diff --git a/.jshintrc b/.jshintrc index 833091d..6ce7020 100644 --- a/.jshintrc +++ b/.jshintrc @@ -1,4 +1,5 @@ -{ +{ + "esversion":6, "curly": true, "eqeqeq": true, "nocomma": true, diff --git a/.travis.yml b/.travis.yml new file mode 100644 index 0000000..2a355c3 --- /dev/null +++ b/.travis.yml @@ -0,0 +1,8 @@ +language: node_js + +node_js: + - 7 + +script: + - node_modules/.bin/jshint src + - npm test diff --git a/node_modules/.bin/_mocha b/node_modules/.bin/_mocha new file mode 120000 index 0000000..f2a54ff --- /dev/null +++ b/node_modules/.bin/_mocha @@ -0,0 +1 @@ +../mocha/bin/_mocha \ No newline at end of file diff --git a/node_modules/.bin/he b/node_modules/.bin/he new file mode 120000 index 0000000..2a8eb5e --- /dev/null +++ b/node_modules/.bin/he @@ -0,0 +1 @@ +../he/bin/he \ No newline at end of file diff --git a/node_modules/.bin/is-ci b/node_modules/.bin/is-ci new file mode 120000 index 0000000..fe6aca6 --- /dev/null +++ b/node_modules/.bin/is-ci @@ -0,0 +1 @@ +../is-ci/bin.js \ No newline at end of file diff --git a/node_modules/.bin/jshint b/node_modules/.bin/jshint new file mode 120000 index 0000000..1b5b30c --- /dev/null +++ b/node_modules/.bin/jshint @@ -0,0 +1 @@ +../jshint/bin/jshint \ No newline at end of file diff --git a/node_modules/.bin/mkdirp b/node_modules/.bin/mkdirp new file mode 120000 index 0000000..017896c --- /dev/null +++ b/node_modules/.bin/mkdirp @@ -0,0 +1 @@ +../mkdirp/bin/cmd.js \ No newline at end of file diff --git a/node_modules/.bin/mocha b/node_modules/.bin/mocha new file mode 120000 index 0000000..43c668d --- /dev/null +++ b/node_modules/.bin/mocha @@ -0,0 +1 @@ +../mocha/bin/mocha \ No newline at end of file diff --git a/node_modules/.bin/shjs b/node_modules/.bin/shjs new file mode 120000 index 0000000..a044997 --- /dev/null +++ b/node_modules/.bin/shjs @@ -0,0 +1 @@ +../shelljs/bin/shjs \ No newline at end of file diff --git a/node_modules/.bin/strip-json-comments b/node_modules/.bin/strip-json-comments new file mode 120000 index 0000000..63d549f --- /dev/null +++ b/node_modules/.bin/strip-json-comments @@ -0,0 +1 @@ +../strip-json-comments/cli.js \ No newline at end of file diff --git a/node_modules/balanced-match/.npmignore b/node_modules/balanced-match/.npmignore new file mode 100644 index 0000000..ae5d8c3 --- /dev/null +++ b/node_modules/balanced-match/.npmignore @@ -0,0 +1,5 @@ +test +.gitignore +.travis.yml +Makefile +example.js diff --git a/node_modules/balanced-match/LICENSE.md b/node_modules/balanced-match/LICENSE.md new file mode 100644 index 0000000..2cdc8e4 --- /dev/null +++ b/node_modules/balanced-match/LICENSE.md @@ -0,0 +1,21 @@ +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/balanced-match/README.md b/node_modules/balanced-match/README.md new file mode 100644 index 0000000..08e918c --- /dev/null +++ b/node_modules/balanced-match/README.md @@ -0,0 +1,91 @@ +# balanced-match + +Match balanced string pairs, like `{` and `}` or `` and ``. Supports regular expressions as well! + +[![build status](https://secure.travis-ci.org/juliangruber/balanced-match.svg)](http://travis-ci.org/juliangruber/balanced-match) +[![downloads](https://img.shields.io/npm/dm/balanced-match.svg)](https://www.npmjs.org/package/balanced-match) + +[![testling badge](https://ci.testling.com/juliangruber/balanced-match.png)](https://ci.testling.com/juliangruber/balanced-match) + +## Example + +Get the first matching pair of braces: + +```js +var balanced = require('balanced-match'); + +console.log(balanced('{', '}', 'pre{in{nested}}post')); +console.log(balanced('{', '}', 'pre{first}between{second}post')); +console.log(balanced(/\s+\{\s+/, /\s+\}\s+/, 'pre { in{nest} } post')); +``` + +The matches are: + +```bash +$ node example.js +{ start: 3, end: 14, pre: 'pre', body: 'in{nested}', post: 'post' } +{ start: 3, + end: 9, + pre: 'pre', + body: 'first', + post: 'between{second}post' } +{ start: 3, end: 17, pre: 'pre', body: 'in{nest}', post: 'post' } +``` + +## API + +### var m = balanced(a, b, str) + +For the first non-nested matching pair of `a` and `b` in `str`, return an +object with those keys: + +* **start** the index of the first match of `a` +* **end** the index of the matching `b` +* **pre** the preamble, `a` and `b` not included +* **body** the match, `a` and `b` not included +* **post** the postscript, `a` and `b` not included + +If there's no match, `undefined` will be returned. + +If the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `['{', 'a', '']` and `{a}}` will match `['', 'a', '}']`. + +### var r = balanced.range(a, b, str) + +For the first non-nested matching pair of `a` and `b` in `str`, return an +array with indexes: `[ , ]`. + +If there's no match, `undefined` will be returned. + +If the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `[ 1, 3 ]` and `{a}}` will match `[0, 2]`. + +## Installation + +With [npm](https://npmjs.org) do: + +```bash +npm install balanced-match +``` + +## License + +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/balanced-match/index.js b/node_modules/balanced-match/index.js new file mode 100644 index 0000000..1685a76 --- /dev/null +++ b/node_modules/balanced-match/index.js @@ -0,0 +1,59 @@ +'use strict'; +module.exports = balanced; +function balanced(a, b, str) { + if (a instanceof RegExp) a = maybeMatch(a, str); + if (b instanceof RegExp) b = maybeMatch(b, str); + + var r = range(a, b, str); + + return r && { + start: r[0], + end: r[1], + pre: str.slice(0, r[0]), + body: str.slice(r[0] + a.length, r[1]), + post: str.slice(r[1] + b.length) + }; +} + +function maybeMatch(reg, str) { + var m = str.match(reg); + return m ? m[0] : null; +} + +balanced.range = range; +function range(a, b, str) { + var begs, beg, left, right, result; + var ai = str.indexOf(a); + var bi = str.indexOf(b, ai + 1); + var i = ai; + + if (ai >= 0 && bi > 0) { + begs = []; + left = str.length; + + while (i >= 0 && !result) { + if (i == ai) { + begs.push(i); + ai = str.indexOf(a, i + 1); + } else if (begs.length == 1) { + result = [ begs.pop(), bi ]; + } else { + beg = begs.pop(); + if (beg < left) { + left = beg; + right = bi; + } + + bi = str.indexOf(b, i + 1); + } + + i = ai < bi && ai >= 0 ? ai : bi; + } + + if (begs.length) { + result = [ left, right ]; + } + } + + return result; +} diff --git a/node_modules/balanced-match/package.json b/node_modules/balanced-match/package.json new file mode 100644 index 0000000..8fc8f8a --- /dev/null +++ b/node_modules/balanced-match/package.json @@ -0,0 +1,104 @@ +{ + "_args": [ + [ + "balanced-match@^1.0.0", + "/home/licence/helayelq/Integration/my-test-project/node_modules/brace-expansion" + ] + ], + "_from": "balanced-match@>=1.0.0 <2.0.0", + "_id": "balanced-match@1.0.0", + "_inCache": true, + "_installable": true, + "_location": "/balanced-match", + "_nodeVersion": "7.8.0", + "_npmOperationalInternal": { + "host": "s3://npm-registry-packages", + "tmp": "tmp/balanced-match-1.0.0.tgz_1497251909645_0.8755026108119637" + }, + "_npmUser": { + "email": "julian@juliangruber.com", + "name": "juliangruber" + }, + "_npmVersion": "4.2.0", + "_phantomChildren": {}, + "_requested": { + "name": "balanced-match", + "raw": "balanced-match@^1.0.0", + "rawSpec": "^1.0.0", + "scope": null, + "spec": ">=1.0.0 <2.0.0", + "type": "range" + }, + "_requiredBy": [ + "/brace-expansion" + ], + "_resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.0.tgz", + "_shasum": "89b4d199ab2bee49de164ea02b89ce462d71b767", + "_shrinkwrap": null, + "_spec": "balanced-match@^1.0.0", + "_where": "/home/licence/helayelq/Integration/my-test-project/node_modules/brace-expansion", + "author": { + "email": "mail@juliangruber.com", + "name": "Julian Gruber", + "url": "http://juliangruber.com" + }, + "bugs": { + "url": "https://github.com/juliangruber/balanced-match/issues" + }, + "dependencies": {}, + "description": "Match balanced character pairs, like \"{\" and \"}\"", + "devDependencies": { + "matcha": "^0.7.0", + "tape": "^4.6.0" + }, + "directories": {}, + "dist": { + "shasum": "89b4d199ab2bee49de164ea02b89ce462d71b767", + "tarball": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.0.tgz" + }, + "gitHead": "d701a549a7653a874eebce7eca25d3577dc868ac", + "homepage": "https://github.com/juliangruber/balanced-match", + "keywords": [ + "balanced", + "match", + "parse", + "regexp", + "test" + ], + "license": "MIT", + "main": "index.js", + "maintainers": [ + { + "name": "juliangruber", + "email": "julian@juliangruber.com" + } + ], + "name": "balanced-match", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/juliangruber/balanced-match.git" + }, + "scripts": { + "bench": "make bench", + "test": "make