([]protoimpl.MessageInfo, 8) +var file_waves_node_grpc_accounts_api_proto_msgTypes = make([]protoimpl.MessageInfo, 9) var file_waves_node_grpc_accounts_api_proto_goTypes = []interface{}{ (*AccountRequest)(nil), // 0: waves.node.grpc.AccountRequest (*DataRequest)(nil), // 1: waves.node.grpc.DataRequest @@ -680,29 +761,30 @@ var file_waves_node_grpc_accounts_api_proto_goTypes = []interface{}{ (*BalanceResponse)(nil), // 3: waves.node.grpc.BalanceResponse (*DataEntryResponse)(nil), // 4: waves.node.grpc.DataEntryResponse (*ScriptData)(nil), // 5: waves.node.grpc.ScriptData - (*LeaseResponse)(nil), // 6: waves.node.grpc.LeaseResponse - (*BalanceResponse_WavesBalances)(nil), // 7: waves.node.grpc.BalanceResponse.WavesBalances - (*waves.Amount)(nil), // 8: waves.Amount - (*waves.DataTransactionData_DataEntry)(nil), // 9: waves.DataTransactionData.DataEntry - (*waves.Recipient)(nil), // 10: waves.Recipient - (*wrapperspb.StringValue)(nil), // 11: google.protobuf.StringValue - (*wrapperspb.BytesValue)(nil), // 12: google.protobuf.BytesValue + (*ScriptResponse)(nil), // 6: waves.node.grpc.ScriptResponse + (*LeaseResponse)(nil), // 7: waves.node.grpc.LeaseResponse + (*BalanceResponse_WavesBalances)(nil), // 8: waves.node.grpc.BalanceResponse.WavesBalances + (*waves.Amount)(nil), // 9: waves.Amount + (*waves.DataTransactionData_DataEntry)(nil), // 10: waves.DataTransactionData.DataEntry + (*waves.Recipient)(nil), // 11: waves.Recipient + (*wrapperspb.StringValue)(nil), // 12: google.protobuf.StringValue + (*wrapperspb.BytesValue)(nil), // 13: google.protobuf.BytesValue } var file_waves_node_grpc_accounts_api_proto_depIdxs = []int32{ - 7, // 0: waves.node.grpc.BalanceResponse.waves:type_name -> waves.node.grpc.BalanceResponse.WavesBalances - 8, // 1: waves.node.grpc.BalanceResponse.asset:type_name -> waves.Amount - 9, // 2: waves.node.grpc.DataEntryResponse.entry:type_name -> waves.DataTransactionData.DataEntry - 10, // 3: waves.node.grpc.LeaseResponse.recipient:type_name -> waves.Recipient + 8, // 0: waves.node.grpc.BalanceResponse.waves:type_name -> waves.node.grpc.BalanceResponse.WavesBalances + 9, // 1: waves.node.grpc.BalanceResponse.asset:type_name -> waves.Amount + 10, // 2: waves.node.grpc.DataEntryResponse.entry:type_name -> waves.DataTransactionData.DataEntry + 11, // 3: waves.node.grpc.LeaseResponse.recipient:type_name -> waves.Recipient 2, // 4: waves.node.grpc.AccountsApi.GetBalances:input_type -> waves.node.grpc.BalancesRequest 0, // 5: waves.node.grpc.AccountsApi.GetScript:input_type -> waves.node.grpc.AccountRequest 0, // 6: waves.node.grpc.AccountsApi.GetActiveLeases:input_type -> waves.node.grpc.AccountRequest 1, // 7: waves.node.grpc.AccountsApi.GetDataEntries:input_type -> waves.node.grpc.DataRequest - 11, // 8: waves.node.grpc.AccountsApi.ResolveAlias:input_type -> google.protobuf.StringValue + 12, // 8: waves.node.grpc.AccountsApi.ResolveAlias:input_type -> google.protobuf.StringValue 3, // 9: waves.node.grpc.AccountsApi.GetBalances:output_type -> waves.node.grpc.BalanceResponse - 5, // 10: waves.node.grpc.AccountsApi.GetScript:output_type -> waves.node.grpc.ScriptData - 6, // 11: waves.node.grpc.AccountsApi.GetActiveLeases:output_type -> waves.node.grpc.LeaseResponse + 6, // 10: waves.node.grpc.AccountsApi.GetScript:output_type -> waves.node.grpc.ScriptResponse + 7, // 11: waves.node.grpc.AccountsApi.GetActiveLeases:output_type -> waves.node.grpc.LeaseResponse 4, // 12: waves.node.grpc.AccountsApi.GetDataEntries:output_type -> waves.node.grpc.DataEntryResponse - 12, // 13: waves.node.grpc.AccountsApi.ResolveAlias:output_type -> google.protobuf.BytesValue + 13, // 13: waves.node.grpc.AccountsApi.ResolveAlias:output_type -> google.protobuf.BytesValue 9, // [9:14] is the sub-list for method output_type 4, // [4:9] is the sub-list for method input_type 4, // [4:4] is the sub-list for extension type_name @@ -789,7 +871,7 @@ func file_waves_node_grpc_accounts_api_proto_init() { } } file_waves_node_grpc_accounts_api_proto_msgTypes[6].Exporter = func(v interface{}, i int) interface{} { - switch v := v.(*LeaseResponse); i { + switch v := v.(*ScriptResponse); i { case 0: return &v.state case 1: @@ -801,6 +883,18 @@ func file_waves_node_grpc_accounts_api_proto_init() { } } file_waves_node_grpc_accounts_api_proto_msgTypes[7].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*LeaseResponse); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_waves_node_grpc_accounts_api_proto_msgTypes[8].Exporter = func(v interface{}, i int) interface{} { switch v := v.(*BalanceResponse_WavesBalances); i { case 0: return &v.state @@ -823,7 +917,7 @@ func file_waves_node_grpc_accounts_api_proto_init() { GoPackagePath: reflect.TypeOf(x{}).PkgPath(), RawDescriptor: file_waves_node_grpc_accounts_api_proto_rawDesc, NumEnums: 0, - NumMessages: 8, + NumMessages: 9, NumExtensions: 0, NumServices: 1, }, diff --git a/pkg/grpc/generated/waves/node/grpc/accounts_api_grpc.pb.go b/pkg/grpc/generated/waves/node/grpc/accounts_api_grpc.pb.go index f669cd797..56b0a82a0 100644 --- a/pkg/grpc/generated/waves/node/grpc/accounts_api_grpc.pb.go +++ b/pkg/grpc/generated/waves/node/grpc/accounts_api_grpc.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go-grpc. DO NOT EDIT. // versions: // - protoc-gen-go-grpc v1.2.0 -// - protoc v3.21.12 +// - protoc v4.24.4 // source: waves/node/grpc/accounts_api.proto package grpc @@ -24,7 +24,7 @@ const _ = grpc.SupportPackageIsVersion7 // For semantics around ctx use and closing/ending streaming RPCs, please refer to https://pkg.go.dev/google.golang.org/grpc/?tab=doc#ClientConn.NewStream. type AccountsApiClient interface { GetBalances(ctx context.Context, in *BalancesRequest, opts ...grpc.CallOption) (AccountsApi_GetBalancesClient, error) - GetScript(ctx context.Context, in *AccountRequest, opts ...grpc.CallOption) (*ScriptData, error) + GetScript(ctx context.Context, in *AccountRequest, opts ...grpc.CallOption) (*ScriptResponse, error) GetActiveLeases(ctx context.Context, in *AccountRequest, opts ...grpc.CallOption) (AccountsApi_GetActiveLeasesClient, error) GetDataEntries(ctx context.Context, in *DataRequest, opts ...grpc.CallOption) (AccountsApi_GetDataEntriesClient, error) ResolveAlias(ctx context.Context, in *wrapperspb.StringValue, opts ...grpc.CallOption) (*wrapperspb.BytesValue, error) @@ -70,8 +70,8 @@ func (x *accountsApiGetBalancesClient) Recv() (*BalanceResponse, error) { return m, nil } -func (c *accountsApiClient) GetScript(ctx context.Context, in *AccountRequest, opts ...grpc.CallOption) (*ScriptData, error) { - out := new(ScriptData) +func (c *accountsApiClient) GetScript(ctx context.Context, in *AccountRequest, opts ...grpc.CallOption) (*ScriptResponse, error) { + out := new(ScriptResponse) err := c.cc.Invoke(ctx, "/waves.node.grpc.AccountsApi/GetScript", in, out, opts...) if err != nil { return nil, err @@ -157,7 +157,7 @@ func (c *accountsApiClient) ResolveAlias(ctx context.Context, in *wrapperspb.Str // for forward compatibility type AccountsApiServer interface { GetBalances(*BalancesRequest, AccountsApi_GetBalancesServer) error - GetScript(context.Context, *AccountRequest) (*ScriptData, error) + GetScript(context.Context, *AccountRequest) (*ScriptResponse, error) GetActiveLeases(*AccountRequest, AccountsApi_GetActiveLeasesServer) error GetDataEntries(*DataRequest, AccountsApi_GetDataEntriesServer) error ResolveAlias(context.Context, *wrapperspb.StringValue) (*wrapperspb.BytesValue, error) @@ -170,7 +170,7 @@ type UnimplementedAccountsApiServer struct { func (UnimplementedAccountsApiServer) GetBalances(*BalancesRequest, AccountsApi_GetBalancesServer) error { return status.Errorf(codes.Unimplemented, "method GetBalances not implemented") } -func (UnimplementedAccountsApiServer) GetScript(context.Context, *AccountRequest) (*ScriptData, error) { +func (UnimplementedAccountsApiServer) GetScript(context.Context, *AccountRequest) (*ScriptResponse, error) { return nil, status.Errorf(codes.Unimplemented, "method GetScript not implemented") } func (UnimplementedAccountsApiServer) GetActiveLeases(*AccountRequest, AccountsApi_GetActiveLeasesServer) error { diff --git a/pkg/grpc/generated/waves/node/grpc/assets_api.pb.go b/pkg/grpc/generated/waves/node/grpc/assets_api.pb.go index a1da34bb1..8bb683fcc 100644 --- a/pkg/grpc/generated/waves/node/grpc/assets_api.pb.go +++ b/pkg/grpc/generated/waves/node/grpc/assets_api.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: // protoc-gen-go v1.27.1 -// protoc v3.21.12 +// protoc v4.24.4 // source: waves/node/grpc/assets_api.proto package grpc @@ -201,6 +201,8 @@ type AssetInfoResponse struct { Sponsorship int64 `protobuf:"varint,8,opt,name=sponsorship,proto3" json:"sponsorship,omitempty"` IssueTransaction *waves.SignedTransaction `protobuf:"bytes,11,opt,name=issue_transaction,json=issueTransaction,proto3" json:"issue_transaction,omitempty"` SponsorBalance int64 `protobuf:"varint,10,opt,name=sponsor_balance,json=sponsorBalance,proto3" json:"sponsor_balance,omitempty"` + SequenceInBlock int32 `protobuf:"varint,12,opt,name=sequence_in_block,json=sequenceInBlock,proto3" json:"sequence_in_block,omitempty"` + IssueHeight int32 `protobuf:"varint,13,opt,name=issue_height,json=issueHeight,proto3" json:"issue_height,omitempty"` } func (x *AssetInfoResponse) Reset() { @@ -305,6 +307,20 @@ func (x *AssetInfoResponse) GetSponsorBalance() int64 { return 0 } +func (x *AssetInfoResponse) GetSequenceInBlock() int32 { + if x != nil { + return x.SequenceInBlock + } + return 0 +} + +func (x *AssetInfoResponse) GetIssueHeight() int32 { + if x != nil { + return x.IssueHeight + } + return 0 +} + var File_waves_node_grpc_assets_api_proto protoreflect.FileDescriptor var file_waves_node_grpc_assets_api_proto_rawDesc = []byte{ @@ -330,7 +346,7 @@ var file_waves_node_grpc_assets_api_proto_rawDesc = []byte{ 0x65, 0x74, 0x5f, 0x69, 0x6e, 0x66, 0x6f, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x22, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x41, 0x73, 0x73, 0x65, 0x74, 0x49, 0x6e, 0x66, 0x6f, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, - 0x65, 0x52, 0x09, 0x61, 0x73, 0x73, 0x65, 0x74, 0x49, 0x6e, 0x66, 0x6f, 0x22, 0x87, 0x03, 0x0a, + 0x65, 0x52, 0x09, 0x61, 0x73, 0x73, 0x65, 0x74, 0x49, 0x6e, 0x66, 0x6f, 0x22, 0xd6, 0x03, 0x0a, 0x11, 0x41, 0x73, 0x73, 0x65, 0x74, 0x49, 0x6e, 0x66, 0x6f, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x12, 0x16, 0x0a, 0x06, 0x69, 0x73, 0x73, 0x75, 0x65, 0x72, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x06, 0x69, 0x73, 0x73, 0x75, 0x65, 0x72, 0x12, 0x12, 0x0a, 0x04, 0x6e, 0x61, @@ -355,25 +371,30 @@ var file_waves_node_grpc_assets_api_proto_rawDesc = []byte{ 0x75, 0x65, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x27, 0x0a, 0x0f, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x6f, 0x72, 0x5f, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x65, 0x18, 0x0a, 0x20, 0x01, 0x28, 0x03, 0x52, 0x0e, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x6f, 0x72, 0x42, - 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x65, 0x32, 0xa4, 0x01, 0x0a, 0x09, 0x41, 0x73, 0x73, 0x65, 0x74, - 0x73, 0x41, 0x70, 0x69, 0x12, 0x4c, 0x0a, 0x07, 0x47, 0x65, 0x74, 0x49, 0x6e, 0x66, 0x6f, 0x12, - 0x1d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, - 0x63, 0x2e, 0x41, 0x73, 0x73, 0x65, 0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x22, + 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x65, 0x12, 0x2a, 0x0a, 0x11, 0x73, 0x65, 0x71, 0x75, 0x65, 0x6e, + 0x63, 0x65, 0x5f, 0x69, 0x6e, 0x5f, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x18, 0x0c, 0x20, 0x01, 0x28, + 0x05, 0x52, 0x0f, 0x73, 0x65, 0x71, 0x75, 0x65, 0x6e, 0x63, 0x65, 0x49, 0x6e, 0x42, 0x6c, 0x6f, + 0x63, 0x6b, 0x12, 0x21, 0x0a, 0x0c, 0x69, 0x73, 0x73, 0x75, 0x65, 0x5f, 0x68, 0x65, 0x69, 0x67, + 0x68, 0x74, 0x18, 0x0d, 0x20, 0x01, 0x28, 0x05, 0x52, 0x0b, 0x69, 0x73, 0x73, 0x75, 0x65, 0x48, + 0x65, 0x69, 0x67, 0x68, 0x74, 0x32, 0xa4, 0x01, 0x0a, 0x09, 0x41, 0x73, 0x73, 0x65, 0x74, 0x73, + 0x41, 0x70, 0x69, 0x12, 0x4c, 0x0a, 0x07, 0x47, 0x65, 0x74, 0x49, 0x6e, 0x66, 0x6f, 0x12, 0x1d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, - 0x2e, 0x41, 0x73, 0x73, 0x65, 0x74, 0x49, 0x6e, 0x66, 0x6f, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, - 0x73, 0x65, 0x12, 0x49, 0x0a, 0x0a, 0x47, 0x65, 0x74, 0x4e, 0x46, 0x54, 0x4c, 0x69, 0x73, 0x74, - 0x12, 0x1b, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, - 0x70, 0x63, 0x2e, 0x4e, 0x46, 0x54, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x1c, 0x2e, + 0x2e, 0x41, 0x73, 0x73, 0x65, 0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x22, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, - 0x4e, 0x46, 0x54, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x30, 0x01, 0x42, 0x73, 0x0a, - 0x1a, 0x63, 0x6f, 0x6d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, - 0x72, 0x6d, 0x2e, 0x61, 0x70, 0x69, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x5a, 0x43, 0x67, 0x69, 0x74, - 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, - 0x74, 0x66, 0x6f, 0x72, 0x6d, 0x2f, 0x67, 0x6f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x70, 0x6b, - 0x67, 0x2f, 0x67, 0x72, 0x70, 0x63, 0x2f, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x64, - 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x6e, 0x6f, 0x64, 0x65, 0x2f, 0x67, 0x72, 0x70, 0x63, - 0xaa, 0x02, 0x0f, 0x57, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x4e, 0x6f, 0x64, 0x65, 0x2e, 0x47, 0x72, - 0x70, 0x63, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33, + 0x41, 0x73, 0x73, 0x65, 0x74, 0x49, 0x6e, 0x66, 0x6f, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, + 0x65, 0x12, 0x49, 0x0a, 0x0a, 0x47, 0x65, 0x74, 0x4e, 0x46, 0x54, 0x4c, 0x69, 0x73, 0x74, 0x12, + 0x1b, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, + 0x63, 0x2e, 0x4e, 0x46, 0x54, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x1c, 0x2e, 0x77, + 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x4e, + 0x46, 0x54, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x30, 0x01, 0x42, 0x73, 0x0a, 0x1a, + 0x63, 0x6f, 0x6d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, 0x72, + 0x6d, 0x2e, 0x61, 0x70, 0x69, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x5a, 0x43, 0x67, 0x69, 0x74, 0x68, + 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, + 0x66, 0x6f, 0x72, 0x6d, 0x2f, 0x67, 0x6f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x70, 0x6b, 0x67, + 0x2f, 0x67, 0x72, 0x70, 0x63, 0x2f, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x64, 0x2f, + 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x6e, 0x6f, 0x64, 0x65, 0x2f, 0x67, 0x72, 0x70, 0x63, 0xaa, + 0x02, 0x0f, 0x57, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x4e, 0x6f, 0x64, 0x65, 0x2e, 0x47, 0x72, 0x70, + 0x63, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33, } var ( diff --git a/pkg/grpc/generated/waves/node/grpc/assets_api_grpc.pb.go b/pkg/grpc/generated/waves/node/grpc/assets_api_grpc.pb.go index b9e98f55c..c652b8f55 100644 --- a/pkg/grpc/generated/waves/node/grpc/assets_api_grpc.pb.go +++ b/pkg/grpc/generated/waves/node/grpc/assets_api_grpc.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go-grpc. DO NOT EDIT. // versions: // - protoc-gen-go-grpc v1.2.0 -// - protoc v3.21.12 +// - protoc v4.24.4 // source: waves/node/grpc/assets_api.proto package grpc diff --git a/pkg/grpc/generated/waves/node/grpc/blockchain_api.pb.go b/pkg/grpc/generated/waves/node/grpc/blockchain_api.pb.go index d3fb20216..473066706 100644 --- a/pkg/grpc/generated/waves/node/grpc/blockchain_api.pb.go +++ b/pkg/grpc/generated/waves/node/grpc/blockchain_api.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: // protoc-gen-go v1.27.1 -// protoc v3.21.12 +// protoc v4.24.4 // source: waves/node/grpc/blockchain_api.proto package grpc diff --git a/pkg/grpc/generated/waves/node/grpc/blockchain_api_grpc.pb.go b/pkg/grpc/generated/waves/node/grpc/blockchain_api_grpc.pb.go index 1e8162699..27c2cad16 100644 --- a/pkg/grpc/generated/waves/node/grpc/blockchain_api_grpc.pb.go +++ b/pkg/grpc/generated/waves/node/grpc/blockchain_api_grpc.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go-grpc. DO NOT EDIT. // versions: // - protoc-gen-go-grpc v1.2.0 -// - protoc v3.21.12 +// - protoc v4.24.4 // source: waves/node/grpc/blockchain_api.proto package grpc diff --git a/pkg/grpc/generated/waves/node/grpc/blocks_api.pb.go b/pkg/grpc/generated/waves/node/grpc/blocks_api.pb.go index 9923a21e4..e6f60d004 100644 --- a/pkg/grpc/generated/waves/node/grpc/blocks_api.pb.go +++ b/pkg/grpc/generated/waves/node/grpc/blocks_api.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: // protoc-gen-go v1.27.1 -// protoc v3.21.12 +// protoc v4.24.4 // source: waves/node/grpc/blocks_api.proto package grpc @@ -222,8 +222,10 @@ type BlockWithHeight struct { sizeCache protoimpl.SizeCache unknownFields protoimpl.UnknownFields - Block *waves.Block `protobuf:"bytes,1,opt,name=block,proto3" json:"block,omitempty"` - Height uint32 `protobuf:"varint,2,opt,name=height,proto3" json:"height,omitempty"` + Block *waves.Block `protobuf:"bytes,1,opt,name=block,proto3" json:"block,omitempty"` + Height uint32 `protobuf:"varint,2,opt,name=height,proto3" json:"height,omitempty"` + Vrf []byte `protobuf:"bytes,3,opt,name=vrf,proto3" json:"vrf,omitempty"` + RewardShares []*waves.RewardShare `protobuf:"bytes,4,rep,name=reward_shares,json=rewardShares,proto3" json:"reward_shares,omitempty"` } func (x *BlockWithHeight) Reset() { @@ -272,6 +274,20 @@ func (x *BlockWithHeight) GetHeight() uint32 { return 0 } +func (x *BlockWithHeight) GetVrf() []byte { + if x != nil { + return x.Vrf + } + return nil +} + +func (x *BlockWithHeight) GetRewardShares() []*waves.RewardShare { + if x != nil { + return x.RewardShares + } + return nil +} + var File_waves_node_grpc_blocks_api_proto protoreflect.FileDescriptor var file_waves_node_grpc_blocks_api_proto_rawDesc = []byte{ @@ -279,63 +295,69 @@ var file_waves_node_grpc_blocks_api_proto_rawDesc = []byte{ 0x63, 0x2f, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x73, 0x5f, 0x61, 0x70, 0x69, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x0f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x1a, 0x11, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x62, 0x6c, 0x6f, 0x63, 0x6b, - 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x1a, 0x1b, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2f, 0x70, - 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2f, 0x65, 0x6d, 0x70, 0x74, 0x79, 0x2e, 0x70, 0x72, - 0x6f, 0x74, 0x6f, 0x1a, 0x1e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2f, 0x70, 0x72, 0x6f, 0x74, - 0x6f, 0x62, 0x75, 0x66, 0x2f, 0x77, 0x72, 0x61, 0x70, 0x70, 0x65, 0x72, 0x73, 0x2e, 0x70, 0x72, - 0x6f, 0x74, 0x6f, 0x22, 0x83, 0x01, 0x0a, 0x0c, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x52, 0x65, 0x71, - 0x75, 0x65, 0x73, 0x74, 0x12, 0x1b, 0x0a, 0x08, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x5f, 0x69, 0x64, - 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x48, 0x00, 0x52, 0x07, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x49, - 0x64, 0x12, 0x18, 0x0a, 0x06, 0x68, 0x65, 0x69, 0x67, 0x68, 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, - 0x05, 0x48, 0x00, 0x52, 0x06, 0x68, 0x65, 0x69, 0x67, 0x68, 0x74, 0x12, 0x31, 0x0a, 0x14, 0x69, - 0x6e, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x5f, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, - 0x6f, 0x6e, 0x73, 0x18, 0x64, 0x20, 0x01, 0x28, 0x08, 0x52, 0x13, 0x69, 0x6e, 0x63, 0x6c, 0x75, - 0x64, 0x65, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x42, 0x09, - 0x0a, 0x07, 0x72, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x22, 0xf1, 0x01, 0x0a, 0x11, 0x42, 0x6c, - 0x6f, 0x63, 0x6b, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, - 0x1f, 0x0a, 0x0b, 0x66, 0x72, 0x6f, 0x6d, 0x5f, 0x68, 0x65, 0x69, 0x67, 0x68, 0x74, 0x18, 0x01, - 0x20, 0x01, 0x28, 0x0d, 0x52, 0x0a, 0x66, 0x72, 0x6f, 0x6d, 0x48, 0x65, 0x69, 0x67, 0x68, 0x74, - 0x12, 0x1b, 0x0a, 0x09, 0x74, 0x6f, 0x5f, 0x68, 0x65, 0x69, 0x67, 0x68, 0x74, 0x18, 0x02, 0x20, - 0x01, 0x28, 0x0d, 0x52, 0x08, 0x74, 0x6f, 0x48, 0x65, 0x69, 0x67, 0x68, 0x74, 0x12, 0x32, 0x0a, - 0x14, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x6f, 0x72, 0x5f, 0x70, 0x75, 0x62, 0x6c, 0x69, - 0x63, 0x5f, 0x6b, 0x65, 0x79, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0c, 0x48, 0x00, 0x52, 0x12, 0x67, - 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x6f, 0x72, 0x50, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x4b, 0x65, - 0x79, 0x12, 0x2d, 0x0a, 0x11, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x6f, 0x72, 0x5f, 0x61, - 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x04, 0x20, 0x01, 0x28, 0x0c, 0x48, 0x00, 0x52, 0x10, - 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x6f, 0x72, 0x41, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, - 0x12, 0x31, 0x0a, 0x14, 0x69, 0x6e, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x5f, 0x74, 0x72, 0x61, 0x6e, - 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x18, 0x64, 0x20, 0x01, 0x28, 0x08, 0x52, 0x13, - 0x69, 0x6e, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, - 0x6f, 0x6e, 0x73, 0x42, 0x08, 0x0a, 0x06, 0x66, 0x69, 0x6c, 0x74, 0x65, 0x72, 0x22, 0x4d, 0x0a, - 0x0f, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x57, 0x69, 0x74, 0x68, 0x48, 0x65, 0x69, 0x67, 0x68, 0x74, - 0x12, 0x22, 0x0a, 0x05, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, - 0x0c, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x52, 0x05, 0x62, - 0x6c, 0x6f, 0x63, 0x6b, 0x12, 0x16, 0x0a, 0x06, 0x68, 0x65, 0x69, 0x67, 0x68, 0x74, 0x18, 0x02, - 0x20, 0x01, 0x28, 0x0d, 0x52, 0x06, 0x68, 0x65, 0x69, 0x67, 0x68, 0x74, 0x32, 0xfb, 0x01, 0x0a, - 0x09, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x73, 0x41, 0x70, 0x69, 0x12, 0x4b, 0x0a, 0x08, 0x47, 0x65, - 0x74, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x12, 0x1d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, - 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x52, 0x65, - 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x20, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, - 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x57, 0x69, 0x74, - 0x68, 0x48, 0x65, 0x69, 0x67, 0x68, 0x74, 0x12, 0x57, 0x0a, 0x0d, 0x47, 0x65, 0x74, 0x42, 0x6c, - 0x6f, 0x63, 0x6b, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x12, 0x22, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, - 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, - 0x52, 0x61, 0x6e, 0x67, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x20, 0x2e, 0x77, + 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x1a, 0x18, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x72, 0x65, + 0x77, 0x61, 0x72, 0x64, 0x5f, 0x73, 0x68, 0x61, 0x72, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, + 0x1a, 0x1b, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2f, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, + 0x66, 0x2f, 0x65, 0x6d, 0x70, 0x74, 0x79, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x1a, 0x1e, 0x67, + 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2f, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2f, 0x77, + 0x72, 0x61, 0x70, 0x70, 0x65, 0x72, 0x73, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0x83, 0x01, + 0x0a, 0x0c, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x1b, + 0x0a, 0x08, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, + 0x48, 0x00, 0x52, 0x07, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x49, 0x64, 0x12, 0x18, 0x0a, 0x06, 0x68, + 0x65, 0x69, 0x67, 0x68, 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, 0x05, 0x48, 0x00, 0x52, 0x06, 0x68, + 0x65, 0x69, 0x67, 0x68, 0x74, 0x12, 0x31, 0x0a, 0x14, 0x69, 0x6e, 0x63, 0x6c, 0x75, 0x64, 0x65, + 0x5f, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x18, 0x64, 0x20, + 0x01, 0x28, 0x08, 0x52, 0x13, 0x69, 0x6e, 0x63, 0x6c, 0x75, 0x64, 0x65, 0x54, 0x72, 0x61, 0x6e, + 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x42, 0x09, 0x0a, 0x07, 0x72, 0x65, 0x71, 0x75, + 0x65, 0x73, 0x74, 0x22, 0xf1, 0x01, 0x0a, 0x11, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x52, 0x61, 0x6e, + 0x67, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x1f, 0x0a, 0x0b, 0x66, 0x72, 0x6f, + 0x6d, 0x5f, 0x68, 0x65, 0x69, 0x67, 0x68, 0x74, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x0a, + 0x66, 0x72, 0x6f, 0x6d, 0x48, 0x65, 0x69, 0x67, 0x68, 0x74, 0x12, 0x1b, 0x0a, 0x09, 0x74, 0x6f, + 0x5f, 0x68, 0x65, 0x69, 0x67, 0x68, 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, 0x08, 0x74, + 0x6f, 0x48, 0x65, 0x69, 0x67, 0x68, 0x74, 0x12, 0x32, 0x0a, 0x14, 0x67, 0x65, 0x6e, 0x65, 0x72, + 0x61, 0x74, 0x6f, 0x72, 0x5f, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x5f, 0x6b, 0x65, 0x79, 0x18, + 0x03, 0x20, 0x01, 0x28, 0x0c, 0x48, 0x00, 0x52, 0x12, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, + 0x6f, 0x72, 0x50, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x4b, 0x65, 0x79, 0x12, 0x2d, 0x0a, 0x11, 0x67, + 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x6f, 0x72, 0x5f, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, + 0x18, 0x04, 0x20, 0x01, 0x28, 0x0c, 0x48, 0x00, 0x52, 0x10, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, + 0x74, 0x6f, 0x72, 0x41, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x31, 0x0a, 0x14, 0x69, 0x6e, + 0x63, 0x6c, 0x75, 0x64, 0x65, 0x5f, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, + 0x6e, 0x73, 0x18, 0x64, 0x20, 0x01, 0x28, 0x08, 0x52, 0x13, 0x69, 0x6e, 0x63, 0x6c, 0x75, 0x64, + 0x65, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x42, 0x08, 0x0a, + 0x06, 0x66, 0x69, 0x6c, 0x74, 0x65, 0x72, 0x22, 0x98, 0x01, 0x0a, 0x0f, 0x42, 0x6c, 0x6f, 0x63, + 0x6b, 0x57, 0x69, 0x74, 0x68, 0x48, 0x65, 0x69, 0x67, 0x68, 0x74, 0x12, 0x22, 0x0a, 0x05, 0x62, + 0x6c, 0x6f, 0x63, 0x6b, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x0c, 0x2e, 0x77, 0x61, 0x76, + 0x65, 0x73, 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x52, 0x05, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x12, + 0x16, 0x0a, 0x06, 0x68, 0x65, 0x69, 0x67, 0x68, 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0d, 0x52, + 0x06, 0x68, 0x65, 0x69, 0x67, 0x68, 0x74, 0x12, 0x10, 0x0a, 0x03, 0x76, 0x72, 0x66, 0x18, 0x03, + 0x20, 0x01, 0x28, 0x0c, 0x52, 0x03, 0x76, 0x72, 0x66, 0x12, 0x37, 0x0a, 0x0d, 0x72, 0x65, 0x77, + 0x61, 0x72, 0x64, 0x5f, 0x73, 0x68, 0x61, 0x72, 0x65, 0x73, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, + 0x32, 0x12, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x52, 0x65, 0x77, 0x61, 0x72, 0x64, 0x53, + 0x68, 0x61, 0x72, 0x65, 0x52, 0x0c, 0x72, 0x65, 0x77, 0x61, 0x72, 0x64, 0x53, 0x68, 0x61, 0x72, + 0x65, 0x73, 0x32, 0xfb, 0x01, 0x0a, 0x09, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x73, 0x41, 0x70, 0x69, + 0x12, 0x4b, 0x0a, 0x08, 0x47, 0x65, 0x74, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x12, 0x1d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x42, - 