From 84ddad279188616a556ec1b601b651fb8ac0b2e9 Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Fl=C3=A1vio=20Caetano?= <flavio@vieiracaetano.com>
Date: Mon, 30 Sep 2019 18:28:02 -0300
Subject: [PATCH 1/4] feat(ESLint): add ESLint rule to parse hooks

---
 .eslintrc.js                                  |   29 +
 eslint-plugin/.babelrc                        |    3 +
 eslint-plugin/.gitignore                      |    1 +
 eslint-plugin/README.md                       |   51 +
 eslint-plugin/package.json                    |   27 +
 .../ESLintRuleExhaustiveDeps-test.js          | 5066 +++++++++++++++++
 eslint-plugin/src/index.js                    |   11 +
 eslint-plugin/src/rules/ExaustiveDeps.js      | 1257 ++++
 eslint-plugin/yarn.lock                       | 2953 ++++++++++
 jest.config.js                                |   10 +-
 package.json                                  |    8 +-
 src/__tests__/useEffectUpdate.ts              |   13 +-
 src/index.tsx                                 |   14 +-
 yarn.lock                                     |  636 ++-
 14 files changed, 10043 insertions(+), 36 deletions(-)
 create mode 100644 .eslintrc.js
 create mode 100644 eslint-plugin/.babelrc
 create mode 100644 eslint-plugin/.gitignore
 create mode 100644 eslint-plugin/README.md
 create mode 100644 eslint-plugin/package.json
 create mode 100644 eslint-plugin/src/__tests__/ESLintRuleExhaustiveDeps-test.js
 create mode 100644 eslint-plugin/src/index.js
 create mode 100644 eslint-plugin/src/rules/ExaustiveDeps.js
 create mode 100644 eslint-plugin/yarn.lock