test" + }, + "testling": { + "browsers": [ + "android-browser/4.2..latest", + "chrome/25..latest", + "chrome/canary", + "firefox/20..latest", + "firefox/nightly", + "ie/8..latest", + "ipad/6.0..latest", + "iphone/6.0..latest", + "opera/12..latest", + "opera/next", + "safari/5.1..latest" + ], + "files": "test/*.js" + }, + "version": "1.0.0" +} diff --git a/node_modules/brace-expansion/LICENSE b/node_modules/brace-expansion/LICENSE new file mode 100644 index 0000000..de32266 --- /dev/null +++ b/node_modules/brace-expansion/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2013 Julian Gruber + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/brace-expansion/README.md b/node_modules/brace-expansion/README.md new file mode 100644 index 0000000..6b4e0e1 --- /dev/null +++ b/node_modules/brace-expansion/README.md @@ -0,0 +1,129 @@ +# brace-expansion + +[Brace expansion](https://www.gnu.org/software/bash/manual/html_node/Brace-Expansion.html), +as known from sh/bash, in JavaScript. + +[![build status](https://secure.travis-ci.org/juliangruber/brace-expansion.svg)](http://travis-ci.org/juliangruber/brace-expansion) +[![downloads](https://img.shields.io/npm/dm/brace-expansion.svg)](https://www.npmjs.org/package/brace-expansion) +[![Greenkeeper badge](https://badges.greenkeeper.io/juliangruber/brace-expansion.svg)](https://greenkeeper.io/) + +[![testling badge](https://ci.testling.com/juliangruber/brace-expansion.png)](https://ci.testling.com/juliangruber/brace-expansion) + +## Example + +```js +var expand = require('brace-expansion'); + +expand('file-{a,b,c}.jpg') +// => ['file-a.jpg', 'file-b.jpg', 'file-c.jpg'] + +expand('-v{,,}') +// => ['-v', '-v', '-v'] + +expand('file{0..2}.jpg') +// => ['file0.jpg', 'file1.jpg', 'file2.jpg'] + +expand('file-{a..c}.jpg') +// => ['file-a.jpg', 'file-b.jpg', 'file-c.jpg'] + +expand('file{2..0}.jpg') +// => ['file2.jpg', 'file1.jpg', 'file0.jpg'] + +expand('file{0..4..2}.jpg') +// => ['file0.jpg', 'file2.jpg', 'file4.jpg'] + +expand('file-{a..e..2}.jpg') +// => ['file-a.jpg', 'file-c.jpg', 'file-e.jpg'] + +expand('file{00..10..5}.jpg') +// => ['file00.jpg', 'file05.jpg', 'file10.jpg'] + +expand('{{A..C},{a..c}}') +// => ['A', 'B', 'C', 'a', 'b', 'c'] + +expand('ppp{,config,oe{,conf}}') +// => ['ppp', 'pppconfig', 'pppoe', 'pppoeconf'] +``` + +## API + +```js +var expand = require('brace-expansion'); +``` + +### var expanded = expand(str) + +Return an array of all possible and valid expansions of `str`. If none are +found, `[str]` is returned. + +Valid expansions are: + +```js +/^(.*,)+(.+)?$/ +// {a,b,...} +``` + +A comma separated list of options, like `{a,b}` or `{a,{b,c}}` or `{,a,}`. + +```js +/^-?\d+\.\.-?\d+(\.\.-?\d+)?$/ +// {x..y[..incr]} +``` + +A numeric sequence from `x` to `y` inclusive, with optional increment. +If `x` or `y` start with a leading `0`, all the numbers will be padded +to have equal length. Negative numbers and backwards iteration work too. + +```js +/^-?\d+\.\.-?\d+(\.\.-?\d+)?$/ +// {x..y[..incr]} +``` + +An alphabetic sequence from `x` to `y` inclusive, with optional increment. +`x` and `y` must be exactly one character, and if given, `incr` must be a +number. + +For compatibility reasons, the string `${` is not eligible for brace expansion. + +## Installation + +With [npm](https://npmjs.org) do: + +```bash +npm install brace-expansion +``` + +## Contributors + +- [Julian Gruber](https://github.com/juliangruber) +- [Isaac Z. Schlueter](https://github.com/isaacs) + +## Sponsors + +This module is proudly supported by my [Sponsors](https://github.com/juliangruber/sponsors)! + +Do you want to support modules like this to improve their quality, stability and weigh in on new features? Then please consider donating to my [Patreon](https://www.patreon.com/juliangruber). Not sure how much of my modules you're using? Try [feross/thanks](https://github.com/feross/thanks)! + +## License + +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/brace-expansion/index.js b/node_modules/brace-expansion/index.js new file mode 100644 index 0000000..0478be8 --- /dev/null +++ b/node_modules/brace-expansion/index.js @@ -0,0 +1,201 @@ +var concatMap = require('concat-map'); +var balanced = require('balanced-match'); + +module.exports = expandTop; + +var escSlash = '\0SLASH'+Math.random()+'\0'; +var escOpen = '\0OPEN'+Math.random()+'\0'; +var escClose = '\0CLOSE'+Math.random()+'\0'; +var escComma = '\0COMMA'+Math.random()+'\0'; +var escPeriod = '\0PERIOD'+Math.random()+'\0'; + +function numeric(str) { + return parseInt(str, 10) == str + ? parseInt(str, 10) + : str.charCodeAt(0); +} + +function escapeBraces(str) { + return str.split('\\\\').join(escSlash) + .split('\\{').join(escOpen) + .split('\\}').join(escClose) + .split('\\,').join(escComma) + .split('\\.').join(escPeriod); +} + +function unescapeBraces(str) { + return str.split(escSlash).join('\\') + .split(escOpen).join('{') + .split(escClose).join('}') + .split(escComma).join(',') + .split(escPeriod).join('.'); +} + + +// Basically just str.split(","), but handling cases +// where we have nested braced sections, which should be +// treated as individual members, like {a,{b,c},d} +function parseCommaParts(str) { + if (!str) + return ['']; + + var parts = []; + var m = balanced('{', '}', str); + + if (!m) + return str.split(','); + + var pre = m.pre; + var body = m.body; + var post = m.post; + var p = pre.split(','); + + p[p.length-1] += '{' + body + '}'; + var postParts = parseCommaParts(post); + if (post.length) { + p[p.length-1] += postParts.shift(); + p.push.apply(p, postParts); + } + + parts.push.apply(parts, p); + + return parts; +} + +function expandTop(str) { + if (!str) + return []; + + // I don't know why Bash 4.3 does this, but it does. + // Anything starting with {} will have the first two bytes preserved + // but *only* at the top level, so {},a}b will not expand to anything, + // but a{},b}c will be expanded to [a}c,abc]. + // One could argue that this is a bug in Bash, but since the goal of + // this module is to match Bash's rules, we escape a leading {} + if (str.substr(0, 2) === '{}') { + str = '\\{\\}' + str.substr(2); + } + + return expand(escapeBraces(str), true).map(unescapeBraces); +} + +function identity(e) { + return e; +} + +function embrace(str) { + return '{' + str + '}'; +} +function isPadded(el) { + return /^-?0\d/.test(el); +} + +function lte(i, y) { + return i <= y; +} +function gte(i, y) { + return i >= y; +} + +function expand(str, isTop) { + var expansions = []; + + var m = balanced('{', '}', str); + if (!m || /\$$/.test(m.pre)) return [str]; + + var isNumericSequence = /^-?\d+\.\.-?\d+(?:\.\.-?\d+)?$/.test(m.body); + var isAlphaSequence = /^[a-zA-Z]\.\.[a-zA-Z](?:\.\.-?\d+)?$/.test(m.body); + var isSequence = isNumericSequence || isAlphaSequence; + var isOptions = m.body.indexOf(',') >= 0; + if (!isSequence && !isOptions) { + // {a},b} + if (m.post.match(/,.*\}/)) { + str = m.pre + '{' + m.body + escClose + m.post; + return expand(str); + } + return [str]; + } + + var n; + if (isSequence) { + n = m.body.split(/\.\./); + } else { + n = parseCommaParts(m.body); + if (n.length === 1) { + // x{{a,b}}y ==> x{a}y x{b}y + n = expand(n[0], false).map(embrace); + if (n.length === 1) { + var post = m.post.length + ? expand(m.post, false) + : ['']; + return post.map(function(p) { + return m.pre + n[0] + p; + }); + } + } + } + + // at this point, n is the parts, and we know it's not a comma set + // with a single entry. + + // no need to expand pre, since it is guaranteed to be free of brace-sets + var pre = m.pre; + var post = m.post.length + ? expand(m.post, false) + : ['']; + + var N; + + if (isSequence) { + var x = numeric(n[0]); + var y = numeric(n[1]); + var width = Math.max(n[0].length, n[1].length) + var incr = n.length == 3 + ? Math.abs(numeric(n[2])) + : 1; + var test = lte; + var reverse = y < x; + if (reverse) { + incr *= -1; + test = gte; + } + var pad = n.some(isPadded); + + N = []; + + for (var i = x; test(i, y); i += incr) { + var c; + if (isAlphaSequence) { + c = String.fromCharCode(i); + if (c === '\\') + c = ''; + } else { + c = String(i); + if (pad) { + var need = width - c.length; + if (need > 0) { + var z = new Array(need + 1).join('0'); + if (i < 0) + c = '-' + z + c.slice(1); + else + c = z + c; + } + } + } + N.push(c); + } + } else { + N = concatMap(n, function(el) { return expand(el, false) }); + } + + for (var j = 0; j < N.length; j++) { + for (var k = 0; k < post.length; k++) { + var expansion = pre + N[j] + post[k]; + if (!isTop || isSequence || expansion) + expansions.push(expansion); + } + } + + return