0x6c, 0x6f, 0x63, 0x6b, 0x57, 0x69, 0x74, 0x68, 0x48, 0x65, 0x69, 0x67, 0x68, 0x74, 0x30, 0x01, - 0x12, 0x48, 0x0a, 0x10, 0x47, 0x65, 0x74, 0x43, 0x75, 0x72, 0x72, 0x65, 0x6e, 0x74, 0x48, 0x65, - 0x69, 0x67, 0x68, 0x74, 0x12, 0x16, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, - 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x45, 0x6d, 0x70, 0x74, 0x79, 0x1a, 0x1c, 0x2e, 0x67, - 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x55, - 0x49, 0x6e, 0x74, 0x33, 0x32, 0x56, 0x61, 0x6c, 0x75, 0x65, 0x42, 0x73, 0x0a, 0x1a, 0x63, 0x6f, - 0x6d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, 0x72, 0x6d, 0x2e, - 0x61, 0x70, 0x69, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x5a, 0x43, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, - 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, - 0x72, 0x6d, 0x2f, 0x67, 0x6f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x70, 0x6b, 0x67, 0x2f, 0x67, - 0x72, 0x70, 0x63, 0x2f, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x64, 0x2f, 0x77, 0x61, - 0x76, 0x65, 0x73, 0x2f, 0x6e, 0x6f, 0x64, 0x65, 0x2f, 0x67, 0x72, 0x70, 0x63, 0xaa, 0x02, 0x0f, - 0x57, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x4e, 0x6f, 0x64, 0x65, 0x2e, 0x47, 0x72, 0x70, 0x63, 0x62, - 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33, + 0x6c, 0x6f, 0x63, 0x6b, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x20, 0x2e, 0x77, 0x61, + 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x42, 0x6c, + 0x6f, 0x63, 0x6b, 0x57, 0x69, 0x74, 0x68, 0x48, 0x65, 0x69, 0x67, 0x68, 0x74, 0x12, 0x57, 0x0a, + 0x0d, 0x47, 0x65, 0x74, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x12, 0x22, + 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, + 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x52, 0x61, 0x6e, 0x67, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, + 0x73, 0x74, 0x1a, 0x20, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, + 0x67, 0x72, 0x70, 0x63, 0x2e, 0x42, 0x6c, 0x6f, 0x63, 0x6b, 0x57, 0x69, 0x74, 0x68, 0x48, 0x65, + 0x69, 0x67, 0x68, 0x74, 0x30, 0x01, 0x12, 0x48, 0x0a, 0x10, 0x47, 0x65, 0x74, 0x43, 0x75, 0x72, + 0x72, 0x65, 0x6e, 0x74, 0x48, 0x65, 0x69, 0x67, 0x68, 0x74, 0x12, 0x16, 0x2e, 0x67, 0x6f, 0x6f, + 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x45, 0x6d, 0x70, + 0x74, 0x79, 0x1a, 0x1c, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, + 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x55, 0x49, 0x6e, 0x74, 0x33, 0x32, 0x56, 0x61, 0x6c, 0x75, 0x65, + 0x42, 0x73, 0x0a, 0x1a, 0x63, 0x6f, 0x6d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, + 0x74, 0x66, 0x6f, 0x72, 0x6d, 0x2e, 0x61, 0x70, 0x69, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x5a, 0x43, + 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, + 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, 0x72, 0x6d, 0x2f, 0x67, 0x6f, 0x77, 0x61, 0x76, 0x65, 0x73, + 0x2f, 0x70, 0x6b, 0x67, 0x2f, 0x67, 0x72, 0x70, 0x63, 0x2f, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, + 0x74, 0x65, 0x64, 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x6e, 0x6f, 0x64, 0x65, 0x2f, 0x67, + 0x72, 0x70, 0x63, 0xaa, 0x02, 0x0f, 0x57, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x4e, 0x6f, 0x64, 0x65, + 0x2e, 0x47, 0x72, 0x70, 0x63, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33, } var ( @@ -356,22 +378,24 @@ var file_waves_node_grpc_blocks_api_proto_goTypes = []interface{}{ (*BlockRangeRequest)(nil), // 1: waves.node.grpc.BlockRangeRequest (*BlockWithHeight)(nil), // 2: waves.node.grpc.BlockWithHeight (*waves.Block)(nil), // 3: waves.Block - (*emptypb.Empty)(nil), // 4: google.protobuf.Empty - (*wrapperspb.UInt32Value)(nil), // 5: google.protobuf.UInt32Value + (*waves.RewardShare)(nil), // 4: waves.RewardShare + (*emptypb.Empty)(nil), // 5: google.protobuf.Empty + (*wrapperspb.UInt32Value)(nil), // 6: google.protobuf.UInt32Value } var file_waves_node_grpc_blocks_api_proto_depIdxs = []int32{ 3, // 0: waves.node.grpc.BlockWithHeight.block:type_name -> waves.Block - 0, // 1: waves.node.grpc.BlocksApi.GetBlock:input_type -> waves.node.grpc.BlockRequest - 1, // 2: waves.node.grpc.BlocksApi.GetBlockRange:input_type -> waves.node.grpc.BlockRangeRequest - 4, // 3: waves.node.grpc.BlocksApi.GetCurrentHeight:input_type -> google.protobuf.Empty - 2, // 4: waves.node.grpc.BlocksApi.GetBlock:output_type -> waves.node.grpc.BlockWithHeight - 2, // 5: waves.node.grpc.BlocksApi.GetBlockRange:output_type -> waves.node.grpc.BlockWithHeight - 5, // 6: waves.node.grpc.BlocksApi.GetCurrentHeight:output_type -> google.protobuf.UInt32Value - 4, // [4:7] is the sub-list for method output_type - 1, // [1:4] is the sub-list for method input_type - 1, // [1:1] is the sub-list for extension type_name - 1, // [1:1] is the sub-list for extension extendee - 0, // [0:1] is the sub-list for field type_name + 4, // 1: waves.node.grpc.BlockWithHeight.reward_shares:type_name -> waves.RewardShare + 0, // 2: waves.node.grpc.BlocksApi.GetBlock:input_type -> waves.node.grpc.BlockRequest + 1, // 3: waves.node.grpc.BlocksApi.GetBlockRange:input_type -> waves.node.grpc.BlockRangeRequest + 5, // 4: waves.node.grpc.BlocksApi.GetCurrentHeight:input_type -> google.protobuf.Empty + 2, // 5: waves.node.grpc.BlocksApi.GetBlock:output_type -> waves.node.grpc.BlockWithHeight + 2, // 6: waves.node.grpc.BlocksApi.GetBlockRange:output_type -> waves.node.grpc.BlockWithHeight + 6, // 7: waves.node.grpc.BlocksApi.GetCurrentHeight:output_type -> google.protobuf.UInt32Value + 5, // [5:8] is the sub-list for method output_type + 2, // [2:5] is the sub-list for method input_type + 2, // [2:2] is the sub-list for extension type_name + 2, // [2:2] is the sub-list for extension extendee + 0, // [0:2] is the sub-list for field type_name } func init() { file_waves_node_grpc_blocks_api_proto_init() } diff --git a/pkg/grpc/generated/waves/node/grpc/blocks_api_grpc.pb.go b/pkg/grpc/generated/waves/node/grpc/blocks_api_grpc.pb.go index c514887ba..edaf27d5f 100644 --- a/pkg/grpc/generated/waves/node/grpc/blocks_api_grpc.pb.go +++ b/pkg/grpc/generated/waves/node/grpc/blocks_api_grpc.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go-grpc. DO NOT EDIT. // versions: // - protoc-gen-go-grpc v1.2.0 -// - protoc v3.21.12 +// - protoc v4.24.4 // source: waves/node/grpc/blocks_api.proto package grpc diff --git a/pkg/grpc/generated/waves/node/grpc/transactions_api.pb.go b/pkg/grpc/generated/waves/node/grpc/transactions_api.pb.go index 5a5f7d6b3..86e9c476a 100644 --- a/pkg/grpc/generated/waves/node/grpc/transactions_api.pb.go +++ b/pkg/grpc/generated/waves/node/grpc/transactions_api.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: // protoc-gen-go v1.27.1 -// protoc v3.21.12 +// protoc v4.24.4 // source: waves/node/grpc/transactions_api.proto package grpc @@ -27,6 +27,7 @@ const ( ApplicationStatus_UNKNOWN ApplicationStatus = 0 ApplicationStatus_SUCCEEDED ApplicationStatus = 1 ApplicationStatus_SCRIPT_EXECUTION_FAILED ApplicationStatus = 2 + ApplicationStatus_ELIDED ApplicationStatus = 3 ) // Enum value maps for ApplicationStatus. @@ -35,11 +36,13 @@ var ( 0: "UNKNOWN", 1: "SUCCEEDED", 2: "SCRIPT_EXECUTION_FAILED", + 3: "ELIDED", } ApplicationStatus_value = map[string]int32{ "UNKNOWN": 0, "SUCCEEDED": 1, "SCRIPT_EXECUTION_FAILED": 2, + "ELIDED": 3, } ) @@ -623,54 +626,55 @@ var file_waves_node_grpc_transactions_api_proto_rawDesc = []byte{ 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x31, 0x0a, 0x06, 0x72, 0x65, 0x73, 0x75, 0x6c, 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x19, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x49, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x52, 0x65, - 0x73, 0x75, 0x6c, 0x74, 0x52, 0x06, 0x72, 0x65, 0x73, 0x75, 0x6c, 0x74, 0x2a, 0x4c, 0x0a, 0x11, + 0x73, 0x75, 0x6c, 0x74, 0x52, 0x06, 0x72, 0x65, 0x73, 0x75, 0x6c, 0x74, 0x2a, 0x58, 0x0a, 0x11, 0x41, 0x70, 0x70, 0x6c, 0x69, 0x63, 0x61, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x12, 0x0b, 0x0a, 0x07, 0x55, 0x4e, 0x4b, 0x4e, 0x4f, 0x57, 0x4e, 0x10, 0x00, 0x12, 0x0d, 0x0a, 0x09, 0x53, 0x55, 0x43, 0x43, 0x45, 0x45, 0x44, 0x45, 0x44, 0x10, 0x01, 0x12, 0x1b, 0x0a, 0x17, 0x53, 0x43, 0x52, 0x49, 0x50, 0x54, 0x5f, 0x45, 0x58, 0x45, 0x43, 0x55, 0x54, 0x49, 0x4f, - 0x4e, 0x5f, 0x46, 0x41, 0x49, 0x4c, 0x45, 0x44, 0x10, 0x02, 0x32, 0x9f, 0x04, 0x0a, 0x0f, 0x54, - 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x41, 0x70, 0x69, 0x12, 0x5f, - 0x0a, 0x0f, 0x47, 0x65, 0x74, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, - 0x73, 0x12, 0x24, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, - 0x72, 0x70, 0x63, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, - 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x24, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, - 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, - 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x30, 0x01, 0x12, - 0x6b, 0x0a, 0x0f, 0x47, 0x65, 0x74, 0x53, 0x74, 0x61, 0x74, 0x65, 0x43, 0x68, 0x61, 0x6e, 0x67, - 0x65, 0x73, 0x12, 0x24, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, - 0x67, 0x72, 0x70, 0x63, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, - 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2b, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, - 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x49, 0x6e, 0x76, 0x6f, 0x6b, - 0x65, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x52, 0x65, 0x73, 0x75, 0x6c, 0x74, 0x52, 0x65, 0x73, - 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x22, 0x03, 0x88, 0x02, 0x01, 0x30, 0x01, 0x12, 0x5d, 0x0a, 0x0b, - 0x47, 0x65, 0x74, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x65, 0x73, 0x12, 0x28, 0x2e, 0x77, 0x61, - 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x54, 0x72, - 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x42, 0x79, 0x49, 0x64, 0x52, 0x65, - 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x22, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, - 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, - 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x30, 0x01, 0x12, 0x5e, 0x0a, 0x0e, 0x47, - 0x65, 0x74, 0x55, 0x6e, 0x63, 0x6f, 0x6e, 0x66, 0x69, 0x72, 0x6d, 0x65, 0x64, 0x12, 0x24, 0x2e, + 0x4e, 0x5f, 0x46, 0x41, 0x49, 0x4c, 0x45, 0x44, 0x10, 0x02, 0x12, 0x0a, 0x0a, 0x06, 0x45, 0x4c, + 0x49, 0x44, 0x45, 0x44, 0x10, 0x03, 0x32, 0x9f, 0x04, 0x0a, 0x0f, 0x54, 0x72, 0x61, 0x6e, 0x73, + 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x41, 0x70, 0x69, 0x12, 0x5f, 0x0a, 0x0f, 0x47, 0x65, + 0x74, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x12, 0x24, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x24, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, - 0x6e, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x30, 0x01, 0x12, 0x3e, 0x0a, 0x04, 0x53, - 0x69, 0x67, 0x6e, 0x12, 0x1c, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, - 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x53, 0x69, 0x67, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, - 0x74, 0x1a, 0x18, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x53, 0x69, 0x67, 0x6e, 0x65, 0x64, - 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x3f, 0x0a, 0x09, 0x42, - 0x72, 0x6f, 0x61, 0x64, 0x63, 0x61, 0x73, 0x74, 0x12, 0x18, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, - 0x2e, 0x53, 0x69, 0x67, 0x6e, 0x65, 0x64, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, - 0x6f, 0x6e, 0x1a, 0x18, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x53, 0x69, 0x67, 0x6e, 0x65, - 0x64, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x42, 0x73, 0x0a, 0x1a, - 0x63, 0x6f, 0x6d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, 0x72, - 0x6d, 0x2e, 0x61, 0x70, 0x69, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x5a, 0x43, 0x67, 0x69, 0x74, 0x68, - 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, - 0x66, 0x6f, 0x72, 0x6d, 0x2f, 0x67, 0x6f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x70, 0x6b, 0x67, - 0x2f, 0x67, 0x72, 0x70, 0x63, 0x2f, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x64, 0x2f, - 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x6e, 0x6f, 0x64, 0x65, 0x2f, 0x67, 0x72, 0x70, 0x63, 0xaa, - 0x02, 0x0f, 0x57, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x4e, 0x6f, 0x64, 0x65, 0x2e, 0x47, 0x72, 0x70, - 0x63, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33, + 0x6e, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x30, 0x01, 0x12, 0x6b, 0x0a, 0x0f, 0x47, + 0x65, 0x74, 0x53, 0x74, 0x61, 0x74, 0x65, 0x43, 0x68, 0x61, 0x6e, 0x67, 0x65, 0x73, 0x12, 0x24, + 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, + 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x52, 0x65, 0x71, + 0x75, 0x65, 0x73, 0x74, 0x1a, 0x2b, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, + 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x49, 0x6e, 0x76, 0x6f, 0x6b, 0x65, 0x53, 0x63, 0x72, + 0x69, 0x70, 0x74, 0x52, 0x65, 0x73, 0x75, 0x6c, 0x74, 0x52, 0x65, 0x73, 0x70, 0x6f, 0x6e, 0x73, + 0x65, 0x22, 0x03, 0x88, 0x02, 0x01, 0x30, 0x01, 0x12, 0x5d, 0x0a, 0x0b, 0x47, 0x65, 0x74, 0x53, + 0x74, 0x61, 0x74, 0x75, 0x73, 0x65, 0x73, 0x12, 0x28, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, + 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, + 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x42, 0x79, 0x49, 0x64, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, + 0x74, 0x1a, 0x22, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, + 0x72, 0x70, 0x63, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x53, + 0x74, 0x61, 0x74, 0x75, 0x73, 0x30, 0x01, 0x12, 0x5e, 0x0a, 0x0e, 0x47, 0x65, 0x74, 0x55, 0x6e, + 0x63, 0x6f, 0x6e, 0x66, 0x69, 0x72, 0x6d, 0x65, 0x64, 0x12, 0x24, 0x2e, 0x77, 0x61, 0x76, 0x65, + 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x2e, 0x54, 0x72, 0x61, 0x6e, + 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, + 0x24, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, + 0x63, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x65, 0x73, + 0x70, 0x6f, 0x6e, 0x73, 0x65, 0x30, 0x01, 0x12, 0x3e, 0x0a, 0x04, 0x53, 0x69, 0x67, 0x6e, 0x12, + 0x1c, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x6e, 0x6f, 0x64, 0x65, 0x2e, 0x67, 0x72, 0x70, + 0x63, 0x2e, 0x53, 0x69, 0x67, 0x6e, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x18, 0x2e, + 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x53, 0x69, 0x67, 0x6e, 0x65, 0x64, 0x54, 0x72, 0x61, 0x6e, + 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x3f, 0x0a, 0x09, 0x42, 0x72, 0x6f, 0x61, 0x64, + 0x63, 0x61, 0x73, 0x74, 0x12, 0x18, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x53, 0x69, 0x67, + 0x6e, 0x65, 0x64, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x1a, 0x18, + 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x53, 0x69, 0x67, 0x6e, 0x65, 0x64, 0x54, 0x72, 0x61, + 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x42, 0x73, 0x0a, 0x1a, 0x63, 0x6f, 0x6d, 0x2e, + 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, 0x72, 0x6d, 0x2e, 0x61, 0x70, + 0x69, 0x2e, 0x67, 0x72, 0x70, 0x63, 0x5a, 0x43, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, + 0x6f, 0x6d, 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, 0x72, 0x6d, + 0x2f, 0x67, 0x6f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x70, 0x6b, 0x67, 0x2f, 0x67, 0x72, 0x70, + 0x63, 0x2f, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x64, 0x2f, 0x77, 0x61, 0x76, 0x65, + 0x73, 0x2f, 0x6e, 0x6f, 0x64, 0x65, 0x2f, 0x67, 0x72, 0x70, 0x63, 0xaa, 0x02, 0x0f, 0x57, 0x61, + 0x76, 0x65, 0x73, 0x2e, 0x4e, 0x6f, 0x64, 0x65, 0x2e, 0x47, 0x72, 0x70, 0x63, 0x62, 0x06, 0x70, + 0x72, 0x6f, 0x74, 0x6f, 0x33, } var ( diff --git a/pkg/grpc/generated/waves/node/grpc/transactions_api_grpc.pb.go b/pkg/grpc/generated/waves/node/grpc/transactions_api_grpc.pb.go index 619267e38..5a95b60b4 100644 --- a/pkg/grpc/generated/waves/node/grpc/transactions_api_grpc.pb.go +++ b/pkg/grpc/generated/waves/node/grpc/transactions_api_grpc.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go-grpc. DO NOT EDIT. // versions: // - protoc-gen-go-grpc v1.2.0 -// - protoc v3.21.12 +// - protoc v4.24.4 // source: waves/node/grpc/transactions_api.proto package grpc diff --git a/pkg/grpc/generated/waves/order.pb.go b/pkg/grpc/generated/waves/order.pb.go index a9068caef..83fa8cf5c 100644 --- a/pkg/grpc/generated/waves/order.pb.go +++ b/pkg/grpc/generated/waves/order.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: // protoc-gen-go v1.27.1 -// protoc v3.21.12 +// protoc v4.24.4 // source: waves/order.proto package waves @@ -187,6 +187,7 @@ type Order struct { Version int32 `protobuf:"varint,11,opt,name=version,proto3" json:"version,omitempty"` Proofs [][]byte `protobuf:"bytes,12,rep,name=proofs,proto3" json:"proofs,omitempty"` PriceMode Order_PriceMode `protobuf:"varint,14,opt,name=price_mode,json=priceMode,proto3,enum=waves.Order_PriceMode" json:"price_mode,omitempty"` + Attachment []byte `protobuf:"bytes,15,opt,name=attachment,proto3" json:"attachment,omitempty"` // Types that are assignable to Sender: // // *Order_SenderPublicKey @@ -310,6 +311,13 @@ func (x *Order) GetPriceMode() Order_PriceMode { return Order_DEFAULT } +func (x *Order) GetAttachment() []byte { + if x != nil { + return x.Attachment + } + return nil +} + func (m *Order) GetSender() isOrder_Sender { if m != nil { return m.Sender @@ -358,7 +366,7 @@ var file_waves_order_proto_rawDesc = []byte{ 0x20, 0x01, 0x28, 0x0c, 0x52, 0x0d, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x41, 0x73, 0x73, 0x65, 0x74, 0x49, 0x64, 0x12, 0x24, 0x0a, 0x0e, 0x70, 0x72, 0x69, 0x63, 0x65, 0x5f, 0x61, 0x73, 0x73, 0x65, 0x74, 0x5f, 0x69, 0x64, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x0c, 0x70, 0x72, 0x69, - 0x63, 0x65, 0x41, 0x73, 0x73, 0x65, 0x74, 0x49, 0x64, 0x22, 0xfa, 0x04, 0x0a, 0x05, 0x4f, 0x72, + 0x63, 0x65, 0x41, 0x73, 0x73, 0x65, 0x74, 0x49, 0x64, 0x22, 0x9a, 0x05, 0x0a, 0x05, 0x4f, 0x72, 0x64, 0x65, 0x72, 0x12, 0x19, 0x0a, 0x08, 0x63, 0x68, 0x61, 0x69, 0x6e, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x05, 0x52, 0x07, 0x63, 0x68, 0x61, 0x69, 0x6e, 0x49, 0x64, 0x12, 0x2c, 0x0a, 0x12, 0x6d, 0x61, 0x74, 0x63, 0x68, 0x65, 0x72, 0x5f, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, @@ -386,7 +394,9 @@ var file_waves_order_proto_rawDesc = []byte{ 0x0a, 0x70, 0x72, 0x69, 0x63, 0x65, 0x5f, 0x6d, 0x6f, 0x64, 0x65, 0x18, 0x0e, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x16, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x4f, 0x72, 0x64, 0x65, 0x72, 0x2e, 0x50, 0x72, 0x69, 0x63, 0x65, 0x4d, 0x6f, 0x64, 0x65, 0x52, 0x09, 0x70, 0x72, 0x69, 0x63, 0x65, - 0x4d, 0x6f, 0x64, 0x65, 0x12, 0x2c, 0x0a, 0x11, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x5f, 0x70, + 0x4d, 0x6f, 0x64, 0x65, 0x12, 0x1e, 0x0a, 0x0a, 0x61, 0x74, 0x74, 0x61, 0x63, 0x68, 0x6d, 0x65, + 0x6e, 0x74, 0x18, 0x0f, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x0a, 0x61, 0x74, 0x74, 0x61, 0x63, 0x68, + 0x6d, 0x65, 0x6e, 0x74, 0x12, 0x2c, 0x0a, 0x11, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x5f, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x5f, 0x6b, 0x65, 0x79, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0c, 0x48, 0x00, 0x52, 0x0f, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x50, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x4b, 0x65, 0x79, 0x12, 0x2b, 0x0a, 0x10, 0x65, 0x69, 0x70, 0x37, 0x31, 0x32, 0x5f, 0x73, 0x69, 0x67, diff --git a/pkg/grpc/generated/waves/order_vtproto.pb.go b/pkg/grpc/generated/waves/order_vtproto.pb.go index b0e9fe4cb..b8c88bedc 100644 --- a/pkg/grpc/generated/waves/order_vtproto.pb.go +++ b/pkg/grpc/generated/waves/order_vtproto.pb.go @@ -1,5 +1,5 @@ // Code generated by protoc-gen-go-vtproto. DO NOT EDIT. -// protoc-gen-go-vtproto version: v0.4.0 +// protoc-gen-go-vtproto version: v0.5.0 // source: waves/order.proto package waves @@ -94,6 +94,13 @@ func (m *Order) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { i -= len(m.unknownFields) copy(dAtA[i:], m.unknownFields) } + if len(m.Attachment) > 0 { + i -= len(m.Attachment) + copy(dAtA[i:], m.Attachment) + i = encodeVarint(dAtA, i, uint64(len(m.Attachment))) + i-- + dAtA[i] = 0x7a + } if m.PriceMode != 0 { i = encodeVarint(dAtA, i, uint64(m.PriceMode)) i-- @@ -284,6 +291,10 @@ func (m *Order) SizeVT() (n int) { if m.PriceMode != 0 { n += 1 + sov(uint64(m.PriceMode)) } + l = len(m.Attachment) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } n += len(m.unknownFields) return n } @@ -812,6 +823,40 @@ func (m *Order) UnmarshalVT(dAtA []byte) error { break } } + case 15: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Attachment", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Attachment = append(m.Attachment[:0], dAtA[iNdEx:postIndex]...) + if m.Attachment == nil { + m.Attachment = []byte{} + } + iNdEx = postIndex default: iNdEx = preIndex skippy, err := skip(dAtA[iNdEx:]) diff --git a/pkg/grpc/generated/waves/recipient.pb.go b/pkg/grpc/generated/waves/recipient.pb.go index b5719c6fd..3018e52ed 100644 --- a/pkg/grpc/generated/waves/recipient.pb.go +++ b/pkg/grpc/generated/waves/recipient.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: // protoc-gen-go v1.27.1 -// protoc v3.21.12 +// protoc v4.24.4 // source: waves/recipient.proto package waves diff --git a/pkg/grpc/generated/waves/recipient_vtproto.pb.go b/pkg/grpc/generated/waves/recipient_vtproto.pb.go index c00f07726..c0f33f20d 100644 --- a/pkg/grpc/generated/waves/recipient_vtproto.pb.go +++ b/pkg/grpc/generated/waves/recipient_vtproto.pb.go @@ -1,5 +1,5 @@ // Code generated by protoc-gen-go-vtproto. DO NOT EDIT. -// protoc-gen-go-vtproto version: v0.4.0 +// protoc-gen-go-vtproto version: v0.5.0 // source: waves/recipient.proto package waves diff --git a/pkg/grpc/generated/waves/reward_share.pb.go b/pkg/grpc/generated/waves/reward_share.pb.go new file mode 100644 index 000000000..5297ba721 --- /dev/null +++ b/pkg/grpc/generated/waves/reward_share.pb.go @@ -0,0 +1,157 @@ +// Code generated by protoc-gen-go. DO NOT EDIT. +// versions: +// protoc-gen-go v1.27.1 +// protoc v4.24.4 +// source: waves/reward_share.proto + +package waves + +import ( + protoreflect "google.golang.org/protobuf/reflect/protoreflect" + protoimpl "google.golang.org/protobuf/runtime/protoimpl" + reflect "reflect" + sync "sync" +) + +const ( + // Verify that this generated code is sufficiently up-to-date. + _ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion) + // Verify that runtime/protoimpl is sufficiently up-to-date. + _ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20) +) + +type RewardShare struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + Address []byte `protobuf:"bytes,1,opt,name=address,proto3" json:"address,omitempty"` + Reward int64 `protobuf:"varint,2,opt,name=reward,proto3" json:"reward,omitempty"` +} + +func (x *RewardShare) Reset() { + *x = RewardShare{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_reward_share_proto_msgTypes[0] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *RewardShare) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*RewardShare) ProtoMessage() {} + +func (x *RewardShare) ProtoReflect() protoreflect.Message { + mi := &file_waves_reward_share_proto_msgTypes[0] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use RewardShare.ProtoReflect.Descriptor instead. +func (*RewardShare) Descriptor() ([]byte, []int) { + return file_waves_reward_share_proto_rawDescGZIP(), []int{0} +} + +func (x *RewardShare) GetAddress() []byte { + if x != nil { + return x.Address + } + return nil +} + +func (x *RewardShare) GetReward() int64 { + if x != nil { + return x.Reward + } + return 0 +} + +var File_waves_reward_share_proto protoreflect.FileDescriptor + +var file_waves_reward_share_proto_rawDesc = []byte{ + 0x0a, 0x18, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x72, 0x65, 0x77, 0x61, 0x72, 0x64, 0x5f, 0x73, + 0x68, 0x61, 0x72, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x05, 0x77, 0x61, 0x76, 0x65, + 0x73, 0x22, 0x3f, 0x0a, 0x0b, 0x52, 0x65, 0x77, 0x61, 0x72, 0x64, 0x53, 0x68, 0x61, 0x72, 0x65, + 0x12, 0x18, 0x0a, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, + 0x0c, 0x52, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x16, 0x0a, 0x06, 0x72, 0x65, + 0x77, 0x61, 0x72, 0x64, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x06, 0x72, 0x65, 0x77, 0x61, + 0x72, 0x64, 0x42, 0x5f, 0x0a, 0x1a, 0x63, 0x6f, 0x6d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, + 0x6c, 0x61, 0x74, 0x66, 0x6f, 0x72, 0x6d, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, + 0x5a, 0x39, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x77, 0x61, 0x76, + 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, 0x72, 0x6d, 0x2f, 0x67, 0x6f, 0x77, 0x61, 0x76, + 0x65, 0x73, 0x2f, 0x70, 0x6b, 0x67, 0x2f, 0x67, 0x72, 0x70, 0x63, 0x2f, 0x67, 0x65, 0x6e, 0x65, + 0x72, 0x61, 0x74, 0x65, 0x64, 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, 0xaa, 0x02, 0x05, 0x57, 0x61, + 0x76, 0x65, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33, +} + +var ( + file_waves_reward_share_proto_rawDescOnce sync.Once + file_waves_reward_share_proto_rawDescData = file_waves_reward_share_proto_rawDesc +) + +func file_waves_reward_share_proto_rawDescGZIP() []byte { + file_waves_reward_share_proto_rawDescOnce.Do(func() { + file_waves_reward_share_proto_rawDescData = protoimpl.X.CompressGZIP(file_waves_reward_share_proto_rawDescData) + }) + return file_waves_reward_share_proto_rawDescData +} + +var file_waves_reward_share_proto_msgTypes = make([]protoimpl.MessageInfo, 1) +var file_waves_reward_share_proto_goTypes = []interface{}{ + (*RewardShare)(nil), // 0: waves.RewardShare +} +var file_waves_reward_share_proto_depIdxs = []int32{ + 0, // [0:0] is the sub-list for method output_type + 0, // [0:0] is the sub-list for method input_type + 0, // [0:0] is the sub-list for extension type_name + 0, // [0:0] is the sub-list for extension extendee + 0, // [0:0] is the sub-list for field type_name +} + +func init() { file_waves_reward_share_proto_init() } +func file_waves_reward_share_proto_init() { + if File_waves_reward_share_proto != nil { + return + } + if !protoimpl.UnsafeEnabled { + file_waves_reward_share_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*RewardShare); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + } + type x struct{} + out := protoimpl.TypeBuilder{ + File: protoimpl.DescBuilder{ + GoPackagePath: reflect.TypeOf(x{}).PkgPath(), + RawDescriptor: file_waves_reward_share_proto_rawDesc, + NumEnums: 0, + NumMessages: 1, + NumExtensions: 0, + NumServices: 0, + }, + GoTypes: file_waves_reward_share_proto_goTypes, + DependencyIndexes: file_waves_reward_share_proto_depIdxs, + MessageInfos: file_waves_reward_share_proto_msgTypes, + }.Build() + File_waves_reward_share_proto = out.File + file_waves_reward_share_proto_rawDesc = nil + file_waves_reward_share_proto_goTypes = nil + file_waves_reward_share_proto_depIdxs = nil +} diff --git a/pkg/grpc/generated/waves/reward_share_vtproto.pb.go