diff --git a/.eslintrc.js b/.eslintrc.js
new file mode 100644
index 0000000..4d17014
--- /dev/null
+++ b/.eslintrc.js
@@ -0,0 +1,29 @@
+module.exports = {
+  env: {
+    browser: true,
+    es6: true,
+  },
+  globals: {
+    Atomics: 'readonly',
+    SharedArrayBuffer: 'readonly',
+  },
+  parser: '@typescript-eslint/parser',
+  parserOptions: {
+    ecmaFeatures: {
+      jsx: true,
+    },
+    ecmaVersion: 2018,
+    sourceType: 'module',
+  },
+  plugins: [
+    'react',
+    '@typescript-eslint',
+    'react-hooks',
+    '@react-hook-utilities',
+  ],
+  rules: {
+    'react-hooks/rules-of-hooks': 'error',
+    'react-hooks/exhaustive-deps': 'warn',
+    '@react-hook-utilities/exhaustive-deps': 'warn',
+  },
+};
diff --git a/eslint-plugin/.babelrc b/eslint-plugin/.babelrc
new file mode 100644
index 0000000..8aa924d
--- /dev/null
+++ b/eslint-plugin/.babelrc
@@ -0,0 +1,3 @@
+{
+  "presets": ["@babel/preset-env"]
+}
\ No newline at end of file
diff --git a/eslint-plugin/.gitignore b/eslint-plugin/.gitignore
new file mode 100644
index 0000000..f1ff06d
--- /dev/null
+++ b/eslint-plugin/.gitignore
@@ -0,0 +1 @@
+lib/
\ No newline at end of file
diff --git a/eslint-plugin/README.md b/eslint-plugin/README.md
new file mode 100644
index 0000000..c73482f
--- /dev/null
+++ b/eslint-plugin/README.md
@@ -0,0 +1,51 @@
+# @react-hook-utilities/eslint-plugin
+
+ESLint rules for hook utils
+
+## Installation
+
+You'll first need to install [ESLint](http://eslint.org):
+
+```
+$ npm i eslint --save-dev
+```
+
+Next, install `@react-hook-utilities/eslint-plugin`:
+
+```
+$ npm install @react-hook-utilities/eslint-plugin --save-dev
+```
+
+**Note:** If you installed ESLint globally (using the `-g` flag) then you must also install `@react-hook-utilities/eslint-plugin` globally.
+
+## Usage
+
+Add `@react-hook-utilities` to the plugins section of your `.eslintrc` configuration file. You can omit the `eslint-plugin-` prefix:
+
+```json
+{
+    "plugins": [
+        "@react-hook-utilities"
+    ]
+}
+```
+
+
+Then configure the rules you want to use under the rules section.
+
+```json
+{
+    "rules": {
+        "@react-hook-utilities/exhaustive-deps": 2
+    }
+}
+```
+
+## Supported Rules
+
+* Fill in provided rules here
+
+
+
+
+
diff --git a/eslint-plugin/package.json b/eslint-plugin/package.json
new file mode 100644
index 0000000..1bba449
--- /dev/null
+++ b/eslint-plugin/package.json
@@ -0,0 +1,27 @@
+{
+  "name": "@react-hook-utilities/eslint-plugin",
+  "version": "1.0.0",
+  "description": "ESLint rules for hook react-hook-utilities",
+  "keywords": [
+    "eslint",
+    "eslintplugin",
+    "eslint-plugin"
+  ],
+  "author": "Flávio Caetano",
+  "main": "lib/index.js",
+  "scripts": {
+    "test": "mocha tests --recursive src/__tests__/**/*",
+    "babel": "rm -rf lib && babel src/ -d ./lib"
+  },
+  "devDependencies": {
+    "@babel/cli": "^7.6.2",
+    "@babel/preset-env": "^7.6.2",
+    "babel-eslint": "^10.0.3",
+    "eslint": "~3.9.1",
+    "mocha": "^3.1.2"
+  },
+  "engines": {
+    "node": ">=0.10.0"
+  },
+  "license": "ISC"
+}
diff --git a/eslint-plugin/src/__tests__/ESLintRuleExhaustiveDeps-test.js b/eslint-plugin/src/__tests__/ESLintRuleExhaustiveDeps-test.js
new file mode 100644
index 0000000..cd50089
--- /dev/null
+++ b/eslint-plugin/src/__tests__/ESLintRuleExhaustiveDeps-test.js
@@ -0,0 +1,5066 @@
+/**
+ * Copyright (c) Facebook, Inc. and its affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ *
+ * Original Source: https://github.com/facebook/react/blob/9e64bf18e11828d6b4c0363bff5ed2eca1ccd838/packages/eslint-plugin-react-hooks/__tests__/ESLintRuleExhaustiveDeps-test.js
+ */
+
+'use strict';
+
+const ESLintTester = require('eslint').RuleTester;
+const ReactHooksESLintPlugin = require('@react-hook-utilities/eslint-plugin');
+const ReactHooksESLintRule = ReactHooksESLintPlugin.rules['exhaustive-deps'];
+
+ESLintTester.setDefaultConfig({
+  parser: require.resolve('babel-eslint'),
+  parserOptions: {
+    ecmaVersion: 6,
+    sourceType: 'module',
+  },
+});
+
+// ***************************************************
+// For easier local testing, you can add to any case:
+// {
+//   skip: true,
+//   --or--
+//   only: true,
+//   ...
+// }
+// ***************************************************
+
+const tests = {
+  valid: [
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+          });
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          useDidMount(() => {
+            console.log(local);
+          });
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          useDidMount(() => {
+            return history.listen();
+          });
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          useDidMount(async () => {
+            console.log(local);            
+          });
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          useDidUnmount(() => {
+            console.log(local);
+          });
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          useDidUnmount(async () => {
+            console.log(local);
+          });
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent() {
+          useAsyncEffect(async () => {
+            const local = {};
+            console.log(local);
+          }, []);
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [local]);
+        }
+      `,
+    },
+    {
+      // OK because `props` wasn't defined.
+      // We don't technically know if `props` is supposed
+      // to be an import that hasn't been added yet, or
+      // a component-level variable. Ignore it until it
+      //  gets defined (a different rule would flag it anyway).
+      code: `
+        function MyComponent() {
+          useAsyncEffect(async () => {
+            console.log(props.foo);
+          }, []);
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local1 = {};
+          {
+            const local2 = {};
+            useAsyncEffect(async () => {
+              console.log(local1);
+              console.log(local2);
+            });
+          }
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local1 = {};
+          {
+            const local2 = {};
+            useWorker(async () => {
+              console.log(local1);
+              console.log(local2);
+            }, [local1, local2]);
+          }
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local1 = {};
+          function MyNestedComponent() {
+            const local2 = {};
+            useWorker(async () => {
+              console.log(local1);
+              console.log(local2);
+            }, [local2]);
+          }
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local1 = {};
+          {
+            const local2 = {};
+            useWorkerLoad(async () => {
+              console.log(local1);
+              console.log(local2);
+            }, [local1, local2]);
+          }
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local1 = {};
+          function MyNestedComponent() {
+            const local2 = {};
+            useWorkerLoad(async () => {
+              console.log(local1);
+              console.log(local2);
+            }, [local2]);
+          }
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+            console.log(local);
+          }, [local]);
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent() {
+          useAsyncEffect(async () => {
+            console.log(unresolved);
+          }, []);
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [,,,local,,,]);
+        }
+      `,
+    },
+    {
+      // Regression test
+      code: `
+        function MyComponent({ foo }) {
+          useAsyncEffect(async () => {
+            console.log(foo.length);
+          }, [foo]);
+        }
+      `,
+    },
+    {
+      // Regression test
+      code: `
+        function MyComponent({ foo }) {
+          useAsyncEffect(async () => {
+            console.log(foo.length);
+            console.log(foo.slice(0));
+          }, [foo]);
+        }
+      `,
+    },
+    {
+      // Regression test
+      code: `
+        function MyComponent({ history }) {
+          useAsyncEffect(async () => {
+            return history.listen();
+          }, [history]);
+        }
+      `,
+    },
+    {
+      // Valid because they have meaning without deps.
+      code: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {});
+          useAsyncLayoutEffect(async () => {});
+          useConditionalEffect(props.innerRef, () => {});
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            console.log(props.foo);
+          }, [props.foo]);
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            console.log(props.foo);
+            console.log(props.bar);
+          }, [props.bar, props.foo]);
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            console.log(props.foo);
+            console.log(props.bar);
+          }, [props.foo, props.bar]);
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(props.foo);
+            console.log(props.bar);
+            console.log(local);
+          }, [props.foo, props.bar, local]);
+        }
+      `,
+    },
+    {
+      // [props, props.foo] is technically unnecessary ('props' covers 'props.foo').
+      // However, it's valid for effects to over-specify their deps.
+      // So we don't warn about this. We *would* warn about useEffectUpdate/useWorker.
+      code: `
+        function MyComponent(props) {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(props.foo);
+            console.log(props.bar);
+          }, [props, props.foo]);
+
+          let color = {}
+          useAsyncEffect(async () => {
+            console.log(props.foo.bar.baz);
+            console.log(color);
+          }, [props.foo, props.foo.bar.baz, color]);
+        }
+      `,
+    },
+    {
+      // Valid because we don't care about hooks outside of components.
+      code: `
+        const local = {};
+        useAsyncEffect(async () => {
+          console.log(local);
+        }, []);
+      `,
+    },
+    {
+      // Valid because we don't care about hooks outside of components.
+      code: `
+        const local1 = {};
+        {
+          const local2 = {};
+          useAsyncEffect(async () => {
+            console.log(local1);
+            console.log(local2);
+          }, []);
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent() {
+          const ref = useRef();
+          useAsyncEffect(async () => {
+            console.log(ref.current);
+          }, [ref]);
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent() {
+          const ref = useRef();
+          useAsyncEffect(async () => {
+            console.log(ref.current);
+          }, []);
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent({ maybeRef2, foo }) {
+          const definitelyRef1 = useRef();
+          const definitelyRef2 = useRef();
+          const maybeRef1 = useSomeOtherRefyThing();
+          const [state1, setState1] = useState();
+          const [state2, setState2] = React.useState();
+          const [state3, dispatch1] = useReducer();
+          const [state4, dispatch2] = React.useReducer();
+          const [state5, maybeSetState] = useFunnyState();
+          const [state6, maybeDispatch] = useFunnyReducer();
+          const mySetState = useWorker(async () => {}, []);
+          let myDispatch = useWorker(async () => {}, []);
+
+          useAsyncEffect(async () => {
+            // Known to be static
+            console.log(definitelyRef1.current);
+            console.log(definitelyRef2.current);
+            console.log(maybeRef1.current);
+            console.log(maybeRef2.current);
+            setState1();
+            setState2();
+            dispatch1();
+            dispatch2();
+
+            // Dynamic
+            console.log(state1);
+            console.log(state2);
+            console.log(state3);
+            console.log(state4);
+            console.log(state5);
+            console.log(state6);
+            mySetState();
+            myDispatch();
+
+            // Not sure; assume dynamic
+            maybeSetState();
+            maybeDispatch();
+          }, [
+            // Dynamic
+            state1, state2, state3, state4, state5, state6,
+            maybeRef1, maybeRef2,
+
+            // Not sure; assume dynamic
+            mySetState, myDispatch,
+            maybeSetState, maybeDispatch
+
+            // In this test, we don't specify static deps.
+            // That should be okay.
+          ]);
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent({ maybeRef2 }) {
+          const definitelyRef1 = useRef();
+          const definitelyRef2 = useRef();
+          const maybeRef1 = useSomeOtherRefyThing();
+
+          const [state1, setState1] = useState();
+          const [state2, setState2] = React.useState();
+          const [state3, dispatch1] = useReducer();
+          const [state4, dispatch2] = React.useReducer();
+
+          const [state5, maybeSetState] = useFunnyState();
+          const [state6, maybeDispatch] = useFunnyReducer();
+
+          const mySetState = useWorker(async () => {}, []);
+          let myDispatch = useWorker(async () => {}, []);
+
+          useAsyncEffect(async () => {
+            // Known to be static
+            console.log(definitelyRef1.current);
+            console.log(definitelyRef2.current);
+            console.log(maybeRef1.current);
+            console.log(maybeRef2.current);
+            setState1();
+            setState2();
+            dispatch1();
+            dispatch2();
+
+            // Dynamic
+            console.log(state1);
+            console.log(state2);
+            console.log(state3);
+            console.log(state4);
+            console.log(state5);
+            console.log(state6);
+            mySetState();
+            myDispatch();
+
+            // Not sure; assume dynamic
+            maybeSetState();
+            maybeDispatch();
+          }, [
+            // Dynamic
+            state1, state2, state3, state4, state5, state6,
+            maybeRef1, maybeRef2,
+
+            // Not sure; assume dynamic
+            mySetState, myDispatch,
+            maybeSetState, maybeDispatch,
+
+            // In this test, we specify static deps.
+            // That should be okay too!
+            definitelyRef1, definitelyRef2, setState1, setState2, dispatch1, dispatch2
+          ]);
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent({ maybeRef2, foo }) {
+          const definitelyRef1 = useRef();
+          const definitelyRef2 = useRef();
+          const maybeRef1 = useSomeOtherRefyThing();
+          const [state1, setState1] = useState();
+          const [state2, setState2] = React.useState();
+          const [state3, dispatch1] = useReducer();
+          const [state4, dispatch2] = React.useReducer();
+          const [state5, maybeSetState] = useFunnyState();
+          const [state6, maybeDispatch] = useFunnyReducer();
+          const mySetState = useWorkerLoad(async () => {}, []);
+          let myDispatch = useWorkerLoad(async () => {}, []);
+
+          useAsyncEffect(async () => {
+            // Known to be static
+            console.log(definitelyRef1.current);
+            console.log(definitelyRef2.current);
+            console.log(maybeRef1.current);
+            console.log(maybeRef2.current);
+            setState1();
+            setState2();
+            dispatch1();
+            dispatch2();
+
+            // Dynamic
+            console.log(state1);
+            console.log(state2);
+            console.log(state3);
+            console.log(state4);
+            console.log(state5);
+            console.log(state6);
+            mySetState();
+            myDispatch();
+
+            // Not sure; assume dynamic
+            maybeSetState();
+            maybeDispatch();
+          }, [
+            // Dynamic
+            state1, state2, state3, state4, state5, state6,
+            maybeRef1, maybeRef2,
+
+            // Not sure; assume dynamic
+            mySetState, myDispatch,
+            maybeSetState, maybeDispatch
+
+            // In this test, we don't specify static deps.
+            // That should be okay.
+          ]);
+        }
+      `,
+    },
+    {
+      code: `
+        function MyComponent({ maybeRef2 }) {
+          const definitelyRef1 = useRef();
+          const definitelyRef2 = useRef();
+          const maybeRef1 = useSomeOtherRefyThing();
+
+          const [state1, setState1] = useState();
+          const [state2, setState2] = React.useState();
+          const [state3, dispatch1] = useReducer();
+          const [state4, dispatch2] = React.useReducer();
+
+          const [state5, maybeSetState] = useFunnyState();
+          const [state6, maybeDispatch] = useFunnyReducer();
+
+          const mySetState = useWorkerLoad(async () => {}, []);
+          let myDispatch = useWorkerLoad(async () => {}, []);
+
+          useAsyncEffect(async () => {
+            // Known to be static
+            console.log(definitelyRef1.current);
+            console.log(definitelyRef2.current);
+            console.log(maybeRef1.current);
+            console.log(maybeRef2.current);
+            setState1();
+            setState2();
+            dispatch1();
+            dispatch2();
+
+            // Dynamic
+            console.log(state1);
+            console.log(state2);
+            console.log(state3);
+            console.log(state4);
+            console.log(state5);
+            console.log(state6);
+            mySetState();
+            myDispatch();
+
+            // Not sure; assume dynamic
+            maybeSetState();
+            maybeDispatch();
+          }, [
+            // Dynamic
+            state1, state2, state3, state4, state5, state6,
+            maybeRef1, maybeRef2,
+
+            // Not sure; assume dynamic
+            mySetState, myDispatch,
+            maybeSetState, maybeDispatch,
+
+            // In this test, we specify static deps.
+            // That should be okay too!
+            definitelyRef1, definitelyRef2, setState1, setState2, dispatch1, dispatch2
+          ]);
+        }
+      `,
+    },
+    {
+      code: `
+        const MyComponent = forwardRef((props, ref) => {
+          useConditionalEffect(ref, () => ({
+            focus() {
+              alert(props.hello);
+            }
+          }))
+        });
+      `,
+    },
+    {
+      code: `
+        const MyComponent = forwardRef((props, ref) => {
+          useConditionalEffect(ref, () => ({
+            focus() {
+              alert(props.hello);
+            }
+          }), [props.hello])
+        });
+      `,
+    },
+    {
+      // This is not ideal but warning would likely create
+      // too many false positives. We do, however, prevent
+      // direct assignments.
+      code: `
+        function MyComponent(props) {
+          let obj = {};
+          useAsyncEffect(async () => {
+            obj.foo = true;
+          }, [obj]);
+        }
+      `,
+    },
+    {
+      // Valid because we assign ref.current
+      // ourselves. Therefore it's likely not
+      // a ref managed by React.
+      code: `
+        function MyComponent() {
+          const myRef = useRef();
+          useAsyncEffect(async () => {
+            const handleMove = () => {};
+            myRef.current = {};
+            return () => {
+              console.log(myRef.current.toString())
+            };
+          }, []);
+          return <div />;
+        }
+      `,
+    },
+    {
+      // Valid because we assign ref.current
+      // ourselves. Therefore it's likely not
+      // a ref managed by React.
+      code: `
+        function useMyThing(myRef) {
+          useAsyncEffect(async () => {
+            const handleMove = () => {};
+            myRef.current = {};
+            return () => {
+              console.log(myRef.current.toString())
+            };
+          }, [myRef]);
+        }
+      `,
+    },
+    {
+      // Valid because the ref is captured.
+      code: `
+        function MyComponent() {
+          const myRef = useRef();
+          useAsyncEffect(async () => {
+            const handleMove = () => {};
+            const node = myRef.current;
+            node.addEventListener('mousemove', handleMove);
+            return () => node.removeEventListener('mousemove', handleMove);
+          }, []);
+          return <div ref={myRef} />;
+        }
+      `,
+    },
+    {
+      // Valid because the ref is captured.
+      code: `
+        function useMyThing(myRef) {
+          useAsyncEffect(async () => {
+            const handleMove = () => {};
+            const node = myRef.current;
+            node.addEventListener('mousemove', handleMove);
+            return () => node.removeEventListener('mousemove', handleMove);
+          }, [myRef]);
+          return <div ref={myRef} />;
+        }
+      `,
+    },
+    {
+      // Valid because it's not an effect.
+      code: `
+        function useMyThing(myRef) {
+          useWorker(async () => {
+            const handleMouse = () => {};
+            myRef.current.addEventListener('mousemove', handleMouse);
+            myRef.current.addEventListener('mousein', handleMouse);
+            return function() {
+              setTimeout(() => {
+                myRef.current.removeEventListener('mousemove', handleMouse);
+                myRef.current.removeEventListener('mousein', handleMouse);
+              });
+            }
+          }, [myRef]);
+        }
+      `,
+    },
+    {
+      // Valid because it's not an effect.
+      code: `
+        function useMyThing(myRef) {
+          useWorkerLoad(async () => {
+            const handleMouse = () => {};
+            myRef.current.addEventListener('mousemove', handleMouse);
+            myRef.current.addEventListener('mousein', handleMouse);
+            return function() {
+              setTimeout(() => {
+                myRef.current.removeEventListener('mousemove', handleMouse);
+                myRef.current.removeEventListener('mousein', handleMouse);
+              });
+            }
+          }, [myRef]);
+        }
+      `,
+    },
+    {
+      // Valid because we read ref.current in a function that isn't cleanup.
+      code: `
+        function useMyThing() {
+          const myRef = useRef();
+          useAsyncEffect(async () => {
+            const handleMove = () => {
+              console.log(myRef.current)
+            };
+            window.addEventListener('mousemove', handleMove);
+            return () => window.removeEventListener('mousemove', handleMove);
+          }, []);
+          return <div ref={myRef} />;
+        }
+      `,
+    },
+    {
+      // Valid because we read ref.current in a function that isn't cleanup.
+      code: `
+        function useMyThing() {
+          const myRef = useRef();
+          useAsyncEffect(async () => {
+            const handleMove = () => {
+              return () => window.removeEventListener('mousemove', handleMove);
+            };
+            window.addEventListener('mousemove', handleMove);
+            return () => {};
+          }, []);
+          return <div ref={myRef} />;
+        }
+      `,
+    },
+    {
+      // Valid because it's a primitive constant.
+      code: `
+        function MyComponent() {
+          const local1 = 42;
+          const local2 = '42';
+          const local3 = null;
+          useAsyncEffect(async () => {
+            console.log(local1);
+            console.log(local2);
+            console.log(local3);
+          }, []);
+        }
+      `,
+    },
+    {
+      // It's not a mistake to specify constant values though.
+      code: `
+        function MyComponent() {
+          const local1 = 42;
+          const local2 = '42';
+          const local3 = null;
+          useAsyncEffect(async () => {
+            console.log(local1);
+            console.log(local2);
+            console.log(local3);
+          }, [local1, local2, local3]);
+        }
+      `,
+    },
+    {
+      // It is valid for effects to over-specify their deps.
+      code: `
+        function MyComponent(props) {
+          const local = props.local;
+          useAsyncEffect(async () => {}, [local]);
+        }
+      `,
+    },
+    {
+      // Valid even though activeTab is "unused".
+      // We allow over-specifying deps for effects, but not callbacks or memo.
+      code: `
+        function Foo({ activeTab }) {
+          useAsyncEffect(async () => {
+            window.scrollTo(0, 0);
+          }, [activeTab]);
+        }
+      `,
+    },
+    {
+      // It is valid to specify broader effect deps than strictly necessary.
+      // Don't warn for this.
+      code: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            console.log(props.foo.bar.baz);
+          }, [props]);
+          useAsyncEffect(async () => {
+            console.log(props.foo.bar.baz);
+          }, [props.foo]);
+          useAsyncEffect(async () => {
+            console.log(props.foo.bar.baz);
+          }, [props.foo.bar]);
+          useAsyncEffect(async () => {
+            console.log(props.foo.bar.baz);
+          }, [props.foo.bar.baz]);
+        }
+      `,
+    },
+    {
+      // It is *also* valid to specify broader memo/callback deps than strictly necessary.
+      // Don't warn for this either.
+      code: `
+        function MyComponent(props) {
+          const fn = useWorker(async () => {
+            console.log(props.foo.bar.baz);
+          }, [props]);
+          const fn2 = useWorker(async () => {
+            console.log(props.foo.bar.baz);
+          }, [props.foo]);
+          const fn3 = useEffectUpdate(() => {
+            console.log(props.foo.bar.baz);
+          }, [props.foo.bar]);
+          const fn4 = useEffectUpdate(() => {
+            console.log(props.foo.bar.baz);
+          }, [props.foo.bar.baz]);
+        }
+      `,
+    },
+    {
+      // It is *also* valid to specify broader memo/callback deps than strictly necessary.
+      // Don't warn for this either.
+      code: `
+        function MyComponent(props) {
+          const fn = useWorkerLoad(async () => {
+            console.log(props.foo.bar.baz);
+          }, [props]);
+          const fn2 = useWorkerLoad(async () => {
+            console.log(props.foo.bar.baz);
+          }, [props.foo]);
+          const fn3 = useEffectUpdate(() => {
+            console.log(props.foo.bar.baz);
+          }, [props.foo.bar]);
+          const fn4 = useEffectUpdate(() => {
+            console.log(props.foo.bar.baz);
+          }, [props.foo.bar.baz]);
+        }
+      `,
+    },
+    {
+      // Declaring handleNext is optional because
+      // it doesn't use anything in the function scope.
+      code: `
+        function MyComponent(props) {
+          function handleNext1() {
+            console.log('hello');
+          }
+          const handleNext2 = () => {
+            console.log('hello');
+          };
+          let handleNext3 = function() {
+            console.log('hello');
+          };
+          useAsyncEffect(async () => {
+            return Store.subscribe(handleNext1);
+          }, []);
+          useAsyncLayoutEffect(async () => {
+            return Store.subscribe(handleNext2);
+          }, []);
+          useEffectUpdate(() => {
+            return Store.subscribe(handleNext3);
+          }, []);
+        }
+      `,
+    },
+    {
+      // Declaring handleNext is optional because
+      // it doesn't use anything in the function scope.
+      code: `
+        function MyComponent(props) {
+          function handleNext() {
+            console.log('hello');
+          }
+          useAsyncEffect(async () => {
+            return Store.subscribe(handleNext);
+          }, []);
+          useAsyncLayoutEffect(async () => {
+            return Store.subscribe(handleNext);
+          }, []);
+          useEffectUpdate(() => {
+            return Store.subscribe(handleNext);
+          }, []);
+        }
+      `,
+    },
+    {
+      // Declaring handleNext is optional because
+      // everything they use is fully static.
+      code: `
+        function MyComponent(props) {
+          let [, setState] = useState();
+          let [, dispatch] = React.useReducer();
+
+          function handleNext1(value) {
+            let value2 = value * 100;
+            setState(value2);
+            console.log('hello');
+          }
+          const handleNext2 = (value) => {
+            setState(foo(value));
+            console.log('hello');
+          };
+          let handleNext3 = function(value) {
+            console.log(value);
+            dispatch({ type: 'x', value });
+          };
+          useAsyncEffect(async () => {
+            return Store.subscribe(handleNext1);
+          }, []);
+          useAsyncLayoutEffect(async () => {
+            return Store.subscribe(handleNext2);
+          }, []);
+          useEffectUpdate(() => {
+            return Store.subscribe(handleNext3);
+          }, []);
+        }
+      `,
+    },
+    {
+      code: `
+        function useInterval(callback, delay) {
+          const savedCallback = useRef();
+          useAsyncEffect(async () => {
+            savedCallback.current = callback;
+          });
+          useAsyncEffect(async () => {
+            function tick() {
+              savedCallback.current();
+            }
+            if (delay !== null) {
+              let id = setInterval(tick, delay);
+              return () => clearInterval(id);
+            }
+          }, [delay]);
+        }
+      `,
+    },
+    {
+      code: `
+        function Counter() {
+          const [count, setCount] = useState(0);
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              setCount(c => c + 1);
+            }, 1000);
+            return () => clearInterval(id);
+          }, []);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+    },
+    {
+      code: `
+        function Counter() {
+          const [count, setCount] = useState(0);
+
+          function tick() {
+            setCount(c => c + 1);
+          }
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              tick();
+            }, 1000);
+            return () => clearInterval(id);
+          }, []);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+    },
+    {
+      code: `
+        function Counter() {
+          const [count, dispatch] = useReducer((state, action) => {
+            if (action === 'inc') {
+              return state + 1;
+            }
+          }, 0);
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              dispatch('inc');
+            }, 1000);
+            return () => clearInterval(id);
+          }, []);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+    },
+    {
+      code: `
+        function Counter() {
+          const [count, dispatch] = useReducer((state, action) => {
+            if (action === 'inc') {
+              return state + 1;
+            }
+          }, 0);
+
+          const tick = () => {
+            dispatch('inc');
+          };
+
+          useAsyncEffect(async () => {
+            let id = setInterval(tick, 1000);
+            return () => clearInterval(id);
+          }, []);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+    },
+    {
+      // Regression test for a crash
+      code: `
+        function Podcasts() {
+          useAsyncEffect(async () => {
+            setPodcasts([]);
+          }, []);
+          let [podcasts, setPodcasts] = useState(null);
+        }
+      `,
+    },
+    {
+      code: `
+        function withFetch(fetchPodcasts) {
+          return function Podcasts({ id }) {
+            let [podcasts, setPodcasts] = useState(null);
+            useAsyncEffect(async () => {
+              fetchPodcasts(id).then(setPodcasts);
+            }, [id]);
+          }
+        }
+      `,
+    },
+    {
+      code: `
+        function Podcasts({ id }) {
+          let [podcasts, setPodcasts] = useState(null);
+          useAsyncEffect(async () => {
+            function doFetch({ fetchPodcasts }) {
+              fetchPodcasts(id).then(setPodcasts);
+            }
+            doFetch({ fetchPodcasts: API.fetchPodcasts });
+          }, [id]);
+        }
+      `,
+    },
+    {
+      code: `
+        function Counter() {
+          let [count, setCount] = useState(0);
+
+          function increment(x) {
+            return x + 1;
+          }
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              setCount(increment);
+            }, 1000);
+            return () => clearInterval(id);
+          }, []);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+    },
+    {
+      code: `
+        function Counter() {
+          let [count, setCount] = useState(0);
+
+          function increment(x) {
+            return x + 1;
+          }
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              setCount(count => increment(count));
+            }, 1000);
+            return () => clearInterval(id);
+          }, []);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+    },
+    {
+      code: `
+        import increment from './increment';
+        function Counter() {
+          let [count, setCount] = useState(0);
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              setCount(count => count + increment);
+            }, 1000);
+            return () => clearInterval(id);
+          }, []);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+    },
+    {
+      code: `
+        function withStuff(increment) {
+          return function Counter() {
+            let [count, setCount] = useState(0);
+
+            useAsyncEffect(async () => {
+              let id = setInterval(() => {
+                setCount(count => count + increment);
+              }, 1000);
+              return () => clearInterval(id);
+            }, []);
+
+            return <h1>{count}</h1>;
+          }
+        }
+      `,
+    },
+    {
+      code: `
+        function App() {
+          const [query, setQuery] = useState('react');
+          const [state, setState] = useState(null);
+          useAsyncEffect(async () => {
+            let ignore = false;
+            fetchSomething();
+            async function fetchSomething() {
+              const result = await (await fetch('http://hn.algolia.com/api/v1/search?query=' + query)).json();
+              if (!ignore) setState(result);
+            }
+            return () => { ignore = true; };
+          }, [query]);
+          return (
+            <>
+              <input value={query} onChange={e => setQuery(e.target.value)} />
+              {JSON.stringify(state)}
+            </>
+          );
+        }
+      `,
+    },
+    {
+      code: `
+        function Example() {
+          const foo = useWorker(async () => {
+            foo();
+          }, []);
+        }
+      `,
+    },
+    {
+      code: `
+        function Example({ prop }) {
+          const foo = useWorker(async () => {
+            if (prop) {
+              foo();
+            }
+          }, [prop]);
+        }
+      `,
+    },
+    {
+      code: `
+        function Example() {
+          const foo = useWorkerLoad(async () => {
+            foo();
+          }, []);
+        }
+      `,
+    },
+    {
+      code: `
+        function Example({ prop }) {
+          const foo = useWorkerLoad(async () => {
+            if (prop) {
+              foo();
+            }
+          }, [prop]);
+        }
+      `,
+    },
+    {
+      code: `
+        function Hello() {
+          const [state, setState] = useState(0);
+          useAsyncEffect(async () => {
+            const handleResize = () => setState(window.innerWidth);
+            window.addEventListener('resize', handleResize);
+            return () => window.removeEventListener('resize', handleResize);
+          });
+        }
+      `,
+    },
+    // Ignore Generic Type Variables for arrow functions
+    {
+      code: `
+        function Example({ prop }) {
+          const bar = useAsyncEffect(<T>(a: T): Hello => {
+            prop();
+          }, [prop]);
+        }
+      `,
+    },
+    // Ignore arguments keyword for arrow functions.
+    {
+      code: `
+        function Example() {
+          useAsyncEffect(async () => {
+            arguments
+          }, [])
+        }
+      `,
+    },
+    {
+      code: `
+        function Example() {
+          useAsyncEffect(async () => {
+            const bar = () => {
+              arguments;
+            };
+            bar();
+          }, [])
+        }
+      `,
+    },
+  ],
+  invalid: [
+    {
+      code: `
+        function MyComponent() {
+          const ref = useLazyRef();
+          const [state, setState] = useState();
+          useAsyncEffect(async () => {
+            ref.current = {};
+            setState(state + 1);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const ref = useLazyRef();
+          const [state, setState] = useState();
+          useAsyncEffect(async () => {
+            ref.current = {};
+            setState(state + 1);
+          }, [state]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'state'. " +
+          'Either include it or remove the dependency array. ' +
+          `You can also do a functional update 'setState(s => ...)' ` +
+          `if you only need 'state' in the 'setState' call.`,
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const ref = useLazyRef();
+          const [state, setState] = useState();
+          useAsyncEffect(() => {
+            ref.current = {};
+            setState(state + 1);
+          }, [ref]);
+        }
+      `,
+      // We don't ask to remove static deps but don't add them either.
+      // Don't suggest removing "ref" (it's fine either way)
+      // but *do* add "state". *Don't* add "setState" ourselves.
+      output: `
+        function MyComponent() {
+          const ref = useLazyRef();
+          const [state, setState] = useState();
+          useAsyncEffect(() => {
+            ref.current = {};
+            setState(state + 1);
+          }, [ref, state]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'state'. " +
+          'Either include it or remove the dependency array. ' +
+          `You can also do a functional update 'setState(s => ...)' ` +
+          `if you only need 'state' in the 'setState' call.`,
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          const ref1 = useLazyRef();
+          const ref2 = useLazyRef();
+          useAsyncEffect(() => {
+            ref1.current.focus();
+            console.log(ref2.current.textContent);
+            alert(props.someOtherRefs.current.innerHTML);
+            fetch(props.color);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const ref1 = useLazyRef();
+          const ref2 = useLazyRef();
+          useAsyncEffect(() => {
+            ref1.current.focus();
+            console.log(ref2.current.textContent);
+            alert(props.someOtherRefs.current.innerHTML);
+            fetch(props.color);
+          }, [props.color, props.someOtherRefs]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has missing dependencies: 'props.color' and 'props.someOtherRefs'. " +
+          'Either include them or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          const ref1 = useLazyRef();
+          const ref2 = useLazyRef();
+          useAsyncEffect(() => {
+            ref1.current.focus();
+            console.log(ref2.current.textContent);
+            alert(props.someOtherRefs.current.innerHTML);
+            fetch(props.color);
+          }, [ref1.current, ref2.current, props.someOtherRefs, props.color]);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const ref1 = useLazyRef();
+          const ref2 = useLazyRef();
+          useAsyncEffect(() => {
+            ref1.current.focus();
+            console.log(ref2.current.textContent);
+            alert(props.someOtherRefs.current.innerHTML);
+            fetch(props.color);
+          }, [props.someOtherRefs, props.color]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has unnecessary dependencies: 'ref1.current' and 'ref2.current'. " +
+          'Either exclude them or remove the dependency array. ' +
+          "Mutable values like 'ref1.current' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const ref = useLazyRef();
+          useAsyncEffect(() => {
+            console.log(ref.current);
+          }, [ref.current]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const ref = useLazyRef();
+          useAsyncEffect(() => {
+            console.log(ref.current);
+          }, []);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has an unnecessary dependency: 'ref.current'. " +
+          'Either exclude it or remove the dependency array. ' +
+          "Mutable values like 'ref.current' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        function MyComponent({ activeTab }) {
+          const ref1 = useLazyRef();
+          const ref2 = useLazyRef();
+          useAsyncEffect(() => {
+            ref1.current.scrollTop = 0;
+            ref2.current.scrollTop = 0;
+          }, [ref1.current, ref2.current, activeTab]);
+        }
+      `,
+      output: `
+        function MyComponent({ activeTab }) {
+          const ref1 = useLazyRef();
+          const ref2 = useLazyRef();
+          useAsyncEffect(() => {
+            ref1.current.scrollTop = 0;
+            ref2.current.scrollTop = 0;
+          }, [activeTab]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has unnecessary dependencies: 'ref1.current' and 'ref2.current'. " +
+          'Either exclude them or remove the dependency array. ' +
+          "Mutable values like 'ref1.current' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        function MyComponent({ activeTab, initY }) {
+          const ref1 = useLazyRef();
+          const ref2 = useLazyRef();
+          const fn = useWorker(() => {
+            ref1.current.scrollTop = initY;
+            ref2.current.scrollTop = initY;
+          }, [ref1.current, ref2.current, activeTab, initY]);
+        }
+      `,
+      output: `
+        function MyComponent({ activeTab, initY }) {
+          const ref1 = useLazyRef();
+          const ref2 = useLazyRef();
+          const fn = useWorker(() => {
+            ref1.current.scrollTop = initY;
+            ref2.current.scrollTop = initY;
+          }, [initY]);
+        }
+      `,
+      errors: [
+        "React Hook useWorker has unnecessary dependencies: 'activeTab', 'ref1.current', and 'ref2.current'. " +
+          'Either exclude them or remove the dependency array. ' +
+          "Mutable values like 'ref1.current' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const ref = useLazyRef();
+          useAsyncEffect(() => {
+            console.log(ref.current);
+          }, [ref.current, ref]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const ref = useLazyRef();
+          useAsyncEffect(() => {
+            console.log(ref.current);
+          }, [ref]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has an unnecessary dependency: 'ref.current'. " +
+          'Either exclude it or remove the dependency array. ' +
+          "Mutable values like 'ref.current' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [local]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'local'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      // Note: we *could* detect it's a primitive and never assigned
+      // even though it's not a constant -- but we currently don't.
+      // So this is an error.
+      code: `
+        function MyComponent() {
+          let local = 42;
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          let local = 42;
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [local]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'local'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      // Regexes are literals but potentially stateful.
+      code: `
+        function MyComponent() {
+          const local = /foo/;
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local = /foo/;
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [local]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'local'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      // Regression test
+      code: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            if (true) {
+              console.log(local);
+            }
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            if (true) {
+              console.log(local);
+            }
+          }, [local]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'local'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      // Regression test
+      code: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            try {
+              console.log(local);
+            } finally {}
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            try {
+              console.log(local);
+            } finally {}
+          }, [local]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'local'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      // Regression test
+      code: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            function inner() {
+              console.log(local);
+            }
+            inner();
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            function inner() {
+              console.log(local);
+            }
+            inner();
+          }, [local]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'local'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local1 = {};
+          {
+            const local2 = {};
+            useAsyncEffect(async () => {
+              console.log(local1);
+              console.log(local2);
+            }, []);
+          }
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local1 = {};
+          {
+            const local2 = {};
+            useAsyncEffect(async () => {
+              console.log(local1);
+              console.log(local2);
+            }, [local1, local2]);
+          }
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has missing dependencies: 'local1' and 'local2'. " +
+          'Either include them or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local1 = {};
+          const local2 = {};
+          useAsyncEffect(async () => {
+            console.log(local1);
+            console.log(local2);
+          }, [local1]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local1 = {};
+          const local2 = {};
+          useAsyncEffect(async () => {
+            console.log(local1);
+            console.log(local2);
+          }, [local1, local2]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'local2'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local1 = {};
+          function MyNestedComponent() {
+            const local2 = {};
+            useWorker(async () => {
+              console.log(local1);
+              console.log(local2);
+            }, [local1]);
+          }
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local1 = {};
+          function MyNestedComponent() {
+            const local2 = {};
+            useWorker(async () => {
+              console.log(local1);
+              console.log(local2);
+            }, [local2]);
+          }
+        }
+      `,
+      errors: [
+        "React Hook useWorker has a missing dependency: 'local2'. " +
+          'Either include it or remove the dependency array. ' +
+          "Outer scope values like 'local1' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local1 = {};
+          function MyNestedComponent() {
+            const local2 = {};
+            useWorkerLoad(async () => {
+              console.log(local1);
+              console.log(local2);
+            }, [local1]);
+          }
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local1 = {};
+          function MyNestedComponent() {
+            const local2 = {};
+            useWorkerLoad(async () => {
+              console.log(local1);
+              console.log(local2);
+            }, [local2]);
+          }
+        }
+      `,
+      errors: [
+        "React Hook useWorkerLoad has a missing dependency: 'local2'. " +
+          'Either include it or remove the dependency array. ' +
+          "Outer scope values like 'local1' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+            console.log(local);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+            console.log(local);
+          }, [local]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'local'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+            console.log(local);
+          }, [local, local]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+            console.log(local);
+          }, [local]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a duplicate dependency: 'local'. " +
+          'Either omit it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          useWorker(async () => {}, [window]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          useWorker(async () => {}, []);
+        }
+      `,
+      errors: [
+        "React Hook useWorker has an unnecessary dependency: 'window'. " +
+          'Either exclude it or remove the dependency array. ' +
+          "Outer scope values like 'window' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          useWorkerLoad(async () => {}, [window]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          useWorkerLoad(async () => {}, []);
+        }
+      `,
+      errors: [
+        "React Hook useWorkerLoad has an unnecessary dependency: 'window'. " +
+          'Either exclude it or remove the dependency array. ' +
+          "Outer scope values like 'window' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      // It is not valid for useWorker to specify extraneous deps
+      // because it doesn't serve as a side effect trigger unlike useAsyncEffect.
+      code: `
+        function MyComponent(props) {
+          let local = props.foo;
+          useWorker(async () => {}, [local]);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          let local = props.foo;
+          useWorker(async () => {}, []);
+        }
+      `,
+      errors: [
+        "React Hook useWorker has an unnecessary dependency: 'local'. " +
+          'Either exclude it or remove the dependency array.',
+      ],
+    },
+    {
+      // It is not valid for useWorkerLoad to specify extraneous deps
+      // because it doesn't serve as a side effect trigger unlike useAsyncEffect.
+      code: `
+        function MyComponent(props) {
+          let local = props.foo;
+          useWorkerLoad(async () => {}, [local]);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          let local = props.foo;
+          useWorkerLoad(async () => {}, []);
+        }
+      `,
+      errors: [
+        "React Hook useWorkerLoad has an unnecessary dependency: 'local'. " +
+          'Either exclude it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent({ history }) {
+          useAsyncEffect(async () => {
+            return history.listen();
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent({ history }) {
+          useAsyncEffect(async () => {
+            return history.listen();
+          }, [history]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'history'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent({ history }) {
+          useAsyncEffect(async () => {
+            return [
+              history.foo.bar[2].dobedo.listen(),
+              history.foo.bar().dobedo.listen[2]
+            ];
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent({ history }) {
+          useAsyncEffect(async () => {
+            return [
+              history.foo.bar[2].dobedo.listen(),
+              history.foo.bar().dobedo.listen[2]
+            ];
+          }, [history.foo]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'history.foo'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          useAsyncEffect(async () => {}, ['foo']);
+        }
+      `,
+      // TODO: we could autofix this.
+      output: `
+        function MyComponent() {
+          useAsyncEffect(async () => {}, ['foo']);
+        }
+      `,
+      errors: [
+        // Don't assume user meant `foo` because it's not used in the effect.
+        "The 'foo' literal is not a valid dependency because it never changes. " +
+          'You can safely remove it.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent({ foo, bar, baz }) {
+          useAsyncEffect(async () => {
+            console.log(foo, bar, baz);
+          }, ['foo', 'bar']);
+        }
+      `,
+      output: `
+        function MyComponent({ foo, bar, baz }) {
+          useAsyncEffect(async () => {
+            console.log(foo, bar, baz);
+          }, [bar, baz, foo]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has missing dependencies: 'bar', 'baz', and 'foo'. " +
+          'Either include them or remove the dependency array.',
+        "The 'foo' literal is not a valid dependency because it never changes. " +
+          'Did you mean to include foo in the array instead?',
+        "The 'bar' literal is not a valid dependency because it never changes. " +
+          'Did you mean to include bar in the array instead?',
+      ],
+    },
+    {
+      code: `
+        function MyComponent({ foo, bar, baz }) {
+          useAsyncEffect(async () => {
+            console.log(foo, bar, baz);
+          }, [42, false, null]);
+        }
+      `,
+      output: `
+        function MyComponent({ foo, bar, baz }) {
+          useAsyncEffect(async () => {
+            console.log(foo, bar, baz);
+          }, [bar, baz, foo]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has missing dependencies: 'bar', 'baz', and 'foo'. " +
+          'Either include them or remove the dependency array.',
+        'The 42 literal is not a valid dependency because it never changes. You can safely remove it.',
+        'The false literal is not a valid dependency because it never changes. You can safely remove it.',
+        'The null literal is not a valid dependency because it never changes. You can safely remove it.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const dependencies = [];
+          useAsyncEffect(async () => {}, dependencies);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const dependencies = [];
+          useAsyncEffect(async () => {}, dependencies);
+        }
+      `,
+      errors: [
+        'React Hook useAsyncEffect was passed a dependency list that is not an ' +
+          "array literal. This means we can't statically verify whether you've " +
+          'passed the correct dependencies.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          const dependencies = [local];
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, dependencies);
+        }
+      `,
+      // TODO: should this autofix or bail out?
+      output: `
+        function MyComponent() {
+          const local = {};
+          const dependencies = [local];
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [local]);
+        }
+      `,
+      errors: [
+        'React Hook useAsyncEffect was passed a dependency list that is not an ' +
+          "array literal. This means we can't statically verify whether you've " +
+          'passed the correct dependencies.',
+        "React Hook useAsyncEffect has a missing dependency: 'local'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          const dependencies = [local];
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [...dependencies]);
+        }
+      `,
+      // TODO: should this autofix or bail out?
+      output: `
+        function MyComponent() {
+          const local = {};
+          const dependencies = [local];
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [local]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'local'. " +
+          'Either include it or remove the dependency array.',
+        'React Hook useAsyncEffect has a spread element in its dependency array. ' +
+          "This means we can't statically verify whether you've passed the " +
+          'correct dependencies.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [local, ...dependencies]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [local, ...dependencies]);
+        }
+      `,
+      errors: [
+        'React Hook useAsyncEffect has a spread element in its dependency array. ' +
+          "This means we can't statically verify whether you've passed the " +
+          'correct dependencies.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [computeCacheKey(local)]);
+        }
+      `,
+      // TODO: I'm not sure this is a good idea.
+      // Maybe bail out?
+      output: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [local]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'local'. " +
+          'Either include it or remove the dependency array.',
+        'React Hook useAsyncEffect has a complex expression in the dependency array. ' +
+          'Extract it to a separate variable so it can be statically checked.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            console.log(props.items[0]);
+          }, [props.items[0]]);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            console.log(props.items[0]);
+          }, [props.items]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'props.items'. " +
+          'Either include it or remove the dependency array.',
+        'React Hook useAsyncEffect has a complex expression in the dependency array. ' +
+          'Extract it to a separate variable so it can be statically checked.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            console.log(props.items[0]);
+          }, [props.items, props.items[0]]);
+        }
+      `,
+      // TODO: ideally autofix would remove the bad expression?
+      output: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            console.log(props.items[0]);
+          }, [props.items, props.items[0]]);
+        }
+      `,
+      errors: [
+        'React Hook useAsyncEffect has a complex expression in the dependency array. ' +
+          'Extract it to a separate variable so it can be statically checked.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent({ items }) {
+          useAsyncEffect(async () => {
+            console.log(items[0]);
+          }, [items[0]]);
+        }
+      `,
+      output: `
+        function MyComponent({ items }) {
+          useAsyncEffect(async () => {
+            console.log(items[0]);
+          }, [items]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'items'. " +
+          'Either include it or remove the dependency array.',
+        'React Hook useAsyncEffect has a complex expression in the dependency array. ' +
+          'Extract it to a separate variable so it can be statically checked.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent({ items }) {
+          useAsyncEffect(async () => {
+            console.log(items[0]);
+          }, [items, items[0]]);
+        }
+      `,
+      // TODO: ideally autofix would remove the bad expression?
+      output: `
+        function MyComponent({ items }) {
+          useAsyncEffect(async () => {
+            console.log(items[0]);
+          }, [items, items[0]]);
+        }
+      `,
+      errors: [
+        'React Hook useAsyncEffect has a complex expression in the dependency array. ' +
+          'Extract it to a separate variable so it can be statically checked.',
+      ],
+    },
+    {
+      // It is not valid for useWorker to specify extraneous deps
+      // because it doesn't serve as a side effect trigger unlike useAsyncEffect.
+      // However, we generally allow specifying *broader* deps as escape hatch.
+      // So while [props, props.foo] is unnecessary, 'props' wins here as the
+      // broader one, and this is why 'props.foo' is reported as unnecessary.
+      code: `
+        function MyComponent(props) {
+          const local = {};
+          useWorker(async () => {
+            console.log(props.foo);
+            console.log(props.bar);
+          }, [props, props.foo]);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const local = {};
+          useWorker(async () => {
+            console.log(props.foo);
+            console.log(props.bar);
+          }, [props]);
+        }
+      `,
+      errors: [
+        "React Hook useWorker has an unnecessary dependency: 'props.foo'. " +
+          'Either exclude it or remove the dependency array.',
+      ],
+    },
+    {
+      // Since we don't have 'props' in the list, we'll suggest narrow dependencies.
+      code: `
+        function MyComponent(props) {
+          const local = {};
+          useWorker(async () => {
+            console.log(props.foo);
+            console.log(props.bar);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const local = {};
+          useWorker(async () => {
+            console.log(props.foo);
+            console.log(props.bar);
+          }, [props.bar, props.foo]);
+        }
+      `,
+      errors: [
+        "React Hook useWorker has missing dependencies: 'props.bar' and 'props.foo'. " +
+          'Either include them or remove the dependency array.',
+      ],
+    },
+    {
+      // It is not valid for useWorkerLoad to specify extraneous deps
+      // because it doesn't serve as a side effect trigger unlike useAsyncEffect.
+      // However, we generally allow specifying *broader* deps as escape hatch.
+      // So while [props, props.foo] is unnecessary, 'props' wins here as the
+      // broader one, and this is why 'props.foo' is reported as unnecessary.
+      code: `
+        function MyComponent(props) {
+          const local = {};
+          useWorkerLoad(async () => {
+            console.log(props.foo);
+            console.log(props.bar);
+          }, [props, props.foo]);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const local = {};
+          useWorkerLoad(async () => {
+            console.log(props.foo);
+            console.log(props.bar);
+          }, [props]);
+        }
+      `,
+      errors: [
+        "React Hook useWorkerLoad has an unnecessary dependency: 'props.foo'. " +
+          'Either exclude it or remove the dependency array.',
+      ],
+    },
+    {
+      // Since we don't have 'props' in the list, we'll suggest narrow dependencies.
+      code: `
+        function MyComponent(props) {
+          const local = {};
+          useWorkerLoad(async () => {
+            console.log(props.foo);
+            console.log(props.bar);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const local = {};
+          useWorkerLoad(async () => {
+            console.log(props.foo);
+            console.log(props.bar);
+          }, [props.bar, props.foo]);
+        }
+      `,
+      errors: [
+        "React Hook useWorkerLoad has missing dependencies: 'props.bar' and 'props.foo'. " +
+          'Either include them or remove the dependency array.',
+      ],
+    },
+    {
+      // Effects are allowed to over-specify deps. We'll complain about missing
+      // 'local', but we won't remove the already-specified 'local.id' from your list.
+      code: `
+        function MyComponent() {
+          const local = {id: 42};
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [local.id]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local = {id: 42};
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [local, local.id]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'local'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      // Callbacks are not allowed to over-specify deps. So we'll complain about missing
+      // 'local' and we will also *remove* 'local.id' from your list.
+      code: `
+        function MyComponent() {
+          const local = {id: 42};
+          const fn = useWorker(async () => {
+            console.log(local);
+          }, [local.id]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local = {id: 42};
+          const fn = useWorker(async () => {
+            console.log(local);
+          }, [local]);
+        }
+      `,
+      errors: [
+        "React Hook useWorker has a missing dependency: 'local'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      // Callbacks are not allowed to over-specify deps. So we'll complain about
+      // the unnecessary 'local.id'.
+      code: `
+        function MyComponent() {
+          const local = {id: 42};
+          const fn = useWorker(async () => {
+            console.log(local);
+          }, [local.id, local]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local = {id: 42};
+          const fn = useWorker(async () => {
+            console.log(local);
+          }, [local]);
+        }
+      `,
+      errors: [
+        "React Hook useWorker has an unnecessary dependency: 'local.id'. " +
+          'Either exclude it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          const fn = useWorker(async () => {
+            console.log(props.foo.bar.baz);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const fn = useWorker(async () => {
+            console.log(props.foo.bar.baz);
+          }, [props.foo.bar.baz]);
+        }
+      `,
+      errors: [
+        "React Hook useWorker has a missing dependency: 'props.foo.bar.baz'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          let color = {}
+          const fn = useWorker(async () => {
+            console.log(props.foo.bar.baz);
+            console.log(color);
+          }, [props.foo, props.foo.bar.baz]);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          let color = {}
+          const fn = useWorker(async () => {
+            console.log(props.foo.bar.baz);
+            console.log(color);
+          }, [color, props.foo.bar.baz]);
+        }
+      `,
+      errors: [
+        "React Hook useWorker has a missing dependency: 'color'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      // Callbacks are not allowed to over-specify deps. So one of these is extra.
+      // However, it *is* allowed to specify broader deps then strictly necessary.
+      // So in this case we ask you to remove 'props.foo.bar.baz' because 'props.foo'
+      // already covers it, and having both is unnecessary.
+      // TODO: maybe consider suggesting a narrower one by default in these cases.
+      code: `
+        function MyComponent(props) {
+          const fn = useWorker(async () => {
+            console.log(props.foo.bar.baz);
+          }, [props.foo.bar.baz, props.foo]);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const fn = useWorker(async () => {
+            console.log(props.foo.bar.baz);
+          }, [props.foo]);
+        }
+      `,
+      errors: [
+        "React Hook useWorker has an unnecessary dependency: 'props.foo.bar.baz'. " +
+          'Either exclude it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          const fn = useWorker(async () => {
+            console.log(props.foo.bar.baz);
+            console.log(props.foo.fizz.bizz);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const fn = useWorker(async () => {
+            console.log(props.foo.bar.baz);
+            console.log(props.foo.fizz.bizz);
+          }, [props.foo.bar.baz, props.foo.fizz.bizz]);
+        }
+      `,
+      errors: [
+        "React Hook useWorker has missing dependencies: 'props.foo.bar.baz' and 'props.foo.fizz.bizz'. " +
+          'Either include them or remove the dependency array.',
+      ],
+    },
+    {
+      // Normally we allow specifying deps too broadly.
+      // So we'd be okay if 'props.foo.bar' was there rather than 'props.foo.bar.baz'.
+      // However, 'props.foo.bar.baz' is missing. So we know there is a mistake.
+      // When we're sure there is a mistake, for callbacks we will rebuild the list
+      // from scratch. This will set the user on a better path by default.
+      // This is why we end up with just 'props.foo.bar', and not them both.
+      code: `
+        function MyComponent(props) {
+          const fn = useWorker(async () => {
+            console.log(props.foo.bar);
+          }, [props.foo.bar.baz]);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const fn = useWorker(async () => {
+            console.log(props.foo.bar);
+          }, [props.foo.bar]);
+        }
+      `,
+      errors: [
+        "React Hook useWorker has a missing dependency: 'props.foo.bar'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          const fn = useWorker(async () => {
+            console.log(props);
+            console.log(props.hello);
+          }, [props.foo.bar.baz]);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const fn = useWorker(async () => {
+            console.log(props);
+            console.log(props.hello);
+          }, [props]);
+        }
+      `,
+      errors: [
+        "React Hook useWorker has a missing dependency: 'props'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      // Callbacks are not allowed to over-specify deps. So we'll complain about missing
+      // 'local' and we will also *remove* 'local.id' from your list.
+      code: `
+        function MyComponent() {
+          const local = {id: 42};
+          const fn = useWorkerLoad(async () => {
+            console.log(local);
+          }, [local.id]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local = {id: 42};
+          const fn = useWorkerLoad(async () => {
+            console.log(local);
+          }, [local]);
+        }
+      `,
+      errors: [
+        "React Hook useWorkerLoad has a missing dependency: 'local'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      // Callbacks are not allowed to over-specify deps. So we'll complain about
+      // the unnecessary 'local.id'.
+      code: `
+        function MyComponent() {
+          const local = {id: 42};
+          const fn = useWorkerLoad(async () => {
+            console.log(local);
+          }, [local.id, local]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local = {id: 42};
+          const fn = useWorkerLoad(async () => {
+            console.log(local);
+          }, [local]);
+        }
+      `,
+      errors: [
+        "React Hook useWorkerLoad has an unnecessary dependency: 'local.id'. " +
+          'Either exclude it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          const fn = useWorkerLoad(async () => {
+            console.log(props.foo.bar.baz);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const fn = useWorkerLoad(async () => {
+            console.log(props.foo.bar.baz);
+          }, [props.foo.bar.baz]);
+        }
+      `,
+      errors: [
+        "React Hook useWorkerLoad has a missing dependency: 'props.foo.bar.baz'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          let color = {}
+          const fn = useWorkerLoad(async () => {
+            console.log(props.foo.bar.baz);
+            console.log(color);
+          }, [props.foo, props.foo.bar.baz]);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          let color = {}
+          const fn = useWorkerLoad(async () => {
+            console.log(props.foo.bar.baz);
+            console.log(color);
+          }, [color, props.foo.bar.baz]);
+        }
+      `,
+      errors: [
+        "React Hook useWorkerLoad has a missing dependency: 'color'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      // Callbacks are not allowed to over-specify deps. So one of these is extra.
+      // However, it *is* allowed to specify broader deps then strictly necessary.
+      // So in this case we ask you to remove 'props.foo.bar.baz' because 'props.foo'
+      // already covers it, and having both is unnecessary.
+      // TODO: maybe consider suggesting a narrower one by default in these cases.
+      code: `
+        function MyComponent(props) {
+          const fn = useWorkerLoad(async () => {
+            console.log(props.foo.bar.baz);
+          }, [props.foo.bar.baz, props.foo]);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const fn = useWorkerLoad(async () => {
+            console.log(props.foo.bar.baz);
+          }, [props.foo]);
+        }
+      `,
+      errors: [
+        "React Hook useWorkerLoad has an unnecessary dependency: 'props.foo.bar.baz'. " +
+          'Either exclude it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          const fn = useWorkerLoad(async () => {
+            console.log(props.foo.bar.baz);
+            console.log(props.foo.fizz.bizz);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const fn = useWorkerLoad(async () => {
+            console.log(props.foo.bar.baz);
+            console.log(props.foo.fizz.bizz);
+          }, [props.foo.bar.baz, props.foo.fizz.bizz]);
+        }
+      `,
+      errors: [
+        "React Hook useWorkerLoad has missing dependencies: 'props.foo.bar.baz' and 'props.foo.fizz.bizz'. " +
+          'Either include them or remove the dependency array.',
+      ],
+    },
+    {
+      // Normally we allow specifying deps too broadly.
+      // So we'd be okay if 'props.foo.bar' was there rather than 'props.foo.bar.baz'.
+      // However, 'props.foo.bar.baz' is missing. So we know there is a mistake.
+      // When we're sure there is a mistake, for callbacks we will rebuild the list
+      // from scratch. This will set the user on a better path by default.
+      // This is why we end up with just 'props.foo.bar', and not them both.
+      code: `
+        function MyComponent(props) {
+          const fn = useWorkerLoad(async () => {
+            console.log(props.foo.bar);
+          }, [props.foo.bar.baz]);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const fn = useWorkerLoad(async () => {
+            console.log(props.foo.bar);
+          }, [props.foo.bar]);
+        }
+      `,
+      errors: [
+        "React Hook useWorkerLoad has a missing dependency: 'props.foo.bar'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          const fn = useWorkerLoad(async () => {
+            console.log(props);
+            console.log(props.hello);
+          }, [props.foo.bar.baz]);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const fn = useWorkerLoad(async () => {
+            console.log(props);
+            console.log(props.hello);
+          }, [props]);
+        }
+      `,
+      errors: [
+        "React Hook useWorkerLoad has a missing dependency: 'props'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [local, local]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [local]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a duplicate dependency: 'local'. " +
+          'Either omit it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local1 = {};
+          useWorker(async () => {
+            const local1 = {};
+            console.log(local1);
+          }, [local1]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local1 = {};
+          useWorker(async () => {
+            const local1 = {};
+            console.log(local1);
+          }, []);
+        }
+      `,
+      errors: [
+        "React Hook useWorker has an unnecessary dependency: 'local1'. " +
+          'Either exclude it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local1 = {};
+          useWorker(async () => {}, [local1]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local1 = {};
+          useWorker(async () => {}, []);
+        }
+      `,
+      errors: [
+        "React Hook useWorker has an unnecessary dependency: 'local1'. " +
+          'Either exclude it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local1 = {};
+          useWorkerLoad(async () => {
+            const local1 = {};
+            console.log(local1);
+          }, [local1]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local1 = {};
+          useWorkerLoad(async () => {
+            const local1 = {};
+            console.log(local1);
+          }, []);
+        }
+      `,
+      errors: [
+        "React Hook useWorkerLoad has an unnecessary dependency: 'local1'. " +
+          'Either exclude it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local1 = {};
+          useWorkerLoad(async () => {}, [local1]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const local1 = {};
+          useWorkerLoad(async () => {}, []);
+        }
+      `,
+      errors: [
+        "React Hook useWorkerLoad has an unnecessary dependency: 'local1'. " +
+          'Either exclude it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            console.log(props.foo);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            console.log(props.foo);
+          }, [props.foo]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'props.foo'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            console.log(props.foo);
+            console.log(props.bar);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            console.log(props.foo);
+            console.log(props.bar);
+          }, [props.bar, props.foo]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has missing dependencies: 'props.bar' and 'props.foo'. " +
+          'Either include them or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          let a, b, c, d, e, f, g;
+          useAsyncEffect(async () => {
+            console.log(b, e, d, c, a, g, f);
+          }, [c, a, g]);
+        }
+      `,
+      // Don't alphabetize if it wasn't alphabetized in the first place.
+      output: `
+        function MyComponent(props) {
+          let a, b, c, d, e, f, g;
+          useAsyncEffect(async () => {
+            console.log(b, e, d, c, a, g, f);
+          }, [c, a, g, b, e, d, f]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has missing dependencies: 'b', 'd', 'e', and 'f'. " +
+          'Either include them or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          let a, b, c, d, e, f, g;
+          useAsyncEffect(async () => {
+            console.log(b, e, d, c, a, g, f);
+          }, [a, c, g]);
+        }
+      `,
+      // Alphabetize if it was alphabetized.
+      output: `
+        function MyComponent(props) {
+          let a, b, c, d, e, f, g;
+          useAsyncEffect(async () => {
+            console.log(b, e, d, c, a, g, f);
+          }, [a, b, c, d, e, f, g]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has missing dependencies: 'b', 'd', 'e', and 'f'. " +
+          'Either include them or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          let a, b, c, d, e, f, g;
+          useAsyncEffect(async () => {
+            console.log(b, e, d, c, a, g, f);
+          }, []);
+        }
+      `,
+      // Alphabetize if it was empty.
+      output: `
+        function MyComponent(props) {
+          let a, b, c, d, e, f, g;
+          useAsyncEffect(async () => {
+            console.log(b, e, d, c, a, g, f);
+          }, [a, b, c, d, e, f, g]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has missing dependencies: 'a', 'b', 'c', 'd', 'e', 'f', and 'g'. " +
+          'Either include them or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(props.foo);
+            console.log(props.bar);
+            console.log(local);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(props.foo);
+            console.log(props.bar);
+            console.log(local);
+          }, [local, props.bar, props.foo]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has missing dependencies: 'local', 'props.bar', and 'props.foo'. " +
+          'Either include them or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(props.foo);
+            console.log(props.bar);
+            console.log(local);
+          }, [props]);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(props.foo);
+            console.log(props.bar);
+            console.log(local);
+          }, [local, props]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'local'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            console.log(props.foo);
+          }, []);
+          useWorker(async () => {
+            console.log(props.foo);
+          }, []);
+          useEffectUpdate(() => {
+            console.log(props.foo);
+          }, []);
+          React.useAsyncEffect(async () => {
+            console.log(props.foo);
+          }, []);
+          React.useWorker(async () => {
+            console.log(props.foo);
+          }, []);
+          React.useEffectUpdate(() => {
+            console.log(props.foo);
+          }, []);
+          React.notReactiveHook(() => {
+            console.log(props.foo);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            console.log(props.foo);
+          }, [props.foo]);
+          useWorker(async () => {
+            console.log(props.foo);
+          }, [props.foo]);
+          useEffectUpdate(() => {
+            console.log(props.foo);
+          }, [props.foo]);
+          React.useAsyncEffect(async () => {
+            console.log(props.foo);
+          }, [props.foo]);
+          React.useWorker(async () => {
+            console.log(props.foo);
+          }, [props.foo]);
+          React.useEffectUpdate(() => {
+            console.log(props.foo);
+          }, [props.foo]);
+          React.notReactiveHook(() => {
+            console.log(props.foo);
+          }, []);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'props.foo'. " +
+          'Either include it or remove the dependency array.',
+        "React Hook useWorker has a missing dependency: 'props.foo'. " +
+          'Either include it or remove the dependency array.',
+        "React Hook useEffectUpdate has a missing dependency: 'props.foo'. " +
+          'Either include it or remove the dependency array.',
+        "React Hook React.useAsyncEffect has a missing dependency: 'props.foo'. " +
+          'Either include it or remove the dependency array.',
+        "React Hook React.useWorker has a missing dependency: 'props.foo'. " +
+          'Either include it or remove the dependency array.',
+        "React Hook React.useEffectUpdate has a missing dependency: 'props.foo'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            console.log(props.foo);
+          }, []);
+          useWorkerLoad(async () => {
+            console.log(props.foo);
+          }, []);
+          useEffectUpdate(() => {
+            console.log(props.foo);
+          }, []);
+          React.useAsyncEffect(async () => {
+            console.log(props.foo);
+          }, []);
+          React.useWorkerLoad(async () => {
+            console.log(props.foo);
+          }, []);
+          React.useEffectUpdate(() => {
+            console.log(props.foo);
+          }, []);
+          React.notReactiveHook(() => {
+            console.log(props.foo);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            console.log(props.foo);
+          }, [props.foo]);
+          useWorkerLoad(async () => {
+            console.log(props.foo);
+          }, [props.foo]);
+          useEffectUpdate(() => {
+            console.log(props.foo);
+          }, [props.foo]);
+          React.useAsyncEffect(async () => {
+            console.log(props.foo);
+          }, [props.foo]);
+          React.useWorkerLoad(async () => {
+            console.log(props.foo);
+          }, [props.foo]);
+          React.useEffectUpdate(() => {
+            console.log(props.foo);
+          }, [props.foo]);
+          React.notReactiveHook(() => {
+            console.log(props.foo);
+          }, []);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'props.foo'. " +
+          'Either include it or remove the dependency array.',
+        "React Hook useWorkerLoad has a missing dependency: 'props.foo'. " +
+          'Either include it or remove the dependency array.',
+        "React Hook useEffectUpdate has a missing dependency: 'props.foo'. " +
+          'Either include it or remove the dependency array.',
+        "React Hook React.useAsyncEffect has a missing dependency: 'props.foo'. " +
+          'Either include it or remove the dependency array.',
+        "React Hook React.useWorkerLoad has a missing dependency: 'props.foo'. " +
+          'Either include it or remove the dependency array.',
+        "React Hook React.useEffectUpdate has a missing dependency: 'props.foo'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [a ? local : b]);
+        }
+      `,
+      // TODO: should we bail out instead?
+      output: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [local]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'local'. " +
+          'Either include it or remove the dependency array.',
+        'React Hook useAsyncEffect has a complex expression in the dependency array. ' +
+          'Extract it to a separate variable so it can be statically checked.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [a && local]);
+        }
+      `,
+      // TODO: should we bail out instead?
+      output: `
+        function MyComponent() {
+          const local = {};
+          useAsyncEffect(async () => {
+            console.log(local);
+          }, [local]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'local'. " +
+          'Either include it or remove the dependency array.',
+        'React Hook useAsyncEffect has a complex expression in the dependency array. ' +
+          'Extract it to a separate variable so it can be statically checked.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const ref = useRef();
+          const [state, setState] = useState();
+          useAsyncEffect(async () => {
+            ref.current = {};
+            setState(state + 1);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const ref = useRef();
+          const [state, setState] = useState();
+          useAsyncEffect(async () => {
+            ref.current = {};
+            setState(state + 1);
+          }, [state]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'state'. " +
+          'Either include it or remove the dependency array. ' +
+          `You can also do a functional update 'setState(s => ...)' ` +
+          `if you only need 'state' in the 'setState' call.`,
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const ref = useRef();
+          const [state, setState] = useState();
+          useAsyncEffect(async () => {
+            ref.current = {};
+            setState(state + 1);
+          }, [ref]);
+        }
+      `,
+      // We don't ask to remove static deps but don't add them either.
+      // Don't suggest removing "ref" (it's fine either way)
+      // but *do* add "state". *Don't* add "setState" ourselves.
+      output: `
+        function MyComponent() {
+          const ref = useRef();
+          const [state, setState] = useState();
+          useAsyncEffect(async () => {
+            ref.current = {};
+            setState(state + 1);
+          }, [ref, state]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'state'. " +
+          'Either include it or remove the dependency array. ' +
+          `You can also do a functional update 'setState(s => ...)' ` +
+          `if you only need 'state' in the 'setState' call.`,
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          const ref1 = useRef();
+          const ref2 = useRef();
+          useAsyncEffect(async () => {
+            ref1.current.focus();
+            console.log(ref2.current.textContent);
+            alert(props.someOtherRefs.current.innerHTML);
+            fetch(props.color);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const ref1 = useRef();
+          const ref2 = useRef();
+          useAsyncEffect(async () => {
+            ref1.current.focus();
+            console.log(ref2.current.textContent);
+            alert(props.someOtherRefs.current.innerHTML);
+            fetch(props.color);
+          }, [props.color, props.someOtherRefs]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has missing dependencies: 'props.color' and 'props.someOtherRefs'. " +
+          'Either include them or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          const ref1 = useRef();
+          const ref2 = useRef();
+          useAsyncEffect(async () => {
+            ref1.current.focus();
+            console.log(ref2.current.textContent);
+            alert(props.someOtherRefs.current.innerHTML);
+            fetch(props.color);
+          }, [ref1.current, ref2.current, props.someOtherRefs, props.color]);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const ref1 = useRef();
+          const ref2 = useRef();
+          useAsyncEffect(async () => {
+            ref1.current.focus();
+            console.log(ref2.current.textContent);
+            alert(props.someOtherRefs.current.innerHTML);
+            fetch(props.color);
+          }, [props.someOtherRefs, props.color]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has unnecessary dependencies: 'ref1.current' and 'ref2.current'. " +
+          'Either exclude them or remove the dependency array. ' +
+          "Mutable values like 'ref1.current' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const ref = useRef();
+          useAsyncEffect(async () => {
+            console.log(ref.current);
+          }, [ref.current]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const ref = useRef();
+          useAsyncEffect(async () => {
+            console.log(ref.current);
+          }, []);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has an unnecessary dependency: 'ref.current'. " +
+          'Either exclude it or remove the dependency array. ' +
+          "Mutable values like 'ref.current' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        function MyComponent({ activeTab }) {
+          const ref1 = useRef();
+          const ref2 = useRef();
+          useAsyncEffect(async () => {
+            ref1.current.scrollTop = 0;
+            ref2.current.scrollTop = 0;
+          }, [ref1.current, ref2.current, activeTab]);
+        }
+      `,
+      output: `
+        function MyComponent({ activeTab }) {
+          const ref1 = useRef();
+          const ref2 = useRef();
+          useAsyncEffect(async () => {
+            ref1.current.scrollTop = 0;
+            ref2.current.scrollTop = 0;
+          }, [activeTab]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has unnecessary dependencies: 'ref1.current' and 'ref2.current'. " +
+          'Either exclude them or remove the dependency array. ' +
+          "Mutable values like 'ref1.current' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        function MyComponent({ activeTab, initY }) {
+          const ref1 = useRef();
+          const ref2 = useRef();
+          const fn = useWorker(async () => {
+            ref1.current.scrollTop = initY;
+            ref2.current.scrollTop = initY;
+          }, [ref1.current, ref2.current, activeTab, initY]);
+        }
+      `,
+      output: `
+        function MyComponent({ activeTab, initY }) {
+          const ref1 = useRef();
+          const ref2 = useRef();
+          const fn = useWorker(async () => {
+            ref1.current.scrollTop = initY;
+            ref2.current.scrollTop = initY;
+          }, [initY]);
+        }
+      `,
+      errors: [
+        "React Hook useWorker has unnecessary dependencies: 'activeTab', 'ref1.current', and 'ref2.current'. " +
+          'Either exclude them or remove the dependency array. ' +
+          "Mutable values like 'ref1.current' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        function MyComponent({ activeTab, initY }) {
+          const ref1 = useRef();
+          const ref2 = useRef();
+          const fn = useWorkerLoad(async () => {
+            ref1.current.scrollTop = initY;
+            ref2.current.scrollTop = initY;
+          }, [ref1.current, ref2.current, activeTab, initY]);
+        }
+      `,
+      output: `
+        function MyComponent({ activeTab, initY }) {
+          const ref1 = useRef();
+          const ref2 = useRef();
+          const fn = useWorkerLoad(async () => {
+            ref1.current.scrollTop = initY;
+            ref2.current.scrollTop = initY;
+          }, [initY]);
+        }
+      `,
+      errors: [
+        "React Hook useWorkerLoad has unnecessary dependencies: 'activeTab', 'ref1.current', and 'ref2.current'. " +
+          'Either exclude them or remove the dependency array. ' +
+          "Mutable values like 'ref1.current' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const ref = useRef();
+          useAsyncEffect(async () => {
+            console.log(ref.current);
+          }, [ref.current, ref]);
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const ref = useRef();
+          useAsyncEffect(async () => {
+            console.log(ref.current);
+          }, [ref]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has an unnecessary dependency: 'ref.current'. " +
+          'Either exclude it or remove the dependency array. ' +
+          "Mutable values like 'ref.current' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        const MyComponent = forwardRef((props, ref) => {
+          useConditionalEffect(ref, () => ({
+            focus() {
+              alert(props.hello);
+            }
+          }), [])
+        });
+      `,
+      output: `
+        const MyComponent = forwardRef((props, ref) => {
+          useConditionalEffect(ref, () => ({
+            focus() {
+              alert(props.hello);
+            }
+          }), [props.hello])
+        });
+      `,
+      errors: [
+        "React Hook useConditionalEffect has a missing dependency: 'props.hello'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            if (props.onChange) {
+              props.onChange();
+            }
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            if (props.onChange) {
+              props.onChange();
+            }
+          }, [props]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'props'. " +
+          'Either include it or remove the dependency array. ' +
+          `However, 'props' will change when *any* prop changes, so the ` +
+          `preferred fix is to destructure the 'props' object outside ` +
+          `of the useAsyncEffect call and refer to those specific ` +
+          `props inside useAsyncEffect.`,
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+           function play() {
+              props.onPlay();
+            }
+            function pause() {
+              props.onPause();
+            }
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+           function play() {
+              props.onPlay();
+            }
+            function pause() {
+              props.onPause();
+            }
+          }, [props]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'props'. " +
+          'Either include it or remove the dependency array. ' +
+          `However, 'props' will change when *any* prop changes, so the ` +
+          `preferred fix is to destructure the 'props' object outside ` +
+          `of the useAsyncEffect call and refer to those specific ` +
+          `props inside useAsyncEffect.`,
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            if (props.foo.onChange) {
+              props.foo.onChange();
+            }
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            if (props.foo.onChange) {
+              props.foo.onChange();
+            }
+          }, [props.foo]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'props.foo'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            props.onChange();
+            if (props.foo.onChange) {
+              props.foo.onChange();
+            }
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            props.onChange();
+            if (props.foo.onChange) {
+              props.foo.onChange();
+            }
+          }, [props]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'props'. " +
+          'Either include it or remove the dependency array. ' +
+          `However, 'props' will change when *any* prop changes, so the ` +
+          `preferred fix is to destructure the 'props' object outside ` +
+          `of the useAsyncEffect call and refer to those specific ` +
+          `props inside useAsyncEffect.`,
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          const [skillsCount] = useState();
+          useAsyncEffect(async () => {
+            if (skillsCount === 0 && !props.isEditMode) {
+              props.toggleEditMode();
+            }
+          }, [skillsCount, props.isEditMode, props.toggleEditMode]);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const [skillsCount] = useState();
+          useAsyncEffect(async () => {
+            if (skillsCount === 0 && !props.isEditMode) {
+              props.toggleEditMode();
+            }
+          }, [skillsCount, props.isEditMode, props.toggleEditMode, props]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'props'. " +
+          'Either include it or remove the dependency array. ' +
+          `However, 'props' will change when *any* prop changes, so the ` +
+          `preferred fix is to destructure the 'props' object outside ` +
+          `of the useAsyncEffect call and refer to those specific ` +
+          `props inside useAsyncEffect.`,
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          const [skillsCount] = useState();
+          useAsyncEffect(async () => {
+            if (skillsCount === 0 && !props.isEditMode) {
+              props.toggleEditMode();
+            }
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          const [skillsCount] = useState();
+          useAsyncEffect(async () => {
+            if (skillsCount === 0 && !props.isEditMode) {
+              props.toggleEditMode();
+            }
+          }, [props, skillsCount]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has missing dependencies: 'props' and 'skillsCount'. " +
+          'Either include them or remove the dependency array. ' +
+          `However, 'props' will change when *any* prop changes, so the ` +
+          `preferred fix is to destructure the 'props' object outside ` +
+          `of the useAsyncEffect call and refer to those specific ` +
+          `props inside useAsyncEffect.`,
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            externalCall(props);
+            props.onChange();
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            externalCall(props);
+            props.onChange();
+          }, [props]);
+        }
+      `,
+      // Don't suggest to destructure props here since you can't.
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'props'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            props.onChange();
+            externalCall(props);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          useAsyncEffect(async () => {
+            props.onChange();
+            externalCall(props);
+          }, [props]);
+        }
+      `,
+      // Don't suggest to destructure props here since you can't.
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'props'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          let value;
+          let value2;
+          let value3;
+          let value4;
+          let asyncValue;
+          useAsyncEffect(async () => {
+            if (value4) {
+              value = {};
+            }
+            value2 = 100;
+            value = 43;
+            value4 = true;
+            console.log(value2);
+            console.log(value3);
+            setTimeout(() => {
+              asyncValue = 100;
+            });
+          }, []);
+        }
+      `,
+      // This is a separate warning unrelated to others.
+      // We could've made a separate rule for it but it's rare enough to name it.
+      // No autofix suggestion because the intent isn't clear.
+      output: `
+        function MyComponent(props) {
+          let value;
+          let value2;
+          let value3;
+          let value4;
+          let asyncValue;
+          useAsyncEffect(async () => {
+            if (value4) {
+              value = {};
+            }
+            value2 = 100;
+            value = 43;
+            value4 = true;
+            console.log(value2);
+            console.log(value3);
+            setTimeout(() => {
+              asyncValue = 100;
+            });
+          }, []);
+        }
+      `,
+      errors: [
+        // value2
+        `Assignments to the 'value2' variable from inside React Hook useAsyncEffect ` +
+          `will be lost after each render. To preserve the value over time, ` +
+          `store it in a useRef or useLazyRef Hook and keep the mutable value in the '.current' property. ` +
+          `Otherwise, you can move this variable directly inside useAsyncEffect.`, // value
+        `Assignments to the 'value' variable from inside React Hook useAsyncEffect ` +
+          `will be lost after each render. To preserve the value over time, ` +
+          `store it in a useRef or useLazyRef Hook and keep the mutable value in the '.current' property. ` +
+          `Otherwise, you can move this variable directly inside useAsyncEffect.`, // value4
+        `Assignments to the 'value4' variable from inside React Hook useAsyncEffect ` +
+          `will be lost after each render. To preserve the value over time, ` +
+          `store it in a useRef or useLazyRef Hook and keep the mutable value in the '.current' property. ` +
+          `Otherwise, you can move this variable directly inside useAsyncEffect.`, // asyncValue
+        `Assignments to the 'asyncValue' variable from inside React Hook useAsyncEffect ` +
+          `will be lost after each render. To preserve the value over time, ` +
+          `store it in a useRef or useLazyRef Hook and keep the mutable value in the '.current' property. ` +
+          `Otherwise, you can move this variable directly inside useAsyncEffect.`,
+      ],
+    },
+    {
+      code: `
+        function MyComponent(props) {
+          let value;
+          let value2;
+          let value3;
+          let asyncValue;
+          useAsyncEffect(async () => {
+            value = {};
+            value2 = 100;
+            value = 43;
+            console.log(value2);
+            console.log(value3);
+            setTimeout(() => {
+              asyncValue = 100;
+            });
+          }, [value, value2, value3]);
+        }
+      `,
+      // This is a separate warning unrelated to others.
+      // We could've made a separate rule for it but it's rare enough to name it.
+      // No autofix suggestion because the intent isn't clear.
+      output: `
+        function MyComponent(props) {
+          let value;
+          let value2;
+          let value3;
+          let asyncValue;
+          useAsyncEffect(async () => {
+            value = {};
+            value2 = 100;
+            value = 43;
+            console.log(value2);
+            console.log(value3);
+            setTimeout(() => {
+              asyncValue = 100;
+            });
+          }, [value, value2, value3]);
+        }
+      `,
+      errors: [
+        // value
+        `Assignments to the 'value' variable from inside React Hook useAsyncEffect ` +
+          `will be lost after each render. To preserve the value over time, ` +
+          `store it in a useRef or useLazyRef Hook and keep the mutable value in the '.current' property. ` +
+          `Otherwise, you can move this variable directly inside useAsyncEffect.`, // value2
+        `Assignments to the 'value2' variable from inside React Hook useAsyncEffect ` +
+          `will be lost after each render. To preserve the value over time, ` +
+          `store it in a useRef or useLazyRef Hook and keep the mutable value in the '.current' property. ` +
+          `Otherwise, you can move this variable directly inside useAsyncEffect.`, // asyncValue
+        `Assignments to the 'asyncValue' variable from inside React Hook useAsyncEffect ` +
+          `will be lost after each render. To preserve the value over time, ` +
+          `store it in a useRef or useLazyRef Hook and keep the mutable value in the '.current' property. ` +
+          `Otherwise, you can move this variable directly inside useAsyncEffect.`,
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const myRef = useRef();
+          useAsyncEffect(async () => {
+            const handleMove = () => {};
+            myRef.current.addEventListener('mousemove', handleMove);
+            return () => myRef.current.removeEventListener('mousemove', handleMove);
+          }, []);
+          return <div ref={myRef} />;
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const myRef = useRef();
+          useAsyncEffect(async () => {
+            const handleMove = () => {};
+            myRef.current.addEventListener('mousemove', handleMove);
+            return () => myRef.current.removeEventListener('mousemove', handleMove);
+          }, []);
+          return <div ref={myRef} />;
+        }
+      `,
+      errors: [
+        `The ref value 'myRef.current' will likely have changed by the time ` +
+          `this effect cleanup function runs. If this ref points to a node ` +
+          `rendered by React, copy 'myRef.current' to a variable inside the effect, ` +
+          `and use that variable in the cleanup function.`,
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          const myRef = useRef();
+          useAsyncEffect(async () => {
+            const handleMove = () => {};
+            myRef.current.addEventListener('mousemove', handleMove);
+            return () => myRef.current.removeEventListener('mousemove', handleMove);
+          });
+          return <div ref={myRef} />;
+        }
+      `,
+      output: `
+        function MyComponent() {
+          const myRef = useRef();
+          useAsyncEffect(async () => {
+            const handleMove = () => {};
+            myRef.current.addEventListener('mousemove', handleMove);
+            return () => myRef.current.removeEventListener('mousemove', handleMove);
+          });
+          return <div ref={myRef} />;
+        }
+      `,
+      errors: [
+        `The ref value 'myRef.current' will likely have changed by the time ` +
+          `this effect cleanup function runs. If this ref points to a node ` +
+          `rendered by React, copy 'myRef.current' to a variable inside the effect, ` +
+          `and use that variable in the cleanup function.`,
+      ],
+    },
+    {
+      code: `
+        function useMyThing(myRef) {
+          useAsyncEffect(async () => {
+            const handleMove = () => {};
+            myRef.current.addEventListener('mousemove', handleMove);
+            return () => myRef.current.removeEventListener('mousemove', handleMove);
+          }, [myRef]);
+        }
+      `,
+      output: `
+        function useMyThing(myRef) {
+          useAsyncEffect(async () => {
+            const handleMove = () => {};
+            myRef.current.addEventListener('mousemove', handleMove);
+            return () => myRef.current.removeEventListener('mousemove', handleMove);
+          }, [myRef]);
+        }
+      `,
+      errors: [
+        `The ref value 'myRef.current' will likely have changed by the time ` +
+          `this effect cleanup function runs. If this ref points to a node ` +
+          `rendered by React, copy 'myRef.current' to a variable inside the effect, ` +
+          `and use that variable in the cleanup function.`,
+      ],
+    },
+    {
+      code: `
+        function useMyThing(myRef) {
+          useAsyncEffect(async () => {
+            const handleMouse = () => {};
+            myRef.current.addEventListener('mousemove', handleMouse);
+            myRef.current.addEventListener('mousein', handleMouse);
+            return function() {
+              setTimeout(() => {
+                myRef.current.removeEventListener('mousemove', handleMouse);
+                myRef.current.removeEventListener('mousein', handleMouse);
+              });
+            }
+          }, [myRef]);
+        }
+      `,
+      output: `
+        function useMyThing(myRef) {
+          useAsyncEffect(async () => {
+            const handleMouse = () => {};
+            myRef.current.addEventListener('mousemove', handleMouse);
+            myRef.current.addEventListener('mousein', handleMouse);
+            return function() {
+              setTimeout(() => {
+                myRef.current.removeEventListener('mousemove', handleMouse);
+                myRef.current.removeEventListener('mousein', handleMouse);
+              });
+            }
+          }, [myRef]);
+        }
+      `,
+      errors: [
+        `The ref value 'myRef.current' will likely have changed by the time ` +
+          `this effect cleanup function runs. If this ref points to a node ` +
+          `rendered by React, copy 'myRef.current' to a variable inside the effect, ` +
+          `and use that variable in the cleanup function.`,
+      ],
+    },
+    {
+      code: `
+        function useMyThing(myRef, active) {
+          useAsyncEffect(async () => {
+            const handleMove = () => {};
+            if (active) {
+              myRef.current.addEventListener('mousemove', handleMove);
+              return function() {
+                setTimeout(() => {
+                  myRef.current.removeEventListener('mousemove', handleMove);
+                });
+              }
+            }
+          }, [myRef, active]);
+        }
+      `,
+      output: `
+        function useMyThing(myRef, active) {
+          useAsyncEffect(async () => {
+            const handleMove = () => {};
+            if (active) {
+              myRef.current.addEventListener('mousemove', handleMove);
+              return function() {
+                setTimeout(() => {
+                  myRef.current.removeEventListener('mousemove', handleMove);
+                });
+              }
+            }
+          }, [myRef, active]);
+        }
+      `,
+      errors: [
+        `The ref value 'myRef.current' will likely have changed by the time ` +
+          `this effect cleanup function runs. If this ref points to a node ` +
+          `rendered by React, copy 'myRef.current' to a variable inside the effect, ` +
+          `and use that variable in the cleanup function.`,
+      ],
+    },
+    {
+      // Autofix ignores constant primitives (leaving the ones that are there).
+      code: `
+      function MyComponent() {
+        const local1 = 42;
+        const local2 = '42';
+        const local3 = null;
+        const local4 = {};
+        useAsyncEffect(async () => {
+          console.log(local1);
+          console.log(local2);
+          console.log(local3);
+          console.log(local4);
+        }, [local1, local3]);
+      }
+    `,
+      output: `
+      function MyComponent() {
+        const local1 = 42;
+        const local2 = '42';
+        const local3 = null;
+        const local4 = {};
+        useAsyncEffect(async () => {
+          console.log(local1);
+          console.log(local2);
+          console.log(local3);
+          console.log(local4);
+        }, [local1, local3, local4]);
+      }
+    `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'local4'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function MyComponent() {
+          useAsyncEffect(async () => {
+            window.scrollTo(0, 0);
+          }, [window]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has an unnecessary dependency: 'window'. " +
+          'Either exclude it or remove the dependency array. ' +
+          "Outer scope values like 'window' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        import MutableStore from 'store';
+
+        function MyComponent() {
+          useAsyncEffect(async () => {
+            console.log(MutableStore.hello);
+          }, [MutableStore.hello]);
+        }
+      `,
+      output: `
+        import MutableStore from 'store';
+
+        function MyComponent() {
+          useAsyncEffect(async () => {
+            console.log(MutableStore.hello);
+          }, []);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has an unnecessary dependency: 'MutableStore.hello'. " +
+          'Either exclude it or remove the dependency array. ' +
+          "Outer scope values like 'MutableStore.hello' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        import MutableStore from 'store';
+        let z = {};
+
+        function MyComponent(props) {
+          let x = props.foo;
+          {
+            let y = props.bar;
+            useAsyncEffect(async () => {
+              console.log(MutableStore.hello.world, props.foo, x, y, z, global.stuff);
+            }, [MutableStore.hello.world, props.foo, x, y, z, global.stuff]);
+          }
+        }
+      `,
+      output: `
+        import MutableStore from 'store';
+        let z = {};
+
+        function MyComponent(props) {
+          let x = props.foo;
+          {
+            let y = props.bar;
+            useAsyncEffect(async () => {
+              console.log(MutableStore.hello.world, props.foo, x, y, z, global.stuff);
+            }, [props.foo, x, y]);
+          }
+        }
+      `,
+      errors: [
+        'React Hook useAsyncEffect has unnecessary dependencies: ' +
+          "'MutableStore.hello.world', 'global.stuff', and 'z'. " +
+          'Either exclude them or remove the dependency array. ' +
+          "Outer scope values like 'MutableStore.hello.world' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        import MutableStore from 'store';
+        let z = {};
+
+        function MyComponent(props) {
+          let x = props.foo;
+          {
+            let y = props.bar;
+            useAsyncEffect(async () => {
+              // nothing
+            }, [MutableStore.hello.world, props.foo, x, y, z, global.stuff]);
+          }
+        }
+      `,
+      // The output should contain the ones that are inside a component
+      // since there are legit reasons to over-specify them for effects.
+      output: `
+        import MutableStore from 'store';
+        let z = {};
+
+        function MyComponent(props) {
+          let x = props.foo;
+          {
+            let y = props.bar;
+            useAsyncEffect(async () => {
+              // nothing
+            }, [props.foo, x, y]);
+          }
+        }
+      `,
+      errors: [
+        'React Hook useAsyncEffect has unnecessary dependencies: ' +
+          "'MutableStore.hello.world', 'global.stuff', and 'z'. " +
+          'Either exclude them or remove the dependency array. ' +
+          "Outer scope values like 'MutableStore.hello.world' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        import MutableStore from 'store';
+        let z = {};
+
+        function MyComponent(props) {
+          let x = props.foo;
+          {
+            let y = props.bar;
+            const fn = useWorker(async () => {
+              // nothing
+            }, [MutableStore.hello.world, props.foo, x, y, z, global.stuff]);
+          }
+        }
+      `,
+      output: `
+        import MutableStore from 'store';
+        let z = {};
+
+        function MyComponent(props) {
+          let x = props.foo;
+          {
+            let y = props.bar;
+            const fn = useWorker(async () => {
+              // nothing
+            }, []);
+          }
+        }
+      `,
+      errors: [
+        'React Hook useWorker has unnecessary dependencies: ' +
+          "'MutableStore.hello.world', 'global.stuff', 'props.foo', 'x', 'y', and 'z'. " +
+          'Either exclude them or remove the dependency array. ' +
+          "Outer scope values like 'MutableStore.hello.world' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      code: `
+        import MutableStore from 'store';
+        let z = {};
+
+        function MyComponent(props) {
+          let x = props.foo;
+          {
+            let y = props.bar;
+            const fn = useWorkerLoad(async () => {
+              // nothing
+            }, [MutableStore.hello.world, props.foo, x, y, z, global.stuff]);
+          }
+        }
+      `,
+      output: `
+        import MutableStore from 'store';
+        let z = {};
+
+        function MyComponent(props) {
+          let x = props.foo;
+          {
+            let y = props.bar;
+            const fn = useWorkerLoad(async () => {
+              // nothing
+            }, []);
+          }
+        }
+      `,
+      errors: [
+        'React Hook useWorkerLoad has unnecessary dependencies: ' +
+          "'MutableStore.hello.world', 'global.stuff', 'props.foo', 'x', 'y', and 'z'. " +
+          'Either exclude them or remove the dependency array. ' +
+          "Outer scope values like 'MutableStore.hello.world' aren't valid dependencies " +
+          "because mutating them doesn't re-render the component.",
+      ],
+    },
+    {
+      // Every almost-static function is tainted by a dynamic value.
+      code: `
+        function MyComponent(props) {
+          let [, setState] = useState();
+          let [, dispatch] = React.useReducer();
+          let taint = props.foo;
+
+          function handleNext1(value) {
+            let value2 = value * taint;
+            setState(value2);
+            console.log('hello');
+          }
+          const handleNext2 = (value) => {
+            setState(taint(value));
+            console.log('hello');
+          };
+          let handleNext3 = function(value) {
+            setTimeout(() => console.log(taint));
+            dispatch({ type: 'x', value });
+          };
+          useAsyncEffect(async () => {
+            return Store.subscribe(handleNext1);
+          }, []);
+          useAsyncLayoutEffect(async () => {
+            return Store.subscribe(handleNext2);
+          }, []);
+          useEffectUpdate(() => {
+            return Store.subscribe(handleNext3);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          let [, setState] = useState();
+          let [, dispatch] = React.useReducer();
+          let taint = props.foo;
+
+          function handleNext1(value) {
+            let value2 = value * taint;
+            setState(value2);
+            console.log('hello');
+          }
+          const handleNext2 = (value) => {
+            setState(taint(value));
+            console.log('hello');
+          };
+          let handleNext3 = function(value) {
+            setTimeout(() => console.log(taint));
+            dispatch({ type: 'x', value });
+          };
+          useAsyncEffect(async () => {
+            return Store.subscribe(handleNext1);
+          }, [handleNext1]);
+          useAsyncLayoutEffect(async () => {
+            return Store.subscribe(handleNext2);
+          }, [handleNext2]);
+          useEffectUpdate(() => {
+            return Store.subscribe(handleNext3);
+          }, [handleNext3]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'handleNext1'. " +
+          'Either include it or remove the dependency array.',
+        "React Hook useAsyncLayoutEffect has a missing dependency: 'handleNext2'. " +
+          'Either include it or remove the dependency array.',
+        "React Hook useEffectUpdate has a missing dependency: 'handleNext3'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      // Regression test
+      code: `
+        function MyComponent(props) {
+          let [, setState] = useState();
+          let [, dispatch] = React.useReducer();
+          let taint = props.foo;
+
+          // Shouldn't affect anything
+          function handleChange() {}
+
+          function handleNext1(value) {
+            let value2 = value * taint;
+            setState(value2);
+            console.log('hello');
+          }
+          const handleNext2 = (value) => {
+            setState(taint(value));
+            console.log('hello');
+          };
+          let handleNext3 = function(value) {
+            console.log(taint);
+            dispatch({ type: 'x', value });
+          };
+          useAsyncEffect(async () => {
+            return Store.subscribe(handleNext1);
+          }, []);
+          useAsyncLayoutEffect(async () => {
+            return Store.subscribe(handleNext2);
+          }, []);
+          useEffectUpdate(() => {
+            return Store.subscribe(handleNext3);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          let [, setState] = useState();
+          let [, dispatch] = React.useReducer();
+          let taint = props.foo;
+
+          // Shouldn't affect anything
+          function handleChange() {}
+
+          function handleNext1(value) {
+            let value2 = value * taint;
+            setState(value2);
+            console.log('hello');
+          }
+          const handleNext2 = (value) => {
+            setState(taint(value));
+            console.log('hello');
+          };
+          let handleNext3 = function(value) {
+            console.log(taint);
+            dispatch({ type: 'x', value });
+          };
+          useAsyncEffect(async () => {
+            return Store.subscribe(handleNext1);
+          }, [handleNext1]);
+          useAsyncLayoutEffect(async () => {
+            return Store.subscribe(handleNext2);
+          }, [handleNext2]);
+          useEffectUpdate(() => {
+            return Store.subscribe(handleNext3);
+          }, [handleNext3]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'handleNext1'. " +
+          'Either include it or remove the dependency array.',
+        "React Hook useAsyncLayoutEffect has a missing dependency: 'handleNext2'. " +
+          'Either include it or remove the dependency array.',
+        "React Hook useEffectUpdate has a missing dependency: 'handleNext3'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      // Regression test
+      code: `
+        function MyComponent(props) {
+          let [, setState] = useState();
+          let [, dispatch] = React.useReducer();
+          let taint = props.foo;
+
+          // Shouldn't affect anything
+          const handleChange = () => {};
+
+          function handleNext1(value) {
+            let value2 = value * taint;
+            setState(value2);
+            console.log('hello');
+          }
+          const handleNext2 = (value) => {
+            setState(taint(value));
+            console.log('hello');
+          };
+          let handleNext3 = function(value) {
+            console.log(taint);
+            dispatch({ type: 'x', value });
+          };
+          useAsyncEffect(async () => {
+            return Store.subscribe(handleNext1);
+          }, []);
+          useAsyncLayoutEffect(async () => {
+            return Store.subscribe(handleNext2);
+          }, []);
+          useEffectUpdate(() => {
+            return Store.subscribe(handleNext3);
+          }, []);
+        }
+      `,
+      output: `
+        function MyComponent(props) {
+          let [, setState] = useState();
+          let [, dispatch] = React.useReducer();
+          let taint = props.foo;
+
+          // Shouldn't affect anything
+          const handleChange = () => {};
+
+          function handleNext1(value) {
+            let value2 = value * taint;
+            setState(value2);
+            console.log('hello');
+          }
+          const handleNext2 = (value) => {
+            setState(taint(value));
+            console.log('hello');
+          };
+          let handleNext3 = function(value) {
+            console.log(taint);
+            dispatch({ type: 'x', value });
+          };
+          useAsyncEffect(async () => {
+            return Store.subscribe(handleNext1);
+          }, [handleNext1]);
+          useAsyncLayoutEffect(async () => {
+            return Store.subscribe(handleNext2);
+          }, [handleNext2]);
+          useEffectUpdate(() => {
+            return Store.subscribe(handleNext3);
+          }, [handleNext3]);
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'handleNext1'. " +
+          'Either include it or remove the dependency array.',
+        "React Hook useAsyncLayoutEffect has a missing dependency: 'handleNext2'. " +
+          'Either include it or remove the dependency array.',
+        "React Hook useEffectUpdate has a missing dependency: 'handleNext3'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function Counter() {
+          let [count, setCount] = useState(0);
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              setCount(count + 1);
+            }, 1000);
+            return () => clearInterval(id);
+          }, []);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+      output: `
+        function Counter() {
+          let [count, setCount] = useState(0);
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              setCount(count + 1);
+            }, 1000);
+            return () => clearInterval(id);
+          }, [count]);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'count'. " +
+          'Either include it or remove the dependency array. ' +
+          `You can also do a functional update 'setCount(c => ...)' if you ` +
+          `only need 'count' in the 'setCount' call.`,
+      ],
+    },
+    {
+      code: `
+        function Counter() {
+          let [count, setCount] = useState(0);
+          let [increment, setIncrement] = useState(0);
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              setCount(count + increment);
+            }, 1000);
+            return () => clearInterval(id);
+          }, []);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+      output: `
+        function Counter() {
+          let [count, setCount] = useState(0);
+          let [increment, setIncrement] = useState(0);
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              setCount(count + increment);
+            }, 1000);
+            return () => clearInterval(id);
+          }, [count, increment]);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has missing dependencies: 'count' and 'increment'. " +
+          'Either include them or remove the dependency array. ' +
+          `You can also do a functional update 'setCount(c => ...)' if you ` +
+          `only need 'count' in the 'setCount' call.`,
+      ],
+    },
+    {
+      code: `
+        function Counter() {
+          let [count, setCount] = useState(0);
+          let [increment, setIncrement] = useState(0);
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              setCount(count => count + increment);
+            }, 1000);
+            return () => clearInterval(id);
+          }, []);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+      output: `
+        function Counter() {
+          let [count, setCount] = useState(0);
+          let [increment, setIncrement] = useState(0);
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              setCount(count => count + increment);
+            }, 1000);
+            return () => clearInterval(id);
+          }, [increment]);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'increment'. " +
+          'Either include it or remove the dependency array. ' +
+          `You can also replace multiple useState variables with useReducer ` +
+          `if 'setCount' needs the current value of 'increment'.`,
+      ],
+    },
+    {
+      code: `
+        function Counter() {
+          let [count, setCount] = useState(0);
+          let increment = useCustomHook();
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              setCount(count => count + increment);
+            }, 1000);
+            return () => clearInterval(id);
+          }, []);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+      output: `
+        function Counter() {
+          let [count, setCount] = useState(0);
+          let increment = useCustomHook();
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              setCount(count => count + increment);
+            }, 1000);
+            return () => clearInterval(id);
+          }, [increment]);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+      // This intentionally doesn't show the reducer message
+      // because we don't know if it's safe for it to close over a value.
+      // We only show it for state variables (and possibly props).
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'increment'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function Counter({ step }) {
+          let [count, setCount] = useState(0);
+
+          function increment(x) {
+            return x + step;
+          }
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              setCount(count => increment(count));
+            }, 1000);
+            return () => clearInterval(id);
+          }, []);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+      output: `
+        function Counter({ step }) {
+          let [count, setCount] = useState(0);
+
+          function increment(x) {
+            return x + step;
+          }
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              setCount(count => increment(count));
+            }, 1000);
+            return () => clearInterval(id);
+          }, [increment]);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+      // This intentionally doesn't show the reducer message
+      // because we don't know if it's safe for it to close over a value.
+      // We only show it for state variables (and possibly props).
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'increment'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function Counter({ increment }) {
+          let [count, setCount] = useState(0);
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              setCount(count => count + increment);
+            }, 1000);
+            return () => clearInterval(id);
+          }, []);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+      output: `
+        function Counter({ increment }) {
+          let [count, setCount] = useState(0);
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              setCount(count => count + increment);
+            }, 1000);
+            return () => clearInterval(id);
+          }, [increment]);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'increment'. " +
+          'Either include it or remove the dependency array. ' +
+          `If 'setCount' needs the current value of 'increment', ` +
+          `you can also switch to useReducer instead of useState and read 'increment' in the reducer.`,
+      ],
+    },
+    {
+      code: `
+        function Counter() {
+          const [count, setCount] = useState(0);
+
+          function tick() {
+            setCount(count + 1);
+          }
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              tick();
+            }, 1000);
+            return () => clearInterval(id);
+          }, []);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+      output: `
+        function Counter() {
+          const [count, setCount] = useState(0);
+
+          function tick() {
+            setCount(count + 1);
+          }
+
+          useAsyncEffect(async () => {
+            let id = setInterval(() => {
+              tick();
+            }, 1000);
+            return () => clearInterval(id);
+          }, [tick]);
+
+          return <h1>{count}</h1>;
+        }
+      `,
+      // TODO: ideally this should suggest useState updater form
+      // since this code doesn't actually work. The autofix could
+      // at least avoid suggesting 'tick' since it's obviously
+      // always different, and thus useless.
+      errors: [
+        "React Hook useAsyncEffect has a missing dependency: 'tick'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      // Regression test for a crash
+      code: `
+        function Podcasts() {
+          useAsyncEffect(async () => {
+            alert(podcasts);
+          }, []);
+          let [podcasts, setPodcasts] = useState(null);
+        }
+      `,
+      // Note: this autofix is shady because
+      // the variable is used before declaration.
+      // TODO: Maybe we can catch those fixes and not autofix.
+      output: `
+        function Podcasts() {
+          useAsyncEffect(async () => {
+            alert(podcasts);
+          }, [podcasts]);
+          let [podcasts, setPodcasts] = useState(null);
+        }
+      `,
+      errors: [
+        `React Hook useAsyncEffect has a missing dependency: 'podcasts'. ` +
+          `Either include it or remove the dependency array.`,
+      ],
+    },
+    {
+      code: `
+        function Podcasts({ fetchPodcasts, id }) {
+          let [podcasts, setPodcasts] = useState(null);
+          useAsyncEffect(async () => {
+            fetchPodcasts(id).then(setPodcasts);
+          }, [id]);
+        }
+      `,
+      output: `
+        function Podcasts({ fetchPodcasts, id }) {
+          let [podcasts, setPodcasts] = useState(null);
+          useAsyncEffect(async () => {
+            fetchPodcasts(id).then(setPodcasts);
+          }, [fetchPodcasts, id]);
+        }
+      `,
+      errors: [
+        `React Hook useAsyncEffect has a missing dependency: 'fetchPodcasts'. ` +
+          `Either include it or remove the dependency array. ` +
+          `If 'fetchPodcasts' changes too often, ` +
+          `find the parent component that defines it and wrap that definition in useWorker.`,
+      ],
+    },
+    {
+      code: `
+        function Podcasts({ api: { fetchPodcasts }, id }) {
+          let [podcasts, setPodcasts] = useState(null);
+          useAsyncEffect(async () => {
+            fetchPodcasts(id).then(setPodcasts);
+          }, [id]);
+        }
+      `,
+      output: `
+        function Podcasts({ api: { fetchPodcasts }, id }) {
+          let [podcasts, setPodcasts] = useState(null);
+          useAsyncEffect(async () => {
+            fetchPodcasts(id).then(setPodcasts);
+          }, [fetchPodcasts, id]);
+        }
+      `,
+      errors: [
+        `React Hook useAsyncEffect has a missing dependency: 'fetchPodcasts'. ` +
+          `Either include it or remove the dependency array. ` +
+          `If 'fetchPodcasts' changes too often, ` +
+          `find the parent component that defines it and wrap that definition in useWorker.`,
+      ],
+    },
+    {
+      code: `
+        function Podcasts({ fetchPodcasts, fetchPodcasts2, id }) {
+          let [podcasts, setPodcasts] = useState(null);
+          useAsyncEffect(async () => {
+            setTimeout(() => {
+              console.log(id);
+              fetchPodcasts(id).then(setPodcasts);
+              fetchPodcasts2(id).then(setPodcasts);
+            });
+          }, [id]);
+        }
+      `,
+      output: `
+        function Podcasts({ fetchPodcasts, fetchPodcasts2, id }) {
+          let [podcasts, setPodcasts] = useState(null);
+          useAsyncEffect(async () => {
+            setTimeout(() => {
+              console.log(id);
+              fetchPodcasts(id).then(setPodcasts);
+              fetchPodcasts2(id).then(setPodcasts);
+            });
+          }, [fetchPodcasts, fetchPodcasts2, id]);
+        }
+      `,
+      errors: [
+        `React Hook useAsyncEffect has missing dependencies: 'fetchPodcasts' and 'fetchPodcasts2'. ` +
+          `Either include them or remove the dependency array. ` +
+          `If 'fetchPodcasts' changes too often, ` +
+          `find the parent component that defines it and wrap that definition in useWorker.`,
+      ],
+    },
+    {
+      code: `
+        function Podcasts({ fetchPodcasts, id }) {
+          let [podcasts, setPodcasts] = useState(null);
+          useAsyncEffect(async () => {
+            console.log(fetchPodcasts);
+            fetchPodcasts(id).then(setPodcasts);
+          }, [id]);
+        }
+      `,
+      output: `
+        function Podcasts({ fetchPodcasts, id }) {
+          let [podcasts, setPodcasts] = useState(null);
+          useAsyncEffect(async () => {
+            console.log(fetchPodcasts);
+            fetchPodcasts(id).then(setPodcasts);
+          }, [fetchPodcasts, id]);
+        }
+      `,
+      errors: [
+        `React Hook useAsyncEffect has a missing dependency: 'fetchPodcasts'. ` +
+          `Either include it or remove the dependency array. ` +
+          `If 'fetchPodcasts' changes too often, ` +
+          `find the parent component that defines it and wrap that definition in useWorker.`,
+      ],
+    },
+    {
+      // The mistake here is that it was moved inside the effect
+      // so it can't be referenced in the deps array.
+      code: `
+        function Thing() {
+          useAsyncEffect(async () => {
+            const fetchData = async () => {};
+            fetchData();
+          }, [fetchData]);
+        }
+      `,
+      output: `
+        function Thing() {
+          useAsyncEffect(async () => {
+            const fetchData = async () => {};
+            fetchData();
+          }, []);
+        }
+      `,
+      errors: [
+        `React Hook useAsyncEffect has an unnecessary dependency: 'fetchData'. ` +
+          `Either exclude it or remove the dependency array.`,
+      ],
+    },
+    {
+      code: `
+        function Hello() {
+          const [state, setState] = useState(0);
+          useAsyncEffect(async () => {
+            setState({});
+          });
+        }
+      `,
+      output: `
+        function Hello() {
+          const [state, setState] = useState(0);
+          useAsyncEffect(async () => {
+            setState({});
+          }, []);
+        }
+      `,
+      errors: [
+        `React Hook useAsyncEffect contains a call to 'setState'. ` +
+          `Without a list of dependencies, this can lead to an infinite chain of updates. ` +
+          `To fix this, pass [] as a second argument to the useAsyncEffect Hook.`,
+      ],
+    },
+    {
+      code: `
+        function Hello() {
+          const [data, setData] = useState(0);
+          useAsyncEffect(async () => {
+            fetchData.then(setData);
+          });
+        }
+      `,
+      output: `
+        function Hello() {
+          const [data, setData] = useState(0);
+          useAsyncEffect(async () => {
+            fetchData.then(setData);
+          }, []);
+        }
+      `,
+      errors: [
+        `React Hook useAsyncEffect contains a call to 'setData'. ` +
+          `Without a list of dependencies, this can lead to an infinite chain of updates. ` +
+          `To fix this, pass [] as a second argument to the useAsyncEffect Hook.`,
+      ],
+    },
+    {
+      code: `
+        function Hello({ country }) {
+          const [data, setData] = useState(0);
+          useAsyncEffect(async () => {
+            fetchData(country).then(setData);
+          });
+        }
+      `,
+      output: `
+        function Hello({ country }) {
+          const [data, setData] = useState(0);
+          useAsyncEffect(async () => {
+            fetchData(country).then(setData);
+          }, [country]);
+        }
+      `,
+      errors: [
+        `React Hook useAsyncEffect contains a call to 'setData'. ` +
+          `Without a list of dependencies, this can lead to an infinite chain of updates. ` +
+          `To fix this, pass [country] as a second argument to the useAsyncEffect Hook.`,
+      ],
+    },
+    {
+      code: `
+        function Hello({ prop1, prop2 }) {
+          const [state, setState] = useState(0);
+          useAsyncEffect(async () => {
+            if (prop1) {
+              setState(prop2);
+            }
+          });
+        }
+      `,
+      output: `
+        function Hello({ prop1, prop2 }) {
+          const [state, setState] = useState(0);
+          useAsyncEffect(async () => {
+            if (prop1) {
+              setState(prop2);
+            }
+          }, [prop1, prop2]);
+        }
+      `,
+      errors: [
+        `React Hook useAsyncEffect contains a call to 'setState'. ` +
+          `Without a list of dependencies, this can lead to an infinite chain of updates. ` +
+          `To fix this, pass [prop1, prop2] as a second argument to the useAsyncEffect Hook.`,
+      ],
+    },
+    {
+      code: `
+        function Example() {
+          const foo = useWorker(async () => {
+            foo();
+          }, [foo]);
+        }
+      `,
+      output: `
+        function Example() {
+          const foo = useWorker(async () => {
+            foo();
+          }, []);
+        }
+      `,
+      errors: [
+        "React Hook useWorker has an unnecessary dependency: 'foo'. " +
+          'Either exclude it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function Example({ prop }) {
+          const foo = useWorker(async () => {
+            prop.hello(foo);
+          }, [foo]);
+          const bar = useWorker(async () => {
+            foo();
+          }, [foo]);
+        }
+      `,
+      output: `
+        function Example({ prop }) {
+          const foo = useWorker(async () => {
+            prop.hello(foo);
+          }, [prop]);
+          const bar = useWorker(async () => {
+            foo();
+          }, [foo]);
+        }
+      `,
+      errors: [
+        "React Hook useWorker has a missing dependency: 'prop'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function Example() {
+          const foo = useWorkerLoad(async () => {
+            foo();
+          }, [foo]);
+        }
+      `,
+      output: `
+        function Example() {
+          const foo = useWorkerLoad(async () => {
+            foo();
+          }, []);
+        }
+      `,
+      errors: [
+        "React Hook useWorkerLoad has an unnecessary dependency: 'foo'. " +
+          'Either exclude it or remove the dependency array.',
+      ],
+    },
+    {
+      code: `
+        function Example({ prop }) {
+          const foo = useWorkerLoad(async () => {
+            prop.hello(foo);
+          }, [foo]);
+          const bar = useWorkerLoad(async () => {
+            foo();
+          }, [foo]);
+        }
+      `,
+      output: `
+        function Example({ prop }) {
+          const foo = useWorkerLoad(async () => {
+            prop.hello(foo);
+          }, [prop]);
+          const bar = useWorkerLoad(async () => {
+            foo();
+          }, [foo]);
+        }
+      `,
+      errors: [
+        "React Hook useWorkerLoad has a missing dependency: 'prop'. " +
+          'Either include it or remove the dependency array.',
+      ],
+    },
+  ],
+};
+
+// For easier local testing
+if (!process.env.CI) {
+  let only = [];
+  let skipped = [];
+  [...tests.valid, ...tests.invalid].forEach(t => {
+    if (t.skip) {
+      delete t.skip;
+      skipped.push(t);
+    }
+    if (t.only) {
+      delete t.only;
+      only.push(t);
+    }
+    // if (!t.options) {
+    //   t.options = [{ additionalHooks: 'useAsyncLayoutEffect' }];
+    // }
+  });
+  const predicate = t => {
+    if (only.length > 0) {
+      return only.indexOf(t) !== -1;
+    }
+    if (skipped.length > 0) {
+      return skipped.indexOf(t) === -1;
+    }
+    return true;
+  };
+  tests.valid = tests.valid.filter(predicate);
+  tests.invalid = tests.invalid.filter(predicate);
+}
+
+const eslintTester = new ESLintTester();
+eslintTester.run(
+  '@react-hook-utilities/eslint-plugin',
+  ReactHooksESLintRule,
+  tests,
+);
diff --git a/eslint-plugin/src/index.js b/eslint-plugin/src/index.js
new file mode 100644
index 0000000..3bbc31c
--- /dev/null
+++ b/eslint-plugin/src/index.js
@@ -0,0 +1,11 @@
+/**
+ * @fileoverview ESLint rules for hook react-hook-utilities
+ * @author Flávio Caetano
+ */
+'use strict';
+
+import ExhaustiveDeps from './rules/ExaustiveDeps';
+
+export const rules = {
+  'exhaustive-deps': ExhaustiveDeps,
+};
diff --git a/eslint-plugin/src/rules/ExaustiveDeps.js b/eslint-plugin/src/rules/ExaustiveDeps.js
new file mode 100644
index 0000000..01fcde9
--- /dev/null
+++ b/eslint-plugin/src/rules/ExaustiveDeps.js
@@ -0,0 +1,1257 @@
+/**
+ * Copyright (c) Facebook, Inc. and its affiliates.
+ *
+ * This source code is licensed under the MIT license found in the
+ * LICENSE file in the root directory of this source tree.
+ *
+ * Original source: https://github.com/facebook/react/blob/9e64bf18e11828d6b4c0363bff5ed2eca1ccd838/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.js
+ */
+
+/* eslint-disable no-for-of-loops/no-for-of-loops */
+
+'use strict';
+
+export default {
+  meta: {
+    fixable: 'code',
+    schema: [
+      {
+        type: 'object',
+        additionalProperties: false,
+      },
+    ],
+  },
+  create(context) {
+    // Should be shared between visitors.
+    let setStateCallSites = new WeakMap();
+    let stateVariables = new WeakSet();
+    let staticKnownValueCache = new WeakMap();
+    let functionWithoutCapturedValueCache = new WeakMap();
+    function memoizeWithWeakMap(fn, map) {
+      return function(arg) {
+        if (map.has(arg)) {
+          // to verify cache hits:
+          // console.log(arg.name)
+          return map.get(arg);
+        }
+        const result = fn(arg);
+        map.set(arg, result);
+        return result;
+      };
+    }
+
+    return {
+      FunctionExpression: visitFunctionExpression,
+      ArrowFunctionExpression: visitFunctionExpression,
+    };
+
+    /**
+     * Visitor for both function expressions and arrow function expressions.
+     */
+    function visitFunctionExpression(node) {
+      // We only want to lint nodes which are reactive hook callbacks.
+      if (
+        (node.type !== 'FunctionExpression' &&
+          node.type !== 'ArrowFunctionExpression') ||
+        node.parent.type !== 'CallExpression'
+      ) {
+        return;
+      }
+
+      const callbackIndex = getReactiveHookCallbackIndex(node.parent.callee);
+      if (node.parent.arguments[callbackIndex] !== node) {
+        return;
+      }
+
+      // Get the reactive hook node.
+      const reactiveHook = node.parent.callee;
+      const reactiveHookName = getNodeWithoutReactNamespace(reactiveHook).name;
+      const isEffect = reactiveHookName.endsWith('Effect');
+
+      // Get the declared dependencies for this reactive hook. If there is no
+      // second argument then the reactive callback will re-run on every render.
+      // So no need to check for dependency inclusion.
+      const depsIndex = callbackIndex + 1;
+      const declaredDependenciesNode = node.parent.arguments[depsIndex];
+
+      // Get the current scope.
+      const scope = context.getScope();
+
+      // Find all our "pure scopes". On every re-render of a component these
+      // pure scopes may have changes to the variables declared within. So all
+      // variables used in our reactive hook callback but declared in a pure
+      // scope need to be listed as dependencies of our reactive hook callback.
+      //
+      // According to the rules of React you can't read a mutable value in pure
+      // scope. We can't enforce this in a lint so we trust that all variables
+      // declared outside of pure scope are indeed frozen.
+      const pureScopes = new Set();
+      let componentScope = null;
+      {
+        let currentScope = scope.upper;
+        while (currentScope) {
+          pureScopes.add(currentScope);
+          if (currentScope.type === 'function') {
+            break;
+          }
+          currentScope = currentScope.upper;
+        }
+        // If there is no parent function scope then there are no pure scopes.
+        // The ones we've collected so far are incorrect. So don't continue with
+        // the lint.
+        if (!currentScope) {
+          return;
+        }
+        componentScope = currentScope;
+      }
+
+      // Next we'll define a few helpers that helps us
+      // tell if some values don't have to be declared as deps.
+
+      // Some are known to be static based on Hook calls.
+      // const [state, setState] = useState() / React.useState()
+      //               ^^^ true for this reference
+      // const [state, dispatch] = useReducer() / React.useReducer()
+      //               ^^^ true for this reference
+      // const ref = useRef()
+      //       ^^^ true for this reference
+      // False for everything else.
+      function isStaticKnownHookValue(resolved) {
+        if (!Array.isArray(resolved.defs)) {
+          return false;
+        }
+        const def = resolved.defs[0];
+        if (def == null) {
+          return false;
+        }
+        // Look for `let stuff = ...`
+        if (def.node.type !== 'VariableDeclarator') {
+          return false;
+        }
+        const init = def.node.init;
+        if (init == null) {
+          return false;
+        }
+        // Detect primitive constants
+        // const foo = 42
+        let declaration = def.node.parent;
+        if (declaration == null) {
+          // This might happen if variable is declared after the callback.
+          // In that case ESLint won't set up .parent refs.
+          // So we'll set them up manually.
+          fastFindReferenceWithParent(componentScope.block, def.node.id);
+          declaration = def.node.parent;
+          if (declaration == null) {
+            return false;
+          }
+        }
+        if (
+          declaration.kind === 'const' &&
+          init.type === 'Literal' &&
+          (typeof init.value === 'string' ||
+            typeof init.value === 'number' ||
+            init.value === null)
+        ) {
+          // Definitely static
+          return true;
+        }
+        // Detect known Hook calls
+        // const [_, setState] = useState()
+        if (init.type !== 'CallExpression') {
+          return false;
+        }
+        let callee = init.callee;
+        // Step into `= React.something` initializer.
+        if (
+          callee.type === 'MemberExpression' &&
+          callee.object.name === 'React' &&
+          callee.property != null &&
+          !callee.computed
+        ) {
+          callee = callee.property;
+        }
+        if (callee.type !== 'Identifier') {
+          return false;
+        }
+        const id = def.node.id;
+        const { name } = callee;
+
+        if (
+          (name === 'useRef' || name === 'useLazyRef') &&
+          id.type === 'Identifier'
+        ) {
+          // useRef() return value is static.
+          return true;
+        } else if (name === 'useState' || name === 'useReducer') {
+          // Only consider second value in initializing tuple static.
+          if (
+            id.type === 'ArrayPattern' &&
+            id.elements.length === 2 &&
+            Array.isArray(resolved.identifiers)
+          ) {
+            // Is second tuple value the same reference we're checking?
+            if (id.elements[1] === resolved.identifiers[0]) {
+              if (name === 'useState') {
+                const references = resolved.references;
+                for (let i = 0; i < references.length; i++) {
+                  setStateCallSites.set(
+                    references[i].identifier,
+                    id.elements[0],
+                  );
+                }
+              }
+              // Setter is static.
+              return true;
+            } else if (id.elements[0] === resolved.identifiers[0]) {
+              if (name === 'useState') {
+                const references = resolved.references;
+                for (let i = 0; i < references.length; i++) {
+                  stateVariables.add(references[i].identifier);
+                }
+              }
+              // State variable itself is dynamic.
+              return false;
+            }
+          }
+        }
+        // By default assume it's dynamic.
+        return false;
+      }
+
+      // Some are just functions that don't reference anything dynamic.
+      function isFunctionWithoutCapturedValues(resolved) {
+        if (!Array.isArray(resolved.defs)) {
+          return false;
+        }
+        const def = resolved.defs[0];
+        if (def == null) {
+          return false;
+        }
+        if (def.node == null || def.node.id == null) {
+          return false;
+        }
+        // Search the direct component subscopes for
+        // top-level function definitions matching this reference.
+        const fnNode = def.node;
+        let childScopes = componentScope.childScopes;
+        let fnScope = null;
+        let i;
+        for (i = 0; i < childScopes.length; i++) {
+          let childScope = childScopes[i];
+          let childScopeBlock = childScope.block;
+          if (
+            // function handleChange() {}
+            (fnNode.type === 'FunctionDeclaration' &&
+              childScopeBlock === fnNode) ||
+            // const handleChange = () => {}
+            // const handleChange = function() {}
+            (fnNode.type === 'VariableDeclarator' &&
+              childScopeBlock.parent === fnNode)
+          ) {
+            // Found it!
+            fnScope = childScope;
+            break;
+          }
+        }
+        if (fnScope == null) {
+          return false;
+        }
+        // Does this function capture any values
+        // that are in pure scopes (aka render)?
+        for (i = 0; i < fnScope.through.length; i++) {
+          const ref = fnScope.through[i];
+          if (ref.resolved == null) {
+            continue;
+          }
+          if (
+            pureScopes.has(ref.resolved.scope) &&
+            // Static values are fine though,
+            // although we won't check functions deeper.
+            !memoizedIsStaticKnownHookValue(ref.resolved)
+          ) {
+            return false;
+          }
+        }
+        // If we got here, this function doesn't capture anything
+        // from render--or everything it captures is known static.
+        return true;
+      }
+
+      // Remember such values. Avoid re-running extra checks on them.
+      const memoizedIsStaticKnownHookValue = memoizeWithWeakMap(
+        isStaticKnownHookValue,
+        staticKnownValueCache,
+      );
+      const memoizedIsFunctionWithoutCapturedValues = memoizeWithWeakMap(
+        isFunctionWithoutCapturedValues,
+        functionWithoutCapturedValueCache,
+      );
+
+      // These are usually mistaken. Collect them.
+      const currentRefsInEffectCleanup = new Map();
+
+      // Is this reference inside a cleanup function for this effect node?
+      // We can check by traversing scopes upwards  from the reference, and checking
+      // if the last "return () => " we encounter is located directly inside the effect.
+      function isInsideEffectCleanup(reference) {
+        let curScope = reference.from;
+        let isInReturnedFunction = false;
+        while (curScope.block !== node) {
+          if (curScope.type === 'function') {
+            isInReturnedFunction =
+              curScope.block.parent != null &&
+              curScope.block.parent.type === 'ReturnStatement';
+          }
+          curScope = curScope.upper;
+        }
+        return isInReturnedFunction;
+      }
+
+      // Get dependencies from all our resolved references in pure scopes.
+      // Key is dependency string, value is whether it's static.
+      const dependencies = new Map();
+      gatherDependenciesRecursively(scope);
+
+      function gatherDependenciesRecursively(currentScope) {
+        for (const reference of currentScope.references) {
+          // If this reference is not resolved or it is not declared in a pure
+          // scope then we don't care about this reference.
+          if (!reference.resolved) {
+            continue;
+          }
+          if (!pureScopes.has(reference.resolved.scope)) {
+            continue;
+          }
+
+          // Narrow the scope of a dependency if it is, say, a member expression.
+          // Then normalize the narrowed dependency.
+          const referenceNode = fastFindReferenceWithParent(
+            node,
+            reference.identifier,
+          );
+          const dependencyNode = getDependency(referenceNode);
+          const dependency = toPropertyAccessString(dependencyNode);
+
+          // Accessing ref.current inside effect cleanup is bad.
+          if (
+            // We're in an effect...
+            isEffect &&