expansions; +} + diff --git a/node_modules/brace-expansion/package.json b/node_modules/brace-expansion/package.json new file mode 100644 index 0000000..76ed67f --- /dev/null +++ b/node_modules/brace-expansion/package.json @@ -0,0 +1,109 @@ +{ + "_args": [ + [ + "brace-expansion@^1.1.7", + "/home/licence/helayelq/Integration/my-test-project/node_modules/minimatch" + ] + ], + "_from": "brace-expansion@>=1.1.7 <2.0.0", + "_id": "brace-expansion@1.1.11", + "_inCache": true, + "_installable": true, + "_location": "/brace-expansion", + "_nodeVersion": "9.0.0", + "_npmOperationalInternal": { + "host": "s3://npm-registry-packages", + "tmp": "tmp/brace-expansion_1.1.11_1518248541320_0.33962849281003904" + }, + "_npmUser": { + "email": "julian@juliangruber.com", + "name": "juliangruber" + }, + "_npmVersion": "5.5.1", + "_phantomChildren": {}, + "_requested": { + "name": "brace-expansion", + "raw": "brace-expansion@^1.1.7", + "rawSpec": "^1.1.7", + "scope": null, + "spec": ">=1.1.7 <2.0.0", + "type": "range" + }, + "_requiredBy": [ + "/minimatch" + ], + "_resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", + "_shasum": "3c7fcbf529d87226f3d2f52b966ff5271eb441dd", + "_shrinkwrap": null, + "_spec": "brace-expansion@^1.1.7", + "_where": "/home/licence/helayelq/Integration/my-test-project/node_modules/minimatch", + "author": { + "email": "mail@juliangruber.com", + "name": "Julian Gruber", + "url": "http://juliangruber.com" + }, + "bugs": { + "url": "https://github.com/juliangruber/brace-expansion/issues" + }, + "dependencies": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + }, + "description": "Brace expansion as known from sh/bash", + "devDependencies": { + "matcha": "^0.7.0", + "tape": "^4.6.0" + }, + "directories": {}, + "dist": { + "fileCount": 4, + "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", + "shasum": "3c7fcbf529d87226f3d2f52b966ff5271eb441dd", + "tarball": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", + "unpackedSize": 11059 + }, + "gitHead": "01a21de7441549d26ac0c0a9ff91385d16e5c21c", + "homepage": "https://github.com/juliangruber/brace-expansion", + "keywords": [], + "license": "MIT", + "main": "index.js", + "maintainers": [ + { + "name": "isaacs", + "email": "isaacs@npmjs.com" + }, + { + "name": "juliangruber", + "email": "julian@juliangruber.com" + } + ], + "name": "brace-expansion", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/juliangruber/brace-expansion.git" + }, + "scripts": { + "bench": "matcha test/perf/bench.js", + "gentest": "bash test/generate.sh", + "test": "tape test/*.js" + }, + "testling": { + "browsers": [ + "android-browser/4.2..latest", + "chrome/25..latest", + "chrome/canary", + "firefox/20..latest", + "firefox/nightly", + "ie/8..latest", + "ipad/6.0..latest", + "iphone/6.0..latest", + "opera/12..latest", + "opera/next", + "safari/5.1..latest" + ], + "files": "test/*.js" + }, + "version": "1.1.11" +} diff --git a/node_modules/browser-stdout/LICENSE b/node_modules/browser-stdout/LICENSE new file mode 100644 index 0000000..775f6ce --- /dev/null +++ b/node_modules/browser-stdout/LICENSE @@ -0,0 +1,5 @@ +Copyright 2018 kumavis + +Permission to use, copy, modify, and/or distribute this software for any purpose with or without fee is hereby granted, provided that the above copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/browser-stdout/README.md b/node_modules/browser-stdout/README.md new file mode 100644 index 0000000..f32028a --- /dev/null +++ b/node_modules/browser-stdout/README.md @@ -0,0 +1,40 @@ +### wat? + +`process.stdout` in your browser. + +### wai? + +iono. cuz hakz. + +### hau? + +```js +var BrowserStdout = require('browser-stdout') + +myStream.pipe(BrowserStdout()) +``` + +### monkey + +You can monkey-patch `process.stdout` for your dependency graph like this: + +``` +process.stdout = require('browser-stdout')() +var coolTool = require('module-that-uses-stdout-somewhere-in-its-depths') +``` + +### opts + +opts are passed directly to `stream.Writable`. +additionally, a label arg can be used to label console output. + +```js +BrowserStdout({ + objectMode: true, + label: 'dataz', +}) +``` + +### ur doin it rong + +i accept pr's. \ No newline at end of file diff --git a/node_modules/browser-stdout/index.js b/node_modules/browser-stdout/index.js new file mode 100644 index 0000000..daf39c3 --- /dev/null +++ b/node_modules/browser-stdout/index.js @@ -0,0 +1,25 @@ +var WritableStream = require('stream').Writable +var inherits = require('util').inherits + +module.exports = BrowserStdout + + +inherits(BrowserStdout, WritableStream) + +function BrowserStdout(opts) { + if (!(this instanceof BrowserStdout)) return new BrowserStdout(opts) + + opts = opts || {} + WritableStream.call(this, opts) + this.label = (opts.label !== undefined) ? opts.label : 'stdout' +} + +BrowserStdout.prototype._write = function(chunks, encoding, cb) { + var output = chunks.toString ? chunks.toString() : chunks + if (this.label === false) { + console.log(output) + } else { + console.log(this.label+':', output) + } + process.nextTick(cb) +} diff --git a/node_modules/browser-stdout/package.json b/node_modules/browser-stdout/package.json new file mode 100644 index 0000000..628c460 --- /dev/null +++ b/node_modules/browser-stdout/package.json @@ -0,0 +1,78 @@ +{ + "_args": [ + [ + "browser-stdout@1.3.1", + "/home/licence/helayelq/Integration/my-test-project/node_modules/mocha" + ] + ], + "_from": "browser-stdout@1.3.1", + "_id": "browser-stdout@1.3.1", + "_inCache": true, + "_installable": true, + "_location": "/browser-stdout", + "_nodeVersion": "8.9.4", + "_npmOperationalInternal": { + "host": "s3://npm-registry-packages", + "tmp": "tmp/browser-stdout_1.3.1_1519752553651_0.36076610141818133" + }, + "_npmUser": { + "email": "aaron@kumavis.me", + "name": "kumavis" + }, + "_npmVersion": "5.6.0", + "_phantomChildren": {}, + "_requested": { + "name": "browser-stdout", + "raw": "browser-stdout@1.3.1", + "rawSpec": "1.3.1", + "scope": null, + "spec": "1.3.1", + "type": "version" + }, + "_requiredBy": [ + "/mocha" + ], + "_resolved": "https://registry.npmjs.org/browser-stdout/-/browser-stdout-1.3.1.tgz", + "_shasum": "baa559ee14ced73452229bad7326467c61fabd60", + "_shrinkwrap": null, + "_spec": "browser-stdout@1.3.1", + "_where": "/home/licence/helayelq/Integration/my-test-project/node_modules/mocha", + "author": { + "name": "kumavis" + }, + "bugs": { + "url": "https://github.com/kumavis/browser-stdout/issues" + }, + "dependencies": {}, + "description": "`process.stdout` in your browser.", + "devDependencies": {}, + "directories": {}, + "dist": { + "fileCount": 4, + "integrity": "sha512-qhAVI1+Av2X7qelOfAIYwXONood6XlZE/fXaBSmW/T5SzLAmCgzi+eiWE7fUvbHaeNBQH13UftjpXxsfLkMpgw==", + "shasum": "baa559ee14ced73452229bad7326467c61fabd60", + "tarball": "https://registry.npmjs.org/browser-stdout/-/browser-stdout-1.3.1.tgz", + "unpackedSize": 2298 + }, + "gitHead": "456b7f33c2d535fc88cf732d1a0e2d48a7600a1b", + "homepage": "https://github.com/kumavis/browser-stdout#readme", + "license": "ISC", + "main": "index.js", + "maintainers": [ + { + "name": "kumavis", + "email": "aaron@kumavis.me" + } + ], + "name": "browser-stdout", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+ssh://git@github.com/kumavis/browser-stdout.git" + }, + "scripts": { + "test": "echo \"Error: no test specified\" && exit 1" + }, + "version": "1.3.1" +} diff --git a/node_modules/ci-info/CHANGELOG.md b/node_modules/ci-info/CHANGELOG.md new file mode 100644 index 0000000..859a0ad --- /dev/null +++ b/node_modules/ci-info/CHANGELOG.md @@ -0,0 +1,62 @@ +# Changelog + +## v1.6.0 + +* feat: add Sail CI support +* feat: add Buddy support +* feat: add Bitrise support +* feat: detect Jenkins PRs +* feat: detect Drone PRs + +## v1.5.1 + +* fix: use full path to vendors.json + +## v1.5.0 + +* feat: add dsari detection ([#15](https://github.com/watson/ci-info/pull/15)) +* feat: add ci.isPR ([#16](https://github.com/watson/ci-info/pull/16)) + +## v1.4.0 + +* feat: add Cirrus CI detection ([#13](https://github.com/watson/ci-info/pull/13)) +* feat: add Shippable CI detection ([#14](https://github.com/watson/ci-info/pull/14)) + +## v1.3.1 + +* chore: reduce npm package size by not including `.github` folder content ([#11](https://github.com/watson/ci-info/pull/11)) + +## v1.3.0 + +* feat: add support for Strider CD +* chore: deprecate vendor constant `TDDIUM` in favor of `SOLANO` +* docs: add missing vendor constant to docs + +## v1.2.0 + +* feat: detect solano-ci ([#9](https://github.com/watson/ci-info/pull/9)) + +## v1.1.3 + +* fix: fix spelling of Hunson in `ci.name` + +## v1.1.2 + +* fix: no more false