b/pkg/grpc/generated/waves/reward_share_vtproto.pb.go new file mode 100644 index 000000000..2af351a0e --- /dev/null +++ b/pkg/grpc/generated/waves/reward_share_vtproto.pb.go @@ -0,0 +1,185 @@ +// Code generated by protoc-gen-go-vtproto. DO NOT EDIT. +// protoc-gen-go-vtproto version: v0.5.0 +// source: waves/reward_share.proto + +package waves + +import ( + fmt "fmt" + protoimpl "google.golang.org/protobuf/runtime/protoimpl" + io "io" +) + +const ( + // Verify that this generated code is sufficiently up-to-date. + _ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion) + // Verify that runtime/protoimpl is sufficiently up-to-date. + _ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20) +) + +func (m *RewardShare) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *RewardShare) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *RewardShare) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + if m.Reward != 0 { + i = encodeVarint(dAtA, i, uint64(m.Reward)) + i-- + dAtA[i] = 0x10 + } + if len(m.Address) > 0 { + i -= len(m.Address) + copy(dAtA[i:], m.Address) + i = encodeVarint(dAtA, i, uint64(len(m.Address))) + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *RewardShare) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Address) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + if m.Reward != 0 { + n += 1 + sov(uint64(m.Reward)) + } + n += len(m.unknownFields) + return n +} + +func (m *RewardShare) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: RewardShare: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: RewardShare: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Address", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Address = append(m.Address[:0], dAtA[iNdEx:postIndex]...) + if m.Address == nil { + m.Address = []byte{} + } + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Reward", wireType) + } + m.Reward = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Reward |= int64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} diff --git a/pkg/grpc/generated/waves/state_snapshot.pb.go b/pkg/grpc/generated/waves/state_snapshot.pb.go new file mode 100644 index 000000000..726a882d3 --- /dev/null +++ b/pkg/grpc/generated/waves/state_snapshot.pb.go @@ -0,0 +1,243 @@ +// Code generated by protoc-gen-go. DO NOT EDIT. +// versions: +// protoc-gen-go v1.27.1 +// protoc v4.24.4 +// source: waves/state_snapshot.proto + +package waves + +import ( + protoreflect "google.golang.org/protobuf/reflect/protoreflect" + protoimpl "google.golang.org/protobuf/runtime/protoimpl" + reflect "reflect" + sync "sync" +) + +const ( + // Verify that this generated code is sufficiently up-to-date. + _ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion) + // Verify that runtime/protoimpl is sufficiently up-to-date. + _ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20) +) + +type BlockSnapshot struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + BlockId []byte `protobuf:"bytes,1,opt,name=block_id,json=blockId,proto3" json:"block_id,omitempty"` + Snapshots []*TransactionStateSnapshot `protobuf:"bytes,2,rep,name=snapshots,proto3" json:"snapshots,omitempty"` +} + +func (x *BlockSnapshot) Reset() { + *x = BlockSnapshot{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_state_snapshot_proto_msgTypes[0] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *BlockSnapshot) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*BlockSnapshot) ProtoMessage() {} + +func (x *BlockSnapshot) ProtoReflect() protoreflect.Message { + mi := &file_waves_state_snapshot_proto_msgTypes[0] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use BlockSnapshot.ProtoReflect.Descriptor instead. +func (*BlockSnapshot) Descriptor() ([]byte, []int) { + return file_waves_state_snapshot_proto_rawDescGZIP(), []int{0} +} + +func (x *BlockSnapshot) GetBlockId() []byte { + if x != nil { + return x.BlockId + } + return nil +} + +func (x *BlockSnapshot) GetSnapshots() []*TransactionStateSnapshot { + if x != nil { + return x.Snapshots + } + return nil +} + +type MicroBlockSnapshot struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + TotalBlockId []byte `protobuf:"bytes,1,opt,name=total_block_id,json=totalBlockId,proto3" json:"total_block_id,omitempty"` + Snapshots []*TransactionStateSnapshot `protobuf:"bytes,2,rep,name=snapshots,proto3" json:"snapshots,omitempty"` +} + +func (x *MicroBlockSnapshot) Reset() { + *x = MicroBlockSnapshot{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_state_snapshot_proto_msgTypes[1] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *MicroBlockSnapshot) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*MicroBlockSnapshot) ProtoMessage() {} + +func (x *MicroBlockSnapshot) ProtoReflect() protoreflect.Message { + mi := &file_waves_state_snapshot_proto_msgTypes[1] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use MicroBlockSnapshot.ProtoReflect.Descriptor instead. +func (*MicroBlockSnapshot) Descriptor() ([]byte, []int) { + return file_waves_state_snapshot_proto_rawDescGZIP(), []int{1} +} + +func (x *MicroBlockSnapshot) GetTotalBlockId() []byte { + if x != nil { + return x.TotalBlockId + } + return nil +} + +func (x *MicroBlockSnapshot) GetSnapshots() []*TransactionStateSnapshot { + if x != nil { + return x.Snapshots + } + return nil +} + +var File_waves_state_snapshot_proto protoreflect.FileDescriptor + +var file_waves_state_snapshot_proto_rawDesc = []byte{ + 0x0a, 0x1a, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x73, 0x74, 0x61, 0x74, 0x65, 0x5f, 0x73, 0x6e, + 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x05, 0x77, 0x61, + 0x76, 0x65, 0x73, 0x1a, 0x26, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x74, 0x72, 0x61, 0x6e, 0x73, + 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x73, 0x74, 0x61, 0x74, 0x65, 0x5f, 0x73, 0x6e, 0x61, + 0x70, 0x73, 0x68, 0x6f, 0x74, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0x69, 0x0a, 0x0d, 0x42, + 0x6c, 0x6f, 0x63, 0x6b, 0x53, 0x6e, 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x12, 0x19, 0x0a, 0x08, + 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, + 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x49, 0x64, 0x12, 0x3d, 0x0a, 0x09, 0x73, 0x6e, 0x61, 0x70, 0x73, + 0x68, 0x6f, 0x74, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1f, 0x2e, 0x77, 0x61, 0x76, + 0x65, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, + 0x61, 0x74, 0x65, 0x53, 0x6e, 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x52, 0x09, 0x73, 0x6e, 0x61, + 0x70, 0x73, 0x68, 0x6f, 0x74, 0x73, 0x22, 0x79, 0x0a, 0x12, 0x4d, 0x69, 0x63, 0x72, 0x6f, 0x42, + 0x6c, 0x6f, 0x63, 0x6b, 0x53, 0x6e, 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x12, 0x24, 0x0a, 0x0e, + 0x74, 0x6f, 0x74, 0x61, 0x6c, 0x5f, 0x62, 0x6c, 0x6f, 0x63, 0x6b, 0x5f, 0x69, 0x64, 0x18, 0x01, + 0x20, 0x01, 0x28, 0x0c, 0x52, 0x0c, 0x74, 0x6f, 0x74, 0x61, 0x6c, 0x42, 0x6c, 0x6f, 0x63, 0x6b, + 0x49, 0x64, 0x12, 0x3d, 0x0a, 0x09, 0x73, 0x6e, 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x73, 0x18, + 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x1f, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x54, 0x72, + 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x53, 0x6e, + 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x52, 0x09, 0x73, 0x6e, 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, + 0x73, 0x42, 0x68, 0x0a, 0x23, 0x63, 0x6f, 0x6d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, + 0x61, 0x74, 0x66, 0x6f, 0x72, 0x6d, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, + 0x73, 0x6e, 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x5a, 0x39, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, + 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, + 0x72, 0x6d, 0x2f, 0x67, 0x6f, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x70, 0x6b, 0x67, 0x2f, 0x67, + 0x72, 0x70, 0x63, 0x2f, 0x67, 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x64, 0x2f, 0x77, 0x61, + 0x76, 0x65, 0x73, 0xaa, 0x02, 0x05, 0x57, 0x61, 0x76, 0x65, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, + 0x74, 0x6f, 0x33, +} + +var ( + file_waves_state_snapshot_proto_rawDescOnce sync.Once + file_waves_state_snapshot_proto_rawDescData = file_waves_state_snapshot_proto_rawDesc +) + +func file_waves_state_snapshot_proto_rawDescGZIP() []byte { + file_waves_state_snapshot_proto_rawDescOnce.Do(func() { + file_waves_state_snapshot_proto_rawDescData = protoimpl.X.CompressGZIP(file_waves_state_snapshot_proto_rawDescData) + }) + return file_waves_state_snapshot_proto_rawDescData +} + +var file_waves_state_snapshot_proto_msgTypes = make([]protoimpl.MessageInfo, 2) +var file_waves_state_snapshot_proto_goTypes = []interface{}{ + (*BlockSnapshot)(nil), // 0: waves.BlockSnapshot + (*MicroBlockSnapshot)(nil), // 1: waves.MicroBlockSnapshot + (*TransactionStateSnapshot)(nil), // 2: waves.TransactionStateSnapshot +} +var file_waves_state_snapshot_proto_depIdxs = []int32{ + 2, // 0: waves.BlockSnapshot.snapshots:type_name -> waves.TransactionStateSnapshot + 2, // 1: waves.MicroBlockSnapshot.snapshots:type_name -> waves.TransactionStateSnapshot + 2, // [2:2] is the sub-list for method output_type + 2, // [2:2] is the sub-list for method input_type + 2, // [2:2] is the sub-list for extension type_name + 2, // [2:2] is the sub-list for extension extendee + 0, // [0:2] is the sub-list for field type_name +} + +func init() { file_waves_state_snapshot_proto_init() } +func file_waves_state_snapshot_proto_init() { + if File_waves_state_snapshot_proto != nil { + return + } + file_waves_transaction_state_snapshot_proto_init() + if !protoimpl.UnsafeEnabled { + file_waves_state_snapshot_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*BlockSnapshot); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_waves_state_snapshot_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*MicroBlockSnapshot); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + } + type x struct{} + out := protoimpl.TypeBuilder{ + File: protoimpl.DescBuilder{ + GoPackagePath: reflect.TypeOf(x{}).PkgPath(), + RawDescriptor: file_waves_state_snapshot_proto_rawDesc, + NumEnums: 0, + NumMessages: 2, + NumExtensions: 0, + NumServices: 0, + }, + GoTypes: file_waves_state_snapshot_proto_goTypes, + DependencyIndexes: file_waves_state_snapshot_proto_depIdxs, + MessageInfos: file_waves_state_snapshot_proto_msgTypes, + }.Build() + File_waves_state_snapshot_proto = out.File + file_waves_state_snapshot_proto_rawDesc = nil + file_waves_state_snapshot_proto_goTypes = nil + file_waves_state_snapshot_proto_depIdxs = nil +} diff --git a/pkg/grpc/generated/waves/state_snapshot_vtproto.pb.go b/pkg/grpc/generated/waves/state_snapshot_vtproto.pb.go new file mode 100644 index 000000000..8dac9c965 --- /dev/null +++ b/pkg/grpc/generated/waves/state_snapshot_vtproto.pb.go @@ -0,0 +1,401 @@ +// Code generated by protoc-gen-go-vtproto. DO NOT EDIT. +// protoc-gen-go-vtproto version: v0.5.0 +// source: waves/state_snapshot.proto + +package waves + +import ( + fmt "fmt" + protoimpl "google.golang.org/protobuf/runtime/protoimpl" + io "io" +) + +const ( + // Verify that this generated code is sufficiently up-to-date. + _ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion) + // Verify that runtime/protoimpl is sufficiently up-to-date. + _ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20) +) + +func (m *BlockSnapshot) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *BlockSnapshot) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *BlockSnapshot) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + if len(m.Snapshots) > 0 { + for iNdEx := len(m.Snapshots) - 1; iNdEx >= 0; iNdEx-- { + size, err := m.Snapshots[iNdEx].MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0x12 + } + } + if len(m.BlockId) > 0 { + i -= len(m.BlockId) + copy(dAtA[i:], m.BlockId) + i = encodeVarint(dAtA, i, uint64(len(m.BlockId))) + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *MicroBlockSnapshot) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *MicroBlockSnapshot) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *MicroBlockSnapshot) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + if len(m.Snapshots) > 0 { + for iNdEx := len(m.Snapshots) - 1; iNdEx >= 0; iNdEx-- { + size, err := m.Snapshots[iNdEx].MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0x12 + } + } + if len(m.TotalBlockId) > 0 { + i -= len(m.TotalBlockId) + copy(dAtA[i:], m.TotalBlockId) + i = encodeVarint(dAtA, i, uint64(len(m.TotalBlockId))) + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *BlockSnapshot) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.BlockId) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + if len(m.Snapshots) > 0 { + for _, e := range m.Snapshots { + l = e.SizeVT() + n += 1 + l + sov(uint64(l)) + } + } + n += len(m.unknownFields) + return n +} + +func (m *MicroBlockSnapshot) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.TotalBlockId) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + if len(m.Snapshots) > 0 { + for _, e := range m.Snapshots { + l = e.SizeVT() + n += 1 + l + sov(uint64(l)) + } + } + n += len(m.unknownFields) + return n +} + +func (m *BlockSnapshot) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: BlockSnapshot: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: BlockSnapshot: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field BlockId", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.BlockId = append(m.BlockId[:0], dAtA[iNdEx:postIndex]...) + if m.BlockId == nil { + m.BlockId = []byte{} + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Snapshots", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Snapshots = append(m.Snapshots, &TransactionStateSnapshot{}) + if err := m.Snapshots[len(m.Snapshots)-1].UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *MicroBlockSnapshot) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: MicroBlockSnapshot: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: MicroBlockSnapshot: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field TotalBlockId", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.TotalBlockId = append(m.TotalBlockId[:0], dAtA[iNdEx:postIndex]...) + if m.TotalBlockId == nil { + m.TotalBlockId = []byte{} + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Snapshots", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Snapshots = append(m.Snapshots, &TransactionStateSnapshot{}) + if err := m.Snapshots[len(m.Snapshots)-1].UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} diff --git a/pkg/grpc/generated/waves/transaction.pb.go b/pkg/grpc/generated/waves/transaction.pb.go index cb4bd0776..159f5439b 100644 --- a/pkg/grpc/generated/waves/transaction.pb.go +++ b/pkg/grpc/generated/waves/transaction.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: // protoc-gen-go v1.27.1 -// protoc v3.21.12 +// protoc v4.24.4 // source: waves/transaction.proto package waves diff --git a/pkg/grpc/generated/waves/transaction_state_snapshot.pb.go b/pkg/grpc/generated/waves/transaction_state_snapshot.pb.go new file mode 100644 index 000000000..5892c178c --- /dev/null +++ b/pkg/grpc/generated/waves/transaction_state_snapshot.pb.go @@ -0,0 +1,1532 @@ +// Code generated by protoc-gen-go. DO NOT EDIT. +// versions: +// protoc-gen-go v1.27.1 +// protoc v4.24.4 +// source: waves/transaction_state_snapshot.proto + +package waves + +import ( + protoreflect "google.golang.org/protobuf/reflect/protoreflect" + protoimpl "google.golang.org/protobuf/runtime/protoimpl" + reflect "reflect" + sync "sync" +) + +const ( + // Verify that this generated code is sufficiently up-to-date. + _ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion) + // Verify that runtime/protoimpl is sufficiently up-to-date. + _ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20) +) + +type TransactionStatus int32 + +const ( + TransactionStatus_SUCCEEDED TransactionStatus = 0 + TransactionStatus_FAILED TransactionStatus = 1 + TransactionStatus_ELIDED TransactionStatus = 2 +) + +// Enum value maps for TransactionStatus. +var ( + TransactionStatus_name = map[int32]string{ + 0: "SUCCEEDED", + 1: "FAILED", + 2: "ELIDED", + } + TransactionStatus_value = map[string]int32{ + "SUCCEEDED": 0, + "FAILED": 1, + "ELIDED": 2, + } +) + +func (x TransactionStatus) Enum() *TransactionStatus { + p := new(TransactionStatus) + *p = x + return p +} + +func (x TransactionStatus) String() string { + return protoimpl.X.EnumStringOf(x.Descriptor(), protoreflect.EnumNumber(x)) +} + +func (TransactionStatus) Descriptor() protoreflect.EnumDescriptor { + return file_waves_transaction_state_snapshot_proto_enumTypes[0].Descriptor() +} + +func (TransactionStatus) Type() protoreflect.EnumType { + return &file_waves_transaction_state_snapshot_proto_enumTypes[0] +} + +func (x TransactionStatus) Number() protoreflect.EnumNumber { + return protoreflect.EnumNumber(x) +} + +// Deprecated: Use TransactionStatus.Descriptor instead. +func (TransactionStatus) EnumDescriptor() ([]byte, []int) { + return file_waves_transaction_state_snapshot_proto_rawDescGZIP(), []int{0} +} + +type TransactionStateSnapshot struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + Balances []*TransactionStateSnapshot_Balance `protobuf:"bytes,1,rep,name=balances,proto3" json:"balances,omitempty"` + LeaseBalances []*TransactionStateSnapshot_LeaseBalance `protobuf:"bytes,2,rep,name=lease_balances,json=leaseBalances,proto3" json:"lease_balances,omitempty"` + AssetStatics []*TransactionStateSnapshot_AssetStatic `protobuf:"bytes,3,rep,name=asset_statics,json=assetStatics,proto3" json:"asset_statics,omitempty"` + AssetVolumes []*TransactionStateSnapshot_AssetVolume `protobuf:"bytes,4,rep,name=asset_volumes,json=assetVolumes,proto3" json:"asset_volumes,omitempty"` + AssetNamesAndDescriptions []*TransactionStateSnapshot_AssetNameAndDescription `protobuf:"bytes,5,rep,name=asset_names_and_descriptions,json=assetNamesAndDescriptions,proto3" json:"asset_names_and_descriptions,omitempty"` + AssetScripts []*TransactionStateSnapshot_AssetScript `protobuf:"bytes,6,rep,name=asset_scripts,json=assetScripts,proto3" json:"asset_scripts,omitempty"` + Aliases []*TransactionStateSnapshot_Alias `protobuf:"bytes,7,rep,name=aliases,proto3" json:"aliases,omitempty"` + OrderFills []*TransactionStateSnapshot_OrderFill `protobuf:"bytes,8,rep,name=order_fills,json=orderFills,proto3" json:"order_fills,omitempty"` + LeaseStates []*TransactionStateSnapshot_LeaseState `protobuf:"bytes,9,rep,name=lease_states,json=leaseStates,proto3" json:"lease_states,omitempty"` + AccountScripts []*TransactionStateSnapshot_AccountScript `protobuf:"bytes,10,rep,name=account_scripts,json=accountScripts,proto3" json:"account_scripts,omitempty"` + AccountData []*TransactionStateSnapshot_AccountData `protobuf:"bytes,11,rep,name=account_data,json=accountData,proto3" json:"account_data,omitempty"` + Sponsorships []*TransactionStateSnapshot_Sponsorship `protobuf:"bytes,12,rep,name=sponsorships,proto3" json:"sponsorships,omitempty"` + TransactionStatus TransactionStatus `protobuf:"varint,13,opt,name=transaction_status,json=transactionStatus,proto3,enum=waves.TransactionStatus" json:"transaction_status,omitempty"` +} + +func (x *TransactionStateSnapshot) Reset() { + *x = TransactionStateSnapshot{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[0] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *TransactionStateSnapshot) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*TransactionStateSnapshot) ProtoMessage() {} + +func (x *TransactionStateSnapshot) ProtoReflect() protoreflect.Message { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[0] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use TransactionStateSnapshot.ProtoReflect.Descriptor instead. +func (*TransactionStateSnapshot) Descriptor() ([]byte, []int) { + return file_waves_transaction_state_snapshot_proto_rawDescGZIP(), []int{0} +} + +func (x *TransactionStateSnapshot) GetBalances() []*TransactionStateSnapshot_Balance { + if x != nil { + return x.Balances + } + return nil +} + +func (x *TransactionStateSnapshot) GetLeaseBalances() []*TransactionStateSnapshot_LeaseBalance { + if x != nil { + return x.LeaseBalances + } + return nil +} + +func (x *TransactionStateSnapshot) GetAssetStatics() []*TransactionStateSnapshot_AssetStatic { + if x != nil { + return x.AssetStatics + } + return nil +} + +func (x *TransactionStateSnapshot) GetAssetVolumes() []*TransactionStateSnapshot_AssetVolume { + if x != nil { + return x.AssetVolumes + } + return nil +} + +func (x *TransactionStateSnapshot) GetAssetNamesAndDescriptions() []*TransactionStateSnapshot_AssetNameAndDescription { + if x != nil { + return x.AssetNamesAndDescriptions + } + return nil +} + +func (x *TransactionStateSnapshot) GetAssetScripts() []*TransactionStateSnapshot_AssetScript { + if x != nil { + return x.AssetScripts + } + return nil +} + +func (x *TransactionStateSnapshot) GetAliases() []*TransactionStateSnapshot_Alias { + if x != nil { + return x.Aliases + } + return nil +} + +func (x *TransactionStateSnapshot) GetOrderFills() []*TransactionStateSnapshot_OrderFill { + if x != nil { + return x.OrderFills + } + return nil +} + +func (x *TransactionStateSnapshot) GetLeaseStates() []*TransactionStateSnapshot_LeaseState { + if x != nil { + return x.LeaseStates + } + return nil +} + +func (x *TransactionStateSnapshot) GetAccountScripts() []*TransactionStateSnapshot_AccountScript { + if x != nil { + return x.AccountScripts + } + return nil +} + +func (x *TransactionStateSnapshot) GetAccountData() []*TransactionStateSnapshot_AccountData { + if x != nil { + return x.AccountData + } + return nil +} + +func (x *TransactionStateSnapshot) GetSponsorships() []*TransactionStateSnapshot_Sponsorship { + if x != nil { + return x.Sponsorships + } + return nil +} + +func (x *TransactionStateSnapshot) GetTransactionStatus() TransactionStatus { + if x != nil { + return x.TransactionStatus + } + return TransactionStatus_SUCCEEDED +} + +type TransactionStateSnapshot_Balance struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + Address []byte `protobuf:"bytes,1,opt,name=address,proto3" json:"address,omitempty"` + Amount *Amount `protobuf:"bytes,2,opt,name=amount,proto3" json:"amount,omitempty"` +} + +func (x *TransactionStateSnapshot_Balance) Reset() { + *x = TransactionStateSnapshot_Balance{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[1] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *TransactionStateSnapshot_Balance) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*TransactionStateSnapshot_Balance) ProtoMessage() {} + +func (x *TransactionStateSnapshot_Balance) ProtoReflect() protoreflect.Message { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[1] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use TransactionStateSnapshot_Balance.ProtoReflect.Descriptor instead. +func (*TransactionStateSnapshot_Balance) Descriptor() ([]byte, []int) { + return file_waves_transaction_state_snapshot_proto_rawDescGZIP(), []int{0, 0} +} + +func (x *TransactionStateSnapshot_Balance) GetAddress() []byte { + if x != nil { + return x.Address + } + return nil +} + +func (x *TransactionStateSnapshot_Balance) GetAmount() *Amount { + if x != nil { + return x.Amount + } + return nil +} + +type TransactionStateSnapshot_LeaseBalance struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + Address []byte `protobuf:"bytes,1,opt,name=address,proto3" json:"address,omitempty"` + In int64 `protobuf:"varint,2,opt,name=in,proto3" json:"in,omitempty"` + Out int64 `protobuf:"varint,3,opt,name=out,proto3" json:"out,omitempty"` +} + +func (x *TransactionStateSnapshot_LeaseBalance) Reset() { + *x = TransactionStateSnapshot_LeaseBalance{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[2] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *TransactionStateSnapshot_LeaseBalance) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*TransactionStateSnapshot_LeaseBalance) ProtoMessage() {} + +func (x *TransactionStateSnapshot_LeaseBalance) ProtoReflect() protoreflect.Message { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[2] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use TransactionStateSnapshot_LeaseBalance.ProtoReflect.Descriptor instead. +func (*TransactionStateSnapshot_LeaseBalance) Descriptor() ([]byte, []int) { + return file_waves_transaction_state_snapshot_proto_rawDescGZIP(), []int{0, 1} +} + +func (x *TransactionStateSnapshot_LeaseBalance) GetAddress() []byte { + if x != nil { + return x.Address + } + return nil +} + +func (x *TransactionStateSnapshot_LeaseBalance) GetIn() int64 { + if x != nil { + return x.In + } + return 0 +} + +func (x *TransactionStateSnapshot_LeaseBalance) GetOut() int64 { + if x != nil { + return x.Out + } + return 0 +} + +type TransactionStateSnapshot_LeaseState struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + LeaseId []byte `protobuf:"bytes,1,opt,name=lease_id,json=leaseId,proto3" json:"lease_id,omitempty"` + // Types that are assignable to Status: + // + // *TransactionStateSnapshot_LeaseState_Active_ + // *TransactionStateSnapshot_LeaseState_Cancelled_ + Status isTransactionStateSnapshot_LeaseState_Status `protobuf_oneof:"status"` +} + +func (x *TransactionStateSnapshot_LeaseState) Reset() { + *x = TransactionStateSnapshot_LeaseState{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[3] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *TransactionStateSnapshot_LeaseState) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*TransactionStateSnapshot_LeaseState) ProtoMessage() {} + +func (x *TransactionStateSnapshot_LeaseState) ProtoReflect() protoreflect.Message { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[3] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use TransactionStateSnapshot_LeaseState.ProtoReflect.Descriptor instead. +func (*TransactionStateSnapshot_LeaseState) Descriptor() ([]byte, []int) { + return file_waves_transaction_state_snapshot_proto_rawDescGZIP(), []int{0, 2} +} + +func (x *TransactionStateSnapshot_LeaseState) GetLeaseId() []byte { + if x != nil { + return x.LeaseId + } + return nil +} + +func (m *TransactionStateSnapshot_LeaseState) GetStatus() isTransactionStateSnapshot_LeaseState_Status { + if m != nil { + return m.Status + } + return nil +} + +func (x *TransactionStateSnapshot_LeaseState) GetActive() *TransactionStateSnapshot_LeaseState_Active { + if x, ok := x.GetStatus().(*TransactionStateSnapshot_LeaseState_Active_); ok { + return x.Active + } + return nil +} + +func (x *TransactionStateSnapshot_LeaseState) GetCancelled() *TransactionStateSnapshot_LeaseState_Cancelled { + if x, ok := x.GetStatus().