+            // ... and this look like accessing .current...
+            dependencyNode.type === 'Identifier' &&
+            dependencyNode.parent.type === 'MemberExpression' &&
+            !dependencyNode.parent.computed &&
+            dependencyNode.parent.property.type === 'Identifier' &&
+            dependencyNode.parent.property.name === 'current' &&
+            // ...in a cleanup function or below...
+            isInsideEffectCleanup(reference)
+          ) {
+            currentRefsInEffectCleanup.set(dependency, {
+              reference,
+              dependencyNode,
+            });
+          }
+
+          const def = reference.resolved.defs[0];
+
+          if (def == null) {
+            continue;
+          }
+
+          // Ignore references to the function itself as it's not defined yet.
+          if (def.node != null && def.node.init === node.parent) {
+            continue;
+          }
+
+          // Ignore Flow type parameters
+          if (def.type === 'TypeParameter') {
+            continue;
+          }
+
+          // Add the dependency to a map so we can make sure it is referenced
+          // again in our dependencies array. Remember whether it's static.
+          if (!dependencies.has(dependency)) {
+            const resolved = reference.resolved;
+            const isStatic =
+              memoizedIsStaticKnownHookValue(resolved) ||
+              memoizedIsFunctionWithoutCapturedValues(resolved);
+            dependencies.set(dependency, {
+              isStatic,
+              references: [reference],
+            });
+          } else {
+            dependencies.get(dependency).references.push(reference);
+          }
+        }
+        for (const childScope of currentScope.childScopes) {
+          gatherDependenciesRecursively(childScope);
+        }
+      }
+
+      // Warn about accessing .current in cleanup effects.
+      currentRefsInEffectCleanup.forEach(
+        ({ reference, dependencyNode }, dependency) => {
+          const references = reference.resolved.references;
+          // Is React managing this ref or us?
+          // Let's see if we can find a .current assignment.
+          let foundCurrentAssignment = false;
+          for (let i = 0; i < references.length; i++) {
+            const { identifier } = references[i];
+            const { parent } = identifier;
+            if (
+              parent != null &&
+              // ref.current
+              parent.type === 'MemberExpression' &&
+              !parent.computed &&
+              parent.property.type === 'Identifier' &&
+              parent.property.name === 'current' &&
+              // ref.current = <something>
+              parent.parent.type === 'AssignmentExpression' &&
+              parent.parent.left === parent
+            ) {
+              foundCurrentAssignment = true;
+              break;
+            }
+          }
+          // We only want to warn about React-managed refs.
+          if (foundCurrentAssignment) {
+            return;
+          }
+          context.report({
+            node: dependencyNode.parent.property,
+            message:
+              `The ref value '${dependency}.current' will likely have ` +
+              `changed by the time this effect cleanup function runs. If ` +
+              `this ref points to a node rendered by React, copy ` +
+              `'${dependency}.current' to a variable inside the effect, and ` +
+              `use that variable in the cleanup function.`,
+          });
+        },
+      );
+
+      // Warn about assigning to variables in the outer scope.
+      // Those are usually bugs.
+      let staleAssignments = new Set();
+      function reportStaleAssignment(writeExpr, key) {
+        if (staleAssignments.has(key)) {
+          return;
+        }
+        staleAssignments.add(key);
+        context.report({
+          node: writeExpr,
+          message:
+            `Assignments to the '${key}' variable from inside React Hook ` +
+            `${context.getSource(reactiveHook)} will be lost after each ` +
+            `render. To preserve the value over time, store it in a useRef or useLazyRef ` +
+            `Hook and keep the mutable value in the '.current' property. ` +
+            `Otherwise, you can move this variable directly inside ` +
+            `${context.getSource(reactiveHook)}.`,
+        });
+      }
+
+      // Remember which deps are optional and report bad usage first.
+      const optionalDependencies = new Set();
+      dependencies.forEach(({ isStatic, references }, key) => {
+        if (isStatic) {
+          optionalDependencies.add(key);
+        }
+        references.forEach(reference => {
+          if (reference.writeExpr) {
+            reportStaleAssignment(reference.writeExpr, key);
+          }
+        });
+      });
+
+      if (staleAssignments.size > 0) {
+        // The intent isn't clear so we'll wait until you fix those first.
+        return;
+      }
+
+      if (!declaredDependenciesNode) {
+        // Check if there are any top-level setState() calls.
+        // Those tend to lead to infinite loops.
+        let setStateInsideEffectWithoutDeps = null;
+        dependencies.forEach(({ isStatic, references }, key) => {
+          if (setStateInsideEffectWithoutDeps) {
+            return;
+          }
+          references.forEach(reference => {
+            if (setStateInsideEffectWithoutDeps) {
+              return;
+            }
+
+            const id = reference.identifier;
+            const isSetState = setStateCallSites.has(id);
+            if (!isSetState) {
+              return;
+            }
+
+            let fnScope = reference.from;
+            while (fnScope.type !== 'function') {
+              fnScope = fnScope.upper;
+            }
+            const isDirectlyInsideEffect = fnScope.block === node;
+            if (isDirectlyInsideEffect) {
+              // TODO: we could potentially ignore early returns.
+              setStateInsideEffectWithoutDeps = key;
+            }
+          });
+        });
+        if (setStateInsideEffectWithoutDeps) {
+          let { suggestedDependencies } = collectRecommendations({
+            dependencies,
+            declaredDependencies: [],
+            optionalDependencies,
+            externalDependencies: new Set(),
+            isEffect: true,
+          });
+          context.report({
+            node: node.parent.callee,
+            message:
+              `React Hook ${reactiveHookName} contains a call to '${setStateInsideEffectWithoutDeps}'. ` +
+              `Without a list of dependencies, this can lead to an infinite chain of updates. ` +
+              `To fix this, pass [` +
+              suggestedDependencies.join(', ') +
+              `] as a second argument to the ${reactiveHookName} Hook.`,
+            fix(fixer) {
+              return fixer.insertTextAfter(
+                node,
+                `, [${suggestedDependencies.join(', ')}]`,
+              );
+            },
+          });
+        }
+        return;
+      }
+
+      const declaredDependencies = [];
+      const externalDependencies = new Set();
+      if (declaredDependenciesNode.type !== 'ArrayExpression') {
+        // If the declared dependencies are not an array expression then we
+        // can't verify that the user provided the correct dependencies. Tell
+        // the user this in an error.
+        context.report({
+          node: declaredDependenciesNode,
+          message:
+            `React Hook ${context.getSource(reactiveHook)} was passed a ` +
+            'dependency list that is not an array literal. This means we ' +
+            "can't statically verify whether you've passed the correct " +
+            'dependencies.',
+        });
+      } else {
+        declaredDependenciesNode.elements.forEach(declaredDependencyNode => {
+          // Skip elided elements.
+          if (declaredDependencyNode === null) {
+            return;
+          }
+          // If we see a spread element then add a special warning.
+          if (declaredDependencyNode.type === 'SpreadElement') {
+            context.report({
+              node: declaredDependencyNode,
+              message:
+                `React Hook ${context.getSource(reactiveHook)} has a spread ` +
+                "element in its dependency array. This means we can't " +
+                "statically verify whether you've passed the " +
+                'correct dependencies.',
+            });
+            return;
+          }
+          // Try to normalize the declared dependency. If we can't then an error
+          // will be thrown. We will catch that error and report an error.
+          let declaredDependency;
+          try {
+            declaredDependency = toPropertyAccessString(declaredDependencyNode);
+          } catch (error) {
+            if (/Unsupported node type/.test(error.message)) {
+              if (declaredDependencyNode.type === 'Literal') {
+                if (dependencies.has(declaredDependencyNode.value)) {
+                  context.report({
+                    node: declaredDependencyNode,
+                    message:
+                      `The ${declaredDependencyNode.raw} literal is not a valid dependency ` +
+                      `because it never changes. ` +
+                      `Did you mean to include ${declaredDependencyNode.value} in the array instead?`,
+                  });
+                } else {
+                  context.report({
+                    node: declaredDependencyNode,
+                    message:
+                      `The ${declaredDependencyNode.raw} literal is not a valid dependency ` +
+                      'because it never changes. You can safely remove it.',
+                  });
+                }
+              } else {
+                context.report({
+                  node: declaredDependencyNode,
+                  message:
+                    `React Hook ${context.getSource(reactiveHook)} has a ` +
+                    `complex expression in the dependency array. ` +
+                    'Extract it to a separate variable so it can be statically checked.',
+                });
+              }
+
+              return;
+            } else {
+              throw error;
+            }
+          }
+
+          let maybeID = declaredDependencyNode;
+          while (maybeID.type === 'MemberExpression') {
+            maybeID = maybeID.object;
+          }
+          const isDeclaredInComponent = !componentScope.through.some(
+            ref => ref.identifier === maybeID,
+          );
+
+          // Add the dependency to our declared dependency map.
+          declaredDependencies.push({
+            key: declaredDependency,
+            node: declaredDependencyNode,
+          });
+
+          if (!isDeclaredInComponent) {
+            externalDependencies.add(declaredDependency);
+          }
+        });
+      }
+
+      let {
+        suggestedDependencies,
+        unnecessaryDependencies,
+        missingDependencies,
+        duplicateDependencies,
+      } = collectRecommendations({
+        dependencies,
+        declaredDependencies,
+        optionalDependencies,
+        externalDependencies,
+        isEffect,
+      });
+
+      const problemCount =
+        duplicateDependencies.size +
+        missingDependencies.size +
+        unnecessaryDependencies.size;
+
+      // If we're going to report a missing dependency,
+      // we might as well recalculate the list ignoring
+      // the currently specified deps. This can result
+      // in some extra deduplication. We can't do this
+      // for effects though because those have legit
+      // use cases for over-specifying deps.
+      if (!isEffect && missingDependencies.size > 0) {
+        suggestedDependencies = collectRecommendations({
+          dependencies,
+          declaredDependencies: [], // Pretend we don't know
+          optionalDependencies,
+          externalDependencies,
+          isEffect,
+        }).suggestedDependencies;
+      }
+
+      // Alphabetize the suggestions, but only if deps were already alphabetized.
+      function areDeclaredDepsAlphabetized() {
+        if (declaredDependencies.length === 0) {
+          return true;
+        }
+        const declaredDepKeys = declaredDependencies.map(dep => dep.key);
+        const sortedDeclaredDepKeys = declaredDepKeys.slice().sort();
+        return declaredDepKeys.join(',') === sortedDeclaredDepKeys.join(',');
+      }
+      if (areDeclaredDepsAlphabetized()) {
+        suggestedDependencies.sort();
+      }
+
+      function getWarningMessage(deps, singlePrefix, label, fixVerb) {
+        if (deps.size === 0) {
+          return null;
+        }
+        return (
+          (deps.size > 1 ? '' : singlePrefix + ' ') +
+          label +
+          ' ' +
+          (deps.size > 1 ? 'dependencies' : 'dependency') +
+          ': ' +
+          joinEnglish(
+            Array.from(deps)
+              .sort()
+              .map(name => "'" + name + "'"),
+          ) +
+          `. Either ${fixVerb} ${
+            deps.size > 1 ? 'them' : 'it'
+          } or remove the dependency array.`
+        );
+      }
+
+      let extraWarning = '';
+      if (unnecessaryDependencies.size > 0) {
+        let badRef = null;
+        Array.from(unnecessaryDependencies.keys()).forEach(key => {
+          if (badRef !== null) {
+            return;
+          }
+          if (key.endsWith('.current')) {
+            badRef = key;
+          }
+        });
+        if (badRef !== null) {
+          extraWarning =
+            ` Mutable values like '${badRef}' aren't valid dependencies ` +
+            "because mutating them doesn't re-render the component.";
+        } else if (externalDependencies.size > 0) {
+          const dep = Array.from(externalDependencies)[0];
+          // Don't show this warning for things that likely just got moved *inside* the callback
+          // because in that case they're clearly not referring to globals.
+          if (!scope.set.has(dep)) {
+            extraWarning =
+              ` Outer scope values like '${dep}' aren't valid dependencies ` +
+              `because mutating them doesn't re-render the component.`;
+          }
+        }
+      }
+
+      // `props.foo()` marks `props` as a dependency because it has
+      // a `this` value. This warning can be confusing.
+      // So if we're going to show it, append a clarification.
+      if (!extraWarning && missingDependencies.has('props')) {
+        let propDep = dependencies.get('props');
+        if (propDep == null) {
+          return;
+        }
+        const refs = propDep.references;
+        if (!Array.isArray(refs)) {
+          return;
+        }
+        let isPropsOnlyUsedInMembers = true;
+        for (let i = 0; i < refs.length; i++) {
+          const ref = refs[i];
+          const id = fastFindReferenceWithParent(
+            componentScope.block,
+            ref.identifier,
+          );
+          if (!id) {
+            isPropsOnlyUsedInMembers = false;
+            break;
+          }
+          const parent = id.parent;
+          if (parent == null) {
+            isPropsOnlyUsedInMembers = false;
+            break;
+          }
+          if (parent.type !== 'MemberExpression') {
+            isPropsOnlyUsedInMembers = false;
+            break;
+          }
+        }
+        if (isPropsOnlyUsedInMembers) {
+          extraWarning =
+            ` However, 'props' will change when *any* prop changes, so the ` +
+            `preferred fix is to destructure the 'props' object outside of ` +
+            `the ${reactiveHookName} call and refer to those specific props ` +
+            `inside ${context.getSource(reactiveHook)}.`;
+        }
+      }
+
+      if (!extraWarning && missingDependencies.size > 0) {
+        // See if the user is trying to avoid specifying a callable prop.
+        // This usually means they're unaware of useWorker.
+        let missingCallbackDep = null;
+        missingDependencies.forEach(missingDep => {
+          if (missingCallbackDep) {
+            return;
+          }
+          // Is this a variable from top scope?
+          const topScopeRef = componentScope.set.get(missingDep);
+          const usedDep = dependencies.get(missingDep);
+          if (usedDep.references[0].resolved !== topScopeRef) {
+            return;
+          }
+          // Is this a destructured prop?
+          const def = topScopeRef.defs[0];
+          if (def == null || def.name == null || def.type !== 'Parameter') {
+            return;
+          }
+          // Was it called in at least one case? Then it's a function.
+          let isFunctionCall = false;
+          let id;
+          for (let i = 0; i < usedDep.references.length; i++) {
+            id = usedDep.references[i].identifier;
+            if (
+              id != null &&
+              id.parent != null &&
+              id.parent.type === 'CallExpression' &&
+              id.parent.callee === id
+            ) {
+              isFunctionCall = true;
+              break;
+            }
+          }
+          if (!isFunctionCall) {
+            return;
+          }
+          // If it's missing (i.e. in component scope) *and* it's a parameter
+          // then it is definitely coming from props destructuring.
+          // (It could also be props itself but we wouldn't be calling it then.)
+          missingCallbackDep = missingDep;
+        });
+        if (missingCallbackDep !== null) {
+          extraWarning =
+            ` If '${missingCallbackDep}' changes too often, ` +
+            `find the parent component that defines it ` +
+            `and wrap that definition in useWorker.`;
+        }
+      }
+
+      if (!extraWarning && missingDependencies.size > 0) {
+        let setStateRecommendation = null;
+        missingDependencies.forEach(missingDep => {
+          if (setStateRecommendation !== null) {
+            return;
+          }
+          const usedDep = dependencies.get(missingDep);
+          const references = usedDep.references;
+          let id;
+          let maybeCall;
+          for (let i = 0; i < references.length; i++) {
+            id = references[i].identifier;
+            maybeCall = id.parent;
+            // Try to see if we have setState(someExpr(missingDep)).
+            while (maybeCall != null && maybeCall !== componentScope.block) {
+              if (maybeCall.type === 'CallExpression') {
+                const correspondingStateVariable = setStateCallSites.get(
+                  maybeCall.callee,
+                );
+                if (correspondingStateVariable != null) {
+                  if (correspondingStateVariable.name === missingDep) {
+                    // setCount(count + 1)
+                    setStateRecommendation = {
+                      missingDep,
+                      setter: maybeCall.callee.name,
+                      form: 'updater',
+                    };
+                  } else if (stateVariables.has(id)) {
+                    // setCount(count + increment)
+                    setStateRecommendation = {
+                      missingDep,
+                      setter: maybeCall.callee.name,
+                      form: 'reducer',
+                    };
+                  } else {
+                    const resolved = references[i].resolved;
+                    if (resolved != null) {
+                      // If it's a parameter *and* a missing dep,
+                      // it must be a prop or something inside a prop.
+                      // Therefore, recommend an inline reducer.
+                      const def = resolved.defs[0];
+                      if (def != null && def.type === 'Parameter') {
+                        setStateRecommendation = {
+                          missingDep,
+                          setter: maybeCall.callee.name,
+                          form: 'inlineReducer',
+                        };
+                      }
+                    }
+                  }
+                  break;
+                }
+              }
+              maybeCall = maybeCall.parent;
+            }
+            if (setStateRecommendation !== null) {
+              break;
+            }
+          }
+        });
+        if (setStateRecommendation !== null) {
+          switch (setStateRecommendation.form) {
+            case 'reducer':
+              extraWarning =
+                ` You can also replace multiple useState variables with useReducer ` +
+                `if '${setStateRecommendation.setter}' needs the ` +
+                `current value of '${setStateRecommendation.missingDep}'.`;
+              break;
+            case 'inlineReducer':
+              extraWarning =
+                ` If '${setStateRecommendation.setter}' needs the ` +
+                `current value of '${setStateRecommendation.missingDep}', ` +
+                `you can also switch to useReducer instead of useState and ` +
+                `read '${setStateRecommendation.missingDep}' in the reducer.`;
+              break;
+            case 'updater':
+              extraWarning =
+                ` You can also do a functional update '${
+                  setStateRecommendation.setter
+                }(${setStateRecommendation.missingDep.substring(
+                  0,
+                  1,
+                )} => ...)' if you only need '${
+                  setStateRecommendation.missingDep
+                }'` + ` in the '${setStateRecommendation.setter}' call.`;
+              break;
+            default:
+              throw new Error('Unknown case.');
+          }
+        }
+      }
+
+      if (problemCount !== 0) {
+        context.report({
+          node: declaredDependenciesNode,
+          message:
+            `React Hook ${context.getSource(reactiveHook)} has ` +
+            // To avoid a long message, show the next actionable item.
+            (getWarningMessage(
+              missingDependencies,
+              'a',
+              'missing',
+              'include',
+            ) ||
+              getWarningMessage(
+                unnecessaryDependencies,
+                'an',
+                'unnecessary',
+                'exclude',
+              ) ||
+              getWarningMessage(
+                duplicateDependencies,
+                'a',
+                'duplicate',
+                'omit',
+              )) +
+            extraWarning,
+          fix(fixer) {
+            // TODO: consider preserving the comments or formatting?
+            return fixer.replaceText(
+              declaredDependenciesNode,
+              `[${suggestedDependencies.join(', ')}]`,
+            );
+          },
+        });
+      }
+    }
+  },
+};
+
+// The meat of the logic.
+function collectRecommendations({
+  dependencies,
+  declaredDependencies,
+  optionalDependencies,
+  externalDependencies,
+  isEffect,
+}) {
+  // Our primary data structure.
+  // It is a logical representation of property chains:
+  // `props` -> `props.foo` -> `props.foo.bar` -> `props.foo.bar.baz`
+  //         -> `props.lol`
+  //         -> `props.huh` -> `props.huh.okay`
+  //         -> `props.wow`
+  // We'll use it to mark nodes that are *used* by the programmer,
+  // and the nodes that were *declared* as deps. Then we will
+  // traverse it to learn which deps are missing or unnecessary.
+  const depTree = createDepTree();
+  function createDepTree() {
+    return {
+      isRequired: false, // True if used in code
+      isSatisfiedRecursively: false, // True if specified in deps
+      hasRequiredNodesBelow: false, // True if something deeper is used by code
+      children: new Map(), // Nodes for properties
+    };
+  }
+
+  // Mark all required nodes first.
+  // Imagine exclamation marks next to each used deep property.
+  dependencies.forEach((_, key) => {
+    const node = getOrCreateNodeByPath(depTree, key);
+    node.isRequired = true;
+    markAllParentsByPath(depTree, key, parent => {
+      parent.hasRequiredNodesBelow = true;
+    });
+  });
+
+  // Mark all satisfied nodes.
+  // Imagine checkmarks next to each declared dependency.
+  declaredDependencies.forEach(({ key }) => {
+    const node = getOrCreateNodeByPath(depTree, key);
+    node.isSatisfiedRecursively = true;
+  });
+  optionalDependencies.forEach(key => {
+    const node = getOrCreateNodeByPath(depTree, key);
+    node.isSatisfiedRecursively = true;
+  });
+
+  // Tree manipulation helpers.
+  function getOrCreateNodeByPath(rootNode, path) {
+    let keys = path.split('.');
+    let node = rootNode;
+    for (let key of keys) {
+      let child = node.children.get(key);
+      if (!child) {
+        child = createDepTree();
+        node.children.set(key, child);
+      }
+      node = child;
+    }
+    return node;
+  }
+  function markAllParentsByPath(rootNode, path, fn) {
+    let keys = path.split('.');
+    let node = rootNode;
+    for (let key of keys) {
+      let child = node.children.get(key);
+      if (!child) {
+        return;
+      }
+      fn(child);
+      node = child;
+    }
+  }
+
+  // Now we can learn which dependencies are missing or necessary.
+  let missingDependencies = new Set();
+  let satisfyingDependencies = new Set();
+  scanTreeRecursively(
+    depTree,
+    missingDependencies,
+    satisfyingDependencies,
+    key => key,
+  );
+  function scanTreeRecursively(node, missingPaths, satisfyingPaths, keyToPath) {
+    node.children.forEach((child, key) => {
+      const path = keyToPath(key);
+      if (child.isSatisfiedRecursively) {
+        if (child.hasRequiredNodesBelow) {
+          // Remember this dep actually satisfied something.
+          satisfyingPaths.add(path);
+        }
+        // It doesn't matter if there's something deeper.
+        // It would be transitively satisfied since we assume immutability.
+        // `props.foo` is enough if you read `props.foo.id`.
+        return;
+      }
+      if (child.isRequired) {
+        // Remember that no declared deps satisfied this node.
+        missingPaths.add(path);
+        // If we got here, nothing in its subtree was satisfied.
+        // No need to search further.
+        return;
+      }
+      scanTreeRecursively(
+        child,
+        missingPaths,
+        satisfyingPaths,
+        childKey => path + '.' + childKey,
+      );
+    });
+  }
+
+  // Collect suggestions in the order they were originally specified.
+  let suggestedDependencies = [];
+  let unnecessaryDependencies = new Set();
+  let duplicateDependencies = new Set();
+  declaredDependencies.forEach(({ key }) => {
+    // Does this declared dep satisfy a real need?
+    if (satisfyingDependencies.has(key)) {
+      if (suggestedDependencies.indexOf(key) === -1) {
+        // Good one.
+        suggestedDependencies.push(key);
+      } else {
+        // Duplicate.
+        duplicateDependencies.add(key);
+      }
+    } else {
+      if (
+        isEffect &&
+        !key.endsWith('.current') &&
+        !externalDependencies.has(key)
+      ) {
+        // Effects are allowed extra "unnecessary" deps.
+        // Such as resetting scroll when ID changes.
+        // Consider them legit.
+        // The exception is ref.current which is always wrong.
+        if (suggestedDependencies.indexOf(key) === -1) {
+          suggestedDependencies.push(key);
+        }
+      } else {
+        // It's definitely not needed.
+        unnecessaryDependencies.add(key);
+      }
+    }
+  });
+
+  // Then add the missing ones at the end.
+  missingDependencies.forEach(key => {
+    suggestedDependencies.push(key);
+  });
+
+  return {
+    suggestedDependencies,
+    unnecessaryDependencies,
+    duplicateDependencies,
+    missingDependencies,
+  };
+}
+
+/**
+ * Assuming () means the passed/returned node:
+ * (props) => (props)
+ * props.(foo) => (props.foo)
+ * props.foo.(bar) => (props).foo.bar
+ * props.foo.bar.(baz) => (props).foo.bar.baz
+ */
+function getDependency(node) {
+  if (
+    node.parent.type === 'MemberExpression' &&
+    node.parent.object === node &&
+    node.parent.property.name !== 'current' &&
+    !node.parent.computed &&
+    !(
+      node.parent.parent != null &&
+      node.parent.parent.type === 'CallExpression' &&
+      node.parent.parent.callee === node.parent
+    )
+  ) {
+    return getDependency(node.parent);
+  } else {
+    return node;
+  }
+}
+
+/**
+ * Assuming () means the passed node.
+ * (foo) -> 'foo'
+ * foo.(bar) -> 'foo.bar'
+ * foo.bar.(baz) -> 'foo.bar.baz'
+ * Otherwise throw.
+ */
+function toPropertyAccessString(node) {
+  if (node.type === 'Identifier') {
+    return node.name;
+  } else if (node.type === 'MemberExpression' && !node.computed) {
+    const object = toPropertyAccessString(node.object);
+    const property = toPropertyAccessString(node.property);
+    return `${object}.${property}`;
+  } else {
+    throw new Error(`Unsupported node type: ${node.type}`);
+  }
+}
+
+function getNodeWithoutReactNamespace(node) {
+  if (
+    node.type === 'MemberExpression' &&
+    node.object.type === 'Identifier' &&
+    node.object.name === 'React' &&
+    node.property.type === 'Identifier' &&
+    !node.computed
+  ) {
+    return node.property;
+  }
+  return node;
+}
+
+// What's the index of callback that needs to be analyzed for a given Hook?
+// -1 if it's not a Hook we care about (e.g. useState).
+// 0 for useEffect/useMemo/useCallback(fn).
+// 1 for useImperativeHandle(ref, fn).
+// For additionally configured Hooks, assume that they're like useEffect (0).
+function getReactiveHookCallbackIndex(calleeNode) {
+  let node = getNodeWithoutReactNamespace(calleeNode);
+  if (node.type !== 'Identifier') {
+    return null;
+  }
+  switch (node.name) {
+    case 'useAsyncEffect':
+    case 'useAsyncLayoutEffect':
+    case 'useWorker':
+    case 'useWorkerLoad':
+    case 'useEffectUpdate':
+      return 0;
+    case 'useConditionalEffect':
+      return 1;
+    default:
+      return -1;
+  }
+}
+
+/**
+ * ESLint won't assign node.parent to references from context.getScope()
+ *
+ * So instead we search for the node from an ancestor assigning node.parent
+ * as we go. This mutates the AST.
+ *
+ * This traversal is:
+ * - optimized by only searching nodes with a range surrounding our target node
+ * - agnostic to AST node types, it looks for `{ type: string, ... }`
+ */
+function fastFindReferenceWithParent(start, target) {
+  let queue = [start];
+  let item = null;
+
+  while (queue.length) {
+    item = queue.shift();
+
+    if (isSameIdentifier(item, target)) {
+      return item;
+    }
+
+    if (!isAncestorNodeOf(item, target)) {
+      continue;
+    }
+
+    for (let [key, value] of Object.entries(item)) {
+      if (key === 'parent') {
+        continue;
+      }
+      if (isNodeLike(value)) {
+        value.parent = item;
+        queue.push(value);
+      } else if (Array.isArray(value)) {
+        value.forEach(val => {
+          if (isNodeLike(val)) {
+            val.parent = item;
+            queue.push(val);
+          }
+        });
+      }
+    }
+  }
+
+  return null;
+}
+
+function joinEnglish(arr) {
+  let s = '';
+  for (let i = 0; i < arr.length; i++) {
+    s += arr[i];
+    if (i === 0 && arr.length === 2) {
+      s += ' and ';
+    } else if (i === arr.length - 2 && arr.length > 2) {
+      s += ', and ';
+    } else if (i < arr.length - 1) {
+      s += ', ';
+    }
+  }
+  return s;
+}
+
+function isNodeLike(val) {
+  return (
+    typeof val === 'object' &&
+    val !== null &&
+    !Array.isArray(val) &&
+    typeof val.type === 'string'
+  );
+}
+
+function isSameIdentifier(a, b) {
+  return (
+    a.type === 'Identifier' &&
+    a.name === b.name &&
+    a.range[0] === b.range[0] &&
+    a.range[1] === b.range[1]
+  );
+}
+
+function isAncestorNodeOf(a, b) {
+  return a.range[0] <= b.range[0] && a.range[1] >= b.range[1];
+}
diff --git a/eslint-plugin/yarn.lock b/eslint-plugin/yarn.lock
new file mode 100644
index 0000000..e0fcf90
--- /dev/null
+++ b/eslint-plugin/yarn.lock
@@ -0,0 +1,2953 @@
+# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY.
+# yarn lockfile v1
+
+
+"@babel/cli@^7.6.2":
+  version "7.6.2"
+  resolved "https://registry.yarnpkg.com/@babel/cli/-/cli-7.6.2.tgz#4ce8b5b4b2e4b4c1b7bd841cec62085e2dfc4465"
+  integrity sha512-JDZ+T/br9pPfT2lmAMJypJDTTTHM9ePD/ED10TRjRzJVdEVy+JB3iRlhzYmTt5YkNgHvxWGlUVnLtdv6ruiDrQ==
+  dependencies:
+    commander "^2.8.1"
+    convert-source-map "^1.1.0"
+    fs-readdir-recursive "^1.1.0"
+    glob "^7.0.0"
+    lodash "^4.17.13"
+    mkdirp "^0.5.1"
+    output-file-sync "^2.0.0"
+    slash "^2.0.0"
+    source-map "^0.5.0"
+  optionalDependencies:
+    chokidar "^2.1.8"
+
+"@babel/code-frame@^7.0.0", "@babel/code-frame@^7.5.5":
+  version "7.5.5"
+  resolved "https://registry.yarnpkg.com/@babel/code-frame/-/code-frame-7.5.5.tgz#bc0782f6d69f7b7d49531219699b988f669a8f9d"
+  integrity sha512-27d4lZoomVyo51VegxI20xZPuSHusqbQag/ztrBC7wegWoQ1nLREPVSKSW8byhTlzTKyNE4ifaTA6lCp7JjpFw==
+  dependencies:
+    "@babel/highlight" "^7.0.0"
+
+"@babel/generator@^7.6.2":
+  version "7.6.2"
+  resolved "https://registry.yarnpkg.com/@babel/generator/-/generator-7.6.2.tgz#dac8a3c2df118334c2a29ff3446da1636a8f8c03"
+  integrity sha512-j8iHaIW4gGPnViaIHI7e9t/Hl8qLjERI6DcV9kEpAIDJsAOrcnXqRS7t+QbhL76pwbtqP+QCQLL0z1CyVmtjjQ==
+  dependencies:
+    "@babel/types" "^7.6.0"
+    jsesc "^2.5.1"
+    lodash "^4.17.13"
+    source-map "^0.5.0"
+
+"@babel/helper-annotate-as-pure@^7.0.0":
+  version "7.0.0"
+  resolved "https://registry.yarnpkg.com/@babel/helper-annotate-as-pure/-/helper-annotate-as-pure-7.0.0.tgz#323d39dd0b50e10c7c06ca7d7638e6864d8c5c32"
+  integrity sha512-3UYcJUj9kvSLbLbUIfQTqzcy5VX7GRZ/CCDrnOaZorFFM01aXp1+GJwuFGV4NDDoAS+mOUyHcO6UD/RfqOks3Q==
+  dependencies:
+    "@babel/types" "^7.0.0"
+
+"@babel/helper-builder-binary-assignment-operator-visitor@^7.1.0":
+  version "7.1.0"
+  resolved "https://registry.yarnpkg.com/@babel/helper-builder-binary-assignment-operator-visitor/-/helper-builder-binary-assignment-operator-visitor-7.1.0.tgz#6b69628dfe4087798e0c4ed98e3d4a6b2fbd2f5f"
+  integrity sha512-qNSR4jrmJ8M1VMM9tibvyRAHXQs2PmaksQF7c1CGJNipfe3D8p+wgNwgso/P2A2r2mdgBWAXljNWR0QRZAMW8w==
+  dependencies:
+    "@babel/helper-explode-assignable-expression" "^7.1.0"
+    "@babel/types" "^7.0.0"
+
+"@babel/helper-call-delegate@^7.4.4":
+  version "7.4.4"
+  resolved "https://registry.yarnpkg.com/@babel/helper-call-delegate/-/helper-call-delegate-7.4.4.tgz#87c1f8ca19ad552a736a7a27b1c1fcf8b1ff1f43"
+  integrity sha512-l79boDFJ8S1c5hvQvG+rc+wHw6IuH7YldmRKsYtpbawsxURu/paVy57FZMomGK22/JckepaikOkY0MoAmdyOlQ==
+  dependencies:
+    "@babel/helper-hoist-variables" "^7.4.4"
+    "@babel/traverse" "^7.4.4"
+    "@babel/types" "^7.4.4"
+
+"@babel/helper-define-map@^7.5.5":
+  version "7.5.5"
+  resolved "https://registry.yarnpkg.com/@babel/helper-define-map/-/helper-define-map-7.5.5.tgz#3dec32c2046f37e09b28c93eb0b103fd2a25d369"
+  integrity sha512-fTfxx7i0B5NJqvUOBBGREnrqbTxRh7zinBANpZXAVDlsZxYdclDp467G1sQ8VZYMnAURY3RpBUAgOYT9GfzHBg==
+  dependencies:
+    "@babel/helper-function-name" "^7.1.0"
+    "@babel/types" "^7.5.5"
+    lodash "^4.17.13"
+
+"@babel/helper-explode-assignable-expression@^7.1.0":
+  version "7.1.0"
+  resolved "https://registry.yarnpkg.com/@babel/helper-explode-assignable-expression/-/helper-explode-assignable-expression-7.1.0.tgz#537fa13f6f1674df745b0c00ec8fe4e99681c8f6"
+  integrity sha512-NRQpfHrJ1msCHtKjbzs9YcMmJZOg6mQMmGRB+hbamEdG5PNpaSm95275VD92DvJKuyl0s2sFiDmMZ+EnnvufqA==
+  dependencies:
+    "@babel/traverse" "^7.1.0"
+    "@babel/types" "^7.0.0"
+
+"@babel/helper-function-name@^7.1.0":
+  version "7.1.0"
+  resolved "https://registry.yarnpkg.com/@babel/helper-function-name/-/helper-function-name-7.1.0.tgz#a0ceb01685f73355d4360c1247f582bfafc8ff53"
+  integrity sha512-A95XEoCpb3TO+KZzJ4S/5uW5fNe26DjBGqf1o9ucyLyCmi1dXq/B3c8iaWTfBk3VvetUxl16e8tIrd5teOCfGw==
+  dependencies:
+    "@babel/helper-get-function-arity" "^7.0.0"
+    "@babel/template" "^7.1.0"
+    "@babel/types" "^7.0.0"
+
+"@babel/helper-get-function-arity@^7.0.0":
+  version "7.0.0"
+  resolved "https://registry.yarnpkg.com/@babel/helper-get-function-arity/-/helper-get-function-arity-7.0.0.tgz#83572d4320e2a4657263734113c42868b64e49c3"
+  integrity sha512-r2DbJeg4svYvt3HOS74U4eWKsUAMRH01Z1ds1zx8KNTPtpTL5JAsdFv8BNyOpVqdFhHkkRDIg5B4AsxmkjAlmQ==
+  dependencies:
+    "@babel/types" "^7.0.0"
+
+"@babel/helper-hoist-variables@^7.4.4":
+  version "7.4.4"
+  resolved "https://registry.yarnpkg.com/@babel/helper-hoist-variables/-/helper-hoist-variables-7.4.4.tgz#0298b5f25c8c09c53102d52ac4a98f773eb2850a"
+  integrity sha512-VYk2/H/BnYbZDDg39hr3t2kKyifAm1W6zHRfhx8jGjIHpQEBv9dry7oQ2f3+J703TLu69nYdxsovl0XYfcnK4w==
+  dependencies:
+    "@babel/types" "^7.4.4"
+
+"@babel/helper-member-expression-to-functions@^7.5.5":
+  version "7.5.5"
+  resolved "https://registry.yarnpkg.com/@babel/helper-member-expression-to-functions/-/helper-member-expression-to-functions-7.5.5.tgz#1fb5b8ec4453a93c439ee9fe3aeea4a84b76b590"
+  integrity sha512-5qZ3D1uMclSNqYcXqiHoA0meVdv+xUEex9em2fqMnrk/scphGlGgg66zjMrPJESPwrFJ6sbfFQYUSa0Mz7FabA==
+  dependencies:
+    "@babel/types" "^7.5.5"
+
+"@babel/helper-module-imports@^7.0.0":
+  version "7.0.0"
+  resolved "https://registry.yarnpkg.com/@babel/helper-module-imports/-/helper-module-imports-7.0.0.tgz#96081b7111e486da4d2cd971ad1a4fe216cc2e3d"
+  integrity sha512-aP/hlLq01DWNEiDg4Jn23i+CXxW/owM4WpDLFUbpjxe4NS3BhLVZQ5i7E0ZrxuQ/vwekIeciyamgB1UIYxxM6A==
+  dependencies:
+    "@babel/types" "^7.0.0"
+
+"@babel/helper-module-transforms@^7.1.0", "@babel/helper-module-transforms@^7.4.4":
+  version "7.5.5"
+  resolved "https://registry.yarnpkg.com/@babel/helper-module-transforms/-/helper-module-transforms-7.5.5.tgz#f84ff8a09038dcbca1fd4355661a500937165b4a"
+  integrity sha512-jBeCvETKuJqeiaCdyaheF40aXnnU1+wkSiUs/IQg3tB85up1LyL8x77ClY8qJpuRJUcXQo+ZtdNESmZl4j56Pw==
+  dependencies:
+    "@babel/helper-module-imports" "^7.0.0"
+    "@babel/helper-simple-access" "^7.1.0"
+    "@babel/helper-split-export-declaration" "^7.4.4"
+    "@babel/template" "^7.4.4"
+    "@babel/types" "^7.5.5"
+    lodash "^4.17.13"
+
+"@babel/helper-optimise-call-expression@^7.0.0":
+  version "7.0.0"
+  resolved "https://registry.yarnpkg.com/@babel/helper-optimise-call-expression/-/helper-optimise-call-expression-7.0.0.tgz#a2920c5702b073c15de51106200aa8cad20497d5"
+  integrity sha512-u8nd9NQePYNQV8iPWu/pLLYBqZBa4ZaY1YWRFMuxrid94wKI1QNt67NEZ7GAe5Kc/0LLScbim05xZFWkAdrj9g==
+  dependencies:
+    "@babel/types" "^7.0.0"
+
+"@babel/helper-plugin-utils@^7.0.0":
+  version "7.0.0"
+  resolved "https://registry.yarnpkg.com/@babel/helper-plugin-utils/-/helper-plugin-utils-7.0.0.tgz#bbb3fbee98661c569034237cc03967ba99b4f250"
+  integrity sha512-CYAOUCARwExnEixLdB6sDm2dIJ/YgEAKDM1MOeMeZu9Ld/bDgVo8aiWrXwcY7OBh+1Ea2uUcVRcxKk0GJvW7QA==
+
+"@babel/helper-regex@^7.0.0", "@babel/helper-regex@^7.4.4":
+  version "7.5.5"
+  resolved "https://registry.yarnpkg.com/@babel/helper-regex/-/helper-regex-7.5.5.tgz#0aa6824f7100a2e0e89c1527c23936c152cab351"
+  integrity sha512-CkCYQLkfkiugbRDO8eZn6lRuR8kzZoGXCg3149iTk5se7g6qykSpy3+hELSwquhu+TgHn8nkLiBwHvNX8Hofcw==
+  dependencies:
+    lodash "^4.17.13"
+
+"@babel/helper-remap-async-to-generator@^7.1.0":
+  version "7.1.0"
+  resolved "https://registry.yarnpkg.com/@babel/helper-remap-async-to-generator/-/helper-remap-async-to-generator-7.1.0.tgz#361d80821b6f38da75bd3f0785ece20a88c5fe7f"
+  integrity sha512-3fOK0L+Fdlg8S5al8u/hWE6vhufGSn0bN09xm2LXMy//REAF8kDCrYoOBKYmA8m5Nom+sV9LyLCwrFynA8/slg==
+  dependencies:
+    "@babel/helper-annotate-as-pure" "^7.0.0"
+    "@babel/helper-wrap-function" "^7.1.0"
+    "@babel/template" "^7.1.0"
+    "@babel/traverse" "^7.1.0"
+    "@babel/types" "^7.0.0"
+
+"@babel/helper-replace-supers@^7.5.5":
+  version "7.5.5"
+  resolved "https://registry.yarnpkg.com/@babel/helper-replace-supers/-/helper-replace-supers-7.5.5.tgz#f84ce43df031222d2bad068d2626cb5799c34bc2"
+  integrity sha512-XvRFWrNnlsow2u7jXDuH4jDDctkxbS7gXssrP4q2nUD606ukXHRvydj346wmNg+zAgpFx4MWf4+usfC93bElJg==
+  dependencies:
+    "@babel/helper-member-expression-to-functions" "^7.5.5"
+    "@babel/helper-optimise-call-expression" "^7.0.0"
+    "@babel/traverse" "^7.5.5"
+    "@babel/types" "^7.5.5"
+
+"@babel/helper-simple-access@^7.1.0":
+  version "7.1.0"
+  resolved "https://registry.yarnpkg.com/@babel/helper-simple-access/-/helper-simple-access-7.1.0.tgz#65eeb954c8c245beaa4e859da6188f39d71e585c"
+  integrity sha512-Vk+78hNjRbsiu49zAPALxTb+JUQCz1aolpd8osOF16BGnLtseD21nbHgLPGUwrXEurZgiCOUmvs3ExTu4F5x6w==
+  dependencies:
+    "@babel/template" "^7.1.0"
+    "@babel/types" "^7.0.0"
+
+"@babel/helper-split-export-declaration@^7.4.4":
+  version "7.4.4"
+  resolved "https://registry.yarnpkg.com/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.4.4.tgz#ff94894a340be78f53f06af038b205c49d993677"
+  integrity sha512-Ro/XkzLf3JFITkW6b+hNxzZ1n5OQ80NvIUdmHspih1XAhtN3vPTuUFT4eQnela+2MaZ5ulH+iyP513KJrxbN7Q==
+  dependencies:
+    "@babel/types" "^7.4.4"
+
+"@babel/helper-wrap-function@^7.1.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/helper-wrap-function/-/helper-wrap-function-7.2.0.tgz#c4e0012445769e2815b55296ead43a958549f6fa"
+  integrity sha512-o9fP1BZLLSrYlxYEYyl2aS+Flun5gtjTIG8iln+XuEzQTs0PLagAGSXUcqruJwD5fM48jzIEggCKpIfWTcR7pQ==
+  dependencies:
+    "@babel/helper-function-name" "^7.1.0"
+    "@babel/template" "^7.1.0"
+    "@babel/traverse" "^7.1.0"
+    "@babel/types" "^7.2.0"
+
+"@babel/highlight@^7.0.0":
+  version "7.5.0"
+  resolved "https://registry.yarnpkg.com/@babel/highlight/-/highlight-7.5.0.tgz#56d11312bd9248fa619591d02472be6e8cb32540"
+  integrity sha512-7dV4eu9gBxoM0dAnj/BCFDW9LFU0zvTrkq0ugM7pnHEgguOEeOz1so2ZghEdzviYzQEED0r4EAgpsBChKy1TRQ==
+  dependencies:
+    chalk "^2.0.0"
+    esutils "^2.0.2"
+    js-tokens "^4.0.0"
+
+"@babel/parser@^7.0.0", "@babel/parser@^7.6.0", "@babel/parser@^7.6.2":
+  version "7.6.2"
+  resolved "https://registry.yarnpkg.com/@babel/parser/-/parser-7.6.2.tgz#205e9c95e16ba3b8b96090677a67c9d6075b70a1"
+  integrity sha512-mdFqWrSPCmikBoaBYMuBulzTIKuXVPtEISFbRRVNwMWpCms/hmE2kRq0bblUHaNRKrjRlmVbx1sDHmjmRgD2Xg==
+
+"@babel/plugin-proposal-async-generator-functions@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-proposal-async-generator-functions/-/plugin-proposal-async-generator-functions-7.2.0.tgz#b289b306669dce4ad20b0252889a15768c9d417e"
+  integrity sha512-+Dfo/SCQqrwx48ptLVGLdE39YtWRuKc/Y9I5Fy0P1DDBB9lsAHpjcEJQt+4IifuSOSTLBKJObJqMvaO1pIE8LQ==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+    "@babel/helper-remap-async-to-generator" "^7.1.0"
+    "@babel/plugin-syntax-async-generators" "^7.2.0"
+
+"@babel/plugin-proposal-dynamic-import@^7.5.0":
+  version "7.5.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-proposal-dynamic-import/-/plugin-proposal-dynamic-import-7.5.0.tgz#e532202db4838723691b10a67b8ce509e397c506"
+  integrity sha512-x/iMjggsKTFHYC6g11PL7Qy58IK8H5zqfm9e6hu4z1iH2IRyAp9u9dL80zA6R76yFovETFLKz2VJIC2iIPBuFw==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+    "@babel/plugin-syntax-dynamic-import" "^7.2.0"
+
+"@babel/plugin-proposal-json-strings@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-proposal-json-strings/-/plugin-proposal-json-strings-7.2.0.tgz#568ecc446c6148ae6b267f02551130891e29f317"
+  integrity sha512-MAFV1CA/YVmYwZG0fBQyXhmj0BHCB5egZHCKWIFVv/XCxAeVGIHfos3SwDck4LvCllENIAg7xMKOG5kH0dzyUg==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+    "@babel/plugin-syntax-json-strings" "^7.2.0"
+
+"@babel/plugin-proposal-object-rest-spread@^7.6.2":
+  version "7.6.2"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-proposal-object-rest-spread/-/plugin-proposal-object-rest-spread-7.6.2.tgz#8ffccc8f3a6545e9f78988b6bf4fe881b88e8096"
+  integrity sha512-LDBXlmADCsMZV1Y9OQwMc0MyGZ8Ta/zlD9N67BfQT8uYwkRswiu2hU6nJKrjrt/58aH/vqfQlR/9yId/7A2gWw==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+    "@babel/plugin-syntax-object-rest-spread" "^7.2.0"
+
+"@babel/plugin-proposal-optional-catch-binding@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-proposal-optional-catch-binding/-/plugin-proposal-optional-catch-binding-7.2.0.tgz#135d81edb68a081e55e56ec48541ece8065c38f5"
+  integrity sha512-mgYj3jCcxug6KUcX4OBoOJz3CMrwRfQELPQ5560F70YQUBZB7uac9fqaWamKR1iWUzGiK2t0ygzjTScZnVz75g==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+    "@babel/plugin-syntax-optional-catch-binding" "^7.2.0"
+
+"@babel/plugin-proposal-unicode-property-regex@^7.6.2":
+  version "7.6.2"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-proposal-unicode-property-regex/-/plugin-proposal-unicode-property-regex-7.6.2.tgz#05413762894f41bfe42b9a5e80919bd575dcc802"
+  integrity sha512-NxHETdmpeSCtiatMRYWVJo7266rrvAC3DTeG5exQBIH/fMIUK7ejDNznBbn3HQl/o9peymRRg7Yqkx6PdUXmMw==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+    "@babel/helper-regex" "^7.4.4"
+    regexpu-core "^4.6.0"
+
+"@babel/plugin-syntax-async-generators@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-async-generators/-/plugin-syntax-async-generators-7.2.0.tgz#69e1f0db34c6f5a0cf7e2b3323bf159a76c8cb7f"
+  integrity sha512-1ZrIRBv2t0GSlcwVoQ6VgSLpLgiN/FVQUzt9znxo7v2Ov4jJrs8RY8tv0wvDmFN3qIdMKWrmMMW6yZ0G19MfGg==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-syntax-dynamic-import@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-dynamic-import/-/plugin-syntax-dynamic-import-7.2.0.tgz#69c159ffaf4998122161ad8ebc5e6d1f55df8612"
+  integrity sha512-mVxuJ0YroI/h/tbFTPGZR8cv6ai+STMKNBq0f8hFxsxWjl94qqhsb+wXbpNMDPU3cfR1TIsVFzU3nXyZMqyK4w==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-syntax-json-strings@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-json-strings/-/plugin-syntax-json-strings-7.2.0.tgz#72bd13f6ffe1d25938129d2a186b11fd62951470"
+  integrity sha512-5UGYnMSLRE1dqqZwug+1LISpA403HzlSfsg6P9VXU6TBjcSHeNlw4DxDx7LgpF+iKZoOG/+uzqoRHTdcUpiZNg==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-syntax-object-rest-spread@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-object-rest-spread/-/plugin-syntax-object-rest-spread-7.2.0.tgz#3b7a3e733510c57e820b9142a6579ac8b0dfad2e"
+  integrity sha512-t0JKGgqk2We+9may3t0xDdmneaXmyxq0xieYcKHxIsrJO64n1OiMWNUtc5gQK1PA0NpdCRrtZp4z+IUaKugrSA==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-syntax-optional-catch-binding@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-optional-catch-binding/-/plugin-syntax-optional-catch-binding-7.2.0.tgz#a94013d6eda8908dfe6a477e7f9eda85656ecf5c"
+  integrity sha512-bDe4xKNhb0LI7IvZHiA13kff0KEfaGX/Hv4lMA9+7TEc63hMNvfKo6ZFpXhKuEp+II/q35Gc4NoMeDZyaUbj9w==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-arrow-functions@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-arrow-functions/-/plugin-transform-arrow-functions-7.2.0.tgz#9aeafbe4d6ffc6563bf8f8372091628f00779550"
+  integrity sha512-ER77Cax1+8/8jCB9fo4Ud161OZzWN5qawi4GusDuRLcDbDG+bIGYY20zb2dfAFdTRGzrfq2xZPvF0R64EHnimg==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-async-to-generator@^7.5.0":
+  version "7.5.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-async-to-generator/-/plugin-transform-async-to-generator-7.5.0.tgz#89a3848a0166623b5bc481164b5936ab947e887e"
+  integrity sha512-mqvkzwIGkq0bEF1zLRRiTdjfomZJDV33AH3oQzHVGkI2VzEmXLpKKOBvEVaFZBJdN0XTyH38s9j/Kiqr68dggg==
+  dependencies:
+    "@babel/helper-module-imports" "^7.0.0"
+    "@babel/helper-plugin-utils" "^7.0.0"
+    "@babel/helper-remap-async-to-generator" "^7.1.0"
+
+"@babel/plugin-transform-block-scoped-functions@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-block-scoped-functions/-/plugin-transform-block-scoped-functions-7.2.0.tgz#5d3cc11e8d5ddd752aa64c9148d0db6cb79fd190"
+  integrity sha512-ntQPR6q1/NKuphly49+QiQiTN0O63uOwjdD6dhIjSWBI5xlrbUFh720TIpzBhpnrLfv2tNH/BXvLIab1+BAI0w==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-block-scoping@^7.6.2":
+  version "7.6.2"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-block-scoping/-/plugin-transform-block-scoping-7.6.2.tgz#96c33ab97a9ae500cc6f5b19e04a7e6553360a79"
+  integrity sha512-zZT8ivau9LOQQaOGC7bQLQOT4XPkPXgN2ERfUgk1X8ql+mVkLc4E8eKk+FO3o0154kxzqenWCorfmEXpEZcrSQ==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+    lodash "^4.17.13"
+
+"@babel/plugin-transform-classes@^7.5.5":
+  version "7.5.5"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-classes/-/plugin-transform-classes-7.5.5.tgz#d094299d9bd680a14a2a0edae38305ad60fb4de9"
+  integrity sha512-U2htCNK/6e9K7jGyJ++1p5XRU+LJjrwtoiVn9SzRlDT2KubcZ11OOwy3s24TjHxPgxNwonCYP7U2K51uVYCMDg==
+  dependencies:
+    "@babel/helper-annotate-as-pure" "^7.0.0"
+    "@babel/helper-define-map" "^7.5.5"
+    "@babel/helper-function-name" "^7.1.0"
+    "@babel/helper-optimise-call-expression" "^7.0.0"
+    "@babel/helper-plugin-utils" "^7.0.0"
+    "@babel/helper-replace-supers" "^7.5.5"
+    "@babel/helper-split-export-declaration" "^7.4.4"
+    globals "^11.1.0"
+
+"@babel/plugin-transform-computed-properties@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-computed-properties/-/plugin-transform-computed-properties-7.2.0.tgz#83a7df6a658865b1c8f641d510c6f3af220216da"
+  integrity sha512-kP/drqTxY6Xt3NNpKiMomfgkNn4o7+vKxK2DDKcBG9sHj51vHqMBGy8wbDS/J4lMxnqs153/T3+DmCEAkC5cpA==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-destructuring@^7.6.0":
+  version "7.6.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-destructuring/-/plugin-transform-destructuring-7.6.0.tgz#44bbe08b57f4480094d57d9ffbcd96d309075ba6"
+  integrity sha512-2bGIS5P1v4+sWTCnKNDZDxbGvEqi0ijeqM/YqHtVGrvG2y0ySgnEEhXErvE9dA0bnIzY9bIzdFK0jFA46ASIIQ==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-dotall-regex@^7.6.2":
+  version "7.6.2"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-dotall-regex/-/plugin-transform-dotall-regex-7.6.2.tgz#44abb948b88f0199a627024e1508acaf8dc9b2f9"
+  integrity sha512-KGKT9aqKV+9YMZSkowzYoYEiHqgaDhGmPNZlZxX6UeHC4z30nC1J9IrZuGqbYFB1jaIGdv91ujpze0exiVK8bA==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+    "@babel/helper-regex" "^7.4.4"
+    regexpu-core "^4.6.0"
+
+"@babel/plugin-transform-duplicate-keys@^7.5.0":
+  version "7.5.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-duplicate-keys/-/plugin-transform-duplicate-keys-7.5.0.tgz#c5dbf5106bf84cdf691222c0974c12b1df931853"
+  integrity sha512-igcziksHizyQPlX9gfSjHkE2wmoCH3evvD2qR5w29/Dk0SMKE/eOI7f1HhBdNhR/zxJDqrgpoDTq5YSLH/XMsQ==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-exponentiation-operator@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-exponentiation-operator/-/plugin-transform-exponentiation-operator-7.2.0.tgz#a63868289e5b4007f7054d46491af51435766008"
+  integrity sha512-umh4hR6N7mu4Elq9GG8TOu9M0bakvlsREEC+ialrQN6ABS4oDQ69qJv1VtR3uxlKMCQMCvzk7vr17RHKcjx68A==
+  dependencies:
+    "@babel/helper-builder-binary-assignment-operator-visitor" "^7.1.0"
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-for-of@^7.4.4":
+  version "7.4.4"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-for-of/-/plugin-transform-for-of-7.4.4.tgz#0267fc735e24c808ba173866c6c4d1440fc3c556"
+  integrity sha512-9T/5Dlr14Z9TIEXLXkt8T1DU7F24cbhwhMNUziN3hB1AXoZcdzPcTiKGRn/6iOymDqtTKWnr/BtRKN9JwbKtdQ==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-function-name@^7.4.4":
+  version "7.4.4"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-function-name/-/plugin-transform-function-name-7.4.4.tgz#e1436116abb0610c2259094848754ac5230922ad"
+  integrity sha512-iU9pv7U+2jC9ANQkKeNF6DrPy4GBa4NWQtl6dHB4Pb3izX2JOEvDTFarlNsBj/63ZEzNNIAMs3Qw4fNCcSOXJA==
+  dependencies:
+    "@babel/helper-function-name" "^7.1.0"
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-literals@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-literals/-/plugin-transform-literals-7.2.0.tgz#690353e81f9267dad4fd8cfd77eafa86aba53ea1"
+  integrity sha512-2ThDhm4lI4oV7fVQ6pNNK+sx+c/GM5/SaML0w/r4ZB7sAneD/piDJtwdKlNckXeyGK7wlwg2E2w33C/Hh+VFCg==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-member-expression-literals@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-member-expression-literals/-/plugin-transform-member-expression-literals-7.2.0.tgz#fa10aa5c58a2cb6afcf2c9ffa8cb4d8b3d489a2d"
+  integrity sha512-HiU3zKkSU6scTidmnFJ0bMX8hz5ixC93b4MHMiYebmk2lUVNGOboPsqQvx5LzooihijUoLR/v7Nc1rbBtnc7FA==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-modules-amd@^7.5.0":
+  version "7.5.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-modules-amd/-/plugin-transform-modules-amd-7.5.0.tgz#ef00435d46da0a5961aa728a1d2ecff063e4fb91"
+  integrity sha512-n20UsQMKnWrltocZZm24cRURxQnWIvsABPJlw/fvoy9c6AgHZzoelAIzajDHAQrDpuKFFPPcFGd7ChsYuIUMpg==
+  dependencies:
+    "@babel/helper-module-transforms" "^7.1.0"
+    "@babel/helper-plugin-utils" "^7.0.0"
+    babel-plugin-dynamic-import-node "^2.3.0"
+
+"@babel/plugin-transform-modules-commonjs@^7.6.0":
+  version "7.6.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-modules-commonjs/-/plugin-transform-modules-commonjs-7.6.0.tgz#39dfe957de4420445f1fcf88b68a2e4aa4515486"
+  integrity sha512-Ma93Ix95PNSEngqomy5LSBMAQvYKVe3dy+JlVJSHEXZR5ASL9lQBedMiCyVtmTLraIDVRE3ZjTZvmXXD2Ozw3g==
+  dependencies:
+    "@babel/helper-module-transforms" "^7.4.4"
+    "@babel/helper-plugin-utils" "^7.0.0"
+    "@babel/helper-simple-access" "^7.1.0"
+    babel-plugin-dynamic-import-node "^2.3.0"
+
+"@babel/plugin-transform-modules-systemjs@^7.5.0":
+  version "7.5.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-modules-systemjs/-/plugin-transform-modules-systemjs-7.5.0.tgz#e75266a13ef94202db2a0620977756f51d52d249"
+  integrity sha512-Q2m56tyoQWmuNGxEtUyeEkm6qJYFqs4c+XyXH5RAuYxObRNz9Zgj/1g2GMnjYp2EUyEy7YTrxliGCXzecl/vJg==
+  dependencies:
+    "@babel/helper-hoist-variables" "^7.4.4"
+    "@babel/helper-plugin-utils" "^7.0.0"
+    babel-plugin-dynamic-import-node "^2.3.0"
+
+"@babel/plugin-transform-modules-umd@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-modules-umd/-/plugin-transform-modules-umd-7.2.0.tgz#7678ce75169f0877b8eb2235538c074268dd01ae"
+  integrity sha512-BV3bw6MyUH1iIsGhXlOK6sXhmSarZjtJ/vMiD9dNmpY8QXFFQTj+6v92pcfy1iqa8DeAfJFwoxcrS/TUZda6sw==
+  dependencies:
+    "@babel/helper-module-transforms" "^7.1.0"
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-named-capturing-groups-regex@^7.6.2":
+  version "7.6.2"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-named-capturing-groups-regex/-/plugin-transform-named-capturing-groups-regex-7.6.2.tgz#c1ca0bb84b94f385ca302c3932e870b0fb0e522b"
+  integrity sha512-xBdB+XOs+lgbZc2/4F5BVDVcDNS4tcSKQc96KmlqLEAwz6tpYPEvPdmDfvVG0Ssn8lAhronaRs6Z6KSexIpK5g==
+  dependencies:
+    regexpu-core "^4.6.0"
+
+"@babel/plugin-transform-new-target@^7.4.4":
+  version "7.4.4"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-new-target/-/plugin-transform-new-target-7.4.4.tgz#18d120438b0cc9ee95a47f2c72bc9768fbed60a5"
+  integrity sha512-r1z3T2DNGQwwe2vPGZMBNjioT2scgWzK9BCnDEh+46z8EEwXBq24uRzd65I7pjtugzPSj921aM15RpESgzsSuA==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-object-super@^7.5.5":
+  version "7.5.5"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-object-super/-/plugin-transform-object-super-7.5.5.tgz#c70021df834073c65eb613b8679cc4a381d1a9f9"
+  integrity sha512-un1zJQAhSosGFBduPgN/YFNvWVpRuHKU7IHBglLoLZsGmruJPOo6pbInneflUdmq7YvSVqhpPs5zdBvLnteltQ==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+    "@babel/helper-replace-supers" "^7.5.5"
+
+"@babel/plugin-transform-parameters@^7.4.4":
+  version "7.4.4"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-parameters/-/plugin-transform-parameters-7.4.4.tgz#7556cf03f318bd2719fe4c922d2d808be5571e16"
+  integrity sha512-oMh5DUO1V63nZcu/ZVLQFqiihBGo4OpxJxR1otF50GMeCLiRx5nUdtokd+u9SuVJrvvuIh9OosRFPP4pIPnwmw==
+  dependencies:
+    "@babel/helper-call-delegate" "^7.4.4"
+    "@babel/helper-get-function-arity" "^7.0.0"
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-property-literals@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-property-literals/-/plugin-transform-property-literals-7.2.0.tgz#03e33f653f5b25c4eb572c98b9485055b389e905"
+  integrity sha512-9q7Dbk4RhgcLp8ebduOpCbtjh7C0itoLYHXd9ueASKAG/is5PQtMR5VJGka9NKqGhYEGn5ITahd4h9QeBMylWQ==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-regenerator@^7.4.5":
+  version "7.4.5"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-regenerator/-/plugin-transform-regenerator-7.4.5.tgz#629dc82512c55cee01341fb27bdfcb210354680f"
+  integrity sha512-gBKRh5qAaCWntnd09S8QC7r3auLCqq5DI6O0DlfoyDjslSBVqBibrMdsqO+Uhmx3+BlOmE/Kw1HFxmGbv0N9dA==
+  dependencies:
+    regenerator-transform "^0.14.0"
+
+"@babel/plugin-transform-reserved-words@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-reserved-words/-/plugin-transform-reserved-words-7.2.0.tgz#4792af87c998a49367597d07fedf02636d2e1634"
+  integrity sha512-fz43fqW8E1tAB3DKF19/vxbpib1fuyCwSPE418ge5ZxILnBhWyhtPgz8eh1RCGGJlwvksHkyxMxh0eenFi+kFw==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-shorthand-properties@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-shorthand-properties/-/plugin-transform-shorthand-properties-7.2.0.tgz#6333aee2f8d6ee7e28615457298934a3b46198f0"
+  integrity sha512-QP4eUM83ha9zmYtpbnyjTLAGKQritA5XW/iG9cjtuOI8s1RuL/3V6a3DeSHfKutJQ+ayUfeZJPcnCYEQzaPQqg==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-spread@^7.6.2":
+  version "7.6.2"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-spread/-/plugin-transform-spread-7.6.2.tgz#fc77cf798b24b10c46e1b51b1b88c2bf661bb8dd"
+  integrity sha512-DpSvPFryKdK1x+EDJYCy28nmAaIMdxmhot62jAXF/o99iA33Zj2Lmcp3vDmz+MUh0LNYVPvfj5iC3feb3/+PFg==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-sticky-regex@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-sticky-regex/-/plugin-transform-sticky-regex-7.2.0.tgz#a1e454b5995560a9c1e0d537dfc15061fd2687e1"
+  integrity sha512-KKYCoGaRAf+ckH8gEL3JHUaFVyNHKe3ASNsZ+AlktgHevvxGigoIttrEJb8iKN03Q7Eazlv1s6cx2B2cQ3Jabw==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+    "@babel/helper-regex" "^7.0.0"
+
+"@babel/plugin-transform-template-literals@^7.4.4":
+  version "7.4.4"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-template-literals/-/plugin-transform-template-literals-7.4.4.tgz#9d28fea7bbce637fb7612a0750989d8321d4bcb0"
+  integrity sha512-mQrEC4TWkhLN0z8ygIvEL9ZEToPhG5K7KDW3pzGqOfIGZ28Jb0POUkeWcoz8HnHvhFy6dwAT1j8OzqN8s804+g==
+  dependencies:
+    "@babel/helper-annotate-as-pure" "^7.0.0"
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-typeof-symbol@^7.2.0":
+  version "7.2.0"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-typeof-symbol/-/plugin-transform-typeof-symbol-7.2.0.tgz#117d2bcec2fbf64b4b59d1f9819894682d29f2b2"
+  integrity sha512-2LNhETWYxiYysBtrBTqL8+La0jIoQQnIScUJc74OYvUGRmkskNY4EzLCnjHBzdmb38wqtTaixpo1NctEcvMDZw==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+
+"@babel/plugin-transform-unicode-regex@^7.6.2":
+  version "7.6.2"
+  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-unicode-regex/-/plugin-transform-unicode-regex-7.6.2.tgz#b692aad888a7e8d8b1b214be6b9dc03d5031f698"
+  integrity sha512-orZI6cWlR3nk2YmYdb0gImrgCUwb5cBUwjf6Ks6dvNVvXERkwtJWOQaEOjPiu0Gu1Tq6Yq/hruCZZOOi9F34Dw==
+  dependencies:
+    "@babel/helper-plugin-utils" "^7.0.0"
+    "@babel/helper-regex" "^7.4.4"
+    regexpu-core "^4.6.0"
+
+"@babel/preset-env@^7.6.2":
+  version "7.6.2"
+  resolved "https://registry.yarnpkg.com/@babel/preset-env/-/preset-env-7.6.2.tgz#abbb3ed785c7fe4220d4c82a53621d71fc0c75d3"
+  integrity sha512-Ru7+mfzy9M1/YTEtlDS8CD45jd22ngb9tXnn64DvQK3ooyqSw9K4K9DUWmYknTTVk4TqygL9dqCrZgm1HMea/Q==
+  dependencies:
+    "@babel/helper-module-imports" "^7.0.0"
+    "@babel/helper-plugin-utils" "^7.0.0"
+    "@babel/plugin-proposal-async-generator-functions" "^7.2.0"
+    "@babel/plugin-proposal-dynamic-import" "^7.5.0"
+    "@babel/plugin-proposal-json-strings" "^7.2.0"
+    "@babel/plugin-proposal-object-rest-spread" "^7.6.2"
+    "@babel/plugin-proposal-optional-catch-binding" "^7.2.0"
+    "@babel/plugin-proposal-unicode-property-regex" "^7.6.2"
+    "@babel/plugin-syntax-async-generators" "^7.2.0"
+    "@babel/plugin-syntax-dynamic-import" "^7.2.0"
+    "@babel/plugin-syntax-json-strings" "^7.2.0"
+    "@babel/plugin-syntax-object-rest-spread" "^7.2.0"
+    "@babel/plugin-syntax-optional-catch-binding" "^7.2.0"
+    "@babel/plugin-transform-arrow-functions" "^7.2.0"
+    "@babel/plugin-transform-async-to-generator" "^7.5.0"
+    "@babel/plugin-transform-block-scoped-functions" "^7.2.0"
+    "@babel/plugin-transform-block-scoping" "^7.6.2"
+    "@babel/plugin-transform-classes" "^7.5.5"
+    "@babel/plugin-transform-computed-properties" "^7.2.0"
+    "@babel/plugin-transform-destructuring" "^7.6.0"
+    "@babel/plugin-transform-dotall-regex" "^7.6.2"
+    "@babel/plugin-transform-duplicate-keys" "^7.5.0"
+    "@babel/plugin-transform-exponentiation-operator" "^7.2.0"
+    "@babel/plugin-transform-for-of" "^7.4.4"
+    "@babel/plugin-transform-function-name" "^7.4.4"
+    "@babel/plugin-transform-literals" "^7.2.0"
+    "@babel/plugin-transform-member-expression-literals" "^7.2.0"
+    "@babel/plugin-transform-modules-amd" "^7.5.0"
+    "@babel/plugin-transform-modules-commonjs" "^7.6.0"
+    "@babel/plugin-transform-modules-systemjs" "^7.5.0"
+    "@babel/plugin-transform-modules-umd" "^7.2.0"
+    "@babel/plugin-transform-named-capturing-groups-regex" "^7.6.2"
+    "@babel/plugin-transform-new-target" "^7.4.4"
+    "@babel/plugin-transform-object-super" "^7.5.5"
+    "@babel/plugin-transform-parameters" "^7.4.4"
+    "@babel/plugin-transform-property-literals" "^7.2.0"
+    "@babel/plugin-transform-regenerator" "^7.4.5"
+    "@babel/plugin-transform-reserved-words" "^7.2.0"
+    "@babel/plugin-transform-shorthand-properties" "^7.2.0"
+    "@babel/plugin-transform-spread" "^7.6.2"
+    "@babel/plugin-transform-sticky-regex" "^7.2.0"
+    "@babel/plugin-transform-template-literals" "^7.4.4"
+    "@babel/plugin-transform-typeof-symbol" "^7.2.0"
+    "@babel/plugin-transform-unicode-regex" "^7.6.2"
+    "@babel/types" "^7.6.0"
+    browserslist "^4.6.0"
+    core-js-compat "^3.1.1"
+    invariant "^2.2.2"
+    js-levenshtein "^1.1.3"
+    semver "^5.5.0"
+
+"@babel/template@^7.1.0", "@babel/template@^7.4.4":
+  version "7.6.0"
+  resolved "https://registry.yarnpkg.com/@babel/template/-/template-7.6.0.tgz#7f0159c7f5012230dad64cca42ec9bdb5c9536e6"
+  integrity sha512-5AEH2EXD8euCk446b7edmgFdub/qfH1SN6Nii3+fyXP807QRx9Q73A2N5hNwRRslC2H9sNzaFhsPubkS4L8oNQ==
+  dependencies:
+    "@babel/code-frame" "^7.0.0"
+    "@babel/parser" "^7.6.0"
+    "@babel/types" "^7.6.0"
+
+"@babel/traverse@^7.0.0", "@babel/traverse@^7.1.0", "@babel/traverse@^7.4.4", "@babel/traverse@^7.5.5":
+  version "7.6.2"
+  resolved "https://registry.yarnpkg.com/@babel/traverse/-/traverse-7.6.2.tgz#b0e2bfd401d339ce0e6c05690206d1e11502ce2c"
+  integrity sha512-8fRE76xNwNttVEF2TwxJDGBLWthUkHWSldmfuBzVRmEDWOtu4XdINTgN7TDWzuLg4bbeIMLvfMFD9we5YcWkRQ==
+  dependencies:
+    "@babel/code-frame" "^7.5.5"
+    "@babel/generator" "^7.6.2"
+    "@babel/helper-function-name" "^7.1.0"
+    "@babel/helper-split-export-declaration" "^7.4.4"
+    "@babel/parser" "^7.6.2"
+    "@babel/types" "^7.6.0"
+    debug "^4.1.0"
+    globals "^11.1.0"
+    lodash "^4.17.13"
+
+"@babel/types@^7.0.0", "@babel/types@^7.2.0", "@babel/types@^7.4.4", "@babel/types@^7.5.5", "@babel/types@^7.6.0":
+  version "7.6.1"
+  resolved "https://registry.yarnpkg.com/@babel/types/-/types-7.6.1.tgz#53abf3308add3ac2a2884d539151c57c4b3ac648"
+  integrity sha512-X7gdiuaCmA0uRjCmRtYJNAVCc/q+5xSgsfKJHqMN4iNLILX39677fJE1O40arPMh0TTtS9ItH67yre6c7k6t0g==
+  dependencies:
+    esutils "^2.0.2"
+    lodash "^4.17.13"
+    to-fast-properties "^2.0.0"
+
+abbrev@1:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/abbrev/-/abbrev-1.1.1.tgz#f8f2c887ad10bf67f634f005b6987fed3179aac8"
+  integrity sha512-nne9/IiQ/hzIhY6pdDnbBtz7DjPTKrY00P/zvPSm5pOFkl6xuGrGnXn/VtTNNfNtAfZ9/1RtehkszU9qcTii0Q==
+
+acorn-jsx@^3.0.0:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/acorn-jsx/-/acorn-jsx-3.0.1.tgz#afdf9488fb1ecefc8348f6fb22f464e32a58b36b"
+  integrity sha1-r9+UiPsezvyDSPb7IvRk4ypYs2s=
+  dependencies:
+    acorn "^3.0.4"
+
+acorn@^3.0.4:
+  version "3.3.0"
+  resolved "https://registry.yarnpkg.com/acorn/-/acorn-3.3.0.tgz#45e37fb39e8da3f25baee3ff5369e2bb5f22017a"
+  integrity sha1-ReN/s56No/JbruP/U2niu18iAXo=
+
+acorn@^5.5.0:
+  version "5.7.3"
+  resolved "https://registry.yarnpkg.com/acorn/-/acorn-5.7.3.tgz#67aa231bf8812974b85235a96771eb6bd07ea279"
+  integrity sha512-T/zvzYRfbVojPWahDsE5evJdHb3oJoQfFbsrKM7w5Zcs++Tr257tia3BmMP8XYVjp1S9RZXQMh7gao96BlqZOw==
+
+ajv-keywords@^1.0.0:
+  version "1.5.1"
+  resolved "https://registry.yarnpkg.com/ajv-keywords/-/ajv-keywords-1.5.1.tgz#314dd0a4b3368fad3dfcdc54ede6171b886daf3c"
+  integrity sha1-MU3QpLM2j609/NxU7eYXG4htrzw=
+
+ajv@^4.7.0:
+  version "4.11.8"
+  resolved "https://registry.yarnpkg.com/ajv/-/ajv-4.11.8.tgz#82ffb02b29e662ae53bdc20af15947706739c536"
+  integrity sha1-gv+wKynmYq5TvcIK8VlHcGc5xTY=
+  dependencies:
+    co "^4.6.0"
+    json-stable-stringify "^1.0.1"
+
+ansi-escapes@^1.1.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/ansi-escapes/-/ansi-escapes-1.4.0.tgz#d3a8a83b319aa67793662b13e761c7911422306e"
+  integrity sha1-06ioOzGapneTZisT52HHkRQiMG4=
+
+ansi-regex@^2.0.0:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-2.1.1.tgz#c3b33ab5ee360d86e0e628f0468ae7ef27d654df"
+  integrity sha1-w7M6te42DYbg5ijwRorn7yfWVN8=
+
+ansi-regex@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-3.0.0.tgz#ed0317c322064f79466c02966bddb605ab37d998"
+  integrity sha1-7QMXwyIGT3lGbAKWa922Bas32Zg=
+
+ansi-styles@^2.2.1:
+  version "2.2.1"
+  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-2.2.1.tgz#b432dd3358b634cf75e1e4664368240533c1ddbe"
+  integrity sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=
+
+ansi-styles@^3.2.1:
+  version "3.2.1"
+  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.2.1.tgz#41fbb20243e50b12be0f04b8dedbf07520ce841d"
+  integrity sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==
+  dependencies:
+    color-convert "^1.9.0"
+
+anymatch@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/anymatch/-/anymatch-2.0.0.tgz#bcb24b4f37934d9aa7ac17b4adaf89e7c76ef2eb"
+  integrity sha512-5teOsQWABXHHBFP9y3skS5P3d/WfWXpv3FUpy+LorMrNYaT9pI4oLMQX7jzQ2KklNpGpWHzdCXTDT2Y3XGlZBw==
+  dependencies:
+    micromatch "^3.1.4"
+    normalize-path "^2.1.1"
+
+aproba@^1.0.3:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/aproba/-/aproba-1.2.0.tgz#6802e6264efd18c790a1b0d517f0f2627bf2c94a"
+  integrity sha512-Y9J6ZjXtoYh8RnXVCMOU/ttDmk1aBjunq9vO0ta5x85WDQiQfUF9sIPBITdbiiIVcBo03Hi3jMxigBtsddlXRw==
+
+are-we-there-yet@~1.1.2:
+  version "1.1.5"
+  resolved "https://registry.yarnpkg.com/are-we-there-yet/-/are-we-there-yet-1.1.5.tgz#4b35c2944f062a8bfcda66410760350fe9ddfc21"
+  integrity sha512-5hYdAkZlcG8tOLujVDTgCT+uPX0VnpAH28gWsLfzpXYm7wP6mp5Q/gYyR7YQ0cKVJcXJnl3j2kpBan13PtQf6w==
+  dependencies:
+    delegates "^1.0.0"
+    readable-stream "^2.0.6"
+
+argparse@^1.0.7:
+  version "1.0.10"
+  resolved "https://registry.yarnpkg.com/argparse/-/argparse-1.0.10.tgz#bcd6791ea5ae09725e17e5ad988134cd40b3d911"
+  integrity sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==
+  dependencies:
+    sprintf-js "~1.0.2"
+
+arr-diff@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/arr-diff/-/arr-diff-4.0.0.tgz#d6461074febfec71e7e15235761a329a5dc7c520"
+  integrity sha1-1kYQdP6/7HHn4VI1dhoyml3HxSA=
+
+arr-flatten@^1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/arr-flatten/-/arr-flatten-1.1.0.tgz#36048bbff4e7b47e136644316c99669ea5ae91f1"
+  integrity sha512-L3hKV5R/p5o81R7O02IGnwpDmkp6E982XhtbuwSe3O4qOtMMMtodicASA1Cny2U+aCXcNpml+m4dPsvsJ3jatg==
+
+arr-union@^3.1.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/arr-union/-/arr-union-3.1.0.tgz#e39b09aea9def866a8f206e288af63919bae39c4"
+  integrity sha1-45sJrqne+Gao8gbiiK9jkZuuOcQ=
+
+array-unique@^0.3.2:
+  version "0.3.2"
+  resolved "https://registry.yarnpkg.com/array-unique/-/array-unique-0.3.2.tgz#a894b75d4bc4f6cd679ef3244a9fd8f46ae2d428"
+  integrity sha1-qJS3XUvE9s1nnvMkSp/Y9Gri1Cg=
+
+assign-symbols@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/assign-symbols/-/assign-symbols-1.0.0.tgz#59667f41fadd4f20ccbc2bb96b8d4f7f78ec0367"
+  integrity sha1-WWZ/QfrdTyDMvCu5a41Pf3jsA2c=
+
+async-each@^1.0.1:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/async-each/-/async-each-1.0.3.tgz#b727dbf87d7651602f06f4d4ac387f47d91b0cbf"
+  integrity sha512-z/WhQ5FPySLdvREByI2vZiTWwCnF0moMJ1hK9YQwDTHKh6I7/uSckMetoRGb5UBZPC1z0jlw+n/XCgjeH7y1AQ==
+
+atob@^2.1.1:
+  version "2.1.2"
+  resolved "https://registry.yarnpkg.com/atob/-/atob-2.1.2.tgz#6d9517eb9e030d2436666651e86bd9f6f13533c9"
+  integrity sha512-Wm6ukoaOGJi/73p/cl2GvLjTI5JM1k/O14isD73YML8StrH/7/lRFgmg8nICZgD3bZZvjwCGxtMOD3wWNAu8cg==
+
+babel-code-frame@^6.16.0:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-code-frame/-/babel-code-frame-6.26.0.tgz#63fd43f7dc1e3bb7ce35947db8fe369a3f58c74b"
+  integrity sha1-Y/1D99weO7fONZR9uP42mj9Yx0s=
+  dependencies:
+    chalk "^1.1.3"
+    esutils "^2.0.2"
+    js-tokens "^3.0.2"
+
+babel-eslint@^10.0.3:
+  version "10.0.3"
+  resolved "https://registry.yarnpkg.com/babel-eslint/-/babel-eslint-10.0.3.tgz#81a2c669be0f205e19462fed2482d33e4687a88a"
+  integrity sha512-z3U7eMY6r/3f3/JB9mTsLjyxrv0Yb1zb8PCWCLpguxfCzBIZUwy23R1t/XKewP+8mEN2Ck8Dtr4q20z6ce6SoA==
+  dependencies:
+    "@babel/code-frame" "^7.0.0"
+    "@babel/parser" "^7.0.0"
+    "@babel/traverse" "^7.0.0"
+    "@babel/types" "^7.0.0"
+    eslint-visitor-keys "^1.0.0"
+    resolve "^1.12.0"
+
+babel-plugin-dynamic-import-node@^2.3.0:
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-dynamic-import-node/-/babel-plugin-dynamic-import-node-2.3.0.tgz#f00f507bdaa3c3e3ff6e7e5e98d90a7acab96f7f"
+  integrity sha512-o6qFkpeQEBxcqt0XYlWzAVxNCSCZdUgcR8IRlhD/8DylxjjO4foPcvTW0GGKa/cVt3rvxZ7o5ippJ+/0nvLhlQ==
+  dependencies:
+    object.assign "^4.1.0"
+
+balanced-match@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.0.tgz#89b4d199ab2bee49de164ea02b89ce462d71b767"
+  integrity sha1-ibTRmasr7kneFk6gK4nORi1xt2c=
+
+base@^0.11.1:
+  version "0.11.2"
+  resolved "https://registry.yarnpkg.com/base/-/base-0.11.2.tgz#7bde5ced145b6d551a90db87f83c558b4eb48a8f"
+  integrity sha512-5T6P4xPgpp0YDFvSWwEZ4NoE3aM4QBQXDzmVbraCkFj8zHM+mba8SyqB5DbZWyR7mYHo6Y7BdQo3MoA4m0TeQg==
+  dependencies:
+    cache-base "^1.0.1"
+    class-utils "^0.3.5"
+    component-emitter "^1.2.1"
+    define-property "^1.0.0"
+    isobject "^3.0.1"
+    mixin-deep "^1.2.0"
+    pascalcase "^0.1.1"
+
+binary-extensions@^1.0.0:
+  version "1.13.1"
+  resolved "https://registry.yarnpkg.com/binary-extensions/-/binary-extensions-1.13.1.tgz#598afe54755b2868a5330d2aff9d4ebb53209b65"
+  integrity sha512-Un7MIEDdUC5gNpcGDV97op1Ywk748MpHcFTHoYs6qnj1Z3j7I53VG3nwZhKzoBZmbdRNnb6WRdFlwl7tSDuZGw==
+
+brace-expansion@^1.1.7:
+  version "1.1.11"
+  resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd"
+  integrity sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==
+  dependencies:
+    balanced-match "^1.0.0"
+    concat-map "0.0.1"
+
+braces@^2.3.1, braces@^2.3.2:
+  version "2.3.2"
+  resolved "https://registry.yarnpkg.com/braces/-/braces-2.3.2.tgz#5979fd3f14cd531565e5fa2df1abfff1dfaee729"
+  integrity sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==
+  dependencies:
+    arr-flatten "^1.1.0"
+    array-unique "^0.3.2"
+    extend-shallow "^2.0.1"
+    fill-range "^4.0.0"
+    isobject "^3.0.1"
+    repeat-element "^1.1.2"
+    snapdragon "^0.8.1"
+    snapdragon-node "^2.0.1"
+    split-string "^3.0.2"
+    to-regex "^3.0.1"
+
+browser-stdout@1.3.0:
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/browser-stdout/-/browser-stdout-1.3.0.tgz#f351d32969d32fa5d7a5567154263d928ae3bd1f"
+  integrity sha1-81HTKWnTL6XXpVZxVCY9korjvR8=
+
+browserslist@^4.6.0, browserslist@^4.6.6:
+  version "4.7.0"
+  resolved "https://registry.yarnpkg.com/browserslist/-/browserslist-4.7.0.tgz#9ee89225ffc07db03409f2fee524dc8227458a17"
+  integrity sha512-9rGNDtnj+HaahxiVV38Gn8n8Lr8REKsel68v1sPFfIGEK6uSXTY3h9acgiT1dZVtOOUtifo/Dn8daDQ5dUgVsA==
+  dependencies:
+    caniuse-lite "^1.0.30000989"
+    electron-to-chromium "^1.3.247"
+    node-releases "^1.1.29"
+
+buffer-from@^1.0.0:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/buffer-from/-/buffer-from-1.1.1.tgz#32713bc028f75c02fdb710d7c7bcec1f2c6070ef"
+  integrity sha512-MQcXEUbCKtEo7bhqEs6560Hyd4XaovZlO/k9V3hjVUF/zwW7KBVdSK4gIt/bzwS9MbR5qob+F5jusZsb0YQK2A==
+
+cache-base@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/cache-base/-/cache-base-1.0.1.tgz#0a7f46416831c8b662ee36fe4e7c59d76f666ab2"
+  integrity sha512-AKcdTnFSWATd5/GCPRxr2ChwIJ85CeyrEyjRHlKxQ56d4XJMGym0uAiKn0xbLOGOl3+yRpOTi484dVCEc5AUzQ==
+  dependencies:
+    collection-visit "^1.0.0"
+    component-emitter "^1.2.1"
+    get-value "^2.0.6"
+    has-value "^1.0.0"
+    isobject "^3.0.1"
+    set-value "^2.0.0"
+    to-object-path "^0.3.0"
+    union-value "^1.0.0"
+    unset-value "^1.0.0"
+
+caller-path@^0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/caller-path/-/caller-path-0.1.0.tgz#94085ef63581ecd3daa92444a8fe94e82577751f"
+  integrity sha1-lAhe9jWB7NPaqSREqP6U6CV3dR8=
+  dependencies:
+    callsites "^0.2.0"
+
+callsites@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/callsites/-/callsites-0.2.0.tgz#afab96262910a7f33c19a5775825c69f34e350ca"
+  integrity sha1-r6uWJikQp/M8GaV3WCXGnzTjUMo=
+
+caniuse-lite@^1.0.30000989:
+  version "1.0.30000997"
+  resolved "https://registry.yarnpkg.com/caniuse-lite/-/caniuse-lite-1.0.30000997.tgz#ba44a606804f8680894b7042612c2c7f65685b7e"
+  integrity sha512-BQLFPIdj2ntgBNWp9Q64LGUIEmvhKkzzHhUHR3CD5A9Lb7ZKF20/+sgadhFap69lk5XmK1fTUleDclaRFvgVUA==
+
+chalk@^1.0.0, chalk@^1.1.1, chalk@^1.1.3:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-1.1.3.tgz#a8115c55e4a702fe4d150abd3872822a7e09fc98"
+  integrity sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=
+  dependencies:
+    ansi-styles "^2.2.1"
+    escape-string-regexp "^1.0.2"
+    has-ansi "^2.0.0"
+    strip-ansi "^3.0.0"
+    supports-color "^2.0.0"
+
+chalk@^2.0.0:
+  version "2.4.2"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.4.2.tgz#cd42541677a54333cf541a49108c1432b44c9424"
+  integrity sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==
+  dependencies:
+    ansi-styles "^3.2.1"
+    escape-string-regexp "^1.0.5"
+    supports-color "^5.3.0"
+
+chokidar@^2.1.8:
+  version "2.1.8"
+  resolved "https://registry.yarnpkg.com/chokidar/-/chokidar-2.1.8.tgz#804b3a7b6a99358c3c5c61e71d8728f041cff917"
+  integrity sha512-ZmZUazfOzf0Nve7duiCKD23PFSCs4JPoYyccjUFF3aQkQadqBhfzhjkwBH2mNOG9cTBwhamM37EIsIkZw3nRgg==
+  dependencies:
+    anymatch "^2.0.0"
+    async-each "^1.0.1"
+    braces "^2.3.2"
+    glob-parent "^3.1.0"
+    inherits "^2.0.3"
+    is-binary-path "^1.0.0"
+    is-glob "^4.0.0"
+    normalize-path "^3.0.0"
+    path-is-absolute "^1.0.0"
+    readdirp "^2.2.1"
+    upath "^1.1.1"
+  optionalDependencies:
+    fsevents "^1.2.7"
+
+chownr@^1.1.1:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/chownr/-/chownr-1.1.3.tgz#42d837d5239688d55f303003a508230fa6727142"
+  integrity sha512-i70fVHhmV3DtTl6nqvZOnIjbY0Pe4kAUjwHj8z0zAdgBtYrJyYwLKCCuRBQ5ppkyL0AkN7HKRnETdmdp1zqNXw==
+
+circular-json@^0.3.1:
+  version "0.3.3"
+  resolved "https://registry.yarnpkg.com/circular-json/-/circular-json-0.3.3.tgz#815c99ea84f6809529d2f45791bdf82711352d66"
+  integrity sha512-UZK3NBx2Mca+b5LsG7bY183pHWt5Y1xts4P3Pz7ENTwGVnJOUWbRb3ocjvX7hx9tq/yTAdclXm9sZ38gNuem4A==
+
+class-utils@^0.3.5:
+  version "0.3.6"
+  resolved "https://registry.yarnpkg.com/class-utils/-/class-utils-0.3.6.tgz#f93369ae8b9a7ce02fd41faad0ca83033190c463"
+  integrity sha512-qOhPa/Fj7s6TY8H8esGu5QNpMMQxz79h+urzrNYN6mn+9BnxlDGf5QZ+XeCDsxSjPqsSR56XOZOJmpeurnLMeg==
+  dependencies:
+    arr-union "^3.1.0"
+    define-property "^0.2.5"
+    isobject "^3.0.0"
+    static-extend "^0.1.1"
+
+cli-cursor@^1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/cli-cursor/-/cli-cursor-1.0.2.tgz#64da3f7d56a54412e59794bd62dc35295e8f2987"
+  integrity sha1-ZNo/fValRBLll5S9Ytw1KV6PKYc=
+  dependencies:
+    restore-cursor "^1.0.1"
+
+cli-width@^2.0.0:
+  version "2.2.0"
+  resolved "https://registry.yarnpkg.com/cli-width/-/cli-width-2.2.0.tgz#ff19ede8a9a5e579324147b0c11f0fbcbabed639"
+  integrity sha1-/xnt6Kml5XkyQUewwR8PvLq+1jk=
+
+co@^4.6.0:
+  version "4.6.0"
+  resolved "https://registry.yarnpkg.com/co/-/co-4.6.0.tgz#6ea6bdf3d853ae54ccb8e47bfa0bf3f9031fb184"
+  integrity sha1-bqa989hTrlTMuOR7+gvz+QMfsYQ=
+
+code-point-at@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/code-point-at/-/code-point-at-1.1.0.tgz#0d070b4d043a5bea33a2f1a40e2edb3d9a4ccf77"
+  integrity sha1-DQcLTQQ6W+ozovGkDi7bPZpMz3c=
+
+collection-visit@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/collection-visit/-/collection-visit-1.0.0.tgz#4bc0373c164bc3291b4d368c829cf1a80a59dca0"
+  integrity sha1-S8A3PBZLwykbTTaMgpzxqApZ3KA=
+  dependencies:
+    map-visit "^1.0.0"
+    object-visit "^1.0.0"
+
+color-convert@^1.9.0:
+  version "1.9.3"
+  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.3.tgz#bb71850690e1f136567de629d2d5471deda4c1e8"
+  integrity sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==
+  dependencies:
+    color-name "1.1.3"
+
+color-name@1.1.3:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.3.tgz#a7d0558bd89c42f795dd42328f740831ca53bc25"
+  integrity sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=
+
+commander@2.9.0:
+  version "2.9.0"
+  resolved "https://registry.yarnpkg.com/commander/-/commander-2.9.0.tgz#9c99094176e12240cb22d6c5146098400fe0f7d4"
+  integrity sha1-nJkJQXbhIkDLItbFFGCYQA/g99Q=
+  dependencies:
+    graceful-readlink ">= 1.0.0"
+
+commander@^2.8.1:
+  version "2.20.1"
+  resolved "https://registry.yarnpkg.com/commander/-/commander-2.20.1.tgz#3863ce3ca92d0831dcf2a102f5fb4b5926afd0f9"
+  integrity sha512-cCuLsMhJeWQ/ZpsFTbE765kvVfoeSddc4nU3up4fV+fDBcfUXnbITJ+JzhkdjzOqhURjZgujxaioam4RM9yGUg==
+
+component-emitter@^1.2.1:
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/component-emitter/-/component-emitter-1.3.0.tgz#16e4070fba8ae29b679f2215853ee181ab2eabc0"
+  integrity sha512-Rd3se6QB+sO1TwqZjscQrurpEPIfO0/yYnSin6Q/rD3mOutHvUrCAhJub3r90uNb+SESBuE0QYoB90YdfatsRg==
+
+concat-map@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b"
+  integrity sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=
+
+concat-stream@^1.4.6:
+  version "1.6.2"
+  resolved "https://registry.yarnpkg.com/concat-stream/-/concat-stream-1.6.2.tgz#904bdf194cd3122fc675c77fc4ac3d4ff0fd1a34"
+  integrity sha512-27HBghJxjiZtIk3Ycvn/4kbJk/1uZuJFfuPEns6LaEvpvG1f0hTea8lilrouyo9mVc2GWdcEZ8OLoGmSADlrCw==
+  dependencies:
+    buffer-from "^1.0.0"
+    inherits "^2.0.3"
+    readable-stream "^2.2.2"
+    typedarray "^0.0.6"
+
+console-control-strings@^1.0.0, console-control-strings@~1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/console-control-strings/-/console-control-strings-1.1.0.tgz#3d7cf4464db6446ea644bf4b39507f9851008e8e"
+  integrity sha1-PXz0Rk22RG6mRL9LOVB/mFEAjo4=
+
+convert-source-map@^1.1.0:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/convert-source-map/-/convert-source-map-1.6.0.tgz#51b537a8c43e0f04dec1993bffcdd504e758ac20"
+  integrity sha512-eFu7XigvxdZ1ETfbgPBohgyQ/Z++C0eEhTor0qRwBw9unw+L0/6V8wkSuGgzdThkiS5lSpdptOQPD8Ak40a+7A==
+  dependencies:
+    safe-buffer "~5.1.1"
+
+copy-descriptor@^0.1.0:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/copy-descriptor/-/copy-descriptor-0.1.1.tgz#676f6eb3c39997c2ee1ac3a924fd6124748f578d"
+  integrity sha1-Z29us8OZl8LuGsOpJP1hJHSPV40=
+
+core-js-compat@^3.1.1:
+  version "3.2.1"
+  resolved "https://registry.yarnpkg.com/core-js-compat/-/core-js-compat-3.2.1.tgz#0cbdbc2e386e8e00d3b85dc81c848effec5b8150"
+  integrity sha512-MwPZle5CF9dEaMYdDeWm73ao/IflDH+FjeJCWEADcEgFSE9TLimFKwJsfmkwzI8eC0Aj0mgvMDjeQjrElkz4/A==
+  dependencies:
+    browserslist "^4.6.6"
+    semver "^6.3.0"
+
+core-util-is@~1.0.0:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/core-util-is/-/core-util-is-1.0.2.tgz#b5fd54220aa2bc5ab57aab7140c940754503c1a7"
+  integrity sha1-tf1UIgqivFq1eqtxQMlAdUUDwac=
+
+d@1, d@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/d/-/d-1.0.1.tgz#8698095372d58dbee346ffd0c7093f99f8f9eb5a"
+  integrity sha512-m62ShEObQ39CfralilEQRjH6oAMtNCV1xJyEx5LpRYUVN+EviphDgUc/F3hnYbADmkiNs67Y+3ylmlG7Lnu+FA==
+  dependencies:
+    es5-ext "^0.10.50"
+    type "^1.0.1"
+
+debug@2.6.8:
+  version "2.6.8"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.8.tgz#e731531ca2ede27d188222427da17821d68ff4fc"
+  integrity sha1-5zFTHKLt4n0YgiJCfaF4IdaP9Pw=
+  dependencies:
+    ms "2.0.0"
+
+debug@^2.1.1, debug@^2.2.0, debug@^2.3.3:
+  version "2.6.9"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.9.tgz#5d128515df134ff327e90a4c93f4e077a536341f"
+  integrity sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==
+  dependencies:
+    ms "2.0.0"
+
+debug@^3.2.6:
+  version "3.2.6"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-3.2.6.tgz#e83d17de16d8a7efb7717edbe5fb10135eee629b"
+  integrity sha512-mel+jf7nrtEl5Pn1Qx46zARXKDpBbvzezse7p7LqINmdoIk8PYP5SySaxEmYv6TZ0JyEKA1hsCId6DIhgITtWQ==
+  dependencies:
+    ms "^2.1.1"
+
+debug@^4.1.0:
+  version "4.1.1"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-4.1.1.tgz#3b72260255109c6b589cee050f1d516139664791"
+  integrity sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==
+  dependencies:
+    ms "^2.1.1"
+
+decode-uri-component@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/decode-uri-component/-/decode-uri-component-0.2.0.tgz#eb3913333458775cb84cd1a1fae062106bb87545"
+  integrity sha1-6zkTMzRYd1y4TNGh+uBiEGu4dUU=
+
+deep-extend@^0.6.0:
+  version "0.6.0"
+  resolved "https://registry.yarnpkg.com/deep-extend/-/deep-extend-0.6.0.tgz#c4fa7c95404a17a9c3e8ca7e1537312b736330ac"
+  integrity sha512-LOHxIOaPYdHlJRtCQfDIVZtfw/ufM8+rVj649RIHzcm/vGwQRXFt6OPqIFWsm2XEMrNIEtWR64sY1LEKD2vAOA==
+
+deep-is@~0.1.3:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/deep-is/-/deep-is-0.1.3.tgz#b369d6fb5dbc13eecf524f91b070feedc357cf34"
+  integrity sha1-s2nW+128E+7PUk+RsHD+7cNXzzQ=
+
+define-properties@^1.1.2:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/define-properties/-/define-properties-1.1.3.tgz#cf88da6cbee26fe6db7094f61d870cbd84cee9f1"
+  integrity sha512-3MqfYKj2lLzdMSf8ZIZE/V+Zuy+BgD6f164e8K2w7dgnpKArBDerGYpM46IYYcjnkdPNMjPk9A6VFB8+3SKlXQ==
+  dependencies:
+    object-keys "^1.0.12"
+
+define-property@^0.2.5:
+  version "0.2.5"
+  resolved "https://registry.yarnpkg.com/define-property/-/define-property-0.2.5.tgz#c35b1ef918ec3c990f9a5bc57be04aacec5c8116"
+  integrity sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=
+  dependencies:
+    is-descriptor "^0.1.0"
+
+define-property@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/define-property/-/define-property-1.0.0.tgz#769ebaaf3f4a63aad3af9e8d304c9bbe79bfb0e6"
+  integrity sha1-dp66rz9KY6rTr56NMEybvnm/sOY=
+  dependencies:
+    is-descriptor "^1.0.0"
+
+define-property@^2.0.2:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/define-property/-/define-property-2.0.2.tgz#d459689e8d654ba77e02a817f8710d702cb16e9d"
+  integrity sha512-jwK2UV4cnPpbcG7+VRARKTZPUWowwXA8bzH5NP6ud0oeAxyYPuGZUAC7hMugpCdz4BeSZl2Dl9k66CHJ/46ZYQ==
+  dependencies:
+    is-descriptor "^1.0.2"
+    isobject "^3.0.1"
+
+delegates@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/delegates/-/delegates-1.0.0.tgz#84c6e159b81904fdca59a0ef44cd870d31250f9a"
+  integrity sha1-hMbhWbgZBP3KWaDvRM2HDTElD5o=
+
+detect-libc@^1.0.2:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/detect-libc/-/detect-libc-1.0.3.tgz#fa137c4bd698edf55cd5cd02ac559f91a4c4ba9b"
+  integrity sha1-+hN8S9aY7fVc1c0CrFWfkaTEups=
+
+diff@3.2.0:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/diff/-/diff-3.2.0.tgz#c9ce393a4b7cbd0b058a725c93df299027868ff9"
+  integrity sha1-yc45Okt8vQsFinJck98pkCeGj/k=
+
+doctrine@^1.2.2:
+  version "1.5.0"
+  resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-1.5.0.tgz#379dce730f6166f76cefa4e6707a159b02c5a6fa"
+  integrity sha1-N53Ocw9hZvds76TmcHoVmwLFpvo=
+  dependencies:
+    esutils "^2.0.2"
+    isarray "^1.0.0"
+
+electron-to-chromium@^1.3.247:
+  version "1.3.269"
+  resolved "https://registry.yarnpkg.com/electron-to-chromium/-/electron-to-chromium-1.3.269.tgz#3e00cc9266a0123fc2e7b4f290899e257200e6e3"
+  integrity sha512-t2ZTfo07HxkxTOUbIwMmqHBSnJsC9heqJUm7LwQu2iSk0wNhG4H5cMREtb8XxeCrQABDZ6IqQKY3yZq+NfAqwg==
+
+es5-ext@^0.10.35, es5-ext@^0.10.46, es5-ext@^0.10.50, es5-ext@^0.10.51, es5-ext@~0.10.14:
+  version "0.10.51"
+  resolved "https://registry.yarnpkg.com/es5-ext/-/es5-ext-0.10.51.tgz#ed2d7d9d48a12df86e0299287e93a09ff478842f"
+  integrity sha512-oRpWzM2WcLHVKpnrcyB7OW8j/s67Ba04JCm0WnNv3RiABSvs7mrQlutB8DBv793gKcp0XENR8Il8WxGTlZ73gQ==
+  dependencies:
+    es6-iterator "~2.0.3"
+    es6-symbol "~3.1.1"
+    next-tick "^1.0.0"
+
+es6-iterator@^2.0.3, es6-iterator@~2.0.1, es6-iterator@~2.0.3:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/es6-iterator/-/es6-iterator-2.0.3.tgz#a7de889141a05a94b0854403b2d0a0fbfa98f3b7"
+  integrity sha1-p96IkUGgWpSwhUQDstCg+/qY87c=
+  dependencies:
+    d "1"
+    es5-ext "^0.10.35"
+    es6-symbol "^3.1.1"
+
+es6-map@^0.1.3:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/es6-map/-/es6-map-0.1.5.tgz#9136e0503dcc06a301690f0bb14ff4e364e949f0"
+  integrity sha1-kTbgUD3MBqMBaQ8LsU/042TpSfA=
+  dependencies:
+    d "1"
+    es5-ext "~0.10.14"
+    es6-iterator "~2.0.1"
+    es6-set "~0.1.5"
+    es6-symbol "~3.1.1"
+    event-emitter "~0.3.5"
+
+es6-set@~0.1.5:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/es6-set/-/es6-set-0.1.5.tgz#d2b3ec5d4d800ced818db538d28974db0a73ccb1"
+  integrity sha1-0rPsXU2ADO2BjbU40ol02wpzzLE=
+  dependencies:
+    d "1"
+    es5-ext "~0.10.14"
+    es6-iterator "~2.0.1"
+    es6-symbol "3.1.1"
+    event-emitter "~0.3.5"
+
+es6-symbol@3.1.1:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/es6-symbol/-/es6-symbol-3.1.1.tgz#bf00ef4fdab6ba1b46ecb7b629b4c7ed5715cc77"
+  integrity sha1-vwDvT9q2uhtG7Le2KbTH7VcVzHc=
+  dependencies:
+    d "1"
+    es5-ext "~0.10.14"
+
+es6-symbol@^3.1.1, es6-symbol@~3.1.1:
+  version "3.1.2"
+  resolved "https://registry.yarnpkg.com/es6-symbol/-/es6-symbol-3.1.2.tgz#859fdd34f32e905ff06d752e7171ddd4444a7ed1"
+  integrity sha512-/ZypxQsArlv+KHpGvng52/Iz8by3EQPxhmbuz8yFG89N/caTFBSbcXONDw0aMjy827gQg26XAjP4uXFvnfINmQ==
+  dependencies:
+    d "^1.0.1"
+    es5-ext "^0.10.51"
+
+es6-weak-map@^2.0.1:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/es6-weak-map/-/es6-weak-map-2.0.3.tgz#b6da1f16cc2cc0d9be43e6bdbfc5e7dfcdf31d53"
+  integrity sha512-p5um32HOTO1kP+w7PRnB+5lQ43Z6muuMuIMffvDN8ZB4GcnjLBV6zGStpbASIMk4DCAvEaamhe2zhyCb/QXXsA==
+  dependencies:
+    d "1"
+    es5-ext "^0.10.46"
+    es6-iterator "^2.0.3"
+    es6-symbol "^3.1.1"
+
+escape-string-regexp@1.0.5, escape-string-regexp@^1.0.2, escape-string-regexp@^1.0.5:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz#1b61c0562190a8dff6ae3bb2cf0200ca130b86d4"
+  integrity sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=
+
+escope@^3.6.0:
+  version "3.6.0"
+  resolved "https://registry.yarnpkg.com/escope/-/escope-3.6.0.tgz#e01975e812781a163a6dadfdd80398dc64c889c3"
+  integrity sha1-4Bl16BJ4GhY6ba392AOY3GTIicM=
+  dependencies:
+    es6-map "^0.1.3"
+    es6-weak-map "^2.0.1"
+    esrecurse "^4.1.0"
+    estraverse "^4.1.1"
+
+eslint-visitor-keys@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-1.1.0.tgz#e2a82cea84ff246ad6fb57f9bde5b46621459ec2"
+  integrity sha512-8y9YjtM1JBJU/A9Kc+SbaOV4y29sSWckBwMHa+FGtVj5gN/sbnKDf6xJUl+8g7FAij9LVaP8C24DUiH/f/2Z9A==
+
+eslint@~3.9.1:
+  version "3.9.1"
+  resolved "https://registry.yarnpkg.com/eslint/-/eslint-3.9.1.tgz#5a8597706fc6048bc6061ac754d4a211d28f4f5b"
+  integrity sha1-WoWXcG/GBIvGBhrHVNSiEdKPT1s=
+  dependencies:
+    babel-code-frame "^6.16.0"
+    chalk "^1.1.3"
+    concat-stream "^1.4.6"
+    debug "^2.1.1"
+    doctrine "^1.2.2"
+    escope "^3.6.0"
+    espree "^3.3.1"
+    estraverse "^4.2.0"
+    esutils "^2.0.2"
+    file-entry-cache "^2.0.0"
+    glob "^7.0.3"
+    globals "^9.2.0"
+    ignore "^3.1.5"
+    imurmurhash "^0.1.4"
+    inquirer "^0.12.0"
+    is-my-json-valid "^2.10.0"
+    is-resolvable "^1.0.0"
+    js-yaml "^3.5.1"
+    json-stable-stringify "^1.0.0"
+    levn "^0.3.0"
+    lodash "^4.0.0"
+    mkdirp "^0.5.0"
+    natural-compare "^1.4.0"
+    optionator "^0.8.2"
+    path-is-inside "^1.0.1"
+    pluralize "^1.2.1"
+    progress "^1.1.8"
+    require-uncached "^1.0.2"
+    shelljs "^0.7.5"
+    strip-bom "^3.0.0"
+    strip-json-comments "~1.0.1"
+    table "^3.7.8"
+    text-table "~0.2.0"
+    user-home "^2.0.0"
+
+espree@^3.3.1:
+  version "3.5.4"
+  resolved "https://registry.yarnpkg.com/espree/-/espree-3.5.4.tgz#b0f447187c8a8bed944b815a660bddf5deb5d1a7"
+  integrity sha512-yAcIQxtmMiB/jL32dzEp2enBeidsB7xWPLNiw3IIkpVds1P+h7qF9YwJq1yUNzp2OKXgAprs4F61ih66UsoD1A==
+  dependencies:
+    acorn "^5.5.0"
+    acorn-jsx "^3.0.0"
+
+esprima@^4.0.0:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/esprima/-/esprima-4.0.1.tgz#13b04cdb3e6c5d19df91ab6987a8695619b0aa71"
+  integrity sha512-eGuFFw7Upda+g4p+QHvnW0RyTX/SVeJBDM/gCtMARO0cLuT2HcEKnTPvhjV6aGeqrCB/sbNop0Kszm0jsaWU4A==
+
+esrecurse@^4.1.0:
+  version "4.2.1"
+  resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.2.1.tgz#007a3b9fdbc2b3bb87e4879ea19c92fdbd3942cf"
+  integrity sha512-64RBB++fIOAXPw3P9cy89qfMlvZEXZkqqJkjqqXIvzP5ezRZjW+lPWjw35UX/3EhUPFYbg5ER4JYgDw4007/DQ==
+  dependencies:
+    estraverse "^4.1.0"
+
+estraverse@^4.1.0, estraverse@^4.1.1, estraverse@^4.2.0:
+  version "4.3.0"
+  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-4.3.0.tgz#398ad3f3c5a24948be7725e83d11a7de28cdbd1d"
+  integrity sha512-39nnKffWz8xN1BU/2c79n9nB9HDzo0niYUqx6xyqUnyoAnQyyWpOTdZEeiCch8BBu515t4wp9ZmgVfVhn9EBpw==
+
+esutils@^2.0.2:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/esutils/-/esutils-2.0.3.tgz#74d2eb4de0b8da1293711910d50775b9b710ef64"
+  integrity sha512-kVscqXk4OCp68SZ0dkgEKVi6/8ij300KBWTJq32P/dYeWTSwK41WyTxalN1eRmA5Z9UU/LX9D7FWSmV9SAYx6g==
+
+event-emitter@~0.3.5:
+  version "0.3.5"
+  resolved "https://registry.yarnpkg.com/event-emitter/-/event-emitter-0.3.5.tgz#df8c69eef1647923c7157b9ce83840610b02cc39"
+  integrity sha1-34xp7vFkeSPHFXuc6DhAYQsCzDk=
+  dependencies:
+    d "1"
+    es5-ext "~0.10.14"
+
+exit-hook@^1.0.0:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/exit-hook/-/exit-hook-1.1.1.tgz#f05ca233b48c05d54fff07765df8507e95c02ff8"
+  integrity sha1-8FyiM7SMBdVP/wd2XfhQfpXAL/g=
+
+expand-brackets@^2.1.4:
+  version "2.1.4"
+  resolved "https://registry.yarnpkg.com/expand-brackets/-/expand-brackets-2.1.4.tgz#b77735e315ce30f6b6eff0f83b04151a22449622"
+  integrity sha1-t3c14xXOMPa27/D4OwQVGiJEliI=
+  dependencies:
+    debug "^2.3.3"
+    define-property "^0.2.5"
+    extend-shallow "^2.0.1"
+    posix-character-classes "^0.1.0"
+    regex-not "^1.0.0"
+    snapdragon "^0.8.1"
+    to-regex "^3.0.1"
+
+extend-shallow@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/extend-shallow/-/extend-shallow-2.0.1.tgz#51af7d614ad9a9f610ea1bafbb989d6b1c56890f"
+  integrity sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=
+  dependencies:
+    is-extendable "^0.1.0"
+
+extend-shallow@^3.0.0, extend-shallow@^3.0.2:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/extend-shallow/-/extend-shallow-3.0.2.tgz#26a71aaf073b39fb2127172746131c2704028db8"
+  integrity sha1-Jqcarwc7OfshJxcnRhMcJwQCjbg=
+  dependencies:
+    assign-symbols "^1.0.0"
+    is-extendable "^1.0.1"
+
+extglob@^2.0.4:
+  version "2.0.4"
+  resolved "https://registry.yarnpkg.com/extglob/-/extglob-2.0.4.tgz#ad00fe4dc612a9232e8718711dc5cb5ab0285543"
+  integrity sha512-Nmb6QXkELsuBr24CJSkilo6UHHgbekK5UiZgfE6UHD3Eb27YC6oD+bhcT+tJ6cl8dmsgdQxnWlcry8ksBIBLpw==
+  dependencies:
+    array-unique "^0.3.2"
+    define-property "^1.0.0"
+    expand-brackets "^2.1.4"
+    extend-shallow "^2.0.1"
+    fragment-cache "^0.2.1"
+    regex-not "^1.0.0"
+    snapdragon "^0.8.1"
+    to-regex "^3.0.1"
+
+fast-levenshtein@~2.0.4:
+  version "2.0.6"
+  resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917"
+  integrity sha1-PYpcZog6FqMMqGQ+hR8Zuqd5eRc=
+
+figures@^1.3.5:
+  version "1.7.0"
+  resolved "https://registry.yarnpkg.com/figures/-/figures-1.7.0.tgz#cbe1e3affcf1cd44b80cadfed28dc793a9701d2e"
+  integrity sha1-y+Hjr/zxzUS4DK3+0o3Hk6lwHS4=
+  dependencies:
+    escape-string-regexp "^1.0.5"
+    object-assign "^4.1.0"
+
+file-entry-cache@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-2.0.0.tgz#c392990c3e684783d838b8c84a45d8a048458361"
+  integrity sha1-w5KZDD5oR4PYOLjISkXYoEhFg2E=
+  dependencies:
+    flat-cache "^1.2.1"
+    object-assign "^4.0.1"
+
+fill-range@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/fill-range/-/fill-range-4.0.0.tgz#d544811d428f98eb06a63dc402d2403c328c38f7"
+  integrity sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=
+  dependencies:
+    extend-shallow "^2.0.1"
+    is-number "^3.0.0"
+    repeat-string "^1.6.1"
+    to-regex-range "^2.1.0"
+
+flat-cache@^1.2.1:
+  version "1.3.4"
+  resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-1.3.4.tgz#2c2ef77525cc2929007dfffa1dd314aa9c9dee6f"
+  integrity sha512-VwyB3Lkgacfik2vhqR4uv2rvebqmDvFu4jlN/C1RzWoJEo8I7z4Q404oiqYCkq41mni8EzQnm95emU9seckwtg==
+  dependencies:
+    circular-json "^0.3.1"
+    graceful-fs "^4.1.2"
+    rimraf "~2.6.2"
+    write "^0.2.1"
+
+for-in@^1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/for-in/-/for-in-1.0.2.tgz#81068d295a8142ec0ac726c6e2200c30fb6d5e80"
+  integrity sha1-gQaNKVqBQuwKxybG4iAMMPttXoA=
+
+fragment-cache@^0.2.1:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/fragment-cache/-/fragment-cache-0.2.1.tgz#4290fad27f13e89be7f33799c6bc5a0abfff0d19"
+  integrity sha1-QpD60n8T6Jvn8zeZxrxaCr//DRk=
+  dependencies:
+    map-cache "^0.2.2"
+
+fs-minipass@^1.2.5:
+  version "1.2.7"
+  resolved "https://registry.yarnpkg.com/fs-minipass/-/fs-minipass-1.2.7.tgz#ccff8570841e7fe4265693da88936c55aed7f7c7"
+  integrity sha512-GWSSJGFy4e9GUeCcbIkED+bgAoFyj7XF1mV8rma3QW4NIqX9Kyx79N/PF61H5udOV3aY1IaMLs6pGbH71nlCTA==
+  dependencies:
+    minipass "^2.6.0"
+
+fs-readdir-recursive@^1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/fs-readdir-recursive/-/fs-readdir-recursive-1.1.0.tgz#e32fc030a2ccee44a6b5371308da54be0b397d27"
+  integrity sha512-GNanXlVr2pf02+sPN40XN8HG+ePaNcvM0q5mZBd668Obwb0yD5GiUbZOFgwn8kGMY6I3mdyDJzieUy3PTYyTRA==
+
+fs.realpath@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f"
+  integrity sha1-FQStJSMVjKpA20onh8sBQRmU6k8=
+
+fsevents@^1.2.7:
+  version "1.2.9"
+  resolved "https://registry.yarnpkg.com/fsevents/-/fsevents-1.2.9.tgz#3f5ed66583ccd6f400b5a00db6f7e861363e388f"
+  integrity sha512-oeyj2H3EjjonWcFjD5NvZNE9Rqe4UW+nQBU2HNeKw0koVLEFIhtyETyAakeAM3de7Z/SW5kcA+fZUait9EApnw==
+  dependencies:
+    nan "^2.12.1"
+    node-pre-gyp "^0.12.0"
+
+function-bind@^1.1.1:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/function-bind/-/function-bind-1.1.1.tgz#a56899d3ea3c9bab874bb9773b7c5ede92f4895d"
+  integrity sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A==
+
+gauge@~2.7.3:
+  version "2.7.4"
+  resolved "https://registry.yarnpkg.com/gauge/-/gauge-2.7.4.tgz#2c03405c7538c39d7eb37b317022e325fb018bf7"
+  integrity sha1-LANAXHU4w51+s3sxcCLjJfsBi/c=
+  dependencies:
+    aproba "^1.0.3"
+    console-control-strings "^1.0.0"
+    has-unicode "^2.0.0"
+    object-assign "^4.1.0"
+    signal-exit "^3.0.0"
+    string-width "^1.0.1"
+    strip-ansi "^3.0.1"
+    wide-align "^1.1.0"
+
+generate-function@^2.0.0:
+  version "2.3.1"
+  resolved "https://registry.yarnpkg.com/generate-function/-/generate-function-2.3.1.tgz#f069617690c10c868e73b8465746764f97c3479f"
+  integrity sha512-eeB5GfMNeevm/GRYq20ShmsaGcmI81kIX2K9XQx5miC8KdHaC6Jm0qQ8ZNeGOi7wYB8OsdxKs+Y2oVuTFuVwKQ==
+  dependencies:
+    is-property "^1.0.2"
+
+generate-object-property@^1.1.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/generate-object-property/-/generate-object-property-1.2.0.tgz#9c0e1c40308ce804f4783618b937fa88f99d50d0"
+  integrity sha1-nA4cQDCM6AT0eDYYuTf6iPmdUNA=
+  dependencies:
+    is-property "^1.0.0"
+
+get-value@^2.0.3, get-value@^2.0.6:
+  version "2.0.6"
+  resolved "https://registry.yarnpkg.com/get-value/-/get-value-2.0.6.tgz#dc15ca1c672387ca76bd37ac0a395ba2042a2c28"
+  integrity sha1-3BXKHGcjh8p2vTesCjlbogQqLCg=
+
+glob-parent@^3.1.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-3.1.0.tgz#9e6af6299d8d3bd2bd40430832bd113df906c5ae"
+  integrity sha1-nmr2KZ2NO9K9QEMIMr0RPfkGxa4=
+  dependencies:
+    is-glob "^3.1.0"
+    path-dirname "^1.0.0"
+
+glob@7.1.1:
+  version "7.1.1"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.1.tgz#805211df04faaf1c63a3600306cdf5ade50b2ec8"
+  integrity sha1-gFIR3wT6rxxjo2ADBs31reULLsg=
+  dependencies:
+    fs.realpath "^1.0.0"
+    inflight "^1.0.4"
+    inherits "2"
+    minimatch "^3.0.2"
+    once "^1.3.0"
+    path-is-absolute "^1.0.0"
+
+glob@^7.0.0, glob@^7.0.3, glob@^7.1.3:
+  version "7.1.4"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.4.tgz#aa608a2f6c577ad357e1ae5a5c26d9a8d1969255"
+  integrity sha512-hkLPepehmnKk41pUGm3sYxoFs/umurYfYJCerbXEyFIWcAzvpipAgVkBqqT9RBKMGjnq6kMuyYwha6csxbiM1A==
+  dependencies:
+    fs.realpath "^1.0.0"
+    inflight "^1.0.4"
+    inherits "2"
+    minimatch "^3.0.4"
+    once "^1.3.0"
+    path-is-absolute "^1.0.0"
+
+globals@^11.1.0:
+  version "11.12.0"
+  resolved "https://registry.yarnpkg.com/globals/-/globals-11.12.0.tgz#ab8795338868a0babd8525758018c2a7eb95c42e"
+  integrity sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==
+
+globals@^9.2.0:
+  version "9.18.0"
+  resolved "https://registry.yarnpkg.com/globals/-/globals-9.18.0.tgz#aa3896b3e69b487f17e31ed2143d69a8e30c2d8a"
+  integrity sha512-S0nG3CLEQiY/ILxqtztTWH/3iRRdyBLw6KMDxnKMchrtbj2OFmehVh0WUCfW3DUrIgx/qFrJPICrq4Z4sTR9UQ==
+
+graceful-fs@^4.1.11, graceful-fs@^4.1.2:
+  version "4.2.2"
+  resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-4.2.2.tgz#6f0952605d0140c1cfdb138ed005775b92d67b02"
+  integrity sha512-IItsdsea19BoLC7ELy13q1iJFNmd7ofZH5+X/pJr90/nRoPEX0DJo1dHDbgtYWOhJhcCgMDTOw84RZ72q6lB+Q==
+
+"graceful-readlink@>= 1.0.0":
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/graceful-readlink/-/graceful-readlink-1.0.1.tgz#4cafad76bc62f02fa039b2f94e9a3dd3a391a725"
+  integrity sha1-TK+tdrxi8C+gObL5Tpo906ORpyU=
+
+growl@1.9.2:
+  version "1.9.2"
+  resolved "https://registry.yarnpkg.com/growl/-/growl-1.9.2.tgz#0ea7743715db8d8de2c5ede1775e1b45ac85c02f"
+  integrity sha1-Dqd0NxXbjY3ixe3hd14bRayFwC8=
+
+has-ansi@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/has-ansi/-/has-ansi-2.0.0.tgz#34f5049ce1ecdf2b0649af3ef24e45ed35416d91"
+  integrity sha1-NPUEnOHs3ysGSa8+8k5F7TVBbZE=
+  dependencies:
+    ansi-regex "^2.0.0"
+
+has-flag@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-1.0.0.tgz#9d9e793165ce017a00f00418c43f942a7b1d11fa"
+  integrity sha1-nZ55MWXOAXoA8AQYxD+UKnsdEfo=
+
+has-flag@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-3.0.0.tgz#b5d454dc2199ae225699f3467e5a07f3b955bafd"
+  integrity sha1-tdRU3CGZriJWmfNGfloH87lVuv0=
+
+has-symbols@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/has-symbols/-/has-symbols-1.0.0.tgz#ba1a8f1af2a0fc39650f5c850367704122063b44"
+  integrity sha1-uhqPGvKg/DllD1yFA2dwQSIGO0Q=
+
+has-unicode@^2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/has-unicode/-/has-unicode-2.0.1.tgz#e0e6fe6a28cf51138855e086d1691e771de2a8b9"
+  integrity sha1-4Ob+aijPUROIVeCG0Wkedx3iqLk=
+
+has-value@^0.3.1:
+  version "0.3.1"
+  resolved "https://registry.yarnpkg.com/has-value/-/has-value-0.3.1.tgz#7b1f58bada62ca827ec0a2078025654845995e1f"
+  integrity sha1-ex9YutpiyoJ+wKIHgCVlSEWZXh8=
+  dependencies:
+    get-value "^2.0.3"
+    has-values "^0.1.4"
+    isobject "^2.0.0"
+
+has-value@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/has-value/-/has-value-1.0.0.tgz#18b281da585b1c5c51def24c930ed29a0be6b177"
+  integrity sha1-GLKB2lhbHFxR3vJMkw7SmgvmsXc=
+  dependencies:
+    get-value "^2.0.6"
+    has-values "^1.0.0"
+    isobject "^3.0.0"
+
+has-values@^0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/has-values/-/has-values-0.1.4.tgz#6d61de95d91dfca9b9a02089ad384bff8f62b771"
+  integrity sha1-bWHeldkd/Km5oCCJrThL/49it3E=
+
+has-values@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/has-values/-/has-values-1.0.0.tgz#95b0b63fec2146619a6fe57fe75628d5a39efe4f"
+  integrity sha1-lbC2P+whRmGab+V/51Yo1aOe/k8=
+  dependencies:
+    is-number "^3.0.0"
+    kind-of "^4.0.0"
+
+he@1.1.1:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/he/-/he-1.1.1.tgz#93410fd21b009735151f8868c2f271f3427e23fd"
+  integrity sha1-k0EP0hsAlzUVH4howvJx80J+I/0=
+
+iconv-lite@^0.4.4:
+  version "0.4.24"
+  resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.24.tgz#2022b4b25fbddc21d2f524974a474aafe733908b"
+  integrity sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==
+  dependencies:
+    safer-buffer ">= 2.1.2 < 3"
+
+ignore-walk@^3.0.1:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/ignore-walk/-/ignore-walk-3.0.2.tgz#99d83a246c196ea5c93ef9315ad7b0819c35069b"
+  integrity sha512-EXyErtpHbn75ZTsOADsfx6J/FPo6/5cjev46PXrcTpd8z3BoRkXgYu9/JVqrI7tusjmwCZutGeRJeU0Wo1e4Cw==
+  dependencies:
+    minimatch "^3.0.4"
+
+ignore@^3.1.5:
+  version "3.3.10"
+  resolved "https://registry.yarnpkg.com/ignore/-/ignore-3.3.10.tgz#0a97fb876986e8081c631160f8f9f389157f0043"
+  integrity sha512-Pgs951kaMm5GXP7MOvxERINe3gsaVjUWFm+UZPSq9xYriQAksyhg0csnS0KXSNRD5NmNdapXEpjxG49+AKh/ug==
+
+imurmurhash@^0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea"
+  integrity sha1-khi5srkoojixPcT7a21XbyMUU+o=
+
+inflight@^1.0.4:
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/inflight/-/inflight-1.0.6.tgz#49bd6331d7d02d0c09bc910a1075ba8165b56df9"
+  integrity sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=
+  dependencies:
+    once "^1.3.0"
+    wrappy "1"
+
+inherits@2, inherits@^2.0.3, inherits@~2.0.3:
+  version "2.0.4"
+  resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.4.tgz#0fa2c64f932917c3433a0ded55363aae37416b7c"
+  integrity sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==
+
+ini@~1.3.0:
+  version "1.3.5"
+  resolved "https://registry.yarnpkg.com/ini/-/ini-1.3.5.tgz#eee25f56db1c9ec6085e0c22778083f596abf927"
+  integrity sha512-RZY5huIKCMRWDUqZlEi72f/lmXKMvuszcMBduliQ3nnWbx9X/ZBQO7DijMEYS9EhHBb2qacRUMtC7svLwe0lcw==
+
+inquirer@^0.12.0:
+  version "0.12.0"
+  resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-0.12.0.tgz#1ef2bfd63504df0bc75785fff8c2c41df12f077e"
+  integrity sha1-HvK/1jUE3wvHV4X/+MLEHfEvB34=
+  dependencies:
+    ansi-escapes "^1.1.0"
+    ansi-regex "^2.0.0"
+    chalk "^1.0.0"
+    cli-cursor "^1.0.1"
+    cli-width "^2.0.0"
+    figures "^1.3.5"
+    lodash "^4.3.0"
+    readline2 "^1.0.1"
+    run-async "^0.1.0"
+    rx-lite "^3.1.2"
+    string-width "^1.0.1"
+    strip-ansi "^3.0.0"
+    through "^2.3.6"
+
+interpret@^1.0.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/interpret/-/interpret-1.2.0.tgz#d5061a6224be58e8083985f5014d844359576296"
+  integrity sha512-mT34yGKMNceBQUoVn7iCDKDntA7SC6gycMAWzGx1z/CMCTV7b2AAtXlo3nRyHZ1FelRkQbQjprHSYGwzLtkVbw==
+
+invariant@^2.2.2:
+  version "2.2.4"
+  resolved "https://registry.yarnpkg.com/invariant/-/invariant-2.2.4.tgz#610f3c92c9359ce1db616e538008d23ff35158e6"
+  integrity sha512-phJfQVBuaJM5raOpJjSfkiD6BpbCE4Ns//LaXl6wGYtUBY83nWS6Rf9tXm2e8VaK60JEjYldbPif/A2B1C2gNA==
+  dependencies:
+    loose-envify "^1.0.0"
+
+is-accessor-descriptor@^0.1.6:
+  version "0.1.6"
+  resolved "https://registry.yarnpkg.com/is-accessor-descriptor/-/is-accessor-descriptor-0.1.6.tgz#a9e12cb3ae8d876727eeef3843f8a0897b5c98d6"
+  integrity sha1-qeEss66Nh2cn7u84Q/igiXtcmNY=
+  dependencies:
+    kind-of "^3.0.2"
+
+is-accessor-descriptor@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz#169c2f6d3df1f992618072365c9b0ea1f6878656"
+  integrity sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==
+  dependencies:
+    kind-of "^6.0.0"
+
+is-binary-path@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/is-binary-path/-/is-binary-path-1.0.1.tgz#75f16642b480f187a711c814161fd3a4a7655898"
+  integrity sha1-dfFmQrSA8YenEcgUFh/TpKdlWJg=
+  dependencies:
+    binary-extensions "^1.0.0"
+
+is-buffer@^1.1.5:
+  version "1.1.6"
+  resolved "https://registry.yarnpkg.com/is-buffer/-/is-buffer-1.1.6.tgz#efaa2ea9daa0d7ab2ea13a97b2b8ad51fefbe8be"
+  integrity sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w==
+
+is-data-descriptor@^0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/is-data-descriptor/-/is-data-descriptor-0.1.4.tgz#0b5ee648388e2c860282e793f1856fec3f301b56"
+  integrity sha1-C17mSDiOLIYCgueT8YVv7D8wG1Y=
+  dependencies:
+    kind-of "^3.0.2"
+
+is-data-descriptor@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz#d84876321d0e7add03990406abbbbd36ba9268c7"
+  integrity sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==
+  dependencies:
+    kind-of "^6.0.0"
+
+is-descriptor@^0.1.0:
+  version "0.1.6"
+  resolved "https://registry.yarnpkg.com/is-descriptor/-/is-descriptor-0.1.6.tgz#366d8240dde487ca51823b1ab9f07a10a78251ca"
+  integrity sha512-avDYr0SB3DwO9zsMov0gKCESFYqCnE4hq/4z3TdUlukEy5t9C0YRq7HLrsN52NAcqXKaepeCD0n+B0arnVG3Hg==
+  dependencies:
+    is-accessor-descriptor "^0.1.6"
+    is-data-descriptor "^0.1.4"
+    kind-of "^5.0.0"
+
+is-descriptor@^1.0.0, is-descriptor@^1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/is-descriptor/-/is-descriptor-1.0.2.tgz#3b159746a66604b04f8c81524ba365c5f14d86ec"
+  integrity sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==
+  dependencies:
+    is-accessor-descriptor "^1.0.0"
+    is-data-descriptor "^1.0.0"
+    kind-of "^6.0.2"
+
+is-extendable@^0.1.0, is-extendable@^0.1.1:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/is-extendable/-/is-extendable-0.1.1.tgz#62b110e289a471418e3ec36a617d472e301dfc89"
+  integrity sha1-YrEQ4omkcUGOPsNqYX1HLjAd/Ik=
+
+is-extendable@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/is-extendable/-/is-extendable-1.0.1.tgz#a7470f9e426733d81bd81e1155264e3a3507cab4"
+  integrity sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==
+  dependencies:
+    is-plain-object "^2.0.4"
+
+is-extglob@^2.1.0, is-extglob@^2.1.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2"
+  integrity sha1-qIwCU1eR8C7TfHahueqXc8gz+MI=
+
+is-fullwidth-code-point@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz#ef9e31386f031a7f0d643af82fde50c457ef00cb"
+  integrity sha1-754xOG8DGn8NZDr4L95QxFfvAMs=
+  dependencies:
+    number-is-nan "^1.0.0"
+
+is-fullwidth-code-point@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz#a3b30a5c4f199183167aaab93beefae3ddfb654f"
+  integrity sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=
+
+is-glob@^3.1.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-3.1.0.tgz#7ba5ae24217804ac70707b96922567486cc3e84a"
+  integrity sha1-e6WuJCF4BKxwcHuWkiVnSGzD6Eo=
+  dependencies:
+    is-extglob "^2.1.0"
+
+is-glob@^4.0.0:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.1.tgz#7567dbe9f2f5e2467bc77ab83c4a29482407a5dc"
+  integrity sha512-5G0tKtBTFImOqDnLB2hG6Bp2qcKEFduo4tZu9MT/H6NQv/ghhy30o55ufafxJ/LdH79LLs2Kfrn85TLKyA7BUg==
+  dependencies:
+    is-extglob "^2.1.1"
+
+is-my-ip-valid@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/is-my-ip-valid/-/is-my-ip-valid-1.0.0.tgz#7b351b8e8edd4d3995d4d066680e664d94696824"
+  integrity sha512-gmh/eWXROncUzRnIa1Ubrt5b8ep/MGSnfAUI3aRp+sqTCs1tv1Isl8d8F6JmkN3dXKc3ehZMrtiPN9eL03NuaQ==
+
+is-my-json-valid@^2.10.0:
+  version "2.20.0"
+  resolved "https://registry.yarnpkg.com/is-my-json-valid/-/is-my-json-valid-2.20.0.tgz#1345a6fca3e8daefc10d0fa77067f54cedafd59a"
+  integrity sha512-XTHBZSIIxNsIsZXg7XB5l8z/OBFosl1Wao4tXLpeC7eKU4Vm/kdop2azkPqULwnfGQjmeDIyey9g7afMMtdWAA==
+  dependencies:
+    generate-function "^2.0.0"
+    generate-object-property "^1.1.0"
+    is-my-ip-valid "^1.0.0"
+    jsonpointer "^4.0.0"
+    xtend "^4.0.0"
+
+is-number@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/is-number/-/is-number-3.0.0.tgz#24fd6201a4782cf50561c810276afc7d12d71195"
+  integrity sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=
+  dependencies:
+    kind-of "^3.0.2"
+
+is-plain-obj@^1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/is-plain-obj/-/is-plain-obj-1.1.0.tgz#71a50c8429dfca773c92a390a4a03b39fcd51d3e"
+  integrity sha1-caUMhCnfync8kqOQpKA7OfzVHT4=
+
+is-plain-object@^2.0.3, is-plain-object@^2.0.4:
+  version "2.0.4"
+  resolved "https://registry.yarnpkg.com/is-plain-object/-/is-plain-object-2.0.4.tgz#2c163b3fafb1b606d9d17928f05c2a1c38e07677"
+  integrity sha512-h5PpgXkWitc38BBMYawTYMWJHFZJVnBquFE57xFpjB8pJFiF6gZ+bU+WyI/yqXiFR5mdLsgYNaPe8uao6Uv9Og==
+  dependencies:
+    isobject "^3.0.1"
+
+is-property@^1.0.0, is-property@^1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/is-property/-/is-property-1.0.2.tgz#57fe1c4e48474edd65b09911f26b1cd4095dda84"
+  integrity sha1-V/4cTkhHTt1lsJkR8msc1Ald2oQ=
+
+is-resolvable@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/is-resolvable/-/is-resolvable-1.1.0.tgz#fb18f87ce1feb925169c9a407c19318a3206ed88"
+  integrity sha512-qgDYXFSR5WvEfuS5dMj6oTMEbrrSaM0CrFk2Yiq/gXnBvD9pMa2jGXxyhGLfvhZpuMZe18CJpFxAt3CRs42NMg==
+
+is-windows@^1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/is-windows/-/is-windows-1.0.2.tgz#d1850eb9791ecd18e6182ce12a30f396634bb19d"
+  integrity sha512-eXK1UInq2bPmjyX6e3VHIzMLobc4J94i4AWn+Hpq3OU5KkrRC96OAcR3PRJ/pGu6m8TRnBHP9dkXQVsT/COVIA==
+
+isarray@1.0.0, isarray@^1.0.0, isarray@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/isarray/-/isarray-1.0.0.tgz#bb935d48582cba168c06834957a54a3e07124f11"
+  integrity sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE=
+
+isobject@^2.0.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/isobject/-/isobject-2.1.0.tgz#f065561096a3f1da2ef46272f815c840d87e0c89"
+  integrity sha1-8GVWEJaj8dou9GJy+BXIQNh+DIk=
+  dependencies:
+    isarray "1.0.0"
+
+isobject@^3.0.0, isobject@^3.0.1:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/isobject/-/isobject-3.0.1.tgz#4e431e92b11a9731636aa1f9c8d1ccbcfdab78df"
+  integrity sha1-TkMekrEalzFjaqH5yNHMvP2reN8=
+
+js-levenshtein@^1.1.3:
+  version "1.1.6"
+  resolved "https://registry.yarnpkg.com/js-levenshtein/-/js-levenshtein-1.1.6.tgz#c6cee58eb3550372df8deb85fad5ce66ce01d59d"
+  integrity sha512-X2BB11YZtrRqY4EnQcLX5Rh373zbK4alC1FW7D7MBhL2gtcC17cTnr6DmfHZeS0s2rTHjUTMMHfG7gO8SSdw+g==
+
+"js-tokens@^3.0.0 || ^4.0.0", js-tokens@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/js-tokens/-/js-tokens-4.0.0.tgz#19203fb59991df98e3a287050d4647cdeaf32499"
+  integrity sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==
+
+js-tokens@^3.0.2:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/js-tokens/-/js-tokens-3.0.2.tgz#9866df395102130e38f7f996bceb65443209c25b"
+  integrity sha1-mGbfOVECEw449/mWvOtlRDIJwls=
+
+js-yaml@^3.5.1:
+  version "3.13.1"
+  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.13.1.tgz#aff151b30bfdfa8e49e05da22e7415e9dfa37847"
+  integrity sha512-YfbcO7jXDdyj0DGxYVSlSeQNHbD7XPWvrVWeVUujrQEoZzWJIRrCPoyk6kL6IAjAG2IolMK4T0hNUe0HOUs5Jw==
+  dependencies:
+    argparse "^1.0.7"
+    esprima "^4.0.0"
+
+jsesc@^2.5.1:
+  version "2.5.2"
+  resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-2.5.2.tgz#80564d2e483dacf6e8ef209650a67df3f0c283a4"
+  integrity sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==
+
+jsesc@~0.5.0:
+  version "0.5.0"
+  resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-0.5.0.tgz#e7dee66e35d6fc16f710fe91d5cf69f70f08911d"
+  integrity sha1-597mbjXW/Bb3EP6R1c9p9w8IkR0=
+
+json-stable-stringify@^1.0.0, json-stable-stringify@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/json-stable-stringify/-/json-stable-stringify-1.0.1.tgz#9a759d39c5f2ff503fd5300646ed445f88c4f9af"
+  integrity sha1-mnWdOcXy/1A/1TAGRu1EX4jE+a8=
+  dependencies:
+    jsonify "~0.0.0"
+
+json3@3.3.2:
+  version "3.3.2"
+  resolved "https://registry.yarnpkg.com/json3/-/json3-3.3.2.tgz#3c0434743df93e2f5c42aee7b19bcb483575f4e1"
+  integrity sha1-PAQ0dD35Pi9cQq7nsZvLSDV19OE=
+
+jsonify@~0.0.0:
+  version "0.0.0"
+  resolved "https://registry.yarnpkg.com/jsonify/-/jsonify-0.0.0.tgz#2c74b6ee41d93ca51b7b5aaee8f503631d252a73"
+  integrity sha1-LHS27kHZPKUbe1qu6PUDYx0lKnM=
+
+jsonpointer@^4.0.0:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/jsonpointer/-/jsonpointer-4.0.1.tgz#4fd92cb34e0e9db3c89c8622ecf51f9b978c6cb9"
+  integrity sha1-T9kss04OnbPInIYi7PUfm5eMbLk=
+
+kind-of@^3.0.2, kind-of@^3.0.3, kind-of@^3.2.0:
+  version "3.2.2"
+  resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-3.2.2.tgz#31ea21a734bab9bbb0f32466d893aea51e4a3c64"
+  integrity sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=
+  dependencies:
+    is-buffer "^1.1.5"
+
+kind-of@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-4.0.0.tgz#20813df3d712928b207378691a45066fae72dd57"
+  integrity sha1-IIE989cSkosgc3hpGkUGb65y3Vc=
+  dependencies:
+    is-buffer "^1.1.5"
+
+kind-of@^5.0.0:
+  version "5.1.0"
+  resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-5.1.0.tgz#729c91e2d857b7a419a1f9aa65685c4c33f5845d"
+  integrity sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw==
+
+kind-of@^6.0.0, kind-of@^6.0.2:
+  version "6.0.2"
+  resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-6.0.2.tgz#01146b36a6218e64e58f3a8d66de5d7fc6f6d051"
+  integrity sha512-s5kLOcnH0XqDO+FvuaLX8DDjZ18CGFk7VygH40QoKPUQhW4e2rvM0rwUq0t8IQDOwYSeLK01U90OjzBTme2QqA==
+
+levn@^0.3.0, levn@~0.3.0:
+  version "0.3.0"
+  resolved "https://registry.yarnpkg.com/levn/-/levn-0.3.0.tgz#3b09924edf9f083c0490fdd4c0bc4421e04764ee"
+  integrity sha1-OwmSTt+fCDwEkP3UwLxEIeBHZO4=
+  dependencies:
+    prelude-ls "~1.1.2"
+    type-check "~0.3.2"
+
+lodash._baseassign@^3.0.0:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/lodash._baseassign/-/lodash._baseassign-3.2.0.tgz#8c38a099500f215ad09e59f1722fd0c52bfe0a4e"
+  integrity sha1-jDigmVAPIVrQnlnxci/QxSv+Ck4=
+  dependencies:
+    lodash._basecopy "^3.0.0"
+    lodash.keys "^3.0.0"
+
+lodash._basecopy@^3.0.0:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/lodash._basecopy/-/lodash._basecopy-3.0.1.tgz#8da0e6a876cf344c0ad8a54882111dd3c5c7ca36"
+  integrity sha1-jaDmqHbPNEwK2KVIghEd08XHyjY=
+
+lodash._basecreate@^3.0.0:
+  version "3.0.3"
+  resolved "https://registry.yarnpkg.com/lodash._basecreate/-/lodash._basecreate-3.0.3.tgz#1bc661614daa7fc311b7d03bf16806a0213cf821"
+  integrity sha1-G8ZhYU2qf8MRt9A78WgGoCE8+CE=
+
+lodash._getnative@^3.0.0:
+  version "3.9.1"
+  resolved "https://registry.yarnpkg.com/lodash._getnative/-/lodash._getnative-3.9.1.tgz#570bc7dede46d61cdcde687d65d3eecbaa3aaff5"
+  integrity sha1-VwvH3t5G1hzc3mh9ZdPuy6o6r/U=
+
+lodash._isiterateecall@^3.0.0:
+  version "3.0.9"
+  resolved "https://registry.yarnpkg.com/lodash._isiterateecall/-/lodash._isiterateecall-3.0.9.tgz#5203ad7ba425fae842460e696db9cf3e6aac057c"
+  integrity sha1-UgOte6Ql+uhCRg5pbbnPPmqsBXw=
+
+lodash.create@3.1.1:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/lodash.create/-/lodash.create-3.1.1.tgz#d7f2849f0dbda7e04682bb8cd72ab022461debe7"
+  integrity sha1-1/KEnw29p+BGgruM1yqwIkYd6+c=
+  dependencies:
+    lodash._baseassign "^3.0.0"
+    lodash._basecreate "^3.0.0"
+    lodash._isiterateecall "^3.0.0"
+
+lodash.isarguments@^3.0.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/lodash.isarguments/-/lodash.isarguments-3.1.0.tgz#2f573d85c6a24289ff00663b491c1d338ff3458a"
+  integrity sha1-L1c9hcaiQon/AGY7SRwdM4/zRYo=
+
+lodash.isarray@^3.0.0:
+  version "3.0.4"
+  resolved "https://registry.yarnpkg.com/lodash.isarray/-/lodash.isarray-3.0.4.tgz#79e4eb88c36a8122af86f844aa9bcd851b5fbb55"
+  integrity sha1-eeTriMNqgSKvhvhEqpvNhRtfu1U=
+
+lodash.keys@^3.0.0:
+  version "3.1.2"
+  resolved "https://registry.yarnpkg.com/lodash.keys/-/lodash.keys-3.1.2.tgz#4dbc0472b156be50a0b286855d1bd0b0c656098a"
+  integrity sha1-TbwEcrFWvlCgsoaFXRvQsMZWCYo=
+  dependencies:
+    lodash._getnative "^3.0.0"
+    lodash.isarguments "^3.0.0"
+    lodash.isarray "^3.0.0"
+
+lodash@^4.0.0, lodash@^4.17.13, lodash@^4.3.0:
+  version "4.17.15"
+  resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.15.tgz#b447f6670a0455bbfeedd11392eff330ea097548"
+  integrity sha512-8xOcRHvCjnocdS5cpwXQXVzmmh5e5+saE2QGoeQmbKmRS6J3VQppPOIt0MnmE+4xlZoumy0GPG0D0MVIQbNA1A==
+
+loose-envify@^1.0.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/loose-envify/-/loose-envify-1.4.0.tgz#71ee51fa7be4caec1a63839f7e682d8132d30caf"
+  integrity sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==
+  dependencies:
+    js-tokens "^3.0.0 || ^4.0.0"
+
+map-cache@^0.2.2:
+  version "0.2.2"
+  resolved "https://registry.yarnpkg.com/map-cache/-/map-cache-0.2.2.tgz#c32abd0bd6525d9b051645bb4f26ac5dc98a0dbf"
+  integrity sha1-wyq9C9ZSXZsFFkW7TyasXcmKDb8=
+
+map-visit@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/map-visit/-/map-visit-1.0.0.tgz#ecdca8f13144e660f1b5bd41f12f3479d98dfb8f"
+  integrity sha1-7Nyo8TFE5mDxtb1B8S80edmN+48=
+  dependencies:
+    object-visit "^1.0.0"
+
+micromatch@^3.1.10, micromatch@^3.1.4:
+  version "3.1.10"
+  resolved "https://registry.yarnpkg.com/micromatch/-/micromatch-3.1.10.tgz#70859bc95c9840952f359a068a3fc49f9ecfac23"
+  integrity sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg==
+  dependencies:
+    arr-diff "^4.0.0"
+    array-unique "^0.3.2"
+    braces "^2.3.1"
+    define-property "^2.0.2"
+    extend-shallow "^3.0.2"
+    extglob "^2.0.4"
+    fragment-cache "^0.2.1"
+    kind-of "^6.0.2"
+    nanomatch "^1.2.9"
+    object.pick "^1.3.0"
+    regex-not "^1.0.0"
+    snapdragon "^0.8.1"
+    to-regex "^3.0.2"
+
+minimatch@^3.0.2, minimatch@^3.0.4:
+  version "3.0.4"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083"
+  integrity sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==
+  dependencies:
+    brace-expansion "^1.1.7"
+
+minimist@0.0.8:
+  version "0.0.8"
+  resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.8.tgz#857fcabfc3397d2625b8228262e86aa7a011b05d"
+  integrity sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0=
+
+minimist@^1.2.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/minimist/-/minimist-1.2.0.tgz#a35008b20f41383eec1fb914f4cd5df79a264284"
+  integrity sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=
+
+minipass@^2.6.0, minipass@^2.8.6:
+  version "2.8.6"
+  resolved "https://registry.yarnpkg.com/minipass/-/minipass-2.8.6.tgz#620d889ace26356391d010ecb9458749df9b6db5"
+  integrity sha512-lFG7d6g3+/UaFDCOtqPiKAC9zngWWsQZl1g5q6gaONqrjq61SX2xFqXMleQiFVyDpYwa018E9hmlAFY22PCb+A==
+  dependencies:
+    safe-buffer "^5.1.2"
+    yallist "^3.0.0"
+
+minipass@^2.9.0:
+  version "2.9.0"
+  resolved "https://registry.yarnpkg.com/minipass/-/minipass-2.9.0.tgz#e713762e7d3e32fed803115cf93e04bca9fcc9a6"
+  integrity sha512-wxfUjg9WebH+CUDX/CdbRlh5SmfZiy/hpkxaRI16Y9W56Pa75sWgd/rvFilSgrauD9NyFymP/+JFV3KwzIsJeg==
+  dependencies:
+    safe-buffer "^5.1.2"
+    yallist "^3.0.0"
+
+minizlib@^1.2.1:
+  version "1.3.2"
+  resolved "https://registry.yarnpkg.com/minizlib/-/minizlib-1.3.2.tgz#5d24764998f98112586f7e566bd4c0999769dad4"
+  integrity sha512-lsNFqSHdJ21EwKzCp12HHJGxSMtHkCW1EMA9cceG3MkMNARjuWotZnMe3NKNshAvFXpm4loZqmYsCmRwhS2JMw==
+  dependencies:
+    minipass "^2.9.0"
+
+mixin-deep@^1.2.0:
+  version "1.3.2"
+  resolved "https://registry.yarnpkg.com/mixin-deep/-/mixin-deep-1.3.2.tgz#1120b43dc359a785dce65b55b82e257ccf479566"
+  integrity sha512-WRoDn//mXBiJ1H40rqa3vH0toePwSsGb45iInWlTySa+Uu4k3tYUSxa2v1KqAiLtvlrSzaExqS1gtk96A9zvEA==
+  dependencies:
+    for-in "^1.0.2"
+    is-extendable "^1.0.1"
+
+mkdirp@0.5.1, mkdirp@^0.5.0, mkdirp@^0.5.1:
+  version "0.5.1"
+  resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.1.tgz#30057438eac6cf7f8c4767f38648d6697d75c903"
+  integrity sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=
+  dependencies:
+    minimist "0.0.8"
+
+mocha@^3.1.2:
+  version "3.5.3"
+  resolved "https://registry.yarnpkg.com/mocha/-/mocha-3.5.3.tgz#1e0480fe36d2da5858d1eb6acc38418b26eaa20d"
+  integrity sha512-/6na001MJWEtYxHOV1WLfsmR4YIynkUEhBwzsb+fk2qmQ3iqsi258l/Q2MWHJMImAcNpZ8DEdYAK72NHoIQ9Eg==
+  dependencies:
+    browser-stdout "1.3.0"
+    commander "2.9.0"
+    debug "2.6.8"
+    diff "3.2.0"
+    escape-string-regexp "1.0.5"
+    glob "7.1.1"
+    growl "1.9.2"
+    he "1.1.1"
+    json3 "3.3.2"
+    lodash.create "3.1.1"
+    mkdirp "0.5.1"
+    supports-color "3.1.2"
+
+ms@2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8"
+  integrity sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=
+
+ms@^2.1.1:
+  version "2.1.2"
+  resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.2.tgz#d09d1f357b443f493382a8eb3ccd183872ae6009"
+  integrity sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==
+
+mute-stream@0.0.5:
+  version "0.0.5"
+  resolved "https://registry.yarnpkg.com/mute-stream/-/mute-stream-0.0.5.tgz#8fbfabb0a98a253d3184331f9e8deb7372fac6c0"
+  integrity sha1-j7+rsKmKJT0xhDMfno3rc3L6xsA=
+
+nan@^2.12.1:
+  version "2.14.0"
+  resolved "https://registry.yarnpkg.com/nan/-/nan-2.14.0.tgz#7818f722027b2459a86f0295d434d1fc2336c52c"
+  integrity sha512-INOFj37C7k3AfaNTtX8RhsTw7qRy7eLET14cROi9+5HAVbbHuIWUHEauBv5qT4Av2tWasiTY1Jw6puUNqRJXQg==
+
+nanomatch@^1.2.9:
+  version "1.2.13"
+  resolved "https://registry.yarnpkg.com/nanomatch/-/nanomatch-1.2.13.tgz#b87a8aa4fc0de8fe6be88895b38983ff265bd119"
+  integrity sha512-fpoe2T0RbHwBTBUOftAfBPaDEi06ufaUai0mE6Yn1kacc3SnTErfb/h+X94VXzI64rKFHYImXSvdwGGCmwOqCA==
+  dependencies:
+    arr-diff "^4.0.0"
+    array-unique "^0.3.2"
+    define-property "^2.0.2"
+    extend-shallow "^3.0.2"
+    fragment-cache "^0.2.1"
+    is-windows "^1.0.2"
+    kind-of "^6.0.2"
+    object.pick "^1.3.0"
+    regex-not "^1.0.0"
+    snapdragon "^0.8.1"
+    to-regex "^3.0.1"
+
+natural-compare@^1.4.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/natural-compare/-/natural-compare-1.4.0.tgz#4abebfeed7541f2c27acfb29bdbbd15c8d5ba4f7"
+  integrity sha1-Sr6/7tdUHywnrPspvbvRXI1bpPc=
+
+needle@^2.2.1:
+  version "2.4.0"
+  resolved "https://registry.yarnpkg.com/needle/-/needle-2.4.0.tgz#6833e74975c444642590e15a750288c5f939b57c"
+  integrity sha512-4Hnwzr3mi5L97hMYeNl8wRW/Onhy4nUKR/lVemJ8gJedxxUyBLm9kkrDColJvoSfwi0jCNhD+xCdOtiGDQiRZg==
+  dependencies:
+    debug "^3.2.6"
+    iconv-lite "^0.4.4"
+    sax "^1.2.4"
+
+next-tick@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/next-tick/-/next-tick-1.0.0.tgz#ca86d1fe8828169b0120208e3dc8424b9db8342c"
+  integrity sha1-yobR/ogoFpsBICCOPchCS524NCw=
+
+node-pre-gyp@^0.12.0:
+  version "0.12.0"
+  resolved "https://registry.yarnpkg.com/node-pre-gyp/-/node-pre-gyp-0.12.0.tgz#39ba4bb1439da030295f899e3b520b7785766149"
+  integrity sha512-4KghwV8vH5k+g2ylT+sLTjy5wmUOb9vPhnM8NHvRf9dHmnW/CndrFXy2aRPaPST6dugXSdHXfeaHQm77PIz/1A==
+  dependencies:
+    detect-libc "^1.0.2"
+    mkdirp "^0.5.1"
+    needle "^2.2.1"
+    nopt "^4.0.1"
+    npm-packlist "^1.1.6"
+    npmlog "^4.0.2"
+    rc "^1.2.7"
+    rimraf "^2.6.1"
+    semver "^5.3.0"
+    tar "^4"
+
+node-releases@^1.1.29:
+  version "1.1.33"
+  resolved "https://registry.yarnpkg.com/node-releases/-/node-releases-1.1.33.tgz#349f10291234624574f44cf32b7de259bf028303"
+  integrity sha512-I0V30bWQEoHb+10W8oedVoUrdjW5wIkYm0w7vvcrPO95pZY738m1k77GF5sO0vKg5eXYg9oGtrMAETbgZGm11A==
+  dependencies:
+    semver "^5.3.0"
+
+nopt@^4.0.1:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/nopt/-/nopt-4.0.1.tgz#d0d4685afd5415193c8c7505602d0d17cd64474d"
+  integrity sha1-0NRoWv1UFRk8jHUFYC0NF81kR00=
+  dependencies:
+    abbrev "1"
+    osenv "^0.1.4"
+
+normalize-path@^2.1.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/normalize-path/-/normalize-path-2.1.1.tgz#1ab28b556e198363a8c1a6f7e6fa20137fe6aed9"
+  integrity sha1-GrKLVW4Zg2Oowab35vogE3/mrtk=
+  dependencies:
+    remove-trailing-separator "^1.0.1"
+
+normalize-path@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/normalize-path/-/normalize-path-3.0.0.tgz#0dcd69ff23a1c9b11fd0978316644a0388216a65"
+  integrity sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==
+
+npm-bundled@^1.0.1:
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/npm-bundled/-/npm-bundled-1.0.6.tgz#e7ba9aadcef962bb61248f91721cd932b3fe6bdd"
+  integrity sha512-8/JCaftHwbd//k6y2rEWp6k1wxVfpFzB6t1p825+cUb7Ym2XQfhwIC5KwhrvzZRJu+LtDE585zVaS32+CGtf0g==
+
+npm-packlist@^1.1.6:
+  version "1.4.4"
+  resolved "https://registry.yarnpkg.com/npm-packlist/-/npm-packlist-1.4.4.tgz#866224233850ac534b63d1a6e76050092b5d2f44"
+  integrity sha512-zTLo8UcVYtDU3gdeaFu2Xu0n0EvelfHDGuqtNIn5RO7yQj4H1TqNdBc/yZjxnWA0PVB8D3Woyp0i5B43JwQ6Vw==
+  dependencies:
+    ignore-walk "^3.0.1"
+    npm-bundled "^1.0.1"
+
+npmlog@^4.0.2:
+  version "4.1.2"
+  resolved "https://registry.yarnpkg.com/npmlog/-/npmlog-4.1.2.tgz#08a7f2a8bf734604779a9efa4ad5cc717abb954b"
+  integrity sha512-2uUqazuKlTaSI/dC8AzicUck7+IrEaOnN/e0jd3Xtt1KcGpwx30v50mL7oPyr/h9bL3E4aZccVwpwP+5W9Vjkg==
+  dependencies:
+    are-we-there-yet "~1.1.2"
+    console-control-strings "~1.1.0"
+    gauge "~2.7.3"
+    set-blocking "~2.0.0"
+
+number-is-nan@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/number-is-nan/-/number-is-nan-1.0.1.tgz#097b602b53422a522c1afb8790318336941a011d"
+  integrity sha1-CXtgK1NCKlIsGvuHkDGDNpQaAR0=
+
+object-assign@^4.0.1, object-assign@^4.1.0:
+  version "4.1.1"
+  resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.1.tgz#2109adc7965887cfc05cbbd442cac8bfbb360863"
+  integrity sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=
+
+object-copy@^0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/object-copy/-/object-copy-0.1.0.tgz#7e7d858b781bd7c991a41ba975ed3812754e998c"
+  integrity sha1-fn2Fi3gb18mRpBupde04EnVOmYw=
+  dependencies:
+    copy-descriptor "^0.1.0"
+    define-property "^0.2.5"
+    kind-of "^3.0.3"
+
+object-keys@^1.0.11, object-keys@^1.0.12:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/object-keys/-/object-keys-1.1.1.tgz#1c47f272df277f3b1daf061677d9c82e2322c60e"
+  integrity sha512-NuAESUOUMrlIXOfHKzD6bpPu3tYt3xvjNdRIQ+FeT0lNb4K8WR70CaDxhuNguS2XG+GjkyMwOzsN5ZktImfhLA==
+
+object-visit@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/object-visit/-/object-visit-1.0.1.tgz#f79c4493af0c5377b59fe39d395e41042dd045bb"
+  integrity sha1-95xEk68MU3e1n+OdOV5BBC3QRbs=
+  dependencies:
+    isobject "^3.0.0"
+
+object.assign@^4.1.0:
+  version "4.1.0"
+  resolved "https://registry.yarnpkg.com/object.assign/-/object.assign-4.1.0.tgz#968bf1100d7956bb3ca086f006f846b3bc4008da"
+  integrity sha512-exHJeq6kBKj58mqGyTQ9DFvrZC/eR6OwxzoM9YRoGBqrXYonaFyGiFMuc9VZrXf7DarreEwMpurG3dd+CNyW5w==
+  dependencies:
+    define-properties "^1.1.2"
+    function-bind "^1.1.1"
+    has-symbols "^1.0.0"
+    object-keys "^1.0.11"
+
+object.pick@^1.3.0:
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/object.pick/-/object.pick-1.3.0.tgz#87a10ac4c1694bd2e1cbf53591a66141fb5dd747"
+  integrity sha1-h6EKxMFpS9Lhy/U1kaZhQftd10c=
+  dependencies:
+    isobject "^3.0.1"
+
+once@^1.3.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1"
+  integrity sha1-WDsap3WWHUsROsF9nFC6753Xa9E=
+  dependencies:
+    wrappy "1"
+
+onetime@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/onetime/-/onetime-1.1.0.tgz#a1f7838f8314c516f05ecefcbc4ccfe04b4ed789"
+  integrity sha1-ofeDj4MUxRbwXs78vEzP4EtO14k=
+
+optionator@^0.8.2:
+  version "0.8.2"
+  resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.8.2.tgz#364c5e409d3f4d6301d6c0b4c05bba50180aeb64"
+  integrity sha1-NkxeQJ0/TWMB1sC0wFu6UBgK62Q=
+  dependencies:
+    deep-is "~0.1.3"
+    fast-levenshtein "~2.0.4"
+    levn "~0.3.0"
+    prelude-ls "~1.1.2"
+    type-check "~0.3.2"
+    wordwrap "~1.0.0"
+
+os-homedir@^1.0.0:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/os-homedir/-/os-homedir-1.0.2.tgz#ffbc4988336e0e833de0c168c7ef152121aa7fb3"
+  integrity sha1-/7xJiDNuDoM94MFox+8VISGqf7M=
+
+os-tmpdir@^1.0.0:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/os-tmpdir/-/os-tmpdir-1.0.2.tgz#bbe67406c79aa85c5cfec766fe5734555dfa1274"
+  integrity sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=
+
+osenv@^0.1.4:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/osenv/-/osenv-0.1.5.tgz#85cdfafaeb28e8677f416e287592b5f3f49ea410"
+  integrity sha512-0CWcCECdMVc2Rw3U5w9ZjqX6ga6ubk1xDVKxtBQPK7wis/0F2r9T6k4ydGYhecl7YUBxBVxhL5oisPsNxAPe2g==
+  dependencies:
+    os-homedir "^1.0.0"
+    os-tmpdir "^1.0.0"
+
+output-file-sync@^2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/output-file-sync/-/output-file-sync-2.0.1.tgz#f53118282f5f553c2799541792b723a4c71430c0"
+  integrity sha512-mDho4qm7WgIXIGf4eYU1RHN2UU5tPfVYVSRwDJw0uTmj35DQUt/eNp19N7v6T3SrR0ESTEf2up2CGO73qI35zQ==
+  dependencies:
+    graceful-fs "^4.1.11"
+    is-plain-obj "^1.1.0"
+    mkdirp "^0.5.1"
+
+pascalcase@^0.1.1:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/pascalcase/-/pascalcase-0.1.1.tgz#b363e55e8006ca6fe21784d2db22bd15d7917f14"
+  integrity sha1-s2PlXoAGym/iF4TS2yK9FdeRfxQ=
+
+path-dirname@^1.0.0:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/path-dirname/-/path-dirname-1.0.2.tgz#cc33d24d525e099a5388c0336c6e32b9160609e0"
+  integrity sha1-zDPSTVJeCZpTiMAzbG4yuRYGCeA=
+
+path-is-absolute@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f"
+  integrity sha1-F0uSaHNVNP+8es5r9TpanhtcX18=
+
+path-is-inside@^1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/path-is-inside/-/path-is-inside-1.0.2.tgz#365417dede44430d1c11af61027facf074bdfc53"
+  integrity sha1-NlQX3t5EQw0cEa9hAn+s8HS9/FM=
+
+path-parse@^1.0.6:
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/path-parse/-/path-parse-1.0.6.tgz#d62dbb5679405d72c4737ec58600e9ddcf06d24c"
+  integrity sha512-GSmOT2EbHrINBf9SR7CDELwlJ8AENk3Qn7OikK4nFYAu3Ote2+JYNVvkpAEQm3/TLNEJFD/xZJjzyxg3KBWOzw==
+
+pluralize@^1.2.1:
+  version "1.2.1"
+  resolved "https://registry.yarnpkg.com/pluralize/-/pluralize-1.2.1.tgz#d1a21483fd22bb41e58a12fa3421823140897c45"
+  integrity sha1-0aIUg/0iu0HlihL6NCGCMUCJfEU=
+
+posix-character-classes@^0.1.0:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/posix-character-classes/-/posix-character-classes-0.1.1.tgz#01eac0fe3b5af71a2a6c02feabb8c1fef7e00eab"
+  integrity sha1-AerA/jta9xoqbAL+q7jB/vfgDqs=
+
+prelude-ls@~1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/prelude-ls/-/prelude-ls-1.1.2.tgz#21932a549f5e52ffd9a827f570e04be62a97da54"
+  integrity sha1-IZMqVJ9eUv/ZqCf1cOBL5iqX2lQ=
+
+private@^0.1.6:
+  version "0.1.8"
+  resolved "https://registry.yarnpkg.com/private/-/private-0.1.8.tgz#2381edb3689f7a53d653190060fcf822d2f368ff"
+  integrity sha512-VvivMrbvd2nKkiG38qjULzlc+4Vx4wm/whI9pQD35YrARNnhxeiRktSOhSukRLFNlzg6Br/cJPet5J/u19r/mg==
+
+process-nextick-args@~2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/process-nextick-args/-/process-nextick-args-2.0.1.tgz#7820d9b16120cc55ca9ae7792680ae7dba6d7fe2"
+  integrity sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag==
+
+progress@^1.1.8:
+  version "1.1.8"
+  resolved "https://registry.yarnpkg.com/progress/-/progress-1.1.8.tgz#e260c78f6161cdd9b0e56cc3e0a85de17c7a57be"
+  integrity sha1-4mDHj2Fhzdmw5WzD4Khd4Xx6V74=
+
+rc@^1.2.7:
+  version "1.2.8"
+  resolved "https://registry.yarnpkg.com/rc/-/rc-1.2.8.tgz#cd924bf5200a075b83c188cd6b9e211b7fc0d3ed"
+  integrity sha512-y3bGgqKj3QBdxLbLkomlohkvsA8gdAiUQlSBJnBhfn+BPxg4bc62d8TcBW15wavDfgexCgccckhcZvywyQYPOw==
+  dependencies:
+    deep-extend "^0.6.0"
+    ini "~1.3.0"
+    minimist "^1.2.0"
+    strip-json-comments "~2.0.1"
+
+readable-stream@^2.0.2, readable-stream@^2.0.6, readable-stream@^2.2.2:
+  version "2.3.6"
+  resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-2.3.6.tgz#b11c27d88b8ff1fbe070643cf94b0c79ae1b0aaf"
+  integrity sha512-tQtKA9WIAhBF3+VLAseyMqZeBjW0AHJoxOtYqSUZNJxauErmLbVm2FW1y+J/YA9dUrAC39ITejlZWhVIwawkKw==
+  dependencies:
+    core-util-is "~1.0.0"
+    inherits "~2.0.3"
+    isarray "~1.0.0"
+    process-nextick-args "~2.0.0"
+    safe-buffer "~5.1.1"
+    string_decoder "~1.1.1"
+    util-deprecate "~1.0.1"
+
+readdirp@^2.2.1:
+  version "2.2.1"
+  resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-2.2.1.tgz#0e87622a3325aa33e892285caf8b4e846529a525"
+  integrity sha512-1JU/8q+VgFZyxwrJ+SVIOsh+KywWGpds3NTqikiKpDMZWScmAYyKIgqkO+ARvNWJfXeXR1zxz7aHF4u4CyH6vQ==
+  dependencies:
+    graceful-fs "^4.1.11"
+    micromatch "^3.1.10"
+    readable-stream "^2.0.2"
+
+readline2@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/readline2/-/readline2-1.0.1.tgz#41059608ffc154757b715d9989d199ffbf372e35"
+  integrity sha1-QQWWCP/BVHV7cV2ZidGZ/783LjU=
+  dependencies:
+    code-point-at "^1.0.0"
+    is-fullwidth-code-point "^1.0.0"
+    mute-stream "0.0.5"
+
+rechoir@^0.6.2:
+  version "0.6.2"
+  resolved "https://registry.yarnpkg.com/rechoir/-/rechoir-0.6.2.tgz#85204b54dba82d5742e28c96756ef43af50e3384"
+  integrity sha1-hSBLVNuoLVdC4oyWdW70OvUOM4Q=
+  dependencies:
+    resolve "^1.1.6"
+
+regenerate-unicode-properties@^8.1.0:
+  version "8.1.0"
+  resolved "https://registry.yarnpkg.com/regenerate-unicode-properties/-/regenerate-unicode-properties-8.1.0.tgz#ef51e0f0ea4ad424b77bf7cb41f3e015c70a3f0e"
+  integrity sha512-LGZzkgtLY79GeXLm8Dp0BVLdQlWICzBnJz/ipWUgo59qBaZ+BHtq51P2q1uVZlppMuUAT37SDk39qUbjTWB7bA==
+  dependencies:
+    regenerate "^1.4.0"
+
+regenerate@^1.4.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/regenerate/-/regenerate-1.4.0.tgz#4a856ec4b56e4077c557589cae85e7a4c8869a11"
+  integrity sha512-1G6jJVDWrt0rK99kBjvEtziZNCICAuvIPkSiUFIQxVP06RCVpq3dmDo2oi6ABpYaDYaTRr67BEhL8r1wgEZZKg==
+
+regenerator-transform@^0.14.0:
+  version "0.14.1"
+  resolved "https://registry.yarnpkg.com/regenerator-transform/-/regenerator-transform-0.14.1.tgz#3b2fce4e1ab7732c08f665dfdb314749c7ddd2fb"
+  integrity sha512-flVuee02C3FKRISbxhXl9mGzdbWUVHubl1SMaknjxkFB1/iqpJhArQUvRxOOPEc/9tAiX0BaQ28FJH10E4isSQ==
+  dependencies:
+    private "^0.1.6"
+
+regex-not@^1.0.0, regex-not@^1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/regex-not/-/regex-not-1.0.2.tgz#1f4ece27e00b0b65e0247a6810e6a85d83a5752c"
+  integrity sha512-J6SDjUgDxQj5NusnOtdFxDwN/+HWykR8GELwctJ7mdqhcyy1xEc4SRFHUXvxTp661YaVKAjfRLZ9cCqS6tn32A==
+  dependencies:
+    extend-shallow "^3.0.2"
+    safe-regex "^1.1.0"
+
+regexpu-core@^4.6.0:
+  version "4.6.0"
+  resolved "https://registry.yarnpkg.com/regexpu-core/-/regexpu-core-4.6.0.tgz#2037c18b327cfce8a6fea2a4ec441f2432afb8b6"
+  integrity sha512-YlVaefl8P5BnFYOITTNzDvan1ulLOiXJzCNZxduTIosN17b87h3bvG9yHMoHaRuo88H4mQ06Aodj5VtYGGGiTg==
+  dependencies:
+    regenerate "^1.4.0"
+    regenerate-unicode-properties "^8.1.0"
+    regjsgen "^0.5.0"
+    regjsparser "^0.6.0"
+    unicode-match-property-ecmascript "^1.0.4"
+    unicode-match-property-value-ecmascript "^1.1.0"
+
+regjsgen@^0.5.0:
+  version "0.5.0"
+  resolved "https://registry.yarnpkg.com/regjsgen/-/regjsgen-0.5.0.tgz#a7634dc08f89209c2049adda3525711fb97265dd"
+  integrity sha512-RnIrLhrXCX5ow/E5/Mh2O4e/oa1/jW0eaBKTSy3LaCj+M3Bqvm97GWDp2yUtzIs4LEn65zR2yiYGFqb2ApnzDA==
+
+regjsparser@^0.6.0:
+  version "0.6.0"
+  resolved "https://registry.yarnpkg.com/regjsparser/-/regjsparser-0.6.0.tgz#f1e6ae8b7da2bae96c99399b868cd6c933a2ba9c"
+  integrity sha512-RQ7YyokLiQBomUJuUG8iGVvkgOLxwyZM8k6d3q5SAXpg4r5TZJZigKFvC6PpD+qQ98bCDC5YelPeA3EucDoNeQ==
+  dependencies:
+    jsesc "~0.5.0"
+
+remove-trailing-separator@^1.0.1:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/remove-trailing-separator/-/remove-trailing-separator-1.1.0.tgz#c24bce2a283adad5bc3f58e0d48249b92379d8ef"
+  integrity sha1-wkvOKig62tW8P1jg1IJJuSN52O8=
+
+repeat-element@^1.1.2:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/repeat-element/-/repeat-element-1.1.3.tgz#782e0d825c0c5a3bb39731f84efee6b742e6b1ce"
+  integrity sha512-ahGq0ZnV5m5XtZLMb+vP76kcAM5nkLqk0lpqAuojSKGgQtn4eRi4ZZGm2olo2zKFH+sMsWaqOCW1dqAnOru72g==
+
+repeat-string@^1.6.1:
+  version "1.6.1"
+  resolved "https://registry.yarnpkg.com/repeat-string/-/repeat-string-1.6.1.tgz#8dcae470e1c88abc2d600fff4a776286da75e637"
+  integrity sha1-jcrkcOHIirwtYA//Sndihtp15jc=
+
+require-uncached@^1.0.2:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/require-uncached/-/require-uncached-1.0.3.tgz#4e0d56d6c9662fd31e43011c4b95aa49955421d3"
+  integrity sha1-Tg1W1slmL9MeQwEcS5WqSZVUIdM=
+  dependencies:
+    caller-path "^0.1.0"
+    resolve-from "^1.0.0"
+
+resolve-from@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-1.0.1.tgz#26cbfe935d1aeeeabb29bc3fe5aeb01e93d44226"
+  integrity sha1-Jsv+k10a7uq7Kbw/5a6wHpPUQiY=
+
+resolve-url@^0.2.1:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/resolve-url/-/resolve-url-0.2.1.tgz#2c637fe77c893afd2a663fe21aa9080068e2052a"
+  integrity sha1-LGN/53yJOv0qZj/iGqkIAGjiBSo=
+
+resolve@^1.1.6, resolve@^1.12.0:
+  version "1.12.0"
+  resolved "https://registry.yarnpkg.com/resolve/-/resolve-1.12.0.tgz#3fc644a35c84a48554609ff26ec52b66fa577df6"
+  integrity sha512-B/dOmuoAik5bKcD6s6nXDCjzUKnaDvdkRyAk6rsmsKLipWj4797iothd7jmmUhWTfinVMU+wc56rYKsit2Qy4w==
+  dependencies:
+    path-parse "^1.0.6"
+
+restore-cursor@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/restore-cursor/-/restore-cursor-1.0.1.tgz#34661f46886327fed2991479152252df92daa541"
+  integrity sha1-NGYfRohjJ/7SmRR5FSJS35LapUE=
+  dependencies:
+    exit-hook "^1.0.0"
+    onetime "^1.0.0"
+
+ret@~0.1.10:
+  version "0.1.15"
+  resolved "https://registry.yarnpkg.com/ret/-/ret-0.1.15.tgz#b8a4825d5bdb1fc3f6f53c2bc33f81388681c7bc"
+  integrity sha512-TTlYpa+OL+vMMNG24xSlQGEJ3B/RzEfUlLct7b5G/ytav+wPrplCpVMFuwzXbkecJrb6IYo1iFb0S9v37754mg==
+
+rimraf@^2.6.1:
+  version "2.7.1"
+  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.7.1.tgz#35797f13a7fdadc566142c29d4f07ccad483e3ec"
+  integrity sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==
+  dependencies:
+    glob "^7.1.3"
+
+rimraf@~2.6.2:
+  version "2.6.3"
+  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.6.3.tgz#b2d104fe0d8fb27cf9e0a1cda8262dd3833c6cab"
+  integrity sha512-mwqeW5XsA2qAejG46gYdENaxXjx9onRNCfn7L0duuP4hCuTIi/QO7PDK07KJfp1d+izWPrzEJDcSqBa0OZQriA==
+  dependencies:
+    glob "^7.1.3"
+
+run-async@^0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/run-async/-/run-async-0.1.0.tgz#c8ad4a5e110661e402a7d21b530e009f25f8e389"
+  integrity sha1-yK1KXhEGYeQCp9IbUw4AnyX444k=
+  dependencies:
+    once "^1.3.0"
+
+rx-lite@^3.1.2:
+  version "3.1.2"
+  resolved "https://registry.yarnpkg.com/rx-lite/-/rx-lite-3.1.2.tgz#19ce502ca572665f3b647b10939f97fd1615f102"
+  integrity sha1-Gc5QLKVyZl87ZHsQk5+X/RYV8QI=
+
+safe-buffer@^5.1.2:
+  version "5.2.0"
+  resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.2.0.tgz#b74daec49b1148f88c64b68d49b1e815c1f2f519"
+  integrity sha512-fZEwUGbVl7kouZs1jCdMLdt95hdIv0ZeHg6L7qPeciMZhZ+/gdesW4wgTARkrFWEpspjEATAzUGPG8N2jJiwbg==
+
+safe-buffer@~5.1.0, safe-buffer@~5.1.1:
+  version "5.1.2"
+  resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.1.2.tgz#991ec69d296e0313747d59bdfd2b745c35f8828d"
+  integrity sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==
+
+safe-regex@^1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/safe-regex/-/safe-regex-1.1.0.tgz#40a3669f3b077d1e943d44629e157dd48023bf2e"
+  integrity sha1-QKNmnzsHfR6UPURinhV91IAjvy4=
+  dependencies:
+    ret "~0.1.10"
+
+"safer-buffer@>= 2.1.2 < 3":
+  version "2.1.2"
+  resolved "https://registry.yarnpkg.com/safer-buffer/-/safer-buffer-2.1.2.tgz#44fa161b0187b9549dd84bb91802f9bd8385cd6a"
+  integrity sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==
+
+sax@^1.2.4:
+  version "1.2.4"
+  resolved "https://registry.yarnpkg.com/sax/-/sax-1.2.4.tgz#2816234e2378bddc4e5354fab5caa895df7100d9"
+  integrity sha512-NqVDv9TpANUjFm0N8uM5GxL36UgKi9/atZw+x7YFnQ8ckwFGKrl4xX4yWtrey3UJm5nP1kUbnYgLopqWNSRhWw==
+
+semver@^5.3.0, semver@^5.5.0:
+  version "5.7.1"
+  resolved "https://registry.yarnpkg.com/semver/-/semver-5.7.1.tgz#a954f931aeba508d307bbf069eff0c01c96116f7"
+  integrity sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==
+
+semver@^6.3.0:
+  version "6.3.0"
+  resolved "https://registry.yarnpkg.com/semver/-/semver-6.3.0.tgz#ee0a64c8af5e8ceea67687b133761e1becbd1d3d"
+  integrity sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==
+
+set-blocking@~2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/set-blocking/-/set-blocking-2.0.0.tgz#045f9782d011ae9a6803ddd382b24392b3d890f7"
+  integrity sha1-BF+XgtARrppoA93TgrJDkrPYkPc=
+
+set-value@^2.0.0, set-value@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/set-value/-/set-value-2.0.1.tgz#a18d40530e6f07de4228c7defe4227af8cad005b"
+  integrity sha512-JxHc1weCN68wRY0fhCoXpyK55m/XPHafOmK4UWD7m2CI14GMcFypt4w/0+NV5f/ZMby2F6S2wwA7fgynh9gWSw==
+  dependencies:
+    extend-shallow "^2.0.1"
+    is-extendable "^0.1.1"
+    is-plain-object "^2.0.3"
+    split-string "^3.0.1"
+
+shelljs@^0.7.5:
+  version "0.7.8"
+  resolved "https://registry.yarnpkg.com/shelljs/-/shelljs-0.7.8.tgz#decbcf874b0d1e5fb72e14b164a9683048e9acb3"
+  integrity sha1-3svPh0sNHl+3LhSxZKloMEjprLM=
+  dependencies:
+    glob "^7.0.0"
+    interpret "^1.0.0"
+    rechoir "^0.6.2"
+
+signal-exit@^3.0.0:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/signal-exit/-/signal-exit-3.0.2.tgz#b5fdc08f1287ea1178628e415e25132b73646c6d"
+  integrity sha1-tf3AjxKH6hF4Yo5BXiUTK3NkbG0=
+
+slash@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/slash/-/slash-2.0.0.tgz#de552851a1759df3a8f206535442f5ec4ddeab44"
+  integrity sha512-ZYKh3Wh2z1PpEXWr0MpSBZ0V6mZHAQfYevttO11c51CaWjGTaadiKZ+wVt1PbMlDV5qhMFslpZCemhwOK7C89A==
+
+slice-ansi@0.0.4:
+  version "0.0.4"
+  resolved "https://registry.yarnpkg.com/slice-ansi/-/slice-ansi-0.0.4.tgz#edbf8903f66f7ce2f8eafd6ceed65e264c831b35"
+  integrity sha1-7b+JA/ZvfOL46v1s7tZeJkyDGzU=
+
+snapdragon-node@^2.0.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/snapdragon-node/-/snapdragon-node-2.1.1.tgz#6c175f86ff14bdb0724563e8f3c1b021a286853b"
+  integrity sha512-O27l4xaMYt/RSQ5TR3vpWCAB5Kb/czIcqUFOM/C4fYcLnbZUc1PkjTAMjof2pBWaSTwOUd6qUHcFGVGj7aIwnw==
+  dependencies:
+    define-property "^1.0.0"
+    isobject "^3.0.0"
+    snapdragon-util "^3.0.1"
+
+snapdragon-util@^3.0.1:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/snapdragon-util/-/snapdragon-util-3.0.1.tgz#f956479486f2acd79700693f6f7b805e45ab56e2"
+  integrity sha512-mbKkMdQKsjX4BAL4bRYTj21edOf8cN7XHdYUJEe+Zn99hVEYcMvKPct1IqNe7+AZPirn8BCDOQBHQZknqmKlZQ==
+  dependencies:
+    kind-of "^3.2.0"
+
+snapdragon@^0.8.1:
+  version "0.8.2"
+  resolved "https://registry.yarnpkg.com/snapdragon/-/snapdragon-0.8.2.tgz#64922e7c565b0e14204ba1aa7d6964278d25182d"
+  integrity sha512-FtyOnWN/wCHTVXOMwvSv26d+ko5vWlIDD6zoUJ7LW8vh+ZBC8QdljveRP+crNrtBwioEUWy/4dMtbBjA4ioNlg==
+  dependencies:
+    base "^0.11.1"
+    debug "^2.2.0"
+    define-property "^0.2.5"
+    extend-shallow "^2.0.1"
+    map-cache "^0.2.2"
+    source-map "^0.5.6"
+    source-map-resolve "^0.5.0"
+    use "^3.1.0"
+
+source-map-resolve@^0.5.0:
+  version "0.5.2"
+  resolved "https://registry.yarnpkg.com/source-map-resolve/-/source-map-resolve-0.5.2.tgz#72e2cc34095543e43b2c62b2c4c10d4a9054f259"
+  integrity sha512-MjqsvNwyz1s0k81Goz/9vRBe9SZdB09Bdw+/zYyO+3CuPk6fouTaxscHkgtE8jKvf01kVfl8riHzERQ/kefaSA==
+  dependencies:
+    atob "^2.1.1"
+    decode-uri-component "^0.2.0"
+    resolve-url "^0.2.1"
+    source-map-url "^0.4.0"
+    urix "^0.1.0"
+
+source-map-url@^0.4.0:
+  version "0.4.0"
+  resolved "https://registry.yarnpkg.com/source-map-url/-/source-map-url-0.4.0.tgz#3e935d7ddd73631b97659956d55128e87b5084a3"
+  integrity sha1-PpNdfd1zYxuXZZlW1VEo6HtQhKM=
+
+source-map@^0.5.0, source-map@^0.5.6:
+  version "0.5.7"
+  resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.5.7.tgz#8a039d2d1021d22d1ea14c80d8ea468ba2ef3fcc"
+  integrity sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w=
+
+split-string@^3.0.1, split-string@^3.0.2:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/split-string/-/split-string-3.1.0.tgz#7cb09dda3a86585705c64b39a6466038682e8fe2"
+  integrity sha512-NzNVhJDYpwceVVii8/Hu6DKfD2G+NrQHlS/V/qgv763EYudVwEcMQNxd2lh+0VrUByXN/oJkl5grOhYWvQUYiw==
+  dependencies:
+    extend-shallow "^3.0.0"
+
+sprintf-js@~1.0.2:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/sprintf-js/-/sprintf-js-1.0.3.tgz#04e6926f662895354f3dd015203633b857297e2c"
+  integrity sha1-BOaSb2YolTVPPdAVIDYzuFcpfiw=
+
+static-extend@^0.1.1:
+  version "0.1.2"
+  resolved "https://registry.yarnpkg.com/static-extend/-/static-extend-0.1.2.tgz#60809c39cbff55337226fd5e0b520f341f1fb5c6"
+  integrity sha1-YICcOcv/VTNyJv1eC1IPNB8ftcY=
+  dependencies:
+    define-property "^0.2.5"
+    object-copy "^0.1.0"
+
+string-width@^1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/string-width/-/string-width-1.0.2.tgz#118bdf5b8cdc51a2a7e70d211e07e2b0b9b107d3"
+  integrity sha1-EYvfW4zcUaKn5w0hHgfisLmxB9M=
+  dependencies:
+    code-point-at "^1.0.0"
+    is-fullwidth-code-point "^1.0.0"
+    strip-ansi "^3.0.0"
+
+"string-width@^1.0.2 || 2", string-width@^2.0.0:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/string-width/-/string-width-2.1.1.tgz#ab93f27a8dc13d28cac815c462143a6d9012ae9e"
+  integrity sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==
+  dependencies:
+    is-fullwidth-code-point "^2.0.0"
+    strip-ansi "^4.0.0"
+
+string_decoder@~1.1.1:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.1.1.tgz#9cf1611ba62685d7030ae9e4ba34149c3af03fc8"
+  integrity sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==
+  dependencies:
+    safe-buffer "~5.1.0"
+
+strip-ansi@^3.0.0, strip-ansi@^3.0.1:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-3.0.1.tgz#6a385fb8853d952d5ff05d0e8aaf94278dc63dcf"
+  integrity sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=
+  dependencies:
+    ansi-regex "^2.0.0"
+
+strip-ansi@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-4.0.0.tgz#a8479022eb1ac368a871389b635262c505ee368f"
+  integrity sha1-qEeQIusaw2iocTibY1JixQXuNo8=
+  dependencies:
+    ansi-regex "^3.0.0"
+
+strip-bom@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/strip-bom/-/strip-bom-3.0.0.tgz#2334c18e9c759f7bdd56fdef7e9ae3d588e68ed3"
+  integrity sha1-IzTBjpx1n3vdVv3vfprj1YjmjtM=
+
+strip-json-comments@~1.0.1:
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-1.0.4.tgz#1e15fbcac97d3ee99bf2d73b4c656b082bbafb91"
+  integrity sha1-HhX7ysl9Pumb8tc7TGVrCCu6+5E=
+
+strip-json-comments@~2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-2.0.1.tgz#3c531942e908c2697c0ec344858c286c7ca0a60a"
+  integrity sha1-PFMZQukIwml8DsNEhYwobHygpgo=
+
+supports-color@3.1.2:
+  version "3.1.2"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-3.1.2.tgz#72a262894d9d408b956ca05ff37b2ed8a6e2a2d5"
+  integrity sha1-cqJiiU2dQIuVbKBf83su2KbiotU=
+  dependencies:
+    has-flag "^1.0.0"
+
+supports-color@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-2.0.0.tgz#535d045ce6b6363fa40117084629995e9df324c7"
+  integrity sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=
+
+supports-color@^5.3.0:
+  version "5.5.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.5.0.tgz#e2e69a44ac8772f78a1ec0b35b689df6530efc8f"
+  integrity sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==
+  dependencies:
+    has-flag "^3.0.0"
+
+table@^3.7.8:
+  version "3.8.3"
+  resolved "https://registry.yarnpkg.com/table/-/table-3.8.3.tgz#2bbc542f0fda9861a755d3947fefd8b3f513855f"
+  integrity sha1-K7xULw/amGGnVdOUf+/Ys/UThV8=
+  dependencies:
+    ajv "^4.7.0"
+    ajv-keywords "^1.0.0"
+    chalk "^1.1.1"
+    lodash "^4.0.0"
+    slice-ansi "0.0.4"
+    string-width "^2.0.0"
+
+tar@^4:
+  version "4.4.13"
+  resolved "https://registry.yarnpkg.com/tar/-/tar-4.4.13.tgz#43b364bc52888d555298637b10d60790254ab525"
+  integrity sha512-w2VwSrBoHa5BsSyH+KxEqeQBAllHhccyMFVHtGtdMpF4W7IRWfZjFiQceJPChOeTsSDVUpER2T8FA93pr0L+QA==
+  dependencies:
+    chownr "^1.1.1"
+    fs-minipass "^1.2.5"
+    minipass "^2.8.6"
+    minizlib "^1.2.1"
+    mkdirp "^0.5.0"
+    safe-buffer "^5.1.2"
+    yallist "^3.0.3"
+
+text-table@~0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/text-table/-/text-table-0.2.0.tgz#7f5ee823ae805207c00af2df4a84ec3fcfa570b4"
+  integrity sha1-f17oI66AUgfACvLfSoTsP8+lcLQ=
+
+through@^2.3.6:
+  version "2.3.8"
+  resolved "https://registry.yarnpkg.com/through/-/through-2.3.8.tgz#0dd4c9ffaabc357960b1b724115d7e0e86a2e1f5"
+  integrity sha1-DdTJ/6q8NXlgsbckEV1+Doai4fU=
+
+to-fast-properties@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/to-fast-properties/-/to-fast-properties-2.0.0.tgz#dc5e698cbd079265bc73e0377681a4e4e83f616e"
+  integrity sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=
+
+to-object-path@^0.3.0:
+  version "0.3.0"
+  resolved "https://registry.yarnpkg.com/to-object-path/-/to-object-path-0.3.0.tgz#297588b7b0e7e0ac08e04e672f85c1f4999e17af"
+  integrity sha1-KXWIt7Dn4KwI4E5nL4XB9JmeF68=
+  dependencies:
+    kind-of "^3.0.2"
+
+to-regex-range@^2.1.0:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/to-regex-range/-/to-regex-range-2.1.1.tgz#7c80c17b9dfebe599e27367e0d4dd5590141db38"
+  integrity sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=
+  dependencies:
+    is-number "^3.0.0"
+    repeat-string "^1.6.1"
+
+to-regex@^3.0.1, to-regex@^3.0.2:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/to-regex/-/to-regex-3.0.2.tgz#13cfdd9b336552f30b51f33a8ae1b42a7a7599ce"
+  integrity sha512-FWtleNAtZ/Ki2qtqej2CXTOayOH9bHDQF+Q48VpWyDXjbYxA4Yz8iDB31zXOBUlOHHKidDbqGVrTUvQMPmBGBw==
+  dependencies:
+    define-property "^2.0.2"
+    extend-shallow "^3.0.2"
+    regex-not "^1.0.2"
+    safe-regex "^1.1.0"
+
+type-check@~0.3.2:
+  version "0.3.2"
+  resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.3.2.tgz#5884cab512cf1d355e3fb784f30804b2b520db72"
+  integrity sha1-WITKtRLPHTVeP7eE8wgEsrUg23I=
+  dependencies:
+    prelude-ls "~1.1.2"
+
+type@^1.0.1:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/type/-/type-1.2.0.tgz#848dd7698dafa3e54a6c479e759c4bc3f18847a0"
+  integrity sha512-+5nt5AAniqsCnu2cEQQdpzCAh33kVx8n0VoFidKpB1dVVLAN/F+bgVOqOJqOnEnrhp222clB5p3vUlD+1QAnfg==
+
+typedarray@^0.0.6:
+  version "0.0.6"
+  resolved "https://registry.yarnpkg.com/typedarray/-/typedarray-0.0.6.tgz#867ac74e3864187b1d3d47d996a78ec5c8830777"
+  integrity sha1-hnrHTjhkGHsdPUfZlqeOxciDB3c=
+
+unicode-canonical-property-names-ecmascript@^1.0.4:
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/unicode-canonical-property-names-ecmascript/-/unicode-canonical-property-names-ecmascript-1.0.4.tgz#2619800c4c825800efdd8343af7dd9933cbe2818"
+  integrity sha512-jDrNnXWHd4oHiTZnx/ZG7gtUTVp+gCcTTKr8L0HjlwphROEW3+Him+IpvC+xcJEFegapiMZyZe02CyuOnRmbnQ==
+
+unicode-match-property-ecmascript@^1.0.4:
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/unicode-match-property-ecmascript/-/unicode-match-property-ecmascript-1.0.4.tgz#8ed2a32569961bce9227d09cd3ffbb8fed5f020c"
+  integrity sha512-L4Qoh15vTfntsn4P1zqnHulG0LdXgjSO035fEpdtp6YxXhMT51Q6vgM5lYdG/5X3MjS+k/Y9Xw4SFCY9IkR0rg==
+  dependencies:
+    unicode-canonical-property-names-ecmascript "^1.0.4"
+    unicode-property-aliases-ecmascript "^1.0.4"
+
+unicode-match-property-value-ecmascript@^1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/unicode-match-property-value-ecmascript/-/unicode-match-property-value-ecmascript-1.1.0.tgz#5b4b426e08d13a80365e0d657ac7a6c1ec46a277"
+  integrity sha512-hDTHvaBk3RmFzvSl0UVrUmC3PuW9wKVnpoUDYH0JDkSIovzw+J5viQmeYHxVSBptubnr7PbH2e0fnpDRQnQl5g==
+
+unicode-property-aliases-ecmascript@^1.0.4:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/unicode-property-aliases-ecmascript/-/unicode-property-aliases-ecmascript-1.0.5.tgz#a9cc6cc7ce63a0a3023fc99e341b94431d405a57"
+  integrity sha512-L5RAqCfXqAwR3RriF8pM0lU0w4Ryf/GgzONwi6KnL1taJQa7x1TCxdJnILX59WIGOwR57IVxn7Nej0fz1Ny6fw==
+
+union-value@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/union-value/-/union-value-1.0.1.tgz#0b6fe7b835aecda61c6ea4d4f02c14221e109847"
+  integrity sha512-tJfXmxMeWYnczCVs7XAEvIV7ieppALdyepWMkHkwciRpZraG/xwT+s2JN8+pr1+8jCRf80FFzvr+MpQeeoF4Xg==
+  dependencies:
+    arr-union "^3.1.0"
+    get-value "^2.0.6"
+    is-extendable "^0.1.1"
+    set-value "^2.0.1"
+
+unset-value@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/unset-value/-/unset-value-1.0.0.tgz#8376873f7d2335179ffb1e6fc3a8ed0dfc8ab559"
+  integrity sha1-g3aHP30jNRef+x5vw6jtDfyKtVk=
+  dependencies:
+    has-value "^0.3.1"
+    isobject "^3.0.0"
+
+upath@^1.1.1:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/upath/-/upath-1.2.0.tgz#8f66dbcd55a883acdae4408af8b035a5044c1894"
+  integrity sha512-aZwGpamFO61g3OlfT7OQCHqhGnW43ieH9WZeP7QxN/G/jS4jfqUkZxoryvJgVPEcrl5NL/ggHsSmLMHuH64Lhg==
+
+urix@^0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/urix/-/urix-0.1.0.tgz#da937f7a62e21fec1fd18d49b35c2935067a6c72"
+  integrity sha1-2pN/emLiH+wf0Y1Js1wpNQZ6bHI=
+
+use@^3.1.0:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/use/-/use-3.1.1.tgz#d50c8cac79a19fbc20f2911f56eb973f4e10070f"
+  integrity sha512-cwESVXlO3url9YWlFW/TA9cshCEhtu7IKJ/p5soJ/gGpj7vbvFrAY/eIioQ6Dw23KjZhYgiIo8HOs1nQ2vr/oQ==
+
+user-home@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/user-home/-/user-home-2.0.0.tgz#9c70bfd8169bc1dcbf48604e0f04b8b49cde9e9f"
+  integrity sha1-nHC/2Babwdy/SGBODwS4tJzenp8=
+  dependencies:
+    os-homedir "^1.0.0"
+
+util-deprecate@~1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/util-deprecate/-/util-deprecate-1.0.2.tgz#450d4dc9fa70de732762fbd2d4a28981419a0ccf"
+  integrity sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=
+
+wide-align@^1.1.0:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/wide-align/-/wide-align-1.1.3.tgz#ae074e6bdc0c14a431e804e624549c633b000457"
+  integrity sha512-QGkOQc8XL6Bt5PwnsExKBPuMKBxnGxWWW3fU55Xt4feHozMUhdUMaBCk290qpm/wG5u/RSKzwdAC4i51YigihA==
+  dependencies:
+    string-width "^1.0.2 || 2"
+
+wordwrap@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-1.0.0.tgz#27584810891456a4171c8d0226441ade90cbcaeb"
+  integrity sha1-J1hIEIkUVqQXHI0CJkQa3pDLyus=
+
+wrappy@1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f"
+  integrity sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=
+
+write@^0.2.1:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/write/-/write-0.2.1.tgz#5fc03828e264cea3fe91455476f7a3c566cb0757"
+  integrity sha1-X8A4KOJkzqP+kUVUdvejxWbLB1c=
+  dependencies:
+    mkdirp "^0.5.1"
+
+xtend@^4.0.0:
+  version "4.0.2"
+  resolved "https://registry.yarnpkg.com/xtend/-/xtend-4.0.2.tgz#bb72779f5fa465186b1f438f674fa347fdb5db54"
+  integrity sha512-LKYU1iAXJXUgAXn9URjiu+MWhyUXHsvfp7mcuYm9dSUKK0/CjtrUwFAxD82/mCWbtLsGjFIad0wIsod4zrTAEQ==
+
+yallist@^3.0.0, yallist@^3.0.3:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/yallist/-/yallist-3.1.0.tgz#906cc2100972dc2625ae78f566a2577230a1d6f7"
+  integrity sha512-6gpP93MR+VOOehKbCPchro3wFZNSNmek8A2kbkOAZLIZAYx1KP/zAqwO0sOHi3xJEb+UBz8NaYt/17UNit1Q9w==
diff --git a/jest.config.js b/jest.config.js
index 749c55a..7b9239f 100644
--- a/jest.config.js
+++ b/jest.config.js
@@ -1,8 +1,6 @@
 module.exports = {
-  roots: [
-    "<rootDir>/src"
-  ],
+  roots: ['<rootDir>/src'],
   transform: {
-    "^.+\\.tsx?$": "ts-jest"
-  }
-}
\ No newline at end of file
+    '^.+\\.tsx?$': 'ts-jest',
+  },
+};
diff --git a/package.json b/package.json
index 441345e..d64a107 100644
--- a/package.json
+++ b/package.json
@@ -21,7 +21,7 @@
   "scripts": {
     "build": "tsc && prettier --check 'dist/**/*' --write",
     "test": "jest --coverage",
-    "lint": "prettier --check 'src/**/*'",
+    "lint": "eslint --ext=.ts,.tsx --max-warnings=0 src/ && prettier --check 'src/**/*'",
     "docs": "typedoc --out docs/$npm_package_version && scripts/gen-docs-index.sh $npm_package_version",
     "version": "conventional-changelog -p angular -i CHANGELOG.md -s && git add CHANGELOG.md"
   },
@@ -35,11 +35,17 @@
     "react": "^16"
   },
   "devDependencies": {
+    "@react-hook-utilities/eslint-plugin": "./eslint-plugin",
     "@testing-library/react-hooks": "^2.0.1",
     "@types/jest": "^24.0.18",
     "@types/react": "^16.9.2",
+    "@typescript-eslint/eslint-plugin": "^2.3.1",
+    "@typescript-eslint/parser": "^2.3.1",
     "commitlint": "^8.2.0",
     "conventional-changelog-cli": "^2.0.25",
+    "eslint": "^6.5.0",
+    "eslint-plugin-react": "^7.14.3",
+    "eslint-plugin-react-hooks": "^2.1.1",
     "husky": "^3.0.5",
     "jest": "^24.9.0",
     "prettier": "^1.19.1",
diff --git a/src/__tests__/useEffectUpdate.ts b/src/__tests__/useEffectUpdate.ts
index c00df4a..6304dc5 100644
--- a/src/__tests__/useEffectUpdate.ts
+++ b/src/__tests__/useEffectUpdate.ts
@@ -4,12 +4,15 @@ import { useEffectUpdate } from '..';
 