positive matches for Jenkins + +## v1.1.1 + +* docs: sort lists of CI servers in README.md +* docs: add missing AWS CodeBuild to the docs + +## v1.1.0 + +* feat: add AWS CodeBuild to CI detection ([#2](https://github.com/watson/ci-info/pull/2)) + +## v1.0.1 + +* chore: reduce npm package size by using an `.npmignore` file ([#3](https://github.com/watson/ci-info/pull/3)) + +## v1.0.0 + +* Initial release diff --git a/node_modules/ci-info/LICENSE b/node_modules/ci-info/LICENSE new file mode 100644 index 0000000..6784683 --- /dev/null +++ b/node_modules/ci-info/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016-2018 Thomas Watson Steen + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/ci-info/README.md b/node_modules/ci-info/README.md new file mode 100644 index 0000000..c88be8f --- /dev/null +++ b/node_modules/ci-info/README.md @@ -0,0 +1,107 @@ +# ci-info + +Get details about the current Continuous Integration environment. + +Please [open an +issue](https://github.com/watson/ci-info/issues/new?template=ci-server-not-detected.md) +if your CI server isn't properly detected :) + +[![npm](https://img.shields.io/npm/v/ci-info.svg)](https://www.npmjs.com/package/ci-info) +[![Build status](https://travis-ci.org/watson/ci-info.svg?branch=master)](https://travis-ci.org/watson/ci-info) +[![js-standard-style](https://img.shields.io/badge/code%20style-standard-brightgreen.svg?style=flat)](https://github.com/feross/standard) + +## Installation + +```bash +npm install ci-info --save +``` + +## Usage + +```js +var ci = require('ci-info') + +if (ci.isCI) { + console.log('The name of the CI server is:', ci.name) +} else { + console.log('This program is not running on a CI server') +} +``` + +## Supported CI tools + +Officially supported CI servers: + +| Name | Constant | +|------|----------| +| [AWS CodeBuild](https://aws.amazon.com/codebuild/) | `ci.CODEBUILD` | +| [AppVeyor](http://www.appveyor.com) | `ci.APPVEYOR` | +| [Bamboo](https://www.atlassian.com/software/bamboo) by Atlassian | `ci.BAMBOO` | +| [Bitbucket Pipelines](https://bitbucket.org/product/features/pipelines) | `ci.BITBUCKET` | +| [Bitrise](https://www.bitrise.io/) | `ci.BITRISE` | +| [Buddy](https://buddy.works/) | `ci.BUDDY` | +| [Buildkite](https://buildkite.com) | `ci.BUILDKITE` | +| [CircleCI](http://circleci.com) | `ci.CIRCLE` | +| [Cirrus CI](https://cirrus-ci.org) | `ci.CIRRUS` | +| [Codeship](https://codeship.com) | `ci.CODESHIP` | +| [Drone](https://drone.io) | `ci.DRONE` | +| [dsari](https://github.com/rfinnie/dsari) | `ci.DSARI` | +| [GitLab CI](https://about.gitlab.com/gitlab-ci/) | `ci.GITLAB` | +| [GoCD](https://www.go.cd/) | `ci.GOCD` | +| [Hudson](http://hudson-ci.org) | `ci.HUDSON` | +| [Jenkins CI](https://jenkins-ci.org) | `ci.JENKINS` | +| [Magnum CI](https://magnum-ci.com) | `ci.MAGNUM` | +| [Sail CI](https://sail.ci/) | `ci.SAIL` | +| [Semaphore](https://semaphoreci.com) | `ci.SEMAPHORE` | +| [Shippable](https://www.shippable.com/) | `ci.SHIPPABLE` | +| [Solano CI](https://www.solanolabs.com/) | `ci.SOLANO` | +| [Strider CD](https://strider-cd.github.io/) | `ci.STRIDER` | +| [TaskCluster](http://docs.taskcluster.net) | `ci.TASKCLUSTER` | +| [Team Foundation Server](https://www.visualstudio.com/en-us/products/tfs-overview-vs.aspx) by Microsoft | `ci.TFS` | +| [TeamCity](https://www.jetbrains.com/teamcity/) by JetBrains | `ci.TEAMCITY` | +| [Travis CI](http://travis-ci.org) | `ci.TRAVIS` | + +## API + +### `ci.name` + +A string. Will contain the name of the CI server the code is running on. +If not CI server is detected, it will be `null`. + +Don't depend on the value of this string not to change for a specific +vendor. If you find your self writing `ci.name === 'Travis CI'`, you +most likely want to use `ci.TRAVIS` instead. + +### `ci.isCI` + +A boolean. Will be `true` if the code is running on a CI server. +Otherwise `false`. + +Some CI servers not listed here might still trigger the `ci.isCI` +boolean to be set to `true` if they use certain vendor neutral +environment variables. In those cases `ci.name` will be `null` and no +vendor specific boolean will be set to `true`. + +### `ci.isPR` + +A boolean if PR detection is supported for the current CI server. Will +be `true` if a PR is being tested. Otherwise `false`. If PR detection is +not supported for the current CI server, the value will be `null`. + +### `ci.` + +A vendor specific boolean constants is exposed for each support CI +vendor. A constant will be `true` if the code is determined to run on +the given CI server. Otherwise `false`. + +Examples of vendor constants are `ci.TRAVIS` or `ci.APPVEYOR`. For a +complete list, see the support table above. + +Deprecated vendor constants that will be removed in the next major +release: + +- `ci.TDDIUM` (Solano CI) This have been renamed `ci.SOLANO` + +## License + +[MIT](LICENSE) diff --git a/node_modules/ci-info/index.js b/node_modules/ci-info/index.js new file mode 100644 index 0000000..27794d4 --- /dev/null +++ b/node_modules/ci-info/index.js @@ -0,0 +1,66 @@ +'use strict' + +var vendors = require('./vendors.json') + +var env = process.env + +// Used for testinging only +Object.defineProperty(exports, '_vendors', { + value: vendors.map(function (v) { return v.constant }) +}) + +exports.name = null +exports.isPR = null + +vendors.forEach(function (vendor) { + var envs = Array.isArray(vendor.env) ? vendor.env : [vendor.env] + var isCI = envs.every(function (obj) { + return checkEnv(obj) + }) + + exports[vendor.constant] = isCI + + if (isCI) { + exports.name = vendor.name + + switch (typeof vendor.pr) { + case 'string': + // "pr": "CIRRUS_PR" + exports.isPR = !!env[vendor.pr] + break + case 'object': + if ('env' in vendor.pr) { + // "pr": { "env": "BUILDKITE_PULL_REQUEST", "ne": "false" } + exports.isPR = vendor.pr.env in env && env[vendor.pr.env] !== vendor.pr.ne + } else if ('any' in vendor.pr) { + // "pr": { "any": ["ghprbPullId", "CHANGE_ID"] } + exports.isPR = vendor.pr.any.some(function (key) { + return !!env[key] + }) + } else { + // "pr": { "DRONE_BUILD_EVENT": "pull_request" } + exports.isPR = checkEnv(vendor.pr) + } + break + default: + // PR detection not supported for this vendor + exports.isPR = null + } + } +}) + +exports.isCI = !!( + env.CI || // Travis CI, CircleCI, Cirrus CI, Gitlab CI, Appveyor, CodeShip, dsari + env.CONTINUOUS_INTEGRATION || // Travis CI, Cirrus CI + env.BUILD_NUMBER || // Jenkins, TeamCity + env.RUN_ID || // TaskCluster, dsari + exports.name || + false +) + +function checkEnv (obj) { + if (typeof obj === 'string') return !!env[obj] + return Object.keys(obj).every(function (k) { + return env[k] === obj[k] + }) +} diff --git a/node_modules/ci-info/package.json b/node_modules/ci-info/package.json new file mode 100644 index 0000000..1a4c48c --- /dev/null +++ b/node_modules/ci-info/package.json @@ -0,0 +1,97 @@ +{ + "_args": [ + [ + "ci-info@^1.5.0", + "/home/licence/helayelq/Integration/my-test-project/node_modules/is-ci" + ] + ], + "_from": "ci-info@>=1.5.0 <2.0.0", + "_hasShrinkwrap": false, + "_id": "ci-info@1.6.0", + "_inCache": true, + "_installable": true, + "_location": "/ci-info", + "_nodeVersion": "10.10.0", + "_npmOperationalInternal": { + "host": "s3://npm-registry-packages", + "tmp": "tmp/ci-info_1.6.0_1537432620983_0.7446311114890938" + }, + "_npmUser": { + "email": "w@tson.dk", + "name": "watson" + }, + "_npmVersion": "6.4.1", + "_phantomChildren": {}, + "_requested": { + "name": "ci-info", + "raw": "ci-info@^1.5.0", + "rawSpec": "^1.5.0", + "scope": null, + "spec": ">=1.5.0 <2.0.0", + "type": "range" + }, + "_requiredBy": [ + "/is-ci" + ], + "_resolved": "https://registry.npmjs.org/ci-info/-/ci-info-1.6.0.tgz", + "_shasum": "2ca20dbb9ceb32d4524a683303313f0304b1e497", + "_shrinkwrap": null, + "_spec": "ci-info@^1.5.0", + "_where": "/home/licence/helayelq/Integration/my-test-project/node_modules/is-ci", + "author": { + "email": "w@tson.dk", + "name": "Thomas Watson Steen", + "url": "https://twitter.com/wa7son" + }, + "bugs": { + "url": "https://github.com/watson/ci-info/issues" + }, + "coordinates": [ + 12.593091, + 55.778271 + ], + "dependencies": {}, + "description": "Get details about the current Continuous Integration environment", + "devDependencies": { + "clear-require": "^1.0.1", + "standard": "^12.0.1", + "tape": "^4.9.1" + }, + "directories": {}, + "dist": { + "fileCount": 6, + "integrity": "sha512-vsGdkwSCDpWmP80ncATX7iea5DWQemg1UgCW5J8tqjU3lYw4FBYuj89J0CTVomA7BEfvSZd84GmHko+MxFQU2A==", + "npm-signature": "-----BEGIN PGP SIGNATURE-----\r\nVersion: OpenPGP.js v3.0.4\r\nComment: https://openpgpjs.org\r\n\r\nwsFcBAEBCAAQBQJbo1wtCRA9TVsSAnZWagAANfwP/ROk4A97KwBmsJw5o/ev\nlaftMiVwnI/966mQ6Ak1GfTWx28SjLWKnE+IGKK+1dXDOoXrb6td8TCl/FUQ\n2e7khqDoPswsPtUJfJWY4dYCtS8UfvfJk6BlsMR7ebHxDc9dVpIhZ+V0MpVk\n7HdW3ay5sGoLUXenULN/8WoaRkpujVPJ9sltX25ZkEj1fvGuF33VszNAC7b5\nYXRKCPVFsMZF7APoJiMs9120tlIdw+uiT812ZY6QiwX0HlcHnYswE33h70NA\nZ7Od1js8nAWpdZi1FPiJtCQtl99iAIZboBijRhpkDILdeGR8S/f25HDTvjHW\n3oXk5/Im6hzFnPYezUs3EKf4GT92Bs4fDuCF8Sp1EoChtE+r35L09WFNRKzE\npp7L4+ZHPsszHz44z7Q84TZKtmBPX51fwoTSL//2ix1g31ZrMfYuvCA/s1Yf\n7+3IVlNMW0sUnzGepgF8+jevtOE238XcLHBrTl4LhTsSwmEyR9sRKs6xD1Lx\nQbmyBRWpsluaHnmxaQVoVxzJCz0J7RReE6/UUfGzzmeF6vrKtd6eCv2ZUECk\nSQwVW90PUjr1IgPaVa8stjq9kFxQtG0mwTS2eEO+gxM3hb0RT2t3ecdG3Zq9\n0INHULVlKDtKMXpoQ2QEV3XaZM0X2j2sqnQxuYsQHt6Al45Q43rcz/yGgjWT\nICTT\r\n=iAOM\r\n-----END PGP SIGNATURE-----\r\n", + "shasum": "2ca20dbb9ceb32d4524a683303313f0304b1e497", + "tarball": "https://registry.npmjs.org/ci-info/-/ci-info-1.6.0.tgz", + "unpackedSize": 11845 + }, + "gitHead": "3d07175c39b07090ab939471c47ef363ea74ab97", + "homepage": "https://github.com/watson/ci-info", + "keywords": [ + "ci", + "continuous", + "detect", + "integration", + "test" + ], + "license": "MIT", + "main": "index.js", + "maintainers": [ + { + "name": "watson", + "email": "w@tson.dk" + } + ], + "name": "ci-info", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/watson/ci-info.git" + }, + "scripts": { + "test": "standard && node test.js" + }, + "version": "1.6.0" +} diff --git a/node_modules/ci-info/vendors.json b/node_modules/ci-info/vendors.json new file mode 100644 index 0000000..a157b78 --- /dev/null +++ b/node_modules/ci-info/vendors.json @@ -0,0 +1,152 @@ +[ + { + "name": "AppVeyor", + "constant": "APPVEYOR", + "env": "APPVEYOR", + "pr": "APPVEYOR_PULL_REQUEST_NUMBER" + }, + { + "name": "Bamboo", + "constant": "BAMBOO", + "env": "bamboo_planKey" + }, + { + "name": "Bitbucket Pipelines", + "constant": "BITBUCKET", + "env": "BITBUCKET_COMMIT" + }, + { + "name": "Bitrise", + "constant": "BITRISE", + "env": "BITRISE_IO", + "pr": "BITRISE_PULL_REQUEST" + }, + { + "name": "Buddy", + "constant": "BUDDY", + "env": "BUDDY_WORKSPACE_ID", + "pr": "BUDDY_EXECUTION_PULL_REQUEST_ID" + }, + { + "name": "Buildkite", + "constant": "BUILDKITE", + "env": "BUILDKITE", + "pr": { "env": "BUILDKITE_PULL_REQUEST", "ne": "false" } + }, + { + "name": "CircleCI", + "constant": "CIRCLE", + "env": "CIRCLECI", + "pr": "CIRCLE_PULL_REQUEST" + }, + { + "name": "Cirrus CI", + "constant": "CIRRUS", + "env": "CIRRUS_CI", + "pr": "CIRRUS_PR" + }, + { + "name": "AWS CodeBuild", + "constant": "CODEBUILD", + "env": "CODEBUILD_BUILD_ARN" + }, + { + "name": "Codeship", + "constant": "CODESHIP", + "env": { "CI_NAME": "codeship" } + }, + { + "name": "Drone", + "constant": "DRONE", + "env": "DRONE", + "pr": { "DRONE_BUILD_EVENT": "pull_request" } + }, + { + "name": "dsari", + "constant": "DSARI", + "env": "DSARI" + }, + { + "name": "GitLab CI", + "constant": "GITLAB", + "env": "GITLAB_CI" + }, + { + "name": "GoCD", + "constant": "GOCD", + "env": "GO_PIPELINE_LABEL" + }, + { + "name": "Hudson", + "constant": "HUDSON", + "env": "HUDSON_URL" + }, + { + "name": "Jenkins", + "constant": "JENKINS", + "env": ["JENKINS_URL", "BUILD_ID"], + "pr": { "any": ["ghprbPullId", "CHANGE_ID"] } + }, + { + "name": "Magnum CI", + "constant": "MAGNUM", + "env": "MAGNUM" + }, + { + "name": "Sail CI", + "constant": "SAIL", + "env": "SAILCI", + "pr": "SAIL_PULL_REQUEST_NUMBER" + }, + { + "name": "Semaphore", + "constant": "SEMAPHORE", + "env": "SEMAPHORE", + "pr": "PULL_REQUEST_NUMBER" + }, + { + "name": "Shippable", + "constant": "SHIPPABLE", + "env": "SHIPPABLE", + "pr": { "IS_PULL_REQUEST": "true" } + }, + { + "name": "Solano CI", + "constant": "SOLANO", + "env": "TDDIUM", + "pr": "TDDIUM_PR_ID" + }, + { + "name": "Strider CD", + "constant": "STRIDER", + "env": "STRIDER" + }, + { + "name": "TaskCluster", + "constant": "TASKCLUSTER", + "env": ["TASK_ID", "RUN_ID"] + }, + { + "name": "Solano CI", + "constant": "TDDIUM", + "env": "TDDIUM", + "pr": "TDDIUM_PR_ID", + "deprecated": true + }, + { + "name": "TeamCity", + "constant": "TEAMCITY", + "env": "TEAMCITY_VERSION" + }, + { + "name": "Team Foundation Server", + "constant": "TFS", + "env": "TF_BUILD" + }, + { + "name": "Travis CI", + "constant": "TRAVIS", + "env": "TRAVIS", + "pr": { "env": "TRAVIS_PULL_REQUEST", "ne": "false" } + } +] diff --git a/node_modules/cli/.npmignore b/node_modules/cli/.npmignore new file mode 100644 index 0000000..b512c09 --- /dev/null +++ b/node_modules/cli/.npmignore @@ -0,0 +1 @@ +node_modules \ No newline at end of file diff --git a/node_modules/cli/README.md b/node_modules/cli/README.md new file mode 100644 index 0000000..501779e --- /dev/null +++ b/node_modules/cli/README.md @@ -0,0 +1,201 @@ +**cli is a toolkit for rapidly building command line apps - it includes:** + +- Full featured opts/args parser +- Plugin support for adding common options and switches +- Helper methods for working with input/output and spawning child processes +- Output colored/styled messages, [progress bars](https://github.com/chriso/cli/blob/master/examples/progress.js) or [spinners](https://github.com/chriso/cli/blob/master/examples/spinner.js) +- Command [auto-completion](https://github.com/chriso/cli/blob/master/examples/command.js) and [glob support](https://github.com/chriso/cli/blob/master/examples/glob.js) + +Install using `npm install cli` or just bundle [cli.js](https://github.com/chriso/cli/raw/master/cli.js) with your app. + +## Example apps + +### sort.js + +```javascript +#!/usr/bin/env node +require('cli').withStdinLines(function(lines, newline) { + this.output(lines.sort().join(newline)); +}); +``` + +Try it out + +```bash +$ ./sort.js < input.txt +``` + +Let's add support for an `-n` switch to use a numeric sort, and a `-r` switch to reverse output - only 5 extra lines of code (!) + +```javascript +var cli = require('cli'), options = cli.parse(); + +cli.withStdinLines(function(lines, newline) { + lines.sort(!options.n ? null : function(a, b) { + return parseInt(a) > parseInt(b); + }); + if (options.r) lines.reverse(); + this.output(lines.join(newline)); +}); +``` + +## Command Line Arguments Parser + +cli takes an object as a map for the arguments you wish to parse. +Each property/key in the object is the long version of the argument i.e. --file +The array associated with it is the options to apply to that argument. + +### Example +```javascript +cli.parse({ + file: [ 'f', 'A file to process', 'file', temp.log ], // -f, --file FILE A file to process + time: [ 't', 'An access time', 'time', false], // -t, --time TIME An access time + work: [ false, 'What kind of work to do', 'string', 'sleep' ] // --work STRING What kind of work to do +}); +``` +### Explanation of array options + +1. A short name, single letter i.e. -f, or false if no short name is supported for this option +2. A description of the option +3. The type of object the argument should map too. + Below is a list of the return types followed by a description and a list of + valid values you can use for this option to get desired type of Object back. + - **as-is:** What you enter, is what you get + - 'string', 1, true + - **int:** Is converted to an Integer wrapped in a Number Object + - 'int', 'number', 'num', + - 'time', 'seconds', 'secs', 'minutes', 'mins' + - 'x', 'n' + - **date:** Is converted to a Date Object + - 'date', 'datetime', 'date_time' + - **float:** Is converted to a Float wrapped in a Number Object + - 'float', 'decimal' + - **file:** Is converted to a String Object if it is a valid path + - 'path', 'file', 'directory', 'dir' + - **email:** Converted to a String Object if it is a valid email format + - 'email' + - **url:** Converted to a String Object if it is a valid URL format + - 'url', 'uri', 'domain', 'host' + - **ip:** Converted to a String Object if it is a valid IP Address format + - 'ip' + - **true:** Converted to true if argument is present on command line + - 'bool', 'boolean', 'on' + - **false:** Converted to false if argument is present on command line + - 'false', 'off', false, 0 +4. A default value for this option if one is not given on the command line + +## Helper methods + +cli has methods that collect stdin (newline is auto-detected as \n or \r\n) + +```javascript +cli.withStdin(callback); //callback receives stdin as a string +cli.withStdinLines(callback); //callback receives stdin split into an array of lines (lines, newline) +``` + +cli also has a lower level method for working with input line by line (see [./examples/cat.js](https://github.com/chriso/cli/blob/master/examples/cat.js) for an example). + +```javascript +cli.withInput(file, function (line, newline, eof) { + if (!eof) { + this.output(line + newline); + } +}); +``` +*Note: `file` can be omitted if you want to work with stdin* + +```javascript +//cli.toType(object); If a Built-in type, returns the name of the type as a lower cased String +cli.toType([]); // 'array' +cli.toType(new Date()); // 'date' +cli.toType(1); // 'integer' +cli.toType(1.1); // 'float' +cli.toType(Math); // 'math' +cli.toType(/a/); // 'regex' +cli.toType(JSON); // 'json' +``` + +To output a progress bar, call + +```javascript +cli.progress(progress); //Where 0 <= progress <= 1 +``` + +To spawn a child process, use + +```javascript +cli.exec(cmd, callback); //callback receives the output of the process (split into lines) +``` + +cli also comes bundled with kof's [node-natives](https://github.com/kof/node-natives) (access with cli.native) and creationix' [stack](https://github.com/creationix/stack) (access with cli.createServer) + +## Plugins + +Plugins are a way of adding common opts and can be enabled using + +```javascript +cli.enable(plugin1, [plugin2, ...]); //To disable, use the equivalent disable() method +``` + +**help** - *enabled by default* + +Adds `-h,--help` to output auto-generated usage information + +**version** + +Adds `-v,--version` to output version information for the app. cli will attempt to locate and parse a nearby *package.json* + +To set your own app name and version, use `cli.setApp(app_name, version)` + +**status** + +Adds options to show/hide the stylized status messages that are output to the console when using one of these methods + +```javascript +cli.debug(msg); //Only shown when using --debug +cli.error(msg); +cli.fatal(msg); //Exits the process after outputting msg +cli.info(msg); +cli.ok(msg); +``` + +`-k,--no-color` will omit ANSI color escapes from the output + +**glob** - *requires* `npm install glob` + +Enables glob matching of arguments + +**timeout** + +Adds `-t,--timeout N` to exit the process after N seconds with an error + +**catchall** + +Adds `-c,--catch` to catch and output uncaughtExceptions and resume execution + +*Note: Plugins are automatically disabled if an option or switch of the same name is already defined* + +## LICENSE + +(MIT license) + +Copyright (c) 2010 Chris O'Hara + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/cli/cli.js b/node_modules/cli/cli.js new file mode 100644 index 0000000..aefaef5 --- /dev/null +++ b/node_modules/cli/cli.js @@ -0,0 +1,1112 @@ +/** + * Copyright (c) 2010 Chris O'Hara + * + * Permission is hereby granted, free of charge, to any person obtaining + * a copy of this software and associated documentation files (the + * "Software"), to deal in the Software without restriction, including + * without limitation the rights to use, copy, modify, merge, publish, + * distribute, sublicense, and/or sell copies of the Software, and to + * permit persons to whom the Software is furnished to do so, subject to + * the following conditions: + * + * The above copyright notice and this permission notice shall be + * included in all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, + * EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF + * MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND + * NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE + * LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION + * OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION + * WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + */ + + //Note: cli includes kof/node-natives and creationix/stack. I couldn't find + //license information for either - contact me if you want your license added + +var cli = exports, + argv, curr_opt, curr_val, full_opt, is_long, + short_tags = [], opt_list, parsed = {}, + usage, argv_parsed, command_list, commands, + show_debug; + +cli.app = null; +cli.version = null; +cli.argv = []; +cli.argc = 0; + +cli.options = {}; +cli.args = []; +cli.command = null; + +cli.width = 70; +cli.option_width = 25; + +/** + * Bind kof's node-natives (https://github.com/kof/node-natives) to `cli.native` + * + * Rather than requiring node natives (e.g. var fs = require('fs')), all + * native modules can be accessed like `cli.native.fs` + */ +cli.native = {}; +var define_native = function (module) { + Object.defineProperty(cli.native, module, { + enumerable: true, + configurable: true, + get: function() { + delete cli.native[module]; + return (cli.native[module] = require(module)); + } + }); +}; +var natives = process.binding('natives'); +for (var module in natives) { + define_native(module); +} + +cli.output = console.log; +cli.exit = require('exit'); + +cli.no_color = false; +if (process.env.NODE_DISABLE_COLORS || process.env.TERM === 'dumb') { + cli.no_color = true; +} + +/** + * Define plugins. Plugins can be enabled and disabled by calling: + * + * `cli.enable(plugin1, [plugin2, ...])` + * `cli.disable(plugin1, [plugin2, ...])` + * + * Methods are chainable - `cli.enable(plugin).disable(plugin2)`. + * + * The 'help' plugin is enabled by default. + */ +var enable = { + help: true, //Adds -h, --help + version: false, //Adds -v,--version => gets version by parsing a nearby package.json + status: false, //Adds -k,--no-color & --debug => display plain status messages /display debug messages + timeout: false, //Adds -t,--timeout N => timeout the process after N seconds + catchall: false, //Adds -c,--catch => catch and output uncaughtExceptions + glob: false //Adds glob matching => use cli.glob(arg) +} +cli.enable = function (/*plugins*/) { + Array.prototype.slice.call(arguments).forEach(function (plugin) { + switch (plugin) { + case 'catchall': + process.on('uncaughtException', function (err) { + cli.error('Uncaught exception: ' + (err.msg || err)); + }); + break; + case 'help': case 'version': case 'status': + case 'autocomplete': case 'timeout': + //Just add switches. + break; + case 'glob': + cli.glob = require('glob'); + break; + default: + cli.fatal('Unknown plugin "' + plugin + '"'); + break; + } + enable[plugin] = true; + }); + return cli; +} +cli.disable = function (/*plugins*/) { + Array.prototype.slice.call(arguments).forEach(function (plugin) { + if (enable[plugin]) { + enable[plugin] = false; + } + }); + return cli; +} + +/** + * Sets argv (default is process.argv). + * + * @param {Array|String} argv + * @param {Boolean} keep_arg0 (optional - default is false) + * @api public + */ +cli.setArgv = function (arr, keep_arg0) { + if (typeof arr == 'string') { + arr = arr.split(' '); + } else { + arr = arr.slice(); + } + cli.app = arr.shift(); + // Strip off argv[0] if it's a node binary + // So this is still broken and will break if you are calling node through a + // symlink, unless you are lucky enough to have it as 'node' literal. Latter + // is a hack, but resolving abspaths/symlinks is an unportable can of worms. + if (!keep_arg0 && (['node', 'node.exe'].indexOf(cli.native.path.basename(cli.app)) !== -1 + || cli.native.path.basename(process.execPath) === cli.app + || process.execPath === cli.app)) { + cli.app = arr.shift(); + } + cli.app = cli.native.path.basename(cli.app); + argv_parsed = false; + cli.args = cli.argv = argv = arr; + cli.argc = argv.length; + cli.options = {}; + cli.command = null; +}; +cli.setArgv(process.argv); + +/** + * Returns the next opt, or false if no opts are found. + * + * @return {String} opt + * @api public + */ +cli.next = function () { + if (!argv_parsed) { + cli.args = []; + argv_parsed = true; + } + + curr_val = null; + + //If we're currently in a group of short opts (e.g. -abc), return the next opt + if (short_tags.length) { + curr_opt = short_tags.shift(); + full_opt = '-' + curr_opt; + return curr_opt; + } + + if (!argv.length) { + return false; + } + + curr_opt = argv.shift(); + + //If an escape sequence is found (- or --), subsequent opts are ignored + if (curr_opt === '-' || curr_opt === '--') { + while (argv.length) { + cli.args.push(argv.shift()); + } + return false; + } + + //If the next element in argv isn't an opt, add it to the list of args + if (curr_opt[0] !== '-') { + cli.args.push(curr_opt); + return cli.next(); + } else { + //Check if the opt is short/long + is_long = curr_opt[1] === '-'; + curr_opt = curr_opt.substr(is_long ? 