(*TransactionStateSnapshot_LeaseState_Cancelled_); ok { + return x.Cancelled + } + return nil +} + +type isTransactionStateSnapshot_LeaseState_Status interface { + isTransactionStateSnapshot_LeaseState_Status() +} + +type TransactionStateSnapshot_LeaseState_Active_ struct { + Active *TransactionStateSnapshot_LeaseState_Active `protobuf:"bytes,21,opt,name=active,proto3,oneof"` +} + +type TransactionStateSnapshot_LeaseState_Cancelled_ struct { + Cancelled *TransactionStateSnapshot_LeaseState_Cancelled `protobuf:"bytes,22,opt,name=cancelled,proto3,oneof"` +} + +func (*TransactionStateSnapshot_LeaseState_Active_) isTransactionStateSnapshot_LeaseState_Status() {} + +func (*TransactionStateSnapshot_LeaseState_Cancelled_) isTransactionStateSnapshot_LeaseState_Status() { +} + +type TransactionStateSnapshot_AssetStatic struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + AssetId []byte `protobuf:"bytes,1,opt,name=asset_id,json=assetId,proto3" json:"asset_id,omitempty"` + SourceTransactionId []byte `protobuf:"bytes,2,opt,name=source_transaction_id,json=sourceTransactionId,proto3" json:"source_transaction_id,omitempty"` + IssuerPublicKey []byte `protobuf:"bytes,3,opt,name=issuer_public_key,json=issuerPublicKey,proto3" json:"issuer_public_key,omitempty"` + Decimals int32 `protobuf:"varint,4,opt,name=decimals,proto3" json:"decimals,omitempty"` + Nft bool `protobuf:"varint,5,opt,name=nft,proto3" json:"nft,omitempty"` +} + +func (x *TransactionStateSnapshot_AssetStatic) Reset() { + *x = TransactionStateSnapshot_AssetStatic{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[4] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *TransactionStateSnapshot_AssetStatic) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*TransactionStateSnapshot_AssetStatic) ProtoMessage() {} + +func (x *TransactionStateSnapshot_AssetStatic) ProtoReflect() protoreflect.Message { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[4] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use TransactionStateSnapshot_AssetStatic.ProtoReflect.Descriptor instead. +func (*TransactionStateSnapshot_AssetStatic) Descriptor() ([]byte, []int) { + return file_waves_transaction_state_snapshot_proto_rawDescGZIP(), []int{0, 3} +} + +func (x *TransactionStateSnapshot_AssetStatic) GetAssetId() []byte { + if x != nil { + return x.AssetId + } + return nil +} + +func (x *TransactionStateSnapshot_AssetStatic) GetSourceTransactionId() []byte { + if x != nil { + return x.SourceTransactionId + } + return nil +} + +func (x *TransactionStateSnapshot_AssetStatic) GetIssuerPublicKey() []byte { + if x != nil { + return x.IssuerPublicKey + } + return nil +} + +func (x *TransactionStateSnapshot_AssetStatic) GetDecimals() int32 { + if x != nil { + return x.Decimals + } + return 0 +} + +func (x *TransactionStateSnapshot_AssetStatic) GetNft() bool { + if x != nil { + return x.Nft + } + return false +} + +type TransactionStateSnapshot_AssetVolume struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + AssetId []byte `protobuf:"bytes,1,opt,name=asset_id,json=assetId,proto3" json:"asset_id,omitempty"` + Reissuable bool `protobuf:"varint,2,opt,name=reissuable,proto3" json:"reissuable,omitempty"` + Volume []byte `protobuf:"bytes,3,opt,name=volume,proto3" json:"volume,omitempty"` +} + +func (x *TransactionStateSnapshot_AssetVolume) Reset() { + *x = TransactionStateSnapshot_AssetVolume{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[5] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *TransactionStateSnapshot_AssetVolume) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*TransactionStateSnapshot_AssetVolume) ProtoMessage() {} + +func (x *TransactionStateSnapshot_AssetVolume) ProtoReflect() protoreflect.Message { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[5] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use TransactionStateSnapshot_AssetVolume.ProtoReflect.Descriptor instead. +func (*TransactionStateSnapshot_AssetVolume) Descriptor() ([]byte, []int) { + return file_waves_transaction_state_snapshot_proto_rawDescGZIP(), []int{0, 4} +} + +func (x *TransactionStateSnapshot_AssetVolume) GetAssetId() []byte { + if x != nil { + return x.AssetId + } + return nil +} + +func (x *TransactionStateSnapshot_AssetVolume) GetReissuable() bool { + if x != nil { + return x.Reissuable + } + return false +} + +func (x *TransactionStateSnapshot_AssetVolume) GetVolume() []byte { + if x != nil { + return x.Volume + } + return nil +} + +type TransactionStateSnapshot_AssetNameAndDescription struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + AssetId []byte `protobuf:"bytes,1,opt,name=asset_id,json=assetId,proto3" json:"asset_id,omitempty"` + Name string `protobuf:"bytes,2,opt,name=name,proto3" json:"name,omitempty"` + Description string `protobuf:"bytes,3,opt,name=description,proto3" json:"description,omitempty"` + LastUpdated int32 `protobuf:"varint,4,opt,name=last_updated,json=lastUpdated,proto3" json:"last_updated,omitempty"` +} + +func (x *TransactionStateSnapshot_AssetNameAndDescription) Reset() { + *x = TransactionStateSnapshot_AssetNameAndDescription{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[6] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *TransactionStateSnapshot_AssetNameAndDescription) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*TransactionStateSnapshot_AssetNameAndDescription) ProtoMessage() {} + +func (x *TransactionStateSnapshot_AssetNameAndDescription) ProtoReflect() protoreflect.Message { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[6] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use TransactionStateSnapshot_AssetNameAndDescription.ProtoReflect.Descriptor instead. +func (*TransactionStateSnapshot_AssetNameAndDescription) Descriptor() ([]byte, []int) { + return file_waves_transaction_state_snapshot_proto_rawDescGZIP(), []int{0, 5} +} + +func (x *TransactionStateSnapshot_AssetNameAndDescription) GetAssetId() []byte { + if x != nil { + return x.AssetId + } + return nil +} + +func (x *TransactionStateSnapshot_AssetNameAndDescription) GetName() string { + if x != nil { + return x.Name + } + return "" +} + +func (x *TransactionStateSnapshot_AssetNameAndDescription) GetDescription() string { + if x != nil { + return x.Description + } + return "" +} + +func (x *TransactionStateSnapshot_AssetNameAndDescription) GetLastUpdated() int32 { + if x != nil { + return x.LastUpdated + } + return 0 +} + +type TransactionStateSnapshot_AssetScript struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + AssetId []byte `protobuf:"bytes,1,opt,name=asset_id,json=assetId,proto3" json:"asset_id,omitempty"` + Script []byte `protobuf:"bytes,2,opt,name=script,proto3" json:"script,omitempty"` +} + +func (x *TransactionStateSnapshot_AssetScript) Reset() { + *x = TransactionStateSnapshot_AssetScript{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[7] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *TransactionStateSnapshot_AssetScript) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*TransactionStateSnapshot_AssetScript) ProtoMessage() {} + +func (x *TransactionStateSnapshot_AssetScript) ProtoReflect() protoreflect.Message { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[7] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use TransactionStateSnapshot_AssetScript.ProtoReflect.Descriptor instead. +func (*TransactionStateSnapshot_AssetScript) Descriptor() ([]byte, []int) { + return file_waves_transaction_state_snapshot_proto_rawDescGZIP(), []int{0, 6} +} + +func (x *TransactionStateSnapshot_AssetScript) GetAssetId() []byte { + if x != nil { + return x.AssetId + } + return nil +} + +func (x *TransactionStateSnapshot_AssetScript) GetScript() []byte { + if x != nil { + return x.Script + } + return nil +} + +type TransactionStateSnapshot_Alias struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + Address []byte `protobuf:"bytes,1,opt,name=address,proto3" json:"address,omitempty"` + Alias string `protobuf:"bytes,2,opt,name=alias,proto3" json:"alias,omitempty"` +} + +func (x *TransactionStateSnapshot_Alias) Reset() { + *x = TransactionStateSnapshot_Alias{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[8] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *TransactionStateSnapshot_Alias) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*TransactionStateSnapshot_Alias) ProtoMessage() {} + +func (x *TransactionStateSnapshot_Alias) ProtoReflect() protoreflect.Message { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[8] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use TransactionStateSnapshot_Alias.ProtoReflect.Descriptor instead. +func (*TransactionStateSnapshot_Alias) Descriptor() ([]byte, []int) { + return file_waves_transaction_state_snapshot_proto_rawDescGZIP(), []int{0, 7} +} + +func (x *TransactionStateSnapshot_Alias) GetAddress() []byte { + if x != nil { + return x.Address + } + return nil +} + +func (x *TransactionStateSnapshot_Alias) GetAlias() string { + if x != nil { + return x.Alias + } + return "" +} + +type TransactionStateSnapshot_OrderFill struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + OrderId []byte `protobuf:"bytes,1,opt,name=order_id,json=orderId,proto3" json:"order_id,omitempty"` + Volume int64 `protobuf:"varint,2,opt,name=volume,proto3" json:"volume,omitempty"` + Fee int64 `protobuf:"varint,3,opt,name=fee,proto3" json:"fee,omitempty"` +} + +func (x *TransactionStateSnapshot_OrderFill) Reset() { + *x = TransactionStateSnapshot_OrderFill{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[9] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *TransactionStateSnapshot_OrderFill) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*TransactionStateSnapshot_OrderFill) ProtoMessage() {} + +func (x *TransactionStateSnapshot_OrderFill) ProtoReflect() protoreflect.Message { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[9] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use TransactionStateSnapshot_OrderFill.ProtoReflect.Descriptor instead. +func (*TransactionStateSnapshot_OrderFill) Descriptor() ([]byte, []int) { + return file_waves_transaction_state_snapshot_proto_rawDescGZIP(), []int{0, 8} +} + +func (x *TransactionStateSnapshot_OrderFill) GetOrderId() []byte { + if x != nil { + return x.OrderId + } + return nil +} + +func (x *TransactionStateSnapshot_OrderFill) GetVolume() int64 { + if x != nil { + return x.Volume + } + return 0 +} + +func (x *TransactionStateSnapshot_OrderFill) GetFee() int64 { + if x != nil { + return x.Fee + } + return 0 +} + +type TransactionStateSnapshot_AccountScript struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + SenderPublicKey []byte `protobuf:"bytes,1,opt,name=sender_public_key,json=senderPublicKey,proto3" json:"sender_public_key,omitempty"` + Script []byte `protobuf:"bytes,2,opt,name=script,proto3" json:"script,omitempty"` + VerifierComplexity int64 `protobuf:"varint,3,opt,name=verifier_complexity,json=verifierComplexity,proto3" json:"verifier_complexity,omitempty"` +} + +func (x *TransactionStateSnapshot_AccountScript) Reset() { + *x = TransactionStateSnapshot_AccountScript{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[10] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *TransactionStateSnapshot_AccountScript) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*TransactionStateSnapshot_AccountScript) ProtoMessage() {} + +func (x *TransactionStateSnapshot_AccountScript) ProtoReflect() protoreflect.Message { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[10] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use TransactionStateSnapshot_AccountScript.ProtoReflect.Descriptor instead. +func (*TransactionStateSnapshot_AccountScript) Descriptor() ([]byte, []int) { + return file_waves_transaction_state_snapshot_proto_rawDescGZIP(), []int{0, 9} +} + +func (x *TransactionStateSnapshot_AccountScript) GetSenderPublicKey() []byte { + if x != nil { + return x.SenderPublicKey + } + return nil +} + +func (x *TransactionStateSnapshot_AccountScript) GetScript() []byte { + if x != nil { + return x.Script + } + return nil +} + +func (x *TransactionStateSnapshot_AccountScript) GetVerifierComplexity() int64 { + if x != nil { + return x.VerifierComplexity + } + return 0 +} + +type TransactionStateSnapshot_AccountData struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + Address []byte `protobuf:"bytes,1,opt,name=address,proto3" json:"address,omitempty"` + Entries []*DataTransactionData_DataEntry `protobuf:"bytes,2,rep,name=entries,proto3" json:"entries,omitempty"` +} + +func (x *TransactionStateSnapshot_AccountData) Reset() { + *x = TransactionStateSnapshot_AccountData{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[11] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *TransactionStateSnapshot_AccountData) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*TransactionStateSnapshot_AccountData) ProtoMessage() {} + +func (x *TransactionStateSnapshot_AccountData) ProtoReflect() protoreflect.Message { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[11] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use TransactionStateSnapshot_AccountData.ProtoReflect.Descriptor instead. +func (*TransactionStateSnapshot_AccountData) Descriptor() ([]byte, []int) { + return file_waves_transaction_state_snapshot_proto_rawDescGZIP(), []int{0, 10} +} + +func (x *TransactionStateSnapshot_AccountData) GetAddress() []byte { + if x != nil { + return x.Address + } + return nil +} + +func (x *TransactionStateSnapshot_AccountData) GetEntries() []*DataTransactionData_DataEntry { + if x != nil { + return x.Entries + } + return nil +} + +type TransactionStateSnapshot_Sponsorship struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + AssetId []byte `protobuf:"bytes,1,opt,name=asset_id,json=assetId,proto3" json:"asset_id,omitempty"` + MinFee int64 `protobuf:"varint,2,opt,name=min_fee,json=minFee,proto3" json:"min_fee,omitempty"` +} + +func (x *TransactionStateSnapshot_Sponsorship) Reset() { + *x = TransactionStateSnapshot_Sponsorship{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[12] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *TransactionStateSnapshot_Sponsorship) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*TransactionStateSnapshot_Sponsorship) ProtoMessage() {} + +func (x *TransactionStateSnapshot_Sponsorship) ProtoReflect() protoreflect.Message { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[12] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use TransactionStateSnapshot_Sponsorship.ProtoReflect.Descriptor instead. +func (*TransactionStateSnapshot_Sponsorship) Descriptor() ([]byte, []int) { + return file_waves_transaction_state_snapshot_proto_rawDescGZIP(), []int{0, 11} +} + +func (x *TransactionStateSnapshot_Sponsorship) GetAssetId() []byte { + if x != nil { + return x.AssetId + } + return nil +} + +func (x *TransactionStateSnapshot_Sponsorship) GetMinFee() int64 { + if x != nil { + return x.MinFee + } + return 0 +} + +type TransactionStateSnapshot_LeaseState_Active struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields + + Amount int64 `protobuf:"varint,1,opt,name=amount,proto3" json:"amount,omitempty"` + Sender []byte `protobuf:"bytes,2,opt,name=sender,proto3" json:"sender,omitempty"` + Recipient []byte `protobuf:"bytes,3,opt,name=recipient,proto3" json:"recipient,omitempty"` +} + +func (x *TransactionStateSnapshot_LeaseState_Active) Reset() { + *x = TransactionStateSnapshot_LeaseState_Active{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[13] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *TransactionStateSnapshot_LeaseState_Active) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*TransactionStateSnapshot_LeaseState_Active) ProtoMessage() {} + +func (x *TransactionStateSnapshot_LeaseState_Active) ProtoReflect() protoreflect.Message { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[13] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use TransactionStateSnapshot_LeaseState_Active.ProtoReflect.Descriptor instead. +func (*TransactionStateSnapshot_LeaseState_Active) Descriptor() ([]byte, []int) { + return file_waves_transaction_state_snapshot_proto_rawDescGZIP(), []int{0, 2, 0} +} + +func (x *TransactionStateSnapshot_LeaseState_Active) GetAmount() int64 { + if x != nil { + return x.Amount + } + return 0 +} + +func (x *TransactionStateSnapshot_LeaseState_Active) GetSender() []byte { + if x != nil { + return x.Sender + } + return nil +} + +func (x *TransactionStateSnapshot_LeaseState_Active) GetRecipient() []byte { + if x != nil { + return x.Recipient + } + return nil +} + +type TransactionStateSnapshot_LeaseState_Cancelled struct { + state protoimpl.MessageState + sizeCache protoimpl.SizeCache + unknownFields protoimpl.UnknownFields +} + +func (x *TransactionStateSnapshot_LeaseState_Cancelled) Reset() { + *x = TransactionStateSnapshot_LeaseState_Cancelled{} + if protoimpl.UnsafeEnabled { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[14] + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + ms.StoreMessageInfo(mi) + } +} + +func (x *TransactionStateSnapshot_LeaseState_Cancelled) String() string { + return protoimpl.X.MessageStringOf(x) +} + +func (*TransactionStateSnapshot_LeaseState_Cancelled) ProtoMessage() {} + +func (x *TransactionStateSnapshot_LeaseState_Cancelled) ProtoReflect() protoreflect.Message { + mi := &file_waves_transaction_state_snapshot_proto_msgTypes[14] + if protoimpl.UnsafeEnabled && x != nil { + ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x)) + if ms.LoadMessageInfo() == nil { + ms.StoreMessageInfo(mi) + } + return ms + } + return mi.MessageOf(x) +} + +// Deprecated: Use TransactionStateSnapshot_LeaseState_Cancelled.ProtoReflect.Descriptor instead. +func (*TransactionStateSnapshot_LeaseState_Cancelled) Descriptor() ([]byte, []int) { + return file_waves_transaction_state_snapshot_proto_rawDescGZIP(), []int{0, 2, 1} +} + +var File_waves_transaction_state_snapshot_proto protoreflect.FileDescriptor + +var file_waves_transaction_state_snapshot_proto_rawDesc = []byte{ + 0x0a, 0x26, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, + 0x69, 0x6f, 0x6e, 0x5f, 0x73, 0x74, 0x61, 0x74, 0x65, 0x5f, 0x73, 0x6e, 0x61, 0x70, 0x73, 0x68, + 0x6f, 0x74, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x05, 0x77, 0x61, 0x76, 0x65, 0x73, 0x1a, + 0x12, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x2e, 0x70, 0x72, + 0x6f, 0x74, 0x6f, 0x1a, 0x17, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x74, 0x72, 0x61, 0x6e, 0x73, + 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0xc1, 0x13, 0x0a, + 0x18, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x61, 0x74, + 0x65, 0x53, 0x6e, 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x12, 0x43, 0x0a, 0x08, 0x62, 0x61, 0x6c, + 0x61, 0x6e, 0x63, 0x65, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x27, 0x2e, 0x77, 0x61, + 0x76, 0x65, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x53, + 0x74, 0x61, 0x74, 0x65, 0x53, 0x6e, 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x2e, 0x42, 0x61, 0x6c, + 0x61, 0x6e, 0x63, 0x65, 0x52, 0x08, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x65, 0x73, 0x12, 0x53, + 0x0a, 0x0e, 0x6c, 0x65, 0x61, 0x73, 0x65, 0x5f, 0x62, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x65, 0x73, + 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x2c, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x54, + 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x53, + 0x6e, 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x2e, 0x4c, 0x65, 0x61, 0x73, 0x65, 0x42, 0x61, 0x6c, + 0x61, 0x6e, 0x63, 0x65, 0x52, 0x0d, 0x6c, 0x65, 0x61, 0x73, 0x65, 0x42, 0x61, 0x6c, 0x61, 0x6e, + 0x63, 0x65, 0x73, 0x12, 0x50, 0x0a, 0x0d, 0x61, 0x73, 0x73, 0x65, 0x74, 0x5f, 0x73, 0x74, 0x61, + 0x74, 0x69, 0x63, 0x73, 0x18, 0x03, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x2b, 0x2e, 0x77, 0x61, 0x76, + 0x65, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, + 0x61, 0x74, 0x65, 0x53, 0x6e, 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x2e, 0x41, 0x73, 0x73, 0x65, + 0x74, 0x53, 0x74, 0x61, 0x74, 0x69, 0x63, 0x52, 0x0c, 0x61, 0x73, 0x73, 0x65, 0x74, 0x53, 0x74, + 0x61, 0x74, 0x69, 0x63, 0x73, 0x12, 0x50, 0x0a, 0x0d, 0x61, 0x73, 0x73, 0x65, 0x74, 0x5f, 0x76, + 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x73, 0x18, 0x04, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x2b, 0x2e, 0x77, + 0x61, 0x76, 0x65, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, + 0x53, 0x74, 0x61, 0x74, 0x65, 0x53, 0x6e, 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x2e, 0x41, 0x73, + 0x73, 0x65, 0x74, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x52, 0x0c, 0x61, 0x73, 0x73, 0x65, 0x74, + 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x73, 0x12, 0x78, 0x0a, 0x1c, 0x61, 0x73, 0x73, 0x65, 0x74, + 0x5f, 0x6e, 0x61, 0x6d, 0x65, 0x73, 0x5f, 0x61, 0x6e, 0x64, 0x5f, 0x64, 0x65, 0x73, 0x63, 0x72, + 0x69, 0x70, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x18, 0x05, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x37, 0x2e, + 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, + 0x6e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x53, 0x6e, 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x2e, 0x41, + 0x73, 0x73, 0x65, 0x74, 0x4e, 0x61, 0x6d, 0x65, 0x41, 0x6e, 0x64, 0x44, 0x65, 0x73, 0x63, 0x72, + 0x69, 0x70, 0x74, 0x69, 0x6f, 0x6e, 0x52, 0x19, 0x61, 0x73, 0x73, 0x65, 0x74, 0x4e, 0x61, 0x6d, + 0x65, 0x73, 0x41, 0x6e, 0x64, 0x44, 0x65, 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, 0x69, 0x6f, 0x6e, + 0x73, 0x12, 0x50, 0x0a, 0x0d, 0x61, 0x73, 0x73, 0x65, 0x74, 0x5f, 0x73, 0x63, 0x72, 0x69, 0x70, + 0x74, 0x73, 0x18, 0x06, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x2b, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, + 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x61, 0x74, + 0x65, 0x53, 0x6e, 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x2e, 0x41, 0x73, 0x73, 0x65, 0x74, 0x53, + 0x63, 0x72, 0x69, 0x70, 0x74, 0x52, 0x0c, 0x61, 0x73, 0x73, 0x65, 0x74, 0x53, 0x63, 0x72, 0x69, + 0x70, 0x74, 0x73, 0x12, 0x3f, 0x0a, 0x07, 0x61, 0x6c, 0x69, 0x61, 0x73, 0x65, 0x73, 0x18, 0x07, + 0x20, 0x03, 0x28, 0x0b, 0x32, 0x25, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x54, 0x72, 0x61, + 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x53, 0x6e, 0x61, + 0x70, 0x73, 0x68, 0x6f, 0x74, 0x2e, 0x41, 0x6c, 0x69, 0x61, 0x73, 0x52, 0x07, 0x61, 0x6c, 0x69, + 0x61, 0x73, 0x65, 0x73, 0x12, 0x4a, 0x0a, 0x0b, 0x6f, 0x72, 0x64, 0x65, 0x72, 0x5f, 0x66, 0x69, + 0x6c, 0x6c, 0x73, 0x18, 0x08, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x29, 0x2e, 0x77, 0x61, 0x76, 0x65, + 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x61, + 0x74, 0x65, 0x53, 0x6e, 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x2e, 0x4f, 0x72, 0x64, 0x65, 0x72, + 0x46, 0x69, 0x6c, 0x6c, 0x52, 0x0a, 0x6f, 0x72, 0x64, 0x65, 0x72, 0x46, 0x69, 0x6c, 0x6c, 0x73, + 0x12, 0x4d, 0x0a, 0x0c, 0x6c, 0x65, 0x61, 0x73, 0x65, 0x5f, 0x73, 0x74, 0x61, 0x74, 0x65, 0x73, + 0x18, 0x09, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x2a, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x54, + 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x53, + 0x6e, 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x2e, 0x4c, 0x65, 0x61, 0x73, 0x65, 0x53, 0x74, 0x61, + 0x74, 0x65, 0x52, 0x0b, 0x6c, 0x65, 0x61, 0x73, 0x65, 0x53, 0x74, 0x61, 0x74, 0x65, 0x73, 0x12, + 0x56, 0x0a, 0x0f, 0x61, 0x63, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x5f, 0x73, 0x63, 0x72, 0x69, 0x70, + 0x74, 0x73, 0x18, 0x0a, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x2d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, + 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x61, 0x74, + 0x65, 0x53, 0x6e, 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x2e, 0x41, 0x63, 0x63, 0x6f, 0x75, 0x6e, + 0x74, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x52, 0x0e, 0x61, 0x63, 0x63, 0x6f, 0x75, 0x6e, 0x74, + 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x73, 0x12, 0x4e, 0x0a, 0x0c, 0x61, 0x63, 0x63, 0x6f, 0x75, + 0x6e, 0x74, 0x5f, 0x64, 0x61, 0x74, 0x61, 0x18, 0x0b, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x2b, 0x2e, + 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, + 0x6e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x53, 0x6e, 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x2e, 0x41, + 0x63, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x44, 0x61, 0x74, 0x61, 0x52, 0x0b, 0x61, 0x63, 0x63, 0x6f, + 0x75, 0x6e, 0x74, 0x44, 0x61, 0x74, 0x61, 0x12, 0x4f, 0x0a, 0x0c, 0x73, 0x70, 0x6f, 0x6e, 0x73, + 0x6f, 0x72, 0x73, 0x68, 0x69, 0x70, 0x73, 0x18, 0x0c, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x2b, 0x2e, + 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, + 0x6e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x53, 0x6e, 0x61, 0x70, 0x73, 0x68, 0x6f, 0x74, 0x2e, 0x53, + 0x70, 0x6f, 0x6e, 0x73, 0x6f, 0x72, 0x73, 0x68, 0x69, 0x70, 0x52, 0x0c, 0x73, 0x70, 0x6f, 0x6e, + 0x73, 0x6f, 0x72, 0x73, 0x68, 0x69, 0x70, 0x73, 0x12, 0x47, 0x0a, 0x12, 0x74, 0x72, 0x61, 0x6e, + 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x73, 0x74, 0x61, 0x74, 0x75, 0x73, 0x18, 0x0d, + 0x20, 0x01, 0x28, 0x0e, 0x32, 0x18, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x54, 0x72, 0x61, + 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x61, 0x74, 0x75, 0x73, 0x52, 0x11, + 0x74, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x61, 0x74, 0x75, + 0x73, 0x1a, 0x4a, 0x0a, 0x07, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x65, 0x12, 0x18, 0x0a, 0x07, + 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x61, + 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x25, 0x0a, 0x06, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, + 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x0d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x41, + 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x52, 0x06, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x1a, 0x4a, 0x0a, + 0x0c, 0x4c, 0x65, 0x61, 0x73, 0x65, 0x42, 0x61, 0x6c, 0x61, 0x6e, 0x63, 0x65, 0x12, 0x18, 0x0a, + 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, + 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x6e, 0x18, 0x02, 0x20, + 0x01, 0x28, 0x03, 0x52, 0x02, 0x69, 0x6e, 0x12, 0x10, 0x0a, 0x03, 0x6f, 0x75, 0x74, 0x18, 0x03, + 0x20, 0x01, 0x28, 0x03, 0x52, 0x03, 0x6f, 0x75, 0x74, 0x1a, 0xb9, 0x02, 0x0a, 0x0a, 0x4c, 0x65, + 0x61, 0x73, 0x65, 0x53, 0x74, 0x61, 0x74, 0x65, 0x12, 0x19, 0x0a, 0x08, 0x6c, 0x65, 0x61, 0x73, + 0x65, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x6c, 0x65, 0x61, 0x73, + 0x65, 0x49, 0x64, 0x12, 0x4b, 0x0a, 0x06, 0x61, 0x63, 0x74, 0x69, 0x76, 0x65, 0x18, 0x15, 0x20, + 0x01, 0x28, 0x0b, 0x32, 0x31, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, + 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x53, 0x6e, 0x61, 0x70, + 0x73, 0x68, 0x6f, 0x74, 0x2e, 0x4c, 0x65, 0x61, 0x73, 0x65, 0x53, 0x74, 0x61, 0x74, 0x65, 0x2e, + 0x41, 0x63, 0x74, 0x69, 0x76, 0x65, 0x48, 0x00, 0x52, 0x06, 0x61, 0x63, 0x74, 0x69, 0x76, 0x65, + 0x12, 0x54, 0x0a, 0x09, 0x63, 0x61, 0x6e, 0x63, 0x65, 0x6c, 0x6c, 0x65, 0x64, 0x18, 0x16, 0x20, + 0x01, 0x28, 0x0b, 0x32, 0x34, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x54, 0x72, 0x61, 0x6e, + 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x53, 0x74, 0x61, 0x74, 0x65, 0x53, 0x6e, 0x61, 0x70, + 0x73, 0x68, 0x6f, 0x74, 0x2e, 0x4c, 0x65, 0x61, 0x73, 0x65, 0x53, 0x74, 0x61, 0x74, 0x65, 0x2e, + 0x43, 0x61, 