 const deps = [1, 2, 3];
 
-const hook = async ({ dependencies, cleanup }: any) =>
+const hook = async ({ dependencies = [], cleanup }: any) =>
   new Promise<any>(resolve => {
-    useEffectUpdate(oldState => {
-      resolve(oldState);
-      return cleanup;
-    }, dependencies);
+    useEffectUpdate(
+      oldState => {
+        resolve(oldState);
+        return cleanup;
+      },
+      dependencies, // eslint-disable-line @react-hook-utilities/exhaustive-deps
+    );
   });
 
 it('receives empty array as old state', () => {
diff --git a/src/index.tsx b/src/index.tsx
index da9ea48..a73623e 100644
--- a/src/index.tsx
+++ b/src/index.tsx
@@ -55,11 +55,11 @@ export interface ValuablePromise<T> extends Promise<T> {
  */
 export const useAsyncEffect = (
   effect: () => Promise<void>,
-  dependencies?: readonly any[],
+  dependencies: readonly any[] = [],
 ) => {
   useEffect(() => {
     effect();
-  }, dependencies);
+  }, [...dependencies, effect]);
 };
 
 /**
@@ -73,11 +73,11 @@ export const useAsyncEffect = (
  */
 export const useAsyncLayoutEffect = (
   effect: () => Promise<void>,
-  dependencies?: readonly any[],
+  dependencies: readonly any[] = [],
 ) => {
   useLayoutEffect(() => {
     effect();
-  }, dependencies);
+  }, [...dependencies, effect]);
 };
 
 /**
@@ -280,7 +280,7 @@ export function useEffectUpdate<Dependencies extends readonly any[]>(
     } finally {
       oldState.current = dependencies;
     }
-  }, dependencies);
+  }, [...dependencies, effect, oldState.current]);
 }
 
 /**
@@ -448,7 +448,7 @@ export function useConditionalEffect<T1, T2, T3, T4, T5, T6, T7, T8, T9, T10>(
  */
 export function useConditionalEffect<Dependencies extends readonly any[]>(
   evalCondition: (oldState: Dependencies) => boolean,
-  effect: () => (() => void) | void,
+  effect: () => void | (() => void),
   dependencies: Dependencies,
 ): void;
 export function useConditionalEffect<Dependencies extends readonly any[]>(
@@ -458,7 +458,7 @@ export function useConditionalEffect<Dependencies extends readonly any[]>(
 ): void {
   useEffectUpdate(
     oldState => (evalCondition(oldState) ? effect() : undefined),
-    dependencies,
+    dependencies, // eslint-disable-line @react-hook-utilities/exhaustive-deps,react-hooks/exhaustive-deps
   );
 }
 
diff --git a/yarn.lock b/yarn.lock
index 3ce89dd..40f182d 100644
--- a/yarn.lock
+++ b/yarn.lock
@@ -428,6 +428,9 @@
     mkdirp "^0.5.1"
     rimraf "^2.5.2"
 
+"@react-hook-utilities/eslint-plugin@./eslint-plugin":
+  version "1.0.0"
+
 "@testing-library/react-hooks@^2.0.1":
   version "2.0.1"
   resolved "https://registry.yarnpkg.com/@testing-library/react-hooks/-/react-hooks-2.0.1.tgz#1c3ec40882d0830df3078ddae0056fdf7366c81d"
@@ -470,6 +473,11 @@
   dependencies:
     "@babel/types" "^7.3.0"
 
+"@types/eslint-visitor-keys@^1.0.0":
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/@types/eslint-visitor-keys/-/eslint-visitor-keys-1.0.0.tgz#1ee30d79544ca84d68d4b3cdb0af4f205663dd2d"
+  integrity sha512-OCutwjDZ4aFS6PB1UZ988C4YgwlBHJd6wCeQqaLdmadZ/7e+w79+hbMUFC1QXDNCmdyoRfAFdm0RypzwR+Qpag==
+
 "@types/istanbul-lib-coverage@*", "@types/istanbul-lib-coverage@^2.0.0":
   version "2.0.1"
   resolved "https://registry.yarnpkg.com/@types/istanbul-lib-coverage/-/istanbul-lib-coverage-2.0.1.tgz#42995b446db9a48a11a07ec083499a860e9138ff"
@@ -502,6 +510,11 @@
   dependencies:
     "@types/jest-diff" "*"
 
+"@types/json-schema@^7.0.3":
+  version "7.0.3"
+  resolved "https://registry.yarnpkg.com/@types/json-schema/-/json-schema-7.0.3.tgz#bdfd69d61e464dcc81b25159c270d75a73c1a636"
+  integrity sha512-Il2DtDVRGDcqjDtE+rF8iqg1CArehSK84HZJCT7AMITlyXRBpuPhqGLDQMowraqqu1coEaimg4ZOqggt6L6L+A==
+
 "@types/minimatch@3.0.3":
   version "3.0.3"
   resolved "https://registry.yarnpkg.com/@types/minimatch/-/minimatch-3.0.3.tgz#3dca0e3f33b200fc7d1139c0cd96c1268cadfd9d"
@@ -559,6 +572,49 @@
   dependencies:
     "@types/yargs-parser" "*"
 
+"@typescript-eslint/eslint-plugin@^2.3.1":
+  version "2.10.0"
+  resolved "https://registry.yarnpkg.com/@typescript-eslint/eslint-plugin/-/eslint-plugin-2.10.0.tgz#c4cb103275e555e8a7e9b3d14c5951eb6d431e70"
+  integrity sha512-rT51fNLW0u3fnDGnAHVC5nu+Das+y2CpW10yqvf6/j5xbuUV3FxA3mBaIbM24CXODXjbgUznNb4Kg9XZOUxKAw==
+  dependencies:
+    "@typescript-eslint/experimental-utils" "2.10.0"
+    eslint-utils "^1.4.3"
+    functional-red-black-tree "^1.0.1"
+    regexpp "^3.0.0"
+    tsutils "^3.17.1"
+
+"@typescript-eslint/experimental-utils@2.10.0":
+  version "2.10.0"
+  resolved "https://registry.yarnpkg.com/@typescript-eslint/experimental-utils/-/experimental-utils-2.10.0.tgz#8db1656cdfd3d9dcbdbf360b8274dea76f0b2c2c"
+  integrity sha512-FZhWq6hWWZBP76aZ7bkrfzTMP31CCefVIImrwP3giPLcoXocmLTmr92NLZxuIcTL4GTEOE33jQMWy9PwelL+yQ==
+  dependencies:
+    "@types/json-schema" "^7.0.3"
+    "@typescript-eslint/typescript-estree" "2.10.0"
+    eslint-scope "^5.0.0"
+
+"@typescript-eslint/parser@^2.3.1":
+  version "2.10.0"
+  resolved "https://registry.yarnpkg.com/@typescript-eslint/parser/-/parser-2.10.0.tgz#24b2e48384ab6d5a6121e4c4faf8892c79657ad3"
+  integrity sha512-wQNiBokcP5ZsTuB+i4BlmVWq6o+oAhd8en2eSm/EE9m7BgZUIfEeYFd6z3S+T7bgNuloeiHA1/cevvbBDLr98g==
+  dependencies:
+    "@types/eslint-visitor-keys" "^1.0.0"
+    "@typescript-eslint/experimental-utils" "2.10.0"
+    "@typescript-eslint/typescript-estree" "2.10.0"
+    eslint-visitor-keys "^1.1.0"
+
+"@typescript-eslint/typescript-estree@2.10.0":
+  version "2.10.0"
+  resolved "https://registry.yarnpkg.com/@typescript-eslint/typescript-estree/-/typescript-estree-2.10.0.tgz#89cdabd5e8c774e9d590588cb42fb9afd14dcbd9"
+  integrity sha512-oOYnplddQNm/LGVkqbkAwx4TIBuuZ36cAQq9v3nFIU9FmhemHuVzAesMSXNQDdAzCa5bFgCrfD3JWhYVKlRN2g==
+  dependencies:
+    debug "^4.1.1"
+    eslint-visitor-keys "^1.1.0"
+    glob "^7.1.6"
+    is-glob "^4.0.1"
+    lodash.unescape "4.0.1"
+    semver "^6.3.0"
+    tsutils "^3.17.1"
+
 JSONStream@^1.0.4:
   version "1.3.5"
   resolved "https://registry.yarnpkg.com/JSONStream/-/JSONStream-1.3.5.tgz#3208c1f08d3a4d99261ab64f92302bc15e111ca0"
@@ -585,6 +641,11 @@ acorn-globals@^4.1.0:
     acorn "^6.0.1"
     acorn-walk "^6.0.1"
 