2 : 1); + } + + //Accept grouped short opts, e.g. -abc => -a -b -c + if (!is_long && curr_opt.length > 1) { + short_tags = curr_opt.split(''); + return cli.next(); + } + + var eq, len; + + //Check if the long opt is in the form --option=VALUE + if (is_long && (eq = curr_opt.indexOf('=')) >= 0) { + curr_val = curr_opt.substr(eq + 1); + curr_opt = curr_opt.substr(0, eq); + len = curr_val.length; + //Allow values to be quoted + if ((curr_val[0] === '"' && curr_val[len - 1] === '"') || + (curr_val[0] === "'" && curr_val[len - 1] === "'")) + { + curr_val = curr_val.substr(1, len-2); + } + if (curr_val.match(/^[0-9]+$/)) { + curr_val = parseInt(curr_val, 10); + } + } + + //Save the opt representation for later + full_opt = (is_long ? '--' : '-') + curr_opt; + + return curr_opt; +}; + +/** + * Parses command line opts. + * + * `opts` must be an object with opts defined like: + * long_tag: [short_tag, description, value_type, default_value]; + * + * `commands` is an optional array or object for apps that are of the form + * my_app [OPTIONS] [ARGS] + * The command list is output with usage information + there is bundled + * support for auto-completion, etc. + * + * See README.md for more information. + * + * @param {Object} opts + * @param {Object} commands (optional) + * @return {Object} opts (parsed) + * @api public + */ +cli.parse = function (opts, command_def) { + var default_val, i, o, parsed = cli.options, seen, + catch_all = !opts; + opt_list = opts || {}; + commands = command_def; + command_list = commands || []; + if (commands && !Array.isArray(commands)) { + command_list = Object.keys(commands); + } + while ((o = cli.next())) { + seen = false; + for (var opt in opt_list) { + if (!(opt_list[opt] instanceof Array)) { + continue; + } + if (!opt_list[opt][0]) { + opt_list[opt][0] = opt; + } + if (o === opt || o === opt_list[opt][0]) { + seen = true; + if (opt_list[opt].length === 2) { + parsed[opt] = true; + break; + } + default_val = null; + if (opt_list[opt].length === 4) { + default_val = opt_list[opt][3]; + } + if (opt_list[opt][2] instanceof Array) { + for (i = 0, l = opt_list[opt][2].length; i < l; i++) { + if (typeof opt_list[opt][2][i] === 'number') { + opt_list[opt][2][i] += ''; + } + } + parsed[opt] = cli.getArrayValue(opt_list[opt][2], is_long ? null : default_val); + break; + } + if (opt_list[opt][2].toLowerCase) { + opt_list[opt][2] = opt_list[opt][2].toLowerCase(); + } + switch (opt_list[opt][2]) { + case 'string': case 1: case true: + parsed[opt] = cli.getValue(default_val); + break; + case 'int': case 'number': case 'num': + case 'time': case 'seconds': case 'secs': case 'minutes': case 'mins': + case 'x': case 'n': + parsed[opt] = cli.getInt(default_val); + break; + case 'date': case 'datetime': case 'date_time': + parsed[opt] = cli.getDate(default_val); + break; + case 'float': case 'decimal': + parsed[opt] = cli.getFloat(default_val); + break; + case 'path': case 'file': case 'directory': case 'dir': + parsed[opt] = cli.getPath(default_val, opt_list[opt][2]); + break; + case 'email': + parsed[opt] = cli.getEmail(default_val); + break; + case 'url': case 'uri': case 'domain': case 'host': + parsed[opt] = cli.getUrl(default_val, opt_list[opt][2]); + break; + case 'ip': + parsed[opt] = cli.getIp(default_val); + break; + case 'bool': case 'boolean': case 'on': + parsed[opt] = true; + break; + case 'false': case 'off': case false: case 0: + parsed[opt] = false; + break; + default: + cli.fatal('Unknown opt type "' + opt_list[opt][2] + '"'); + } + break; + } + } + if (!seen) { + if (enable.help && (o === 'h' || o === 'help')) { + cli.getUsage(); + } else if (enable.version && (o === 'v' || o === 'version')) { + if (cli.version == null) { + cli.parsePackageJson(); + } + console.error(cli.app + ' v' + cli.version); + cli.exit(); + break; + } else if (enable.catchall && (o === 'c' || o === 'catch')) { + continue; + } else if (enable.status && (o === 'k' || o === 'no-color')) { + cli.no_color = (o === 'k' || o === 'no-color'); + continue; + } else if (enable.status && (o === 'debug')) { + show_debug = o === 'debug'; + continue; + } else if (enable.timeout && (o === 't' || o === 'timeout')) { + var secs = cli.getInt(); + setTimeout(function () { + cli.fatal('Process timed out after ' + secs + 's'); + }, secs * 1000); + continue; + } else if (catch_all) { + parsed[o] = curr_val || true; + continue; + } + cli.fatal('Unknown option ' + full_opt); + } + } + //Fill the remaining options with their default value or null + for (var opt in opt_list) { + default_val = opt_list[opt].length === 4 ? opt_list[opt][3] : null; + if (!(opt_list[opt] instanceof Array)) { + parsed[opt] = opt_list[opt]; + continue; + } else if (typeof parsed[opt] === 'undefined') { + parsed[opt] = default_val; + } + } + if (command_list.length) { + if (cli.args.length === 0) { + if (enable.help) { + cli.getUsage(); + } else { + cli.fatal('A command is required (' + command_list.join(', ') + ').'); + } + return cli.exit(1); + } else { + cli.command = cli.autocompleteCommand(cli.args.shift()); + } + } + cli.argc = cli.args.length; + return parsed; +}; + +/** + * Helper method for matching a command from the command list. + * + * @param {String} command + * @return {String} full_command + * @api public + */ +cli.autocompleteCommand = function (command) { + var list; + if (!(command_list instanceof Array)) { + list = Object.keys(command_list); + } else { + list = command_list; + } + var i, j = 0, c = command.length, tmp_list; + if (list.length === 0 || list.indexOf(command) !== -1) { + return command; + } + for (i = 0; i < c; i++) { + tmp_list = []; + l = list.length; + if (l <= 1) break; + for (j = 0; j < l; j++) + if (list[j].length >= i && list[j][i] === command[i]) + tmp_list.push(list[j]); + list = tmp_list; + } + l = list.length; + if (l === 1) { + return list[0]; + } else if (l === 0) { + cli.fatal('Unknown command "' + command + '"' + (enable.help ? '. Please see --help for more information' : '')); + } else { + list.sort(); + cli.fatal('The command "' + command + '" is ambiguous and could mean "' + list.join('", "') + '"'); + } +}; + +/** + * Adds methods to output styled status messages to stderr. + * + * Added methods are cli.info(msg), cli.error(msg), cli.ok(msg), and + * cli.debug(msg). + * + * To control status messages, use the 'status' plugin + * 1) debug() messages are hidden by default. Display them with + * the --debug opt. + * 2) to hide all status messages, use the -s or --silent opt. + * + * @api private + */ +cli.status = function (msg, type) { + var pre; + switch (type) { + case 'info': + pre = cli.no_color ? 'INFO:' : '\x1B[33mINFO\x1B[0m:'; + break; + case 'debug': + pre = cli.no_color ? 'DEBUG:' : '\x1B[36mDEBUG\x1B[0m:'; + break; + case 'error': + case 'fatal': + pre = cli.no_color ? 'ERROR:' : '\x1B[31mERROR\x1B[0m:'; + break; + case 'ok': + pre = cli.no_color ? 'OK:' : '\x1B[32mOK\x1B[0m:'; + break; + } + msg = pre + ' ' + msg; + if (type === 'fatal') { + console.error(msg); + return cli.exit(1); + } + if (enable.status && !show_debug && type === 'debug') { + return; + } + console.error(msg); +}; +['info','error','ok','debug','fatal'].forEach(function (type) { + cli[type] = function (msg) { + cli.status(msg, type); + }; +}); + +/** + * Sets the app name and version. + * + * Usage: + * setApp('myapp', '0.1.0'); + * setApp('./package.json'); //Pull name/version from package.json + * + * @param {String} name + * @return cli (for chaining) + * @api public + */ +cli.setApp = function (name, version) { + if (name.indexOf('package.json') !== -1) { + cli.parsePackageJson(name); + } else { + cli.app = name; + cli.version = version; + } + return cli; +}; + +/** + * Parses the version number from package.json. If no path is specified, cli + * will attempt to locate a package.json in ./, ../ or ../../ + * + * @param {String} path (optional) + * @api public + */ +cli.parsePackageJson = function (path) { + var parse_packagejson = function (path) { + var packagejson = JSON.parse(cli.native.fs.readFileSync(path, 'utf8')); + cli.version = packagejson.version; + cli.app = packagejson.name; + }; + var try_all = function (arr, func, err) { + for (var i = 0, l = arr.length; i < l; i++) { + try { + func(arr[i]); + return; + } catch (e) { + if (i === l-1) { + cli.fatal(err); + } + } + } + }; + try { + if (path) { + return parse_packagejson(path); + } + try_all([ + __dirname + '/package.json', + __dirname + '/../package.json', + __dirname + '/../../package.json' + ], parse_packagejson); + } catch (e) { + cli.fatal('Could not detect ' + cli.app + ' version'); + } +}; + +/** + * Sets the usage string - default is `app [OPTIONS] [ARGS]`. + * + * @param {String} u + * @return cli (for chaining) + * @api public + */ +cli.setUsage = function (u) { + usage = u; + return cli; +}; + +var pad = function (str, len) { + if (typeof len === 'undefined') { + len = str; + str = ''; + } + if (str.length < len) { + len -= str.length; + while (len--) str += ' '; + } + return