0x6e, 0x63, 0x65, 0x6c, 0x6c, 0x65, 0x64, 0x48, 0x00, 0x52, 0x09, 0x63, 0x61, 0x6e, + 0x63, 0x65, 0x6c, 0x6c, 0x65, 0x64, 0x1a, 0x56, 0x0a, 0x06, 0x41, 0x63, 0x74, 0x69, 0x76, 0x65, + 0x12, 0x16, 0x0a, 0x06, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, + 0x52, 0x06, 0x61, 0x6d, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x16, 0x0a, 0x06, 0x73, 0x65, 0x6e, 0x64, + 0x65, 0x72, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x06, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, + 0x12, 0x1c, 0x0a, 0x09, 0x72, 0x65, 0x63, 0x69, 0x70, 0x69, 0x65, 0x6e, 0x74, 0x18, 0x03, 0x20, + 0x01, 0x28, 0x0c, 0x52, 0x09, 0x72, 0x65, 0x63, 0x69, 0x70, 0x69, 0x65, 0x6e, 0x74, 0x1a, 0x0b, + 0x0a, 0x09, 0x43, 0x61, 0x6e, 0x63, 0x65, 0x6c, 0x6c, 0x65, 0x64, 0x42, 0x08, 0x0a, 0x06, 0x73, + 0x74, 0x61, 0x74, 0x75, 0x73, 0x1a, 0xb6, 0x01, 0x0a, 0x0b, 0x41, 0x73, 0x73, 0x65, 0x74, 0x53, + 0x74, 0x61, 0x74, 0x69, 0x63, 0x12, 0x19, 0x0a, 0x08, 0x61, 0x73, 0x73, 0x65, 0x74, 0x5f, 0x69, + 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x61, 0x73, 0x73, 0x65, 0x74, 0x49, 0x64, + 0x12, 0x32, 0x0a, 0x15, 0x73, 0x6f, 0x75, 0x72, 0x63, 0x65, 0x5f, 0x74, 0x72, 0x61, 0x6e, 0x73, + 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x5f, 0x69, 0x64, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0c, 0x52, + 0x13, 0x73, 0x6f, 0x75, 0x72, 0x63, 0x65, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, + 0x6f, 0x6e, 0x49, 0x64, 0x12, 0x2a, 0x0a, 0x11, 0x69, 0x73, 0x73, 0x75, 0x65, 0x72, 0x5f, 0x70, + 0x75, 0x62, 0x6c, 0x69, 0x63, 0x5f, 0x6b, 0x65, 0x79, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0c, 0x52, + 0x0f, 0x69, 0x73, 0x73, 0x75, 0x65, 0x72, 0x50, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x4b, 0x65, 0x79, + 0x12, 0x1a, 0x0a, 0x08, 0x64, 0x65, 0x63, 0x69, 0x6d, 0x61, 0x6c, 0x73, 0x18, 0x04, 0x20, 0x01, + 0x28, 0x05, 0x52, 0x08, 0x64, 0x65, 0x63, 0x69, 0x6d, 0x61, 0x6c, 0x73, 0x12, 0x10, 0x0a, 0x03, + 0x6e, 0x66, 0x74, 0x18, 0x05, 0x20, 0x01, 0x28, 0x08, 0x52, 0x03, 0x6e, 0x66, 0x74, 0x1a, 0x60, + 0x0a, 0x0b, 0x41, 0x73, 0x73, 0x65, 0x74, 0x56, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x12, 0x19, 0x0a, + 0x08, 0x61, 0x73, 0x73, 0x65, 0x74, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, + 0x07, 0x61, 0x73, 0x73, 0x65, 0x74, 0x49, 0x64, 0x12, 0x1e, 0x0a, 0x0a, 0x72, 0x65, 0x69, 0x73, + 0x73, 0x75, 0x61, 0x62, 0x6c, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x08, 0x52, 0x0a, 0x72, 0x65, + 0x69, 0x73, 0x73, 0x75, 0x61, 0x62, 0x6c, 0x65, 0x12, 0x16, 0x0a, 0x06, 0x76, 0x6f, 0x6c, 0x75, + 0x6d, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x06, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, + 0x1a, 0x8d, 0x01, 0x0a, 0x17, 0x41, 0x73, 0x73, 0x65, 0x74, 0x4e, 0x61, 0x6d, 0x65, 0x41, 0x6e, + 0x64, 0x44, 0x65, 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x19, 0x0a, 0x08, + 0x61, 0x73, 0x73, 0x65, 0x74, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, + 0x61, 0x73, 0x73, 0x65, 0x74, 0x49, 0x64, 0x12, 0x12, 0x0a, 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x18, + 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x12, 0x20, 0x0a, 0x0b, 0x64, + 0x65, 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, 0x69, 0x6f, 0x6e, 0x18, 0x03, 0x20, 0x01, 0x28, 0x09, + 0x52, 0x0b, 0x64, 0x65, 0x73, 0x63, 0x72, 0x69, 0x70, 0x74, 0x69, 0x6f, 0x6e, 0x12, 0x21, 0x0a, + 0x0c, 0x6c, 0x61, 0x73, 0x74, 0x5f, 0x75, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, 0x18, 0x04, 0x20, + 0x01, 0x28, 0x05, 0x52, 0x0b, 0x6c, 0x61, 0x73, 0x74, 0x55, 0x70, 0x64, 0x61, 0x74, 0x65, 0x64, + 0x1a, 0x40, 0x0a, 0x0b, 0x41, 0x73, 0x73, 0x65, 0x74, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x12, + 0x19, 0x0a, 0x08, 0x61, 0x73, 0x73, 0x65, 0x74, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, + 0x0c, 0x52, 0x07, 0x61, 0x73, 0x73, 0x65, 0x74, 0x49, 0x64, 0x12, 0x16, 0x0a, 0x06, 0x73, 0x63, + 0x72, 0x69, 0x70, 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x06, 0x73, 0x63, 0x72, 0x69, + 0x70, 0x74, 0x1a, 0x37, 0x0a, 0x05, 0x41, 0x6c, 0x69, 0x61, 0x73, 0x12, 0x18, 0x0a, 0x07, 0x61, + 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x61, 0x64, + 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x14, 0x0a, 0x05, 0x61, 0x6c, 0x69, 0x61, 0x73, 0x18, 0x02, + 0x20, 0x01, 0x28, 0x09, 0x52, 0x05, 0x61, 0x6c, 0x69, 0x61, 0x73, 0x1a, 0x50, 0x0a, 0x09, 0x4f, + 0x72, 0x64, 0x65, 0x72, 0x46, 0x69, 0x6c, 0x6c, 0x12, 0x19, 0x0a, 0x08, 0x6f, 0x72, 0x64, 0x65, + 0x72, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x6f, 0x72, 0x64, 0x65, + 0x72, 0x49, 0x64, 0x12, 0x16, 0x0a, 0x06, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x18, 0x02, 0x20, + 0x01, 0x28, 0x03, 0x52, 0x06, 0x76, 0x6f, 0x6c, 0x75, 0x6d, 0x65, 0x12, 0x10, 0x0a, 0x03, 0x66, + 0x65, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x03, 0x52, 0x03, 0x66, 0x65, 0x65, 0x1a, 0x84, 0x01, + 0x0a, 0x0d, 0x41, 0x63, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x53, 0x63, 0x72, 0x69, 0x70, 0x74, 0x12, + 0x2a, 0x0a, 0x11, 0x73, 0x65, 0x6e, 0x64, 0x65, 0x72, 0x5f, 0x70, 0x75, 0x62, 0x6c, 0x69, 0x63, + 0x5f, 0x6b, 0x65, 0x79, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x0f, 0x73, 0x65, 0x6e, 0x64, + 0x65, 0x72, 0x50, 0x75, 0x62, 0x6c, 0x69, 0x63, 0x4b, 0x65, 0x79, 0x12, 0x16, 0x0a, 0x06, 0x73, + 0x63, 0x72, 0x69, 0x70, 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x06, 0x73, 0x63, 0x72, + 0x69, 0x70, 0x74, 0x12, 0x2f, 0x0a, 0x13, 0x76, 0x65, 0x72, 0x69, 0x66, 0x69, 0x65, 0x72, 0x5f, + 0x63, 0x6f, 0x6d, 0x70, 0x6c, 0x65, 0x78, 0x69, 0x74, 0x79, 0x18, 0x03, 0x20, 0x01, 0x28, 0x03, + 0x52, 0x12, 0x76, 0x65, 0x72, 0x69, 0x66, 0x69, 0x65, 0x72, 0x43, 0x6f, 0x6d, 0x70, 0x6c, 0x65, + 0x78, 0x69, 0x74, 0x79, 0x1a, 0x67, 0x0a, 0x0b, 0x41, 0x63, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x44, + 0x61, 0x74, 0x61, 0x12, 0x18, 0x0a, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x18, 0x01, + 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, 0x61, 0x64, 0x64, 0x72, 0x65, 0x73, 0x73, 0x12, 0x3e, 0x0a, + 0x07, 0x65, 0x6e, 0x74, 0x72, 0x69, 0x65, 0x73, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x24, + 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x2e, 0x44, 0x61, 0x74, 0x61, 0x54, 0x72, 0x61, 0x6e, 0x73, + 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x44, 0x61, 0x74, 0x61, 0x2e, 0x44, 0x61, 0x74, 0x61, 0x45, + 0x6e, 0x74, 0x72, 0x79, 0x52, 0x07, 0x65, 0x6e, 0x74, 0x72, 0x69, 0x65, 0x73, 0x1a, 0x41, 0x0a, + 0x0b, 0x53, 0x70, 0x6f, 0x6e, 0x73, 0x6f, 0x72, 0x73, 0x68, 0x69, 0x70, 0x12, 0x19, 0x0a, 0x08, + 0x61, 0x73, 0x73, 0x65, 0x74, 0x5f, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0c, 0x52, 0x07, + 0x61, 0x73, 0x73, 0x65, 0x74, 0x49, 0x64, 0x12, 0x17, 0x0a, 0x07, 0x6d, 0x69, 0x6e, 0x5f, 0x66, + 0x65, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x06, 0x6d, 0x69, 0x6e, 0x46, 0x65, 0x65, + 0x2a, 0x3a, 0x0a, 0x11, 0x54, 0x72, 0x61, 0x6e, 0x73, 0x61, 0x63, 0x74, 0x69, 0x6f, 0x6e, 0x53, + 0x74, 0x61, 0x74, 0x75, 0x73, 0x12, 0x0d, 0x0a, 0x09, 0x53, 0x55, 0x43, 0x43, 0x45, 0x45, 0x44, + 0x45, 0x44, 0x10, 0x00, 0x12, 0x0a, 0x0a, 0x06, 0x46, 0x41, 0x49, 0x4c, 0x45, 0x44, 0x10, 0x01, + 0x12, 0x0a, 0x0a, 0x06, 0x45, 0x4c, 0x49, 0x44, 0x45, 0x44, 0x10, 0x02, 0x42, 0x68, 0x0a, 0x23, + 0x63, 0x6f, 0x6d, 0x2e, 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, 0x72, + 0x6d, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x73, 0x6e, 0x61, 0x70, 0x73, + 0x68, 0x6f, 0x74, 0x5a, 0x39, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, + 0x77, 0x61, 0x76, 0x65, 0x73, 0x70, 0x6c, 0x61, 0x74, 0x66, 0x6f, 0x72, 0x6d, 0x2f, 0x67, 0x6f, + 0x77, 0x61, 0x76, 0x65, 0x73, 0x2f, 0x70, 0x6b, 0x67, 0x2f, 0x67, 0x72, 0x70, 0x63, 0x2f, 0x67, + 0x65, 0x6e, 0x65, 0x72, 0x61, 0x74, 0x65, 0x64, 0x2f, 0x77, 0x61, 0x76, 0x65, 0x73, 0xaa, 0x02, + 0x05, 0x57, 0x61, 0x76, 0x65, 0x73, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33, +} + +var ( + file_waves_transaction_state_snapshot_proto_rawDescOnce sync.Once + file_waves_transaction_state_snapshot_proto_rawDescData = file_waves_transaction_state_snapshot_proto_rawDesc +) + +func file_waves_transaction_state_snapshot_proto_rawDescGZIP() []byte { + file_waves_transaction_state_snapshot_proto_rawDescOnce.Do(func() { + file_waves_transaction_state_snapshot_proto_rawDescData = protoimpl.X.CompressGZIP(file_waves_transaction_state_snapshot_proto_rawDescData) + }) + return file_waves_transaction_state_snapshot_proto_rawDescData +} + +var file_waves_transaction_state_snapshot_proto_enumTypes = make([]protoimpl.EnumInfo, 1) +var file_waves_transaction_state_snapshot_proto_msgTypes = make([]protoimpl.MessageInfo, 15) +var file_waves_transaction_state_snapshot_proto_goTypes = []interface{}{ + (TransactionStatus)(0), // 0: waves.TransactionStatus + (*TransactionStateSnapshot)(nil), // 1: waves.TransactionStateSnapshot + (*TransactionStateSnapshot_Balance)(nil), // 2: waves.TransactionStateSnapshot.Balance + (*TransactionStateSnapshot_LeaseBalance)(nil), // 3: waves.TransactionStateSnapshot.LeaseBalance + (*TransactionStateSnapshot_LeaseState)(nil), // 4: waves.TransactionStateSnapshot.LeaseState + (*TransactionStateSnapshot_AssetStatic)(nil), // 5: waves.TransactionStateSnapshot.AssetStatic + (*TransactionStateSnapshot_AssetVolume)(nil), // 6: waves.TransactionStateSnapshot.AssetVolume + (*TransactionStateSnapshot_AssetNameAndDescription)(nil), // 7: waves.TransactionStateSnapshot.AssetNameAndDescription + (*TransactionStateSnapshot_AssetScript)(nil), // 8: waves.TransactionStateSnapshot.AssetScript + (*TransactionStateSnapshot_Alias)(nil), // 9: waves.TransactionStateSnapshot.Alias + (*TransactionStateSnapshot_OrderFill)(nil), // 10: waves.TransactionStateSnapshot.OrderFill + (*TransactionStateSnapshot_AccountScript)(nil), // 11: waves.TransactionStateSnapshot.AccountScript + (*TransactionStateSnapshot_AccountData)(nil), // 12: waves.TransactionStateSnapshot.AccountData + (*TransactionStateSnapshot_Sponsorship)(nil), // 13: waves.TransactionStateSnapshot.Sponsorship + (*TransactionStateSnapshot_LeaseState_Active)(nil), // 14: waves.TransactionStateSnapshot.LeaseState.Active + (*TransactionStateSnapshot_LeaseState_Cancelled)(nil), // 15: waves.TransactionStateSnapshot.LeaseState.Cancelled + (*Amount)(nil), // 16: waves.Amount + (*DataTransactionData_DataEntry)(nil), // 17: waves.DataTransactionData.DataEntry +} +var file_waves_transaction_state_snapshot_proto_depIdxs = []int32{ + 2, // 0: waves.TransactionStateSnapshot.balances:type_name -> waves.TransactionStateSnapshot.Balance + 3, // 1: waves.TransactionStateSnapshot.lease_balances:type_name -> waves.TransactionStateSnapshot.LeaseBalance + 5, // 2: waves.TransactionStateSnapshot.asset_statics:type_name -> waves.TransactionStateSnapshot.AssetStatic + 6, // 3: waves.TransactionStateSnapshot.asset_volumes:type_name -> waves.TransactionStateSnapshot.AssetVolume + 7, // 4: waves.TransactionStateSnapshot.asset_names_and_descriptions:type_name -> waves.TransactionStateSnapshot.AssetNameAndDescription + 8, // 5: waves.TransactionStateSnapshot.asset_scripts:type_name -> waves.TransactionStateSnapshot.AssetScript + 9, // 6: waves.TransactionStateSnapshot.aliases:type_name -> waves.TransactionStateSnapshot.Alias + 10, // 7: waves.TransactionStateSnapshot.order_fills:type_name -> waves.TransactionStateSnapshot.OrderFill + 4, // 8: waves.TransactionStateSnapshot.lease_states:type_name -> waves.TransactionStateSnapshot.LeaseState + 11, // 9: waves.TransactionStateSnapshot.account_scripts:type_name -> waves.TransactionStateSnapshot.AccountScript + 12, // 10: waves.TransactionStateSnapshot.account_data:type_name -> waves.TransactionStateSnapshot.AccountData + 13, // 11: waves.TransactionStateSnapshot.sponsorships:type_name -> waves.TransactionStateSnapshot.Sponsorship + 0, // 12: waves.TransactionStateSnapshot.transaction_status:type_name -> waves.TransactionStatus + 16, // 13: waves.TransactionStateSnapshot.Balance.amount:type_name -> waves.Amount + 14, // 14: waves.TransactionStateSnapshot.LeaseState.active:type_name -> waves.TransactionStateSnapshot.LeaseState.Active + 15, // 15: waves.TransactionStateSnapshot.LeaseState.cancelled:type_name -> waves.TransactionStateSnapshot.LeaseState.Cancelled + 17, // 16: waves.TransactionStateSnapshot.AccountData.entries:type_name -> waves.DataTransactionData.DataEntry + 17, // [17:17] is the sub-list for method output_type + 17, // [17:17] is the sub-list for method input_type + 17, // [17:17] is the sub-list for extension type_name + 17, // [17:17] is the sub-list for extension extendee + 0, // [0:17] is the sub-list for field type_name +} + +func init() { file_waves_transaction_state_snapshot_proto_init() } +func file_waves_transaction_state_snapshot_proto_init() { + if File_waves_transaction_state_snapshot_proto != nil { + return + } + file_waves_amount_proto_init() + file_waves_transaction_proto_init() + if !protoimpl.UnsafeEnabled { + file_waves_transaction_state_snapshot_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*TransactionStateSnapshot); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_waves_transaction_state_snapshot_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*TransactionStateSnapshot_Balance); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_waves_transaction_state_snapshot_proto_msgTypes[2].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*TransactionStateSnapshot_LeaseBalance); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_waves_transaction_state_snapshot_proto_msgTypes[3].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*TransactionStateSnapshot_LeaseState); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_waves_transaction_state_snapshot_proto_msgTypes[4].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*TransactionStateSnapshot_AssetStatic); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_waves_transaction_state_snapshot_proto_msgTypes[5].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*TransactionStateSnapshot_AssetVolume); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_waves_transaction_state_snapshot_proto_msgTypes[6].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*TransactionStateSnapshot_AssetNameAndDescription); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_waves_transaction_state_snapshot_proto_msgTypes[7].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*TransactionStateSnapshot_AssetScript); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_waves_transaction_state_snapshot_proto_msgTypes[8].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*TransactionStateSnapshot_Alias); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_waves_transaction_state_snapshot_proto_msgTypes[9].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*TransactionStateSnapshot_OrderFill); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_waves_transaction_state_snapshot_proto_msgTypes[10].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*TransactionStateSnapshot_AccountScript); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_waves_transaction_state_snapshot_proto_msgTypes[11].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*TransactionStateSnapshot_AccountData); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_waves_transaction_state_snapshot_proto_msgTypes[12].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*TransactionStateSnapshot_Sponsorship); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_waves_transaction_state_snapshot_proto_msgTypes[13].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*TransactionStateSnapshot_LeaseState_Active); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + file_waves_transaction_state_snapshot_proto_msgTypes[14].Exporter = func(v interface{}, i int) interface{} { + switch v := v.(*TransactionStateSnapshot_LeaseState_Cancelled); i { + case 0: + return &v.state + case 1: + return &v.sizeCache + case 2: + return &v.unknownFields + default: + return nil + } + } + } + file_waves_transaction_state_snapshot_proto_msgTypes[3].OneofWrappers = []interface{}{ + (*TransactionStateSnapshot_LeaseState_Active_)(nil), + (*TransactionStateSnapshot_LeaseState_Cancelled_)(nil), + } + type x struct{} + out := protoimpl.TypeBuilder{ + File: protoimpl.DescBuilder{ + GoPackagePath: reflect.TypeOf(x{}).PkgPath(), + RawDescriptor: file_waves_transaction_state_snapshot_proto_rawDesc, + NumEnums: 1, + NumMessages: 15, + NumExtensions: 0, + NumServices: 0, + }, + GoTypes: file_waves_transaction_state_snapshot_proto_goTypes, + DependencyIndexes: file_waves_transaction_state_snapshot_proto_depIdxs, + EnumInfos: file_waves_transaction_state_snapshot_proto_enumTypes, + MessageInfos: file_waves_transaction_state_snapshot_proto_msgTypes, + }.Build() + File_waves_transaction_state_snapshot_proto = out.File + file_waves_transaction_state_snapshot_proto_rawDesc = nil + file_waves_transaction_state_snapshot_proto_goTypes = nil + file_waves_transaction_state_snapshot_proto_depIdxs = nil +} diff --git a/pkg/grpc/generated/waves/transaction_state_snapshot_vtproto.pb.go b/pkg/grpc/generated/waves/transaction_state_snapshot_vtproto.pb.go new file mode 100644 index 000000000..c48808e76 --- /dev/null +++ b/pkg/grpc/generated/waves/transaction_state_snapshot_vtproto.pb.go @@ -0,0 +1,3640 @@ +// Code generated by protoc-gen-go-vtproto. DO NOT EDIT. +// protoc-gen-go-vtproto version: v0.5.0 +// source: waves/transaction_state_snapshot.proto + +package waves + +import ( + fmt "fmt" + protoimpl "google.golang.org/protobuf/runtime/protoimpl" + io "io" +) + +const ( + // Verify that this generated code is sufficiently up-to-date. + _ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion) + // Verify that runtime/protoimpl is sufficiently up-to-date. + _ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20) +) + +func (m *TransactionStateSnapshot_Balance) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TransactionStateSnapshot_Balance) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *TransactionStateSnapshot_Balance) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + if m.Amount != nil { + size, err := m.Amount.MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0x12 + } + if len(m.Address) > 0 { + i -= len(m.Address) + copy(dAtA[i:], m.Address) + i = encodeVarint(dAtA, i, uint64(len(m.Address))) + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *TransactionStateSnapshot_LeaseBalance) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TransactionStateSnapshot_LeaseBalance) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *TransactionStateSnapshot_LeaseBalance) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + if m.Out != 0 { + i = encodeVarint(dAtA, i, uint64(m.Out)) + i-- + dAtA[i] = 0x18 + } + if m.In != 0 { + i = encodeVarint(dAtA, i, uint64(m.In)) + i-- + dAtA[i] = 0x10 + } + if len(m.Address) > 0 { + i -= len(m.Address) + copy(dAtA[i:], m.Address) + i = encodeVarint(dAtA, i, uint64(len(m.Address))) + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *TransactionStateSnapshot_LeaseState_Active) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TransactionStateSnapshot_LeaseState_Active) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *TransactionStateSnapshot_LeaseState_Active) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + if len(m.Recipient) > 0 { + i -= len(m.Recipient) + copy(dAtA[i:], m.Recipient) + i = encodeVarint(dAtA, i, uint64(len(m.Recipient))) + i-- + dAtA[i] = 0x1a + } + if len(m.Sender) > 0 { + i -= len(m.Sender) + copy(dAtA[i:], m.Sender) + i = encodeVarint(dAtA, i, uint64(len(m.Sender))) + i-- + dAtA[i] = 0x12 + } + if m.Amount != 0 { + i = encodeVarint(dAtA, i, uint64(m.Amount)) + i-- + dAtA[i] = 0x8 + } + return len(dAtA) - i, nil +} + +func (m *TransactionStateSnapshot_LeaseState_Cancelled) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TransactionStateSnapshot_LeaseState_Cancelled) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *TransactionStateSnapshot_LeaseState_Cancelled) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + return len(dAtA) - i, nil +} + +func (m *TransactionStateSnapshot_LeaseState) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TransactionStateSnapshot_LeaseState) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *TransactionStateSnapshot_LeaseState) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + if msg, ok := m.Status.(*TransactionStateSnapshot_LeaseState_Cancelled_); ok { + size, err := msg.MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + } + if msg, ok := m.Status.(*TransactionStateSnapshot_LeaseState_Active_); ok { + size, err := msg.MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + } + if len(m.LeaseId) > 0 { + i -= len(m.LeaseId) + copy(dAtA[i:], m.LeaseId) + i = encodeVarint(dAtA, i, uint64(len(m.LeaseId))) + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *TransactionStateSnapshot_LeaseState_Active_) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *TransactionStateSnapshot_LeaseState_Active_) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + i := len(dAtA) + if m.Active != nil { + size, err := m.Active.MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0x1 + i-- + dAtA[i] = 0xaa + } + return len(dAtA) - i, nil +} +func (m *TransactionStateSnapshot_LeaseState_Cancelled_) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *TransactionStateSnapshot_LeaseState_Cancelled_) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + i := len(dAtA) + if m.Cancelled != nil { + size, err := m.Cancelled.MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0x1 + i-- + dAtA[i] = 0xb2 + } + return len(dAtA) - i, nil +} +func (m *TransactionStateSnapshot_AssetStatic) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TransactionStateSnapshot_AssetStatic) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *TransactionStateSnapshot_AssetStatic) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + if m.Nft { + i-- + if m.Nft { + dAtA[i] = 1 + } else { + dAtA[i] = 0 + } + i-- + dAtA[i] = 0x28 + } + if m.Decimals != 0 { + i = encodeVarint(dAtA, i, uint64(m.Decimals)) + i-- + dAtA[i] = 0x20 + } + if len(m.IssuerPublicKey) > 0 { + i -= len(m.IssuerPublicKey) + copy(dAtA[i:], m.IssuerPublicKey) + i = encodeVarint(dAtA, i, uint64(len(m.IssuerPublicKey))) + i-- + dAtA[i] = 0x1a + } + if len(m.SourceTransactionId) > 0 { + i -= len(m.SourceTransactionId) + copy(dAtA[i:], m.SourceTransactionId) + i = encodeVarint(dAtA, i, uint64(len(m.SourceTransactionId))) + i-- + dAtA[i] = 0x12 + } + if len(m.AssetId) > 0 { + i -= len(m.AssetId) + copy(dAtA[i:], m.AssetId) + i = encodeVarint(dAtA, i, uint64(len(m.AssetId))) + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *TransactionStateSnapshot_AssetVolume) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TransactionStateSnapshot_AssetVolume) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *TransactionStateSnapshot_AssetVolume) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + if len(m.Volume) > 0 { + i -= len(m.Volume) + copy(dAtA[i:], m.Volume) + i = encodeVarint(dAtA, i, uint64(len(m.Volume))) + i-- + dAtA[i] = 0x1a + } + if m.Reissuable { + i-- + if m.Reissuable { + dAtA[i] = 1 + } else { + dAtA[i] = 0 + } + i-- + dAtA[i] = 0x10 + } + if len(m.AssetId) > 0 { + i -= len(m.AssetId) + copy(dAtA[i:], m.AssetId) + i = encodeVarint(dAtA, i, uint64(len(m.AssetId))) + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *TransactionStateSnapshot_AssetNameAndDescription) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TransactionStateSnapshot_AssetNameAndDescription) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *TransactionStateSnapshot_AssetNameAndDescription) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + if m.LastUpdated != 0 { + i = encodeVarint(dAtA, i, uint64(m.LastUpdated)) + i-- + dAtA[i] = 0x20 + } + if len(m.Description) > 0 { + i -= len(m.Description) + copy(dAtA[i:], m.Description) + i = encodeVarint(dAtA, i, uint64(len(m.Description))) + i-- + dAtA[i] = 0x1a + } + if len(m.Name) > 0 { + i -= len(m.Name) + copy(dAtA[i:], m.Name) + i = encodeVarint(dAtA, i, uint64(len(m.Name))) + i-- + dAtA[i] = 0x12 + } + if len(m.AssetId) > 0 { + i -= len(m.AssetId) + copy(dAtA[i:], m.AssetId) + i = encodeVarint(dAtA, i, uint64(len(m.AssetId))) + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *TransactionStateSnapshot_AssetScript) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TransactionStateSnapshot_AssetScript) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *TransactionStateSnapshot_AssetScript) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + if len(m.Script) > 0 { + i -= len(m.Script) + copy(dAtA[i:], m.Script) + i = encodeVarint(dAtA, i, uint64(len(m.Script))) + i-- + dAtA[i] = 0x12 + } + if len(m.AssetId) > 0 { + i -= len(m.AssetId) + copy(dAtA[i:], m.AssetId) + i = encodeVarint(dAtA, i, uint64(len(m.AssetId))) + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *TransactionStateSnapshot_Alias) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TransactionStateSnapshot_Alias) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *TransactionStateSnapshot_Alias) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + if len(m.Alias) > 0 { + i -= len(m.Alias) + copy(dAtA[i:], m.Alias) + i = encodeVarint(dAtA, i, uint64(len(m.Alias))) + i-- + dAtA[i] = 0x12 + } + if len(m.Address) > 0 { + i -= len(m.Address) + copy(dAtA[i:], m.Address) + i = encodeVarint(dAtA, i, uint64(len(m.Address))) + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *TransactionStateSnapshot_OrderFill) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TransactionStateSnapshot_OrderFill) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *TransactionStateSnapshot_OrderFill) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + if m.Fee != 0 { + i = encodeVarint(dAtA, i, uint64(m.Fee)) + i-- + dAtA[i] = 0x18 + } + if m.Volume != 0 { + i = encodeVarint(dAtA, i, uint64(m.Volume)) + i-- + dAtA[i] = 0x10 + } + if len(m.OrderId) > 0 { + i -= len(m.OrderId) + copy(dAtA[i:], m.OrderId) + i = encodeVarint(dAtA, i, uint64(len(m.OrderId))) + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *TransactionStateSnapshot_AccountScript) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TransactionStateSnapshot_AccountScript) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *TransactionStateSnapshot_AccountScript) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + if m.VerifierComplexity != 0 { + i = encodeVarint(dAtA, i, uint64(m.VerifierComplexity)) + i-- + dAtA[i] = 0x18 + } + if len(m.Script) > 0 { + i -= len(m.Script) + copy(dAtA[i:], m.Script) + i = encodeVarint(dAtA, i, uint64(len(m.Script))) + i-- + dAtA[i] = 0x12 + } + if len(m.SenderPublicKey) > 0 { + i -= len(m.SenderPublicKey) + copy(dAtA[i:], m.SenderPublicKey) + i = encodeVarint(dAtA, i, uint64(len(m.SenderPublicKey))) + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *TransactionStateSnapshot_AccountData) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TransactionStateSnapshot_AccountData) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *TransactionStateSnapshot_AccountData) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + if len(m.Entries) > 0 { + for iNdEx := len(m.Entries) - 1; iNdEx >= 0; iNdEx-- { + size, err := m.Entries[iNdEx].MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0x12 + } + } + if len(m.Address) > 0 { + i -= len(m.Address) + copy(dAtA[i:], m.Address) + i = encodeVarint(dAtA, i, uint64(len(m.Address))) + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *TransactionStateSnapshot_Sponsorship) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TransactionStateSnapshot_Sponsorship) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *TransactionStateSnapshot_Sponsorship) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + if m.MinFee != 0 { + i = encodeVarint(dAtA, i, uint64(m.MinFee)) + i-- + dAtA[i] = 0x10 + } + if len(m.AssetId) > 0 { + i -= len(m.AssetId) + copy(dAtA[i:], m.AssetId) + i = encodeVarint(dAtA, i, uint64(len(m.AssetId))) + i-- + dAtA[i] = 0xa + } + return len(dAtA) - i, nil +} + +func (m *TransactionStateSnapshot) MarshalVTStrict() (dAtA []byte, err error) { + if m == nil { + return nil, nil + } + size := m.SizeVT() + dAtA = make([]byte, size) + n, err := m.MarshalToSizedBufferVTStrict(dAtA[:size]) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *TransactionStateSnapshot) MarshalToVTStrict(dAtA []byte) (int, error) { + size := m.SizeVT() + return m.MarshalToSizedBufferVTStrict(dAtA[:size]) +} + +func (m *TransactionStateSnapshot) MarshalToSizedBufferVTStrict(dAtA []byte) (int, error) { + if m == nil { + return 0, nil + } + i := len(dAtA) + _ = i + var l int + _ = l + if m.unknownFields != nil { + i -= len(m.unknownFields) + copy(dAtA[i:], m.unknownFields) + } + if m.TransactionStatus != 0 { + i = encodeVarint(dAtA, i, uint64(m.TransactionStatus)) + i-- + dAtA[i] = 0x68 + } + if len(m.Sponsorships) > 0 { + for iNdEx := len(m.Sponsorships) - 1; iNdEx >= 0; iNdEx-- { + size, err := m.Sponsorships[iNdEx].MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0x62 + } + } + if len(m.AccountData) > 0 { + for iNdEx := len(m.AccountData) - 1; iNdEx >= 0; iNdEx-- { + size, err := m.AccountData[iNdEx].MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0x5a + } + } + if len(m.AccountScripts) > 0 { + for iNdEx := len(m.AccountScripts) - 1; iNdEx >= 0; iNdEx-- { + size, err := m.AccountScripts[iNdEx].MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0x52 + } + } + if len(m.LeaseStates) > 0 { + for iNdEx := len(m.LeaseStates) - 1; iNdEx >= 0; iNdEx-- { + size, err := m.LeaseStates[iNdEx].MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0x4a + } + } + if len(m.OrderFills) > 0 { + for iNdEx := len(m.OrderFills) - 1; iNdEx >= 0; iNdEx-- { + size, err := m.OrderFills[iNdEx].MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0x42 + } + } + if len(m.Aliases) > 0 { + for iNdEx := len(m.Aliases) - 1; iNdEx >= 0; iNdEx-- { + size, err := m.Aliases[iNdEx].MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0x3a + } + } + if len(m.AssetScripts) > 0 { + for iNdEx := len(m.AssetScripts) - 1; iNdEx >= 0; iNdEx-- { + size, err := m.AssetScripts[iNdEx].MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0x32 + } + } + if len(m.AssetNamesAndDescriptions) > 0 { + for iNdEx := len(m.AssetNamesAndDescriptions) - 1; iNdEx >= 0; iNdEx-- { + size, err := m.AssetNamesAndDescriptions[iNdEx].MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0x2a + } + } + if len(m.AssetVolumes) > 0 { + for iNdEx := len(m.AssetVolumes) - 1; iNdEx >= 0; iNdEx-- { + size, err := m.AssetVolumes[iNdEx].MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0x22 + } + } + if len(m.AssetStatics) > 0 { + for iNdEx := len(m.AssetStatics) - 1; iNdEx >= 0; iNdEx-- { + size, err := m.AssetStatics[iNdEx].MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0x1a + } + } + if len(m.LeaseBalances) > 0 { + for iNdEx := len(m.LeaseBalances) - 1; iNdEx >= 0; iNdEx-- { + size, err := m.LeaseBalances[iNdEx].MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0x12 + } + } + if len(m.Balances) > 0 { + for iNdEx := len(m.Balances) - 1; iNdEx >= 0; iNdEx-- { + size, err := m.Balances[iNdEx].MarshalToSizedBufferVTStrict(dAtA[:i]) + if err != nil { + return 0, err + } + i -= size + i = encodeVarint(dAtA, i, uint64(size)) + i-- + dAtA[i] = 0xa + } + } + return len(dAtA) - i, nil +} + +func (m *TransactionStateSnapshot_Balance) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Address) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + if m.Amount != nil { + l = m.Amount.SizeVT() + n += 1 + l + sov(uint64(l)) + } + n += len(m.unknownFields) + return n +} + +func (m *TransactionStateSnapshot_LeaseBalance) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Address) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + if m.In != 0 { + n += 1 + sov(uint64(m.In)) + } + if m.Out != 0 { + n += 1 + sov(uint64(m.Out)) + } + n += len(m.unknownFields) + return n +} + +func (m *TransactionStateSnapshot_LeaseState_Active) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Amount != 0 { + n += 1 + sov(uint64(m.Amount)) + } + l = len(m.Sender) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + l = len(m.Recipient) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + n += len(m.unknownFields) + return n +} + +func (m *TransactionStateSnapshot_LeaseState_Cancelled) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + n += len(m.unknownFields) + return n +} + +func (m *TransactionStateSnapshot_LeaseState) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.LeaseId) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + if vtmsg, ok := m.Status.(interface{ SizeVT() int }); ok { + n += vtmsg.SizeVT() + } + n += len(m.unknownFields) + return n +} + +func (m *TransactionStateSnapshot_LeaseState_Active_) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Active != nil { + l = m.Active.SizeVT() + n += 2 + l + sov(uint64(l)) + } + return n +} +func (m *TransactionStateSnapshot_LeaseState_Cancelled_) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Cancelled != nil { + l = m.Cancelled.SizeVT() + n += 2 + l + sov(uint64(l)) + } + return n +} +func (m *TransactionStateSnapshot_AssetStatic) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.AssetId) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + l = len(m.SourceTransactionId) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + l = len(m.IssuerPublicKey) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + if m.Decimals != 0 { + n += 1 + sov(uint64(m.Decimals)) + } + if m.Nft { + n += 2 + } + n += len(m.unknownFields) + return n +} + +func (m *TransactionStateSnapshot_AssetVolume) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.AssetId) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + if m.Reissuable { + n += 2 + } + l = len(m.Volume) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + n += len(m.unknownFields) + return n +} + +func (m *TransactionStateSnapshot_AssetNameAndDescription) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.AssetId) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + l = len(m.Name) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + l = len(m.Description) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + if m.LastUpdated != 0 { + n += 1 + sov(uint64(m.LastUpdated)) + } + n += len(m.unknownFields) + return n +} + +func (m *TransactionStateSnapshot_AssetScript) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.AssetId) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + l = len(m.Script) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + n += len(m.unknownFields) + return n +} + +func (m *TransactionStateSnapshot_Alias) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Address) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + l = len(m.Alias) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + n += len(m.unknownFields) + return n +} + +func (m *TransactionStateSnapshot_OrderFill) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.OrderId) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + if m.Volume != 0 { + n += 1 + sov(uint64(m.Volume)) + } + if m.Fee != 0 { + n += 1 + sov(uint64(m.Fee)) + } + n += len(m.unknownFields) + return n +} + +func (m *TransactionStateSnapshot_AccountScript) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.SenderPublicKey) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + l = len(m.Script) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + if m.VerifierComplexity != 0 { + n += 1 + sov(uint64(m.VerifierComplexity)) + } + n += len(m.unknownFields) + return n +} + +func (m *TransactionStateSnapshot_AccountData) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.Address) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + if len(m.Entries) > 0 { + for _, e := range m.Entries { + l = e.SizeVT() + n += 1 + l + sov(uint64(l)) + } + } + n += len(m.unknownFields) + return n +} + +func (m *TransactionStateSnapshot_Sponsorship) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.AssetId) + if l > 0 { + n += 1 + l + sov(uint64(l)) + } + if m.MinFee != 0 { + n += 1 + sov(uint64(m.MinFee)) + } + n += len(m.unknownFields) + return n +} + +func (m *TransactionStateSnapshot) SizeVT() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if len(m.Balances) > 0 { + for _, e := range m.Balances { + l = e.SizeVT() + n += 1 + l + sov(uint64(l)) + } + } + if len(m.LeaseBalances) > 0 { + for _, e := range m.LeaseBalances { + l = e.SizeVT() + n += 1 + l + sov(uint64(l)) + } + } + if len(m.AssetStatics) > 0 { + for _, e := range m.AssetStatics { + l = e.SizeVT() + n += 1 + l + sov(uint64(l)) + } + } + if len(m.AssetVolumes) > 0 { + for _, e := range m.AssetVolumes { + l = e.SizeVT() + n += 1 + l + sov(uint64(l)) + } + } + if len(m.AssetNamesAndDescriptions) > 0 { + for _, e := range m.AssetNamesAndDescriptions { + l = e.SizeVT() + n += 1 + l + sov(uint64(l)) + } + } + if len(m.AssetScripts) > 0 { + for _, e := range m.AssetScripts { + l = e.SizeVT() + n += 1 + l + sov(uint64(l)) + } + } + if len(m.Aliases) > 0 { + for _, e := range m.Aliases { + l = e.SizeVT() + n += 1 + l + sov(uint64(l)) + } + } + if len(m.OrderFills) > 0 { + for _, e := range m.OrderFills { + l = e.SizeVT() + n += 1 + l + sov(uint64(l)) + } + } + if len(m.LeaseStates) > 0 { + for _, e := range m.LeaseStates { + l = e.SizeVT() + n += 1 + l + sov(uint64(l)) + } + } + if len(m.AccountScripts) > 0 { + for _, e := range m.AccountScripts { + l = e.SizeVT() + n += 1 + l + sov(uint64(l)) + } + } + if len(m.AccountData) > 0 { + for _, e := range m.AccountData { + l = e.SizeVT() + n += 1 + l + sov(uint64(l)) + } + } + if len(m.Sponsorships) > 0 { + for _, e := range m.Sponsorships { + l = e.SizeVT() + n += 1 + l + sov(uint64(l)) + } + } + if m.TransactionStatus != 0 { + n += 1 + sov(uint64(m.TransactionStatus)) + } + n += len(m.unknownFields) + return n +} + +func (m *TransactionStateSnapshot_Balance) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TransactionStateSnapshot_Balance: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TransactionStateSnapshot_Balance: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Address", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Address = append(m.Address[:0], dAtA[iNdEx:postIndex]...) + if m.Address == nil { + m.Address = []byte{} + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Amount", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if m.Amount == nil { + m.Amount = &Amount{} + } + if err := m.Amount.UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TransactionStateSnapshot_LeaseBalance) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TransactionStateSnapshot_LeaseBalance: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TransactionStateSnapshot_LeaseBalance: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Address", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Address = append(m.Address[:0], dAtA[iNdEx:postIndex]...) + if m.Address == nil { + m.Address = []byte{} + } + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field In", wireType) + } + m.In = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.In |= int64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Out", wireType) + } + m.Out = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Out |= int64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TransactionStateSnapshot_LeaseState_Active) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TransactionStateSnapshot_LeaseState_Active: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TransactionStateSnapshot_LeaseState_Active: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Amount", wireType) + } + m.Amount = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Amount |= int64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Sender", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Sender = append(m.Sender[:0], dAtA[iNdEx:postIndex]...) + if m.Sender == nil { + m.Sender = []byte{} + } + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Recipient", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Recipient = append(m.Recipient[:0], dAtA[iNdEx:postIndex]...) + if m.Recipient == nil { + m.Recipient = []byte{} + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TransactionStateSnapshot_LeaseState_Cancelled) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TransactionStateSnapshot_LeaseState_Cancelled: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TransactionStateSnapshot_LeaseState_Cancelled: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TransactionStateSnapshot_LeaseState) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TransactionStateSnapshot_LeaseState: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TransactionStateSnapshot_LeaseState: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field LeaseId", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.LeaseId = append(m.LeaseId[:0], dAtA[iNdEx:postIndex]...) + if m.LeaseId == nil { + m.LeaseId = []byte{} + } + iNdEx = postIndex + case 21: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Active", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if oneof, ok := m.Status.(*TransactionStateSnapshot_LeaseState_Active_); ok { + if err := oneof.Active.UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + } else { + v := &TransactionStateSnapshot_LeaseState_Active{} + if err := v.UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + m.Status = &TransactionStateSnapshot_LeaseState_Active_{Active: v} + } + iNdEx = postIndex + case 22: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Cancelled", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if oneof, ok := m.Status.(*TransactionStateSnapshot_LeaseState_Cancelled_); ok { + if err := oneof.Cancelled.UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + } else { + v := &TransactionStateSnapshot_LeaseState_Cancelled{} + if err := v.UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + m.Status = &TransactionStateSnapshot_LeaseState_Cancelled_{Cancelled: v} + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TransactionStateSnapshot_AssetStatic) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TransactionStateSnapshot_AssetStatic: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TransactionStateSnapshot_AssetStatic: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field AssetId", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.AssetId = append(m.AssetId[:0], dAtA[iNdEx:postIndex]...) + if m.AssetId == nil { + m.AssetId = []byte{} + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field SourceTransactionId", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.SourceTransactionId = append(m.SourceTransactionId[:0], dAtA[iNdEx:postIndex]...) + if m.SourceTransactionId == nil { + m.SourceTransactionId = []byte{} + } + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field IssuerPublicKey", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.IssuerPublicKey = append(m.IssuerPublicKey[:0], dAtA[iNdEx:postIndex]...) + if m.IssuerPublicKey == nil { + m.IssuerPublicKey = []byte{} + } + iNdEx = postIndex + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Decimals", wireType) + } + m.Decimals = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Decimals |= int32(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Nft", wireType) + } + var v int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + m.Nft = bool(v != 0) + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TransactionStateSnapshot_AssetVolume) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TransactionStateSnapshot_AssetVolume: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TransactionStateSnapshot_AssetVolume: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field AssetId", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.AssetId = append(m.AssetId[:0], dAtA[iNdEx:postIndex]...) + if m.AssetId == nil { + m.AssetId = []byte{} + } + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Reissuable", wireType) + } + var v int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + m.Reissuable = bool(v != 0) + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Volume", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Volume = append(m.Volume[:0], dAtA[iNdEx:postIndex]...) + if m.Volume == nil { + m.Volume = []byte{} + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TransactionStateSnapshot_AssetNameAndDescription) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TransactionStateSnapshot_AssetNameAndDescription: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TransactionStateSnapshot_AssetNameAndDescription: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field AssetId", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.AssetId = append(m.AssetId[:0], dAtA[iNdEx:postIndex]...) + if m.AssetId == nil { + m.AssetId = []byte{} + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Name", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Name = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Description", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Description = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field LastUpdated", wireType) + } + m.LastUpdated = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.LastUpdated |= int32(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TransactionStateSnapshot_AssetScript) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TransactionStateSnapshot_AssetScript: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TransactionStateSnapshot_AssetScript: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field AssetId", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.AssetId = append(m.AssetId[:0], dAtA[iNdEx:postIndex]...) + if m.AssetId == nil { + m.AssetId = []byte{} + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Script", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Script = append(m.Script[:0], dAtA[iNdEx:postIndex]...) + if m.Script == nil { + m.Script = []byte{} + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TransactionStateSnapshot_Alias) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TransactionStateSnapshot_Alias: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TransactionStateSnapshot_Alias: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Address", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Address = append(m.Address[:0], dAtA[iNdEx:postIndex]...) + if m.Address == nil { + m.Address = []byte{} + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Alias", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Alias = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TransactionStateSnapshot_OrderFill) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TransactionStateSnapshot_OrderFill: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TransactionStateSnapshot_OrderFill: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field OrderId", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.OrderId = append(m.OrderId[:0], dAtA[iNdEx:postIndex]...) + if m.OrderId == nil { + m.OrderId = []byte{} + } + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Volume", wireType) + } + m.Volume = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Volume |= int64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Fee", wireType) + } + m.Fee = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.Fee |= int64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TransactionStateSnapshot_AccountScript) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TransactionStateSnapshot_AccountScript: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TransactionStateSnapshot_AccountScript: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field SenderPublicKey", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.SenderPublicKey = append(m.SenderPublicKey[:0], dAtA[iNdEx:postIndex]...) + if m.SenderPublicKey == nil { + m.SenderPublicKey = []byte{} + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Script", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Script = append(m.Script[:0], dAtA[iNdEx:postIndex]...) + if m.Script == nil { + m.Script = []byte{} + } + iNdEx = postIndex + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field VerifierComplexity", wireType) + } + m.VerifierComplexity = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.VerifierComplexity |= int64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TransactionStateSnapshot_AccountData) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TransactionStateSnapshot_AccountData: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TransactionStateSnapshot_AccountData: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Address", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Address = append(m.Address[:0], dAtA[iNdEx:postIndex]...) + if m.Address == nil { + m.Address = []byte{} + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Entries", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Entries = append(m.Entries, &DataTransactionData_DataEntry{}) + if err := m.Entries[len(m.Entries)-1].UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TransactionStateSnapshot_Sponsorship) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TransactionStateSnapshot_Sponsorship: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TransactionStateSnapshot_Sponsorship: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field AssetId", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + byteLen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + byteLen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.AssetId = append(m.AssetId[:0], dAtA[iNdEx:postIndex]...) + if m.AssetId == nil { + m.AssetId = []byte{} + } + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field MinFee", wireType) + } + m.MinFee = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.MinFee |= int64(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *TransactionStateSnapshot) UnmarshalVT(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: TransactionStateSnapshot: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: TransactionStateSnapshot: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Balances", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Balances = append(m.Balances, &TransactionStateSnapshot_Balance{}) + if err := m.Balances[len(m.Balances)-1].UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field LeaseBalances", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.LeaseBalances = append(m.LeaseBalances, &TransactionStateSnapshot_LeaseBalance{}) + if err := m.LeaseBalances[len(m.LeaseBalances)-1].UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field AssetStatics", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.AssetStatics = append(m.AssetStatics, &TransactionStateSnapshot_AssetStatic{}) + if err := m.AssetStatics[len(m.AssetStatics)-1].UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field AssetVolumes", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.AssetVolumes = append(m.AssetVolumes, &TransactionStateSnapshot_AssetVolume{}) + if err := m.AssetVolumes[len(m.AssetVolumes)-1].UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field AssetNamesAndDescriptions", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.AssetNamesAndDescriptions = append(m.AssetNamesAndDescriptions, &TransactionStateSnapshot_AssetNameAndDescription{}) + if err := m.AssetNamesAndDescriptions[len(m.AssetNamesAndDescriptions)-1].UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field AssetScripts", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.AssetScripts = append(m.AssetScripts, &TransactionStateSnapshot_AssetScript{}) + if err := m.AssetScripts[len(m.AssetScripts)-1].UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Aliases", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Aliases = append(m.Aliases, &TransactionStateSnapshot_Alias{}) + if err := m.Aliases[len(m.Aliases)-1].UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 8: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field OrderFills", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.OrderFills = append(m.OrderFills, &TransactionStateSnapshot_OrderFill{}) + if err := m.OrderFills[len(m.OrderFills)-1].UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 9: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field LeaseStates", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.LeaseStates = append(m.LeaseStates, &TransactionStateSnapshot_LeaseState{}) + if err := m.LeaseStates[len(m.LeaseStates)-1].UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 10: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field AccountScripts", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.AccountScripts = append(m.AccountScripts, &TransactionStateSnapshot_AccountScript{}) + if err := m.AccountScripts[len(m.AccountScripts)-1].UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 11: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field AccountData", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.AccountData = append(m.AccountData, &TransactionStateSnapshot_AccountData{}) + if err := m.AccountData[len(m.AccountData)-1].UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 12: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Sponsorships", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLength + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLength + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Sponsorships = append(m.Sponsorships, &TransactionStateSnapshot_Sponsorship{}) + if err := m.Sponsorships[len(m.Sponsorships)-1].UnmarshalVT(dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 13: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field TransactionStatus", wireType) + } + m.TransactionStatus = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflow + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.TransactionStatus |= TransactionStatus(b&0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skip(dAtA[iNdEx:]) + if err != nil { + return err + } + if (skippy < 0) || (iNdEx+skippy) < 0 { + return ErrInvalidLength + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.unknownFields = append(m.unknownFields, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} diff --git a/pkg/grpc/generated/waves/transaction_vtproto.pb.go b/pkg/grpc/generated/waves/transaction_vtproto.pb.go index 0cce8c9ff..85adba128 100644 --- a/pkg/grpc/generated/waves/transaction_vtproto.pb.go +++ b/pkg/grpc/generated/waves/transaction_vtproto.pb.go @@ -1,5 +1,5 @@ // Code generated by protoc-gen-go-vtproto. DO NOT EDIT. -// protoc-gen-go-vtproto version: v0.4.0 +// protoc-gen-go-vtproto version: v0.5.0 // source: waves/transaction.proto package waves diff --git a/pkg/grpc/protobuf-schemas b/pkg/grpc/protobuf-schemas index a59b344b3..dd1929bd8 160000 --- a/pkg/grpc/protobuf-schemas +++ b/pkg/grpc/protobuf-schemas @@ -1 +1 @@ -Subproject commit a59b344b360e6cff03bd0e42e1cbb2c033bbca66 +Subproject commit dd1929bd8d81033d36478c207c32f20b7187ae46 diff --git a/pkg/grpc/server/accounts_api.go b/pkg/grpc/server/accounts_api.go index 10655ee0e..c28111ee7 100644 --- a/pkg/grpc/server/accounts_api.go +++ b/pkg/grpc/server/accounts_api.go @@ -57,15 +57,18 @@ func (s *Server) GetBalances(req *g.BalancesRequest, srv g.AccountsApi_GetBalanc return nil } -func (s *Server) GetScript(_ context.Context, req *g.AccountRequest) (*g.ScriptData, error) { +func (s *Server) GetScript(_ context.Context, req *g.AccountRequest) (*g.ScriptResponse, error) { c := proto.ProtobufConverter{FallbackChainID: s.scheme} addr, err := c.Address(s.scheme, req.Address) if err != nil { return nil, status.Errorf(codes.InvalidArgument, err.Error()) } rcp := proto.NewRecipientFromAddress(addr) - scriptInfo, _ := s.state.ScriptInfoByAccount(rcp) - return scriptInfo.ToProtobuf(), nil + scriptInfo, err := s.state.ScriptInfoByAccount(rcp) + if err != nil { + return nil, err + } + return scriptInfo.ToScriptResponseProtobuf(), nil } func (s *Server) GetActiveLeases(req *g.AccountRequest, srv g.AccountsApi_GetActiveLeasesServer) error { diff --git a/pkg/mock/grpc.go b/pkg/mock/grpc.go index 2494cfcb0..da104bf0c 100644 --- a/pkg/mock/grpc.go +++ b/pkg/mock/grpc.go @@ -214,10 +214,10 @@ func (mr *MockGrpcHandlersMockRecorder) GetNFTList(arg0, arg1 interface{}) *gomo } // GetScript mocks base method. -func (m *MockGrpcHandlers) GetScript(arg0 context.Context, arg1 *grpc.AccountRequest) (*grpc.ScriptData, error) { +func (m *MockGrpcHandlers) GetScript(arg0 context.Context, arg1 *grpc.AccountRequest) (*grpc.ScriptResponse, error) { m.ctrl.T.Helper() ret := m.ctrl.Call(m, "GetScript", arg0, arg1) - ret0, _ := ret[0].