+acorn-jsx@^5.1.0:
+  version "5.1.0"
+  resolved "https://registry.yarnpkg.com/acorn-jsx/-/acorn-jsx-5.1.0.tgz#294adb71b57398b0680015f0a38c563ee1db5384"
+  integrity sha512-tMUqwBWfLFbJbizRmEcWSLw6HnFzfdJs2sOJEOwwtVPMoH/0Ay+E703oZz78VSXZiiDcZrQ5XKjPIUQixhmgVw==
+
 acorn-walk@^6.0.1:
   version "6.2.0"
   resolved "https://registry.yarnpkg.com/acorn-walk/-/acorn-walk-6.2.0.tgz#123cb8f3b84c2171f1f7fb252615b1c78a6b1a8c"
@@ -600,12 +661,17 @@ acorn@^6.0.1:
   resolved "https://registry.yarnpkg.com/acorn/-/acorn-6.3.0.tgz#0087509119ffa4fc0a0041d1e93a417e68cb856e"
   integrity sha512-/czfa8BwS88b9gWQVhc8eknunSA2DoJpJyTQkhheIf5E48u1N0R4q/YxxsAeqRrmK9TQ/uYfgLDfZo91UlANIA==
 
+acorn@^7.1.0:
+  version "7.1.0"
+  resolved "https://registry.yarnpkg.com/acorn/-/acorn-7.1.0.tgz#949d36f2c292535da602283586c2477c57eb2d6c"
+  integrity sha512-kL5CuoXA/dgxlBbVrflsflzQ3PAas7RYZB52NOm/6839iVYJgKMJ3cQJD+t2i5+qFa8h3MDpEOJiS64E8JLnSQ==
+
 add-stream@^1.0.0:
   version "1.0.0"
   resolved "https://registry.yarnpkg.com/add-stream/-/add-stream-1.0.0.tgz#6a7990437ca736d5e1288db92bd3266d5f5cb2aa"
   integrity sha1-anmQQ3ynNtXhKI25K9MmbV9csqo=
 
-ajv@^6.5.5:
+ajv@^6.10.0, ajv@^6.10.2, ajv@^6.5.5:
   version "6.10.2"
   resolved "https://registry.yarnpkg.com/ajv/-/ajv-6.10.2.tgz#d3cea04d6b017b2894ad69040fec8b623eb4bd52"
   integrity sha512-TXtUUEYHuaTEbLZWIKUr5pmBuhDLy+8KYtPYdcV8qC+pOZL+NKqYwvWSRrVXHn+ZmRRAu8vJTAznH7Oag6RVRw==
@@ -620,6 +686,13 @@ ansi-escapes@^3.0.0:
   resolved "https://registry.yarnpkg.com/ansi-escapes/-/ansi-escapes-3.2.0.tgz#8780b98ff9dbf5638152d1f1fe5c1d7b4442976b"
   integrity sha512-cBhpre4ma+U0T1oM5fXg7Dy1Jw7zzwv7lt/GoCpr+hDQJoYnKVPLL4dCvSEFMmQurOQvSrwT7SL/DAlhBI97RQ==
 
+ansi-escapes@^4.2.1:
+  version "4.3.0"
+  resolved "https://registry.yarnpkg.com/ansi-escapes/-/ansi-escapes-4.3.0.tgz#a4ce2b33d6b214b7950d8595c212f12ac9cc569d"
+  integrity sha512-EiYhwo0v255HUL6eDyuLrXEkTi7WwVCLAw+SeOQ7M7qdun1z1pum4DEm/nuqIVbPvi9RPPc9k9LbyBv6H0DwVg==
+  dependencies:
+    type-fest "^0.8.1"
+
 ansi-regex@^2.0.0:
   version "2.1.1"
   resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-2.1.1.tgz#c3b33ab5ee360d86e0e628f0468ae7ef27d654df"
@@ -635,6 +708,11 @@ ansi-regex@^4.0.0, ansi-regex@^4.1.0:
   resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-4.1.0.tgz#8b9f8f08cf1acb843756a839ca8c7e3168c51997"
   integrity sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg==
 
+ansi-regex@^5.0.0:
+  version "5.0.0"
+  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-5.0.0.tgz#388539f55179bf39339c81af30a654d69f87cb75"
+  integrity sha512-bY6fj56OUQ0hU1KjFNDQuJFezqKdrAyFdIevADiqrWHwSlbmBNMHp5ak2f40Pm8JTFyM2mqxkG6ngkHO11f/lg==
+
 ansi-styles@^3.2.0, ansi-styles@^3.2.1:
   version "3.2.1"
   resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.2.1.tgz#41fbb20243e50b12be0f04b8dedbf07520ce841d"
@@ -700,6 +778,14 @@ array-ify@^1.0.0:
   resolved "https://registry.yarnpkg.com/array-ify/-/array-ify-1.0.0.tgz#9e528762b4a9066ad163a6962a364418e9626ece"
   integrity sha1-nlKHYrSpBmrRY6aWKjZEGOlibs4=
 
+array-includes@^3.0.3:
+  version "3.0.3"
+  resolved "https://registry.yarnpkg.com/array-includes/-/array-includes-3.0.3.tgz#184b48f62d92d7452bb31b323165c7f8bd02266d"
+  integrity sha1-GEtI9i2S10UrsxsyMWXH+L0CJm0=
+  dependencies:
+    define-properties "^1.1.2"
+    es-abstract "^1.7.0"
+
 array-unique@^0.3.2:
   version "0.3.2"
   resolved "https://registry.yarnpkg.com/array-unique/-/array-unique-0.3.2.tgz#a894b75d4bc4f6cd679ef3244a9fd8f46ae2d428"
@@ -982,7 +1068,7 @@ caseless@~0.12.0:
   resolved "https://registry.yarnpkg.com/caseless/-/caseless-0.12.0.tgz#1b681c21ff84033c826543090689420d187151dc"
   integrity sha1-G2gcIf+EAzyCZUMJBolCDRhxUdw=
 
-chalk@2.4.2, chalk@^2.0.0, chalk@^2.0.1, chalk@^2.4.2:
+chalk@2.4.2, chalk@^2.0.0, chalk@^2.0.1, chalk@^2.1.0, chalk@^2.4.2:
   version "2.4.2"
   resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.4.2.tgz#cd42541677a54333cf541a49108c1432b44c9424"
   integrity sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==
@@ -991,6 +1077,11 @@ chalk@2.4.2, chalk@^2.0.0, chalk@^2.0.1, chalk@^2.4.2:
     escape-string-regexp "^1.0.5"
     supports-color "^5.3.0"
 
+chardet@^0.7.0:
+  version "0.7.0"
+  resolved "https://registry.yarnpkg.com/chardet/-/chardet-0.7.0.tgz#90094849f0937f2eedc2425d0d28a9e5f0cbad9e"
+  integrity sha512-mT8iDcrh03qDGRRmoA2hmBJnxpllMR+0/0qlzjqZES6NdiWDcZkCNAk4rPFZ9Q85r27unkiNNg8ZOiwZXBHwcA==
+
 chownr@^1.1.1:
   version "1.1.2"
   resolved "https://registry.yarnpkg.com/chownr/-/chownr-1.1.2.tgz#a18f1e0b269c8a6a5d3c86eb298beb14c3dd7bf6"
@@ -1011,6 +1102,18 @@ class-utils@^0.3.5:
     isobject "^3.0.0"
     static-extend "^0.1.1"
 
+cli-cursor@^3.1.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/cli-cursor/-/cli-cursor-3.1.0.tgz#264305a7ae490d1d03bf0c9ba7c925d1753af307"
+  integrity sha512-I/zHAwsKf9FqGoXM4WWRACob9+SNukZTd94DWF57E4toouRulbCxcUh6RKUEOQlYTHJnzkPMySvPNaaSLNfLZw==
+  dependencies:
+    restore-cursor "^3.1.0"
+
+cli-width@^2.0.0:
+  version "2.2.0"
+  resolved "https://registry.yarnpkg.com/cli-width/-/cli-width-2.2.0.tgz#ff19ede8a9a5e579324147b0c11f0fbcbabed639"
+  integrity sha1-/xnt6Kml5XkyQUewwR8PvLq+1jk=
+
 cliui@^5.0.0:
   version "5.0.0"
   resolved "https://registry.yarnpkg.com/cliui/-/cliui-5.0.0.tgz#deefcfdb2e800784aa34f46fa08e06851c7bbbc5"
@@ -1303,7 +1406,7 @@ cosmiconfig@^5.2.0, cosmiconfig@^5.2.1:
     js-yaml "^3.13.1"
     parse-json "^4.0.0"
 
-cross-spawn@^6.0.0:
+cross-spawn@^6.0.0, cross-spawn@^6.0.5:
   version "6.0.5"
   resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-6.0.5.tgz#4a5ec7c64dfae22c3a14124dbacdee846d80cbc4"
   integrity sha512-eTVLrBSt7fjbDygz805pMnstIs2VTBNkRm0qxZd+M7A5XDdxVRWO5MxGBXZhjY4cqLYLdtrGqRf8mBPmzwSpWQ==
@@ -1380,7 +1483,7 @@ debug@^3.2.6:
   dependencies:
     ms "^2.1.1"
 
-debug@^4.1.0, debug@^4.1.1:
+debug@^4.0.1, debug@^4.1.0, debug@^4.1.1:
   version "4.1.1"
   resolved "https://registry.yarnpkg.com/debug/-/debug-4.1.1.tgz#3b72260255109c6b589cee050f1d516139664791"
   integrity sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==
@@ -1469,6 +1572,20 @@ diff-sequences@^24.9.0:
   resolved "https://registry.yarnpkg.com/diff-sequences/-/diff-sequences-24.9.0.tgz#5715d6244e2aa65f48bba0bc972db0b0b11e95b5"
   integrity sha512-Dj6Wk3tWyTE+Fo1rW8v0Xhwk80um6yFYKbuAxc9c3EZxIHFDYwbi34Uk42u1CdnIiVorvt4RmlSDjIPyzGC2ew==
 
+doctrine@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-2.1.0.tgz#5cd01fc101621b42c4cd7f5d1a66243716d3f39d"
+  integrity sha512-35mSku4ZXK0vfCuHEDAwt55dg2jNajHZ1odvF+8SSr82EsZY4QmXfuWso8oEd8zRhVObSN18aM0CjSdoBX7zIw==
+  dependencies:
+    esutils "^2.0.2"
+
+doctrine@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-3.0.0.tgz#addebead72a6574db783639dc87a121773973961"
+  integrity sha512-yS+Q5i3hBf7GBkd4KG8a7eBNNWNGLTaEwwYWUijIYM7zrlYDM0BFXHjjPWlWZ1Rg7UaddZeIDmi9jF3HmqiQ2w==
+  dependencies:
+    esutils "^2.0.2"
+
 domexception@^1.0.1:
   version "1.0.1"
   resolved "https://registry.yarnpkg.com/domexception/-/domexception-1.0.1.tgz#937442644ca6a31261ef36e3ec677fe805582c90"
@@ -1496,6 +1613,11 @@ emoji-regex@^7.0.1:
   resolved "https://registry.yarnpkg.com/emoji-regex/-/emoji-regex-7.0.3.tgz#933a04052860c85e83c122479c4748a8e4c72156"
   integrity sha512-CwBLREIQ7LvYFB0WyRvwhq5N5qPhc6PMjD6bYggFlI5YyDgl+0vxq5VHbMOFqLg7hfWzmu8T5Z1QofhmTIhItA==
 
+emoji-regex@^8.0.0:
+  version "8.0.0"
+  resolved "https://registry.yarnpkg.com/emoji-regex/-/emoji-regex-8.0.0.tgz#e818fd69ce5ccfcb404594f842963bf53164cc37"
+  integrity sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==
+
 end-of-stream@^1.1.0:
   version "1.4.1"
   resolved "https://registry.yarnpkg.com/end-of-stream/-/end-of-stream-1.4.1.tgz#ed29634d19baba463b6ce6b80a37213eab71ec43"
@@ -1510,6 +1632,22 @@ error-ex@^1.2.0, error-ex@^1.3.1:
   dependencies:
     is-arrayish "^0.2.1"
 
+es-abstract@^1.12.0, es-abstract@^1.15.0, es-abstract@^1.7.0:
+  version "1.16.2"
+  resolved "https://registry.yarnpkg.com/es-abstract/-/es-abstract-1.16.2.tgz#4e874331645e9925edef141e74fc4bd144669d34"
+  integrity sha512-jYo/J8XU2emLXl3OLwfwtuFfuF2w6DYPs+xy9ZfVyPkDcrauu6LYrw/q2TyCtrbc/KUdCiC5e9UajRhgNkVopA==
+  dependencies:
+    es-to-primitive "^1.2.1"
+    function-bind "^1.1.1"
+    has "^1.0.3"
+    has-symbols "^1.0.1"
+    is-callable "^1.1.4"
+    is-regex "^1.0.4"
+    object-inspect "^1.7.0"
+    object-keys "^1.1.1"
+    string.prototype.trimleft "^2.1.0"
+    string.prototype.trimright "^2.1.0"
+
 es-abstract@^1.5.1:
   version "1.14.2"
   resolved "https://registry.yarnpkg.com/es-abstract/-/es-abstract-1.14.2.tgz#7ce108fad83068c8783c3cdf62e504e084d8c497"
@@ -1535,6 +1673,15 @@ es-to-primitive@^1.2.0:
     is-date-object "^1.0.1"
     is-symbol "^1.0.2"
 
+es-to-primitive@^1.2.1:
+  version "1.2.1"
+  resolved "https://registry.yarnpkg.com/es-to-primitive/-/es-to-primitive-1.2.1.tgz#e55cd4c9cdc188bcefb03b366c736323fc5c898a"
+  integrity sha512-QCOllgZJtaUo9miYBcLChTUaHNjJF3PYs1VidD7AwiEj1kYxKeQTctLAezAOH5ZKRH0g2IgPn6KwB4IT8iRpvA==
+  dependencies:
+    is-callable "^1.1.4"
+    is-date-object "^1.0.1"
+    is-symbol "^1.0.2"
+
 escape-string-regexp@^1.0.5:
   version "1.0.5"
   resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz#1b61c0562190a8dff6ae3bb2cf0200ca130b86d4"
@@ -1552,6 +1699,104 @@ escodegen@^1.9.1:
   optionalDependencies:
     source-map "~0.6.1"
 
+eslint-plugin-eslint-plugin@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/eslint-plugin-eslint-plugin/-/eslint-plugin-eslint-plugin-2.1.0.tgz#a7a00f15a886957d855feacaafee264f039e62d5"
+  integrity sha512-kT3A/ZJftt28gbl/Cv04qezb/NQ1dwYIbi8lyf806XMxkus7DvOVCLIfTXMrorp322Pnoez7+zabXH29tADIDg==
+
+eslint-plugin-react-hooks@^2.1.1:
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/eslint-plugin-react-hooks/-/eslint-plugin-react-hooks-2.3.0.tgz#53e073961f1f5ccf8dd19558036c1fac8c29d99a"
+  integrity sha512-gLKCa52G4ee7uXzdLiorca7JIQZPPXRAQDXV83J4bUEeUuc5pIEyZYAZ45Xnxe5IuupxEqHS+hUhSLIimK1EMw==
+
+eslint-plugin-react@^7.14.3:
+  version "7.17.0"
+  resolved "https://registry.yarnpkg.com/eslint-plugin-react/-/eslint-plugin-react-7.17.0.tgz#a31b3e134b76046abe3cd278e7482bd35a1d12d7"
+  integrity sha512-ODB7yg6lxhBVMeiH1c7E95FLD4E/TwmFjltiU+ethv7KPdCwgiFuOZg9zNRHyufStTDLl/dEFqI2Q1VPmCd78A==
+  dependencies:
+    array-includes "^3.0.3"
+    doctrine "^2.1.0"
+    eslint-plugin-eslint-plugin "^2.1.0"
+    has "^1.0.3"
+    jsx-ast-utils "^2.2.3"
+    object.entries "^1.1.0"
+    object.fromentries "^2.0.1"
+    object.values "^1.1.0"
+    prop-types "^15.7.2"
+    resolve "^1.13.1"
+
+eslint-scope@^5.0.0:
+  version "5.0.0"
+  resolved "https://registry.yarnpkg.com/eslint-scope/-/eslint-scope-5.0.0.tgz#e87c8887c73e8d1ec84f1ca591645c358bfc8fb9"
+  integrity sha512-oYrhJW7S0bxAFDvWqzvMPRm6pcgcnWc4QnofCAqRTRfQC0JcwenzGglTtsLyIuuWFfkqDG9vz67cnttSd53djw==
+  dependencies:
+    esrecurse "^4.1.0"
+    estraverse "^4.1.1"
+
+eslint-utils@^1.4.3:
+  version "1.4.3"
+  resolved "https://registry.yarnpkg.com/eslint-utils/-/eslint-utils-1.4.3.tgz#74fec7c54d0776b6f67e0251040b5806564e981f"
+  integrity sha512-fbBN5W2xdY45KulGXmLHZ3c3FHfVYmKg0IrAKGOkT/464PQsx2UeIzfz1RmEci+KLm1bBaAzZAh8+/E+XAeZ8Q==
+  dependencies:
+    eslint-visitor-keys "^1.1.0"
+
+eslint-visitor-keys@^1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-1.1.0.tgz#e2a82cea84ff246ad6fb57f9bde5b46621459ec2"
+  integrity sha512-8y9YjtM1JBJU/A9Kc+SbaOV4y29sSWckBwMHa+FGtVj5gN/sbnKDf6xJUl+8g7FAij9LVaP8C24DUiH/f/2Z9A==
+
+eslint@^6.5.0:
+  version "6.7.2"
+  resolved "https://registry.yarnpkg.com/eslint/-/eslint-6.7.2.tgz#c17707ca4ad7b2d8af986a33feba71e18a9fecd1"
+  integrity sha512-qMlSWJaCSxDFr8fBPvJM9kJwbazrhNcBU3+DszDW1OlEwKBBRWsJc7NJFelvwQpanHCR14cOLD41x8Eqvo3Nng==
+  dependencies:
+    "@babel/code-frame" "^7.0.0"
+    ajv "^6.10.0"
+    chalk "^2.1.0"
+    cross-spawn "^6.0.5"
+    debug "^4.0.1"
+    doctrine "^3.0.0"
+    eslint-scope "^5.0.0"
+    eslint-utils "^1.4.3"
+    eslint-visitor-keys "^1.1.0"
+    espree "^6.1.2"
+    esquery "^1.0.1"
+    esutils "^2.0.2"
+    file-entry-cache "^5.0.1"
+    functional-red-black-tree "^1.0.1"
+    glob-parent "^5.0.0"
+    globals "^12.1.0"
+    ignore "^4.0.6"
+    import-fresh "^3.0.0"
+    imurmurhash "^0.1.4"
+    inquirer "^7.0.0"
+    is-glob "^4.0.0"
+    js-yaml "^3.13.1"
+    json-stable-stringify-without-jsonify "^1.0.1"
+    levn "^0.3.0"
+    lodash "^4.17.14"
+    minimatch "^3.0.4"
+    mkdirp "^0.5.1"
+    natural-compare "^1.4.0"
+    optionator "^0.8.3"
+    progress "^2.0.0"
+    regexpp "^2.0.1"
+    semver "^6.1.2"
+    strip-ansi "^5.2.0"
+    strip-json-comments "^3.0.1"
+    table "^5.2.3"
+    text-table "^0.2.0"
+    v8-compile-cache "^2.0.3"
+
+espree@^6.1.2:
+  version "6.1.2"
+  resolved "https://registry.yarnpkg.com/espree/-/espree-6.1.2.tgz#6c272650932b4f91c3714e5e7b5f5e2ecf47262d"
+  integrity sha512-2iUPuuPP+yW1PZaMSDM9eyVf8D5P0Hi8h83YtZ5bPc/zHYjII5khoixIUTMO794NOY8F/ThF1Bo8ncZILarUTA==
+  dependencies:
+    acorn "^7.1.0"
+    acorn-jsx "^5.1.0"
+    eslint-visitor-keys "^1.1.0"
+
 esprima@^3.1.3:
   version "3.1.3"
   resolved "https://registry.yarnpkg.com/esprima/-/esprima-3.1.3.tgz#fdca51cee6133895e3c88d535ce49dbff62a4633"
@@ -1562,7 +1807,21 @@ esprima@^4.0.0:
   resolved "https://registry.yarnpkg.com/esprima/-/esprima-4.0.1.tgz#13b04cdb3e6c5d19df91ab6987a8695619b0aa71"
   integrity sha512-eGuFFw7Upda+g4p+QHvnW0RyTX/SVeJBDM/gCtMARO0cLuT2HcEKnTPvhjV6aGeqrCB/sbNop0Kszm0jsaWU4A==
 
-estraverse@^4.2.0:
+esquery@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/esquery/-/esquery-1.0.1.tgz#406c51658b1f5991a5f9b62b1dc25b00e3e5c708"
+  integrity sha512-SmiyZ5zIWH9VM+SRUReLS5Q8a7GxtRdxEBVZpm98rJM7Sb+A9DVCndXfkeFUd3byderg+EbDkfnevfCwynWaNA==
+  dependencies:
+    estraverse "^4.0.0"
+
+esrecurse@^4.1.0:
+  version "4.2.1"
+  resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.2.1.tgz#007a3b9fdbc2b3bb87e4879ea19c92fdbd3942cf"
+  integrity sha512-64RBB++fIOAXPw3P9cy89qfMlvZEXZkqqJkjqqXIvzP5ezRZjW+lPWjw35UX/3EhUPFYbg5ER4JYgDw4007/DQ==
+  dependencies:
+    estraverse "^4.1.0"
+
+estraverse@^4.0.0, estraverse@^4.1.0, estraverse@^4.1.1, estraverse@^4.2.0:
   version "4.3.0"
   resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-4.3.0.tgz#398ad3f3c5a24948be7725e83d11a7de28cdbd1d"
   integrity sha512-39nnKffWz8xN1BU/2c79n9nB9HDzo0niYUqx6xyqUnyoAnQyyWpOTdZEeiCch8BBu515t4wp9ZmgVfVhn9EBpw==
@@ -1640,6 +1899,15 @@ extend@~3.0.2:
   resolved "https://registry.yarnpkg.com/extend/-/extend-3.0.2.tgz#f8b1136b4071fbd8eb140aff858b1019ec2915fa"
   integrity sha512-fjquC59cD7CyW6urNXK0FBufkZcoiGG80wTuPujX590cB5Ttln20E2UB4S/WARVqhXffZl2LNgS+gQdPIIim/g==
 
+external-editor@^3.0.3:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/external-editor/-/external-editor-3.1.0.tgz#cb03f740befae03ea4d283caed2741a83f335495"
+  integrity sha512-hMQ4CX1p1izmuLYyZqLMO/qGNw10wSv9QDCPfzXfyFrOaCSSoRfqE1Kf1s5an66J5JZC62NewG+mK49jOCtQew==
+  dependencies:
+    chardet "^0.7.0"
+    iconv-lite "^0.4.24"
+    tmp "^0.0.33"
+
 extglob@^2.0.4:
   version "2.0.4"
   resolved "https://registry.yarnpkg.com/extglob/-/extglob-2.0.4.tgz#ad00fe4dc612a9232e8718711dc5cb5ab0285543"
@@ -1674,7 +1942,7 @@ fast-json-stable-stringify@2.x, fast-json-stable-stringify@^2.0.0:
   resolved "https://registry.yarnpkg.com/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz#d5142c0caee6b1189f87d3a76111064f86c8bbf2"
   integrity sha1-1RQsDK7msRifh9OnYREGT4bIu/I=
 
-fast-levenshtein@~2.0.4:
+fast-levenshtein@~2.0.4, fast-levenshtein@~2.0.6:
   version "2.0.6"
   resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917"
   integrity sha1-PYpcZog6FqMMqGQ+hR8Zuqd5eRc=
@@ -1686,6 +1954,20 @@ fb-watchman@^2.0.0:
   dependencies:
     bser "^2.0.0"
 
+figures@^3.0.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/figures/-/figures-3.1.0.tgz#4b198dd07d8d71530642864af2d45dd9e459c4ec"
+  integrity sha512-ravh8VRXqHuMvZt/d8GblBeqDMkdJMBdv/2KntFH+ra5MXkO7nxNKpzQ3n6QD/2da1kH0aWmNISdvhM7gl2gVg==
+  dependencies:
+    escape-string-regexp "^1.0.5"
+
+file-entry-cache@^5.0.1:
+  version "5.0.1"
+  resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-5.0.1.tgz#ca0f6efa6dd3d561333fb14515065c2fafdf439c"
+  integrity sha512-bCg29ictuBaKUwwArK4ouCaqDgLZcysCFLmM/Yn/FDoqndh/9vNuQfXRDvTuXKLxfD/JtZQGKFT8MGcJBK644g==
+  dependencies:
+    flat-cache "^2.0.1"
+
 fill-range@^4.0.0:
   version "4.0.0"
   resolved "https://registry.yarnpkg.com/fill-range/-/fill-range-4.0.0.tgz#d544811d428f98eb06a63dc402d2403c328c38f7"
@@ -1726,6 +2008,20 @@ find-up@^4.0.0:
     locate-path "^5.0.0"
     path-exists "^4.0.0"
 
+flat-cache@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-2.0.1.tgz#5d296d6f04bda44a4630a301413bdbc2ec085ec0"
+  integrity sha512-LoQe6yDuUMDzQAEH8sgmh4Md6oZnc/7PjtwjNFSzveXqSHt6ka9fPBuso7IGf9Rz4uqnSnWiFH2B/zj24a5ReA==
+  dependencies:
+    flatted "^2.0.0"
+    rimraf "2.6.3"
+    write "1.0.3"
+
+flatted@^2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/flatted/-/flatted-2.0.1.tgz#69e57caa8f0eacbc281d2e2cb458d46fdb449e08"
+  integrity sha512-a1hQMktqW9Nmqr5aktAux3JMNqaucxGcjtjWnZLHX7yyPCmlSV3M54nGYbqT8K+0GhF3NBgmJCc3ma+WOgX8Jg==
+
 for-in@^1.0.2:
   version "1.0.2"
   resolved "https://registry.yarnpkg.com/for-in/-/for-in-1.0.2.tgz#81068d295a8142ec0ac726c6e2200c30fb6d5e80"
@@ -1786,6 +2082,11 @@ function-bind@^1.1.1:
   resolved "https://registry.yarnpkg.com/function-bind/-/function-bind-1.1.1.tgz#a56899d3ea3c9bab874bb9773b7c5ede92f4895d"
   integrity sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A==
 
+functional-red-black-tree@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/functional-red-black-tree/-/functional-red-black-tree-1.0.1.tgz#1b0ab3bd553b2a0d6399d29c0e3ea0b252078327"
+  integrity sha1-GwqzvVU7Kg1jmdKcDj6gslIHgyc=
+
 gauge@~2.7.3:
   version "2.7.4"
   resolved "https://registry.yarnpkg.com/gauge/-/gauge-2.7.4.tgz#2c03405c7538c39d7eb37b317022e325fb018bf7"
@@ -1890,6 +2191,13 @@ gitconfiglocal@^1.0.0:
   dependencies:
     ini "^1.3.2"
 
+glob-parent@^5.0.0:
+  version "5.1.0"
+  resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-5.1.0.tgz#5f4c1d1e748d30cd73ad2944b3577a81b081e8c2"
+  integrity sha512-qjtRgnIVmOfnKUE3NJAQEdk+lKrxfw8t5ke7SXtfMTHcjsBfOfWXCQfdb30zfDoZQ2IRSIiidmjtbHZPZ++Ihw==
+  dependencies:
+    is-glob "^4.0.1"
+
 glob@^7.0.0, glob@^7.1.1, glob@^7.1.2, glob@^7.1.3:
   version "7.1.4"
   resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.4.tgz#aa608a2f6c577ad357e1ae5a5c26d9a8d1969255"
@@ -1902,6 +2210,18 @@ glob@^7.0.0, glob@^7.1.1, glob@^7.1.2, glob@^7.1.3:
     once "^1.3.0"
     path-is-absolute "^1.0.0"
 
+glob@^7.1.6:
+  version "7.1.6"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.6.tgz#141f33b81a7c2492e125594307480c46679278a6"
+  integrity sha512-LwaxwyZ72Lk7vZINtNNrywX0ZuLyStrdDtabefZKAY5ZGJhVtgdznluResxNmPitE0SAO+O26sWTHeKSI2wMBA==
+  dependencies:
+    fs.realpath "^1.0.0"
+    inflight "^1.0.4"
+    inherits "2"
+    minimatch "^3.0.4"
+    once "^1.3.0"
+    path-is-absolute "^1.0.0"
+
 global-dirs@^0.1.1:
   version "0.1.1"
   resolved "https://registry.yarnpkg.com/global-dirs/-/global-dirs-0.1.1.tgz#b319c0dd4607f353f3be9cca4c72fc148c49f445"
@@ -1914,6 +2234,13 @@ globals@^11.1.0:
   resolved "https://registry.yarnpkg.com/globals/-/globals-11.12.0.tgz#ab8795338868a0babd8525758018c2a7eb95c42e"
   integrity sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==
 
+globals@^12.1.0:
+  version "12.3.0"
+  resolved "https://registry.yarnpkg.com/globals/-/globals-12.3.0.tgz#1e564ee5c4dded2ab098b0f88f24702a3c56be13"
+  integrity sha512-wAfjdLgFsPZsklLJvOBUBmzYE8/CwhEqSBEMRXA3qxIiNtyqvjYurAtIfDh6chlEPUfmTY3MnZh5Hfh4q0UlIw==
+  dependencies:
+    type-fest "^0.8.1"
+
 graceful-fs@^4.1.11, graceful-fs@^4.1.15, graceful-fs@^4.1.2, graceful-fs@^4.1.3, graceful-fs@^4.1.6, graceful-fs@^4.2.0:
   version "4.2.2"
   resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-4.2.2.tgz#6f0952605d0140c1cfdb138ed005775b92d67b02"
@@ -1980,6 +2307,11 @@ has-symbols@^1.0.0:
   resolved "https://registry.yarnpkg.com/has-symbols/-/has-symbols-1.0.0.tgz#ba1a8f1af2a0fc39650f5c850367704122063b44"
   integrity sha1-uhqPGvKg/DllD1yFA2dwQSIGO0Q=
 
+has-symbols@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/has-symbols/-/has-symbols-1.0.1.tgz#9f5214758a44196c406d9bd76cebf81ec2dd31e8"
+  integrity sha512-PLcsoqu++dmEIZB+6totNFKq/7Do+Z0u4oT0zKOJNl3lYK6vGwwu2hjHs+68OEZbTjiUE9bgOABXbP/GvrS0Kg==
+
 has-unicode@^2.0.0:
   version "2.0.1"
   resolved "https://registry.yarnpkg.com/has-unicode/-/has-unicode-2.0.1.tgz#e0e6fe6a28cf51138855e086d1691e771de2a8b9"
@@ -2066,7 +2398,7 @@ husky@^3.0.5:
     run-node "^1.0.0"
     slash "^3.0.0"
 
-iconv-lite@0.4.24, iconv-lite@^0.4.4:
+iconv-lite@0.4.24, iconv-lite@^0.4.24, iconv-lite@^0.4.4:
   version "0.4.24"
   resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.24.tgz#2022b4b25fbddc21d2f524974a474aafe733908b"
   integrity sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==
@@ -2080,6 +2412,11 @@ ignore-walk@^3.0.1:
   dependencies:
     minimatch "^3.0.4"
 
+ignore@^4.0.6:
+  version "4.0.6"
+  resolved "https://registry.yarnpkg.com/ignore/-/ignore-4.0.6.tgz#750e3db5862087b4737ebac8207ffd1ef27b25fc"
+  integrity sha512-cyFDKrqc/YdcWFniJhzI42+AzS+gNwmUzOSFcRCQYwySuBBBy/KjuxWLZ/FHEH6Moq1NizMOBWyTcv8O4OZIMg==
+
 import-fresh@^2.0.0:
   version "2.0.0"
   resolved "https://registry.yarnpkg.com/import-fresh/-/import-fresh-2.0.0.tgz#d81355c15612d386c61f9ddd3922d4304822a546"
@@ -2139,6 +2476,25 @@ ini@^1.3.2, ini@^1.3.4, ini@~1.3.0:
   resolved "https://registry.yarnpkg.com/ini/-/ini-1.3.5.tgz#eee25f56db1c9ec6085e0c22778083f596abf927"
   integrity sha512-RZY5huIKCMRWDUqZlEi72f/lmXKMvuszcMBduliQ3nnWbx9X/ZBQO7DijMEYS9EhHBb2qacRUMtC7svLwe0lcw==
 
+inquirer@^7.0.0:
+  version "7.0.0"
+  resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-7.0.0.tgz#9e2b032dde77da1db5db804758b8fea3a970519a"
+  integrity sha512-rSdC7zelHdRQFkWnhsMu2+2SO41mpv2oF2zy4tMhmiLWkcKbOAs87fWAJhVXttKVwhdZvymvnuM95EyEXg2/tQ==
+  dependencies:
+    ansi-escapes "^4.2.1"
+    chalk "^2.4.2"
+    cli-cursor "^3.1.0"
+    cli-width "^2.0.0"
+    external-editor "^3.0.3"
+    figures "^3.0.0"
+    lodash "^4.17.15"
+    mute-stream "0.0.8"
+    run-async "^2.2.0"
+    rxjs "^6.4.0"
+    string-width "^4.1.0"
+    strip-ansi "^5.1.0"
+    through "^2.3.6"
+
 interpret@^1.0.0:
   version "1.2.0"
   resolved "https://registry.yarnpkg.com/interpret/-/interpret-1.2.0.tgz#d5061a6224be58e8083985f5014d844359576296"
@@ -2241,6 +2597,11 @@ is-extendable@^1.0.1:
   dependencies:
     is-plain-object "^2.0.4"
 
+is-extglob@^2.1.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2"
+  integrity sha1-qIwCU1eR8C7TfHahueqXc8gz+MI=
+
 is-finite@^1.0.0:
   version "1.0.2"
   resolved "https://registry.yarnpkg.com/is-finite/-/is-finite-1.0.2.tgz#cc6677695602be550ef11e8b4aa6305342b6d0aa"
@@ -2260,11 +2621,23 @@ is-fullwidth-code-point@^2.0.0:
   resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz#a3b30a5c4f199183167aaab93beefae3ddfb654f"
   integrity sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=
 
+is-fullwidth-code-point@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz#f116f8064fe90b3f7844a38997c0b75051269f1d"
+  integrity sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==
+
 is-generator-fn@^2.0.0:
   version "2.1.0"
   resolved "https://registry.yarnpkg.com/is-generator-fn/-/is-generator-fn-2.1.0.tgz#7d140adc389aaf3011a8f2a2a4cfa6faadffb118"
   integrity sha512-cTIB4yPYL/Grw0EaSzASzg6bBy9gqCofvWN8okThAYIxKJZC+udlRAmGbM0XLeniEJSs8uEgHPGuHSe1XsOLSQ==
 
+is-glob@^4.0.0, is-glob@^4.0.1:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.1.tgz#7567dbe9f2f5e2467bc77ab83c4a29482407a5dc"
+  integrity sha512-5G0tKtBTFImOqDnLB2hG6Bp2qcKEFduo4tZu9MT/H6NQv/ghhy30o55ufafxJ/LdH79LLs2Kfrn85TLKyA7BUg==
+  dependencies:
+    is-extglob "^2.1.1"
+
 is-number@^3.0.0:
   version "3.0.0"
   resolved "https://registry.yarnpkg.com/is-number/-/is-number-3.0.0.tgz#24fd6201a4782cf50561c810276afc7d12d71195"
@@ -2289,6 +2662,11 @@ is-plain-object@^2.0.3, is-plain-object@^2.0.4:
   dependencies:
     isobject "^3.0.1"
 
+is-promise@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/is-promise/-/is-promise-2.1.0.tgz#79a2a9ece7f096e80f36d2b2f3bc16c1ff4bf3fa"
+  integrity sha1-eaKp7OfwlugPNtKy87wWwf9L8/o=
+
 is-regex@^1.0.4:
   version "1.0.4"
   resolved "https://registry.yarnpkg.com/is-regex/-/is-regex-1.0.4.tgz#5517489b547091b0930e095654ced25ee97e9491"
@@ -2843,6 +3221,11 @@ json-schema@0.2.3:
   resolved "https://registry.yarnpkg.com/json-schema/-/json-schema-0.2.3.tgz#b480c892e59a2f05954ce727bd3f2a4e882f9e13"
   integrity sha1-tIDIkuWaLwWVTOcnvT8qTogvnhM=
 
+json-stable-stringify-without-jsonify@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/json-stable-stringify-without-jsonify/-/json-stable-stringify-without-jsonify-1.0.1.tgz#9db7b59496ad3f3cfef30a75142d2d930ad72651"
+  integrity sha1-nbe1lJatPzz+8wp1FC0tkwrXJlE=
+
 json-stringify-safe@^5.0.1, json-stringify-safe@~5.0.1:
   version "5.0.1"
   resolved "https://registry.yarnpkg.com/json-stringify-safe/-/json-stringify-safe-5.0.1.tgz#1296a2d58fd45f19a0f6ce01d65701e2c735b6eb"
@@ -2877,6 +3260,14 @@ jsprim@^1.2.2:
     json-schema "0.2.3"
     verror "1.10.0"
 
+jsx-ast-utils@^2.2.3:
+  version "2.2.3"
+  resolved "https://registry.yarnpkg.com/jsx-ast-utils/-/jsx-ast-utils-2.2.3.tgz#8a9364e402448a3ce7f14d357738310d9248054f"
+  integrity sha512-EdIHFMm+1BPynpKOpdPqiOsvnIrInRGJD7bzPZdPkjitQEqpdpUuFpq4T0npZFKTiB3RhWFdGN+oqOJIdhDhQA==
+  dependencies:
+    array-includes "^3.0.3"
+    object.assign "^4.1.0"
+
 kind-of@^3.0.2, kind-of@^3.0.3, kind-of@^3.2.0:
   version "3.2.2"
   resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-3.2.2.tgz#31ea21a734bab9bbb0f32466d893aea51e4a3c64"
@@ -2916,7 +3307,7 @@ leven@^3.1.0:
   resolved "https://registry.yarnpkg.com/leven/-/leven-3.1.0.tgz#77891de834064cccba82ae7842bb6b14a13ed7f2"
   integrity sha512-qsda+H8jTaUaN/x5vzW2rzc+8Rw4TAQ/4KjB46IwK5VH+IlVeeeje/EoZRpiXvIqjFgK84QffqPztGI3VBLG1A==
 
-levn@~0.3.0:
+levn@^0.3.0, levn@~0.3.0:
   version "0.3.0"
   resolved "https://registry.yarnpkg.com/levn/-/levn-0.3.0.tgz#3b09924edf9f083c0490fdd4c0bc4421e04764ee"
   integrity sha1-OwmSTt+fCDwEkP3UwLxEIeBHZO4=
@@ -3008,12 +3399,17 @@ lodash.templatesettings@^4.0.0:
   dependencies:
     lodash._reinterpolate "^3.0.0"
 
+lodash.unescape@4.0.1:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/lodash.unescape/-/lodash.unescape-4.0.1.tgz#bf2249886ce514cda112fae9218cdc065211fc9c"
+  integrity sha1-vyJJiGzlFM2hEvrpIYzcBlIR/Jw=
+
 lodash@4.17.14:
   version "4.17.14"
   resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.14.tgz#9ce487ae66c96254fe20b599f21b6816028078ba"
   integrity sha512-mmKYbW3GLuJeX+iGP+Y7Gp1AiGHGbXHCOh/jZmrawMmsE7MS4znI3RL2FsjbqOyMayHInjOeykW7PEajUk1/xw==
 
-lodash@^4.14.14, lodash@^4.17.11, lodash@^4.17.13, lodash@^4.17.15, lodash@^4.2.1:
+lodash@^4.14.14, lodash@^4.17.11, lodash@^4.17.13, lodash@^4.17.14, lodash@^4.17.15, lodash@^4.2.1:
   version "4.17.15"
   resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.15.tgz#b447f6670a0455bbfeedd11392eff330ea097548"
   integrity sha512-8xOcRHvCjnocdS5cpwXQXVzmmh5e5+saE2QGoeQmbKmRS6J3VQppPOIt0MnmE+4xlZoumy0GPG0D0MVIQbNA1A==
@@ -3167,6 +3563,11 @@ mime-types@^2.1.12, mime-types@~2.1.19:
   dependencies:
     mime-db "1.40.0"
 
+mimic-fn@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/mimic-fn/-/mimic-fn-2.1.0.tgz#7ed2c2ccccaf84d3ffcb7a69b57711fc2083401b"
+  integrity sha512-OqbOk5oEQeAZ8WXWydlu9HJjz9WVdEIvamMCcXmuqUYjTknH/sqsWvhQ3vgwKFRR1HpjvNBKQ37nbJgYzGqGcg==
+
 minimatch@^3.0.0, minimatch@^3.0.4:
   version "3.0.4"
   resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083"
@@ -3242,6 +3643,11 @@ ms@^2.1.1:
   resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.2.tgz#d09d1f357b443f493382a8eb3ccd183872ae6009"
   integrity sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==
 
+mute-stream@0.0.8:
+  version "0.0.8"
+  resolved "https://registry.yarnpkg.com/mute-stream/-/mute-stream-0.0.8.tgz#1630c42b2251ff81e2a283de96a5497ea92e5e0d"
+  integrity sha512-nnbWWOkoWyUsTjKrhgD0dcz22mdkSnpYqbEjIm2nhwhuxlSkpywJmBo8h0ZqJdkp73mb90SssHkN4rsRaBAfAA==
+
 nan@^2.12.1:
   version "2.14.0"
   resolved "https://registry.yarnpkg.com/nan/-/nan-2.14.0.tgz#7818f722027b2459a86f0295d434d1fc2336c52c"
@@ -3414,7 +3820,12 @@ object-inspect@^1.6.0:
   resolved "https://registry.yarnpkg.com/object-inspect/-/object-inspect-1.6.0.tgz#c70b6cbf72f274aab4c34c0c82f5167bf82cf15b"
   integrity sha512-GJzfBZ6DgDAmnuaM3104jR4s1Myxr3Y3zfIyN4z3UdqN69oSRacNK8UhnobDdC+7J2AHCjGwxQubNJfE70SXXQ==
 
-object-keys@^1.0.12, object-keys@^1.1.1:
+object-inspect@^1.7.0:
+  version "1.7.0"
+  resolved "https://registry.yarnpkg.com/object-inspect/-/object-inspect-1.7.0.tgz#f4f6bd181ad77f006b5ece60bd0b6f398ff74a67"
+  integrity sha512-a7pEHdh1xKIAgTySUGgLMx/xwDZskN1Ud6egYYN3EdRW4ZMPNEDUTF+hwy2LUC+Bl+SyLXANnwz/jyh/qutKUw==
+
+object-keys@^1.0.11, object-keys@^1.0.12, object-keys@^1.1.1:
   version "1.1.1"
   resolved "https://registry.yarnpkg.com/object-keys/-/object-keys-1.1.1.tgz#1c47f272df277f3b1daf061677d9c82e2322c60e"
   integrity sha512-NuAESUOUMrlIXOfHKzD6bpPu3tYt3xvjNdRIQ+FeT0lNb4K8WR70CaDxhuNguS2XG+GjkyMwOzsN5ZktImfhLA==
@@ -3426,6 +3837,36 @@ object-visit@^1.0.0:
   dependencies:
     isobject "^3.0.0"
 
+object.assign@^4.1.0:
+  version "4.1.0"
+  resolved "https://registry.yarnpkg.com/object.assign/-/object.assign-4.1.0.tgz#968bf1100d7956bb3ca086f006f846b3bc4008da"
+  integrity sha512-exHJeq6kBKj58mqGyTQ9DFvrZC/eR6OwxzoM9YRoGBqrXYonaFyGiFMuc9VZrXf7DarreEwMpurG3dd+CNyW5w==
+  dependencies:
+    define-properties "^1.1.2"
+    function-bind "^1.1.1"
+    has-symbols "^1.0.0"
+    object-keys "^1.0.11"
+
+object.entries@^1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/object.entries/-/object.entries-1.1.0.tgz#2024fc6d6ba246aee38bdb0ffd5cfbcf371b7519"
+  integrity sha512-l+H6EQ8qzGRxbkHOd5I/aHRhHDKoQXQ8g0BYt4uSweQU1/J6dZUOyWh9a2Vky35YCKjzmgxOzta2hH6kf9HuXA==
+  dependencies:
+    define-properties "^1.1.3"
+    es-abstract "^1.12.0"
+    function-bind "^1.1.1"
+    has "^1.0.3"
+
+object.fromentries@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/object.fromentries/-/object.fromentries-2.0.1.tgz#050f077855c7af8ae6649f45c80b16ee2d31e704"
+  integrity sha512-PUQv8Hbg3j2QX0IQYv3iAGCbGcu4yY4KQ92/dhA4sFSixBmSmp13UpDLs6jGK8rBtbmhNNIK99LD2k293jpiGA==
+  dependencies:
+    define-properties "^1.1.3"
+    es-abstract "^1.15.0"
+    function-bind "^1.1.1"
+    has "^1.0.3"
+
 object.getownpropertydescriptors@^2.0.3:
   version "2.0.3"
   resolved "https://registry.yarnpkg.com/object.getownpropertydescriptors/-/object.getownpropertydescriptors-2.0.3.tgz#8758c846f5b407adab0f236e0986f14b051caa16"
@@ -3441,6 +3882,16 @@ object.pick@^1.3.0:
   dependencies:
     isobject "^3.0.1"
 
+object.values@^1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/object.values/-/object.values-1.1.0.tgz#bf6810ef5da3e5325790eaaa2be213ea84624da9"
+  integrity sha512-8mf0nKLAoFX6VlNVdhGj31SVYpaNFtUnuoOXWyFEstsWRgU837AK+JYM0iAxwkSzGRbwn8cbFmgbyxj1j4VbXg==
+  dependencies:
+    define-properties "^1.1.3"
+    es-abstract "^1.12.0"
+    function-bind "^1.1.1"
+    has "^1.0.3"
+
 once@^1.3.0, once@^1.3.1, once@^1.4.0:
   version "1.4.0"
   resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1"
@@ -3448,6 +3899,13 @@ once@^1.3.0, once@^1.3.1, once@^1.4.0:
   dependencies:
     wrappy "1"
 
+onetime@^5.1.0:
+  version "5.1.0"
+  resolved "https://registry.yarnpkg.com/onetime/-/onetime-5.1.0.tgz#fff0f3c91617fe62bb50189636e99ac8a6df7be5"
+  integrity sha512-5NcSkPHhwTVFIQN+TUqXoS5+dlElHXdpAWu9I0HP20YOtIi+aZ0Ct82jdlILDxjLEAWwvm+qj1m6aEtsDVmm6Q==
+  dependencies:
+    mimic-fn "^2.1.0"
+
 opencollective-postinstall@^2.0.2:
   version "2.0.2"
   resolved "https://registry.yarnpkg.com/opencollective-postinstall/-/opencollective-postinstall-2.0.2.tgz#5657f1bede69b6e33a45939b061eb53d3c6c3a89"
@@ -3473,12 +3931,24 @@ optionator@^0.8.1:
     type-check "~0.3.2"
     wordwrap "~1.0.0"
 
+optionator@^0.8.3:
+  version "0.8.3"
+  resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.8.3.tgz#84fa1d036fe9d3c7e21d99884b601167ec8fb495"
+  integrity sha512-+IW9pACdk3XWmmTXG8m3upGUJst5XRGzxMRjXzAuJ1XnIFNvfhjjIuYkDvysnPQ7qzqVzLt78BCruntqRhWQbA==
+  dependencies:
+    deep-is "~0.1.3"
+    fast-levenshtein "~2.0.6"
+    levn "~0.3.0"
+    prelude-ls "~1.1.2"
+    type-check "~0.3.2"
+    word-wrap "~1.2.3"
+
 os-homedir@^1.0.0:
   version "1.0.2"
   resolved "https://registry.yarnpkg.com/os-homedir/-/os-homedir-1.0.2.tgz#ffbc4988336e0e833de0c168c7ef152121aa7fb3"
   integrity sha1-/7xJiDNuDoM94MFox+8VISGqf7M=
 
-os-tmpdir@^1.0.0:
+os-tmpdir@^1.0.0, os-tmpdir@~1.0.2:
   version "1.0.2"
   resolved "https://registry.yarnpkg.com/os-tmpdir/-/os-tmpdir-1.0.2.tgz#bbe67406c79aa85c5cfec766fe5734555dfa1274"
   integrity sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=
@@ -3743,7 +4213,7 @@ process-nextick-args@~2.0.0:
   resolved "https://registry.yarnpkg.com/process-nextick-args/-/process-nextick-args-2.0.1.tgz#7820d9b16120cc55ca9ae7792680ae7dba6d7fe2"
   integrity sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag==
 
-progress@^2.0.3:
+progress@^2.0.0, progress@^2.0.3:
   version "2.0.3"
   resolved "https://registry.yarnpkg.com/progress/-/progress-2.0.3.tgz#7e8cf8d8f5b8f239c1bc68beb4eb78567d572ef8"
   integrity sha512-7PiHtLll5LdnKIMw100I+8xJXR5gW2QwWYkT6iJva0bXitZKa/XMrSbdmg3r2Xnaidz9Qumd0VPaMrZlF9V9sA==
@@ -3756,7 +4226,7 @@ prompts@^2.0.1:
     kleur "^3.0.3"
     sisteransi "^1.0.3"
 
-prop-types@^15.6.2:
+prop-types@^15.6.2, prop-types@^15.7.2:
   version "15.7.2"
   resolved "https://registry.yarnpkg.com/prop-types/-/prop-types-15.7.2.tgz#52c41e75b8c87e72b9d9360e0206b99dcbffa6c5"
   integrity sha512-8QQikdH7//R2vurIJSutZ1smHYTcLpRWEOlHnzcWHmBYrOGUysKwSsrC89BCiFj3CbrfJ/nXFdJepOVrY1GCHQ==
@@ -3969,6 +4439,16 @@ regex-not@^1.0.0, regex-not@^1.0.2:
     extend-shallow "^3.0.2"
     safe-regex "^1.1.0"
 
+regexpp@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/regexpp/-/regexpp-2.0.1.tgz#8d19d31cf632482b589049f8281f93dbcba4d07f"
+  integrity sha512-lv0M6+TkDVniA3aD1Eg0DVpfU/booSu7Eev3TDO/mZKHBfVjgCGTV4t4buppESEYDtkArYFOxTJWv6S5C+iaNw==
+
+regexpp@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/regexpp/-/regexpp-3.0.0.tgz#dd63982ee3300e67b41c1956f850aa680d9d330e"
+  integrity sha512-Z+hNr7RAVWxznLPuA7DIh8UNX1j9CDrUQxskw9IrBE1Dxue2lyXT+shqEIeLUjrokxIP8CMy1WkjgG3rTsd5/g==
+
 remove-trailing-separator@^1.0.1:
   version "1.1.0"
   resolved "https://registry.yarnpkg.com/remove-trailing-separator/-/remove-trailing-separator-1.1.0.tgz#c24bce2a283adad5bc3f58e0d48249b92379d8ef"
@@ -4096,11 +4576,33 @@ resolve@1.x, resolve@^1.1.6, resolve@^1.10.0, resolve@^1.3.2:
   dependencies:
     path-parse "^1.0.6"
 
+resolve@^1.13.1:
+  version "1.13.1"
+  resolved "https://registry.yarnpkg.com/resolve/-/resolve-1.13.1.tgz#be0aa4c06acd53083505abb35f4d66932ab35d16"
+  integrity sha512-CxqObCX8K8YtAhOBRg+lrcdn+LK+WYOS8tSjqSFbjtrI5PnS63QPhZl4+yKfrU9tdsbMu9Anr/amegT87M9Z6w==
+  dependencies:
+    path-parse "^1.0.6"
+
+restore-cursor@^3.1.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/restore-cursor/-/restore-cursor-3.1.0.tgz#39f67c54b3a7a58cea5236d95cf0034239631f7e"
+  integrity sha512-l+sSefzHpj5qimhFSE5a8nufZYAM3sBSVMAPtYkmC+4EH2anSGaEMXSD0izRQbu9nfyQ9y5JrVmp7E8oZrUjvA==
+  dependencies:
+    onetime "^5.1.0"
+    signal-exit "^3.0.2"
+
 ret@~0.1.10:
   version "0.1.15"
   resolved "https://registry.yarnpkg.com/ret/-/ret-0.1.15.tgz#b8a4825d5bdb1fc3f6f53c2bc33f81388681c7bc"
   integrity sha512-TTlYpa+OL+vMMNG24xSlQGEJ3B/RzEfUlLct7b5G/ytav+wPrplCpVMFuwzXbkecJrb6IYo1iFb0S9v37754mg==
 
+rimraf@2.6.3:
+  version "2.6.3"
+  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.6.3.tgz#b2d104fe0d8fb27cf9e0a1cda8262dd3833c6cab"
+  integrity sha512-mwqeW5XsA2qAejG46gYdENaxXjx9onRNCfn7L0duuP4hCuTIi/QO7PDK07KJfp1d+izWPrzEJDcSqBa0OZQriA==
+  dependencies:
+    glob "^7.1.3"
+
 rimraf@^2.5.2, rimraf@^2.5.4, rimraf@^2.6.1, rimraf@^2.6.3:
   version "2.7.1"
   resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.7.1.tgz#35797f13a7fdadc566142c29d4f07ccad483e3ec"
@@ -4113,11 +4615,25 @@ rsvp@^4.8.4:
   resolved "https://registry.yarnpkg.com/rsvp/-/rsvp-4.8.5.tgz#c8f155311d167f68f21e168df71ec5b083113734"
   integrity sha512-nfMOlASu9OnRJo1mbEk2cz0D56a1MBNrJ7orjRZQG10XDyuvwksKbuXNp6qa+kbn839HwjwhBzhFmdsaEAfauA==
 
+run-async@^2.2.0:
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/run-async/-/run-async-2.3.0.tgz#0371ab4ae0bdd720d4166d7dfda64ff7a445a6c0"
+  integrity sha1-A3GrSuC91yDUFm19/aZP96RFpsA=
+  dependencies:
+    is-promise "^2.1.0"
+
 run-node@^1.0.0:
   version "1.0.0"
   resolved "https://registry.yarnpkg.com/run-node/-/run-node-1.0.0.tgz#46b50b946a2aa2d4947ae1d886e9856fd9cabe5e"
   integrity sha512-kc120TBlQ3mih1LSzdAJXo4xn/GWS2ec0l3S+syHDXP9uRr0JAT8Qd3mdMuyjqCzeZktgP3try92cEgf9Nks8A==
 
+rxjs@^6.4.0:
+  version "6.5.3"
+  resolved "https://registry.yarnpkg.com/rxjs/-/rxjs-6.5.3.tgz#510e26317f4db91a7eb1de77d9dd9ba0a4899a3a"
+  integrity sha512-wuYsAYYFdWTAnAaPoKGNhfpWwKZbJW+HgAJ+mImp+Epl7BG8oNWBCTyRM8gba9k4lk8BgWdoYm21Mo/RYhhbgA==
+  dependencies:
+    tslib "^1.9.0"
+
 safe-buffer@^5.0.1, safe-buffer@^5.1.2, safe-buffer@~5.2.0:
   version "5.2.0"
   resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.2.0.tgz#b74daec49b1148f88c64b68d49b1e815c1f2f519"
@@ -4183,7 +4699,7 @@ semver@6.2.0:
   resolved "https://registry.yarnpkg.com/semver/-/semver-6.2.0.tgz#4d813d9590aaf8a9192693d6c85b9344de5901db"
   integrity sha512-jdFC1VdUGT/2Scgbimf7FSx9iJLXoqfglSF+gJeuNWVpiE37OIbc1jywR/GJyFdz3mnkz2/id0L0J/cr0izR5A==
 
-semver@^6.0.0, semver@^6.2.0:
+semver@^6.0.0, semver@^6.1.2, semver@^6.2.0, semver@^6.3.0:
   version "6.3.0"
   resolved "https://registry.yarnpkg.com/semver/-/semver-6.3.0.tgz#ee0a64c8af5e8ceea67687b133761e1becbd1d3d"
   integrity sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==
@@ -4249,6 +4765,15 @@ slash@^3.0.0:
   resolved "https://registry.yarnpkg.com/slash/-/slash-3.0.0.tgz#6539be870c165adbd5240220dbe361f1bc4d4634"
   integrity sha512-g9Q1haeby36OSStwb4ntCGGGaKsaVSjQ68fBxoQcutl5fS1vuY18H3wSt3jFyFtrkx+Kz0V1G85A4MyAdDMi2Q==
 
+slice-ansi@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/slice-ansi/-/slice-ansi-2.1.0.tgz#cacd7693461a637a5788d92a7dd4fba068e81636"
+  integrity sha512-Qu+VC3EwYLldKa1fCxuuvULvSJOKEgk9pi8dZeCVK7TqBfUNTH4sFkk4joj8afVSfAYgJoSOetjx9QWOJ5mYoQ==
+  dependencies:
+    ansi-styles "^3.2.0"
+    astral-regex "^1.0.0"
+    is-fullwidth-code-point "^2.0.0"
+
 snapdragon-node@^2.0.1:
   version "2.1.1"
   resolved "https://registry.yarnpkg.com/snapdragon-node/-/snapdragon-node-2.1.1.tgz#6c175f86ff14bdb0724563e8f3c1b021a286853b"
@@ -4432,7 +4957,16 @@ string-width@^3.0.0, string-width@^3.1.0:
     is-fullwidth-code-point "^2.0.0"
     strip-ansi "^5.1.0"
 
-string.prototype.trimleft@^2.0.0:
+string-width@^4.1.0:
+  version "4.2.0"
+  resolved "https://registry.yarnpkg.com/string-width/-/string-width-4.2.0.tgz#952182c46cc7b2c313d1596e623992bd163b72b5"
+  integrity sha512-zUz5JD+tgqtuDjMhwIg5uFVV3dtqZ9yQJlZVfq4I01/K5Paj5UHj7VyrQOJvzawSVlKpObApbfD0Ed6yJc+1eg==
+  dependencies:
+    emoji-regex "^8.0.0"
+    is-fullwidth-code-point "^3.0.0"
+    strip-ansi "^6.0.0"
+
+string.prototype.trimleft@^2.0.0, string.prototype.trimleft@^2.1.0:
   version "2.1.0"
   resolved "https://registry.yarnpkg.com/string.prototype.trimleft/-/string.prototype.trimleft-2.1.0.tgz#6cc47f0d7eb8d62b0f3701611715a3954591d634"
   integrity sha512-FJ6b7EgdKxxbDxc79cOlok6Afd++TTs5szo+zJTUyow3ycrRfJVE2pq3vcN53XexvKZu/DJMDfeI/qMiZTrjTw==
@@ -4440,7 +4974,7 @@ string.prototype.trimleft@^2.0.0:
     define-properties "^1.1.3"
     function-bind "^1.1.1"
 
-string.prototype.trimright@^2.0.0:
+string.prototype.trimright@^2.0.0, string.prototype.trimright@^2.1.0:
   version "2.1.0"
   resolved "https://registry.yarnpkg.com/string.prototype.trimright/-/string.prototype.trimright-2.1.0.tgz#669d164be9df9b6f7559fa8e89945b168a5a6c58"
   integrity sha512-fXZTSV55dNBwv16uw+hh5jkghxSnc5oHq+5K/gXgizHwAvMetdAJlHqqoFC1FSDVPYWLkAKl2cxpUT41sV7nSg==
@@ -4483,6 +5017,13 @@ strip-ansi@^5.0.0, strip-ansi@^5.1.0, strip-ansi@^5.2.0:
   dependencies:
     ansi-regex "^4.1.0"
 
+strip-ansi@^6.0.0:
+  version "6.0.0"
+  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-6.0.0.tgz#0b1571dd7669ccd4f3e06e14ef1eed26225ae532"
+  integrity sha512-AuvKTrTfQNYNIctbR1K/YGTR1756GycPsg7b9bdV9Duqur4gv6aKqHXah67Z8ImS7WEz5QVcOtlfW2rZEugt6w==
+  dependencies:
+    ansi-regex "^5.0.0"
+
 strip-bom@^2.0.0:
   version "2.0.0"
   resolved "https://registry.yarnpkg.com/strip-bom/-/strip-bom-2.0.0.tgz#6219a85616520491f35788bdbf1447a99c7e6b0e"
@@ -4512,6 +5053,11 @@ strip-indent@^2.0.0:
   resolved "https://registry.yarnpkg.com/strip-indent/-/strip-indent-2.0.0.tgz#5ef8db295d01e6ed6cbf7aab96998d7822527b68"
   integrity sha1-XvjbKV0B5u1sv3qrlpmNeCJSe2g=
 
+strip-json-comments@^3.0.1:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-3.0.1.tgz#85713975a91fb87bf1b305cca77395e40d2a64a7"
+  integrity sha512-VTyMAUfdm047mwKl+u79WIdrZxtFtn+nBxHeb844XBQ9uMNTuTHdx2hc5RiAJYqwTj3wc/xe5HLSdJSkJ+WfZw==
+
 strip-json-comments@~2.0.1:
   version "2.0.1"
   resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-2.0.1.tgz#3c531942e908c2697c0ec344858c286c7ca0a60a"
@@ -4536,6 +5082,16 @@ symbol-tree@^3.2.2:
   resolved "https://registry.yarnpkg.com/symbol-tree/-/symbol-tree-3.2.4.tgz#430637d248ba77e078883951fb9aa0eed7c63fa2"
   integrity sha512-9QNk5KwDF+Bvz+PyObkmSYjI5ksVUYtjW7AU22r2NKcfLJcXp96hkDWU3+XndOsUb+AQ9QhfzfCT2O+CNWT5Tw==
 
+table@^5.2.3:
+  version "5.4.6"
+  resolved "https://registry.yarnpkg.com/table/-/table-5.4.6.tgz#1292d19500ce3f86053b05f0e8e7e4a3bb21079e"
+  integrity sha512-wmEc8m4fjnob4gt5riFRtTu/6+4rSe12TpAELNSqHMfF3IqnA+CH37USM6/YR3qRZv7e56kAEAtd6nKZaxe0Ug==
+  dependencies:
+    ajv "^6.10.2"
+    lodash "^4.17.14"
+    slice-ansi "^2.1.0"
+    string-width "^3.0.0"
+
 tar@^4:
   version "4.4.11"
   resolved "https://registry.yarnpkg.com/tar/-/tar-4.4.11.tgz#7ac09801445a3cf74445ed27499136b5240ffb73"
@@ -4582,6 +5138,11 @@ text-extensions@^2.0.0:
   resolved "https://registry.yarnpkg.com/text-extensions/-/text-extensions-2.0.0.tgz#43eabd1b495482fae4a2bf65e5f56c29f69220f6"
   integrity sha512-F91ZqLgvi1E0PdvmxMgp+gcf6q8fMH7mhdwWfzXnl1k+GbpQDmi8l7DzLC5JTASKbwpY3TfxajAUzAXcv2NmsQ==
 
+text-table@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/text-table/-/text-table-0.2.0.tgz#7f5ee823ae805207c00af2df4a84ec3fcfa570b4"
+  integrity sha1-f17oI66AUgfACvLfSoTsP8+lcLQ=
+
 throat@^4.0.0:
   version "4.1.0"
   resolved "https://registry.yarnpkg.com/throat/-/throat-4.1.0.tgz#89037cbc92c56ab18926e6ba4cbb200e15672a6a"
@@ -4602,11 +5163,18 @@ through2@^3.0.0:
   dependencies:
     readable-stream "2 || 3"
 
-through@2, "through@>=2.2.7 <3":
+through@2, "through@>=2.2.7 <3", through@^2.3.6:
   version "2.3.8"
   resolved "https://registry.yarnpkg.com/through/-/through-2.3.8.tgz#0dd4c9ffaabc357960b1b724115d7e0e86a2e1f5"
   integrity sha1-DdTJ/6q8NXlgsbckEV1+Doai4fU=
 
+tmp@^0.0.33:
+  version "0.0.33"
+  resolved "https://registry.yarnpkg.com/tmp/-/tmp-0.0.33.tgz#6d34335889768d21b2bcda0aa277ced3b1bfadf9"
+  integrity sha512-jRCJlojKnZ3addtTOjdIqoRuPEKBvNXcGYqzO6zWZX8KfKEpnGY5jfggJQ3EjKuu8D4bJRr0y+cYJFmYbImXGw==
+  dependencies:
+    os-tmpdir "~1.0.2"
+
 tmpl@1.0.x:
   version "1.0.4"
   resolved "https://registry.yarnpkg.com/tmpl/-/tmpl-1.0.4.tgz#23640dd7b42d00433911140820e5cf440e521dd1"
@@ -4701,6 +5269,18 @@ ts-jest@^24.1.0:
     semver "^5.5"
     yargs-parser "10.x"
 
+tslib@^1.8.1, tslib@^1.9.0:
+  version "1.10.0"
+  resolved "https://registry.yarnpkg.com/tslib/-/tslib-1.10.0.tgz#c3c19f95973fb0a62973fb09d90d961ee43e5c8a"
+  integrity sha512-qOebF53frne81cf0S9B41ByenJ3/IuH8yJKngAX35CmiZySA0khhkovshKK+jGCaMnVomla7gVlIcc3EvKPbTQ==
+
+tsutils@^3.17.1:
+  version "3.17.1"
+  resolved "https://registry.yarnpkg.com/tsutils/-/tsutils-3.17.1.tgz#ed719917f11ca0dee586272b2ac49e015a2dd759"
+  integrity sha512-kzeQ5B8H3w60nFY2g8cJIuH7JDpsALXySGtwGJ0p2LSjLgay3NdIpqq5SoOBe46bKDW2iq25irHCr8wjomUS2g==
+  dependencies:
+    tslib "^1.8.1"
+
 tunnel-agent@^0.6.0:
   version "0.6.0"
   resolved "https://registry.yarnpkg.com/tunnel-agent/-/tunnel-agent-0.6.0.tgz#27a5dea06b36b04a0a9966774b290868f0fc40fd"
@@ -4725,6 +5305,11 @@ type-fest@^0.6.0:
   resolved "https://registry.yarnpkg.com/type-fest/-/type-fest-0.6.0.tgz#8d2a2370d3df886eb5c90ada1c5bf6188acf838b"
   integrity sha512-q+MB8nYR1KDLrgr4G5yemftpMC7/QLqVndBmEEdqzmNj5dcFOO4Oo8qlwZE3ULT3+Zim1F8Kq4cBnikNhlCMlg==
 
+type-fest@^0.8.1:
+  version "0.8.1"
+  resolved "https://registry.yarnpkg.com/type-fest/-/type-fest-0.8.1.tgz#09e249ebde851d3b1e48d27c105444667f17b83d"
+  integrity sha512-4dbzIzqvjtgiM5rw1k5rEHtBANKmdudhGyBEajN01fEyhaAIhsoKNy6y7+IN93IfpFtwY9iqi7kD+xwKhQsNJA==
+
 typedoc-default-themes@^0.7.2:
   version "0.7.2"
   resolved "https://registry.yarnpkg.com/typedoc-default-themes/-/typedoc-default-themes-0.7.2.tgz#1e9896f920b58e6da0bba9d7e643738d02405a5a"
@@ -4833,6 +5418,11 @@ uuid@^3.3.2:
   resolved "https://registry.yarnpkg.com/uuid/-/uuid-3.3.3.tgz#4568f0216e78760ee1dbf3a4d2cf53e224112866"
   integrity sha512-pW0No1RGHgzlpHJO1nsVrHKpOEIxkGg1xB+v0ZmdNH5OAeAwzAVrCnI2/6Mtx+Uys6iaylxa+D3g4j63IKKjSQ==
 
+v8-compile-cache@^2.0.3:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/v8-compile-cache/-/v8-compile-cache-2.1.0.tgz#e14de37b31a6d194f5690d67efc4e7f6fc6ab30e"
+  integrity sha512-usZBT3PW+LOjM25wbqIlZwPeJV+3OSz3M1k1Ws8snlW39dZyYL9lOGC5FgPVHfk0jKmjiDV8Z0mIbVQPiwFs7g==
+
 validate-npm-package-license@^3.0.1:
   version "3.0.4"
   resolved "https://registry.yarnpkg.com/validate-npm-package-license/-/validate-npm-package-license-3.0.4.tgz#fc91f6b9c7ba15c857f4cb2c5defeec39d4f410a"
@@ -4918,6 +5508,11 @@ wide-align@^1.1.0:
   dependencies:
     string-width "^1.0.2 || 2"
 
+word-wrap@~1.2.3:
+  version "1.2.3"
+  resolved "https://registry.yarnpkg.com/word-wrap/-/word-wrap-1.2.3.tgz#610636f6b1f703891bd34771ccb17fb93b47079c"
+  integrity sha512-Hz/mrNwitNRh/HUAtM/VT/5VH+ygD6DV7mYKZAtHOrbs8U7lvPS6xf7EJKMF0uW1KJCl0H701g3ZGus+muE5vQ==
+
 wordwrap@~0.0.2:
   version "0.0.3"
   resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-0.0.3.tgz#a3d5da6cd5c0bc0008d37234bbaf1bed63059107"
@@ -4951,6 +5546,13 @@ write-file-atomic@2.4.1:
     imurmurhash "^0.1.4"
     signal-exit "^3.0.2"
 
+write@1.0.3:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/write/-/write-1.0.3.tgz#0800e14523b923a387e415123c865616aae0f5c3"
+  integrity sha512-/lg70HAjtkUgWPVZhZcm+T4hkL8Zbtp1nFNOn3lRrxnlv50SRBv7cR7RqR+GMsd3hUXy9hWBo4CHTbFTcOYwig==
+  dependencies:
+    mkdirp "^0.5.1"
+
 ws@^5.2.0:
   version "5.2.2"
   resolved "https://registry.yarnpkg.com/ws/-/ws-5.2.2.tgz#dffef14866b8e8dc9133582514d1befaf96e980f"

From 039e3f562a305df11bdebf4230bfbd46ef27d60f Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Fl=C3=A1vio=20Caetano?= <flavio@vieiracaetano.com>
Date: Tue, 1 Oct 2019 15:38:53 -0300
Subject: [PATCH 2/4] chore(ESLint): configure project to work as a monorepo

---
 eslint-plugin/.babelrc                        |    3 -
 eslint-plugin/.gitignore                      |    1 -
 .../ESLintRuleExhaustiveDeps-test.js          |  179 +-
 eslint-plugin/{src => lib}/index.js           |    5 +-
 .../{src => lib}/rules/ExaustiveDeps.js       |  366 ++-
 eslint-plugin/package.json                    |    6 +-
 eslint-plugin/yarn.lock                       | 2746 +----------------
 jest.config.js                                |    2 +-
 package.json                                  |    4 +-
 src/__tests__/useDidUnmount.ts                |   16 +-
 src/__tests__/useLazyRef.ts                   |    8 +-
 src/__tests__/usePromisedState.ts             |   18 +-
 src/__tests__/useWorkerState.ts               |    4 +-
 src/index.tsx                                 |   84 +-
 yarn.lock                                     |   61 +-
 15 files changed, 450 insertions(+), 3053 deletions(-)
 delete mode 100644 eslint-plugin/.babelrc
 delete mode 100644 eslint-plugin/.gitignore
 rename eslint-plugin/{src => lib}/__tests__/ESLintRuleExhaustiveDeps-test.js (96%)
 rename eslint-plugin/{src => lib}/index.js (66%)
 rename eslint-plugin/{src => lib}/rules/ExaustiveDeps.js (88%)

diff --git a/eslint-plugin/.babelrc b/eslint-plugin/.babelrc
deleted file mode 100644
index 8aa924d..0000000
--- a/eslint-plugin/.babelrc
+++ /dev/null
@@ -1,3 +0,0 @@
-{
-  "presets": ["@babel/preset-env"]
-}
\ No newline at end of file
diff --git a/eslint-plugin/.gitignore b/eslint-plugin/.gitignore
deleted file mode 100644
index f1ff06d..0000000
--- a/eslint-plugin/.gitignore
+++ /dev/null
@@ -1 +0,0 @@
-lib/
\ No newline at end of file
diff --git a/eslint-plugin/src/__tests__/ESLintRuleExhaustiveDeps-test.js b/eslint-plugin/lib/__tests__/ESLintRuleExhaustiveDeps-test.js
similarity index 96%
rename from eslint-plugin/src/__tests__/ESLintRuleExhaustiveDeps-test.js
rename to eslint-plugin/lib/__tests__/ESLintRuleExhaustiveDeps-test.js
index cd50089..be2e969 100644
--- a/eslint-plugin/src/__tests__/ESLintRuleExhaustiveDeps-test.js
+++ b/eslint-plugin/lib/__tests__/ESLintRuleExhaustiveDeps-test.js
@@ -6,13 +6,13 @@
  *
  * Original Source: https://github.com/facebook/react/blob/9e64bf18e11828d6b4c0363bff5ed2eca1ccd838/packages/eslint-plugin-react-hooks/__tests__/ESLintRuleExhaustiveDeps-test.js
  */
-
 'use strict';
 
 const ESLintTester = require('eslint').RuleTester;
-const ReactHooksESLintPlugin = require('@react-hook-utilities/eslint-plugin');
-const ReactHooksESLintRule = ReactHooksESLintPlugin.rules['exhaustive-deps'];
 
+const ReactHooksESLintPlugin = require('..');
+
+const ReactHooksESLintRule = ReactHooksESLintPlugin.rules['exhaustive-deps'];
 ESLintTester.setDefaultConfig({
   parser: require.resolve('babel-eslint'),
   parserOptions: {
@@ -175,7 +175,7 @@ const tests = {
           const local1 = {};
           {
             const local2 = {};
-            useWorkerLoad(async () => {
+            useWorkerState(async () => {
               console.log(local1);
               console.log(local2);
             }, [local1, local2]);
@@ -189,7 +189,7 @@ const tests = {
           const local1 = {};
           function MyNestedComponent() {
             const local2 = {};
-            useWorkerLoad(async () => {
+            useWorkerState(async () => {
               console.log(local1);
               console.log(local2);
             }, [local2]);
@@ -495,8 +495,8 @@ const tests = {
           const [state4, dispatch2] = React.useReducer();
           const [state5, maybeSetState] = useFunnyState();
           const [state6, maybeDispatch] = useFunnyReducer();
-          const mySetState = useWorkerLoad(async () => {}, []);
-          let myDispatch = useWorkerLoad(async () => {}, []);
+          const mySetState = useWorkerState(async () => {}, []);
+          let myDispatch = useWorkerState(async () => {}, []);
 
           useAsyncEffect(async () => {
             // Known to be static
@@ -552,8 +552,8 @@ const tests = {
           const [state5, maybeSetState] = useFunnyState();
           const [state6, maybeDispatch] = useFunnyReducer();
 