(*grpc.ScriptData) + ret0, _ := ret[0].(*grpc.ScriptResponse) ret1, _ := ret[1].(error) return ret0, ret1 } diff --git a/pkg/mock/state.go b/pkg/mock/state.go index 77faed293..d6ff78d57 100644 --- a/pkg/mock/state.go +++ b/pkg/mock/state.go @@ -868,6 +868,21 @@ func (mr *MockStateInfoMockRecorder) ShouldPersistAddressTransactions() *gomock. return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "ShouldPersistAddressTransactions", reflect.TypeOf((*MockStateInfo)(nil).ShouldPersistAddressTransactions)) } +// SnapshotsAtHeight mocks base method. +func (m *MockStateInfo) SnapshotsAtHeight(height proto.Height) (proto.BlockSnapshot, error) { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "SnapshotsAtHeight", height) + ret0, _ := ret[0].(proto.BlockSnapshot) + ret1, _ := ret[1].(error) + return ret0, ret1 +} + +// SnapshotsAtHeight indicates an expected call of SnapshotsAtHeight. +func (mr *MockStateInfoMockRecorder) SnapshotsAtHeight(height interface{}) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "SnapshotsAtHeight", reflect.TypeOf((*MockStateInfo)(nil).SnapshotsAtHeight), height) +} + // StateHashAtHeight mocks base method. func (m *MockStateInfo) StateHashAtHeight(height uint64) (*proto.StateHash, error) { m.ctrl.T.Helper() @@ -2175,6 +2190,21 @@ func (mr *MockStateMockRecorder) ShouldPersistAddressTransactions() *gomock.Call return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "ShouldPersistAddressTransactions", reflect.TypeOf((*MockState)(nil).ShouldPersistAddressTransactions)) } +// SnapshotsAtHeight mocks base method. +func (m *MockState) SnapshotsAtHeight(height proto.Height) (proto.BlockSnapshot, error) { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "SnapshotsAtHeight", height) + ret0, _ := ret[0].(proto.BlockSnapshot) + ret1, _ := ret[1].(error) + return ret0, ret1 +} + +// SnapshotsAtHeight indicates an expected call of SnapshotsAtHeight. +func (mr *MockStateMockRecorder) SnapshotsAtHeight(height interface{}) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "SnapshotsAtHeight", reflect.TypeOf((*MockState)(nil).SnapshotsAtHeight), height) +} + // StartProvidingExtendedApi mocks base method. func (m *MockState) StartProvidingExtendedApi() error { m.ctrl.T.Helper() diff --git a/pkg/proto/block_snapshot.go b/pkg/proto/block_snapshot.go new file mode 100644 index 000000000..bb457eb08 --- /dev/null +++ b/pkg/proto/block_snapshot.go @@ -0,0 +1,68 @@ +package proto + +import ( + "encoding/binary" + + "github.com/pkg/errors" + + g "github.com/wavesplatform/gowaves/pkg/grpc/generated/waves" +) + +type BlockSnapshot struct { + TxSnapshots [][]AtomicSnapshot +} + +func (bs *BlockSnapshot) AppendTxSnapshot(txSnapshot []AtomicSnapshot) { + bs.TxSnapshots = append(bs.TxSnapshots, txSnapshot) +} + +func (bs BlockSnapshot) MarshallBinary() ([]byte, error) { + result := binary.BigEndian.AppendUint32([]byte{}, uint32(len(bs.TxSnapshots))) + for _, ts := range bs.TxSnapshots { + var res g.TransactionStateSnapshot + for _, atomicSnapshot := range ts { + if err := atomicSnapshot.AppendToProtobuf(&res); err != nil { + return nil, errors.Wrap(err, "failed to marshall TransactionSnapshot to proto") + } + } + tsBytes, err := res.MarshalVTStrict() + if err != nil { + return nil, err + } + result = binary.BigEndian.AppendUint32(result, uint32(len(tsBytes))) + result = append(result, tsBytes...) + } + return result, nil +} + +func (bs *BlockSnapshot) UnmarshalBinary(data []byte, scheme Scheme) error { + if len(data) < uint32Size { + return errors.Errorf("BlockSnapshot UnmarshallBinary: invalid data size") + } + txSnCnt := binary.BigEndian.Uint32(data[0:uint32Size]) + data = data[uint32Size:] + var txSnapshots [][]AtomicSnapshot + for i := uint32(0); i < txSnCnt; i++ { + if len(data) < uint32Size { + return errors.Errorf("BlockSnapshot UnmarshallBinary: invalid data size") + } + tsBytesLen := binary.BigEndian.Uint32(data[0:uint32Size]) + var tsProto g.TransactionStateSnapshot + data = data[uint32Size:] + if uint32(len(data)) < tsBytesLen { + return errors.Errorf("BlockSnapshot UnmarshallBinary: invalid snapshot size") + } + err := tsProto.UnmarshalVT(data[0:tsBytesLen]) + if err != nil { + return err + } + atomicTS, err := TxSnapshotsFromProtobuf(scheme, &tsProto) + if err != nil { + return err + } + txSnapshots = append(txSnapshots, atomicTS) + data = data[tsBytesLen:] + } + bs.TxSnapshots = txSnapshots + return nil +} diff --git a/pkg/proto/protobuf_converters.go b/pkg/proto/protobuf_converters.go index 14182debc..a417b75b0 100644 --- a/pkg/proto/protobuf_converters.go +++ b/pkg/proto/protobuf_converters.go @@ -60,6 +60,231 @@ func SignedTxFromProtobuf(data []byte) (Transaction, error) { return res, nil } +func balancesFromProto(scheme Scheme, txSnapshotProto *g.TransactionStateSnapshot, res *[]AtomicSnapshot) error { + for _, balance := range txSnapshotProto.Balances { + if len(balance.Amount.AssetId) == 0 { + var sn WavesBalanceSnapshot + err := sn.FromProtobuf(scheme, balance) + if err != nil { + return err + } + *res = append(*res, sn) + } else { + var sn AssetBalanceSnapshot + err := sn.FromProtobuf(scheme, balance) + if err != nil { + return err + } + *res = append(*res, sn) + } + } + return nil +} +func leaseBalancesFromProto(scheme Scheme, txSnapshotProto *g.TransactionStateSnapshot, res *[]AtomicSnapshot) error { + for _, lBalance := range txSnapshotProto.LeaseBalances { + var sn LeaseBalanceSnapshot + err := sn.FromProtobuf(scheme, lBalance) + if err != nil { + return err + } + *res = append(*res, sn) + } + return nil +} + +func staticAssetFromProto(txSnapshotProto *g.TransactionStateSnapshot, res *[]AtomicSnapshot) error { + for _, assetStatic := range txSnapshotProto.AssetStatics { + var sn StaticAssetInfoSnapshot + err := sn.FromProtobuf(assetStatic) + if err != nil { + return err + } + *res = append(*res, sn) + } + return nil +} + +func assetVolumeFromProto(txSnapshotProto *g.TransactionStateSnapshot, res *[]AtomicSnapshot) error { + for _, assetVolume := range txSnapshotProto.AssetVolumes { + var sn AssetVolumeSnapshot + err := sn.FromProtobuf(assetVolume) + if err != nil { + return err + } + *res = append(*res, sn) + } + return nil +} + +func assetDescrFromProto(txSnapshotProto *g.TransactionStateSnapshot, res *[]AtomicSnapshot) error { + for _, assetNameAndDescr := range txSnapshotProto.AssetNamesAndDescriptions { + var sn AssetDescriptionSnapshot + err := sn.FromProtobuf(assetNameAndDescr) + if err != nil { + return err + } + *res = append(*res, sn) + } + return nil +} + +func assetScriptFromProto(txSnapshotProto *g.TransactionStateSnapshot, res *[]AtomicSnapshot) error { + for _, assetScript := range txSnapshotProto.AssetScripts { + var sn AssetScriptSnapshot + err := sn.FromProtobuf(assetScript) + if err != nil { + return err + } + *res = append(*res, sn) + } + return nil +} + +func aliasFromProto(scheme Scheme, txSnapshotProto *g.TransactionStateSnapshot, res *[]AtomicSnapshot) error { + for _, alias := range txSnapshotProto.Aliases { + var sn AliasSnapshot + err := sn.FromProtobuf(scheme, alias) + if err != nil { + return err + } + *res = append(*res, sn) + } + return nil +} + +func filledVolumeFromProto(txSnapshotProto *g.TransactionStateSnapshot, res *[]AtomicSnapshot) error { + for _, orderFill := range txSnapshotProto.OrderFills { + var sn FilledVolumeFeeSnapshot + err := sn.FromProtobuf(orderFill) + if err != nil { + return err + } + *res = append(*res, sn) + } + return nil +} + +func leaseStateFromProto(scheme Scheme, txSnapshotProto *g.TransactionStateSnapshot, res *[]AtomicSnapshot) error { + for _, leaseState := range txSnapshotProto.LeaseStates { + var sn LeaseStateSnapshot + err := sn.FromProtobuf(scheme, leaseState) + if err != nil { + return err + } + *res = append(*res, sn) + } + return nil +} + +func accountScriptFromProto(txSnapshotProto *g.TransactionStateSnapshot, res *[]AtomicSnapshot) error { + for _, accountScript := range txSnapshotProto.AccountScripts { + var sn AccountScriptSnapshot + err := sn.FromProtobuf(accountScript) + if err != nil { + return err + } + *res = append(*res, sn) + } + return nil +} + +func dataEntryFromProto(scheme Scheme, txSnapshotProto *g.TransactionStateSnapshot, res *[]AtomicSnapshot) error { + for _, accountData := range txSnapshotProto.AccountData { + var sn DataEntriesSnapshot + err := sn.FromProtobuf(scheme, accountData) + if err != nil { + return err + } + *res = append(*res, sn) + } + return nil +} + +func sponsorshipFromProto(txSnapshotProto *g.TransactionStateSnapshot, res *[]AtomicSnapshot) error { + for _, sponsorship := range txSnapshotProto.Sponsorships { + var sn SponsorshipSnapshot + err := sn.FromProtobuf(sponsorship) + if err != nil { + return err + } + *res = append(*res, sn) + } + return nil +} + +// TxSnapshotsFromProtobuf Unmarshalling order (how in proto schemas): +// WavesBalances and AssetBalances +// LeaseBalances +// StaticAsset +// AssetVolume +// AssetDescription +// AssetScripts +// Aliases +// FilledVolumes +// LeaseStates +// AccountScripts +// DataEntries +// Sponsorships +// TxStatus. +func TxSnapshotsFromProtobuf(scheme Scheme, txSnapshotProto *g.TransactionStateSnapshot) ([]AtomicSnapshot, error) { + var txSnapshots []AtomicSnapshot + err := balancesFromProto(scheme, txSnapshotProto, &txSnapshots) + if err != nil { + return nil, err + } + err = leaseBalancesFromProto(scheme, txSnapshotProto, &txSnapshots) + if err != nil { + return nil, err + } + err = staticAssetFromProto(txSnapshotProto, &txSnapshots) + if err != nil { + return nil, err + } + err = assetVolumeFromProto(txSnapshotProto, &txSnapshots) + if err != nil { + return nil, err + } + err = assetDescrFromProto(txSnapshotProto, &txSnapshots) + if err != nil { + return nil, err + } + err = assetScriptFromProto(txSnapshotProto, &txSnapshots) + if err != nil { + return nil, err + } + err = aliasFromProto(scheme, txSnapshotProto, &txSnapshots) + if err != nil { + return nil, err + } + err = filledVolumeFromProto(txSnapshotProto, &txSnapshots) + if err != nil { + return nil, err + } + err = leaseStateFromProto(scheme, txSnapshotProto, &txSnapshots) + if err != nil { + return nil, err + } + err = accountScriptFromProto(txSnapshotProto, &txSnapshots) + if err != nil { + return nil, err + } + err = dataEntryFromProto(scheme, txSnapshotProto, &txSnapshots) + if err != nil { + return nil, err + } + err = sponsorshipFromProto(txSnapshotProto, &txSnapshots) + if err != nil { + return nil, err + } + var sn TransactionStatusSnapshot + err = sn.FromProtobuf(txSnapshotProto.TransactionStatus) + if err != nil { + return nil, err + } + txSnapshots = append(txSnapshots, sn) + return txSnapshots, nil +} + type ProtobufConverter struct { FallbackChainID byte err error diff --git a/pkg/proto/snapshot_types.go b/pkg/proto/snapshot_types.go index 78fa771d5..ca9f14c5f 100644 --- a/pkg/proto/snapshot_types.go +++ b/pkg/proto/snapshot_types.go @@ -3,16 +3,19 @@ package proto import ( "math/big" + "github.com/pkg/errors" + "github.com/wavesplatform/gowaves/pkg/crypto" + g "github.com/wavesplatform/gowaves/pkg/grpc/generated/waves" ) type AtomicSnapshot interface { Apply(SnapshotApplier) error /* TODO remove it. It is temporarily used to mark snapshots generated by tx diff that shouldn't be applied, - because balances diffs are applied later in the block. */ + because balances diffs are applied later in the block. */ IsGeneratedByTxDiff() bool + AppendToProtobuf(txSnapshots *g.TransactionStateSnapshot) error } - type WavesBalanceSnapshot struct { Address WavesAddress Balance uint64 @@ -24,6 +27,40 @@ func (s WavesBalanceSnapshot) IsGeneratedByTxDiff() bool { func (s WavesBalanceSnapshot) Apply(a SnapshotApplier) error { return a.ApplyWavesBalance(s) } +func (s WavesBalanceSnapshot) ToProtobuf() (*g.TransactionStateSnapshot_Balance, error) { + return &g.TransactionStateSnapshot_Balance{ + Address: s.Address.Body(), + Amount: &g.Amount{ + AssetId: nil, + Amount: int64(s.Balance), + }, + }, nil +} + +func (s WavesBalanceSnapshot) AppendToProtobuf(txSnapshots *g.TransactionStateSnapshot) error { + snapshotInProto, err := s.ToProtobuf() + if err != nil { + return err + } + txSnapshots.Balances = append(txSnapshots.Balances, snapshotInProto) + return nil +} + +func (s *WavesBalanceSnapshot) FromProtobuf(scheme Scheme, p *g.TransactionStateSnapshot_Balance) error { + var c ProtobufConverter + addr, err := c.Address(scheme, p.Address) + if err != nil { + return err + } + amount := c.amount(p.Amount) + if c.err != nil { + return err + } + s.Address = addr + s.Balance = amount + return nil +} + type AssetBalanceSnapshot struct { Address WavesAddress AssetID crypto.Digest @@ -36,6 +73,45 @@ func (s AssetBalanceSnapshot) IsGeneratedByTxDiff() bool { func (s AssetBalanceSnapshot) Apply(a SnapshotApplier) error { return a.ApplyAssetBalance(s) } +func (s AssetBalanceSnapshot) ToProtobuf() (*g.TransactionStateSnapshot_Balance, error) { + return &g.TransactionStateSnapshot_Balance{ + Address: s.Address.Body(), + Amount: &g.Amount{ + AssetId: s.AssetID.Bytes(), + Amount: int64(s.Balance), + }, + }, nil +} + +func (s *AssetBalanceSnapshot) FromProtobuf(scheme Scheme, p *g.TransactionStateSnapshot_Balance) error { + var c ProtobufConverter + addr, err := c.Address(scheme, p.Address) + if err != nil { + return err + } + amount := c.amount(p.Amount) + if c.err != nil { + return c.err + } + asset := c.extractOptionalAsset(p.Amount) + if c.err != nil { + return c.err + } + s.Address = addr + s.Balance = amount + s.AssetID = asset.ID + return nil +} + +func (s AssetBalanceSnapshot) AppendToProtobuf(txSnapshots *g.TransactionStateSnapshot) error { + snapshotInProto, err := s.ToProtobuf() + if err != nil { + return err + } + txSnapshots.Balances = append(txSnapshots.Balances, snapshotInProto) + return nil +} + type DataEntriesSnapshot struct { // AccountData in pb Address WavesAddress DataEntries []DataEntry @@ -47,6 +123,44 @@ func (s DataEntriesSnapshot) IsGeneratedByTxDiff() bool { func (s DataEntriesSnapshot) Apply(a SnapshotApplier) error { return a.ApplyDataEntries(s) } +func (s DataEntriesSnapshot) ToProtobuf() (*g.TransactionStateSnapshot_AccountData, error) { + entries := make([]*g.DataTransactionData_DataEntry, 0, len(s.DataEntries)) + for _, e := range s.DataEntries { + entries = append(entries, e.ToProtobuf()) + } + return &g.TransactionStateSnapshot_AccountData{ + Address: s.Address.Body(), + Entries: entries, + }, nil +} + +func (s DataEntriesSnapshot) AppendToProtobuf(txSnapshots *g.TransactionStateSnapshot) error { + snapshotInProto, err := s.ToProtobuf() + if err != nil { + return err + } + txSnapshots.AccountData = append(txSnapshots.AccountData, snapshotInProto) + return nil +} + +func (s *DataEntriesSnapshot) FromProtobuf(scheme Scheme, p *g.TransactionStateSnapshot_AccountData) error { + var c ProtobufConverter + addr, err := c.Address(scheme, p.Address) + if err != nil { + return err + } + dataEntries := make([]DataEntry, 0, len(p.Entries)) + for _, e := range p.Entries { + dataEntries = append(dataEntries, c.entry(e)) + if c.err != nil { + return c.err + } + } + s.Address = addr + s.DataEntries = dataEntries + return nil +} + type AccountScriptSnapshot struct { SenderPublicKey crypto.PublicKey Script Script @@ -59,6 +173,39 @@ func (s AccountScriptSnapshot) IsGeneratedByTxDiff() bool { func (s AccountScriptSnapshot) Apply(a SnapshotApplier) error { return a.ApplyAccountScript(s) } +func (s AccountScriptSnapshot) ToProtobuf() (*g.TransactionStateSnapshot_AccountScript, error) { + return &g.TransactionStateSnapshot_AccountScript{ + SenderPublicKey: s.SenderPublicKey.Bytes(), + Script: s.Script, + VerifierComplexity: int64(s.VerifierComplexity), + }, nil +} + +func (s AccountScriptSnapshot) AppendToProtobuf(txSnapshots *g.TransactionStateSnapshot) error { + snapshotInProto, err := s.ToProtobuf() + if err != nil { + return err + } + txSnapshots.AccountScripts = append(txSnapshots.AccountScripts, snapshotInProto) + return nil +} + +func (s *AccountScriptSnapshot) FromProtobuf(p *g.TransactionStateSnapshot_AccountScript) error { + var c ProtobufConverter + publicKey := c.publicKey(p.SenderPublicKey) + if c.err != nil { + return c.err + } + script := c.script(p.Script) + if c.err != nil { + return c.err + } + s.SenderPublicKey = publicKey + s.Script = script + s.VerifierComplexity = uint64(p.VerifierComplexity) + return nil +} + type AssetScriptSnapshot struct { AssetID crypto.Digest Script Script @@ -70,6 +217,37 @@ func (s AssetScriptSnapshot) IsGeneratedByTxDiff() bool { func (s AssetScriptSnapshot) Apply(a SnapshotApplier) error { return a.ApplyAssetScript(s) } +func (s AssetScriptSnapshot) ToProtobuf() (*g.TransactionStateSnapshot_AssetScript, error) { + return &g.TransactionStateSnapshot_AssetScript{ + AssetId: s.AssetID.Bytes(), + Script: s.Script, + }, nil +} + +func (s AssetScriptSnapshot) AppendToProtobuf(txSnapshots *g.TransactionStateSnapshot) error { + snapshotInProto, err := s.ToProtobuf() + if err != nil { + return err + } + txSnapshots.AssetScripts = append(txSnapshots.AssetScripts, snapshotInProto) + return nil +} + +func (s *AssetScriptSnapshot) FromProtobuf(p *g.TransactionStateSnapshot_AssetScript) error { + var c ProtobufConverter + asset := c.optionalAsset(p.AssetId) + if c.err != nil { + return c.err + } + script := c.script(p.Script) + if c.err != nil { + return c.err + } + s.AssetID = asset.ID + s.Script = script + return nil +} + type LeaseBalanceSnapshot struct { Address WavesAddress LeaseIn uint64 @@ -82,6 +260,35 @@ func (s LeaseBalanceSnapshot) IsGeneratedByTxDiff() bool { func (s LeaseBalanceSnapshot) Apply(a SnapshotApplier) error { return a.ApplyLeaseBalance(s) } +func (s LeaseBalanceSnapshot) ToProtobuf() (*g.TransactionStateSnapshot_LeaseBalance, error) { + return &g.TransactionStateSnapshot_LeaseBalance{ + Address: s.Address.Body(), + In: int64(s.LeaseIn), + Out: int64(s.LeaseOut), + }, nil +} + +func (s LeaseBalanceSnapshot) AppendToProtobuf(txSnapshots *g.TransactionStateSnapshot) error { + snapshotInProto, err := s.ToProtobuf() + if err != nil { + return err + } + txSnapshots.LeaseBalances = append(txSnapshots.LeaseBalances, snapshotInProto) + return nil +} + +func (s *LeaseBalanceSnapshot) FromProtobuf(scheme Scheme, p *g.TransactionStateSnapshot_LeaseBalance) error { + var c ProtobufConverter + addr, err := c.Address(scheme, p.Address) + if err != nil { + return err + } + s.Address = addr + s.LeaseIn = uint64(p.In) + s.LeaseOut = uint64(p.Out) + return nil +} + type LeaseStateStatus interface{ leaseStateStatusMarker() } type LeaseStateStatusActive struct { @@ -107,6 +314,69 @@ func (s LeaseStateSnapshot) IsGeneratedByTxDiff() bool { func (s LeaseStateSnapshot) Apply(a SnapshotApplier) error { return a.ApplyLeaseState(s) } +func (s LeaseStateSnapshot) ToProtobuf() (*g.TransactionStateSnapshot_LeaseState, error) { + res := &g.TransactionStateSnapshot_LeaseState{ + LeaseId: s.LeaseID.Bytes(), + Status: nil, + } + switch status := s.Status.(type) { + case *LeaseStateStatusActive: + res.Status = &g.TransactionStateSnapshot_LeaseState_Active_{ + Active: &g.TransactionStateSnapshot_LeaseState_Active{ + Amount: int64(status.Amount), + Sender: status.Sender.Body(), + Recipient: status.Recipient.Body(), + }, + } + case *LeaseStatusCancelled: + res.Status = &g.TransactionStateSnapshot_LeaseState_Cancelled_{ + Cancelled: &g.TransactionStateSnapshot_LeaseState_Cancelled{}, + } + default: + return nil, errors.Errorf("failed to serialize LeaseStateSnapshot to Proto: invalid Lease status") + } + return res, nil +} + +func (s LeaseStateSnapshot) AppendToProtobuf(txSnapshots *g.TransactionStateSnapshot) error { + snapshotInProto, err := s.ToProtobuf() + if err != nil { + return err + } + txSnapshots.LeaseStates = append(txSnapshots.LeaseStates, snapshotInProto) + return nil +} + +func (s *LeaseStateSnapshot) FromProtobuf(scheme Scheme, p *g.TransactionStateSnapshot_LeaseState) error { + var c ProtobufConverter + leaseID := c.digest(p.LeaseId) + if c.err != nil { + return c.err + } + var status LeaseStateStatus + if active := p.GetActive(); active != nil { + sender, errAddressFromBytes := c.Address(scheme, active.Sender) + if errAddressFromBytes != nil { + return errAddressFromBytes + } + recipientAddr, errAddressFromBytes := c.Address(scheme, active.Recipient) + if errAddressFromBytes != nil { + return errAddressFromBytes + } + res := LeaseStateStatusActive{ + Amount: uint64(active.Amount), + Sender: sender, + Recipient: recipientAddr, + } + status = &res + } else if cancel := p.GetCancelled(); cancel != nil { + status = &LeaseStatusCancelled{} + } + s.LeaseID = leaseID + s.Status = status + return nil +} + type SponsorshipSnapshot struct { AssetID crypto.Digest MinSponsoredFee uint64 @@ -118,6 +388,33 @@ func (s SponsorshipSnapshot) IsGeneratedByTxDiff() bool { func (s SponsorshipSnapshot) Apply(a SnapshotApplier) error { return a.ApplySponsorship(s) } +func (s SponsorshipSnapshot) ToProtobuf() (*g.TransactionStateSnapshot_Sponsorship, error) { + return &g.TransactionStateSnapshot_Sponsorship{ + AssetId: s.AssetID.Bytes(), + MinFee: int64(s.MinSponsoredFee), + }, nil +} + +func (s SponsorshipSnapshot) AppendToProtobuf(txSnapshots *g.TransactionStateSnapshot) error { + snapshotInProto, err := s.ToProtobuf() + if err != nil { + return err + } + txSnapshots.Sponsorships = append(txSnapshots.Sponsorships, snapshotInProto) + return nil +} + +func (s *SponsorshipSnapshot) FromProtobuf(p *g.TransactionStateSnapshot_Sponsorship) error { + var c ProtobufConverter + asset := c.optionalAsset(p.AssetId) + if c.err != nil { + return c.err + } + s.AssetID = asset.ID + s.MinSponsoredFee = uint64(p.MinFee) + return nil +} + type AliasSnapshot struct { Address WavesAddress Alias Alias @@ -129,6 +426,33 @@ func (s AliasSnapshot) IsGeneratedByTxDiff() bool { func (s AliasSnapshot) Apply(a SnapshotApplier) error { return a.ApplyAlias(s) } +func (s AliasSnapshot) ToProtobuf() (*g.TransactionStateSnapshot_Alias, error) { + return &g.TransactionStateSnapshot_Alias{ + Address: s.Address.Body(), + Alias: s.Alias.Alias, + }, nil +} + +func (s AliasSnapshot) AppendToProtobuf(txSnapshots *g.TransactionStateSnapshot) error { + snapshotInProto, err := s.ToProtobuf() + if err != nil { + return err + } + txSnapshots.Aliases = append(txSnapshots.Aliases, snapshotInProto) + return nil +} + +func (s *AliasSnapshot) FromProtobuf(scheme Scheme, p *g.TransactionStateSnapshot_Alias) error { + var c ProtobufConverter + addr, err := c.Address(scheme, p.Address) + if err != nil { + return err + } + s.Address = addr + s.Alias.Alias = p.Alias + return nil +} + // FilledVolumeFeeSnapshot Filled Volume and Fee. type FilledVolumeFeeSnapshot struct { // OrderFill OrderID crypto.Digest @@ -142,6 +466,35 @@ func (s FilledVolumeFeeSnapshot) IsGeneratedByTxDiff() bool { func (s FilledVolumeFeeSnapshot) Apply(a SnapshotApplier) error { return a.ApplyFilledVolumeAndFee(s) } +func (s FilledVolumeFeeSnapshot) ToProtobuf() (*g.TransactionStateSnapshot_OrderFill, error) { + return &g.TransactionStateSnapshot_OrderFill{ + OrderId: s.OrderID.Bytes(), + Volume: int64(s.FilledVolume), + Fee: int64(s.FilledFee), + }, nil +} + +func (s FilledVolumeFeeSnapshot) AppendToProtobuf(txSnapshots *g.TransactionStateSnapshot) error { + snapshotInProto, err := s.ToProtobuf() + if err != nil { + return err + } + txSnapshots.OrderFills = append(txSnapshots.OrderFills, snapshotInProto) + return nil +} + +func (s *FilledVolumeFeeSnapshot) FromProtobuf(p *g.TransactionStateSnapshot_OrderFill) error { + var c ProtobufConverter + orderID := c.digest(p.OrderId) + if c.err != nil { + return c.err + } + s.OrderID = orderID + s.FilledVolume = uint64(p.Volume) + s.FilledFee = uint64(p.Fee) + return nil +} + type StaticAssetInfoSnapshot struct { AssetID crypto.Digest SourceTransactionID crypto.Digest @@ -156,6 +509,47 @@ func (s StaticAssetInfoSnapshot) IsGeneratedByTxDiff() bool { func (s StaticAssetInfoSnapshot) Apply(a SnapshotApplier) error { return a.ApplyStaticAssetInfo(s) } +func (s StaticAssetInfoSnapshot) ToProtobuf() (*g.TransactionStateSnapshot_AssetStatic, error) { + return &g.TransactionStateSnapshot_AssetStatic{ + AssetId: s.AssetID.Bytes(), + SourceTransactionId: s.SourceTransactionID.Bytes(), + IssuerPublicKey: s.IssuerPublicKey.Bytes(), + Decimals: int32(s.Decimals), + Nft: s.IsNFT, + }, nil +} + +func (s