-          const mySetState = useWorkerLoad(async () => {}, []);
-          let myDispatch = useWorkerLoad(async () => {}, []);
+          const mySetState = useWorkerState(async () => {}, []);
+          let myDispatch = useWorkerState(async () => {}, []);
 
           useAsyncEffect(async () => {
             // Known to be static
@@ -715,7 +715,7 @@ const tests = {
       // Valid because it's not an effect.
       code: `
         function useMyThing(myRef) {
-          useWorkerLoad(async () => {
+          useWorkerState(async () => {
             const handleMouse = () => {};
             myRef.current.addEventListener('mousemove', handleMouse);
             myRef.current.addEventListener('mousein', handleMouse);
@@ -856,10 +856,10 @@ const tests = {
       // Don't warn for this either.
       code: `
         function MyComponent(props) {
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             console.log(props.foo.bar.baz);
           }, [props]);
-          const fn2 = useWorkerLoad(async () => {
+          const fn2 = useWorkerState(async () => {
             console.log(props.foo.bar.baz);
           }, [props.foo]);
           const fn3 = useEffectUpdate(() => {
@@ -1204,7 +1204,7 @@ const tests = {
     {
       code: `
         function Example() {
-          const foo = useWorkerLoad(async () => {
+          const foo = useWorkerState(async () => {
             foo();
           }, []);
         }
@@ -1213,7 +1213,7 @@ const tests = {
     {
       code: `
         function Example({ prop }) {
-          const foo = useWorkerLoad(async () => {
+          const foo = useWorkerState(async () => {
             if (prop) {
               foo();
             }
@@ -1232,8 +1232,7 @@ const tests = {
           });
         }
       `,
-    },
-    // Ignore Generic Type Variables for arrow functions
+    }, // Ignore Generic Type Variables for arrow functions
     {
       code: `
         function Example({ prop }) {
@@ -1242,8 +1241,7 @@ const tests = {
           }, [prop]);
         }
       `,
-    },
-    // Ignore arguments keyword for arrow functions.
+    }, // Ignore arguments keyword for arrow functions.
     {
       code: `
         function Example() {
@@ -1739,7 +1737,7 @@ const tests = {
           const local1 = {};
           function MyNestedComponent() {
             const local2 = {};
-            useWorkerLoad(async () => {
+            useWorkerState(async () => {
               console.log(local1);
               console.log(local2);
             }, [local1]);
@@ -1751,7 +1749,7 @@ const tests = {
           const local1 = {};
           function MyNestedComponent() {
             const local2 = {};
-            useWorkerLoad(async () => {
+            useWorkerState(async () => {
               console.log(local1);
               console.log(local2);
             }, [local2]);
@@ -1759,7 +1757,7 @@ const tests = {
         }
       `,
       errors: [
-        "React Hook useWorkerLoad has a missing dependency: 'local2'. " +
+        "React Hook useWorkerState has a missing dependency: 'local2'. " +
           'Either include it or remove the dependency array. ' +
           "Outer scope values like 'local1' aren't valid dependencies " +
           "because mutating them doesn't re-render the component.",
@@ -1834,16 +1832,16 @@ const tests = {
     {
       code: `
         function MyComponent() {
-          useWorkerLoad(async () => {}, [window]);
+          useWorkerState(async () => {}, [window]);
         }
       `,
       output: `
         function MyComponent() {
-          useWorkerLoad(async () => {}, []);
+          useWorkerState(async () => {}, []);
         }
       `,
       errors: [
-        "React Hook useWorkerLoad has an unnecessary dependency: 'window'. " +
+        "React Hook useWorkerState has an unnecessary dependency: 'window'. " +
           'Either exclude it or remove the dependency array. ' +
           "Outer scope values like 'window' aren't valid dependencies " +
           "because mutating them doesn't re-render the component.",
@@ -1870,22 +1868,22 @@ const tests = {
       ],
     },
     {
-      // It is not valid for useWorkerLoad to specify extraneous deps
+      // It is not valid for useWorkerState to specify extraneous deps
       // because it doesn't serve as a side effect trigger unlike useAsyncEffect.
       code: `
         function MyComponent(props) {
           let local = props.foo;
-          useWorkerLoad(async () => {}, [local]);
+          useWorkerState(async () => {}, [local]);
         }
       `,
       output: `
         function MyComponent(props) {
           let local = props.foo;
-          useWorkerLoad(async () => {}, []);
+          useWorkerState(async () => {}, []);
         }
       `,
       errors: [
-        "React Hook useWorkerLoad has an unnecessary dependency: 'local'. " +
+        "React Hook useWorkerState has an unnecessary dependency: 'local'. " +
           'Either exclude it or remove the dependency array.',
       ],
     },
@@ -2265,7 +2263,7 @@ const tests = {
       ],
     },
     {
-      // It is not valid for useWorkerLoad to specify extraneous deps
+      // It is not valid for useWorkerState to specify extraneous deps
       // because it doesn't serve as a side effect trigger unlike useAsyncEffect.
       // However, we generally allow specifying *broader* deps as escape hatch.
       // So while [props, props.foo] is unnecessary, 'props' wins here as the
@@ -2273,7 +2271,7 @@ const tests = {
       code: `
         function MyComponent(props) {
           const local = {};
-          useWorkerLoad(async () => {
+          useWorkerState(async () => {
             console.log(props.foo);
             console.log(props.bar);
           }, [props, props.foo]);
@@ -2282,14 +2280,14 @@ const tests = {
       output: `
         function MyComponent(props) {
           const local = {};
-          useWorkerLoad(async () => {
+          useWorkerState(async () => {
             console.log(props.foo);
             console.log(props.bar);
           }, [props]);
         }
       `,
       errors: [
-        "React Hook useWorkerLoad has an unnecessary dependency: 'props.foo'. " +
+        "React Hook useWorkerState has an unnecessary dependency: 'props.foo'. " +
           'Either exclude it or remove the dependency array.',
       ],
     },
@@ -2298,7 +2296,7 @@ const tests = {
       code: `
         function MyComponent(props) {
           const local = {};
-          useWorkerLoad(async () => {
+          useWorkerState(async () => {
             console.log(props.foo);
             console.log(props.bar);
           }, []);
@@ -2307,14 +2305,14 @@ const tests = {
       output: `
         function MyComponent(props) {
           const local = {};
-          useWorkerLoad(async () => {
+          useWorkerState(async () => {
             console.log(props.foo);
             console.log(props.bar);
           }, [props.bar, props.foo]);
         }
       `,
       errors: [
-        "React Hook useWorkerLoad has missing dependencies: 'props.bar' and 'props.foo'. " +
+        "React Hook useWorkerState has missing dependencies: 'props.bar' and 'props.foo'. " +
           'Either include them or remove the dependency array.',
       ],
     },
@@ -2535,7 +2533,7 @@ const tests = {
       code: `
         function MyComponent() {
           const local = {id: 42};
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             console.log(local);
           }, [local.id]);
         }
@@ -2543,13 +2541,13 @@ const tests = {
       output: `
         function MyComponent() {
           const local = {id: 42};
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             console.log(local);
           }, [local]);
         }
       `,
       errors: [
-        "React Hook useWorkerLoad has a missing dependency: 'local'. " +
+        "React Hook useWorkerState has a missing dependency: 'local'. " +
           'Either include it or remove the dependency array.',
       ],
     },
@@ -2559,7 +2557,7 @@ const tests = {
       code: `
         function MyComponent() {
           const local = {id: 42};
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             console.log(local);
           }, [local.id, local]);
         }
@@ -2567,33 +2565,33 @@ const tests = {
       output: `
         function MyComponent() {
           const local = {id: 42};
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             console.log(local);
           }, [local]);
         }
       `,
       errors: [
-        "React Hook useWorkerLoad has an unnecessary dependency: 'local.id'. " +
+        "React Hook useWorkerState has an unnecessary dependency: 'local.id'. " +
           'Either exclude it or remove the dependency array.',
       ],
     },
     {
       code: `
         function MyComponent(props) {
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             console.log(props.foo.bar.baz);
           }, []);
         }
       `,
       output: `
         function MyComponent(props) {
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             console.log(props.foo.bar.baz);
           }, [props.foo.bar.baz]);
         }
       `,
       errors: [
-        "React Hook useWorkerLoad has a missing dependency: 'props.foo.bar.baz'. " +
+        "React Hook useWorkerState has a missing dependency: 'props.foo.bar.baz'. " +
           'Either include it or remove the dependency array.',
       ],
     },
@@ -2601,7 +2599,7 @@ const tests = {
       code: `
         function MyComponent(props) {
           let color = {}
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             console.log(props.foo.bar.baz);
             console.log(color);
           }, [props.foo, props.foo.bar.baz]);
@@ -2610,14 +2608,14 @@ const tests = {
       output: `
         function MyComponent(props) {
           let color = {}
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             console.log(props.foo.bar.baz);
             console.log(color);
           }, [color, props.foo.bar.baz]);
         }
       `,
       errors: [
-        "React Hook useWorkerLoad has a missing dependency: 'color'. " +
+        "React Hook useWorkerState has a missing dependency: 'color'. " +
           'Either include it or remove the dependency array.',
       ],
     },
@@ -2629,27 +2627,27 @@ const tests = {
       // TODO: maybe consider suggesting a narrower one by default in these cases.
       code: `
         function MyComponent(props) {
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             console.log(props.foo.bar.baz);
           }, [props.foo.bar.baz, props.foo]);
         }
       `,
       output: `
         function MyComponent(props) {
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             console.log(props.foo.bar.baz);
           }, [props.foo]);
         }
       `,
       errors: [
-        "React Hook useWorkerLoad has an unnecessary dependency: 'props.foo.bar.baz'. " +
+        "React Hook useWorkerState has an unnecessary dependency: 'props.foo.bar.baz'. " +
           'Either exclude it or remove the dependency array.',
       ],
     },
     {
       code: `
         function MyComponent(props) {
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             console.log(props.foo.bar.baz);
             console.log(props.foo.fizz.bizz);
           }, []);
@@ -2657,14 +2655,14 @@ const tests = {
       `,
       output: `
         function MyComponent(props) {
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             console.log(props.foo.bar.baz);
             console.log(props.foo.fizz.bizz);
           }, [props.foo.bar.baz, props.foo.fizz.bizz]);
         }
       `,
       errors: [
-        "React Hook useWorkerLoad has missing dependencies: 'props.foo.bar.baz' and 'props.foo.fizz.bizz'. " +
+        "React Hook useWorkerState has missing dependencies: 'props.foo.bar.baz' and 'props.foo.fizz.bizz'. " +
           'Either include them or remove the dependency array.',
       ],
     },
@@ -2677,27 +2675,27 @@ const tests = {
       // This is why we end up with just 'props.foo.bar', and not them both.
       code: `
         function MyComponent(props) {
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             console.log(props.foo.bar);
           }, [props.foo.bar.baz]);
         }
       `,
       output: `
         function MyComponent(props) {
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             console.log(props.foo.bar);
           }, [props.foo.bar]);
         }
       `,
       errors: [
-        "React Hook useWorkerLoad has a missing dependency: 'props.foo.bar'. " +
+        "React Hook useWorkerState has a missing dependency: 'props.foo.bar'. " +
           'Either include it or remove the dependency array.',
       ],
     },
     {
       code: `
         function MyComponent(props) {
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             console.log(props);
             console.log(props.hello);
           }, [props.foo.bar.baz]);
@@ -2705,14 +2703,14 @@ const tests = {
       `,
       output: `
         function MyComponent(props) {
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             console.log(props);
             console.log(props.hello);
           }, [props]);
         }
       `,
       errors: [
-        "React Hook useWorkerLoad has a missing dependency: 'props'. " +
+        "React Hook useWorkerState has a missing dependency: 'props'. " +
           'Either include it or remove the dependency array.',
       ],
     },
@@ -2784,7 +2782,7 @@ const tests = {
       code: `
         function MyComponent() {
           const local1 = {};
-          useWorkerLoad(async () => {
+          useWorkerState(async () => {
             const local1 = {};
             console.log(local1);
           }, [local1]);
@@ -2793,14 +2791,14 @@ const tests = {
       output: `
         function MyComponent() {
           const local1 = {};
-          useWorkerLoad(async () => {
+          useWorkerState(async () => {
             const local1 = {};
             console.log(local1);
           }, []);
         }
       `,
       errors: [
-        "React Hook useWorkerLoad has an unnecessary dependency: 'local1'. " +
+        "React Hook useWorkerState has an unnecessary dependency: 'local1'. " +
           'Either exclude it or remove the dependency array.',
       ],
     },
@@ -2808,17 +2806,17 @@ const tests = {
       code: `
         function MyComponent() {
           const local1 = {};
-          useWorkerLoad(async () => {}, [local1]);
+          useWorkerState(async () => {}, [local1]);
         }
       `,
       output: `
         function MyComponent() {
           const local1 = {};
-          useWorkerLoad(async () => {}, []);
+          useWorkerState(async () => {}, []);
         }
       `,
       errors: [
-        "React Hook useWorkerLoad has an unnecessary dependency: 'local1'. " +
+        "React Hook useWorkerState has an unnecessary dependency: 'local1'. " +
           'Either exclude it or remove the dependency array.',
       ],
     },
@@ -3057,7 +3055,7 @@ const tests = {
           useAsyncEffect(async () => {
             console.log(props.foo);
           }, []);
-          useWorkerLoad(async () => {
+          useWorkerState(async () => {
             console.log(props.foo);
           }, []);
           useEffectUpdate(() => {
@@ -3066,7 +3064,7 @@ const tests = {
           React.useAsyncEffect(async () => {
             console.log(props.foo);
           }, []);
-          React.useWorkerLoad(async () => {
+          React.useWorkerState(async () => {
             console.log(props.foo);
           }, []);
           React.useEffectUpdate(() => {
@@ -3082,7 +3080,7 @@ const tests = {
           useAsyncEffect(async () => {
             console.log(props.foo);
           }, [props.foo]);
-          useWorkerLoad(async () => {
+          useWorkerState(async () => {
             console.log(props.foo);
           }, [props.foo]);
           useEffectUpdate(() => {
@@ -3091,7 +3089,7 @@ const tests = {
           React.useAsyncEffect(async () => {
             console.log(props.foo);
           }, [props.foo]);
-          React.useWorkerLoad(async () => {
+          React.useWorkerState(async () => {
             console.log(props.foo);
           }, [props.foo]);
           React.useEffectUpdate(() => {
@@ -3105,13 +3103,13 @@ const tests = {
       errors: [
         "React Hook useAsyncEffect has a missing dependency: 'props.foo'. " +
           'Either include it or remove the dependency array.',
-        "React Hook useWorkerLoad has a missing dependency: 'props.foo'. " +
+        "React Hook useWorkerState has a missing dependency: 'props.foo'. " +
           'Either include it or remove the dependency array.',
         "React Hook useEffectUpdate has a missing dependency: 'props.foo'. " +
           'Either include it or remove the dependency array.',
         "React Hook React.useAsyncEffect has a missing dependency: 'props.foo'. " +
           'Either include it or remove the dependency array.',
-        "React Hook React.useWorkerLoad has a missing dependency: 'props.foo'. " +
+        "React Hook React.useWorkerState has a missing dependency: 'props.foo'. " +
           'Either include it or remove the dependency array.',
         "React Hook React.useEffectUpdate has a missing dependency: 'props.foo'. " +
           'Either include it or remove the dependency array.',
@@ -3373,7 +3371,7 @@ const tests = {
         function MyComponent({ activeTab, initY }) {
           const ref1 = useRef();
           const ref2 = useRef();
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             ref1.current.scrollTop = initY;
             ref2.current.scrollTop = initY;
           }, [ref1.current, ref2.current, activeTab, initY]);
@@ -3383,14 +3381,14 @@ const tests = {
         function MyComponent({ activeTab, initY }) {
           const ref1 = useRef();
           const ref2 = useRef();
-          const fn = useWorkerLoad(async () => {
+          const fn = useWorkerState(async () => {
             ref1.current.scrollTop = initY;
             ref2.current.scrollTop = initY;
           }, [initY]);
         }
       `,
       errors: [
-        "React Hook useWorkerLoad has unnecessary dependencies: 'activeTab', 'ref1.current', and 'ref2.current'. " +
+        "React Hook useWorkerState has unnecessary dependencies: 'activeTab', 'ref1.current', and 'ref2.current'. " +
           'Either exclude them or remove the dependency array. ' +
           "Mutable values like 'ref1.current' aren't valid dependencies " +
           "because mutating them doesn't re-render the component.",
@@ -4150,7 +4148,7 @@ const tests = {
           let x = props.foo;
           {
             let y = props.bar;
-            const fn = useWorkerLoad(async () => {
+            const fn = useWorkerState(async () => {
               // nothing
             }, [MutableStore.hello.world, props.foo, x, y, z, global.stuff]);
           }
@@ -4164,14 +4162,14 @@ const tests = {
           let x = props.foo;
           {
             let y = props.bar;
-            const fn = useWorkerLoad(async () => {
+            const fn = useWorkerState(async () => {
               // nothing
             }, []);
           }
         }
       `,
       errors: [
-        'React Hook useWorkerLoad has unnecessary dependencies: ' +
+        'React Hook useWorkerState has unnecessary dependencies: ' +
           "'MutableStore.hello.world', 'global.stuff', 'props.foo', 'x', 'y', and 'z'. " +
           'Either exclude them or remove the dependency array. ' +
           "Outer scope values like 'MutableStore.hello.world' aren't valid dependencies " +
@@ -4982,53 +4980,52 @@ const tests = {
     {
       code: `
         function Example() {
-          const foo = useWorkerLoad(async () => {
+          const foo = useWorkerState(async () => {
             foo();
           }, [foo]);
         }
       `,
       output: `
         function Example() {
-          const foo = useWorkerLoad(async () => {
+          const foo = useWorkerState(async () => {
             foo();
           }, []);
         }
       `,
       errors: [
-        "React Hook useWorkerLoad has an unnecessary dependency: 'foo'. " +
+        "React Hook useWorkerState has an unnecessary dependency: 'foo'. " +
           'Either exclude it or remove the dependency array.',
       ],
     },
     {
       code: `
         function Example({ prop }) {
-          const foo = useWorkerLoad(async () => {
+          const foo = useWorkerState(async () => {
             prop.hello(foo);
           }, [foo]);
-          const bar = useWorkerLoad(async () => {
+          const bar = useWorkerState(async () => {
             foo();
           }, [foo]);
         }
       `,
       output: `
         function Example({ prop }) {
-          const foo = useWorkerLoad(async () => {
+          const foo = useWorkerState(async () => {
             prop.hello(foo);
           }, [prop]);
-          const bar = useWorkerLoad(async () => {
+          const bar = useWorkerState(async () => {
             foo();
           }, [foo]);
         }
       `,
       errors: [
-        "React Hook useWorkerLoad has a missing dependency: 'prop'. " +
+        "React Hook useWorkerState has a missing dependency: 'prop'. " +
           'Either include it or remove the dependency array.',
       ],
     },
   ],
-};
+}; // For easier local testing
 
-// For easier local testing
 if (!process.env.CI) {
   let only = [];
   let skipped = [];
@@ -5037,23 +5034,27 @@ if (!process.env.CI) {
       delete t.skip;
       skipped.push(t);
     }
+
     if (t.only) {
       delete t.only;
       only.push(t);
-    }
-    // if (!t.options) {
+    } // if (!t.options) {
     //   t.options = [{ additionalHooks: 'useAsyncLayoutEffect' }];
     // }
   });
+
   const predicate = t => {
     if (only.length > 0) {
       return only.indexOf(t) !== -1;
     }
+
     if (skipped.length > 0) {
       return skipped.indexOf(t) === -1;
     }
+
     return true;
   };
+
   tests.valid = tests.valid.filter(predicate);
   tests.invalid = tests.invalid.filter(predicate);
 }
diff --git a/eslint-plugin/src/index.js b/eslint-plugin/lib/index.js
similarity index 66%
rename from eslint-plugin/src/index.js
rename to eslint-plugin/lib/index.js
index 3bbc31c..196d98c 100644
--- a/eslint-plugin/src/index.js
+++ b/eslint-plugin/lib/index.js
@@ -4,8 +4,7 @@
  */
 'use strict';
 
-import ExhaustiveDeps from './rules/ExaustiveDeps';
-
-export const rules = {
+const ExhaustiveDeps = require('./rules/ExaustiveDeps');
+exports.rules = {
   'exhaustive-deps': ExhaustiveDeps,
 };
diff --git a/eslint-plugin/src/rules/ExaustiveDeps.js b/eslint-plugin/lib/rules/ExaustiveDeps.js
similarity index 88%
rename from eslint-plugin/src/rules/ExaustiveDeps.js
rename to eslint-plugin/lib/rules/ExaustiveDeps.js
index 01fcde9..97036db 100644
--- a/eslint-plugin/src/rules/ExaustiveDeps.js
+++ b/eslint-plugin/lib/rules/ExaustiveDeps.js
@@ -7,11 +7,9 @@
  * Original source: https://github.com/facebook/react/blob/9e64bf18e11828d6b4c0363bff5ed2eca1ccd838/packages/eslint-plugin-react-hooks/src/ExhaustiveDeps.js
  */
 
-/* eslint-disable no-for-of-loops/no-for-of-loops */
-
 'use strict';
 
-export default {
+module.exports = {
   meta: {
     fixable: 'code',
     schema: [
@@ -21,12 +19,14 @@ export default {
       },
     ],
   },
+
   create(context) {
     // Should be shared between visitors.
     let setStateCallSites = new WeakMap();
     let stateVariables = new WeakSet();
     let staticKnownValueCache = new WeakMap();
     let functionWithoutCapturedValueCache = new WeakMap();
+
     function memoizeWithWeakMap(fn, map) {
       return function(arg) {
         if (map.has(arg)) {
@@ -34,6 +34,7 @@ export default {
           // console.log(arg.name)
           return map.get(arg);
         }
+
         const result = fn(arg);
         map.set(arg, result);
         return result;
@@ -44,10 +45,10 @@ export default {
       FunctionExpression: visitFunctionExpression,
       ArrowFunctionExpression: visitFunctionExpression,
     };
-
     /**
      * Visitor for both function expressions and arrow function expressions.
      */
+
     function visitFunctionExpression(node) {
       // We only want to lint nodes which are reactive hook callbacks.
       if (
@@ -59,25 +60,21 @@ export default {
       }
 
       const callbackIndex = getReactiveHookCallbackIndex(node.parent.callee);
+
       if (node.parent.arguments[callbackIndex] !== node) {
         return;
-      }
+      } // Get the reactive hook node.
 
-      // Get the reactive hook node.
       const reactiveHook = node.parent.callee;
       const reactiveHookName = getNodeWithoutReactNamespace(reactiveHook).name;
-      const isEffect = reactiveHookName.endsWith('Effect');
-
-      // Get the declared dependencies for this reactive hook. If there is no
+      const isEffect = reactiveHookName.endsWith('Effect'); // Get the declared dependencies for this reactive hook. If there is no
       // second argument then the reactive callback will re-run on every render.
       // So no need to check for dependency inclusion.
-      const depsIndex = callbackIndex + 1;
-      const declaredDependenciesNode = node.parent.arguments[depsIndex];
 
-      // Get the current scope.
-      const scope = context.getScope();
+      const depsIndex = callbackIndex + 1;
+      const declaredDependenciesNode = node.parent.arguments[depsIndex]; // Get the current scope.
 
-      // Find all our "pure scopes". On every re-render of a component these
+      const scope = context.getScope(); // Find all our "pure scopes". On every re-render of a component these
       // pure scopes may have changes to the variables declared within. So all
       // variables used in our reactive hook callback but declared in a pure
       // scope need to be listed as dependencies of our reactive hook callback.
@@ -85,29 +82,31 @@ export default {
       // According to the rules of React you can't read a mutable value in pure
       // scope. We can't enforce this in a lint so we trust that all variables
       // declared outside of pure scope are indeed frozen.
+
       const pureScopes = new Set();
       let componentScope = null;
       {
         let currentScope = scope.upper;
+
         while (currentScope) {
           pureScopes.add(currentScope);
+
           if (currentScope.type === 'function') {
             break;
           }
+
           currentScope = currentScope.upper;
-        }
-        // If there is no parent function scope then there are no pure scopes.
+        } // If there is no parent function scope then there are no pure scopes.
         // The ones we've collected so far are incorrect. So don't continue with
         // the lint.
+
         if (!currentScope) {
           return;
         }
-        componentScope = currentScope;
-      }
 
-      // Next we'll define a few helpers that helps us
+        componentScope = currentScope;
+      } // Next we'll define a few helpers that helps us
       // tell if some values don't have to be declared as deps.
-
       // Some are known to be static based on Hook calls.
       // const [state, setState] = useState() / React.useState()
       //               ^^^ true for this reference
@@ -116,35 +115,43 @@ export default {
       // const ref = useRef()
       //       ^^^ true for this reference
       // False for everything else.
+
       function isStaticKnownHookValue(resolved) {
         if (!Array.isArray(resolved.defs)) {
           return false;
         }
+
         const def = resolved.defs[0];
+
         if (def == null) {
           return false;
-        }
-        // Look for `let stuff = ...`
+        } // Look for `let stuff = ...`
+
         if (def.node.type !== 'VariableDeclarator') {
           return false;
         }
+
         const init = def.node.init;
+
         if (init == null) {
           return false;
-        }
-        // Detect primitive constants
+        } // Detect primitive constants
         // const foo = 42
+
         let declaration = def.node.parent;
+
         if (declaration == null) {
           // This might happen if variable is declared after the callback.
           // In that case ESLint won't set up .parent refs.
           // So we'll set them up manually.
           fastFindReferenceWithParent(componentScope.block, def.node.id);
           declaration = def.node.parent;
+
           if (declaration == null) {
             return false;
           }
         }
+
         if (
           declaration.kind === 'const' &&
           init.type === 'Literal' &&
@@ -154,14 +161,15 @@ export default {
         ) {
           // Definitely static
           return true;
-        }
-        // Detect known Hook calls
+        } // Detect known Hook calls
         // const [_, setState] = useState()
+
         if (init.type !== 'CallExpression') {
           return false;
         }
-        let callee = init.callee;
-        // Step into `= React.something` initializer.
+
+        let callee = init.callee; // Step into `= React.something` initializer.
+
         if (
           callee.type === 'MemberExpression' &&
           callee.object.name === 'React' &&
@@ -170,9 +178,11 @@ export default {
         ) {
           callee = callee.property;
         }
+
         if (callee.type !== 'Identifier') {
           return false;
         }
+
         const id = def.node.id;
         const { name } = callee;
 
@@ -193,57 +203,62 @@ export default {
             if (id.elements[1] === resolved.identifiers[0]) {
               if (name === 'useState') {
                 const references = resolved.references;
+
                 for (let i = 0; i < references.length; i++) {
                   setStateCallSites.set(
                     references[i].identifier,
                     id.elements[0],
                   );
                 }
-              }
-              // Setter is static.
+              } // Setter is static.
+
               return true;
             } else if (id.elements[0] === resolved.identifiers[0]) {
               if (name === 'useState') {
                 const references = resolved.references;
+
                 for (let i = 0; i < references.length; i++) {
                   stateVariables.add(references[i].identifier);
                 }
-              }
-              // State variable itself is dynamic.
+              } // State variable itself is dynamic.
+
               return false;
             }
           }
-        }
-        // By default assume it's dynamic.
+        } // By default assume it's dynamic.
+
         return false;
-      }
+      } // Some are just functions that don't reference anything dynamic.
 
-      // Some are just functions that don't reference anything dynamic.
       function isFunctionWithoutCapturedValues(resolved) {
         if (!Array.isArray(resolved.defs)) {
           return false;
         }
+
         const def = resolved.defs[0];
+
         if (def == null) {
           return false;
         }
+
         if (def.node == null || def.node.id == null) {
           return false;
-        }
-        // Search the direct component subscopes for
+        } // Search the direct component subscopes for
         // top-level function definitions matching this reference.
+
         const fnNode = def.node;
         let childScopes = componentScope.childScopes;
         let fnScope = null;
         let i;
+
         for (i = 0; i < childScopes.length; i++) {
           let childScope = childScopes[i];
           let childScopeBlock = childScope.block;
+
           if (
             // function handleChange() {}
             (fnNode.type === 'FunctionDeclaration' &&
-              childScopeBlock === fnNode) ||
-            // const handleChange = () => {}
+              childScopeBlock === fnNode) || // const handleChange = () => {}
             // const handleChange = function() {}
             (fnNode.type === 'VariableDeclarator' &&
               childScopeBlock.parent === fnNode)
@@ -253,31 +268,32 @@ export default {
             break;
           }
         }
+
         if (fnScope == null) {
           return false;
-        }
-        // Does this function capture any values
+        } // Does this function capture any values
         // that are in pure scopes (aka render)?
+
         for (i = 0; i < fnScope.through.length; i++) {
           const ref = fnScope.through[i];
+
           if (ref.resolved == null) {
             continue;
           }
+
           if (
-            pureScopes.has(ref.resolved.scope) &&
-            // Static values are fine though,
+            pureScopes.has(ref.resolved.scope) && // Static values are fine though,
             // although we won't check functions deeper.
             !memoizedIsStaticKnownHookValue(ref.resolved)
           ) {
             return false;
           }
-        }
-        // If we got here, this function doesn't capture anything
+        } // If we got here, this function doesn't capture anything
         // from render--or everything it captures is known static.
+
         return true;
-      }
+      } // Remember such values. Avoid re-running extra checks on them.
 
-      // Remember such values. Avoid re-running extra checks on them.
       const memoizedIsStaticKnownHookValue = memoizeWithWeakMap(
         isStaticKnownHookValue,
         staticKnownValueCache,
@@ -285,30 +301,30 @@ export default {
       const memoizedIsFunctionWithoutCapturedValues = memoizeWithWeakMap(
         isFunctionWithoutCapturedValues,
         functionWithoutCapturedValueCache,
-      );
-
-      // These are usually mistaken. Collect them.
-      const currentRefsInEffectCleanup = new Map();
+      ); // These are usually mistaken. Collect them.
 
-      // Is this reference inside a cleanup function for this effect node?
+      const currentRefsInEffectCleanup = new Map(); // Is this reference inside a cleanup function for this effect node?
       // We can check by traversing scopes upwards  from the reference, and checking
       // if the last "return () => " we encounter is located directly inside the effect.
+
       function isInsideEffectCleanup(reference) {
         let curScope = reference.from;
         let isInReturnedFunction = false;
+
         while (curScope.block !== node) {
           if (curScope.type === 'function') {
             isInReturnedFunction =
               curScope.block.parent != null &&
               curScope.block.parent.type === 'ReturnStatement';
           }
+
           curScope = curScope.upper;
         }
-        return isInReturnedFunction;
-      }
 
-      // Get dependencies from all our resolved references in pure scopes.
+        return isInReturnedFunction;
+      } // Get dependencies from all our resolved references in pure scopes.
       // Key is dependency string, value is whether it's static.
+
       const dependencies = new Map();
       gatherDependenciesRecursively(scope);
 
@@ -319,30 +335,27 @@ export default {
           if (!reference.resolved) {
             continue;
           }
+
           if (!pureScopes.has(reference.resolved.scope)) {
             continue;
-          }
-
-          // Narrow the scope of a dependency if it is, say, a member expression.
+          } // Narrow the scope of a dependency if it is, say, a member expression.
           // Then normalize the narrowed dependency.
+
           const referenceNode = fastFindReferenceWithParent(
             node,
             reference.identifier,
           );
           const dependencyNode = getDependency(referenceNode);
-          const dependency = toPropertyAccessString(dependencyNode);
+          const dependency = toPropertyAccessString(dependencyNode); // Accessing ref.current inside effect cleanup is bad.
 
-          // Accessing ref.current inside effect cleanup is bad.
           if (
             // We're in an effect...
-            isEffect &&
-            // ... and this look like accessing .current...
+            isEffect && // ... and this look like accessing .current...
             dependencyNode.type === 'Identifier' &&
             dependencyNode.parent.type === 'MemberExpression' &&
             !dependencyNode.parent.computed &&
             dependencyNode.parent.property.type === 'Identifier' &&
-            dependencyNode.parent.property.name === 'current' &&
-            // ...in a cleanup function or below...
+            dependencyNode.parent.property.name === 'current' && // ...in a cleanup function or below...
             isInsideEffectCleanup(reference)
           ) {
             currentRefsInEffectCleanup.set(dependency, {
@@ -355,20 +368,17 @@ export default {
 
           if (def == null) {
             continue;
-          }
+          } // Ignore references to the function itself as it's not defined yet.
 
-          // Ignore references to the function itself as it's not defined yet.
           if (def.node != null && def.node.init === node.parent) {
             continue;
-          }
+          } // Ignore Flow type parameters
 
-          // Ignore Flow type parameters
           if (def.type === 'TypeParameter') {
             continue;
-          }
-
-          // Add the dependency to a map so we can make sure it is referenced
+          } // Add the dependency to a map so we can make sure it is referenced
           // again in our dependencies array. Remember whether it's static.
+
           if (!dependencies.has(dependency)) {
             const resolved = reference.resolved;
             const isStatic =
@@ -382,40 +392,41 @@ export default {
             dependencies.get(dependency).references.push(reference);
           }
         }
+
         for (const childScope of currentScope.childScopes) {
           gatherDependenciesRecursively(childScope);
         }
-      }
+      } // Warn about accessing .current in cleanup effects.
 
-      // Warn about accessing .current in cleanup effects.
       currentRefsInEffectCleanup.forEach(
         ({ reference, dependencyNode }, dependency) => {
-          const references = reference.resolved.references;
-          // Is React managing this ref or us?
+          const references = reference.resolved.references; // Is React managing this ref or us?
           // Let's see if we can find a .current assignment.
+
           let foundCurrentAssignment = false;
+
           for (let i = 0; i < references.length; i++) {
             const { identifier } = references[i];
             const { parent } = identifier;
+
             if (
-              parent != null &&
-              // ref.current
+              parent != null && // ref.current
               parent.type === 'MemberExpression' &&
               !parent.computed &&
               parent.property.type === 'Identifier' &&
-              parent.property.name === 'current' &&
-              // ref.current = <something>
+              parent.property.name === 'current' && // ref.current = <something>
               parent.parent.type === 'AssignmentExpression' &&
               parent.parent.left === parent
             ) {
               foundCurrentAssignment = true;
               break;
             }
-          }
-          // We only want to warn about React-managed refs.
+          } // We only want to warn about React-managed refs.
+
           if (foundCurrentAssignment) {
             return;
           }
+
           context.report({
             node: dependencyNode.parent.property,
             message:
@@ -426,15 +437,16 @@ export default {
               `use that variable in the cleanup function.`,
           });
         },
-      );
-
-      // Warn about assigning to variables in the outer scope.
+      ); // Warn about assigning to variables in the outer scope.
       // Those are usually bugs.
+
       let staleAssignments = new Set();
+
       function reportStaleAssignment(writeExpr, key) {
         if (staleAssignments.has(key)) {
           return;
         }
+
         staleAssignments.add(key);
         context.report({
           node: writeExpr,
@@ -446,14 +458,14 @@ export default {
             `Otherwise, you can move this variable directly inside ` +
             `${context.getSource(reactiveHook)}.`,
         });
-      }
+      } // Remember which deps are optional and report bad usage first.
 
-      // Remember which deps are optional and report bad usage first.
       const optionalDependencies = new Set();
       dependencies.forEach(({ isStatic, references }, key) => {
         if (isStatic) {
           optionalDependencies.add(key);
         }
+
         references.forEach(reference => {
           if (reference.writeExpr) {
             reportStaleAssignment(reference.writeExpr, key);
@@ -474,6 +486,7 @@ export default {
           if (setStateInsideEffectWithoutDeps) {
             return;
           }
+
           references.forEach(reference => {
             if (setStateInsideEffectWithoutDeps) {
               return;
@@ -481,21 +494,26 @@ export default {
 
             const id = reference.identifier;
             const isSetState = setStateCallSites.has(id);
+
             if (!isSetState) {
               return;
             }
 
             let fnScope = reference.from;
+
             while (fnScope.type !== 'function') {
               fnScope = fnScope.upper;
             }
+
             const isDirectlyInsideEffect = fnScope.block === node;
+
             if (isDirectlyInsideEffect) {
               // TODO: we could potentially ignore early returns.
               setStateInsideEffectWithoutDeps = key;
             }
           });
         });
+
         if (setStateInsideEffectWithoutDeps) {
           let { suggestedDependencies } = collectRecommendations({
             dependencies,
@@ -512,6 +530,7 @@ export default {
               `To fix this, pass [` +
               suggestedDependencies.join(', ') +
               `] as a second argument to the ${reactiveHookName} Hook.`,
+
             fix(fixer) {
               return fixer.insertTextAfter(
                 node,
@@ -520,11 +539,13 @@ export default {
             },
           });
         }
+
         return;
       }
 
       const declaredDependencies = [];
       const externalDependencies = new Set();
+
       if (declaredDependenciesNode.type !== 'ArrayExpression') {
         // If the declared dependencies are not an array expression then we
         // can't verify that the user provided the correct dependencies. Tell
@@ -542,8 +563,8 @@ export default {
           // Skip elided elements.
           if (declaredDependencyNode === null) {
             return;
-          }
-          // If we see a spread element then add a special warning.
+          } // If we see a spread element then add a special warning.
+
           if (declaredDependencyNode.type === 'SpreadElement') {
             context.report({
               node: declaredDependencyNode,
@@ -554,10 +575,11 @@ export default {
                 'correct dependencies.',
             });
             return;
-          }
-          // Try to normalize the declared dependency. If we can't then an error
+          } // Try to normalize the declared dependency. If we can't then an error
           // will be thrown. We will catch that error and report an error.
+
           let declaredDependency;
+
           try {
             declaredDependency = toPropertyAccessString(declaredDependencyNode);
           } catch (error) {
@@ -596,14 +618,15 @@ export default {
           }
 
           let maybeID = declaredDependencyNode;
+
           while (maybeID.type === 'MemberExpression') {
             maybeID = maybeID.object;
           }
+
           const isDeclaredInComponent = !componentScope.through.some(
             ref => ref.identifier === maybeID,
-          );
+          ); // Add the dependency to our declared dependency map.
 
-          // Add the dependency to our declared dependency map.
           declaredDependencies.push({
             key: declaredDependency,
             node: declaredDependencyNode,
@@ -627,37 +650,37 @@ export default {
         externalDependencies,
         isEffect,
       });
-
       const problemCount =
         duplicateDependencies.size +
         missingDependencies.size +
-        unnecessaryDependencies.size;
-
-      // If we're going to report a missing dependency,
+        unnecessaryDependencies.size; // If we're going to report a missing dependency,
       // we might as well recalculate the list ignoring
       // the currently specified deps. This can result
       // in some extra deduplication. We can't do this
       // for effects though because those have legit
       // use cases for over-specifying deps.
+
       if (!isEffect && missingDependencies.size > 0) {
         suggestedDependencies = collectRecommendations({
           dependencies,
-          declaredDependencies: [], // Pretend we don't know
+          declaredDependencies: [],
+          // Pretend we don't know
           optionalDependencies,
           externalDependencies,
           isEffect,
         }).suggestedDependencies;
-      }
+      } // Alphabetize the suggestions, but only if deps were already alphabetized.
 
-      // Alphabetize the suggestions, but only if deps were already alphabetized.
       function areDeclaredDepsAlphabetized() {
         if (declaredDependencies.length === 0) {
           return true;
         }
+
         const declaredDepKeys = declaredDependencies.map(dep => dep.key);
         const sortedDeclaredDepKeys = declaredDepKeys.slice().sort();
         return declaredDepKeys.join(',') === sortedDeclaredDepKeys.join(',');
       }
+
       if (areDeclaredDepsAlphabetized()) {
         suggestedDependencies.sort();
       }
@@ -666,6 +689,7 @@ export default {
         if (deps.size === 0) {
           return null;
         }
+
         return (
           (deps.size > 1 ? '' : singlePrefix + ' ') +
           label +
@@ -684,65 +708,77 @@ export default {
       }
 
       let extraWarning = '';
+
       if (unnecessaryDependencies.size > 0) {
         let badRef = null;
         Array.from(unnecessaryDependencies.keys()).forEach(key => {
           if (badRef !== null) {
             return;
           }
+
           if (key.endsWith('.current')) {
             badRef = key;
           }
         });
+
         if (badRef !== null) {
           extraWarning =
             ` Mutable values like '${badRef}' aren't valid dependencies ` +
             "because mutating them doesn't re-render the component.";
         } else if (externalDependencies.size > 0) {
-          const dep = Array.from(externalDependencies)[0];
-          // Don't show this warning for things that likely just got moved *inside* the callback
+          const dep = Array.from(externalDependencies)[0]; // Don't show this warning for things that likely just got moved *inside* the callback
           // because in that case they're clearly not referring to globals.
+
           if (!scope.set.has(dep)) {
             extraWarning =
               ` Outer scope values like '${dep}' aren't valid dependencies ` +
               `because mutating them doesn't re-render the component.`;
           }
         }
-      }
-
-      // `props.foo()` marks `props` as a dependency because it has
+      } // `props.foo()` marks `props` as a dependency because it has
       // a `this` value. This warning can be confusing.
       // So if we're going to show it, append a clarification.
+
       if (!extraWarning && missingDependencies.has('props')) {
         let propDep = dependencies.get('props');
+
         if (propDep == null) {
           return;
         }
+
         const refs = propDep.references;
+
         if (!Array.isArray(refs)) {
           return;
         }
+
         let isPropsOnlyUsedInMembers = true;
+
         for (let i = 0; i < refs.length; i++) {
           const ref = refs[i];
           const id = fastFindReferenceWithParent(
             componentScope.block,
             ref.identifier,
           );
+
           if (!id) {
             isPropsOnlyUsedInMembers = false;
             break;
           }
+
           const parent = id.parent;
+
           if (parent == null) {
             isPropsOnlyUsedInMembers = false;
             break;
           }
+
           if (parent.type !== 'MemberExpression') {
             isPropsOnlyUsedInMembers = false;
             break;
           }
         }
+
         if (isPropsOnlyUsedInMembers) {
           extraWarning =
             ` However, 'props' will change when *any* prop changes, so the ` +
@@ -759,23 +795,27 @@ export default {
         missingDependencies.forEach(missingDep => {
           if (missingCallbackDep) {
             return;
-          }
-          // Is this a variable from top scope?
+          } // Is this a variable from top scope?
+
           const topScopeRef = componentScope.set.get(missingDep);
           const usedDep = dependencies.get(missingDep);
+
           if (usedDep.references[0].resolved !== topScopeRef) {
             return;
-          }
-          // Is this a destructured prop?
+          } // Is this a destructured prop?
+
           const def = topScopeRef.defs[0];
+
           if (def == null || def.name == null || def.type !== 'Parameter') {
             return;
-          }
-          // Was it called in at least one case? Then it's a function.
+          } // Was it called in at least one case? Then it's a function.
+
           let isFunctionCall = false;
           let id;
+
           for (let i = 0; i < usedDep.references.length; i++) {
             id = usedDep.references[i].identifier;
+
             if (
               id != null &&
               id.parent != null &&
@@ -786,14 +826,16 @@ export default {
               break;
             }
           }
+
           if (!isFunctionCall) {
             return;
-          }
-          // If it's missing (i.e. in component scope) *and* it's a parameter
+          } // If it's missing (i.e. in component scope) *and* it's a parameter
           // then it is definitely coming from props destructuring.
           // (It could also be props itself but we wouldn't be calling it then.)
+
           missingCallbackDep = missingDep;
         });
+
         if (missingCallbackDep !== null) {
           extraWarning =
             ` If '${missingCallbackDep}' changes too often, ` +
@@ -808,19 +850,22 @@ export default {
           if (setStateRecommendation !== null) {
             return;
           }
+
           const usedDep = dependencies.get(missingDep);
           const references = usedDep.references;
           let id;
           let maybeCall;
+
           for (let i = 0; i < references.length; i++) {
             id = references[i].identifier;
-            maybeCall = id.parent;
-            // Try to see if we have setState(someExpr(missingDep)).
+            maybeCall = id.parent; // Try to see if we have setState(someExpr(missingDep)).
+
             while (maybeCall != null && maybeCall !== componentScope.block) {
               if (maybeCall.type === 'CallExpression') {
                 const correspondingStateVariable = setStateCallSites.get(
                   maybeCall.callee,
                 );
+
                 if (correspondingStateVariable != null) {
                   if (correspondingStateVariable.name === missingDep) {
                     // setCount(count + 1)
@@ -838,11 +883,13 @@ export default {
                     };
                   } else {
                     const resolved = references[i].resolved;
+
                     if (resolved != null) {
                       // If it's a parameter *and* a missing dep,
                       // it must be a prop or something inside a prop.
                       // Therefore, recommend an inline reducer.
                       const def = resolved.defs[0];
+
                       if (def != null && def.type === 'Parameter') {
                         setStateRecommendation = {
                           missingDep,
@@ -852,16 +899,20 @@ export default {
                       }
                     }
                   }
+
                   break;
                 }
               }
+
               maybeCall = maybeCall.parent;
             }
+
             if (setStateRecommendation !== null) {
               break;
             }
           }
         });
+
         if (setStateRecommendation !== null) {
           switch (setStateRecommendation.form) {
             case 'reducer':
@@ -870,6 +921,7 @@ export default {
                 `if '${setStateRecommendation.setter}' needs the ` +
                 `current value of '${setStateRecommendation.missingDep}'.`;
               break;
+
             case 'inlineReducer':
               extraWarning =
                 ` If '${setStateRecommendation.setter}' needs the ` +
@@ -877,6 +929,7 @@ export default {
                 `you can also switch to useReducer instead of useState and ` +
                 `read '${setStateRecommendation.missingDep}' in the reducer.`;
               break;
+
             case 'updater':
               extraWarning =
                 ` You can also do a functional update '${
@@ -888,6 +941,7 @@ export default {
                   setStateRecommendation.missingDep
                 }'` + ` in the '${setStateRecommendation.setter}' call.`;
               break;
+
             default:
               throw new Error('Unknown case.');
           }
@@ -898,8 +952,7 @@ export default {
         context.report({
           node: declaredDependenciesNode,
           message:
-            `React Hook ${context.getSource(reactiveHook)} has ` +
-            // To avoid a long message, show the next actionable item.
+            `React Hook ${context.getSource(reactiveHook)} has ` + // To avoid a long message, show the next actionable item.
             (getWarningMessage(
               missingDependencies,
               'a',
@@ -919,6 +972,7 @@ export default {
                 'omit',
               )) +
             extraWarning,
+
           fix(fixer) {
             // TODO: consider preserving the comments or formatting?
             return fixer.replaceText(
@@ -930,9 +984,8 @@ export default {
       }
     }
   },
-};
+}; // The meat of the logic.
 
-// The meat of the logic.
 function collectRecommendations({
   dependencies,
   declaredDependencies,
@@ -950,27 +1003,29 @@ function collectRecommendations({
   // and the nodes that were *declared* as deps. Then we will
   // traverse it to learn which deps are missing or unnecessary.
   const depTree = createDepTree();
+
   function createDepTree() {
     return {
-      isRequired: false, // True if used in code
-      isSatisfiedRecursively: false, // True if specified in deps
-      hasRequiredNodesBelow: false, // True if something deeper is used by code
+      isRequired: false,
+      // True if used in code
+      isSatisfiedRecursively: false,
+      // True if specified in deps
+      hasRequiredNodesBelow: false,
+      // True if something deeper is used by code
       children: new Map(), // Nodes for properties
     };
-  }
-
-  // Mark all required nodes first.
+  } // Mark all required nodes first.
   // Imagine exclamation marks next to each used deep property.
+
   dependencies.forEach((_, key) => {
     const node = getOrCreateNodeByPath(depTree, key);
     node.isRequired = true;
     markAllParentsByPath(depTree, key, parent => {
       parent.hasRequiredNodesBelow = true;
     });
-  });
-
-  // Mark all satisfied nodes.
+  }); // Mark all satisfied nodes.
   // Imagine checkmarks next to each declared dependency.
+
   declaredDependencies.forEach(({ key }) => {
     const node = getOrCreateNodeByPath(depTree, key);
     node.isSatisfiedRecursively = true;
@@ -978,36 +1033,42 @@ function collectRecommendations({
   optionalDependencies.forEach(key => {
     const node = getOrCreateNodeByPath(depTree, key);
     node.isSatisfiedRecursively = true;
-  });
+  }); // Tree manipulation helpers.
 
-  // Tree manipulation helpers.
   function getOrCreateNodeByPath(rootNode, path) {
     let keys = path.split('.');
     let node = rootNode;
+
     for (let key of keys) {
       let child = node.children.get(key);
+
       if (!child) {
         child = createDepTree();
         node.children.set(key, child);
       }
+
       node = child;
     }
+
     return node;
   }
+
   function markAllParentsByPath(rootNode, path, fn) {
     let keys = path.split('.');
     let node = rootNode;
+
     for (let key of keys) {
       let child = node.children.get(key);
+
       if (!child) {
         return;
       }
+
       fn(child);
       node = child;
     }
-  }
+  } // Now we can learn which dependencies are missing or necessary.
 
-  // Now we can learn which dependencies are missing or necessary.
   let missingDependencies = new Set();
   let satisfyingDependencies = new Set();
   scanTreeRecursively(
@@ -1016,26 +1077,30 @@ function collectRecommendations({
     satisfyingDependencies,
     key => key,
   );
+
   function scanTreeRecursively(node, missingPaths, satisfyingPaths, keyToPath) {
     node.children.forEach((child, key) => {
       const path = keyToPath(key);
+
       if (child.isSatisfiedRecursively) {
         if (child.hasRequiredNodesBelow) {
           // Remember this dep actually satisfied something.
           satisfyingPaths.add(path);
-        }
-        // It doesn't matter if there's something deeper.
+        } // It doesn't matter if there's something deeper.
         // It would be transitively satisfied since we assume immutability.
         // `props.foo` is enough if you read `props.foo.id`.
+
         return;
       }
+
       if (child.isRequired) {
         // Remember that no declared deps satisfied this node.
-        missingPaths.add(path);
-        // If we got here, nothing in its subtree was satisfied.
+        missingPaths.add(path); // If we got here, nothing in its subtree was satisfied.
         // No need to search further.
+
         return;
       }
+
       scanTreeRecursively(
         child,
         missingPaths,
@@ -1043,9 +1108,8 @@ function collectRecommendations({
         childKey => path + '.' + childKey,
       );
     });
-  }
+  } // Collect suggestions in the order they were originally specified.
 
-  // Collect suggestions in the order they were originally specified.
   let suggestedDependencies = [];
   let unnecessaryDependencies = new Set();
   let duplicateDependencies = new Set();
@@ -1077,13 +1141,11 @@ function collectRecommendations({
         unnecessaryDependencies.add(key);
       }
     }
-  });
+  }); // Then add the missing ones at the end.
 
-  // Then add the missing ones at the end.
   missingDependencies.forEach(key => {
     suggestedDependencies.push(key);
   });
-
   return {
     suggestedDependencies,
     unnecessaryDependencies,
@@ -1091,7 +1153,6 @@ function collectRecommendations({
     missingDependencies,
   };
 }
-
 /**
  * Assuming () means the passed/returned node:
  * (props) => (props)
@@ -1099,6 +1160,7 @@ function collectRecommendations({
  * props.foo.(bar) => (props).foo.bar
  * props.foo.bar.(baz) => (props).foo.bar.baz
  */
+
 function getDependency(node) {
   if (
     node.parent.type === 'MemberExpression' &&
@@ -1116,7 +1178,6 @@ function getDependency(node) {
     return node;
   }
 }
-
 /**
  * Assuming () means the passed node.
  * (foo) -> 'foo'
@@ -1124,6 +1185,7 @@ function getDependency(node) {
  * foo.bar.(baz) -> 'foo.bar.baz'
  * Otherwise throw.
  */
+
 function toPropertyAccessString(node) {
   if (node.type === 'Identifier') {
     return node.name;
@@ -1146,33 +1208,36 @@ function getNodeWithoutReactNamespace(node) {
   ) {
     return node.property;
   }
-  return node;
-}
 
-// What's the index of callback that needs to be analyzed for a given Hook?
+  return node;
+} // What's the index of callback that needs to be analyzed for a given Hook?
 // -1 if it's not a Hook we care about (e.g. useState).
 // 0 for useEffect/useMemo/useCallback(fn).
 // 1 for useImperativeHandle(ref, fn).
 // For additionally configured Hooks, assume that they're like useEffect (0).
+
 function getReactiveHookCallbackIndex(calleeNode) {
   let node = getNodeWithoutReactNamespace(calleeNode);
+
   if (node.type !== 'Identifier') {
     return null;
   }
+
   switch (node.name) {
     case 'useAsyncEffect':
     case 'useAsyncLayoutEffect':
     case 'useWorker':
-    case 'useWorkerLoad':
+    case 'useWorkerState':
     case 'useEffectUpdate':
       return 0;
+
     case 'useConditionalEffect':
       return 1;
+
     default:
       return -1;
   }
 }
-
 /**
  * ESLint won't assign node.parent to references from context.getScope()
  *
@@ -1183,6 +1248,7 @@ function getReactiveHookCallbackIndex(calleeNode) {
  * - optimized by only searching nodes with a range surrounding our target node
  * - agnostic to AST node types, it looks for `{ type: string, ... }`
  */
+
 function fastFindReferenceWithParent(start, target) {
   let queue = [start];
   let item = null;
@@ -1202,6 +1268,7 @@ function fastFindReferenceWithParent(start, target) {
       if (key === 'parent') {
         continue;
       }
+
       if (isNodeLike(value)) {
         value.parent = item;
         queue.push(value);
@@ -1221,8 +1288,10 @@ function fastFindReferenceWithParent(start, target) {
 
 function joinEnglish(arr) {
   let s = '';
+
   for (let i = 0; i < arr.length; i++) {
     s += arr[i];
+
     if (i === 0 && arr.length === 2) {
       s += ' and ';
     } else if (i === arr.length - 2 && arr.length > 2) {
@@ -1231,6 +1300,7 @@ function joinEnglish(arr) {
       s += ', ';
     }
   }
+
   return s;
 }
 
diff --git a/eslint-plugin/package.json b/eslint-plugin/package.json
index 1bba449..e48bbf4 100644
--- a/eslint-plugin/package.json
+++ b/eslint-plugin/package.json
@@ -1,6 +1,6 @@
 {
   "name": "@react-hook-utilities/eslint-plugin",
-  "version": "1.0.0",
+  "version": "0.1.0",
   "description": "ESLint rules for hook react-hook-utilities",
   "keywords": [
     "eslint",
@@ -14,10 +14,6 @@
     "babel": "rm -rf lib && babel src/ -d ./lib"
   },
   "devDependencies": {
-    "@babel/cli": "^7.6.2",
-    "@babel/preset-env": "^7.6.2",
-    "babel-eslint": "^10.0.3",
-    "eslint": "~3.9.1",
     "mocha": "^3.1.2"
   },
   "engines": {
diff --git a/eslint-plugin/yarn.lock b/eslint-plugin/yarn.lock
index e0fcf90..cdcf854 100644
--- a/eslint-plugin/yarn.lock
+++ b/eslint-plugin/yarn.lock
@@ -2,805 +2,11 @@
 # yarn lockfile v1
 
 
-"@babel/cli@^7.6.2":
-  version "7.6.2"
-  resolved "https://registry.yarnpkg.com/@babel/cli/-/cli-7.6.2.tgz#4ce8b5b4b2e4b4c1b7bd841cec62085e2dfc4465"
-  integrity sha512-JDZ+T/br9pPfT2lmAMJypJDTTTHM9ePD/ED10TRjRzJVdEVy+JB3iRlhzYmTt5YkNgHvxWGlUVnLtdv6ruiDrQ==
-  dependencies:
-    commander "^2.8.1"
-    convert-source-map "^1.1.0"
-    fs-readdir-recursive "^1.1.0"
-    glob "^7.0.0"
-    lodash "^4.17.13"
-    mkdirp "^0.5.1"
-    output-file-sync "^2.0.0"
-    slash "^2.0.0"
-    source-map "^0.5.0"
-  optionalDependencies:
-    chokidar "^2.1.8"
-
-"@babel/code-frame@^7.0.0", "@babel/code-frame@^7.5.5":
-  version "7.5.5"
-  resolved "https://registry.yarnpkg.com/@babel/code-frame/-/code-frame-7.5.5.tgz#bc0782f6d69f7b7d49531219699b988f669a8f9d"
-  integrity sha512-27d4lZoomVyo51VegxI20xZPuSHusqbQag/ztrBC7wegWoQ1nLREPVSKSW8byhTlzTKyNE4ifaTA6lCp7JjpFw==
-  dependencies:
-    "@babel/highlight" "^7.0.0"
-
-"@babel/generator@^7.6.2":
-  version "7.6.2"
-  resolved "https://registry.yarnpkg.com/@babel/generator/-/generator-7.6.2.tgz#dac8a3c2df118334c2a29ff3446da1636a8f8c03"
-  integrity sha512-j8iHaIW4gGPnViaIHI7e9t/Hl8qLjERI6DcV9kEpAIDJsAOrcnXqRS7t+QbhL76pwbtqP+QCQLL0z1CyVmtjjQ==
-  dependencies:
-    "@babel/types" "^7.6.0"
-    jsesc "^2.5.1"
-    lodash "^4.17.13"
-    source-map "^0.5.0"
-
-"@babel/helper-annotate-as-pure@^7.0.0":
-  version "7.0.0"
-  resolved "https://registry.yarnpkg.com/@babel/helper-annotate-as-pure/-/helper-annotate-as-pure-7.0.0.tgz#323d39dd0b50e10c7c06ca7d7638e6864d8c5c32"
-  integrity sha512-3UYcJUj9kvSLbLbUIfQTqzcy5VX7GRZ/CCDrnOaZorFFM01aXp1+GJwuFGV4NDDoAS+mOUyHcO6UD/RfqOks3Q==
-  dependencies:
-    "@babel/types" "^7.0.0"
-
-"@babel/helper-builder-binary-assignment-operator-visitor@^7.1.0":
-  version "7.1.0"
-  resolved "https://registry.yarnpkg.com/@babel/helper-builder-binary-assignment-operator-visitor/-/helper-builder-binary-assignment-operator-visitor-7.1.0.tgz#6b69628dfe4087798e0c4ed98e3d4a6b2fbd2f5f"
-  integrity sha512-qNSR4jrmJ8M1VMM9tibvyRAHXQs2PmaksQF7c1CGJNipfe3D8p+wgNwgso/P2A2r2mdgBWAXljNWR0QRZAMW8w==
-  dependencies:
-    "@babel/helper-explode-assignable-expression" "^7.1.0"
-    "@babel/types" "^7.0.0"
-
-"@babel/helper-call-delegate@^7.4.4":
-  version "7.4.4"
-  resolved "https://registry.yarnpkg.com/@babel/helper-call-delegate/-/helper-call-delegate-7.4.4.tgz#87c1f8ca19ad552a736a7a27b1c1fcf8b1ff1f43"
-  integrity sha512-l79boDFJ8S1c5hvQvG+rc+wHw6IuH7YldmRKsYtpbawsxURu/paVy57FZMomGK22/JckepaikOkY0MoAmdyOlQ==
-  dependencies:
-    "@babel/helper-hoist-variables" "^7.4.4"
-    "@babel/traverse" "^7.4.4"
-    "@babel/types" "^7.4.4"
-
-"@babel/helper-define-map@^7.5.5":
-  version "7.5.5"
-  resolved "https://registry.yarnpkg.com/@babel/helper-define-map/-/helper-define-map-7.5.5.tgz#3dec32c2046f37e09b28c93eb0b103fd2a25d369"
-  integrity sha512-fTfxx7i0B5NJqvUOBBGREnrqbTxRh7zinBANpZXAVDlsZxYdclDp467G1sQ8VZYMnAURY3RpBUAgOYT9GfzHBg==
-  dependencies:
-    "@babel/helper-function-name" "^7.1.0"
-    "@babel/types" "^7.5.5"
-    lodash "^4.17.13"
-
-"@babel/helper-explode-assignable-expression@^7.1.0":
-  version "7.1.0"
-  resolved "https://registry.yarnpkg.com/@babel/helper-explode-assignable-expression/-/helper-explode-assignable-expression-7.1.0.tgz#537fa13f6f1674df745b0c00ec8fe4e99681c8f6"
-  integrity sha512-NRQpfHrJ1msCHtKjbzs9YcMmJZOg6mQMmGRB+hbamEdG5PNpaSm95275VD92DvJKuyl0s2sFiDmMZ+EnnvufqA==
-  dependencies:
-    "@babel/traverse" "^7.1.0"
-    "@babel/types" "^7.0.0"
-
-"@babel/helper-function-name@^7.1.0":
-  version "7.1.0"
-  resolved "https://registry.yarnpkg.com/@babel/helper-function-name/-/helper-function-name-7.1.0.tgz#a0ceb01685f73355d4360c1247f582bfafc8ff53"
-  integrity sha512-A95XEoCpb3TO+KZzJ4S/5uW5fNe26DjBGqf1o9ucyLyCmi1dXq/B3c8iaWTfBk3VvetUxl16e8tIrd5teOCfGw==
-  dependencies:
-    "@babel/helper-get-function-arity" "^7.0.0"
-    "@babel/template" "^7.1.0"
-    "@babel/types" "^7.0.0"
-
-"@babel/helper-get-function-arity@^7.0.0":
-  version "7.0.0"
-  resolved "https://registry.yarnpkg.com/@babel/helper-get-function-arity/-/helper-get-function-arity-7.0.0.tgz#83572d4320e2a4657263734113c42868b64e49c3"
-  integrity sha512-r2DbJeg4svYvt3HOS74U4eWKsUAMRH01Z1ds1zx8KNTPtpTL5JAsdFv8BNyOpVqdFhHkkRDIg5B4AsxmkjAlmQ==
-  dependencies:
-    "@babel/types" "^7.0.0"
-
-"@babel/helper-hoist-variables@^7.4.4":
-  version "7.4.4"
-  resolved "https://registry.yarnpkg.com/@babel/helper-hoist-variables/-/helper-hoist-variables-7.4.4.tgz#0298b5f25c8c09c53102d52ac4a98f773eb2850a"
-  integrity sha512-VYk2/H/BnYbZDDg39hr3t2kKyifAm1W6zHRfhx8jGjIHpQEBv9dry7oQ2f3+J703TLu69nYdxsovl0XYfcnK4w==
-  dependencies:
-    "@babel/types" "^7.4.4"
-
-"@babel/helper-member-expression-to-functions@^7.5.5":
-  version "7.5.5"
-  resolved "https://registry.yarnpkg.com/@babel/helper-member-expression-to-functions/-/helper-member-expression-to-functions-7.5.5.tgz#1fb5b8ec4453a93c439ee9fe3aeea4a84b76b590"
-  integrity sha512-5qZ3D1uMclSNqYcXqiHoA0meVdv+xUEex9em2fqMnrk/scphGlGgg66zjMrPJESPwrFJ6sbfFQYUSa0Mz7FabA==
-  dependencies:
-    "@babel/types" "^7.5.5"
-
-"@babel/helper-module-imports@^7.0.0":
-  version "7.0.0"
-  resolved "https://registry.yarnpkg.com/@babel/helper-module-imports/-/helper-module-imports-7.0.0.tgz#96081b7111e486da4d2cd971ad1a4fe216cc2e3d"
-  integrity sha512-aP/hlLq01DWNEiDg4Jn23i+CXxW/owM4WpDLFUbpjxe4NS3BhLVZQ5i7E0ZrxuQ/vwekIeciyamgB1UIYxxM6A==
-  dependencies:
-    "@babel/types" "^7.0.0"
-
-"@babel/helper-module-transforms@^7.1.0", "@babel/helper-module-transforms@^7.4.4":
-  version "7.5.5"
-  resolved "https://registry.yarnpkg.com/@babel/helper-module-transforms/-/helper-module-transforms-7.5.5.tgz#f84ff8a09038dcbca1fd4355661a500937165b4a"
-  integrity sha512-jBeCvETKuJqeiaCdyaheF40aXnnU1+wkSiUs/IQg3tB85up1LyL8x77ClY8qJpuRJUcXQo+ZtdNESmZl4j56Pw==
-  dependencies:
-    "@babel/helper-module-imports" "^7.0.0"
-    "@babel/helper-simple-access" "^7.1.0"
-    "@babel/helper-split-export-declaration" "^7.4.4"
-    "@babel/template" "^7.4.4"
-    "@babel/types" "^7.5.5"
-    lodash "^4.17.13"
-
-"@babel/helper-optimise-call-expression@^7.0.0":
-  version "7.0.0"
-  resolved "https://registry.yarnpkg.com/@babel/helper-optimise-call-expression/-/helper-optimise-call-expression-7.0.0.tgz#a2920c5702b073c15de51106200aa8cad20497d5"
-  integrity sha512-u8nd9NQePYNQV8iPWu/pLLYBqZBa4ZaY1YWRFMuxrid94wKI1QNt67NEZ7GAe5Kc/0LLScbim05xZFWkAdrj9g==
-  dependencies:
-    "@babel/types" "^7.0.0"
-
-"@babel/helper-plugin-utils@^7.0.0":
-  version "7.0.0"
-  resolved "https://registry.yarnpkg.com/@babel/helper-plugin-utils/-/helper-plugin-utils-7.0.0.tgz#bbb3fbee98661c569034237cc03967ba99b4f250"
-  integrity sha512-CYAOUCARwExnEixLdB6sDm2dIJ/YgEAKDM1MOeMeZu9Ld/bDgVo8aiWrXwcY7OBh+1Ea2uUcVRcxKk0GJvW7QA==
-
-"@babel/helper-regex@^7.0.0", "@babel/helper-regex@^7.4.4":
-  version "7.5.5"
-  resolved "https://registry.yarnpkg.com/@babel/helper-regex/-/helper-regex-7.5.5.tgz#0aa6824f7100a2e0e89c1527c23936c152cab351"
-  integrity sha512-CkCYQLkfkiugbRDO8eZn6lRuR8kzZoGXCg3149iTk5se7g6qykSpy3+hELSwquhu+TgHn8nkLiBwHvNX8Hofcw==
-  dependencies:
-    lodash "^4.17.13"
-
-"@babel/helper-remap-async-to-generator@^7.1.0":
-  version "7.1.0"
-  resolved "https://registry.yarnpkg.com/@babel/helper-remap-async-to-generator/-/helper-remap-async-to-generator-7.1.0.tgz#361d80821b6f38da75bd3f0785ece20a88c5fe7f"
-  integrity sha512-3fOK0L+Fdlg8S5al8u/hWE6vhufGSn0bN09xm2LXMy//REAF8kDCrYoOBKYmA8m5Nom+sV9LyLCwrFynA8/slg==
-  dependencies:
-    "@babel/helper-annotate-as-pure" "^7.0.0"
-    "@babel/helper-wrap-function" "^7.1.0"
-    "@babel/template" "^7.1.0"
-    "@babel/traverse" "^7.1.0"
-    "@babel/types" "^7.0.0"
-
-"@babel/helper-replace-supers@^7.5.5":
-  version "7.5.5"
-  resolved "https://registry.yarnpkg.com/@babel/helper-replace-supers/-/helper-replace-supers-7.5.5.tgz#f84ce43df031222d2bad068d2626cb5799c34bc2"
-  integrity sha512-XvRFWrNnlsow2u7jXDuH4jDDctkxbS7gXssrP4q2nUD606ukXHRvydj346wmNg+zAgpFx4MWf4+usfC93bElJg==
-  dependencies:
-    "@babel/helper-member-expression-to-functions" "^7.5.5"
-    "@babel/helper-optimise-call-expression" "^7.0.0"
-    "@babel/traverse" "^7.5.5"
-    "@babel/types" "^7.5.5"
-
-"@babel/helper-simple-access@^7.1.0":
-  version "7.1.0"
-  resolved "https://registry.yarnpkg.com/@babel/helper-simple-access/-/helper-simple-access-7.1.0.tgz#65eeb954c8c245beaa4e859da6188f39d71e585c"
-  integrity sha512-Vk+78hNjRbsiu49zAPALxTb+JUQCz1aolpd8osOF16BGnLtseD21nbHgLPGUwrXEurZgiCOUmvs3ExTu4F5x6w==
-  dependencies:
-    "@babel/template" "^7.1.0"
-    "@babel/types" "^7.0.0"
-
-"@babel/helper-split-export-declaration@^7.4.4":
-  version "7.4.4"
-  resolved "https://registry.yarnpkg.com/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.4.4.tgz#ff94894a340be78f53f06af038b205c49d993677"
-  integrity sha512-Ro/XkzLf3JFITkW6b+hNxzZ1n5OQ80NvIUdmHspih1XAhtN3vPTuUFT4eQnela+2MaZ5ulH+iyP513KJrxbN7Q==
-  dependencies:
-    "@babel/types" "^7.4.4"
-
-"@babel/helper-wrap-function@^7.1.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/helper-wrap-function/-/helper-wrap-function-7.2.0.tgz#c4e0012445769e2815b55296ead43a958549f6fa"
-  integrity sha512-o9fP1BZLLSrYlxYEYyl2aS+Flun5gtjTIG8iln+XuEzQTs0PLagAGSXUcqruJwD5fM48jzIEggCKpIfWTcR7pQ==
-  dependencies:
-    "@babel/helper-function-name" "^7.1.0"
-    "@babel/template" "^7.1.0"
-    "@babel/traverse" "^7.1.0"
-    "@babel/types" "^7.2.0"
-
-"@babel/highlight@^7.0.0":
-  version "7.5.0"
-  resolved "https://registry.yarnpkg.com/@babel/highlight/-/highlight-7.5.0.tgz#56d11312bd9248fa619591d02472be6e8cb32540"
-  integrity sha512-7dV4eu9gBxoM0dAnj/BCFDW9LFU0zvTrkq0ugM7pnHEgguOEeOz1so2ZghEdzviYzQEED0r4EAgpsBChKy1TRQ==
-  dependencies:
-    chalk "^2.0.0"
-    esutils "^2.0.2"
-    js-tokens "^4.0.0"
-
-"@babel/parser@^7.0.0", "@babel/parser@^7.6.0", "@babel/parser@^7.6.2":
-  version "7.6.2"
-  resolved "https://registry.yarnpkg.com/@babel/parser/-/parser-7.6.2.tgz#205e9c95e16ba3b8b96090677a67c9d6075b70a1"
-  integrity sha512-mdFqWrSPCmikBoaBYMuBulzTIKuXVPtEISFbRRVNwMWpCms/hmE2kRq0bblUHaNRKrjRlmVbx1sDHmjmRgD2Xg==
-
-"@babel/plugin-proposal-async-generator-functions@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-proposal-async-generator-functions/-/plugin-proposal-async-generator-functions-7.2.0.tgz#b289b306669dce4ad20b0252889a15768c9d417e"
-  integrity sha512-+Dfo/SCQqrwx48ptLVGLdE39YtWRuKc/Y9I5Fy0P1DDBB9lsAHpjcEJQt+4IifuSOSTLBKJObJqMvaO1pIE8LQ==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-    "@babel/helper-remap-async-to-generator" "^7.1.0"
-    "@babel/plugin-syntax-async-generators" "^7.2.0"
-
-"@babel/plugin-proposal-dynamic-import@^7.5.0":
-  version "7.5.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-proposal-dynamic-import/-/plugin-proposal-dynamic-import-7.5.0.tgz#e532202db4838723691b10a67b8ce509e397c506"
-  integrity sha512-x/iMjggsKTFHYC6g11PL7Qy58IK8H5zqfm9e6hu4z1iH2IRyAp9u9dL80zA6R76yFovETFLKz2VJIC2iIPBuFw==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-    "@babel/plugin-syntax-dynamic-import" "^7.2.0"
-
-"@babel/plugin-proposal-json-strings@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-proposal-json-strings/-/plugin-proposal-json-strings-7.2.0.tgz#568ecc446c6148ae6b267f02551130891e29f317"
-  integrity sha512-MAFV1CA/YVmYwZG0fBQyXhmj0BHCB5egZHCKWIFVv/XCxAeVGIHfos3SwDck4LvCllENIAg7xMKOG5kH0dzyUg==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-    "@babel/plugin-syntax-json-strings" "^7.2.0"
-
-"@babel/plugin-proposal-object-rest-spread@^7.6.2":
-  version "7.6.2"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-proposal-object-rest-spread/-/plugin-proposal-object-rest-spread-7.6.2.tgz#8ffccc8f3a6545e9f78988b6bf4fe881b88e8096"
-  integrity sha512-LDBXlmADCsMZV1Y9OQwMc0MyGZ8Ta/zlD9N67BfQT8uYwkRswiu2hU6nJKrjrt/58aH/vqfQlR/9yId/7A2gWw==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-    "@babel/plugin-syntax-object-rest-spread" "^7.2.0"
-
-"@babel/plugin-proposal-optional-catch-binding@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-proposal-optional-catch-binding/-/plugin-proposal-optional-catch-binding-7.2.0.tgz#135d81edb68a081e55e56ec48541ece8065c38f5"
-  integrity sha512-mgYj3jCcxug6KUcX4OBoOJz3CMrwRfQELPQ5560F70YQUBZB7uac9fqaWamKR1iWUzGiK2t0ygzjTScZnVz75g==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-    "@babel/plugin-syntax-optional-catch-binding" "^7.2.0"
-
-"@babel/plugin-proposal-unicode-property-regex@^7.6.2":
-  version "7.6.2"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-proposal-unicode-property-regex/-/plugin-proposal-unicode-property-regex-7.6.2.tgz#05413762894f41bfe42b9a5e80919bd575dcc802"
-  integrity sha512-NxHETdmpeSCtiatMRYWVJo7266rrvAC3DTeG5exQBIH/fMIUK7ejDNznBbn3HQl/o9peymRRg7Yqkx6PdUXmMw==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-    "@babel/helper-regex" "^7.4.4"
-    regexpu-core "^4.6.0"
-
-"@babel/plugin-syntax-async-generators@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-async-generators/-/plugin-syntax-async-generators-7.2.0.tgz#69e1f0db34c6f5a0cf7e2b3323bf159a76c8cb7f"
-  integrity sha512-1ZrIRBv2t0GSlcwVoQ6VgSLpLgiN/FVQUzt9znxo7v2Ov4jJrs8RY8tv0wvDmFN3qIdMKWrmMMW6yZ0G19MfGg==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-syntax-dynamic-import@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-dynamic-import/-/plugin-syntax-dynamic-import-7.2.0.tgz#69c159ffaf4998122161ad8ebc5e6d1f55df8612"
-  integrity sha512-mVxuJ0YroI/h/tbFTPGZR8cv6ai+STMKNBq0f8hFxsxWjl94qqhsb+wXbpNMDPU3cfR1TIsVFzU3nXyZMqyK4w==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-syntax-json-strings@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-json-strings/-/plugin-syntax-json-strings-7.2.0.tgz#72bd13f6ffe1d25938129d2a186b11fd62951470"
-  integrity sha512-5UGYnMSLRE1dqqZwug+1LISpA403HzlSfsg6P9VXU6TBjcSHeNlw4DxDx7LgpF+iKZoOG/+uzqoRHTdcUpiZNg==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-syntax-object-rest-spread@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-object-rest-spread/-/plugin-syntax-object-rest-spread-7.2.0.tgz#3b7a3e733510c57e820b9142a6579ac8b0dfad2e"
-  integrity sha512-t0JKGgqk2We+9may3t0xDdmneaXmyxq0xieYcKHxIsrJO64n1OiMWNUtc5gQK1PA0NpdCRrtZp4z+IUaKugrSA==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-syntax-optional-catch-binding@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-syntax-optional-catch-binding/-/plugin-syntax-optional-catch-binding-7.2.0.tgz#a94013d6eda8908dfe6a477e7f9eda85656ecf5c"
-  integrity sha512-bDe4xKNhb0LI7IvZHiA13kff0KEfaGX/Hv4lMA9+7TEc63hMNvfKo6ZFpXhKuEp+II/q35Gc4NoMeDZyaUbj9w==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-arrow-functions@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-arrow-functions/-/plugin-transform-arrow-functions-7.2.0.tgz#9aeafbe4d6ffc6563bf8f8372091628f00779550"
-  integrity sha512-ER77Cax1+8/8jCB9fo4Ud161OZzWN5qawi4GusDuRLcDbDG+bIGYY20zb2dfAFdTRGzrfq2xZPvF0R64EHnimg==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-async-to-generator@^7.5.0":
-  version "7.5.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-async-to-generator/-/plugin-transform-async-to-generator-7.5.0.tgz#89a3848a0166623b5bc481164b5936ab947e887e"
-  integrity sha512-mqvkzwIGkq0bEF1zLRRiTdjfomZJDV33AH3oQzHVGkI2VzEmXLpKKOBvEVaFZBJdN0XTyH38s9j/Kiqr68dggg==
-  dependencies:
-    "@babel/helper-module-imports" "^7.0.0"
-    "@babel/helper-plugin-utils" "^7.0.0"
-    "@babel/helper-remap-async-to-generator" "^7.1.0"
-
-"@babel/plugin-transform-block-scoped-functions@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-block-scoped-functions/-/plugin-transform-block-scoped-functions-7.2.0.tgz#5d3cc11e8d5ddd752aa64c9148d0db6cb79fd190"
-  integrity sha512-ntQPR6q1/NKuphly49+QiQiTN0O63uOwjdD6dhIjSWBI5xlrbUFh720TIpzBhpnrLfv2tNH/BXvLIab1+BAI0w==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-block-scoping@^7.6.2":
-  version "7.6.2"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-block-scoping/-/plugin-transform-block-scoping-7.6.2.tgz#96c33ab97a9ae500cc6f5b19e04a7e6553360a79"
-  integrity sha512-zZT8ivau9LOQQaOGC7bQLQOT4XPkPXgN2ERfUgk1X8ql+mVkLc4E8eKk+FO3o0154kxzqenWCorfmEXpEZcrSQ==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-    lodash "^4.17.13"
-
-"@babel/plugin-transform-classes@^7.5.5":
-  version "7.5.5"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-classes/-/plugin-transform-classes-7.5.5.tgz#d094299d9bd680a14a2a0edae38305ad60fb4de9"
-  integrity sha512-U2htCNK/6e9K7jGyJ++1p5XRU+LJjrwtoiVn9SzRlDT2KubcZ11OOwy3s24TjHxPgxNwonCYP7U2K51uVYCMDg==
-  dependencies:
-    "@babel/helper-annotate-as-pure" "^7.0.0"
-    "@babel/helper-define-map" "^7.5.5"
-    "@babel/helper-function-name" "^7.1.0"
-    "@babel/helper-optimise-call-expression" "^7.0.0"
-    "@babel/helper-plugin-utils" "^7.0.0"
-    "@babel/helper-replace-supers" "^7.5.5"
-    "@babel/helper-split-export-declaration" "^7.4.4"
-    globals "^11.1.0"
-
-"@babel/plugin-transform-computed-properties@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-computed-properties/-/plugin-transform-computed-properties-7.2.0.tgz#83a7df6a658865b1c8f641d510c6f3af220216da"
-  integrity sha512-kP/drqTxY6Xt3NNpKiMomfgkNn4o7+vKxK2DDKcBG9sHj51vHqMBGy8wbDS/J4lMxnqs153/T3+DmCEAkC5cpA==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-destructuring@^7.6.0":
-  version "7.6.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-destructuring/-/plugin-transform-destructuring-7.6.0.tgz#44bbe08b57f4480094d57d9ffbcd96d309075ba6"
-  integrity sha512-2bGIS5P1v4+sWTCnKNDZDxbGvEqi0ijeqM/YqHtVGrvG2y0ySgnEEhXErvE9dA0bnIzY9bIzdFK0jFA46ASIIQ==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-dotall-regex@^7.6.2":
-  version "7.6.2"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-dotall-regex/-/plugin-transform-dotall-regex-7.6.2.tgz#44abb948b88f0199a627024e1508acaf8dc9b2f9"
-  integrity sha512-KGKT9aqKV+9YMZSkowzYoYEiHqgaDhGmPNZlZxX6UeHC4z30nC1J9IrZuGqbYFB1jaIGdv91ujpze0exiVK8bA==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-    "@babel/helper-regex" "^7.4.4"
-    regexpu-core "^4.6.0"
-
-"@babel/plugin-transform-duplicate-keys@^7.5.0":
-  version "7.5.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-duplicate-keys/-/plugin-transform-duplicate-keys-7.5.0.tgz#c5dbf5106bf84cdf691222c0974c12b1df931853"
-  integrity sha512-igcziksHizyQPlX9gfSjHkE2wmoCH3evvD2qR5w29/Dk0SMKE/eOI7f1HhBdNhR/zxJDqrgpoDTq5YSLH/XMsQ==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-exponentiation-operator@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-exponentiation-operator/-/plugin-transform-exponentiation-operator-7.2.0.tgz#a63868289e5b4007f7054d46491af51435766008"
-  integrity sha512-umh4hR6N7mu4Elq9GG8TOu9M0bakvlsREEC+ialrQN6ABS4oDQ69qJv1VtR3uxlKMCQMCvzk7vr17RHKcjx68A==
-  dependencies:
-    "@babel/helper-builder-binary-assignment-operator-visitor" "^7.1.0"
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-for-of@^7.4.4":
-  version "7.4.4"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-for-of/-/plugin-transform-for-of-7.4.4.tgz#0267fc735e24c808ba173866c6c4d1440fc3c556"
-  integrity sha512-9T/5Dlr14Z9TIEXLXkt8T1DU7F24cbhwhMNUziN3hB1AXoZcdzPcTiKGRn/6iOymDqtTKWnr/BtRKN9JwbKtdQ==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-function-name@^7.4.4":
-  version "7.4.4"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-function-name/-/plugin-transform-function-name-7.4.4.tgz#e1436116abb0610c2259094848754ac5230922ad"
-  integrity sha512-iU9pv7U+2jC9ANQkKeNF6DrPy4GBa4NWQtl6dHB4Pb3izX2JOEvDTFarlNsBj/63ZEzNNIAMs3Qw4fNCcSOXJA==
-  dependencies:
-    "@babel/helper-function-name" "^7.1.0"
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-literals@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-literals/-/plugin-transform-literals-7.2.0.tgz#690353e81f9267dad4fd8cfd77eafa86aba53ea1"
-  integrity sha512-2ThDhm4lI4oV7fVQ6pNNK+sx+c/GM5/SaML0w/r4ZB7sAneD/piDJtwdKlNckXeyGK7wlwg2E2w33C/Hh+VFCg==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-member-expression-literals@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-member-expression-literals/-/plugin-transform-member-expression-literals-7.2.0.tgz#fa10aa5c58a2cb6afcf2c9ffa8cb4d8b3d489a2d"
-  integrity sha512-HiU3zKkSU6scTidmnFJ0bMX8hz5ixC93b4MHMiYebmk2lUVNGOboPsqQvx5LzooihijUoLR/v7Nc1rbBtnc7FA==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-modules-amd@^7.5.0":
-  version "7.5.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-modules-amd/-/plugin-transform-modules-amd-7.5.0.tgz#ef00435d46da0a5961aa728a1d2ecff063e4fb91"
-  integrity sha512-n20UsQMKnWrltocZZm24cRURxQnWIvsABPJlw/fvoy9c6AgHZzoelAIzajDHAQrDpuKFFPPcFGd7ChsYuIUMpg==
-  dependencies:
-    "@babel/helper-module-transforms" "^7.1.0"
-    "@babel/helper-plugin-utils" "^7.0.0"
-    babel-plugin-dynamic-import-node "^2.3.0"
-
-"@babel/plugin-transform-modules-commonjs@^7.6.0":
-  version "7.6.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-modules-commonjs/-/plugin-transform-modules-commonjs-7.6.0.tgz#39dfe957de4420445f1fcf88b68a2e4aa4515486"
-  integrity sha512-Ma93Ix95PNSEngqomy5LSBMAQvYKVe3dy+JlVJSHEXZR5ASL9lQBedMiCyVtmTLraIDVRE3ZjTZvmXXD2Ozw3g==
-  dependencies:
-    "@babel/helper-module-transforms" "^7.4.4"
-    "@babel/helper-plugin-utils" "^7.0.0"
-    "@babel/helper-simple-access" "^7.1.0"
-    babel-plugin-dynamic-import-node "^2.3.0"
-
-"@babel/plugin-transform-modules-systemjs@^7.5.0":
-  version "7.5.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-modules-systemjs/-/plugin-transform-modules-systemjs-7.5.0.tgz#e75266a13ef94202db2a0620977756f51d52d249"
-  integrity sha512-Q2m56tyoQWmuNGxEtUyeEkm6qJYFqs4c+XyXH5RAuYxObRNz9Zgj/1g2GMnjYp2EUyEy7YTrxliGCXzecl/vJg==
-  dependencies:
-    "@babel/helper-hoist-variables" "^7.4.4"
-    "@babel/helper-plugin-utils" "^7.0.0"
-    babel-plugin-dynamic-import-node "^2.3.0"
-
-"@babel/plugin-transform-modules-umd@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-modules-umd/-/plugin-transform-modules-umd-7.2.0.tgz#7678ce75169f0877b8eb2235538c074268dd01ae"
-  integrity sha512-BV3bw6MyUH1iIsGhXlOK6sXhmSarZjtJ/vMiD9dNmpY8QXFFQTj+6v92pcfy1iqa8DeAfJFwoxcrS/TUZda6sw==
-  dependencies:
-    "@babel/helper-module-transforms" "^7.1.0"
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-named-capturing-groups-regex@^7.6.2":
-  version "7.6.2"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-named-capturing-groups-regex/-/plugin-transform-named-capturing-groups-regex-7.6.2.tgz#c1ca0bb84b94f385ca302c3932e870b0fb0e522b"
-  integrity sha512-xBdB+XOs+lgbZc2/4F5BVDVcDNS4tcSKQc96KmlqLEAwz6tpYPEvPdmDfvVG0Ssn8lAhronaRs6Z6KSexIpK5g==
-  dependencies:
-    regexpu-core "^4.6.0"
-
-"@babel/plugin-transform-new-target@^7.4.4":
-  version "7.4.4"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-new-target/-/plugin-transform-new-target-7.4.4.tgz#18d120438b0cc9ee95a47f2c72bc9768fbed60a5"
-  integrity sha512-r1z3T2DNGQwwe2vPGZMBNjioT2scgWzK9BCnDEh+46z8EEwXBq24uRzd65I7pjtugzPSj921aM15RpESgzsSuA==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-object-super@^7.5.5":
-  version "7.5.5"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-object-super/-/plugin-transform-object-super-7.5.5.tgz#c70021df834073c65eb613b8679cc4a381d1a9f9"
-  integrity sha512-un1zJQAhSosGFBduPgN/YFNvWVpRuHKU7IHBglLoLZsGmruJPOo6pbInneflUdmq7YvSVqhpPs5zdBvLnteltQ==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-    "@babel/helper-replace-supers" "^7.5.5"
-
-"@babel/plugin-transform-parameters@^7.4.4":
-  version "7.4.4"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-parameters/-/plugin-transform-parameters-7.4.4.tgz#7556cf03f318bd2719fe4c922d2d808be5571e16"
-  integrity sha512-oMh5DUO1V63nZcu/ZVLQFqiihBGo4OpxJxR1otF50GMeCLiRx5nUdtokd+u9SuVJrvvuIh9OosRFPP4pIPnwmw==
-  dependencies:
-    "@babel/helper-call-delegate" "^7.4.4"
-    "@babel/helper-get-function-arity" "^7.0.0"
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-property-literals@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-property-literals/-/plugin-transform-property-literals-7.2.0.tgz#03e33f653f5b25c4eb572c98b9485055b389e905"
-  integrity sha512-9q7Dbk4RhgcLp8ebduOpCbtjh7C0itoLYHXd9ueASKAG/is5PQtMR5VJGka9NKqGhYEGn5ITahd4h9QeBMylWQ==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-regenerator@^7.4.5":
-  version "7.4.5"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-regenerator/-/plugin-transform-regenerator-7.4.5.tgz#629dc82512c55cee01341fb27bdfcb210354680f"
-  integrity sha512-gBKRh5qAaCWntnd09S8QC7r3auLCqq5DI6O0DlfoyDjslSBVqBibrMdsqO+Uhmx3+BlOmE/Kw1HFxmGbv0N9dA==
-  dependencies:
-    regenerator-transform "^0.14.0"
-
-"@babel/plugin-transform-reserved-words@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-reserved-words/-/plugin-transform-reserved-words-7.2.0.tgz#4792af87c998a49367597d07fedf02636d2e1634"
-  integrity sha512-fz43fqW8E1tAB3DKF19/vxbpib1fuyCwSPE418ge5ZxILnBhWyhtPgz8eh1RCGGJlwvksHkyxMxh0eenFi+kFw==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-shorthand-properties@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-shorthand-properties/-/plugin-transform-shorthand-properties-7.2.0.tgz#6333aee2f8d6ee7e28615457298934a3b46198f0"
-  integrity sha512-QP4eUM83ha9zmYtpbnyjTLAGKQritA5XW/iG9cjtuOI8s1RuL/3V6a3DeSHfKutJQ+ayUfeZJPcnCYEQzaPQqg==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-spread@^7.6.2":
-  version "7.6.2"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-spread/-/plugin-transform-spread-7.6.2.tgz#fc77cf798b24b10c46e1b51b1b88c2bf661bb8dd"
-  integrity sha512-DpSvPFryKdK1x+EDJYCy28nmAaIMdxmhot62jAXF/o99iA33Zj2Lmcp3vDmz+MUh0LNYVPvfj5iC3feb3/+PFg==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-sticky-regex@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-sticky-regex/-/plugin-transform-sticky-regex-7.2.0.tgz#a1e454b5995560a9c1e0d537dfc15061fd2687e1"
-  integrity sha512-KKYCoGaRAf+ckH8gEL3JHUaFVyNHKe3ASNsZ+AlktgHevvxGigoIttrEJb8iKN03Q7Eazlv1s6cx2B2cQ3Jabw==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-    "@babel/helper-regex" "^7.0.0"
-
-"@babel/plugin-transform-template-literals@^7.4.4":
-  version "7.4.4"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-template-literals/-/plugin-transform-template-literals-7.4.4.tgz#9d28fea7bbce637fb7612a0750989d8321d4bcb0"
-  integrity sha512-mQrEC4TWkhLN0z8ygIvEL9ZEToPhG5K7KDW3pzGqOfIGZ28Jb0POUkeWcoz8HnHvhFy6dwAT1j8OzqN8s804+g==
-  dependencies:
-    "@babel/helper-annotate-as-pure" "^7.0.0"
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-typeof-symbol@^7.2.0":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-typeof-symbol/-/plugin-transform-typeof-symbol-7.2.0.tgz#117d2bcec2fbf64b4b59d1f9819894682d29f2b2"
-  integrity sha512-2LNhETWYxiYysBtrBTqL8+La0jIoQQnIScUJc74OYvUGRmkskNY4EzLCnjHBzdmb38wqtTaixpo1NctEcvMDZw==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-
-"@babel/plugin-transform-unicode-regex@^7.6.2":
-  version "7.6.2"
-  resolved "https://registry.yarnpkg.com/@babel/plugin-transform-unicode-regex/-/plugin-transform-unicode-regex-7.6.2.tgz#b692aad888a7e8d8b1b214be6b9dc03d5031f698"
-  integrity sha512-orZI6cWlR3nk2YmYdb0gImrgCUwb5cBUwjf6Ks6dvNVvXERkwtJWOQaEOjPiu0Gu1Tq6Yq/hruCZZOOi9F34Dw==
-  dependencies:
-    "@babel/helper-plugin-utils" "^7.0.0"
-    "@babel/helper-regex" "^7.4.4"
-    regexpu-core "^4.6.0"
-
-"@babel/preset-env@^7.6.2":
-  version "7.6.2"
-  resolved "https://registry.yarnpkg.com/@babel/preset-env/-/preset-env-7.6.2.tgz#abbb3ed785c7fe4220d4c82a53621d71fc0c75d3"
-  integrity sha512-Ru7+mfzy9M1/YTEtlDS8CD45jd22ngb9tXnn64DvQK3ooyqSw9K4K9DUWmYknTTVk4TqygL9dqCrZgm1HMea/Q==
-  dependencies:
-    "@babel/helper-module-imports" "^7.0.0"
-    "@babel/helper-plugin-utils" "^7.0.0"
-    "@babel/plugin-proposal-async-generator-functions" "^7.2.0"
-    "@babel/plugin-proposal-dynamic-import" "^7.5.0"
-    "@babel/plugin-proposal-json-strings" "^7.2.0"
-    "@babel/plugin-proposal-object-rest-spread" "^7.6.2"
-    "@babel/plugin-proposal-optional-catch-binding" "^7.2.0"
-    "@babel/plugin-proposal-unicode-property-regex" "^7.6.2"
-    "@babel/plugin-syntax-async-generators" "^7.2.0"
-    "@babel/plugin-syntax-dynamic-import" "^7.2.0"
-    "@babel/plugin-syntax-json-strings" "^7.2.0"
-    "@babel/plugin-syntax-object-rest-spread" "^7.2.0"
-    "@babel/plugin-syntax-optional-catch-binding" "^7.2.0"
-    "@babel/plugin-transform-arrow-functions" "^7.2.0"
-    "@babel/plugin-transform-async-to-generator" "^7.5.0"
-    "@babel/plugin-transform-block-scoped-functions" "^7.2.0"
-    "@babel/plugin-transform-block-scoping" "^7.6.2"
-    "@babel/plugin-transform-classes" "^7.5.5"
-    "@babel/plugin-transform-computed-properties" "^7.2.0"
-    "@babel/plugin-transform-destructuring" "^7.6.0"
-    "@babel/plugin-transform-dotall-regex" "^7.6.2"
-    "@babel/plugin-transform-duplicate-keys" "^7.5.0"
-    "@babel/plugin-transform-exponentiation-operator" "^7.2.0"
-    "@babel/plugin-transform-for-of" "^7.4.4"
-    "@babel/plugin-transform-function-name" "^7.4.4"
-    "@babel/plugin-transform-literals" "^7.2.0"
-    "@babel/plugin-transform-member-expression-literals" "^7.2.0"
-    "@babel/plugin-transform-modules-amd" "^7.5.0"
-    "@babel/plugin-transform-modules-commonjs" "^7.6.0"
-    "@babel/plugin-transform-modules-systemjs" "^7.5.0"
-    "@babel/plugin-transform-modules-umd" "^7.2.0"
-    "@babel/plugin-transform-named-capturing-groups-regex" "^7.6.2"
-    "@babel/plugin-transform-new-target" "^7.4.4"
-    "@babel/plugin-transform-object-super" "^7.5.5"
-    "@babel/plugin-transform-parameters" "^7.4.4"
-    "@babel/plugin-transform-property-literals" "^7.2.0"
-    "@babel/plugin-transform-regenerator" "^7.4.5"
-    "@babel/plugin-transform-reserved-words" "^7.2.0"
-    "@babel/plugin-transform-shorthand-properties" "^7.2.0"
-    "@babel/plugin-transform-spread" "^7.6.2"
-    "@babel/plugin-transform-sticky-regex" "^7.2.0"
-    "@babel/plugin-transform-template-literals" "^7.4.4"
-    "@babel/plugin-transform-typeof-symbol" "^7.2.0"
-    "@babel/plugin-transform-unicode-regex" "^7.6.2"
-    "@babel/types" "^7.6.0"
-    browserslist "^4.6.0"
-    core-js-compat "^3.1.1"
-    invariant "^2.2.2"
-    js-levenshtein "^1.1.3"
-    semver "^5.5.0"
-
-"@babel/template@^7.1.0", "@babel/template@^7.4.4":
-  version "7.6.0"
-  resolved "https://registry.yarnpkg.com/@babel/template/-/template-7.6.0.tgz#7f0159c7f5012230dad64cca42ec9bdb5c9536e6"
-  integrity sha512-5AEH2EXD8euCk446b7edmgFdub/qfH1SN6Nii3+fyXP807QRx9Q73A2N5hNwRRslC2H9sNzaFhsPubkS4L8oNQ==
-  dependencies:
-    "@babel/code-frame" "^7.0.0"
-    "@babel/parser" "^7.6.0"
-    "@babel/types" "^7.6.0"
-
-"@babel/traverse@^7.0.0", "@babel/traverse@^7.1.0", "@babel/traverse@^7.4.4", "@babel/traverse@^7.5.5":
-  version "7.6.2"
-  resolved "https://registry.yarnpkg.com/@babel/traverse/-/traverse-7.6.2.tgz#b0e2bfd401d339ce0e6c05690206d1e11502ce2c"
-  integrity sha512-8fRE76xNwNttVEF2TwxJDGBLWthUkHWSldmfuBzVRmEDWOtu4XdINTgN7TDWzuLg4bbeIMLvfMFD9we5YcWkRQ==
-  dependencies:
-    "@babel/code-frame" "^7.5.5"
-    "@babel/generator" "^7.6.2"
-    "@babel/helper-function-name" "^7.1.0"
-    "@babel/helper-split-export-declaration" "^7.4.4"
-    "@babel/parser" "^7.6.2"
-    "@babel/types" "^7.6.0"
-    debug "^4.1.0"
-    globals "^11.1.0"
-    lodash "^4.17.13"
-
-"@babel/types@^7.0.0", "@babel/types@^7.2.0", "@babel/types@^7.4.4", "@babel/types@^7.5.5", "@babel/types@^7.6.0":
-  version "7.6.1"
-  resolved "https://registry.yarnpkg.com/@babel/types/-/types-7.6.1.tgz#53abf3308add3ac2a2884d539151c57c4b3ac648"
-  integrity sha512-X7gdiuaCmA0uRjCmRtYJNAVCc/q+5xSgsfKJHqMN4iNLILX39677fJE1O40arPMh0TTtS9ItH67yre6c7k6t0g==
-  dependencies:
-    esutils "^2.0.2"
-    lodash "^4.17.13"
-    to-fast-properties "^2.0.0"
-
-abbrev@1:
-  version "1.1.1"
-  resolved "https://registry.yarnpkg.com/abbrev/-/abbrev-1.1.1.tgz#f8f2c887ad10bf67f634f005b6987fed3179aac8"
-  integrity sha512-nne9/IiQ/hzIhY6pdDnbBtz7DjPTKrY00P/zvPSm5pOFkl6xuGrGnXn/VtTNNfNtAfZ9/1RtehkszU9qcTii0Q==
-
-acorn-jsx@^3.0.0:
-  version "3.0.1"
-  resolved "https://registry.yarnpkg.com/acorn-jsx/-/acorn-jsx-3.0.1.tgz#afdf9488fb1ecefc8348f6fb22f464e32a58b36b"
-  integrity sha1-r9+UiPsezvyDSPb7IvRk4ypYs2s=
-  dependencies:
-    acorn "^3.0.4"
-
-acorn@^3.0.4:
-  version "3.3.0"
-  resolved "https://registry.yarnpkg.com/acorn/-/acorn-3.3.0.tgz#45e37fb39e8da3f25baee3ff5369e2bb5f22017a"
-  integrity sha1-ReN/s56No/JbruP/U2niu18iAXo=
-
-acorn@^5.5.0:
-  version "5.7.3"
-  resolved "https://registry.yarnpkg.com/acorn/-/acorn-5.7.3.tgz#67aa231bf8812974b85235a96771eb6bd07ea279"
-  integrity sha512-T/zvzYRfbVojPWahDsE5evJdHb3oJoQfFbsrKM7w5Zcs++Tr257tia3BmMP8XYVjp1S9RZXQMh7gao96BlqZOw==
-
-ajv-keywords@^1.0.0:
-  version "1.5.1"
-  resolved "https://registry.yarnpkg.com/ajv-keywords/-/ajv-keywords-1.5.1.tgz#314dd0a4b3368fad3dfcdc54ede6171b886daf3c"
-  integrity sha1-MU3QpLM2j609/NxU7eYXG4htrzw=
-
-ajv@^4.7.0:
-  version "4.11.8"
-  resolved "https://registry.yarnpkg.com/ajv/-/ajv-4.11.8.tgz#82ffb02b29e662ae53bdc20af15947706739c536"
-  integrity sha1-gv+wKynmYq5TvcIK8VlHcGc5xTY=
-  dependencies:
-    co "^4.6.0"
-    json-stable-stringify "^1.0.1"
-
-ansi-escapes@^1.1.0:
-  version "1.4.0"
-  resolved "https://registry.yarnpkg.com/ansi-escapes/-/ansi-escapes-1.4.0.tgz#d3a8a83b319aa67793662b13e761c7911422306e"
-  integrity sha1-06ioOzGapneTZisT52HHkRQiMG4=
-
-ansi-regex@^2.0.0:
-  version "2.1.1"
-  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-2.1.1.tgz#c3b33ab5ee360d86e0e628f0468ae7ef27d654df"
-  integrity sha1-w7M6te42DYbg5ijwRorn7yfWVN8=
-
-ansi-regex@^3.0.0:
-  version "3.0.0"
-  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-3.0.0.tgz#ed0317c322064f79466c02966bddb605ab37d998"
-  integrity sha1-7QMXwyIGT3lGbAKWa922Bas32Zg=
-
-ansi-styles@^2.2.1:
-  version "2.2.1"
-  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-2.2.1.tgz#b432dd3358b634cf75e1e4664368240533c1ddbe"
-  integrity sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=
-
-ansi-styles@^3.2.1:
-  version "3.2.1"
-  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.2.1.tgz#41fbb20243e50b12be0f04b8dedbf07520ce841d"
-  integrity sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==
-  dependencies:
-    color-convert "^1.9.0"
-
-anymatch@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/anymatch/-/anymatch-2.0.0.tgz#bcb24b4f37934d9aa7ac17b4adaf89e7c76ef2eb"
-  integrity sha512-5teOsQWABXHHBFP9y3skS5P3d/WfWXpv3FUpy+LorMrNYaT9pI4oLMQX7jzQ2KklNpGpWHzdCXTDT2Y3XGlZBw==
-  dependencies:
-    micromatch "^3.1.4"
-    normalize-path "^2.1.1"
-
-aproba@^1.0.3:
-  version "1.2.0"
-  resolved "https://registry.yarnpkg.com/aproba/-/aproba-1.2.0.tgz#6802e6264efd18c790a1b0d517f0f2627bf2c94a"
-  integrity sha512-Y9J6ZjXtoYh8RnXVCMOU/ttDmk1aBjunq9vO0ta5x85WDQiQfUF9sIPBITdbiiIVcBo03Hi3jMxigBtsddlXRw==
-
-are-we-there-yet@~1.1.2:
-  version "1.1.5"
-  resolved "https://registry.yarnpkg.com/are-we-there-yet/-/are-we-there-yet-1.1.5.tgz#4b35c2944f062a8bfcda66410760350fe9ddfc21"
-  integrity sha512-5hYdAkZlcG8tOLujVDTgCT+uPX0VnpAH28gWsLfzpXYm7wP6mp5Q/gYyR7YQ0cKVJcXJnl3j2kpBan13PtQf6w==
-  dependencies:
-    delegates "^1.0.0"
-    readable-stream "^2.0.6"
-
-argparse@^1.0.7:
-  version "1.0.10"
-  resolved "https://registry.yarnpkg.com/argparse/-/argparse-1.0.10.tgz#bcd6791ea5ae09725e17e5ad988134cd40b3d911"
-  integrity sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==
-  dependencies:
-    sprintf-js "~1.0.2"
-
-arr-diff@^4.0.0:
-  version "4.0.0"
-  resolved "https://registry.yarnpkg.com/arr-diff/-/arr-diff-4.0.0.tgz#d6461074febfec71e7e15235761a329a5dc7c520"
-  integrity sha1-1kYQdP6/7HHn4VI1dhoyml3HxSA=
-
-arr-flatten@^1.1.0:
-  version "1.1.0"
-  resolved "https://registry.yarnpkg.com/arr-flatten/-/arr-flatten-1.1.0.tgz#36048bbff4e7b47e136644316c99669ea5ae91f1"
-  integrity sha512-L3hKV5R/p5o81R7O02IGnwpDmkp6E982XhtbuwSe3O4qOtMMMtodicASA1Cny2U+aCXcNpml+m4dPsvsJ3jatg==
-
-arr-union@^3.1.0:
-  version "3.1.0"
-  resolved "https://registry.yarnpkg.com/arr-union/-/arr-union-3.1.0.tgz#e39b09aea9def866a8f206e288af63919bae39c4"
-  integrity sha1-45sJrqne+Gao8gbiiK9jkZuuOcQ=
-
-array-unique@^0.3.2:
-  version "0.3.2"
-  resolved "https://registry.yarnpkg.com/array-unique/-/array-unique-0.3.2.tgz#a894b75d4bc4f6cd679ef3244a9fd8f46ae2d428"
-  integrity sha1-qJS3XUvE9s1nnvMkSp/Y9Gri1Cg=
-
-assign-symbols@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/assign-symbols/-/assign-symbols-1.0.0.tgz#59667f41fadd4f20ccbc2bb96b8d4f7f78ec0367"
-  integrity sha1-WWZ/QfrdTyDMvCu5a41Pf3jsA2c=
-
-async-each@^1.0.1:
-  version "1.0.3"
-  resolved "https://registry.yarnpkg.com/async-each/-/async-each-1.0.3.tgz#b727dbf87d7651602f06f4d4ac387f47d91b0cbf"
-  integrity sha512-z/WhQ5FPySLdvREByI2vZiTWwCnF0moMJ1hK9YQwDTHKh6I7/uSckMetoRGb5UBZPC1z0jlw+n/XCgjeH7y1AQ==
-
-atob@^2.1.1:
-  version "2.1.2"
-  resolved "https://registry.yarnpkg.com/atob/-/atob-2.1.2.tgz#6d9517eb9e030d2436666651e86bd9f6f13533c9"
-  integrity sha512-Wm6ukoaOGJi/73p/cl2GvLjTI5JM1k/O14isD73YML8StrH/7/lRFgmg8nICZgD3bZZvjwCGxtMOD3wWNAu8cg==
-
-babel-code-frame@^6.16.0:
-  version "6.26.0"
-  resolved "https://registry.yarnpkg.com/babel-code-frame/-/babel-code-frame-6.26.0.tgz#63fd43f7dc1e3bb7ce35947db8fe369a3f58c74b"
-  integrity sha1-Y/1D99weO7fONZR9uP42mj9Yx0s=
-  dependencies:
-    chalk "^1.1.3"
-    esutils "^2.0.2"
-    js-tokens "^3.0.2"
-
-babel-eslint@^10.0.3:
-  version "10.0.3"
-  resolved "https://registry.yarnpkg.com/babel-eslint/-/babel-eslint-10.0.3.tgz#81a2c669be0f205e19462fed2482d33e4687a88a"
-  integrity sha512-z3U7eMY6r/3f3/JB9mTsLjyxrv0Yb1zb8PCWCLpguxfCzBIZUwy23R1t/XKewP+8mEN2Ck8Dtr4q20z6ce6SoA==
-  dependencies:
-    "@babel/code-frame" "^7.0.0"
-    "@babel/parser" "^7.0.0"
-    "@babel/traverse" "^7.0.0"
-    "@babel/types" "^7.0.0"
-    eslint-visitor-keys "^1.0.0"
-    resolve "^1.12.0"
-
-babel-plugin-dynamic-import-node@^2.3.0:
-  version "2.3.0"
-  resolved "https://registry.yarnpkg.com/babel-plugin-dynamic-import-node/-/babel-plugin-dynamic-import-node-2.3.0.tgz#f00f507bdaa3c3e3ff6e7e5e98d90a7acab96f7f"
-  integrity sha512-o6qFkpeQEBxcqt0XYlWzAVxNCSCZdUgcR8IRlhD/8DylxjjO4foPcvTW0GGKa/cVt3rvxZ7o5ippJ+/0nvLhlQ==
-  dependencies:
-    object.assign "^4.1.0"
-
 balanced-match@^1.0.0:
   version "1.0.0"
   resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.0.tgz#89b4d199ab2bee49de164ea02b89ce462d71b767"
   integrity sha1-ibTRmasr7kneFk6gK4nORi1xt2c=
 
-base@^0.11.1:
-  version "0.11.2"
-  resolved "https://registry.yarnpkg.com/base/-/base-0.11.2.tgz#7bde5ced145b6d551a90db87f83c558b4eb48a8f"
-  integrity sha512-5T6P4xPgpp0YDFvSWwEZ4NoE3aM4QBQXDzmVbraCkFj8zHM+mba8SyqB5DbZWyR7mYHo6Y7BdQo3MoA4m0TeQg==
-  dependencies:
-    cache-base "^1.0.1"
-    class-utils "^0.3.5"
-    component-emitter "^1.2.1"
-    define-property "^1.0.0"
-    isobject "^3.0.1"
-    mixin-deep "^1.2.0"
-    pascalcase "^0.1.1"
-
-binary-extensions@^1.0.0:
-  version "1.13.1"
-  resolved "https://registry.yarnpkg.com/binary-extensions/-/binary-extensions-1.13.1.tgz#598afe54755b2868a5330d2aff9d4ebb53209b65"
-  integrity sha512-Un7MIEDdUC5gNpcGDV97op1Ywk748MpHcFTHoYs6qnj1Z3j7I53VG3nwZhKzoBZmbdRNnb6WRdFlwl7tSDuZGw==
-
 brace-expansion@^1.1.7:
   version "1.1.11"
   resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd"
@@ -809,174 +15,11 @@ brace-expansion@^1.1.7:
     balanced-match "^1.0.0"
     concat-map "0.0.1"
 
-braces@^2.3.1, braces@^2.3.2:
-  version "2.3.2"
-  resolved "https://registry.yarnpkg.com/braces/-/braces-2.3.2.tgz#5979fd3f14cd531565e5fa2df1abfff1dfaee729"
-  integrity sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==
-  dependencies:
-    arr-flatten "^1.1.0"
-    array-unique "^0.3.2"
-    extend-shallow "^2.0.1"
-    fill-range "^4.0.0"
-    isobject "^3.0.1"
-    repeat-element "^1.1.2"
-    snapdragon "^0.8.1"
-    snapdragon-node "^2.0.1"
-    split-string "^3.0.2"
-    to-regex "^3.0.1"
-
 browser-stdout@1.3.0:
   version "1.3.0"
   resolved "https://registry.yarnpkg.com/browser-stdout/-/browser-stdout-1.3.0.tgz#f351d32969d32fa5d7a5567154263d928ae3bd1f"
   integrity sha1-81HTKWnTL6XXpVZxVCY9korjvR8=
 
-browserslist@^4.6.0, browserslist@^4.6.6:
-  version "4.7.0"
-  resolved "https://registry.yarnpkg.com/browserslist/-/browserslist-4.7.0.tgz#9ee89225ffc07db03409f2fee524dc8227458a17"
-  integrity sha512-9rGNDtnj+HaahxiVV38Gn8n8Lr8REKsel68v1sPFfIGEK6uSXTY3h9acgiT1dZVtOOUtifo/Dn8daDQ5dUgVsA==
-  dependencies:
-    caniuse-lite "^1.0.30000989"
-    electron-to-chromium "^1.3.247"
-    node-releases "^1.1.29"
-
-buffer-from@^1.0.0:
-  version "1.1.1"
-  resolved "https://registry.yarnpkg.com/buffer-from/-/buffer-from-1.1.1.tgz#32713bc028f75c02fdb710d7c7bcec1f2c6070ef"
-  integrity sha512-MQcXEUbCKtEo7bhqEs6560Hyd4XaovZlO/k9V3hjVUF/zwW7KBVdSK4gIt/bzwS9MbR5qob+F5jusZsb0YQK2A==
-
-cache-base@^1.0.1:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/cache-base/-/cache-base-1.0.1.tgz#0a7f46416831c8b662ee36fe4e7c59d76f666ab2"
-  integrity sha512-AKcdTnFSWATd5/GCPRxr2ChwIJ85CeyrEyjRHlKxQ56d4XJMGym0uAiKn0xbLOGOl3+yRpOTi484dVCEc5AUzQ==
-  dependencies:
-    collection-visit "^1.0.0"
-    component-emitter "^1.2.1"
-    get-value "^2.0.6"
-    has-value "^1.0.0"
-    isobject "^3.0.1"
-    set-value "^2.0.0"
-    to-object-path "^0.3.0"
-    union-value "^1.0.0"
-    unset-value "^1.0.0"
-
-caller-path@^0.1.0:
-  version "0.1.0"
-  resolved "https://registry.yarnpkg.com/caller-path/-/caller-path-0.1.0.tgz#94085ef63581ecd3daa92444a8fe94e82577751f"
-  integrity sha1-lAhe9jWB7NPaqSREqP6U6CV3dR8=
-  dependencies:
-    callsites "^0.2.0"
-
-callsites@^0.2.0:
-  version "0.2.0"
-  resolved "https://registry.yarnpkg.com/callsites/-/callsites-0.2.0.tgz#afab96262910a7f33c19a5775825c69f34e350ca"
-  integrity sha1-r6uWJikQp/M8GaV3WCXGnzTjUMo=
-
-caniuse-lite@^1.0.30000989:
-  version "1.0.30000997"
-  resolved "https://registry.yarnpkg.com/caniuse-lite/-/caniuse-lite-1.0.30000997.tgz#ba44a606804f8680894b7042612c2c7f65685b7e"
-  integrity sha512-BQLFPIdj2ntgBNWp9Q64LGUIEmvhKkzzHhUHR3CD5A9Lb7ZKF20/+sgadhFap69lk5XmK1fTUleDclaRFvgVUA==
-
-chalk@^1.0.0, chalk@^1.1.1, chalk@^1.1.3:
-  version "1.1.3"
-  resolved "https://registry.yarnpkg.com/chalk/-/chalk-1.1.3.tgz#a8115c55e4a702fe4d150abd3872822a7e09fc98"
-  integrity sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=
-  dependencies:
-    ansi-styles "^2.2.1"
-    escape-string-regexp "^1.0.2"
-    has-ansi "^2.0.0"
-    strip-ansi "^3.0.0"
-    supports-color "^2.0.0"
-
-chalk@^2.0.0:
-  version "2.4.2"
-  resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.4.2.tgz#cd42541677a54333cf541a49108c1432b44c9424"
-  integrity sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==
-  dependencies:
-    ansi-styles "^3.2.1"
-    escape-string-regexp "^1.0.5"
-    supports-color "^5.3.0"
-
-chokidar@^2.1.8:
-  version "2.1.8"
-  resolved "https://registry.yarnpkg.com/chokidar/-/chokidar-2.1.8.tgz#804b3a7b6a99358c3c5c61e71d8728f041cff917"
-  integrity sha512-ZmZUazfOzf0Nve7duiCKD23PFSCs4JPoYyccjUFF3aQkQadqBhfzhjkwBH2mNOG9cTBwhamM37EIsIkZw3nRgg==
-  dependencies:
-    anymatch "^2.0.0"
-    async-each "^1.0.1"
-    braces "^2.3.2"
-    glob-parent "^3.1.0"
-    inherits "^2.0.3"
-    is-binary-path "^1.0.0"
-    is-glob "^4.0.0"
-    normalize-path "^3.0.0"
-    path-is-absolute "^1.0.0"
-    readdirp "^2.2.1"
-    upath "^1.1.1"
-  optionalDependencies:
-    fsevents "^1.2.7"
-
-chownr@^1.1.1:
-  version "1.1.3"
-  resolved "https://registry.yarnpkg.com/chownr/-/chownr-1.1.3.tgz#42d837d5239688d55f303003a508230fa6727142"
-  integrity sha512-i70fVHhmV3DtTl6nqvZOnIjbY0Pe4kAUjwHj8z0zAdgBtYrJyYwLKCCuRBQ5ppkyL0AkN7HKRnETdmdp1zqNXw==
-
-circular-json@^0.3.1:
-  version "0.3.3"
-  resolved "https://registry.yarnpkg.com/circular-json/-/circular-json-0.3.3.tgz#815c99ea84f6809529d2f45791bdf82711352d66"
-  integrity sha512-UZK3NBx2Mca+b5LsG7bY183pHWt5Y1xts4P3Pz7ENTwGVnJOUWbRb3ocjvX7hx9tq/yTAdclXm9sZ38gNuem4A==
-
-class-utils@^0.3.5:
-  version "0.3.6"
-  resolved "https://registry.yarnpkg.com/class-utils/-/class-utils-0.3.6.tgz#f93369ae8b9a7ce02fd41faad0ca83033190c463"
-  integrity sha512-qOhPa/Fj7s6TY8H8esGu5QNpMMQxz79h+urzrNYN6mn+9BnxlDGf5QZ+XeCDsxSjPqsSR56XOZOJmpeurnLMeg==
-  dependencies:
-    arr-union "^3.1.0"
-    define-property "^0.2.5"
-    isobject "^3.0.0"
-    static-extend "^0.1.1"
-
-cli-cursor@^1.0.1:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/cli-cursor/-/cli-cursor-1.0.2.tgz#64da3f7d56a54412e59794bd62dc35295e8f2987"
-  integrity sha1-ZNo/fValRBLll5S9Ytw1KV6PKYc=
-  dependencies:
-    restore-cursor "^1.0.1"
-
-cli-width@^2.0.0:
-  version "2.2.0"
-  resolved "https://registry.yarnpkg.com/cli-width/-/cli-width-2.2.0.tgz#ff19ede8a9a5e579324147b0c11f0fbcbabed639"
-  integrity sha1-/xnt6Kml5XkyQUewwR8PvLq+1jk=
-
-co@^4.6.0:
-  version "4.6.0"
-  resolved "https://registry.yarnpkg.com/co/-/co-4.6.0.tgz#6ea6bdf3d853ae54ccb8e47bfa0bf3f9031fb184"
-  integrity sha1-bqa989hTrlTMuOR7+gvz+QMfsYQ=
-
-code-point-at@^1.0.0:
-  version "1.1.0"
-  resolved "https://registry.yarnpkg.com/code-point-at/-/code-point-at-1.1.0.tgz#0d070b4d043a5bea33a2f1a40e2edb3d9a4ccf77"
-  integrity sha1-DQcLTQQ6W+ozovGkDi7bPZpMz3c=
-
-collection-visit@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/collection-visit/-/collection-visit-1.0.0.tgz#4bc0373c164bc3291b4d368c829cf1a80a59dca0"
-  integrity sha1-S8A3PBZLwykbTTaMgpzxqApZ3KA=
-  dependencies:
-    map-visit "^1.0.0"
-    object-visit "^1.0.0"
-
-color-convert@^1.9.0:
-  version "1.9.3"
-  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.3.tgz#bb71850690e1f136567de629d2d5471deda4c1e8"
-  integrity sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==
-  dependencies:
-    color-name "1.1.3"
-
-color-name@1.1.3:
-  version "1.1.3"
-  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.3.tgz#a7d0558bd89c42f795dd42328f740831ca53bc25"
-  integrity sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=
-
 commander@2.9.0:
   version "2.9.0"
   resolved "https://registry.yarnpkg.com/commander/-/commander-2.9.0.tgz#9c99094176e12240cb22d6c5146098400fe0f7d4"
@@ -984,69 +27,11 @@ commander@2.9.0:
   dependencies:
     graceful-readlink ">= 1.0.0"
 
-commander@^2.8.1:
-  version "2.20.1"
-  resolved "https://registry.yarnpkg.com/commander/-/commander-2.20.1.tgz#3863ce3ca92d0831dcf2a102f5fb4b5926afd0f9"
-  integrity sha512-cCuLsMhJeWQ/ZpsFTbE765kvVfoeSddc4nU3up4fV+fDBcfUXnbITJ+JzhkdjzOqhURjZgujxaioam4RM9yGUg==
-
-component-emitter@^1.2.1:
-  version "1.3.0"
-  resolved "https://registry.yarnpkg.com/component-emitter/-/component-emitter-1.3.0.tgz#16e4070fba8ae29b679f2215853ee181ab2eabc0"
-  integrity sha512-Rd3se6QB+sO1TwqZjscQrurpEPIfO0/yYnSin6Q/rD3mOutHvUrCAhJub3r90uNb+SESBuE0QYoB90YdfatsRg==
-
 concat-map@0.0.1:
   version "0.0.1"
   resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b"
   integrity sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=
 
-concat-stream@^1.4.6:
-  version "1.6.2"
-  resolved "https://registry.yarnpkg.com/concat-stream/-/concat-stream-1.6.2.tgz#904bdf194cd3122fc675c77fc4ac3d4ff0fd1a34"
-  integrity sha512-27HBghJxjiZtIk3Ycvn/4kbJk/1uZuJFfuPEns6LaEvpvG1f0hTea8lilrouyo9mVc2GWdcEZ8OLoGmSADlrCw==
-  dependencies:
-    buffer-from "^1.0.0"
-    inherits "^2.0.3"
-    readable-stream "^2.2.2"
-    typedarray "^0.0.6"
-
-console-control-strings@^1.0.0, console-control-strings@~1.1.0:
-  version "1.1.0"
-  resolved "https://registry.yarnpkg.com/console-control-strings/-/console-control-strings-1.1.0.tgz#3d7cf4464db6446ea644bf4b39507f9851008e8e"
-  integrity sha1-PXz0Rk22RG6mRL9LOVB/mFEAjo4=
-
-convert-source-map@^1.1.0:
-  version "1.6.0"
-  resolved "https://registry.yarnpkg.com/convert-source-map/-/convert-source-map-1.6.0.tgz#51b537a8c43e0f04dec1993bffcdd504e758ac20"
-  integrity sha512-eFu7XigvxdZ1ETfbgPBohgyQ/Z++C0eEhTor0qRwBw9unw+L0/6V8wkSuGgzdThkiS5lSpdptOQPD8Ak40a+7A==
-  dependencies:
-    safe-buffer "~5.1.1"
-
-copy-descriptor@^0.1.0:
-  version "0.1.1"
-  resolved "https://registry.yarnpkg.com/copy-descriptor/-/copy-descriptor-0.1.1.tgz#676f6eb3c39997c2ee1ac3a924fd6124748f578d"
-  integrity sha1-Z29us8OZl8LuGsOpJP1hJHSPV40=
-
-core-js-compat@^3.1.1:
-  version "3.2.1"
-  resolved "https://registry.yarnpkg.com/core-js-compat/-/core-js-compat-3.2.1.tgz#0cbdbc2e386e8e00d3b85dc81c848effec5b8150"
-  integrity sha512-MwPZle5CF9dEaMYdDeWm73ao/IflDH+FjeJCWEADcEgFSE9TLimFKwJsfmkwzI8eC0Aj0mgvMDjeQjrElkz4/A==
-  dependencies:
-    browserslist "^4.6.6"
-    semver "^6.3.0"
-
-core-util-is@~1.0.0:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/core-util-is/-/core-util-is-1.0.2.tgz#b5fd54220aa2bc5ab57aab7140c940754503c1a7"
-  integrity sha1-tf1UIgqivFq1eqtxQMlAdUUDwac=
-
-d@1, d@^1.0.1:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/d/-/d-1.0.1.tgz#8698095372d58dbee346ffd0c7093f99f8f9eb5a"
-  integrity sha512-m62ShEObQ39CfralilEQRjH6oAMtNCV1xJyEx5LpRYUVN+EviphDgUc/F3hnYbADmkiNs67Y+3ylmlG7Lnu+FA==
-  dependencies:
-    es5-ext "^0.10.50"
-    type "^1.0.1"
-
 debug@2.6.8:
   version "2.6.8"
   resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.8.tgz#e731531ca2ede27d188222427da17821d68ff4fc"
@@ -1054,435 +39,21 @@ debug@2.6.8:
   dependencies:
     ms "2.0.0"
 
-debug@^2.1.1, debug@^2.2.0, debug@^2.3.3:
-  version "2.6.9"
-  resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.9.tgz#5d128515df134ff327e90a4c93f4e077a536341f"
-  integrity sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==
-  dependencies:
-    ms "2.0.0"
-
-debug@^3.2.6:
-  version "3.2.6"
-  resolved "https://registry.yarnpkg.com/debug/-/debug-3.2.6.tgz#e83d17de16d8a7efb7717edbe5fb10135eee629b"
-  integrity sha512-mel+jf7nrtEl5Pn1Qx46zARXKDpBbvzezse7p7LqINmdoIk8PYP5SySaxEmYv6TZ0JyEKA1hsCId6DIhgITtWQ==
-  dependencies:
-    ms "^2.1.1"
-
-debug@^4.1.0:
-  version "4.1.1"
-  resolved "https://registry.yarnpkg.com/debug/-/debug-4.1.1.tgz#3b72260255109c6b589cee050f1d516139664791"
-  integrity sha512-pYAIzeRo8J6KPEaJ0VWOh5Pzkbw/RetuzehGM7QRRX5he4fPHx2rdKMB256ehJCkX+XRQm16eZLqLNS8RSZXZw==
-  dependencies:
-    ms "^2.1.1"
-
-decode-uri-component@^0.2.0:
-  version "0.2.0"
-  resolved "https://registry.yarnpkg.com/decode-uri-component/-/decode-uri-component-0.2.0.tgz#eb3913333458775cb84cd1a1fae062106bb87545"
-  integrity sha1-6zkTMzRYd1y4TNGh+uBiEGu4dUU=
-
-deep-extend@^0.6.0:
-  version "0.6.0"
-  resolved "https://registry.yarnpkg.com/deep-extend/-/deep-extend-0.6.0.tgz#c4fa7c95404a17a9c3e8ca7e1537312b736330ac"
-  integrity sha512-LOHxIOaPYdHlJRtCQfDIVZtfw/ufM8+rVj649RIHzcm/vGwQRXFt6OPqIFWsm2XEMrNIEtWR64sY1LEKD2vAOA==
-
-deep-is@~0.1.3:
-  version "0.1.3"
-  resolved "https://registry.yarnpkg.com/deep-is/-/deep-is-0.1.3.tgz#b369d6fb5dbc13eecf524f91b070feedc357cf34"
-  integrity sha1-s2nW+128E+7PUk+RsHD+7cNXzzQ=
-
-define-properties@^1.1.2:
-  version "1.1.3"
-  resolved "https://registry.yarnpkg.com/define-properties/-/define-properties-1.1.3.tgz#cf88da6cbee26fe6db7094f61d870cbd84cee9f1"
-  integrity sha512-3MqfYKj2lLzdMSf8ZIZE/V+Zuy+BgD6f164e8K2w7dgnpKArBDerGYpM46IYYcjnkdPNMjPk9A6VFB8+3SKlXQ==
-  dependencies:
-    object-keys "^1.0.12"
-
-define-property@^0.2.5:
-  version "0.2.5"
-  resolved "https://registry.yarnpkg.com/define-property/-/define-property-0.2.5.tgz#c35b1ef918ec3c990f9a5bc57be04aacec5c8116"
-  integrity sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=
-  dependencies:
-    is-descriptor "^0.1.0"
-
-define-property@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/define-property/-/define-property-1.0.0.tgz#769ebaaf3f4a63aad3af9e8d304c9bbe79bfb0e6"
-  integrity sha1-dp66rz9KY6rTr56NMEybvnm/sOY=
-  dependencies:
-    is-descriptor "^1.0.0"
-
-define-property@^2.0.2:
-  version "2.0.2"
-  resolved "https://registry.yarnpkg.com/define-property/-/define-property-2.0.2.tgz#d459689e8d654ba77e02a817f8710d702cb16e9d"
-  integrity sha512-jwK2UV4cnPpbcG7+VRARKTZPUWowwXA8bzH5NP6ud0oeAxyYPuGZUAC7hMugpCdz4BeSZl2Dl9k66CHJ/46ZYQ==
-  dependencies:
-    is-descriptor "^1.0.2"
-    isobject "^3.0.1"
-
-delegates@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/delegates/-/delegates-1.0.0.tgz#84c6e159b81904fdca59a0ef44cd870d31250f9a"
-  integrity sha1-hMbhWbgZBP3KWaDvRM2HDTElD5o=
-
-detect-libc@^1.0.2:
-  version "1.0.3"
-  resolved "https://registry.yarnpkg.com/detect-libc/-/detect-libc-1.0.3.tgz#fa137c4bd698edf55cd5cd02ac559f91a4c4ba9b"
-  integrity sha1-+hN8S9aY7fVc1c0CrFWfkaTEups=
-
 diff@3.2.0:
   version "3.2.0"
   resolved "https://registry.yarnpkg.com/diff/-/diff-3.2.0.tgz#c9ce393a4b7cbd0b058a725c93df299027868ff9"
   integrity sha1-yc45Okt8vQsFinJck98pkCeGj/k=
 
-doctrine@^1.2.2:
-  version "1.5.0"
-  resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-1.5.0.tgz#379dce730f6166f76cefa4e6707a159b02c5a6fa"
-  integrity sha1-N53Ocw9hZvds76TmcHoVmwLFpvo=
-  dependencies:
-    esutils "^2.0.2"
-    isarray "^1.0.0"
-
-electron-to-chromium@^1.3.247:
-  version "1.3.269"
-  resolved "https://registry.yarnpkg.com/electron-to-chromium/-/electron-to-chromium-1.3.269.tgz#3e00cc9266a0123fc2e7b4f290899e257200e6e3"
-  integrity sha512-t2ZTfo07HxkxTOUbIwMmqHBSnJsC9heqJUm7LwQu2iSk0wNhG4H5cMREtb8XxeCrQABDZ6IqQKY3yZq+NfAqwg==
-
-es5-ext@^0.10.35, es5-ext@^0.10.46, es5-ext@^0.10.50, es5-ext@^0.10.51, es5-ext@~0.10.14:
-  version "0.10.51"
-  resolved "https://registry.yarnpkg.com/es5-ext/-/es5-ext-0.10.51.tgz#ed2d7d9d48a12df86e0299287e93a09ff478842f"
-  integrity sha512-oRpWzM2WcLHVKpnrcyB7OW8j/s67Ba04JCm0WnNv3RiABSvs7mrQlutB8DBv793gKcp0XENR8Il8WxGTlZ73gQ==
-  dependencies:
-    es6-iterator "~2.0.3"
-    es6-symbol "~3.1.1"
-    next-tick "^1.0.0"
-
-es6-iterator@^2.0.3, es6-iterator@~2.0.1, es6-iterator@~2.0.3:
-  version "2.0.3"
-  resolved "https://registry.yarnpkg.com/es6-iterator/-/es6-iterator-2.0.3.tgz#a7de889141a05a94b0854403b2d0a0fbfa98f3b7"
-  integrity sha1-p96IkUGgWpSwhUQDstCg+/qY87c=
-  dependencies:
-    d "1"
-    es5-ext "^0.10.35"
-    es6-symbol "^3.1.1"
-
-es6-map@^0.1.3:
-  version "0.1.5"
-  resolved "https://registry.yarnpkg.com/es6-map/-/es6-map-0.1.5.tgz#9136e0503dcc06a301690f0bb14ff4e364e949f0"
-  integrity sha1-kTbgUD3MBqMBaQ8LsU/042TpSfA=
-  dependencies:
-    d "1"
-    es5-ext "~0.10.14"
-    es6-iterator "~2.0.1"
-    es6-set "~0.1.5"
-    es6-symbol "~3.1.1"
-    event-emitter "~0.3.5"
-
-es6-set@~0.1.5:
-  version "0.1.5"
-  resolved "https://registry.yarnpkg.com/es6-set/-/es6-set-0.1.5.tgz#d2b3ec5d4d800ced818db538d28974db0a73ccb1"
-  integrity sha1-0rPsXU2ADO2BjbU40ol02wpzzLE=
-  dependencies:
-    d "1"
-    es5-ext "~0.10.14"
-    es6-iterator "~2.0.1"
-    es6-symbol "3.1.1"
-    event-emitter "~0.3.5"
-
-es6-symbol@3.1.1:
-  version "3.1.1"
-  resolved "https://registry.yarnpkg.com/es6-symbol/-/es6-symbol-3.1.1.tgz#bf00ef4fdab6ba1b46ecb7b629b4c7ed5715cc77"
-  integrity sha1-vwDvT9q2uhtG7Le2KbTH7VcVzHc=
-  dependencies:
-    d "1"
-    es5-ext "~0.10.14"
-
-es6-symbol@^3.1.1, es6-symbol@~3.1.1:
-  version "3.1.2"
-  resolved "https://registry.yarnpkg.com/es6-symbol/-/es6-symbol-3.1.2.tgz#859fdd34f32e905ff06d752e7171ddd4444a7ed1"
-  integrity sha512-/ZypxQsArlv+KHpGvng52/Iz8by3EQPxhmbuz8yFG89N/caTFBSbcXONDw0aMjy827gQg26XAjP4uXFvnfINmQ==
-  dependencies:
-    d "^1.0.1"
-    es5-ext "^0.10.51"
-
-es6-weak-map@^2.0.1:
-  version "2.0.3"
-  resolved "https://registry.yarnpkg.com/es6-weak-map/-/es6-weak-map-2.0.3.tgz#b6da1f16cc2cc0d9be43e6bdbfc5e7dfcdf31d53"
-  integrity sha512-p5um32HOTO1kP+w7PRnB+5lQ43Z6muuMuIMffvDN8ZB4GcnjLBV6zGStpbASIMk4DCAvEaamhe2zhyCb/QXXsA==
-  dependencies:
-    d "1"
-    es5-ext "^0.10.46"
-    es6-iterator "^2.0.3"
-    es6-symbol "^3.1.1"
-
-escape-string-regexp@1.0.5, escape-string-regexp@^1.0.2, escape-string-regexp@^1.0.5:
+escape-string-regexp@1.0.5:
   version "1.0.5"
   resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz#1b61c0562190a8dff6ae3bb2cf0200ca130b86d4"
   integrity sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=
 
-escope@^3.6.0:
-  version "3.6.0"
-  resolved "https://registry.yarnpkg.com/escope/-/escope-3.6.0.tgz#e01975e812781a163a6dadfdd80398dc64c889c3"
-  integrity sha1-4Bl16BJ4GhY6ba392AOY3GTIicM=
-  dependencies:
-    es6-map "^0.1.3"
-    es6-weak-map "^2.0.1"
-    esrecurse "^4.1.0"
-    estraverse "^4.1.1"
-
-eslint-visitor-keys@^1.0.0:
-  version "1.1.0"
-  resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-1.1.0.tgz#e2a82cea84ff246ad6fb57f9bde5b46621459ec2"
-  integrity sha512-8y9YjtM1JBJU/A9Kc+SbaOV4y29sSWckBwMHa+FGtVj5gN/sbnKDf6xJUl+8g7FAij9LVaP8C24DUiH/f/2Z9A==
-
-eslint@~3.9.1:
-  version "3.9.1"
-  resolved "https://registry.yarnpkg.com/eslint/-/eslint-3.9.1.tgz#5a8597706fc6048bc6061ac754d4a211d28f4f5b"
-  integrity sha1-WoWXcG/GBIvGBhrHVNSiEdKPT1s=
-  dependencies:
-    babel-code-frame "^6.16.0"
-    chalk "^1.1.3"
-    concat-stream "^1.4.6"
-    debug "^2.1.1"
-    doctrine "^1.2.2"
-    escope "^3.6.0"
-    espree "^3.3.1"
-    estraverse "^4.2.0"
-    esutils "^2.0.2"
-    file-entry-cache "^2.0.0"
-    glob "^7.0.3"
-    globals "^9.2.0"
-    ignore "^3.1.5"
-    imurmurhash "^0.1.4"
-    inquirer "^0.12.0"
-    is-my-json-valid "^2.10.0"
-    is-resolvable "^1.0.0"
-    js-yaml "^3.5.1"
-    json-stable-stringify "^1.0.0"
-    levn "^0.3.0"
-    lodash "^4.0.0"
-    mkdirp "^0.5.0"
-    natural-compare "^1.4.0"
-    optionator "^0.8.2"
-    path-is-inside "^1.0.1"
-    pluralize "^1.2.1"
-    progress "^1.1.8"
-    require-uncached "^1.0.2"
-    shelljs "^0.7.5"
-    strip-bom "^3.0.0"
-    strip-json-comments "~1.0.1"
-    table "^3.7.8"
-    text-table "~0.2.0"
-    user-home "^2.0.0"
-
-espree@^3.3.1:
-  version "3.5.4"
-  resolved "https://registry.yarnpkg.com/espree/-/espree-3.5.4.tgz#b0f447187c8a8bed944b815a660bddf5deb5d1a7"
-  integrity sha512-yAcIQxtmMiB/jL32dzEp2enBeidsB7xWPLNiw3IIkpVds1P+h7qF9YwJq1yUNzp2OKXgAprs4F61ih66UsoD1A==
-  dependencies:
-    acorn "^5.5.0"
-    acorn-jsx "^3.0.0"
-
-esprima@^4.0.0:
-  version "4.0.1"
-  resolved "https://registry.yarnpkg.com/esprima/-/esprima-4.0.1.tgz#13b04cdb3e6c5d19df91ab6987a8695619b0aa71"
-  integrity sha512-eGuFFw7Upda+g4p+QHvnW0RyTX/SVeJBDM/gCtMARO0cLuT2HcEKnTPvhjV6aGeqrCB/sbNop0Kszm0jsaWU4A==
-
-esrecurse@^4.1.0:
-  version "4.2.1"
-  resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.2.1.tgz#007a3b9fdbc2b3bb87e4879ea19c92fdbd3942cf"
-  integrity sha512-64RBB++fIOAXPw3P9cy89qfMlvZEXZkqqJkjqqXIvzP5ezRZjW+lPWjw35UX/3EhUPFYbg5ER4JYgDw4007/DQ==
-  dependencies:
-    estraverse "^4.1.0"
-
-estraverse@^4.1.0, estraverse@^4.1.1, estraverse@^4.2.0:
-  version "4.3.0"
-  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-4.3.0.tgz#398ad3f3c5a24948be7725e83d11a7de28cdbd1d"
-  integrity sha512-39nnKffWz8xN1BU/2c79n9nB9HDzo0niYUqx6xyqUnyoAnQyyWpOTdZEeiCch8BBu515t4wp9ZmgVfVhn9EBpw==
-
-esutils@^2.0.2:
-  version "2.0.3"
-  resolved "https://registry.yarnpkg.com/esutils/-/esutils-2.0.3.tgz#74d2eb4de0b8da1293711910d50775b9b710ef64"
-  integrity sha512-kVscqXk4OCp68SZ0dkgEKVi6/8ij300KBWTJq32P/dYeWTSwK41WyTxalN1eRmA5Z9UU/LX9D7FWSmV9SAYx6g==
-
-event-emitter@~0.3.5:
-  version "0.3.5"
-  resolved "https://registry.yarnpkg.com/event-emitter/-/event-emitter-0.3.5.tgz#df8c69eef1647923c7157b9ce83840610b02cc39"
-  integrity sha1-34xp7vFkeSPHFXuc6DhAYQsCzDk=
-  dependencies:
-    d "1"
-    es5-ext "~0.10.14"
-
-exit-hook@^1.0.0:
-  version "1.1.1"
-  resolved "https://registry.yarnpkg.com/exit-hook/-/exit-hook-1.1.1.tgz#f05ca233b48c05d54fff07765df8507e95c02ff8"
-  integrity sha1-8FyiM7SMBdVP/wd2XfhQfpXAL/g=
-
-expand-brackets@^2.1.4:
-  version "2.1.4"
-  resolved "https://registry.yarnpkg.com/expand-brackets/-/expand-brackets-2.1.4.tgz#b77735e315ce30f6b6eff0f83b04151a22449622"
-  integrity sha1-t3c14xXOMPa27/D4OwQVGiJEliI=
-  dependencies:
-    debug "^2.3.3"
-    define-property "^0.2.5"
-    extend-shallow "^2.0.1"
-    posix-character-classes "^0.1.0"
-    regex-not "^1.0.0"
-    snapdragon "^0.8.1"
-    to-regex "^3.0.1"
-
-extend-shallow@^2.0.1:
-  version "2.0.1"
-  resolved "https://registry.yarnpkg.com/extend-shallow/-/extend-shallow-2.0.1.tgz#51af7d614ad9a9f610ea1bafbb989d6b1c56890f"
-  integrity sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=
-  dependencies:
-    is-extendable "^0.1.0"
-
-extend-shallow@^3.0.0, extend-shallow@^3.0.2:
-  version "3.0.2"
-  resolved "https://registry.yarnpkg.com/extend-shallow/-/extend-shallow-3.0.2.tgz#26a71aaf073b39fb2127172746131c2704028db8"
-  integrity sha1-Jqcarwc7OfshJxcnRhMcJwQCjbg=
-  dependencies:
-    assign-symbols "^1.0.0"
-    is-extendable "^1.0.1"
-
-extglob@^2.0.4:
-  version "2.0.4"
-  resolved "https://registry.yarnpkg.com/extglob/-/extglob-2.0.4.tgz#ad00fe4dc612a9232e8718711dc5cb5ab0285543"
-  integrity sha512-Nmb6QXkELsuBr24CJSkilo6UHHgbekK5UiZgfE6UHD3Eb27YC6oD+bhcT+tJ6cl8dmsgdQxnWlcry8ksBIBLpw==
-  dependencies:
-    array-unique "^0.3.2"
-    define-property "^1.0.0"
-    expand-brackets "^2.1.4"
-    extend-shallow "^2.0.1"
-    fragment-cache "^0.2.1"
-    regex-not "^1.0.0"
-    snapdragon "^0.8.1"
-    to-regex "^3.0.1"
-
-fast-levenshtein@~2.0.4:
-  version "2.0.6"
-  resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917"
-  integrity sha1-PYpcZog6FqMMqGQ+hR8Zuqd5eRc=
-
-figures@^1.3.5:
-  version "1.7.0"
-  resolved "https://registry.yarnpkg.com/figures/-/figures-1.7.0.tgz#cbe1e3affcf1cd44b80cadfed28dc793a9701d2e"
-  integrity sha1-y+Hjr/zxzUS4DK3+0o3Hk6lwHS4=
-  dependencies:
-    escape-string-regexp "^1.0.5"
-    object-assign "^4.1.0"
-
-file-entry-cache@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-2.0.0.tgz#c392990c3e684783d838b8c84a45d8a048458361"
-  integrity sha1-w5KZDD5oR4PYOLjISkXYoEhFg2E=
-  dependencies:
-    flat-cache "^1.2.1"
-    object-assign "^4.0.1"
-
-fill-range@^4.0.0:
-  version "4.0.0"
-  resolved "https://registry.yarnpkg.com/fill-range/-/fill-range-4.0.0.tgz#d544811d428f98eb06a63dc402d2403c328c38f7"
-  integrity sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=
-  dependencies:
-    extend-shallow "^2.0.1"
-    is-number "^3.0.0"
-    repeat-string "^1.6.1"
-    to-regex-range "^2.1.0"
-
-flat-cache@^1.2.1:
-  version "1.3.4"
-  resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-1.3.4.tgz#2c2ef77525cc2929007dfffa1dd314aa9c9dee6f"
-  integrity sha512-VwyB3Lkgacfik2vhqR4uv2rvebqmDvFu4jlN/C1RzWoJEo8I7z4Q404oiqYCkq41mni8EzQnm95emU9seckwtg==
-  dependencies:
-    circular-json "^0.3.1"
-    graceful-fs "^4.1.2"
-    rimraf "~2.6.2"
-    write "^0.2.1"
-
-for-in@^1.0.2:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/for-in/-/for-in-1.0.2.tgz#81068d295a8142ec0ac726c6e2200c30fb6d5e80"
-  integrity sha1-gQaNKVqBQuwKxybG4iAMMPttXoA=
-
-fragment-cache@^0.2.1:
-  version "0.2.1"
-  resolved "https://registry.yarnpkg.com/fragment-cache/-/fragment-cache-0.2.1.tgz#4290fad27f13e89be7f33799c6bc5a0abfff0d19"
-  integrity sha1-QpD60n8T6Jvn8zeZxrxaCr//DRk=
-  dependencies:
-    map-cache "^0.2.2"
-
-fs-minipass@^1.2.5:
-  version "1.2.7"
-  resolved "https://registry.yarnpkg.com/fs-minipass/-/fs-minipass-1.2.7.tgz#ccff8570841e7fe4265693da88936c55aed7f7c7"
-  integrity sha512-GWSSJGFy4e9GUeCcbIkED+bgAoFyj7XF1mV8rma3QW4NIqX9Kyx79N/PF61H5udOV3aY1IaMLs6pGbH71nlCTA==
-  dependencies:
-    minipass "^2.6.0"
-
-fs-readdir-recursive@^1.1.0:
-  version "1.1.0"
-  resolved "https://registry.yarnpkg.com/fs-readdir-recursive/-/fs-readdir-recursive-1.1.0.tgz#e32fc030a2ccee44a6b5371308da54be0b397d27"
-  integrity sha512-GNanXlVr2pf02+sPN40XN8HG+ePaNcvM0q5mZBd668Obwb0yD5GiUbZOFgwn8kGMY6I3mdyDJzieUy3PTYyTRA==
-
 fs.realpath@^1.0.0:
   version "1.0.0"
   resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f"
   integrity sha1-FQStJSMVjKpA20onh8sBQRmU6k8=
 
-fsevents@^1.2.7:
-  version "1.2.9"
-  resolved "https://registry.yarnpkg.com/fsevents/-/fsevents-1.2.9.tgz#3f5ed66583ccd6f400b5a00db6f7e861363e388f"
-  integrity sha512-oeyj2H3EjjonWcFjD5NvZNE9Rqe4UW+nQBU2HNeKw0koVLEFIhtyETyAakeAM3de7Z/SW5kcA+fZUait9EApnw==
-  dependencies:
-    nan "^2.12.1"
-    node-pre-gyp "^0.12.0"
-
-function-bind@^1.1.1:
-  version "1.1.1"
-  resolved "https://registry.yarnpkg.com/function-bind/-/function-bind-1.1.1.tgz#a56899d3ea3c9bab874bb9773b7c5ede92f4895d"
-  integrity sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A==
-
-gauge@~2.7.3:
-  version "2.7.4"
-  resolved "https://registry.yarnpkg.com/gauge/-/gauge-2.7.4.tgz#2c03405c7538c39d7eb37b317022e325fb018bf7"
-  integrity sha1-LANAXHU4w51+s3sxcCLjJfsBi/c=
-  dependencies:
-    aproba "^1.0.3"
-    console-control-strings "^1.0.0"
-    has-unicode "^2.0.0"
-    object-assign "^4.1.0"
-    signal-exit "^3.0.0"
-    string-width "^1.0.1"
-    strip-ansi "^3.0.1"
-    wide-align "^1.1.0"
-
-generate-function@^2.0.0:
-  version "2.3.1"
-  resolved "https://registry.yarnpkg.com/generate-function/-/generate-function-2.3.1.tgz#f069617690c10c868e73b8465746764f97c3479f"
-  integrity sha512-eeB5GfMNeevm/GRYq20ShmsaGcmI81kIX2K9XQx5miC8KdHaC6Jm0qQ8ZNeGOi7wYB8OsdxKs+Y2oVuTFuVwKQ==
-  dependencies:
-    is-property "^1.0.2"
-
-generate-object-property@^1.1.0:
-  version "1.2.0"
-  resolved "https://registry.yarnpkg.com/generate-object-property/-/generate-object-property-1.2.0.tgz#9c0e1c40308ce804f4783618b937fa88f99d50d0"
-  integrity sha1-nA4cQDCM6AT0eDYYuTf6iPmdUNA=
-  dependencies:
-    is-property "^1.0.0"
-
-get-value@^2.0.3, get-value@^2.0.6:
-  version "2.0.6"
-  resolved "https://registry.yarnpkg.com/get-value/-/get-value-2.0.6.tgz#dc15ca1c672387ca76bd37ac0a395ba2042a2c28"
-  integrity sha1-3BXKHGcjh8p2vTesCjlbogQqLCg=
-
-glob-parent@^3.1.0:
-  version "3.1.0"
-  resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-3.1.0.tgz#9e6af6299d8d3bd2bd40430832bd113df906c5ae"
-  integrity sha1-nmr2KZ2NO9K9QEMIMr0RPfkGxa4=
-  dependencies:
-    is-glob "^3.1.0"
-    path-dirname "^1.0.0"
-
 glob@7.1.1:
   version "7.1.1"
   resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.1.tgz#805211df04faaf1c63a3600306cdf5ade50b2ec8"
@@ -1495,33 +66,6 @@ glob@7.1.1:
     once "^1.3.0"
     path-is-absolute "^1.0.0"
 
-glob@^7.0.0, glob@^7.0.3, glob@^7.1.3:
-  version "7.1.4"
-  resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.4.tgz#aa608a2f6c577ad357e1ae5a5c26d9a8d1969255"
-  integrity sha512-hkLPepehmnKk41pUGm3sYxoFs/umurYfYJCerbXEyFIWcAzvpipAgVkBqqT9RBKMGjnq6kMuyYwha6csxbiM1A==
-  dependencies:
-    fs.realpath "^1.0.0"
-    inflight "^1.0.4"
-    inherits "2"
-    minimatch "^3.0.4"
-    once "^1.3.0"
-    path-is-absolute "^1.0.0"
-
-globals@^11.1.0:
-  version "11.12.0"
-  resolved "https://registry.yarnpkg.com/globals/-/globals-11.12.0.tgz#ab8795338868a0babd8525758018c2a7eb95c42e"
-  integrity sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==
-
-globals@^9.2.0:
-  version "9.18.0"
-  resolved "https://registry.yarnpkg.com/globals/-/globals-9.18.0.tgz#aa3896b3e69b487f17e31ed2143d69a8e30c2d8a"
-  integrity sha512-S0nG3CLEQiY/ILxqtztTWH/3iRRdyBLw6KMDxnKMchrtbj2OFmehVh0WUCfW3DUrIgx/qFrJPICrq4Z4sTR9UQ==
-
-graceful-fs@^4.1.11, graceful-fs@^4.1.2:
-  version "4.2.2"
-  resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-4.2.2.tgz#6f0952605d0140c1cfdb138ed005775b92d67b02"
-  integrity sha512-IItsdsea19BoLC7ELy13q1iJFNmd7ofZH5+X/pJr90/nRoPEX0DJo1dHDbgtYWOhJhcCgMDTOw84RZ72q6lB+Q==
-
 "graceful-readlink@>= 1.0.0":
   version "1.0.1"
   resolved "https://registry.yarnpkg.com/graceful-readlink/-/graceful-readlink-1.0.1.tgz#4cafad76bc62f02fa039b2f94e9a3dd3a391a725"
@@ -1532,397 +76,34 @@ growl@1.9.2:
   resolved "https://registry.yarnpkg.com/growl/-/growl-1.9.2.tgz#0ea7743715db8d8de2c5ede1775e1b45ac85c02f"
   integrity sha1-Dqd0NxXbjY3ixe3hd14bRayFwC8=
 
-has-ansi@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/has-ansi/-/has-ansi-2.0.0.tgz#34f5049ce1ecdf2b0649af3ef24e45ed35416d91"
-  integrity sha1-NPUEnOHs3ysGSa8+8k5F7TVBbZE=
-  dependencies:
-    ansi-regex "^2.0.0"
-
 has-flag@^1.0.0:
   version "1.0.0"
   resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-1.0.0.tgz#9d9e793165ce017a00f00418c43f942a7b1d11fa"
   integrity sha1-nZ55MWXOAXoA8AQYxD+UKnsdEfo=
 
-has-flag@^3.0.0:
-  version "3.0.0"
-  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-3.0.0.tgz#b5d454dc2199ae225699f3467e5a07f3b955bafd"
-  integrity sha1-tdRU3CGZriJWmfNGfloH87lVuv0=
-
-has-symbols@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/has-symbols/-/has-symbols-1.0.0.tgz#ba1a8f1af2a0fc39650f5c850367704122063b44"
-  integrity sha1-uhqPGvKg/DllD1yFA2dwQSIGO0Q=
-
-has-unicode@^2.0.0:
-  version "2.0.1"
-  resolved "https://registry.yarnpkg.com/has-unicode/-/has-unicode-2.0.1.tgz#e0e6fe6a28cf51138855e086d1691e771de2a8b9"
-  integrity sha1-4Ob+aijPUROIVeCG0Wkedx3iqLk=
-
-has-value@^0.3.1:
-  version "0.3.1"
-  resolved "https://registry.yarnpkg.com/has-value/-/has-value-0.3.1.tgz#7b1f58bada62ca827ec0a2078025654845995e1f"
-  integrity sha1-ex9YutpiyoJ+wKIHgCVlSEWZXh8=
-  dependencies:
-    get-value "^2.0.3"
-    has-values "^0.1.4"
-    isobject "^2.0.0"
-
-has-value@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/has-value/-/has-value-1.0.0.tgz#18b281da585b1c5c51def24c930ed29a0be6b177"
-  integrity sha1-GLKB2lhbHFxR3vJMkw7SmgvmsXc=
-  dependencies:
-    get-value "^2.0.6"
-    has-values "^1.0.0"
-    isobject "^3.0.0"
-
-has-values@^0.1.4:
-  version "0.1.4"
-  resolved "https://registry.yarnpkg.com/has-values/-/has-values-0.1.4.tgz#6d61de95d91dfca9b9a02089ad384bff8f62b771"
-  integrity sha1-bWHeldkd/Km5oCCJrThL/49it3E=
-
-has-values@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/has-values/-/has-values-1.0.0.tgz#95b0b63fec2146619a6fe57fe75628d5a39efe4f"
-  integrity sha1-lbC2P+whRmGab+V/51Yo1aOe/k8=
-  dependencies:
-    is-number "^3.0.0"
-    kind-of "^4.0.0"
-
 he@1.1.1:
   version "1.1.1"
   resolved "https://registry.yarnpkg.com/he/-/he-1.1.1.tgz#93410fd21b009735151f8868c2f271f3427e23fd"
   integrity sha1-k0EP0hsAlzUVH4howvJx80J+I/0=
 
-iconv-lite@^0.4.4:
-  version "0.4.24"
-  resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.24.tgz#2022b4b25fbddc21d2f524974a474aafe733908b"
-  integrity sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==
-  dependencies:
-    safer-buffer ">= 2.1.2 < 3"
-
-ignore-walk@^3.0.1:
-  version "3.0.2"
-  resolved "https://registry.yarnpkg.com/ignore-walk/-/ignore-walk-3.0.2.tgz#99d83a246c196ea5c93ef9315ad7b0819c35069b"
-  integrity sha512-EXyErtpHbn75ZTsOADsfx6J/FPo6/5cjev46PXrcTpd8z3BoRkXgYu9/JVqrI7tusjmwCZutGeRJeU0Wo1e4Cw==
-  dependencies:
-    minimatch "^3.0.4"
-
-ignore@^3.1.5:
-  version "3.3.10"
-  resolved "https://registry.yarnpkg.com/ignore/-/ignore-3.3.10.tgz#0a97fb876986e8081c631160f8f9f389157f0043"
-  integrity sha512-Pgs951kaMm5GXP7MOvxERINe3gsaVjUWFm+UZPSq9xYriQAksyhg0csnS0KXSNRD5NmNdapXEpjxG49+AKh/ug==
-
-imurmurhash@^0.1.4:
-  version "0.1.4"
-  resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea"
-  integrity sha1-khi5srkoojixPcT7a21XbyMUU+o=
-
 inflight@^1.0.4:
   version "1.0.6"
   resolved "https://registry.yarnpkg.com/inflight/-/inflight-1.0.6.tgz#49bd6331d7d02d0c09bc910a1075ba8165b56df9"
-  integrity sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=
-  dependencies:
-    once "^1.3.0"
-    wrappy "1"
-
-inherits@2, inherits@^2.0.3, inherits@~2.0.3:
-  version "2.0.4"
-  resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.4.tgz#0fa2c64f932917c3433a0ded55363aae37416b7c"
-  integrity sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==
-
-ini@~1.3.0:
-  version "1.3.5"
-  resolved "https://registry.yarnpkg.com/ini/-/ini-1.3.5.tgz#eee25f56db1c9ec6085e0c22778083f596abf927"
-  integrity sha512-RZY5huIKCMRWDUqZlEi72f/lmXKMvuszcMBduliQ3nnWbx9X/ZBQO7DijMEYS9EhHBb2qacRUMtC7svLwe0lcw==
-
-inquirer@^0.12.0:
-  version "0.12.0"
-  resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-0.12.0.tgz#1ef2bfd63504df0bc75785fff8c2c41df12f077e"
-  integrity sha1-HvK/1jUE3wvHV4X/+MLEHfEvB34=
-  dependencies:
-    ansi-escapes "^1.1.0"
-    ansi-regex "^2.0.0"
-    chalk "^1.0.0"
-    cli-cursor "^1.0.1"
-    cli-width "^2.0.0"
-    figures "^1.3.5"
-    lodash "^4.3.0"
-    readline2 "^1.0.1"
-    run-async "^0.1.0"
-    rx-lite "^3.1.2"
-    string-width "^1.0.1"
-    strip-ansi "^3.0.0"
-    through "^2.3.6"
-
-interpret@^1.0.0:
-  version "1.2.0"
-  resolved "https://registry.yarnpkg.com/interpret/-/interpret-1.2.0.tgz#d5061a6224be58e8083985f5014d844359576296"
-  integrity sha512-mT34yGKMNceBQUoVn7iCDKDntA7SC6gycMAWzGx1z/CMCTV7b2AAtXlo3nRyHZ1FelRkQbQjprHSYGwzLtkVbw==
-
-invariant@^2.2.2:
-  version "2.2.4"
-  resolved "https://registry.yarnpkg.com/invariant/-/invariant-2.2.4.tgz#610f3c92c9359ce1db616e538008d23ff35158e6"
-  integrity sha512-phJfQVBuaJM5raOpJjSfkiD6BpbCE4Ns//LaXl6wGYtUBY83nWS6Rf9tXm2e8VaK60JEjYldbPif/A2B1C2gNA==
-  dependencies:
-    loose-envify "^1.0.0"
-
-is-accessor-descriptor@^0.1.6:
-  version "0.1.6"
-  resolved "https://registry.yarnpkg.com/is-accessor-descriptor/-/is-accessor-descriptor-0.1.6.tgz#a9e12cb3ae8d876727eeef3843f8a0897b5c98d6"
-  integrity sha1-qeEss66Nh2cn7u84Q/igiXtcmNY=
-  dependencies:
-    kind-of "^3.0.2"
-
-is-accessor-descriptor@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz#169c2f6d3df1f992618072365c9b0ea1f6878656"
-  integrity sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==
-  dependencies:
-    kind-of "^6.0.0"
-
-is-binary-path@^1.0.0:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/is-binary-path/-/is-binary-path-1.0.1.tgz#75f16642b480f187a711c814161fd3a4a7655898"
-  integrity sha1-dfFmQrSA8YenEcgUFh/TpKdlWJg=
-  dependencies:
-    binary-extensions "^1.0.0"
-
-is-buffer@^1.1.5:
-  version "1.1.6"
-  resolved "https://registry.yarnpkg.com/is-buffer/-/is-buffer-1.1.6.tgz#efaa2ea9daa0d7ab2ea13a97b2b8ad51fefbe8be"
-  integrity sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w==
-
-is-data-descriptor@^0.1.4:
-  version "0.1.4"
-  resolved "https://registry.yarnpkg.com/is-data-descriptor/-/is-data-descriptor-0.1.4.tgz#0b5ee648388e2c860282e793f1856fec3f301b56"
-  integrity sha1-C17mSDiOLIYCgueT8YVv7D8wG1Y=
-  dependencies:
-    kind-of "^3.0.2"
-
-is-data-descriptor@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz#d84876321d0e7add03990406abbbbd36ba9268c7"
-  integrity sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==
-  dependencies:
-    kind-of "^6.0.0"
-
-is-descriptor@^0.1.0:
-  version "0.1.6"
-  resolved "https://registry.yarnpkg.com/is-descriptor/-/is-descriptor-0.1.6.tgz#366d8240dde487ca51823b1ab9f07a10a78251ca"
-  integrity sha512-avDYr0SB3DwO9zsMov0gKCESFYqCnE4hq/4z3TdUlukEy5t9C0YRq7HLrsN52NAcqXKaepeCD0n+B0arnVG3Hg==
-  dependencies:
-    is-accessor-descriptor "^0.1.6"
-    is-data-descriptor "^0.1.4"
-    kind-of "^5.0.0"
-
-is-descriptor@^1.0.0, is-descriptor@^1.0.2:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/is-descriptor/-/is-descriptor-1.0.2.tgz#3b159746a66604b04f8c81524ba365c5f14d86ec"
-  integrity sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==
-  dependencies:
-    is-accessor-descriptor "^1.0.0"
-    is-data-descriptor "^1.0.0"
-    kind-of "^6.0.2"
-
-is-extendable@^0.1.0, is-extendable@^0.1.1:
-  version "0.1.1"
-  resolved "https://registry.yarnpkg.com/is-extendable/-/is-extendable-0.1.1.tgz#62b110e289a471418e3ec36a617d472e301dfc89"
-  integrity sha1-YrEQ4omkcUGOPsNqYX1HLjAd/Ik=
-
-is-extendable@^1.0.1:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/is-extendable/-/is-extendable-1.0.1.tgz#a7470f9e426733d81bd81e1155264e3a3507cab4"
-  integrity sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==
-  dependencies:
-    is-plain-object "^2.0.4"
-
-is-extglob@^2.1.0, is-extglob@^2.1.1:
-  version "2.1.1"
-  resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2"
-  integrity sha1-qIwCU1eR8C7TfHahueqXc8gz+MI=
-
-is-fullwidth-code-point@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz#ef9e31386f031a7f0d643af82fde50c457ef00cb"
-  integrity sha1-754xOG8DGn8NZDr4L95QxFfvAMs=
-  dependencies:
-    number-is-nan "^1.0.0"
-
-is-fullwidth-code-point@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz#a3b30a5c4f199183167aaab93beefae3ddfb654f"
-  integrity sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=
-
-is-glob@^3.1.0:
-  version "3.1.0"
-  resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-3.1.0.tgz#7ba5ae24217804ac70707b96922567486cc3e84a"
-  integrity sha1-e6WuJCF4BKxwcHuWkiVnSGzD6Eo=
-  dependencies:
-    is-extglob "^2.1.0"
-
-is-glob@^4.0.0:
-  version "4.0.1"
-  resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.1.tgz#7567dbe9f2f5e2467bc77ab83c4a29482407a5dc"
-  integrity sha512-5G0tKtBTFImOqDnLB2hG6Bp2qcKEFduo4tZu9MT/H6NQv/ghhy30o55ufafxJ/LdH79LLs2Kfrn85TLKyA7BUg==
-  dependencies:
-    is-extglob "^2.1.1"
-
-is-my-ip-valid@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/is-my-ip-valid/-/is-my-ip-valid-1.0.0.tgz#7b351b8e8edd4d3995d4d066680e664d94696824"
-  integrity sha512-gmh/eWXROncUzRnIa1Ubrt5b8ep/MGSnfAUI3aRp+sqTCs1tv1Isl8d8F6JmkN3dXKc3ehZMrtiPN9eL03NuaQ==
-
-is-my-json-valid@^2.10.0:
-  version "2.20.0"
-  resolved "https://registry.yarnpkg.com/is-my-json-valid/-/is-my-json-valid-2.20.0.tgz#1345a6fca3e8daefc10d0fa77067f54cedafd59a"
-  integrity sha512-XTHBZSIIxNsIsZXg7XB5l8z/OBFosl1Wao4tXLpeC7eKU4Vm/kdop2azkPqULwnfGQjmeDIyey9g7afMMtdWAA==
-  dependencies:
-    generate-function "^2.0.0"
-    generate-object-property "^1.1.0"
-    is-my-ip-valid "^1.0.0"
-    jsonpointer "^4.0.0"
-    xtend "^4.0.0"
-
-is-number@^3.0.0:
-  version "3.0.0"
-  resolved "https://registry.yarnpkg.com/is-number/-/is-number-3.0.0.tgz#24fd6201a4782cf50561c810276afc7d12d71195"
-  integrity sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=
-  dependencies:
-    kind-of "^3.0.2"
-
-is-plain-obj@^1.1.0:
-  version "1.1.0"
-  resolved "https://registry.yarnpkg.com/is-plain-obj/-/is-plain-obj-1.1.0.tgz#71a50c8429dfca773c92a390a4a03b39fcd51d3e"
-  integrity sha1-caUMhCnfync8kqOQpKA7OfzVHT4=
-
-is-plain-object@^2.0.3, is-plain-object@^2.0.4:
-  version "2.0.4"
-  resolved "https://registry.yarnpkg.com/is-plain-object/-/is-plain-object-2.0.4.tgz#2c163b3fafb1b606d9d17928f05c2a1c38e07677"
-  integrity sha512-h5PpgXkWitc38BBMYawTYMWJHFZJVnBquFE57xFpjB8pJFiF6gZ+bU+WyI/yqXiFR5mdLsgYNaPe8uao6Uv9Og==
-  dependencies:
-    isobject "^3.0.1"
-
-is-property@^1.0.0, is-property@^1.0.2:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/is-property/-/is-property-1.0.2.tgz#57fe1c4e48474edd65b09911f26b1cd4095dda84"
-  integrity sha1-V/4cTkhHTt1lsJkR8msc1Ald2oQ=
-
-is-resolvable@^1.0.0:
-  version "1.1.0"
-  resolved "https://registry.yarnpkg.com/is-resolvable/-/is-resolvable-1.1.0.tgz#fb18f87ce1feb925169c9a407c19318a3206ed88"
-  integrity sha512-qgDYXFSR5WvEfuS5dMj6oTMEbrrSaM0CrFk2Yiq/gXnBvD9pMa2jGXxyhGLfvhZpuMZe18CJpFxAt3CRs42NMg==
-
-is-windows@^1.0.2:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/is-windows/-/is-windows-1.0.2.tgz#d1850eb9791ecd18e6182ce12a30f396634bb19d"
-  integrity sha512-eXK1UInq2bPmjyX6e3VHIzMLobc4J94i4AWn+Hpq3OU5KkrRC96OAcR3PRJ/pGu6m8TRnBHP9dkXQVsT/COVIA==
-
-isarray@1.0.0, isarray@^1.0.0, isarray@~1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/isarray/-/isarray-1.0.0.tgz#bb935d48582cba168c06834957a54a3e07124f11"
-  integrity sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE=
-
-isobject@^2.0.0:
-  version "2.1.0"
-  resolved "https://registry.yarnpkg.com/isobject/-/isobject-2.1.0.tgz#f065561096a3f1da2ef46272f815c840d87e0c89"
-  integrity sha1-8GVWEJaj8dou9GJy+BXIQNh+DIk=
-  dependencies:
-    isarray "1.0.0"
-
-isobject@^3.0.0, isobject@^3.0.1:
-  version "3.0.1"
-  resolved "https://registry.yarnpkg.com/isobject/-/isobject-3.0.1.tgz#4e431e92b11a9731636aa1f9c8d1ccbcfdab78df"
-  integrity sha1-TkMekrEalzFjaqH5yNHMvP2reN8=
-
-js-levenshtein@^1.1.3:
-  version "1.1.6"
-  resolved "https://registry.yarnpkg.com/js-levenshtein/-/js-levenshtein-1.1.6.tgz#c6cee58eb3550372df8deb85fad5ce66ce01d59d"
-  integrity sha512-X2BB11YZtrRqY4EnQcLX5Rh373zbK4alC1FW7D7MBhL2gtcC17cTnr6DmfHZeS0s2rTHjUTMMHfG7gO8SSdw+g==
-
-"js-tokens@^3.0.0 || ^4.0.0", js-tokens@^4.0.0:
-  version "4.0.0"
-  resolved "https://registry.yarnpkg.com/js-tokens/-/js-tokens-4.0.0.tgz#19203fb59991df98e3a287050d4647cdeaf32499"
-  integrity sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==
-
-js-tokens@^3.0.2:
-  version "3.0.2"
-  resolved "https://registry.yarnpkg.com/js-tokens/-/js-tokens-3.0.2.tgz#9866df395102130e38f7f996bceb65443209c25b"
-  integrity sha1-mGbfOVECEw449/mWvOtlRDIJwls=
-
-js-yaml@^3.5.1:
-  version "3.13.1"
-  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.13.1.tgz#aff151b30bfdfa8e49e05da22e7415e9dfa37847"
-  integrity sha512-YfbcO7jXDdyj0DGxYVSlSeQNHbD7XPWvrVWeVUujrQEoZzWJIRrCPoyk6kL6IAjAG2IolMK4T0hNUe0HOUs5Jw==
+  integrity sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=
   dependencies:
-    argparse "^1.0.7"
-    esprima "^4.0.0"
-
-jsesc@^2.5.1:
-  version "2.5.2"
-  resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-2.5.2.tgz#80564d2e483dacf6e8ef209650a67df3f0c283a4"
-  integrity sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==
-
-jsesc@~0.5.0:
-  version "0.5.0"
-  resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-0.5.0.tgz#e7dee66e35d6fc16f710fe91d5cf69f70f08911d"
-  integrity sha1-597mbjXW/Bb3EP6R1c9p9w8IkR0=
+    once "^1.3.0"
+    wrappy "1"
 
-json-stable-stringify@^1.0.0, json-stable-stringify@^1.0.1:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/json-stable-stringify/-/json-stable-stringify-1.0.1.tgz#9a759d39c5f2ff503fd5300646ed445f88c4f9af"
-  integrity sha1-mnWdOcXy/1A/1TAGRu1EX4jE+a8=
-  dependencies:
-    jsonify "~0.0.0"
+inherits@2:
+  version "2.0.4"
+  resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.4.tgz#0fa2c64f932917c3433a0ded55363aae37416b7c"
+  integrity sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==
 
 json3@3.3.2:
   version "3.3.2"
   resolved "https://registry.yarnpkg.com/json3/-/json3-3.3.2.tgz#3c0434743df93e2f5c42aee7b19bcb483575f4e1"
   integrity sha1-PAQ0dD35Pi9cQq7nsZvLSDV19OE=
 
-jsonify@~0.0.0:
-  version "0.0.0"
-  resolved "https://registry.yarnpkg.com/jsonify/-/jsonify-0.0.0.tgz#2c74b6ee41d93ca51b7b5aaee8f503631d252a73"
-  integrity sha1-LHS27kHZPKUbe1qu6PUDYx0lKnM=
-
-jsonpointer@^4.0.0:
-  version "4.0.1"
-  resolved "https://registry.yarnpkg.com/jsonpointer/-/jsonpointer-4.0.1.tgz#4fd92cb34e0e9db3c89c8622ecf51f9b978c6cb9"
-  integrity sha1-T9kss04OnbPInIYi7PUfm5eMbLk=
-
-kind-of@^3.0.2, kind-of@^3.0.3, kind-of@^3.2.0:
-  version "3.2.2"
-  resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-3.2.2.tgz#31ea21a734bab9bbb0f32466d893aea51e4a3c64"
-  integrity sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=
-  dependencies:
-    is-buffer "^1.1.5"
-
-kind-of@^4.0.0:
-  version "4.0.0"
-  resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-4.0.0.tgz#20813df3d712928b207378691a45066fae72dd57"
-  integrity sha1-IIE989cSkosgc3hpGkUGb65y3Vc=
-  dependencies:
-    is-buffer "^1.1.5"
-
-kind-of@^5.0.0:
-  version "5.1.0"
-  resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-5.1.0.tgz#729c91e2d857b7a419a1f9aa65685c4c33f5845d"
-  integrity sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw==
-
-kind-of@^6.0.0, kind-of@^6.0.2:
-  version "6.0.2"
-  resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-6.0.2.tgz#01146b36a6218e64e58f3a8d66de5d7fc6f6d051"
-  integrity sha512-s5kLOcnH0XqDO+FvuaLX8DDjZ18CGFk7VygH40QoKPUQhW4e2rvM0rwUq0t8IQDOwYSeLK01U90OjzBTme2QqA==
-
-levn@^0.3.0, levn@~0.3.0:
-  version "0.3.0"
-  resolved "https://registry.yarnpkg.com/levn/-/levn-0.3.0.tgz#3b09924edf9f083c0490fdd4c0bc4421e04764ee"
-  integrity sha1-OwmSTt+fCDwEkP3UwLxEIeBHZO4=
-  dependencies:
-    prelude-ls "~1.1.2"
-    type-check "~0.3.2"
-
 lodash._baseassign@^3.0.0:
   version "3.2.0"
   resolved "https://registry.yarnpkg.com/lodash._baseassign/-/lodash._baseassign-3.2.0.tgz#8c38a099500f215ad09e59f1722fd0c52bfe0a4e"
@@ -1979,50 +160,7 @@ lodash.keys@^3.0.0:
     lodash.isarguments "^3.0.0"
     lodash.isarray "^3.0.0"
 
-lodash@^4.0.0, lodash@^4.17.13, lodash@^4.3.0:
-  version "4.17.15"
-  resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.15.tgz#b447f6670a0455bbfeedd11392eff330ea097548"
-  integrity sha512-8xOcRHvCjnocdS5cpwXQXVzmmh5e5+saE2QGoeQmbKmRS6J3VQppPOIt0MnmE+4xlZoumy0GPG0D0MVIQbNA1A==
-
-loose-envify@^1.0.0:
-  version "1.4.0"
-  resolved "https://registry.yarnpkg.com/loose-envify/-/loose-envify-1.4.0.tgz#71ee51fa7be4caec1a63839f7e682d8132d30caf"
-  integrity sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==
-  dependencies:
-    js-tokens "^3.0.0 || ^4.0.0"
-
-map-cache@^0.2.2:
-  version "0.2.2"
-  resolved "https://registry.yarnpkg.com/map-cache/-/map-cache-0.2.2.tgz#c32abd0bd6525d9b051645bb4f26ac5dc98a0dbf"
-  integrity sha1-wyq9C9ZSXZsFFkW7TyasXcmKDb8=
-
-map-visit@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/map-visit/-/map-visit-1.0.0.tgz#ecdca8f13144e660f1b5bd41f12f3479d98dfb8f"
-  integrity sha1-7Nyo8TFE5mDxtb1B8S80edmN+48=
-  dependencies:
-    object-visit "^1.0.0"
-
-micromatch@^3.1.10, micromatch@^3.1.4:
-  version "3.1.10"
-  resolved "https://registry.yarnpkg.com/micromatch/-/micromatch-3.1.10.tgz#70859bc95c9840952f359a068a3fc49f9ecfac23"
-  integrity sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg==
-  dependencies:
-    arr-diff "^4.0.0"
-    array-unique "^0.3.2"
-    braces "^2.3.1"
-    define-property "^2.0.2"
-    extend-shallow "^3.0.2"
-    extglob "^2.0.4"
-    fragment-cache "^0.2.1"
-    kind-of "^6.0.2"
-    nanomatch "^1.2.9"
-    object.pick "^1.3.0"
-    regex-not "^1.0.0"
-    snapdragon "^0.8.1"
-    to-regex "^3.0.2"
-
-minimatch@^3.0.2, minimatch@^3.0.4:
+minimatch@^3.0.2:
   version "3.0.4"
   resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083"
   integrity sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==
@@ -2034,43 +172,7 @@ minimist@0.0.8:
   resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.8.tgz#857fcabfc3397d2625b8228262e86aa7a011b05d"
   integrity sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0=
 