StaticAssetInfoSnapshot) AppendToProtobuf(txSnapshots *g.TransactionStateSnapshot) error { + snapshotInProto, err := s.ToProtobuf() + if err != nil { + return err + } + txSnapshots.AssetStatics = append(txSnapshots.AssetStatics, snapshotInProto) + return nil +} + +func (s *StaticAssetInfoSnapshot) FromProtobuf(p *g.TransactionStateSnapshot_AssetStatic) error { + var c ProtobufConverter + assetID := c.digest(p.AssetId) + if c.err != nil { + return c.err + } + txID := c.digest(p.SourceTransactionId) + if c.err != nil { + return c.err + } + publicKey := c.publicKey(p.IssuerPublicKey) + if c.err != nil { + return c.err + } + s.AssetID = assetID + s.SourceTransactionID = txID + s.IssuerPublicKey = publicKey + s.Decimals = uint8(p.Decimals) + s.IsNFT = p.Nft + return nil +} + type AssetVolumeSnapshot struct { // AssetVolume in pb AssetID crypto.Digest TotalQuantity big.Int // volume in protobuf @@ -168,6 +562,36 @@ func (s AssetVolumeSnapshot) IsGeneratedByTxDiff() bool { func (s AssetVolumeSnapshot) Apply(a SnapshotApplier) error { return a.ApplyAssetVolume(s) } +func (s AssetVolumeSnapshot) ToProtobuf() (*g.TransactionStateSnapshot_AssetVolume, error) { + return &g.TransactionStateSnapshot_AssetVolume{ + AssetId: s.AssetID.Bytes(), + Reissuable: s.IsReissuable, + Volume: s.TotalQuantity.Bytes(), + }, nil +} + +func (s AssetVolumeSnapshot) AppendToProtobuf(txSnapshots *g.TransactionStateSnapshot) error { + snapshotInProto, err := s.ToProtobuf() + if err != nil { + return err + } + txSnapshots.AssetVolumes = append(txSnapshots.AssetVolumes, snapshotInProto) + return nil +} + +func (s *AssetVolumeSnapshot) FromProtobuf(p *g.TransactionStateSnapshot_AssetVolume) error { + var c ProtobufConverter + assetID := c.digest(p.AssetId) + if c.err != nil { + return c.err + } + + s.AssetID = assetID + s.TotalQuantity.SetBytes(p.Volume) + s.IsReissuable = p.Reissuable + return nil +} + type AssetDescriptionSnapshot struct { // AssetNameAndDescription in pb AssetID crypto.Digest AssetName string @@ -181,6 +605,38 @@ func (s AssetDescriptionSnapshot) IsGeneratedByTxDiff() bool { func (s AssetDescriptionSnapshot) Apply(a SnapshotApplier) error { return a.ApplyAssetDescription(s) } +func (s AssetDescriptionSnapshot) ToProtobuf() (*g.TransactionStateSnapshot_AssetNameAndDescription, error) { + return &g.TransactionStateSnapshot_AssetNameAndDescription{ + AssetId: s.AssetID.Bytes(), + Name: s.AssetName, + Description: s.AssetDescription, + LastUpdated: int32(s.ChangeHeight), + }, nil +} + +func (s AssetDescriptionSnapshot) AppendToProtobuf(txSnapshots *g.TransactionStateSnapshot) error { + snapshotInProto, err := s.ToProtobuf() + if err != nil { + return err + } + txSnapshots.AssetNamesAndDescriptions = append(txSnapshots.AssetNamesAndDescriptions, snapshotInProto) + return nil +} + +func (s *AssetDescriptionSnapshot) FromProtobuf(p *g.TransactionStateSnapshot_AssetNameAndDescription) error { + var c ProtobufConverter + assetID := c.digest(p.AssetId) + if c.err != nil { + return c.err + } + + s.AssetID = assetID + s.AssetName = p.Name + s.AssetDescription = p.Description + s.ChangeHeight = uint64(p.LastUpdated) + return nil +} + type TransactionStatusSnapshot struct { TransactionID crypto.Digest Status TransactionStatus @@ -194,6 +650,34 @@ func (s TransactionStatusSnapshot) IsGeneratedByTxDiff() bool { return false } +func (s *TransactionStatusSnapshot) FromProtobuf(p g.TransactionStatus) error { + switch p { + case g.TransactionStatus_SUCCEEDED: + s.Status = TransactionSucceeded + case g.TransactionStatus_FAILED: + s.Status = TransactionFailed + case g.TransactionStatus_ELIDED: + s.Status = TransactionElided + default: + return errors.Errorf("undefinded tx status %d", p) + } + return nil +} + +func (s TransactionStatusSnapshot) AppendToProtobuf(txSnapshots *g.TransactionStateSnapshot) error { + switch s.Status { + case TransactionSucceeded: + txSnapshots.TransactionStatus = g.TransactionStatus_SUCCEEDED + case TransactionElided: + txSnapshots.TransactionStatus = g.TransactionStatus_ELIDED + case TransactionFailed: + txSnapshots.TransactionStatus = g.TransactionStatus_FAILED + default: + return errors.Errorf("undefined tx status %d", s.Status) + } + return nil +} + type SnapshotApplier interface { ApplyWavesBalance(snapshot WavesBalanceSnapshot) error ApplyLeaseBalance(snapshot LeaseBalanceSnapshot) error diff --git a/pkg/proto/types.go b/pkg/proto/types.go index 665e1c20e..5c3f38563 100644 --- a/pkg/proto/types.go +++ b/pkg/proto/types.go @@ -63,6 +63,7 @@ const ( MaxAssetScriptActionsV3 = 30 base64EncodingSizeLimit = 1024 base64EncodingPrefix = "base64:" + uint32Size = 4 ) type Timestamp = uint64 @@ -3062,6 +3063,18 @@ func (s *ScriptInfo) ToProtobuf() *pb.ScriptData { } } +func (s *ScriptInfo) ToScriptResponseProtobuf() *pb.ScriptResponse { + if s == nil { + return &pb.ScriptResponse{} + } + return &pb.ScriptResponse{ + ScriptBytes: s.Bytes, + ScriptText: base64.StdEncoding.EncodeToString(s.Bytes), + Complexity: int64(s.Complexity), + PublicKey: nil, + } +} + func VersionFromScriptBytes(scriptBytes []byte) (int32, error) { if len(scriptBytes) == 0 { // No script has 0 version. diff --git a/pkg/ride/meta/generated/dapp_meta.pb.go b/pkg/ride/meta/generated/dapp_meta.pb.go index 51c7ccd15..719b08123 100644 --- a/pkg/ride/meta/generated/dapp_meta.pb.go +++ b/pkg/ride/meta/generated/dapp_meta.pb.go @@ -1,7 +1,7 @@ // Code generated by protoc-gen-go. DO NOT EDIT. // versions: // protoc-gen-go v1.27.1 -// protoc v3.21.12 +// protoc v4.24.4 // source: waves/lang/dapp_meta.proto package generated diff --git a/pkg/state/api.go b/pkg/state/api.go index 983f09472..6a636a1b6 100644 --- a/pkg/state/api.go +++ b/pkg/state/api.go @@ -4,14 +4,13 @@ import ( "math/big" "runtime" - "github.com/wavesplatform/gowaves/pkg/crypto" - "github.com/wavesplatform/gowaves/pkg/ride/ast" - "github.com/pkg/errors" + "github.com/wavesplatform/gowaves/pkg/crypto" "github.com/wavesplatform/gowaves/pkg/keyvalue" "github.com/wavesplatform/gowaves/pkg/libs/ntptime" "github.com/wavesplatform/gowaves/pkg/proto" + "github.com/wavesplatform/gowaves/pkg/ride/ast" "github.com/wavesplatform/gowaves/pkg/settings" "github.com/wavesplatform/gowaves/pkg/types" ) @@ -137,6 +136,9 @@ type StateInfo interface { RewardAtHeight(height proto.Height) (uint64, error) RewardVotes(height proto.Height) (proto.RewardVotes, error) TotalWavesAmount(height proto.Height) (uint64, error) + + // Snapshots + SnapshotsAtHeight(height proto.Height) (proto.BlockSnapshot, error) } // StateModifier contains all the methods needed to modify node's state. diff --git a/pkg/state/appender.go b/pkg/state/appender.go index 108f98957..f8d0306cf 100644 --- a/pkg/state/appender.go +++ b/pkg/state/appender.go @@ -454,7 +454,99 @@ func (a *txAppender) handleDefaultTransaction(tx proto.Transaction, params *appe return newApplicationResult(true, txScriptsRuns, txChanges, checkerData), nil } -func (a *txAppender) appendTx(tx proto.Transaction, params *appendTxParams) error { +func (a *txAppender) handleEthTx( + tx proto.Transaction, + params *appendTxParams, + accountHasVerifierScript bool, + senderAddr proto.Address, +) (*applicationResult, *invocationResult, bool, error) { + var applicationRes *applicationResult + var invocationRes *invocationResult + needToValidateBalanceDiff := false + ethTx, ok := tx.(*proto.EthereumTransaction) + if !ok { + return nil, nil, false, errors.New("failed to cast interface transaction to ethereum transaction structure") + } + kind, errResolveTx := a.ethTxKindResolver.ResolveTxKind(ethTx, params.blockRewardDistributionActivated) + if errResolveTx != nil { + return nil, nil, false, errors.Wrap(errResolveTx, "failed to guess ethereum transaction kind") + } + ethTx.TxKind = kind + var err error + switch ethTx.TxKind.(type) { + case *proto.EthereumTransferWavesTxKind, *proto.EthereumTransferAssetsErc20TxKind: + applicationRes, err = a.handleDefaultTransaction(tx, params, accountHasVerifierScript) + if err != nil { + return nil, nil, false, errors.Wrapf(err, + "failed to handle ethereum transaction (type %s) with id %s, on height %d", + ethTx.TxKind.String(), ethTx.ID.String(), params.checkerInfo.height+1) + } + // In UTX balances are always validated. + needToValidateBalanceDiff = params.validatingUtx + case *proto.EthereumInvokeScriptTxKind: + fallibleInfo := &fallibleValidationParams{ + appendTxParams: params, + senderScripted: accountHasVerifierScript, + senderAddress: senderAddr, + } + invocationRes, applicationRes, err = a.handleInvokeOrExchangeTransaction(tx, fallibleInfo) + if err != nil { + return nil, nil, false, errors.Wrapf(err, + "failed to handle ethereum invoke script transaction (type %s) with id %s, on height %d", + ethTx.TxKind.String(), ethTx.ID.String(), params.checkerInfo.height+1) + } + default: + return nil, nil, false, errors.Errorf("Undefined ethereum transaction kind %T", ethTx.TxKind) + } + return applicationRes, invocationRes, needToValidateBalanceDiff, nil +} + +func (a *txAppender) handleTxAndScripts( + tx proto.Transaction, + params *appendTxParams, + accountHasVerifierScript bool, + senderAddr proto.Address, +) (*applicationResult, *invocationResult, bool, error) { + switch tx.GetTypeInfo().Type { + case proto.InvokeScriptTransaction, proto.InvokeExpressionTransaction, proto.ExchangeTransaction: + // Invoke and Exchange transactions should be handled differently. + // They may fail, and will be saved to blockchain anyway. + fallibleInfo := &fallibleValidationParams{ + appendTxParams: params, + senderScripted: accountHasVerifierScript, + senderAddress: senderAddr, + } + + invocationRes, applicationRes, err := a.handleInvokeOrExchangeTransaction(tx, fallibleInfo) + if err != nil { + return nil, nil, false, errors.Wrap(err, "failed to handle invoke or exchange transaction") + } + // Exchange and Invoke balances are validated in UTX when acceptFailed is false. + // When acceptFailed is true, balances are validated inside handleFallible(). + needToValidateBalanceDiff := params.validatingUtx && !params.acceptFailed + return applicationRes, invocationRes, needToValidateBalanceDiff, nil + case proto.EthereumMetamaskTransaction: + return a.handleEthTx(tx, params, accountHasVerifierScript, senderAddr) + case proto.GenesisTransaction, proto.PaymentTransaction, proto.IssueTransaction, proto.TransferTransaction, + proto.ReissueTransaction, proto.BurnTransaction, proto.LeaseTransaction, proto.LeaseCancelTransaction, + proto.CreateAliasTransaction, proto.MassTransferTransaction, proto.DataTransaction, proto.SetScriptTransaction, + proto.SponsorshipTransaction, proto.SetAssetScriptTransaction, proto.UpdateAssetInfoTransaction: + applicationRes, err := a.handleDefaultTransaction(tx, params, accountHasVerifierScript) + if err != nil { + id, idErr := tx.GetID(a.settings.AddressSchemeCharacter) + if idErr != nil { + return nil, nil, false, errors.Wrap(err, "failed to generate transaction ID") + } + return nil, nil, false, errors.Wrapf(err, "failed to handle transaction '%s'", base58.Encode(id)) + } + // In UTX balances are always validated. + return applicationRes, nil, params.validatingUtx, nil + default: + return nil, nil, false, errors.Errorf("Undefined transaction type %d", tx.GetTypeInfo()) + } +} + +func (a *txAppender) appendTx(tx proto.Transaction, params *appendTxParams) (txSnapshot, error) { defer func() { a.sc.resetRecentTxComplexity() a.stor.dropUncertain() @@ -463,121 +555,69 @@ func (a *txAppender) appendTx(tx proto.Transaction, params *appendTxParams) erro blockID := params.checkerInfo.blockID // Check that Protobuf transactions are accepted. if err := a.checkProtobufVersion(tx, params.blockV5Activated); err != nil { - return err + return txSnapshot{}, err } // Check transaction for duplication of its ID. if err := a.checkDuplicateTxIds(tx, a.recentTxIds, params.block.Timestamp); err != nil { - return errs.Extend(err, "check duplicate tx ids") + return txSnapshot{}, errs.Extend(err, "check duplicate tx ids") } // Verify tx signature and internal data correctness. senderAddr, err := tx.GetSender(a.settings.AddressSchemeCharacter) if err != nil { - return errs.Extend(err, "failed to get sender addr by pk") + return txSnapshot{}, errs.Extend(err, "failed to get sender addr by pk") } // senderWavesAddr needs only for newestAccountHasVerifier check senderWavesAddr, err := senderAddr.ToWavesAddress(a.settings.AddressSchemeCharacter) if err != nil { - return errors.Wrapf(err, "failed to transform (%T) address type to WavesAddress type", senderAddr) + return txSnapshot{}, errors.Wrapf(err, "failed to transform (%T) address type to WavesAddress type", senderAddr) } accountHasVerifierScript, err := a.stor.scriptsStorage.newestAccountHasVerifier(senderWavesAddr) if err != nil { - return errs.Extend(err, "account has verifier") + return txSnapshot{}, errs.Extend(err, "account has verifier") } - if err := a.verifyWavesTxSigAndData(tx, params, accountHasVerifierScript); err != nil { - return errs.Extend(err, "tx signature or data verification failed") + if err = a.verifyWavesTxSigAndData(tx, params, accountHasVerifierScript); err != nil { + return txSnapshot{}, errs.Extend(err, "tx signature or data verification failed") } // Check tx against state, check tx scripts, calculate balance changes. - var applicationRes *applicationResult - var invocationResult *invocationResult - needToValidateBalanceDiff := false - switch tx.GetTypeInfo().Type { - case proto.InvokeScriptTransaction, proto.InvokeExpressionTransaction, proto.ExchangeTransaction: - // Invoke and Exchange transactions should be handled differently. - // They may fail, and will be saved to blockchain anyway. - fallibleInfo := &fallibleValidationParams{appendTxParams: params, senderScripted: accountHasVerifierScript, senderAddress: senderAddr} - invocationResult, applicationRes, err = a.handleInvokeOrExchangeTransaction(tx, fallibleInfo) - if err != nil { - return errors.Wrap(err, "failed to handle invoke or exchange transaction") - } - // Exchange and Invoke balances are validated in UTX when acceptFailed is false. - // When acceptFailed is true, balances are validated inside handleFallible(). - needToValidateBalanceDiff = params.validatingUtx && !params.acceptFailed - case proto.EthereumMetamaskTransaction: - ethTx, ok := tx.(*proto.EthereumTransaction) - if !ok { - return errors.New("failed to cast interface transaction to ethereum transaction structure") - } - kind, err := a.ethTxKindResolver.ResolveTxKind(ethTx, params.blockRewardDistributionActivated) - if err != nil { - return errors.Wrap(err, "failed to guess ethereum transaction kind") - } - ethTx.TxKind = kind - - switch ethTx.TxKind.(type) { - case *proto.EthereumTransferWavesTxKind, *proto.EthereumTransferAssetsErc20TxKind: - applicationRes, err = a.handleDefaultTransaction(tx, params, accountHasVerifierScript) - if err != nil { - return errors.Wrapf(err, "failed to handle ethereum transaction (type %s) with id %s, on height %d", - ethTx.TxKind.String(), ethTx.ID.String(), params.checkerInfo.height+1) - } - // In UTX balances are always validated. - needToValidateBalanceDiff = params.validatingUtx - case *proto.EthereumInvokeScriptTxKind: - fallibleInfo := &fallibleValidationParams{ - appendTxParams: params, - senderScripted: accountHasVerifierScript, - senderAddress: senderAddr, - } - invocationResult, applicationRes, err = a.handleInvokeOrExchangeTransaction(tx, fallibleInfo) - if err != nil { - return errors.Wrapf(err, "failed to handle ethereum invoke script transaction (type %s) with id %s, on height %d", - ethTx.TxKind.String(), ethTx.ID.String(), params.checkerInfo.height+1) - } - } - default: - applicationRes, err = a.handleDefaultTransaction(tx, params, accountHasVerifierScript) - if err != nil { - id, idErr := tx.GetID(a.settings.AddressSchemeCharacter) - if idErr != nil { - return errors.Wrap(err, "failed to generate transaction ID") - } - return errors.Wrapf(err, "failed to handle transaction '%s'", base58.Encode(id)) - } - // In UTX balances are always validated. - needToValidateBalanceDiff = params.validatingUtx + applicationRes, invocationResult, needToValidateBalanceDiff, err := + a.handleTxAndScripts(tx, params, accountHasVerifierScript, senderAddr) + if err != nil { + return txSnapshot{}, err } if needToValidateBalanceDiff { // Validate balance diff for negative balances. - if err := a.diffApplier.validateTxDiff(applicationRes.changes.diff, a.diffStor); err != nil { - return errs.Extend(err, "validate transaction diff") + if err = a.diffApplier.validateTxDiff(applicationRes.changes.diff, a.diffStor); err != nil { + return txSnapshot{}, errs.Extend(err, "validate transaction diff") } } // Check complexity limits and scripts runs limits. if err := a.checkScriptsLimits(a.totalScriptsRuns+applicationRes.totalScriptsRuns, blockID); err != nil { - return errs.Extend(errors.Errorf("%s: %v", blockID.String(), err), "check scripts limits") + return txSnapshot{}, errs.Extend(errors.Errorf("%s: %v", blockID.String(), err), "check scripts limits") } // Perform state changes, save balance changes, write tx to storage. txID, err := tx.GetID(a.settings.AddressSchemeCharacter) if err != nil { - return errs.Extend(err, "get transaction id") + return txSnapshot{}, errs.Extend(err, "get transaction id") } // invocationResult may be empty if it was not an Invoke Transaction - _, err = a.commitTxApplication(tx, params, invocationResult, applicationRes) + + snapshot, err := a.commitTxApplication(tx, params, invocationResult, applicationRes) + if err != nil { zap.S().Errorf("failed to commit transaction (id %s) after successful validation; this should NEVER happen", base58.Encode(txID)) - return err + return txSnapshot{}, err } // Store additional data for API: transaction by address. if !params.validatingUtx && a.buildApiData { - if err := a.saveTransactionIdByAddresses(applicationRes.changes.addresses(), txID, blockID); err != nil { - return errs.Extend(err, "save transaction id by addresses") + if err = a.saveTransactionIdByAddresses(applicationRes.changes.addresses(), txID, blockID); err != nil { + return txSnapshot{}, errs.Extend(err, "save transaction id by addresses") } } - return nil + return snapshot, nil } // rewards and 60% of the fee to the previous miner. @@ -680,6 +720,7 @@ func (a *txAppender) appendBlock(params *appendBlockParams) error { return err } // Check and append transactions. + var blockSnapshots proto.BlockSnapshot for _, tx := range params.transactions { appendTxArgs := &appendTxParams{ @@ -698,16 +739,18 @@ func (a *txAppender) appendBlock(params *appendBlockParams) error { stateActionsCounterInBlock: stateActionsCounterInBlockValidation, currentMinerPK: params.block.GeneratorPublicKey, } - if err := a.appendTx(tx, appendTxArgs); err != nil { - return err + txSnapshots, errAppendTx := a.appendTx(tx, appendTxArgs) + if errAppendTx != nil { + return errAppendTx } + blockSnapshots.AppendTxSnapshot(txSnapshots.regular) } - // Save fee distribution of this block. - // This will be needed for createMinerAndRewardDiff() of next block due to NG. - if err := a.blockDiffer.saveCurFeeDistr(params.block); err != nil { + if err = a.stor.snapshots.saveSnapshots(params.block.BlockID(), params.height, blockSnapshots); err != nil { return err } - return nil + // Save fee distribution of this block. + // This will be needed for createMinerAndRewardDiff() of next block due to NG. + return a.blockDiffer.saveCurFeeDistr(params.block) } // used only in tests now. All diffs are applied in snapshotApplier. @@ -962,7 +1005,7 @@ func (a *txAppender) validateNextTx(tx proto.Transaction, currentTimestamp, pare // it's correct to use new counter because there's no block exists, but this field is necessary in tx performer stateActionsCounterInBlock: issueCounterInBlock, } - err = a.appendTx(tx, appendTxArgs) + _, err = a.appendTx(tx, appendTxArgs) if err != nil { return proto.NewInfoMsg(err) } diff --git a/pkg/state/constants.go b/pkg/state/constants.go index b3d50467d..0bdcfdffb 100644 --- a/pkg/state/constants.go +++ b/pkg/state/constants.go @@ -25,7 +25,7 @@ const ( // StateVersion is current version of state internal storage formats. // It increases when backward compatibility with previous storage version is lost. - StateVersion = 18 + StateVersion = 19 // Memory limit for address transactions. flush() is called when this // limit is exceeded. diff --git a/pkg/state/fee_validation.go b/pkg/state/fee_validation.go index 30de235f1..7eb5d08c9 100644 --- a/pkg/state/fee_validation.go +++ b/pkg/state/fee_validation.go @@ -4,6 +4,7 @@ import ( "fmt" "github.com/pkg/errors" + "github.com/wavesplatform/gowaves/pkg/crypto" "github.com/wavesplatform/gowaves/pkg/errs" "github.com/wavesplatform/gowaves/pkg/proto" diff --git a/pkg/state/history_storage.go b/pkg/state/history_storage.go index 5419336c2..cc26ee1d9 100644 --- a/pkg/state/history_storage.go +++ b/pkg/state/history_storage.go @@ -41,6 +41,7 @@ const ( stateHash hitSource feeDistr + snapshots ) type blockchainEntityProperties struct { @@ -188,6 +189,11 @@ var properties = map[blockchainEntity]blockchainEntityProperties{ needToCut: true, fixedSize: false, }, + snapshots: { + needToFilter: true, + needToCut: true, + fixedSize: false, + }, } type historyEntry struct { diff --git a/pkg/state/keys.go b/pkg/state/keys.go index 0601df181..97ea22f38 100644 --- a/pkg/state/keys.go +++ b/pkg/state/keys.go @@ -25,6 +25,7 @@ const ( approvedFeaturesKeySize = 1 + 2 votesFeaturesKeySize = 1 + 2 invokeResultKeySize = 1 + crypto.DigestSize + snapshotKeySize = 1 + 8 ) // Primary prefixes for storage keys @@ -123,6 +124,8 @@ const ( // Hit source data. hitSourceKeyPrefix + + snapshotsKeyPrefix ) var ( @@ -180,6 +183,8 @@ func prefixByEntity(entity blockchainEntity) ([]byte, error) { return []byte{blocksInfoKeyPrefix}, nil case rewardChanges: return []byte{rewardChangesKeyPrefix}, nil + case snapshots: + return []byte{snapshotsKeyPrefix}, nil default: return nil, errors.New("bad entity type") } @@ -685,3 +690,14 @@ func (k *hitSourceKey) bytes() []byte { binary.BigEndian.PutUint64(buf[1:], k.height) return buf } + +type snapshotsKey struct { + height uint64 +} + +func (k *snapshotsKey) bytes() []byte { + buf := make([]byte, snapshotKeySize) + buf[0] = snapshotsKeyPrefix + binary.BigEndian.PutUint64(buf[1:], k.height) + return buf +} diff --git a/pkg/state/snapshot_generator_internal_test.go b/pkg/state/snapshot_generator_internal_test.go index c080a7e31..a228a835e 100644 --- a/pkg/state/snapshot_generator_internal_test.go +++ b/pkg/state/snapshot_generator_internal_test.go @@ -7,6 +7,7 @@ import ( "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" + "github.com/wavesplatform/gowaves/pkg/crypto" "github.com/wavesplatform/gowaves/pkg/proto" "github.com/wavesplatform/gowaves/pkg/ride" diff --git a/pkg/state/snapshot_storage.go b/pkg/state/snapshot_storage.go new file mode 100644 index 000000000..1da0e852b --- /dev/null +++ b/pkg/state/snapshot_storage.go @@ -0,0 +1,40 @@ +package state + +import ( + "github.com/wavesplatform/gowaves/pkg/proto" +) + +type snapshotsAtHeight struct { + hs *historyStorage + scheme proto.Scheme +} + +func newSnapshotsAtHeight(hs *historyStorage, scheme proto.Scheme) *snapshotsAtHeight { + return &snapshotsAtHeight{hs: hs, scheme: scheme} +} + +func (s *snapshotsAtHeight) saveSnapshots( + blockID proto.BlockID, + blockHeight uint64, + txSnapshots proto.BlockSnapshot, +) error { + key := snapshotsKey{height: blockHeight} + blockSnapshotsBytes, err := txSnapshots.MarshallBinary() + if err != nil { + return err + } + return s.hs.addNewEntry(snapshots, key.bytes(), blockSnapshotsBytes, blockID) +} + +func (s *snapshotsAtHeight) getSnapshots(height uint64) (proto.BlockSnapshot, error) { + key := snapshotsKey{height: height} + snapshotsBytes, err := s.hs.newestTopEntryData(key.bytes()) + if err != nil { + return proto.BlockSnapshot{}, err + } + var res proto.BlockSnapshot + if err = res.UnmarshalBinary(snapshotsBytes, s.scheme); err != nil { + return proto.BlockSnapshot{}, err + } + return res, nil +} diff --git a/pkg/state/snapshot_storage_internal_test.go b/pkg/state/snapshot_storage_internal_test.go new file mode 100644 index 000000000..d2cbea059 --- /dev/null +++ b/pkg/state/snapshot_storage_internal_test.go @@ -0,0 +1,32 @@ +package state + +import ( + "testing" + + "github.com/stretchr/testify/assert" + + "github.com/wavesplatform/gowaves/pkg/proto" +) + +func TestSaveSnapshots(t *testing.T) { + storage := createStorageObjects(t, true) + snapshotStor := newSnapshotsAtHeight(storage.hs, storage.settings.AddressSchemeCharacter) + ids := genRandBlockIds(t, 1) + snapshots := proto.BlockSnapshot{ + TxSnapshots: [][]proto.AtomicSnapshot{{ + proto.WavesBalanceSnapshot{Address: *generateRandomRecipient(t).Address(), Balance: 100}, + proto.WavesBalanceSnapshot{Address: *generateRandomRecipient(t).Address(), Balance: 100}, + proto.WavesBalanceSnapshot{Address: *generateRandomRecipient(t).Address(), Balance: 100}, + proto.WavesBalanceSnapshot{Address: *generateRandomRecipient(t).Address(), Balance: 100}, + proto.TransactionStatusSnapshot{Status: proto.TransactionSucceeded}, + }}, + } + storage.addBlock(t, ids[0]) + err := snapshotStor.saveSnapshots(ids[0], 10, snapshots) + assert.NoError(t, err) + + fromStorage, err := snapshotStor.getSnapshots(10) + assert.NoError(t, err) + + assert.Equal(t, len(fromStorage.TxSnapshots[0]), len(snapshots.TxSnapshots[0])) +} diff --git a/pkg/state/state.go b/pkg/state/state.go index 6af6dae41..24ae07607 100644 --- a/pkg/state/state.go +++ b/pkg/state/state.go @@ -61,6 +61,7 @@ type blockchainEntitiesStorage struct { invokeResults *invokeResults stateHashes *stateHashes hitSources *hitSources + snapshots *snapshotsAtHeight calculateHashes bool } @@ -93,6 +94,7 @@ func newBlockchainEntitiesStorage(hs *historyStorage, sets *settings.BlockchainS newInvokeResults(hs), newStateHashes(hs), newHitSources(hs), + newSnapshotsAtHeight(hs, sets.AddressSchemeCharacter), calcHashes, }, nil } @@ -2567,6 +2569,10 @@ func (s *stateManager) TotalWavesAmount(height proto.Height) (uint64, error) { return amount, nil } +func (s *stateManager) SnapshotsAtHeight(height proto.Height) (proto.BlockSnapshot, error) { + return s.stor.snapshots.getSnapshots(height) +} + func (s *stateManager) Close() error { if err := s.atx.close(); err != nil { return wrapErr(ClosureError, err) diff --git a/pkg/state/threadsafe_wrapper.go b/pkg/state/threadsafe_wrapper.go index ff5968e02..f2cadc502 100644 --- a/pkg/state/threadsafe_wrapper.go +++ b/pkg/state/threadsafe_wrapper.go @@ -374,6 +374,12 @@ func (a *ThreadSafeReadWrapper) TotalWavesAmount(height proto.Height) (uint64, e return a.s.TotalWavesAmount(height) } +func (a *ThreadSafeReadWrapper) SnapshotsAtHeight(height proto.Height) (proto.BlockSnapshot, error) { + a.mu.RLock() + defer a.mu.RUnlock() + return a.s.SnapshotsAtHeight(height) +} + func NewThreadSafeReadWrapper(mu *sync.RWMutex, s StateInfo) StateInfo { return &ThreadSafeReadWrapper{ mu: mu,