-minimist@^1.2.0:
-  version "1.2.0"
-  resolved "https://registry.yarnpkg.com/minimist/-/minimist-1.2.0.tgz#a35008b20f41383eec1fb914f4cd5df79a264284"
-  integrity sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=
-
-minipass@^2.6.0, minipass@^2.8.6:
-  version "2.8.6"
-  resolved "https://registry.yarnpkg.com/minipass/-/minipass-2.8.6.tgz#620d889ace26356391d010ecb9458749df9b6db5"
-  integrity sha512-lFG7d6g3+/UaFDCOtqPiKAC9zngWWsQZl1g5q6gaONqrjq61SX2xFqXMleQiFVyDpYwa018E9hmlAFY22PCb+A==
-  dependencies:
-    safe-buffer "^5.1.2"
-    yallist "^3.0.0"
-
-minipass@^2.9.0:
-  version "2.9.0"
-  resolved "https://registry.yarnpkg.com/minipass/-/minipass-2.9.0.tgz#e713762e7d3e32fed803115cf93e04bca9fcc9a6"
-  integrity sha512-wxfUjg9WebH+CUDX/CdbRlh5SmfZiy/hpkxaRI16Y9W56Pa75sWgd/rvFilSgrauD9NyFymP/+JFV3KwzIsJeg==
-  dependencies:
-    safe-buffer "^5.1.2"
-    yallist "^3.0.0"
-
-minizlib@^1.2.1:
-  version "1.3.2"
-  resolved "https://registry.yarnpkg.com/minizlib/-/minizlib-1.3.2.tgz#5d24764998f98112586f7e566bd4c0999769dad4"
-  integrity sha512-lsNFqSHdJ21EwKzCp12HHJGxSMtHkCW1EMA9cceG3MkMNARjuWotZnMe3NKNshAvFXpm4loZqmYsCmRwhS2JMw==
-  dependencies:
-    minipass "^2.9.0"
-
-mixin-deep@^1.2.0:
-  version "1.3.2"
-  resolved "https://registry.yarnpkg.com/mixin-deep/-/mixin-deep-1.3.2.tgz#1120b43dc359a785dce65b55b82e257ccf479566"
-  integrity sha512-WRoDn//mXBiJ1H40rqa3vH0toePwSsGb45iInWlTySa+Uu4k3tYUSxa2v1KqAiLtvlrSzaExqS1gtk96A9zvEA==
-  dependencies:
-    for-in "^1.0.2"
-    is-extendable "^1.0.1"
-
-mkdirp@0.5.1, mkdirp@^0.5.0, mkdirp@^0.5.1:
+mkdirp@0.5.1:
   version "0.5.1"
   resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.1.tgz#30057438eac6cf7f8c4767f38648d6697d75c903"
   integrity sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=
@@ -2100,171 +202,6 @@ ms@2.0.0:
   resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8"
   integrity sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=
 
-ms@^2.1.1:
-  version "2.1.2"
-  resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.2.tgz#d09d1f357b443f493382a8eb3ccd183872ae6009"
-  integrity sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==
-
-mute-stream@0.0.5:
-  version "0.0.5"
-  resolved "https://registry.yarnpkg.com/mute-stream/-/mute-stream-0.0.5.tgz#8fbfabb0a98a253d3184331f9e8deb7372fac6c0"
-  integrity sha1-j7+rsKmKJT0xhDMfno3rc3L6xsA=
-
-nan@^2.12.1:
-  version "2.14.0"
-  resolved "https://registry.yarnpkg.com/nan/-/nan-2.14.0.tgz#7818f722027b2459a86f0295d434d1fc2336c52c"
-  integrity sha512-INOFj37C7k3AfaNTtX8RhsTw7qRy7eLET14cROi9+5HAVbbHuIWUHEauBv5qT4Av2tWasiTY1Jw6puUNqRJXQg==
-
-nanomatch@^1.2.9:
-  version "1.2.13"
-  resolved "https://registry.yarnpkg.com/nanomatch/-/nanomatch-1.2.13.tgz#b87a8aa4fc0de8fe6be88895b38983ff265bd119"
-  integrity sha512-fpoe2T0RbHwBTBUOftAfBPaDEi06ufaUai0mE6Yn1kacc3SnTErfb/h+X94VXzI64rKFHYImXSvdwGGCmwOqCA==
-  dependencies:
-    arr-diff "^4.0.0"
-    array-unique "^0.3.2"
-    define-property "^2.0.2"
-    extend-shallow "^3.0.2"
-    fragment-cache "^0.2.1"
-    is-windows "^1.0.2"
-    kind-of "^6.0.2"
-    object.pick "^1.3.0"
-    regex-not "^1.0.0"
-    snapdragon "^0.8.1"
-    to-regex "^3.0.1"
-
-natural-compare@^1.4.0:
-  version "1.4.0"
-  resolved "https://registry.yarnpkg.com/natural-compare/-/natural-compare-1.4.0.tgz#4abebfeed7541f2c27acfb29bdbbd15c8d5ba4f7"
-  integrity sha1-Sr6/7tdUHywnrPspvbvRXI1bpPc=
-
-needle@^2.2.1:
-  version "2.4.0"
-  resolved "https://registry.yarnpkg.com/needle/-/needle-2.4.0.tgz#6833e74975c444642590e15a750288c5f939b57c"
-  integrity sha512-4Hnwzr3mi5L97hMYeNl8wRW/Onhy4nUKR/lVemJ8gJedxxUyBLm9kkrDColJvoSfwi0jCNhD+xCdOtiGDQiRZg==
-  dependencies:
-    debug "^3.2.6"
-    iconv-lite "^0.4.4"
-    sax "^1.2.4"
-
-next-tick@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/next-tick/-/next-tick-1.0.0.tgz#ca86d1fe8828169b0120208e3dc8424b9db8342c"
-  integrity sha1-yobR/ogoFpsBICCOPchCS524NCw=
-
-node-pre-gyp@^0.12.0:
-  version "0.12.0"
-  resolved "https://registry.yarnpkg.com/node-pre-gyp/-/node-pre-gyp-0.12.0.tgz#39ba4bb1439da030295f899e3b520b7785766149"
-  integrity sha512-4KghwV8vH5k+g2ylT+sLTjy5wmUOb9vPhnM8NHvRf9dHmnW/CndrFXy2aRPaPST6dugXSdHXfeaHQm77PIz/1A==
-  dependencies:
-    detect-libc "^1.0.2"
-    mkdirp "^0.5.1"
-    needle "^2.2.1"
-    nopt "^4.0.1"
-    npm-packlist "^1.1.6"
-    npmlog "^4.0.2"
-    rc "^1.2.7"
-    rimraf "^2.6.1"
-    semver "^5.3.0"
-    tar "^4"
-
-node-releases@^1.1.29:
-  version "1.1.33"
-  resolved "https://registry.yarnpkg.com/node-releases/-/node-releases-1.1.33.tgz#349f10291234624574f44cf32b7de259bf028303"
-  integrity sha512-I0V30bWQEoHb+10W8oedVoUrdjW5wIkYm0w7vvcrPO95pZY738m1k77GF5sO0vKg5eXYg9oGtrMAETbgZGm11A==
-  dependencies:
-    semver "^5.3.0"
-
-nopt@^4.0.1:
-  version "4.0.1"
-  resolved "https://registry.yarnpkg.com/nopt/-/nopt-4.0.1.tgz#d0d4685afd5415193c8c7505602d0d17cd64474d"
-  integrity sha1-0NRoWv1UFRk8jHUFYC0NF81kR00=
-  dependencies:
-    abbrev "1"
-    osenv "^0.1.4"
-
-normalize-path@^2.1.1:
-  version "2.1.1"
-  resolved "https://registry.yarnpkg.com/normalize-path/-/normalize-path-2.1.1.tgz#1ab28b556e198363a8c1a6f7e6fa20137fe6aed9"
-  integrity sha1-GrKLVW4Zg2Oowab35vogE3/mrtk=
-  dependencies:
-    remove-trailing-separator "^1.0.1"
-
-normalize-path@^3.0.0:
-  version "3.0.0"
-  resolved "https://registry.yarnpkg.com/normalize-path/-/normalize-path-3.0.0.tgz#0dcd69ff23a1c9b11fd0978316644a0388216a65"
-  integrity sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==
-
-npm-bundled@^1.0.1:
-  version "1.0.6"
-  resolved "https://registry.yarnpkg.com/npm-bundled/-/npm-bundled-1.0.6.tgz#e7ba9aadcef962bb61248f91721cd932b3fe6bdd"
-  integrity sha512-8/JCaftHwbd//k6y2rEWp6k1wxVfpFzB6t1p825+cUb7Ym2XQfhwIC5KwhrvzZRJu+LtDE585zVaS32+CGtf0g==
-
-npm-packlist@^1.1.6:
-  version "1.4.4"
-  resolved "https://registry.yarnpkg.com/npm-packlist/-/npm-packlist-1.4.4.tgz#866224233850ac534b63d1a6e76050092b5d2f44"
-  integrity sha512-zTLo8UcVYtDU3gdeaFu2Xu0n0EvelfHDGuqtNIn5RO7yQj4H1TqNdBc/yZjxnWA0PVB8D3Woyp0i5B43JwQ6Vw==
-  dependencies:
-    ignore-walk "^3.0.1"
-    npm-bundled "^1.0.1"
-
-npmlog@^4.0.2:
-  version "4.1.2"
-  resolved "https://registry.yarnpkg.com/npmlog/-/npmlog-4.1.2.tgz#08a7f2a8bf734604779a9efa4ad5cc717abb954b"
-  integrity sha512-2uUqazuKlTaSI/dC8AzicUck7+IrEaOnN/e0jd3Xtt1KcGpwx30v50mL7oPyr/h9bL3E4aZccVwpwP+5W9Vjkg==
-  dependencies:
-    are-we-there-yet "~1.1.2"
-    console-control-strings "~1.1.0"
-    gauge "~2.7.3"
-    set-blocking "~2.0.0"
-
-number-is-nan@^1.0.0:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/number-is-nan/-/number-is-nan-1.0.1.tgz#097b602b53422a522c1afb8790318336941a011d"
-  integrity sha1-CXtgK1NCKlIsGvuHkDGDNpQaAR0=
-
-object-assign@^4.0.1, object-assign@^4.1.0:
-  version "4.1.1"
-  resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.1.tgz#2109adc7965887cfc05cbbd442cac8bfbb360863"
-  integrity sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=
-
-object-copy@^0.1.0:
-  version "0.1.0"
-  resolved "https://registry.yarnpkg.com/object-copy/-/object-copy-0.1.0.tgz#7e7d858b781bd7c991a41ba975ed3812754e998c"
-  integrity sha1-fn2Fi3gb18mRpBupde04EnVOmYw=
-  dependencies:
-    copy-descriptor "^0.1.0"
-    define-property "^0.2.5"
-    kind-of "^3.0.3"
-
-object-keys@^1.0.11, object-keys@^1.0.12:
-  version "1.1.1"
-  resolved "https://registry.yarnpkg.com/object-keys/-/object-keys-1.1.1.tgz#1c47f272df277f3b1daf061677d9c82e2322c60e"
-  integrity sha512-NuAESUOUMrlIXOfHKzD6bpPu3tYt3xvjNdRIQ+FeT0lNb4K8WR70CaDxhuNguS2XG+GjkyMwOzsN5ZktImfhLA==
-
-object-visit@^1.0.0:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/object-visit/-/object-visit-1.0.1.tgz#f79c4493af0c5377b59fe39d395e41042dd045bb"
-  integrity sha1-95xEk68MU3e1n+OdOV5BBC3QRbs=
-  dependencies:
-    isobject "^3.0.0"
-
-object.assign@^4.1.0:
-  version "4.1.0"
-  resolved "https://registry.yarnpkg.com/object.assign/-/object.assign-4.1.0.tgz#968bf1100d7956bb3ca086f006f846b3bc4008da"
-  integrity sha512-exHJeq6kBKj58mqGyTQ9DFvrZC/eR6OwxzoM9YRoGBqrXYonaFyGiFMuc9VZrXf7DarreEwMpurG3dd+CNyW5w==
-  dependencies:
-    define-properties "^1.1.2"
-    function-bind "^1.1.1"
-    has-symbols "^1.0.0"
-    object-keys "^1.0.11"
-
-object.pick@^1.3.0:
-  version "1.3.0"
-  resolved "https://registry.yarnpkg.com/object.pick/-/object.pick-1.3.0.tgz#87a10ac4c1694bd2e1cbf53591a66141fb5dd747"
-  integrity sha1-h6EKxMFpS9Lhy/U1kaZhQftd10c=
-  dependencies:
-    isobject "^3.0.1"
-
 once@^1.3.0:
   version "1.4.0"
   resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1"
@@ -2272,483 +209,11 @@ once@^1.3.0:
   dependencies:
     wrappy "1"
 
-onetime@^1.0.0:
-  version "1.1.0"
-  resolved "https://registry.yarnpkg.com/onetime/-/onetime-1.1.0.tgz#a1f7838f8314c516f05ecefcbc4ccfe04b4ed789"
-  integrity sha1-ofeDj4MUxRbwXs78vEzP4EtO14k=
-
-optionator@^0.8.2:
-  version "0.8.2"
-  resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.8.2.tgz#364c5e409d3f4d6301d6c0b4c05bba50180aeb64"
-  integrity sha1-NkxeQJ0/TWMB1sC0wFu6UBgK62Q=
-  dependencies:
-    deep-is "~0.1.3"
-    fast-levenshtein "~2.0.4"
-    levn "~0.3.0"
-    prelude-ls "~1.1.2"
-    type-check "~0.3.2"
-    wordwrap "~1.0.0"
-
-os-homedir@^1.0.0:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/os-homedir/-/os-homedir-1.0.2.tgz#ffbc4988336e0e833de0c168c7ef152121aa7fb3"
-  integrity sha1-/7xJiDNuDoM94MFox+8VISGqf7M=
-
-os-tmpdir@^1.0.0:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/os-tmpdir/-/os-tmpdir-1.0.2.tgz#bbe67406c79aa85c5cfec766fe5734555dfa1274"
-  integrity sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=
-
-osenv@^0.1.4:
-  version "0.1.5"
-  resolved "https://registry.yarnpkg.com/osenv/-/osenv-0.1.5.tgz#85cdfafaeb28e8677f416e287592b5f3f49ea410"
-  integrity sha512-0CWcCECdMVc2Rw3U5w9ZjqX6ga6ubk1xDVKxtBQPK7wis/0F2r9T6k4ydGYhecl7YUBxBVxhL5oisPsNxAPe2g==
-  dependencies:
-    os-homedir "^1.0.0"
-    os-tmpdir "^1.0.0"
-
-output-file-sync@^2.0.0:
-  version "2.0.1"
-  resolved "https://registry.yarnpkg.com/output-file-sync/-/output-file-sync-2.0.1.tgz#f53118282f5f553c2799541792b723a4c71430c0"
-  integrity sha512-mDho4qm7WgIXIGf4eYU1RHN2UU5tPfVYVSRwDJw0uTmj35DQUt/eNp19N7v6T3SrR0ESTEf2up2CGO73qI35zQ==
-  dependencies:
-    graceful-fs "^4.1.11"
-    is-plain-obj "^1.1.0"
-    mkdirp "^0.5.1"
-
-pascalcase@^0.1.1:
-  version "0.1.1"
-  resolved "https://registry.yarnpkg.com/pascalcase/-/pascalcase-0.1.1.tgz#b363e55e8006ca6fe21784d2db22bd15d7917f14"
-  integrity sha1-s2PlXoAGym/iF4TS2yK9FdeRfxQ=
-
-path-dirname@^1.0.0:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/path-dirname/-/path-dirname-1.0.2.tgz#cc33d24d525e099a5388c0336c6e32b9160609e0"
-  integrity sha1-zDPSTVJeCZpTiMAzbG4yuRYGCeA=
-
 path-is-absolute@^1.0.0:
   version "1.0.1"
   resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f"
   integrity sha1-F0uSaHNVNP+8es5r9TpanhtcX18=
 
-path-is-inside@^1.0.1:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/path-is-inside/-/path-is-inside-1.0.2.tgz#365417dede44430d1c11af61027facf074bdfc53"
-  integrity sha1-NlQX3t5EQw0cEa9hAn+s8HS9/FM=
-
-path-parse@^1.0.6:
-  version "1.0.6"
-  resolved "https://registry.yarnpkg.com/path-parse/-/path-parse-1.0.6.tgz#d62dbb5679405d72c4737ec58600e9ddcf06d24c"
-  integrity sha512-GSmOT2EbHrINBf9SR7CDELwlJ8AENk3Qn7OikK4nFYAu3Ote2+JYNVvkpAEQm3/TLNEJFD/xZJjzyxg3KBWOzw==
-
-pluralize@^1.2.1:
-  version "1.2.1"
-  resolved "https://registry.yarnpkg.com/pluralize/-/pluralize-1.2.1.tgz#d1a21483fd22bb41e58a12fa3421823140897c45"
-  integrity sha1-0aIUg/0iu0HlihL6NCGCMUCJfEU=
-
-posix-character-classes@^0.1.0:
-  version "0.1.1"
-  resolved "https://registry.yarnpkg.com/posix-character-classes/-/posix-character-classes-0.1.1.tgz#01eac0fe3b5af71a2a6c02feabb8c1fef7e00eab"
-  integrity sha1-AerA/jta9xoqbAL+q7jB/vfgDqs=
-
-prelude-ls@~1.1.2:
-  version "1.1.2"
-  resolved "https://registry.yarnpkg.com/prelude-ls/-/prelude-ls-1.1.2.tgz#21932a549f5e52ffd9a827f570e04be62a97da54"
-  integrity sha1-IZMqVJ9eUv/ZqCf1cOBL5iqX2lQ=
-
-private@^0.1.6:
-  version "0.1.8"
-  resolved "https://registry.yarnpkg.com/private/-/private-0.1.8.tgz#2381edb3689f7a53d653190060fcf822d2f368ff"
-  integrity sha512-VvivMrbvd2nKkiG38qjULzlc+4Vx4wm/whI9pQD35YrARNnhxeiRktSOhSukRLFNlzg6Br/cJPet5J/u19r/mg==
-
-process-nextick-args@~2.0.0:
-  version "2.0.1"
-  resolved "https://registry.yarnpkg.com/process-nextick-args/-/process-nextick-args-2.0.1.tgz#7820d9b16120cc55ca9ae7792680ae7dba6d7fe2"
-  integrity sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag==
-
-progress@^1.1.8:
-  version "1.1.8"
-  resolved "https://registry.yarnpkg.com/progress/-/progress-1.1.8.tgz#e260c78f6161cdd9b0e56cc3e0a85de17c7a57be"
-  integrity sha1-4mDHj2Fhzdmw5WzD4Khd4Xx6V74=
-
-rc@^1.2.7:
-  version "1.2.8"
-  resolved "https://registry.yarnpkg.com/rc/-/rc-1.2.8.tgz#cd924bf5200a075b83c188cd6b9e211b7fc0d3ed"
-  integrity sha512-y3bGgqKj3QBdxLbLkomlohkvsA8gdAiUQlSBJnBhfn+BPxg4bc62d8TcBW15wavDfgexCgccckhcZvywyQYPOw==
-  dependencies:
-    deep-extend "^0.6.0"
-    ini "~1.3.0"
-    minimist "^1.2.0"
-    strip-json-comments "~2.0.1"
-
-readable-stream@^2.0.2, readable-stream@^2.0.6, readable-stream@^2.2.2:
-  version "2.3.6"
-  resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-2.3.6.tgz#b11c27d88b8ff1fbe070643cf94b0c79ae1b0aaf"
-  integrity sha512-tQtKA9WIAhBF3+VLAseyMqZeBjW0AHJoxOtYqSUZNJxauErmLbVm2FW1y+J/YA9dUrAC39ITejlZWhVIwawkKw==
-  dependencies:
-    core-util-is "~1.0.0"
-    inherits "~2.0.3"
-    isarray "~1.0.0"
-    process-nextick-args "~2.0.0"
-    safe-buffer "~5.1.1"
-    string_decoder "~1.1.1"
-    util-deprecate "~1.0.1"
-
-readdirp@^2.2.1:
-  version "2.2.1"
-  resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-2.2.1.tgz#0e87622a3325aa33e892285caf8b4e846529a525"
-  integrity sha512-1JU/8q+VgFZyxwrJ+SVIOsh+KywWGpds3NTqikiKpDMZWScmAYyKIgqkO+ARvNWJfXeXR1zxz7aHF4u4CyH6vQ==
-  dependencies:
-    graceful-fs "^4.1.11"
-    micromatch "^3.1.10"
-    readable-stream "^2.0.2"
-
-readline2@^1.0.1:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/readline2/-/readline2-1.0.1.tgz#41059608ffc154757b715d9989d199ffbf372e35"
-  integrity sha1-QQWWCP/BVHV7cV2ZidGZ/783LjU=
-  dependencies:
-    code-point-at "^1.0.0"
-    is-fullwidth-code-point "^1.0.0"
-    mute-stream "0.0.5"
-
-rechoir@^0.6.2:
-  version "0.6.2"
-  resolved "https://registry.yarnpkg.com/rechoir/-/rechoir-0.6.2.tgz#85204b54dba82d5742e28c96756ef43af50e3384"
-  integrity sha1-hSBLVNuoLVdC4oyWdW70OvUOM4Q=
-  dependencies:
-    resolve "^1.1.6"
-
-regenerate-unicode-properties@^8.1.0:
-  version "8.1.0"
-  resolved "https://registry.yarnpkg.com/regenerate-unicode-properties/-/regenerate-unicode-properties-8.1.0.tgz#ef51e0f0ea4ad424b77bf7cb41f3e015c70a3f0e"
-  integrity sha512-LGZzkgtLY79GeXLm8Dp0BVLdQlWICzBnJz/ipWUgo59qBaZ+BHtq51P2q1uVZlppMuUAT37SDk39qUbjTWB7bA==
-  dependencies:
-    regenerate "^1.4.0"
-
-regenerate@^1.4.0:
-  version "1.4.0"
-  resolved "https://registry.yarnpkg.com/regenerate/-/regenerate-1.4.0.tgz#4a856ec4b56e4077c557589cae85e7a4c8869a11"
-  integrity sha512-1G6jJVDWrt0rK99kBjvEtziZNCICAuvIPkSiUFIQxVP06RCVpq3dmDo2oi6ABpYaDYaTRr67BEhL8r1wgEZZKg==
-
-regenerator-transform@^0.14.0:
-  version "0.14.1"
-  resolved "https://registry.yarnpkg.com/regenerator-transform/-/regenerator-transform-0.14.1.tgz#3b2fce4e1ab7732c08f665dfdb314749c7ddd2fb"
-  integrity sha512-flVuee02C3FKRISbxhXl9mGzdbWUVHubl1SMaknjxkFB1/iqpJhArQUvRxOOPEc/9tAiX0BaQ28FJH10E4isSQ==
-  dependencies:
-    private "^0.1.6"
-
-regex-not@^1.0.0, regex-not@^1.0.2:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/regex-not/-/regex-not-1.0.2.tgz#1f4ece27e00b0b65e0247a6810e6a85d83a5752c"
-  integrity sha512-J6SDjUgDxQj5NusnOtdFxDwN/+HWykR8GELwctJ7mdqhcyy1xEc4SRFHUXvxTp661YaVKAjfRLZ9cCqS6tn32A==
-  dependencies:
-    extend-shallow "^3.0.2"
-    safe-regex "^1.1.0"
-
-regexpu-core@^4.6.0:
-  version "4.6.0"
-  resolved "https://registry.yarnpkg.com/regexpu-core/-/regexpu-core-4.6.0.tgz#2037c18b327cfce8a6fea2a4ec441f2432afb8b6"
-  integrity sha512-YlVaefl8P5BnFYOITTNzDvan1ulLOiXJzCNZxduTIosN17b87h3bvG9yHMoHaRuo88H4mQ06Aodj5VtYGGGiTg==
-  dependencies:
-    regenerate "^1.4.0"
-    regenerate-unicode-properties "^8.1.0"
-    regjsgen "^0.5.0"
-    regjsparser "^0.6.0"
-    unicode-match-property-ecmascript "^1.0.4"
-    unicode-match-property-value-ecmascript "^1.1.0"
-
-regjsgen@^0.5.0:
-  version "0.5.0"
-  resolved "https://registry.yarnpkg.com/regjsgen/-/regjsgen-0.5.0.tgz#a7634dc08f89209c2049adda3525711fb97265dd"
-  integrity sha512-RnIrLhrXCX5ow/E5/Mh2O4e/oa1/jW0eaBKTSy3LaCj+M3Bqvm97GWDp2yUtzIs4LEn65zR2yiYGFqb2ApnzDA==
-
-regjsparser@^0.6.0:
-  version "0.6.0"
-  resolved "https://registry.yarnpkg.com/regjsparser/-/regjsparser-0.6.0.tgz#f1e6ae8b7da2bae96c99399b868cd6c933a2ba9c"
-  integrity sha512-RQ7YyokLiQBomUJuUG8iGVvkgOLxwyZM8k6d3q5SAXpg4r5TZJZigKFvC6PpD+qQ98bCDC5YelPeA3EucDoNeQ==
-  dependencies:
-    jsesc "~0.5.0"
-
-remove-trailing-separator@^1.0.1:
-  version "1.1.0"
-  resolved "https://registry.yarnpkg.com/remove-trailing-separator/-/remove-trailing-separator-1.1.0.tgz#c24bce2a283adad5bc3f58e0d48249b92379d8ef"
-  integrity sha1-wkvOKig62tW8P1jg1IJJuSN52O8=
-
-repeat-element@^1.1.2:
-  version "1.1.3"
-  resolved "https://registry.yarnpkg.com/repeat-element/-/repeat-element-1.1.3.tgz#782e0d825c0c5a3bb39731f84efee6b742e6b1ce"
-  integrity sha512-ahGq0ZnV5m5XtZLMb+vP76kcAM5nkLqk0lpqAuojSKGgQtn4eRi4ZZGm2olo2zKFH+sMsWaqOCW1dqAnOru72g==
-
-repeat-string@^1.6.1:
-  version "1.6.1"
-  resolved "https://registry.yarnpkg.com/repeat-string/-/repeat-string-1.6.1.tgz#8dcae470e1c88abc2d600fff4a776286da75e637"
-  integrity sha1-jcrkcOHIirwtYA//Sndihtp15jc=
-
-require-uncached@^1.0.2:
-  version "1.0.3"
-  resolved "https://registry.yarnpkg.com/require-uncached/-/require-uncached-1.0.3.tgz#4e0d56d6c9662fd31e43011c4b95aa49955421d3"
-  integrity sha1-Tg1W1slmL9MeQwEcS5WqSZVUIdM=
-  dependencies:
-    caller-path "^0.1.0"
-    resolve-from "^1.0.0"
-
-resolve-from@^1.0.0:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-1.0.1.tgz#26cbfe935d1aeeeabb29bc3fe5aeb01e93d44226"
-  integrity sha1-Jsv+k10a7uq7Kbw/5a6wHpPUQiY=
-
-resolve-url@^0.2.1:
-  version "0.2.1"
-  resolved "https://registry.yarnpkg.com/resolve-url/-/resolve-url-0.2.1.tgz#2c637fe77c893afd2a663fe21aa9080068e2052a"
-  integrity sha1-LGN/53yJOv0qZj/iGqkIAGjiBSo=
-
-resolve@^1.1.6, resolve@^1.12.0:
-  version "1.12.0"
-  resolved "https://registry.yarnpkg.com/resolve/-/resolve-1.12.0.tgz#3fc644a35c84a48554609ff26ec52b66fa577df6"
-  integrity sha512-B/dOmuoAik5bKcD6s6nXDCjzUKnaDvdkRyAk6rsmsKLipWj4797iothd7jmmUhWTfinVMU+wc56rYKsit2Qy4w==
-  dependencies:
-    path-parse "^1.0.6"
-
-restore-cursor@^1.0.1:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/restore-cursor/-/restore-cursor-1.0.1.tgz#34661f46886327fed2991479152252df92daa541"
-  integrity sha1-NGYfRohjJ/7SmRR5FSJS35LapUE=
-  dependencies:
-    exit-hook "^1.0.0"
-    onetime "^1.0.0"
-
-ret@~0.1.10:
-  version "0.1.15"
-  resolved "https://registry.yarnpkg.com/ret/-/ret-0.1.15.tgz#b8a4825d5bdb1fc3f6f53c2bc33f81388681c7bc"
-  integrity sha512-TTlYpa+OL+vMMNG24xSlQGEJ3B/RzEfUlLct7b5G/ytav+wPrplCpVMFuwzXbkecJrb6IYo1iFb0S9v37754mg==
-
-rimraf@^2.6.1:
-  version "2.7.1"
-  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.7.1.tgz#35797f13a7fdadc566142c29d4f07ccad483e3ec"
-  integrity sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==
-  dependencies:
-    glob "^7.1.3"
-
-rimraf@~2.6.2:
-  version "2.6.3"
-  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.6.3.tgz#b2d104fe0d8fb27cf9e0a1cda8262dd3833c6cab"
-  integrity sha512-mwqeW5XsA2qAejG46gYdENaxXjx9onRNCfn7L0duuP4hCuTIi/QO7PDK07KJfp1d+izWPrzEJDcSqBa0OZQriA==
-  dependencies:
-    glob "^7.1.3"
-
-run-async@^0.1.0:
-  version "0.1.0"
-  resolved "https://registry.yarnpkg.com/run-async/-/run-async-0.1.0.tgz#c8ad4a5e110661e402a7d21b530e009f25f8e389"
-  integrity sha1-yK1KXhEGYeQCp9IbUw4AnyX444k=
-  dependencies:
-    once "^1.3.0"
-
-rx-lite@^3.1.2:
-  version "3.1.2"
-  resolved "https://registry.yarnpkg.com/rx-lite/-/rx-lite-3.1.2.tgz#19ce502ca572665f3b647b10939f97fd1615f102"
-  integrity sha1-Gc5QLKVyZl87ZHsQk5+X/RYV8QI=
-
-safe-buffer@^5.1.2:
-  version "5.2.0"
-  resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.2.0.tgz#b74daec49b1148f88c64b68d49b1e815c1f2f519"
-  integrity sha512-fZEwUGbVl7kouZs1jCdMLdt95hdIv0ZeHg6L7qPeciMZhZ+/gdesW4wgTARkrFWEpspjEATAzUGPG8N2jJiwbg==
-
-safe-buffer@~5.1.0, safe-buffer@~5.1.1:
-  version "5.1.2"
-  resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.1.2.tgz#991ec69d296e0313747d59bdfd2b745c35f8828d"
-  integrity sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==
-
-safe-regex@^1.1.0:
-  version "1.1.0"
-  resolved "https://registry.yarnpkg.com/safe-regex/-/safe-regex-1.1.0.tgz#40a3669f3b077d1e943d44629e157dd48023bf2e"
-  integrity sha1-QKNmnzsHfR6UPURinhV91IAjvy4=
-  dependencies:
-    ret "~0.1.10"
-
-"safer-buffer@>= 2.1.2 < 3":
-  version "2.1.2"
-  resolved "https://registry.yarnpkg.com/safer-buffer/-/safer-buffer-2.1.2.tgz#44fa161b0187b9549dd84bb91802f9bd8385cd6a"
-  integrity sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==
-
-sax@^1.2.4:
-  version "1.2.4"
-  resolved "https://registry.yarnpkg.com/sax/-/sax-1.2.4.tgz#2816234e2378bddc4e5354fab5caa895df7100d9"
-  integrity sha512-NqVDv9TpANUjFm0N8uM5GxL36UgKi9/atZw+x7YFnQ8ckwFGKrl4xX4yWtrey3UJm5nP1kUbnYgLopqWNSRhWw==
-
-semver@^5.3.0, semver@^5.5.0:
-  version "5.7.1"
-  resolved "https://registry.yarnpkg.com/semver/-/semver-5.7.1.tgz#a954f931aeba508d307bbf069eff0c01c96116f7"
-  integrity sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==
-
-semver@^6.3.0:
-  version "6.3.0"
-  resolved "https://registry.yarnpkg.com/semver/-/semver-6.3.0.tgz#ee0a64c8af5e8ceea67687b133761e1becbd1d3d"
-  integrity sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==
-
-set-blocking@~2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/set-blocking/-/set-blocking-2.0.0.tgz#045f9782d011ae9a6803ddd382b24392b3d890f7"
-  integrity sha1-BF+XgtARrppoA93TgrJDkrPYkPc=
-
-set-value@^2.0.0, set-value@^2.0.1:
-  version "2.0.1"
-  resolved "https://registry.yarnpkg.com/set-value/-/set-value-2.0.1.tgz#a18d40530e6f07de4228c7defe4227af8cad005b"
-  integrity sha512-JxHc1weCN68wRY0fhCoXpyK55m/XPHafOmK4UWD7m2CI14GMcFypt4w/0+NV5f/ZMby2F6S2wwA7fgynh9gWSw==
-  dependencies:
-    extend-shallow "^2.0.1"
-    is-extendable "^0.1.1"
-    is-plain-object "^2.0.3"
-    split-string "^3.0.1"
-
-shelljs@^0.7.5:
-  version "0.7.8"
-  resolved "https://registry.yarnpkg.com/shelljs/-/shelljs-0.7.8.tgz#decbcf874b0d1e5fb72e14b164a9683048e9acb3"
-  integrity sha1-3svPh0sNHl+3LhSxZKloMEjprLM=
-  dependencies:
-    glob "^7.0.0"
-    interpret "^1.0.0"
-    rechoir "^0.6.2"
-
-signal-exit@^3.0.0:
-  version "3.0.2"
-  resolved "https://registry.yarnpkg.com/signal-exit/-/signal-exit-3.0.2.tgz#b5fdc08f1287ea1178628e415e25132b73646c6d"
-  integrity sha1-tf3AjxKH6hF4Yo5BXiUTK3NkbG0=
-
-slash@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/slash/-/slash-2.0.0.tgz#de552851a1759df3a8f206535442f5ec4ddeab44"
-  integrity sha512-ZYKh3Wh2z1PpEXWr0MpSBZ0V6mZHAQfYevttO11c51CaWjGTaadiKZ+wVt1PbMlDV5qhMFslpZCemhwOK7C89A==
-
-slice-ansi@0.0.4:
-  version "0.0.4"
-  resolved "https://registry.yarnpkg.com/slice-ansi/-/slice-ansi-0.0.4.tgz#edbf8903f66f7ce2f8eafd6ceed65e264c831b35"
-  integrity sha1-7b+JA/ZvfOL46v1s7tZeJkyDGzU=
-
-snapdragon-node@^2.0.1:
-  version "2.1.1"
-  resolved "https://registry.yarnpkg.com/snapdragon-node/-/snapdragon-node-2.1.1.tgz#6c175f86ff14bdb0724563e8f3c1b021a286853b"
-  integrity sha512-O27l4xaMYt/RSQ5TR3vpWCAB5Kb/czIcqUFOM/C4fYcLnbZUc1PkjTAMjof2pBWaSTwOUd6qUHcFGVGj7aIwnw==
-  dependencies:
-    define-property "^1.0.0"
-    isobject "^3.0.0"
-    snapdragon-util "^3.0.1"
-
-snapdragon-util@^3.0.1:
-  version "3.0.1"
-  resolved "https://registry.yarnpkg.com/snapdragon-util/-/snapdragon-util-3.0.1.tgz#f956479486f2acd79700693f6f7b805e45ab56e2"
-  integrity sha512-mbKkMdQKsjX4BAL4bRYTj21edOf8cN7XHdYUJEe+Zn99hVEYcMvKPct1IqNe7+AZPirn8BCDOQBHQZknqmKlZQ==
-  dependencies:
-    kind-of "^3.2.0"
-
-snapdragon@^0.8.1:
-  version "0.8.2"
-  resolved "https://registry.yarnpkg.com/snapdragon/-/snapdragon-0.8.2.tgz#64922e7c565b0e14204ba1aa7d6964278d25182d"
-  integrity sha512-FtyOnWN/wCHTVXOMwvSv26d+ko5vWlIDD6zoUJ7LW8vh+ZBC8QdljveRP+crNrtBwioEUWy/4dMtbBjA4ioNlg==
-  dependencies:
-    base "^0.11.1"
-    debug "^2.2.0"
-    define-property "^0.2.5"
-    extend-shallow "^2.0.1"
-    map-cache "^0.2.2"
-    source-map "^0.5.6"
-    source-map-resolve "^0.5.0"
-    use "^3.1.0"
-
-source-map-resolve@^0.5.0:
-  version "0.5.2"
-  resolved "https://registry.yarnpkg.com/source-map-resolve/-/source-map-resolve-0.5.2.tgz#72e2cc34095543e43b2c62b2c4c10d4a9054f259"
-  integrity sha512-MjqsvNwyz1s0k81Goz/9vRBe9SZdB09Bdw+/zYyO+3CuPk6fouTaxscHkgtE8jKvf01kVfl8riHzERQ/kefaSA==
-  dependencies:
-    atob "^2.1.1"
-    decode-uri-component "^0.2.0"
-    resolve-url "^0.2.1"
-    source-map-url "^0.4.0"
-    urix "^0.1.0"
-
-source-map-url@^0.4.0:
-  version "0.4.0"
-  resolved "https://registry.yarnpkg.com/source-map-url/-/source-map-url-0.4.0.tgz#3e935d7ddd73631b97659956d55128e87b5084a3"
-  integrity sha1-PpNdfd1zYxuXZZlW1VEo6HtQhKM=
-
-source-map@^0.5.0, source-map@^0.5.6:
-  version "0.5.7"
-  resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.5.7.tgz#8a039d2d1021d22d1ea14c80d8ea468ba2ef3fcc"
-  integrity sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w=
-
-split-string@^3.0.1, split-string@^3.0.2:
-  version "3.1.0"
-  resolved "https://registry.yarnpkg.com/split-string/-/split-string-3.1.0.tgz#7cb09dda3a86585705c64b39a6466038682e8fe2"
-  integrity sha512-NzNVhJDYpwceVVii8/Hu6DKfD2G+NrQHlS/V/qgv763EYudVwEcMQNxd2lh+0VrUByXN/oJkl5grOhYWvQUYiw==
-  dependencies:
-    extend-shallow "^3.0.0"
-
-sprintf-js@~1.0.2:
-  version "1.0.3"
-  resolved "https://registry.yarnpkg.com/sprintf-js/-/sprintf-js-1.0.3.tgz#04e6926f662895354f3dd015203633b857297e2c"
-  integrity sha1-BOaSb2YolTVPPdAVIDYzuFcpfiw=
-
-static-extend@^0.1.1:
-  version "0.1.2"
-  resolved "https://registry.yarnpkg.com/static-extend/-/static-extend-0.1.2.tgz#60809c39cbff55337226fd5e0b520f341f1fb5c6"
-  integrity sha1-YICcOcv/VTNyJv1eC1IPNB8ftcY=
-  dependencies:
-    define-property "^0.2.5"
-    object-copy "^0.1.0"
-
-string-width@^1.0.1:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/string-width/-/string-width-1.0.2.tgz#118bdf5b8cdc51a2a7e70d211e07e2b0b9b107d3"
-  integrity sha1-EYvfW4zcUaKn5w0hHgfisLmxB9M=
-  dependencies:
-    code-point-at "^1.0.0"
-    is-fullwidth-code-point "^1.0.0"
-    strip-ansi "^3.0.0"
-
-"string-width@^1.0.2 || 2", string-width@^2.0.0:
-  version "2.1.1"
-  resolved "https://registry.yarnpkg.com/string-width/-/string-width-2.1.1.tgz#ab93f27a8dc13d28cac815c462143a6d9012ae9e"
-  integrity sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==
-  dependencies:
-    is-fullwidth-code-point "^2.0.0"
-    strip-ansi "^4.0.0"
-
-string_decoder@~1.1.1:
-  version "1.1.1"
-  resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.1.1.tgz#9cf1611ba62685d7030ae9e4ba34149c3af03fc8"
-  integrity sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==
-  dependencies:
-    safe-buffer "~5.1.0"
-
-strip-ansi@^3.0.0, strip-ansi@^3.0.1:
-  version "3.0.1"
-  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-3.0.1.tgz#6a385fb8853d952d5ff05d0e8aaf94278dc63dcf"
-  integrity sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=
-  dependencies:
-    ansi-regex "^2.0.0"
-
-strip-ansi@^4.0.0:
-  version "4.0.0"
-  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-4.0.0.tgz#a8479022eb1ac368a871389b635262c505ee368f"
-  integrity sha1-qEeQIusaw2iocTibY1JixQXuNo8=
-  dependencies:
-    ansi-regex "^3.0.0"
-
-strip-bom@^3.0.0:
-  version "3.0.0"
-  resolved "https://registry.yarnpkg.com/strip-bom/-/strip-bom-3.0.0.tgz#2334c18e9c759f7bdd56fdef7e9ae3d588e68ed3"
-  integrity sha1-IzTBjpx1n3vdVv3vfprj1YjmjtM=
-
-strip-json-comments@~1.0.1:
-  version "1.0.4"
-  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-1.0.4.tgz#1e15fbcac97d3ee99bf2d73b4c656b082bbafb91"
-  integrity sha1-HhX7ysl9Pumb8tc7TGVrCCu6+5E=
-
-strip-json-comments@~2.0.1:
-  version "2.0.1"
-  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-2.0.1.tgz#3c531942e908c2697c0ec344858c286c7ca0a60a"
-  integrity sha1-PFMZQukIwml8DsNEhYwobHygpgo=
-
 supports-color@3.1.2:
   version "3.1.2"
   resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-3.1.2.tgz#72a262894d9d408b956ca05ff37b2ed8a6e2a2d5"
@@ -2756,198 +221,7 @@ supports-color@3.1.2:
   dependencies:
     has-flag "^1.0.0"
 
-supports-color@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-2.0.0.tgz#535d045ce6b6363fa40117084629995e9df324c7"
-  integrity sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=
-
-supports-color@^5.3.0:
-  version "5.5.0"
-  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.5.0.tgz#e2e69a44ac8772f78a1ec0b35b689df6530efc8f"
-  integrity sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==
-  dependencies:
-    has-flag "^3.0.0"
-
-table@^3.7.8:
-  version "3.8.3"
-  resolved "https://registry.yarnpkg.com/table/-/table-3.8.3.tgz#2bbc542f0fda9861a755d3947fefd8b3f513855f"
-  integrity sha1-K7xULw/amGGnVdOUf+/Ys/UThV8=
-  dependencies:
-    ajv "^4.7.0"
-    ajv-keywords "^1.0.0"
-    chalk "^1.1.1"
-    lodash "^4.0.0"
-    slice-ansi "0.0.4"
-    string-width "^2.0.0"
-
-tar@^4:
-  version "4.4.13"
-  resolved "https://registry.yarnpkg.com/tar/-/tar-4.4.13.tgz#43b364bc52888d555298637b10d60790254ab525"
-  integrity sha512-w2VwSrBoHa5BsSyH+KxEqeQBAllHhccyMFVHtGtdMpF4W7IRWfZjFiQceJPChOeTsSDVUpER2T8FA93pr0L+QA==
-  dependencies:
-    chownr "^1.1.1"
-    fs-minipass "^1.2.5"
-    minipass "^2.8.6"
-    minizlib "^1.2.1"
-    mkdirp "^0.5.0"
-    safe-buffer "^5.1.2"
-    yallist "^3.0.3"
-
-text-table@~0.2.0:
-  version "0.2.0"
-  resolved "https://registry.yarnpkg.com/text-table/-/text-table-0.2.0.tgz#7f5ee823ae805207c00af2df4a84ec3fcfa570b4"
-  integrity sha1-f17oI66AUgfACvLfSoTsP8+lcLQ=
-
-through@^2.3.6:
-  version "2.3.8"
-  resolved "https://registry.yarnpkg.com/through/-/through-2.3.8.tgz#0dd4c9ffaabc357960b1b724115d7e0e86a2e1f5"
-  integrity sha1-DdTJ/6q8NXlgsbckEV1+Doai4fU=
-
-to-fast-properties@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/to-fast-properties/-/to-fast-properties-2.0.0.tgz#dc5e698cbd079265bc73e0377681a4e4e83f616e"
-  integrity sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4=
-
-to-object-path@^0.3.0:
-  version "0.3.0"
-  resolved "https://registry.yarnpkg.com/to-object-path/-/to-object-path-0.3.0.tgz#297588b7b0e7e0ac08e04e672f85c1f4999e17af"
-  integrity sha1-KXWIt7Dn4KwI4E5nL4XB9JmeF68=
-  dependencies:
-    kind-of "^3.0.2"
-
-to-regex-range@^2.1.0:
-  version "2.1.1"
-  resolved "https://registry.yarnpkg.com/to-regex-range/-/to-regex-range-2.1.1.tgz#7c80c17b9dfebe599e27367e0d4dd5590141db38"
-  integrity sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=
-  dependencies:
-    is-number "^3.0.0"
-    repeat-string "^1.6.1"
-
-to-regex@^3.0.1, to-regex@^3.0.2:
-  version "3.0.2"
-  resolved "https://registry.yarnpkg.com/to-regex/-/to-regex-3.0.2.tgz#13cfdd9b336552f30b51f33a8ae1b42a7a7599ce"
-  integrity sha512-FWtleNAtZ/Ki2qtqej2CXTOayOH9bHDQF+Q48VpWyDXjbYxA4Yz8iDB31zXOBUlOHHKidDbqGVrTUvQMPmBGBw==
-  dependencies:
-    define-property "^2.0.2"
-    extend-shallow "^3.0.2"
-    regex-not "^1.0.2"
-    safe-regex "^1.1.0"
-
-type-check@~0.3.2:
-  version "0.3.2"
-  resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.3.2.tgz#5884cab512cf1d355e3fb784f30804b2b520db72"
-  integrity sha1-WITKtRLPHTVeP7eE8wgEsrUg23I=
-  dependencies:
-    prelude-ls "~1.1.2"
-
-type@^1.0.1:
-  version "1.2.0"
-  resolved "https://registry.yarnpkg.com/type/-/type-1.2.0.tgz#848dd7698dafa3e54a6c479e759c4bc3f18847a0"
-  integrity sha512-+5nt5AAniqsCnu2cEQQdpzCAh33kVx8n0VoFidKpB1dVVLAN/F+bgVOqOJqOnEnrhp222clB5p3vUlD+1QAnfg==
-
-typedarray@^0.0.6:
-  version "0.0.6"
-  resolved "https://registry.yarnpkg.com/typedarray/-/typedarray-0.0.6.tgz#867ac74e3864187b1d3d47d996a78ec5c8830777"
-  integrity sha1-hnrHTjhkGHsdPUfZlqeOxciDB3c=
-
-unicode-canonical-property-names-ecmascript@^1.0.4:
-  version "1.0.4"
-  resolved "https://registry.yarnpkg.com/unicode-canonical-property-names-ecmascript/-/unicode-canonical-property-names-ecmascript-1.0.4.tgz#2619800c4c825800efdd8343af7dd9933cbe2818"
-  integrity sha512-jDrNnXWHd4oHiTZnx/ZG7gtUTVp+gCcTTKr8L0HjlwphROEW3+Him+IpvC+xcJEFegapiMZyZe02CyuOnRmbnQ==
-
-unicode-match-property-ecmascript@^1.0.4:
-  version "1.0.4"
-  resolved "https://registry.yarnpkg.com/unicode-match-property-ecmascript/-/unicode-match-property-ecmascript-1.0.4.tgz#8ed2a32569961bce9227d09cd3ffbb8fed5f020c"
-  integrity sha512-L4Qoh15vTfntsn4P1zqnHulG0LdXgjSO035fEpdtp6YxXhMT51Q6vgM5lYdG/5X3MjS+k/Y9Xw4SFCY9IkR0rg==
-  dependencies:
-    unicode-canonical-property-names-ecmascript "^1.0.4"
-    unicode-property-aliases-ecmascript "^1.0.4"
-
-unicode-match-property-value-ecmascript@^1.1.0:
-  version "1.1.0"
-  resolved "https://registry.yarnpkg.com/unicode-match-property-value-ecmascript/-/unicode-match-property-value-ecmascript-1.1.0.tgz#5b4b426e08d13a80365e0d657ac7a6c1ec46a277"
-  integrity sha512-hDTHvaBk3RmFzvSl0UVrUmC3PuW9wKVnpoUDYH0JDkSIovzw+J5viQmeYHxVSBptubnr7PbH2e0fnpDRQnQl5g==
-
-unicode-property-aliases-ecmascript@^1.0.4:
-  version "1.0.5"
-  resolved "https://registry.yarnpkg.com/unicode-property-aliases-ecmascript/-/unicode-property-aliases-ecmascript-1.0.5.tgz#a9cc6cc7ce63a0a3023fc99e341b94431d405a57"
-  integrity sha512-L5RAqCfXqAwR3RriF8pM0lU0w4Ryf/GgzONwi6KnL1taJQa7x1TCxdJnILX59WIGOwR57IVxn7Nej0fz1Ny6fw==
-
-union-value@^1.0.0:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/union-value/-/union-value-1.0.1.tgz#0b6fe7b835aecda61c6ea4d4f02c14221e109847"
-  integrity sha512-tJfXmxMeWYnczCVs7XAEvIV7ieppALdyepWMkHkwciRpZraG/xwT+s2JN8+pr1+8jCRf80FFzvr+MpQeeoF4Xg==
-  dependencies:
-    arr-union "^3.1.0"
-    get-value "^2.0.6"
-    is-extendable "^0.1.1"
-    set-value "^2.0.1"
-
-unset-value@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/unset-value/-/unset-value-1.0.0.tgz#8376873f7d2335179ffb1e6fc3a8ed0dfc8ab559"
-  integrity sha1-g3aHP30jNRef+x5vw6jtDfyKtVk=
-  dependencies:
-    has-value "^0.3.1"
-    isobject "^3.0.0"
-
-upath@^1.1.1:
-  version "1.2.0"
-  resolved "https://registry.yarnpkg.com/upath/-/upath-1.2.0.tgz#8f66dbcd55a883acdae4408af8b035a5044c1894"
-  integrity sha512-aZwGpamFO61g3OlfT7OQCHqhGnW43ieH9WZeP7QxN/G/jS4jfqUkZxoryvJgVPEcrl5NL/ggHsSmLMHuH64Lhg==
-
-urix@^0.1.0:
-  version "0.1.0"
-  resolved "https://registry.yarnpkg.com/urix/-/urix-0.1.0.tgz#da937f7a62e21fec1fd18d49b35c2935067a6c72"
-  integrity sha1-2pN/emLiH+wf0Y1Js1wpNQZ6bHI=
-
-use@^3.1.0:
-  version "3.1.1"
-  resolved "https://registry.yarnpkg.com/use/-/use-3.1.1.tgz#d50c8cac79a19fbc20f2911f56eb973f4e10070f"
-  integrity sha512-cwESVXlO3url9YWlFW/TA9cshCEhtu7IKJ/p5soJ/gGpj7vbvFrAY/eIioQ6Dw23KjZhYgiIo8HOs1nQ2vr/oQ==
-
-user-home@^2.0.0:
-  version "2.0.0"
-  resolved "https://registry.yarnpkg.com/user-home/-/user-home-2.0.0.tgz#9c70bfd8169bc1dcbf48604e0f04b8b49cde9e9f"
-  integrity sha1-nHC/2Babwdy/SGBODwS4tJzenp8=
-  dependencies:
-    os-homedir "^1.0.0"
-
-util-deprecate@~1.0.1:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/util-deprecate/-/util-deprecate-1.0.2.tgz#450d4dc9fa70de732762fbd2d4a28981419a0ccf"
-  integrity sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=
-
-wide-align@^1.1.0:
-  version "1.1.3"
-  resolved "https://registry.yarnpkg.com/wide-align/-/wide-align-1.1.3.tgz#ae074e6bdc0c14a431e804e624549c633b000457"
-  integrity sha512-QGkOQc8XL6Bt5PwnsExKBPuMKBxnGxWWW3fU55Xt4feHozMUhdUMaBCk290qpm/wG5u/RSKzwdAC4i51YigihA==
-  dependencies:
-    string-width "^1.0.2 || 2"
-
-wordwrap@~1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-1.0.0.tgz#27584810891456a4171c8d0226441ade90cbcaeb"
-  integrity sha1-J1hIEIkUVqQXHI0CJkQa3pDLyus=
-
 wrappy@1:
   version "1.0.2"
   resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f"
   integrity sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=
-
-write@^0.2.1:
-  version "0.2.1"
-  resolved "https://registry.yarnpkg.com/write/-/write-0.2.1.tgz#5fc03828e264cea3fe91455476f7a3c566cb0757"
-  integrity sha1-X8A4KOJkzqP+kUVUdvejxWbLB1c=
-  dependencies:
-    mkdirp "^0.5.1"
-
-xtend@^4.0.0:
-  version "4.0.2"
-  resolved "https://registry.yarnpkg.com/xtend/-/xtend-4.0.2.tgz#bb72779f5fa465186b1f438f674fa347fdb5db54"
-  integrity sha512-LKYU1iAXJXUgAXn9URjiu+MWhyUXHsvfp7mcuYm9dSUKK0/CjtrUwFAxD82/mCWbtLsGjFIad0wIsod4zrTAEQ==
-
-yallist@^3.0.0, yallist@^3.0.3:
-  version "3.1.0"
-  resolved "https://registry.yarnpkg.com/yallist/-/yallist-3.1.0.tgz#906cc2100972dc2625ae78f566a2577230a1d6f7"
-  integrity sha512-6gpP93MR+VOOehKbCPchro3wFZNSNmek8A2kbkOAZLIZAYx1KP/zAqwO0sOHi3xJEb+UBz8NaYt/17UNit1Q9w==
diff --git a/jest.config.js b/jest.config.js
index 7b9239f..2fbe9b0 100644
--- a/jest.config.js
+++ b/jest.config.js
@@ -1,5 +1,5 @@
 module.exports = {
-  roots: ['<rootDir>/src'],
+  roots: ['<rootDir>/src', '<rootDir>/eslint-plugin/lib'],
   transform: {
     '^.+\\.tsx?$': 'ts-jest',
   },
diff --git a/package.json b/package.json
index d64a107..bd91e4d 100644
--- a/package.json
+++ b/package.json
@@ -29,7 +29,8 @@
   "types": "dist/index.d.ts",
   "files": [
     "dist/index.js",
-    "dist/index.d.ts"
+    "dist/index.d.ts",
+    "eslint-plugin/!(*/__tests__|yarn*)"
   ],
   "dependencies": {
     "react": "^16"
@@ -41,6 +42,7 @@
     "@types/react": "^16.9.2",
     "@typescript-eslint/eslint-plugin": "^2.3.1",
     "@typescript-eslint/parser": "^2.3.1",
+    "babel-eslint": "^10.0.3",
     "commitlint": "^8.2.0",
     "conventional-changelog-cli": "^2.0.25",
     "eslint": "^6.5.0",
diff --git a/src/__tests__/useDidUnmount.ts b/src/__tests__/useDidUnmount.ts
index e96ae7c..65b8634 100644
--- a/src/__tests__/useDidUnmount.ts
+++ b/src/__tests__/useDidUnmount.ts
@@ -3,23 +3,23 @@ import { renderHook } from '@testing-library/react-hooks';
 import { useDidUnmount } from '..';
 
 let cleanup: jest.Mock;
-let hook: any;
+let useHook: any;
 
 beforeEach(() => {
   cleanup = jest.fn();
-  hook = ({ func = cleanup, deps }: any = {}) => {
+  useHook = ({ func = cleanup, deps }: any = {}) => {
     useDidUnmount(func, deps);
   };
 });
 
 it('does not call the effect if the component is mounted', () => {
-  renderHook(hook);
+  renderHook(useHook);
 
   expect(cleanup).not.toHaveBeenCalled();
 });
 
 it('calls the effect when the component gets unmounted', () => {
-  const { unmount } = renderHook(hook);
+  const { unmount } = renderHook(useHook);
 
   expect(cleanup).not.toHaveBeenCalled();
   unmount();
@@ -28,7 +28,7 @@ it('calls the effect when the component gets unmounted', () => {
 });
 
 it('calls the effect only once', () => {
-  const { unmount } = renderHook(hook);
+  const { unmount } = renderHook(useHook);
 
   expect(cleanup).not.toHaveBeenCalled();
   unmount();
@@ -50,7 +50,7 @@ it('runs an async funciton', async () => {
     finished = true;
   });
 
-  const { unmount } = renderHook(hook);
+  const { unmount } = renderHook(useHook);
 
   unmount();
 
@@ -64,7 +64,7 @@ it('runs an async funciton', async () => {
 
 it('calls the effect with updated dependencies', () => {
   const secondCleanup = jest.fn();
-  const { unmount, rerender } = renderHook(hook, {
+  const { unmount, rerender } = renderHook(useHook, {
     initialProps: { func: cleanup, deps: [cleanup] },
   });
 
@@ -78,7 +78,7 @@ it('calls the effect with updated dependencies', () => {
 
 it('does not update the effect when the dependencies have not been updated', () => {
   const secondCleanup = jest.fn();
-  const { unmount, rerender } = renderHook(hook, {
+  const { unmount, rerender } = renderHook(useHook, {
     initialProps: { func: cleanup, deps: [cleanup] },
   });
 
diff --git a/src/__tests__/useLazyRef.ts b/src/__tests__/useLazyRef.ts
index d793201..b30eea4 100644
--- a/src/__tests__/useLazyRef.ts
+++ b/src/__tests__/useLazyRef.ts
@@ -3,18 +3,18 @@ import { renderHook } from '@testing-library/react-hooks';
 import { useLazyRef } from '..';
 
 const callbackFn = jest.fn();
-const mockHook = () => useLazyRef(callbackFn);
+const useMockHook = () => useLazyRef(callbackFn);
 
 beforeEach(callbackFn.mockRestore);
 
 it('calls factory on first call', () => {
-  renderHook(mockHook);
+  renderHook(useMockHook);
 
   expect(callbackFn.mock.calls.length).toEqual(1);
 });
 
 it('does not call factory when value is unset', () => {
-  const { result, rerender } = renderHook(mockHook);
+  const { result, rerender } = renderHook(useMockHook);
   expect(callbackFn.mock.calls.length).toEqual(1);
 
   // act
@@ -28,7 +28,7 @@ describe('change in current value', () => {
   const assertChangeCurrentValue = () => {
     // initial value
     callbackFn.mockReturnValue(0);
-    const { result } = renderHook(mockHook);
+    const { result } = renderHook(useMockHook);
 
     expect(result.current.current).toEqual(0);
 
diff --git a/src/__tests__/usePromisedState.ts b/src/__tests__/usePromisedState.ts
index eaf7abf..1dca33a 100644
--- a/src/__tests__/usePromisedState.ts
+++ b/src/__tests__/usePromisedState.ts
@@ -3,7 +3,7 @@ import { renderHook, act } from '@testing-library/react-hooks';
 import { usePromisedState } from '..';
 
 describe('non-nullable, non-undefined state type', () => {
-  const hookHelper = () => usePromisedState<number>();
+  const useHookHelper = () => usePromisedState<number>();
 
   it("does not resolve promise if set isn't called", () => {
     let resolved = false;
@@ -11,7 +11,7 @@ describe('non-nullable, non-undefined state type', () => {
       result: {
         current: [promise],
       },
-    } = renderHook(hookHelper);
+    } = renderHook(useHookHelper);
 
     promise.then(() => {
       resolved = true;
@@ -27,7 +27,7 @@ describe('non-nullable, non-undefined state type', () => {
       result: {
         current: [promise, set],
       },
-    } = renderHook(hookHelper);
+    } = renderHook(useHookHelper);
 
     promise.then(() => {
       resolved = true;
@@ -48,7 +48,7 @@ describe('non-nullable, non-undefined state type', () => {
 
   it('resolves a new promise when the state is set', async () => {
     let resolved = false;
-    const { result } = renderHook(hookHelper);
+    const { result } = renderHook(useHookHelper);
 
     result.current[0].then(() => {
       resolved = true;
@@ -69,7 +69,7 @@ describe('non-nullable, non-undefined state type', () => {
 });
 
 describe('nullable state type', () => {
-  const hookHelper = () => usePromisedState<number | undefined>();
+  const useHookHelper = () => usePromisedState<number | undefined>();
 
   it("does not resolve promise if set isn't called", () => {
     let resolved = false;
@@ -77,7 +77,7 @@ describe('nullable state type', () => {
       result: {
         current: [promise],
       },
-    } = renderHook(hookHelper);
+    } = renderHook(useHookHelper);
 
     promise.then(() => {
       resolved = true;
@@ -93,7 +93,7 @@ describe('nullable state type', () => {
       result: {
         current: [promise, set],
       },
-    } = renderHook(hookHelper);
+    } = renderHook(useHookHelper);
 
     promise.then(() => {
       resolved = true;
@@ -108,7 +108,7 @@ describe('nullable state type', () => {
   });
 
   it('waits on a new state after setting undefined', async () => {
-    const { result } = renderHook(hookHelper);
+    const { result } = renderHook(useHookHelper);
 
     act(() => {
       result.current[1](0);
@@ -126,7 +126,7 @@ describe('nullable state type', () => {
 
   it('resolves a new promise when the state is set', async () => {
     let resolved = false;
-    const { result } = renderHook(hookHelper);
+    const { result } = renderHook(useHookHelper);
 
     result.current[0].then(() => {
       resolved = true;
diff --git a/src/__tests__/useWorkerState.ts b/src/__tests__/useWorkerState.ts
index 946d493..f3ede35 100644
--- a/src/__tests__/useWorkerState.ts
+++ b/src/__tests__/useWorkerState.ts
@@ -210,7 +210,7 @@ describe('callback', () => {
   });
 
   it('updates the scope of the callback', async () => {
-    const hook = () => {
+    const useHook = () => {
       const [state, setState] = useState(0);
       const worker = useWorkerState(async () => {
         callbackFn(state);
@@ -218,7 +218,7 @@ describe('callback', () => {
       return { state, setState, ...worker };
     };
 
-    const { result, waitForNextUpdate } = renderHook(hook);
+    const { result, waitForNextUpdate } = renderHook(useHook);
 
     expect(callbackFn.mock.calls[0][0]).toBe(0);
 
diff --git a/src/index.tsx b/src/index.tsx
index a73623e..e807b53 100644
--- a/src/index.tsx
+++ b/src/index.tsx
@@ -4,6 +4,7 @@ import {
   useCallback,
   useState,
   useRef,
+  useMemo,
   MutableRefObject,
 } from 'react';
 
@@ -59,7 +60,7 @@ export const useAsyncEffect = (
 ) => {
   useEffect(() => {
     effect();
-  }, [...dependencies, effect]);
+  }, [...dependencies, effect]); // eslint-disable-line react-hooks/exhaustive-deps
 };
 
 /**
@@ -77,7 +78,7 @@ export const useAsyncLayoutEffect = (
 ) => {
   useLayoutEffect(() => {
     effect();
-  }, [...dependencies, effect]);
+  }, [...dependencies, effect]); // eslint-disable-line react-hooks/exhaustive-deps
 };
 
 /**
@@ -114,19 +115,20 @@ export const useWorker = <TArgs extends readonly any[], TRet>(
     setState(s => ({ ...s, isLoading }));
   }, []);
 
-  const callback = useCallback(async (...args: TArgs): Promise<
-    TRet | undefined
-  > => {
-    try {
-      setIsLoading(true);
-      const result = await worker(...args);
-      setState({ isLoading: false, error: undefined });
+  const callback = useCallback(
+    async (...args: TArgs): Promise<TRet | undefined> => {
+      try {
+        setIsLoading(true);
+        const result = await worker(...args);
+        setState({ isLoading: false, error: undefined });
 
-      return result;
-    } catch (error) {
-      setState({ isLoading: false, error });
-    }
-  }, dependencies);
+        return result;
+      } catch (error) {
+        setState({ isLoading: false, error });
+      }
+    },
+    [...dependencies, worker], // eslint-disable-line react-hooks/exhaustive-deps
+  );
 
   return { callback, error, isLoading, setError, setIsLoading };
 };
@@ -280,7 +282,7 @@ export function useEffectUpdate<Dependencies extends readonly any[]>(
     } finally {
       oldState.current = dependencies;
     }
-  }, [...dependencies, effect, oldState.current]);
+  }, [...dependencies, effect]); // eslint-disable-line react-hooks/exhaustive-deps
 }
 
 /**
@@ -458,7 +460,7 @@ export function useConditionalEffect<Dependencies extends readonly any[]>(
 ): void {
   useEffectUpdate(
     oldState => (evalCondition(oldState) ? effect() : undefined),
-    dependencies, // eslint-disable-line @react-hook-utilities/exhaustive-deps,react-hooks/exhaustive-deps
+    dependencies, // eslint-disable-line @react-hook-utilities/exhaustive-deps
   );
 }
 
@@ -476,7 +478,7 @@ export const useDidMount = (
     if (typeof result === 'function') {
       return result;
     }
-  }, []);
+  }, []); // eslint-disable-line react-hooks/exhaustive-deps
 };
 
 /**
@@ -508,7 +510,7 @@ export const useDidUnmount = (
         effect();
       }
     },
-    dependencies || [],
+    dependencies || [], // eslint-disable-line react-hooks/exhaustive-deps
   );
 };
 
@@ -574,7 +576,7 @@ export function useWorkerState<Data>(
     async () => {
       setData(await worker());
     },
-    dependencies,
+    dependencies, // eslint-disable-line @react-hook-utilities/exhaustive-deps
   );
 
   // start loading immediately
@@ -612,28 +614,34 @@ export const usePromisedState = <T,>(): [
   ValuablePromise<T>,
   (_: T) => void,
 ] => {
-  let resolve: (v: T) => void;
-  const createPromise = (value?: T) => {
-    const result: ValuablePromise<T> = new Promise<T>(r => {
-      resolve = r;
-      if (value) {
-        r(value);
-      }
-    });
-    result.value = value;
-    return result;
-  };
+  let resolve = useRef<(v: T) => void>();
+  const createPromise = useMemo(
+    () => (value?: T) => {
+      const result: ValuablePromise<T> = new Promise<T>(r => {
+        resolve.current = r;
+        if (value) {
+          r(value);
+        }
+      });
+      result.value = value;
+      return result;
+    },
+    [],
+  );
 
   const [state, setState] = useState(createPromise);
   return [
     state,
-    useCallback((newValue: T) => {
-      if (!!newValue) {
-        resolve(newValue);
-        state.value = newValue;
-      }
-
-      setState(createPromise(newValue));
-    }, []),
+    useCallback(
+      (newValue: T) => {
+        if (!!newValue) {
+          resolve.current!(newValue);
+          state.value = newValue;
+        }
+
+        setState(createPromise(newValue));
+      },
+      [createPromise, state.value],
+    ), // eslint-disable-line @react-hook-utilities/exhaustive-deps
   ];
 };
diff --git a/yarn.lock b/yarn.lock
index 40f182d..2e324c2 100644
--- a/yarn.lock
+++ b/yarn.lock
@@ -40,6 +40,16 @@
     source-map "^0.5.0"
     trim-right "^1.0.1"
 
+"@babel/generator@^7.6.2":
+  version "7.7.4"
+  resolved "https://registry.yarnpkg.com/@babel/generator/-/generator-7.7.4.tgz#db651e2840ca9aa66f327dcec1dc5f5fa9611369"
+  integrity sha512-m5qo2WgdOJeyYngKImbkyQrnUN1mPceaG5BV+G0E3gWsa4l/jCSryWJdM2x8OuGAOyh+3d5pVYfZWCiNFtynxg==
+  dependencies:
+    "@babel/types" "^7.7.4"
+    jsesc "^2.5.1"
+    lodash "^4.17.13"
+    source-map "^0.5.0"
+
 "@babel/helper-function-name@^7.1.0":
   version "7.1.0"
   resolved "https://registry.yarnpkg.com/@babel/helper-function-name/-/helper-function-name-7.1.0.tgz#a0ceb01685f73355d4360c1247f582bfafc8ff53"
@@ -86,7 +96,12 @@
     esutils "^2.0.2"
     js-tokens "^4.0.0"
 
-"@babel/parser@^7.1.0", "@babel/parser@^7.4.3", "@babel/parser@^7.6.0":
+"@babel/parser@^7.0.0", "@babel/parser@^7.6.0", "@babel/parser@^7.6.2":
+  version "7.6.2"
+  resolved "https://registry.yarnpkg.com/@babel/parser/-/parser-7.6.2.tgz#205e9c95e16ba3b8b96090677a67c9d6075b70a1"
+  integrity sha512-mdFqWrSPCmikBoaBYMuBulzTIKuXVPtEISFbRRVNwMWpCms/hmE2kRq0bblUHaNRKrjRlmVbx1sDHmjmRgD2Xg==
+
+"@babel/parser@^7.1.0", "@babel/parser@^7.4.3":
   version "7.6.0"
   resolved "https://registry.yarnpkg.com/@babel/parser/-/parser-7.6.0.tgz#3e05d0647432a8326cb28d0de03895ae5a57f39b"
   integrity sha512-+o2q111WEx4srBs7L9eJmcwi655eD8sXniLqMB93TBK9GrNzGrxDWSjiqz2hLU0Ha8MTXFIP0yd9fNdP+m43ZQ==
@@ -114,7 +129,22 @@
     "@babel/parser" "^7.6.0"
     "@babel/types" "^7.6.0"
 
-"@babel/traverse@^7.1.0", "@babel/traverse@^7.4.3", "@babel/traverse@^7.6.0":
+"@babel/traverse@^7.0.0", "@babel/traverse@^7.1.0":
+  version "7.6.2"
+  resolved "https://registry.yarnpkg.com/@babel/traverse/-/traverse-7.6.2.tgz#b0e2bfd401d339ce0e6c05690206d1e11502ce2c"
+  integrity sha512-8fRE76xNwNttVEF2TwxJDGBLWthUkHWSldmfuBzVRmEDWOtu4XdINTgN7TDWzuLg4bbeIMLvfMFD9we5YcWkRQ==
+  dependencies:
+    "@babel/code-frame" "^7.5.5"
+    "@babel/generator" "^7.6.2"
+    "@babel/helper-function-name" "^7.1.0"
+    "@babel/helper-split-export-declaration" "^7.4.4"
+    "@babel/parser" "^7.6.2"
+    "@babel/types" "^7.6.0"
+    debug "^4.1.0"
+    globals "^11.1.0"
+    lodash "^4.17.13"
+
+"@babel/traverse@^7.4.3", "@babel/traverse@^7.6.0":
   version "7.6.0"
   resolved "https://registry.yarnpkg.com/@babel/traverse/-/traverse-7.6.0.tgz#389391d510f79be7ce2ddd6717be66d3fed4b516"
   integrity sha512-93t52SaOBgml/xY74lsmt7xOR4ufYvhb5c5qiM6lu4J/dWGMAfAh6eKw4PjLes6DI6nQgearoxnFJk60YchpvQ==
@@ -138,6 +168,15 @@
     lodash "^4.17.13"
     to-fast-properties "^2.0.0"
 
+"@babel/types@^7.7.4":
+  version "7.7.4"
+  resolved "https://registry.yarnpkg.com/@babel/types/-/types-7.7.4.tgz#516570d539e44ddf308c07569c258ff94fde9193"
+  integrity sha512-cz5Ji23KCi4T+YIE/BolWosrJuSmoZeN1EFnRtBwF+KKLi8GG/Z2c2hOJJeCXPk4mwk4QFvTmwIodJowXgttRA==
+  dependencies:
+    esutils "^2.0.2"
+    lodash "^4.17.13"
+    to-fast-properties "^2.0.0"
+
 "@cnakazawa/watch@^1.0.3":
   version "1.0.3"
   resolved "https://registry.yarnpkg.com/@cnakazawa/watch/-/watch-1.0.3.tgz#099139eaec7ebf07a27c1786a3ff64f39464d2ef"
@@ -429,7 +468,7 @@
     rimraf "^2.5.2"
 
 "@react-hook-utilities/eslint-plugin@./eslint-plugin":
-  version "1.0.0"
+  version "0.1.0"
 
 "@testing-library/react-hooks@^2.0.1":
   version "2.0.1"
@@ -843,6 +882,18 @@ aws4@^1.8.0:
   resolved "https://registry.yarnpkg.com/aws4/-/aws4-1.8.0.tgz#f0e003d9ca9e7f59c7a508945d7b2ef9a04a542f"
   integrity sha512-ReZxvNHIOv88FlT7rxcXIIC0fPt4KZqZbOlivyWtXLt8ESx84zd3kMC6iK5jVeS2qt+g7ftS7ye4fi06X5rtRQ==
 
+babel-eslint@^10.0.3:
+  version "10.0.3"
+  resolved "https://registry.yarnpkg.com/babel-eslint/-/babel-eslint-10.0.3.tgz#81a2c669be0f205e19462fed2482d33e4687a88a"
+  integrity sha512-z3U7eMY6r/3f3/JB9mTsLjyxrv0Yb1zb8PCWCLpguxfCzBIZUwy23R1t/XKewP+8mEN2Ck8Dtr4q20z6ce6SoA==
+  dependencies:
+    "@babel/code-frame" "^7.0.0"
+    "@babel/parser" "^7.0.0"
+    "@babel/traverse" "^7.0.0"
+    "@babel/types" "^7.0.0"
+    eslint-visitor-keys "^1.0.0"
+    resolve "^1.12.0"
+
 babel-jest@^24.9.0:
   version "24.9.0"
   resolved "https://registry.yarnpkg.com/babel-jest/-/babel-jest-24.9.0.tgz#3fc327cb8467b89d14d7bc70e315104a783ccd54"
@@ -1740,7 +1791,7 @@ eslint-utils@^1.4.3:
   dependencies:
     eslint-visitor-keys "^1.1.0"
 
-eslint-visitor-keys@^1.1.0:
+eslint-visitor-keys@^1.0.0, eslint-visitor-keys@^1.1.0:
   version "1.1.0"
   resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-1.1.0.tgz#e2a82cea84ff246ad6fb57f9bde5b46621459ec2"
   integrity sha512-8y9YjtM1JBJU/A9Kc+SbaOV4y29sSWckBwMHa+FGtVj5gN/sbnKDf6xJUl+8g7FAij9LVaP8C24DUiH/f/2Z9A==
@@ -4569,7 +4620,7 @@ resolve@1.1.7:
   resolved "https://registry.yarnpkg.com/resolve/-/resolve-1.1.7.tgz#203114d82ad2c5ed9e8e0411b3932875e889e97b"
   integrity sha1-IDEU2CrSxe2ejgQRs5ModeiJ6Xs=
 
-resolve@1.x, resolve@^1.1.6, resolve@^1.10.0, resolve@^1.3.2:
+resolve@1.x, resolve@^1.1.6, resolve@^1.10.0, resolve@^1.12.0, resolve@^1.3.2:
   version "1.12.0"
   resolved "https://registry.yarnpkg.com/resolve/-/resolve-1.12.0.tgz#3fc644a35c84a48554609ff26ec52b66fa577df6"
   integrity sha512-B/dOmuoAik5bKcD6s6nXDCjzUKnaDvdkRyAk6rsmsKLipWj4797iothd7jmmUhWTfinVMU+wc56rYKsit2Qy4w==

From 2e7a9f696b2dd7bed90da409b30b5b14d9e76ad3 Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Fl=C3=A1vio=20Caetano?= <flavio@vieiracaetano.com>
Date: Tue, 1 Oct 2019 16:32:26 -0300
Subject: [PATCH 3/4] docs(README): add ESLint plugin instructions

---
 README.md               | 16 +++++++++++++++-
 eslint-plugin/README.md | 14 +++++++-------
 2 files changed, 22 insertions(+), 8 deletions(-)

diff --git a/README.md b/README.md
index 70ef41d..a7a0da7 100644
--- a/README.md
+++ b/README.md
@@ -169,7 +169,21 @@ A state that only resolves after setting truthy values.
 
 # Typescript
 
-react-hook-utilities sees Typescript is a first-class citizen. The library is built for and around Typescript and you'll get bonus points for using it. Nonetheless, pure JavaScript files are also available if you're _that_ guy.
+**react-hook-utilities** sees Typescript is a first-class citizen. The library is built for and around Typescript and you'll get bonus points for using it. Nonetheless, pure JavaScript files are also available if you're _that_ guy.
+
+# ESLint
+
+If you're using ESLint and don't want to lose your errors and warnings regarding dependencies, **react-hook-utilities** comes packaged with an [ESLint plugin](eslint-plugin/README.md) to lint it's own hooks. It is recommended to install the plugin as a local dependency:
+
+```sh
+$ yarn add -D ./node_modules/react-hook-utilities/eslint-plugin
+```
+
+We recommend you read the [full documentation](eslint-plugin/README.md) on how to use the ESLint plugin
+
+# Documentation
+
+The documentation is available at: https://fjcaetano.github.com/react-hook-utilities
 
 # [Full Documentation](https://fjcaetano.github.com/react-hook-utilities)
 
diff --git a/eslint-plugin/README.md b/eslint-plugin/README.md
index c73482f..a1cea19 100644
--- a/eslint-plugin/README.md
+++ b/eslint-plugin/README.md
@@ -1,22 +1,22 @@
 # @react-hook-utilities/eslint-plugin
 
-ESLint rules for hook utils
+ESLint rules for hook react-hook-utilities
 
 ## Installation
 
-You'll first need to install [ESLint](http://eslint.org):
+You'll first need to install [ESLint](http://eslint.org) and [react-hook-utilities](https://www.npmjs.com/package/react-hook-utilities)
 
 ```
-$ npm i eslint --save-dev
+$ npm i eslint react-hook-utilities --save-dev
 ```
 
-Next, install `@react-hook-utilities/eslint-plugin`:
+Next, install `@react-hook-utilities/eslint-plugin` directly from the host dependency:
 
 ```
-$ npm install @react-hook-utilities/eslint-plugin --save-dev
+$ npm install ./node_modules/react-hook-utilities/eslint-plugin --save-dev
 ```
 
-**Note:** If you installed ESLint globally (using the `-g` flag) then you must also install `@react-hook-utilities/eslint-plugin` globally.
+**Note:** If you installed ESLint globally (using the `-g` flag) then you must also install `react-hook-utilities` globally.
 
 ## Usage
 
@@ -43,7 +43,7 @@ Then configure the rules you want to use under the rules section.
 
 ## Supported Rules
 
-* Fill in provided rules here
+* exhaustive-deps: Ensures all hooks external references have been declared as dependencies.
 
 
 

From b28dfc23d297d6ef05f888fb038d68503a35201e Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Fl=C3=A1vio=20Caetano?= <flavio@vieiracaetano.com>
Date: Tue, 1 Oct 2019 17:17:08 -0300
Subject: [PATCH 4/4] docs(ESLint): gen docs with ESLint plugin reference

---
 .gitignore                |  3 ++-
 package.json              |  5 +++--
 scripts/gen-docs-index.sh |  5 -----
 scripts/gen-docs.sh       | 11 +++++++++++
 tsconfig.json             |  4 +++-
 yarn.lock                 |  5 +++++
 6 files changed, 24 insertions(+), 9 deletions(-)
 delete mode 100755 scripts/gen-docs-index.sh
 create mode 100755 scripts/gen-docs.sh

diff --git a/.gitignore b/.gitignore
index a5107aa..242f43b 100644
--- a/.gitignore
+++ b/.gitignore
@@ -2,4 +2,5 @@ node_modules/
 dist/
 *.log
 coverage/
-docs/
\ No newline at end of file
+docs/
+pageDocs/
\ No newline at end of file
diff --git a/package.json b/package.json
index bd91e4d..2fc0f89 100644
--- a/package.json
+++ b/package.json
@@ -22,7 +22,7 @@
     "build": "tsc && prettier --check 'dist/**/*' --write",
     "test": "jest --coverage",
     "lint": "eslint --ext=.ts,.tsx --max-warnings=0 src/ && prettier --check 'src/**/*'",
-    "docs": "typedoc --out docs/$npm_package_version && scripts/gen-docs-index.sh $npm_package_version",
+    "docs": "scripts/gen-docs.sh $npm_package_version",
     "version": "conventional-changelog -p angular -i CHANGELOG.md -s && git add CHANGELOG.md"
   },
   "main": "dist/index.js",
@@ -54,6 +54,7 @@
     "react-test-renderer": "^16.9.0",
     "ts-jest": "^24.1.0",
     "typedoc": "^0.16.9",
-    "typescript": "^3.7"
+    "typescript": "^3.7",
+    "typedoc-plugin-markdown-pages": "^0.3.0"
   }
 }
diff --git a/scripts/gen-docs-index.sh b/scripts/gen-docs-index.sh
deleted file mode 100755
index 6c643e2..0000000
--- a/scripts/gen-docs-index.sh
+++ /dev/null
@@ -1,5 +0,0 @@
-#!/bin/sh
-
-PKG_VERSION=$1
-
-echo "<meta http-equiv='refresh' content='0; URL=\"${PKG_VERSION}/index.html\"' />;" > docs/index.html
\ No newline at end of file
diff --git a/scripts/gen-docs.sh b/scripts/gen-docs.sh
new file mode 100755
index 0000000..7786187
--- /dev/null
+++ b/scripts/gen-docs.sh
@@ -0,0 +1,11 @@
+#!/bin/sh
+
+PKG_VERSION=$1
+
+mkdir pageDocs && ln -sf ../eslint-plugin/README.md pageDocs/EslintPlugin.md
+
+yarn run typedoc --out "docs/${PKG_VERSION}"
+
+echo "<meta http-equiv='refresh' content='0; URL=\"${PKG_VERSION}/index.html\"' />;" > docs/index.html
+
+rm -rf pageDocs
\ No newline at end of file
diff --git a/tsconfig.json b/tsconfig.json
index cdbdbeb..fce9ac4 100644
--- a/tsconfig.json
+++ b/tsconfig.json
@@ -12,6 +12,8 @@
   },
   "typedocOptions": {
     "exclude": "src/__tests__/**/*",
-    "out": "docs"
+    "out": "docs",
+    "mdPagesSourcePath": "pageDocs",
+    "theme": "markdown-pages"
   }
 }
diff --git a/yarn.lock b/yarn.lock
index 2e324c2..6a26720 100644
--- a/yarn.lock
+++ b/yarn.lock
@@ -5371,6 +5371,11 @@ typedoc-default-themes@^0.7.2:
     lunr "^2.3.8"
     underscore "^1.9.1"
 
+typedoc-plugin-markdown-pages@^0.3.0:
+  version "0.3.0"
+  resolved "https://registry.yarnpkg.com/typedoc-plugin-markdown-pages/-/typedoc-plugin-markdown-pages-0.3.0.tgz#17f0f9ff3aa312e9ed142eb15ea216ea95d5fb5f"
+  integrity sha512-QVWs6eL0BEOiRgJm6wRRgE8kESFv85HlefLv14ZbMM2VQ1HqErVeT9ukbhkYMznsD/juAsX3Xc5M+Ju7/ZDq4Q==
+
 typedoc@^0.16.9:
   version "0.16.9"
   resolved "https://registry.yarnpkg.com/typedoc/-/typedoc-0.16.9.tgz#d6f46f4dea7d3362029927a92981efdf896f435b"