str; +}; + +/** + * Automatically build usage information from the opts list. If the help + * plugin is enabled (default), this info is displayed with -h, --help. + * + * @api public + */ +cli.getUsage = function (code) { + var short, desc, optional, line, seen_opts = [], + switch_pad = cli.option_width; + + var trunc_desc = function (pref, desc, len) { + var pref_len = pref.length, + desc_len = cli.width - pref_len, + truncated = ''; + if (desc.length <= desc_len) { + return desc; + } + var desc_words = (desc+'').split(' '), chars = 0, word; + while (desc_words.length) { + truncated += (word = desc_words.shift()) + ' '; + chars += word.length; + if (desc_words.length && chars + desc_words[0].length > desc_len) { + truncated += '\n' + pad(pref_len); + chars = 0; + } + } + return truncated; + }; + + usage = usage || cli.app + ' [OPTIONS]' + (command_list.length ? ' ' : '') + ' [ARGS]'; + if (cli.no_color) { + console.error('Usage:\n ' + usage); + console.error('Options: '); + } else { + console.error('\x1b[1mUsage\x1b[0m:\n ' + usage); + console.error('\n\x1b[1mOptions\x1b[0m: '); + } + for (var opt in opt_list) { + + if (opt.length === 1) { + long = opt_list[opt][0]; + short = opt; + } else { + long = opt; + short = opt_list[opt][0]; + } + + //Parse opt_list + desc = opt_list[opt][1].trim(); + type = opt_list[opt].length >= 3 ? opt_list[opt][2] : null; + optional = opt_list[opt].length === 4 ? opt_list[opt][3] : null; + + //Build usage line + if (short === long) { + if (short.length === 1) { + line = ' -' + short; + } else { + line = ' --' + long; + } + } else if (short) { + line = ' -' + short + ', --' + long; + } else { + line = ' --' + long; + } + line += ' '; + + if (type) { + if (type instanceof Array) { + desc += '. VALUE must be either [' + type.join('|') + ']'; + type = 'VALUE'; + } + if (type === true || type === 1) { + type = long.toUpperCase(); + } + type = type.toUpperCase(); + if (type === 'FLOAT' || type === 'INT') { + type = 'NUMBER'; + } + line += optional ? '[' + type + ']' : type; + } + line = pad(line, switch_pad); + line += trunc_desc(line, desc); + line += optional ? ' (Default is ' + optional + ')' : ''; + console.error(line.replace('%s', '%\0s')); + + seen_opts.push(short); + seen_opts.push(long); + } + if (enable.timeout && seen_opts.indexOf('t') === -1 && seen_opts.indexOf('timeout') === -1) { + console.error(pad(' -t, --timeout N', switch_pad) + 'Exit if the process takes longer than N seconds'); + } + if (enable.status) { + if (seen_opts.indexOf('k') === -1 && seen_opts.indexOf('no-color') === -1) { + console.error(pad(' -k, --no-color', switch_pad) + 'Omit color from output'); + } + if (seen_opts.indexOf('debug') === -1) { + console.error(pad(' --debug', switch_pad) + 'Show debug information'); + } + } + if (enable.catchall && seen_opts.indexOf('c') === -1 && seen_opts.indexOf('catch') === -1) { + console.error(pad(' -c, --catch', switch_pad) + 'Catch unanticipated errors'); + } + if (enable.version && seen_opts.indexOf('v') === -1 && seen_opts.indexOf('version') === -1) { + console.error(pad(' -v, --version', switch_pad) + 'Display the current version'); + } + if (enable.help && seen_opts.indexOf('h') === -1 && seen_opts.indexOf('help') === -1) { + console.error(pad(' -h, --help', switch_pad) + 'Display help and usage details'); + } + if (command_list.length) { + console.error('\n\x1b[1mCommands\x1b[0m: '); + if (!Array.isArray(commands)) { + for (var c in commands) { + line = ' ' + pad(c, switch_pad - 2); + line += trunc_desc(line, commands[c]); + console.error(line); + } + } else { + command_list.sort(); + console.error(' ' + trunc_desc(' ', command_list.join(', '))); + } + } + return cli.exit(code); +}; + +/** + * Generates an error message when an opt is incorrectly used. + * + * @param {String} expects (e.g. 'a value') + * @param {String} type (e.g. 'VALUE') + * @api public + */ +cli.getOptError = function (expects, type) { + var err = full_opt + ' expects ' + expects + + '. Use `' + cli.app + ' ' + full_opt + (is_long ? '=' : ' ') + type + '`'; + return err; +}; + +/** + * Gets the next opt value and validates it with an optional validation + * function. If validation fails or no value can be obtained, this method + * will return the default value (if specified) or exit with err_msg. + * + * @param {String} default_val + * @param {Function} validate_func + * @param {String} err_msg + * @api public + */ +cli.getValue = function (default_val, validate_func, err_msg) { + err_msg = err_msg || cli.getOptError('a value', 'VALUE'); + + var value; + + try { + if (curr_val) { + if (validate_func) { + curr_val = validate_func(curr_val); + } + return curr_val; + } + + //Grouped short opts aren't allowed to have values + if (short_tags.length) { + throw 'Short tags'; + } + + //If there's no args left or the next arg is an opt, return the + //default value (if specified) - otherwise fail + if (!argv.length || (argv[0].length === 1 && argv[0][0] === '-')) { + throw 'No value'; + } + + value = argv.shift(); + + if (value.match(/^[0-9]+$/)) { + value = parseInt(value, 10); + } + + //Run the value through a validation/transformation function if specified + if (validate_func) { + value = validate_func(value); + } + } catch (e) { + + //The value didn't pass the validation/transformation. Unshift the value and + //return the default value (if specified) + if (value) { + argv.unshift(value); + } + return default_val != null ? default_val : cli.fatal(err_msg); + } + return value; +}; + +cli.getInt = function (default_val) { + return cli.getValue(default_val, function (value) { + if (typeof value === 'number') return value; + if (!value.match(/^(?:-?(?:0|[1-9][0-9]*))$/)) { + throw 'Invalid int'; + } + return parseInt(value); + }, cli.getOptError('a number', 'NUMBER')); +} + +cli.getDate = function (default_val) { + + return cli.getValue(default_val, function (value) { + if (cli.toType(value) === 'date') return value; + value = new Date(value); + if ( ! value.getTime() ) { + throw value.toString(); + } + + return value; + }, cli.getOptError('a date', 'DATE')); +} + +cli.getFloat = function (default_val) { + return cli.getValue(default_val, function (value) { + if (!value.match(/^(?:-?(?:0|[1-9][0-9]*))?(?:\.[0-9]*)?$/)) { + throw 'Invalid float'; + } + return parseFloat(value, 10); + }, cli.getOptError('a number', 'NUMBER')); +} + +cli.getUrl = function (default_val, identifier) { + identifier = identifier || 'url'; + return cli.getValue(default_val, function (value) { + if (!value.match(/^(?:(?:ht|f)tp(?:s?)\:\/\/|~\/|\/)?(?:\w+:\w+@)?((?:(?:[-\w\d{1-3}]+\.)+(?:com|org|net|gov|mil|biz|info|mobi|name|aero|jobs|edu|co\.uk|ac\.uk|it|fr|tv|museum|asia|local|travel|[a-z]{2})?)|((\b25[0-5]\b|\b[2][0-4][0-9]\b|\b[0-1]?[0-9]?[0-9]\b)(\.(\b25[0-5]\b|\b[2][0-4][0-9]\b|\b[0-1]?[0-9]?[0-9]\b)){3}))(?::[\d]{1,5})?(?:(?:(?:\/(?:[-\w~!$+|.,=]|%[a-f\d]{2})+)+|\/)+|\?|#)?(?:(?:\?(?:[-\w~!$+|.,*:]|%[a-f\d{2}])+=?(?:[-\w~!$+|.,*:=]|%[a-f\d]{2})*)(?:&(?:[-\w~!$+|.,*:]|%[a-f\d{2}])+=?(?:[-\w~!$+|.,*:=]|%[a-f\d]{2})*)*)*(?:#(?:[-\w~!$ |\/.,*:;=]|%[a-f\d]{2})*)?$/i)) { + throw 'Invalid URL'; + } + return value; + }, cli.getOptError('a ' + identifier, identifier.toUpperCase())); +} + +cli.getEmail = function (default_val) { + return cli.getValue(default_val, function (value) { + if (!value.match(/^(?:[\w\!\#\$\%\&\'\*\+\-\/\=\?\^\`\{\|\}\~]+\.)*[\w\!\#\$\%\&\'\*\+\-\/\=\?\^\`\{\|\}\~]+@(?:(?:(?:[a-zA-Z0-9](?:[a-zA-Z0-9\-](?!\.)){0,61}[a-zA-Z0-9]?\.)+[a-zA-Z0-9](?:[a-zA-Z0-9\-](?!$)){0,61}[a-zA-Z0-9]?)|(?:\[(?:(?:[01]?\d{1,2}|2[0-4]\d|25[0-5])\.){3}(?:[01]?\d{1,2}|2[0-4]\d|25[0-5])\]))$/)) { + throw 'Invalid email'; + } + return value; + }, cli.getOptError('an email', 'EMAIL')); +} + +cli.getIp = function (default_val) { + return cli.getValue(default_val, function (value) { + if (!value.match(/^(?:(?:25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)\.){3}(?:25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)$/)) { + throw 'Invalid IP'; + } + return value; + }, cli.getOptError('an IP', 'IP')); +} + +cli.getPath = function (default_val, identifier) { + identifier = identifier || 'path'; + return cli.getValue(default_val, function (value) { + if (value.match(/[?*;{}]/)) { + throw 'Invalid path'; + } + return value; + }, cli.getOptError('a ' + identifier, identifier.toUpperCase())); +} + +cli.getArrayValue = function (arr, default_val) { + return cli.getValue(default_val, function (value) { + if (arr.indexOf(value) === -1) { + throw 'Unexpected value'; + } + return value; + }, cli.getOptError('either [' + arr.join('|') + ']', 'VALUE')); +} + +/** + * Gets all data from STDIN (with optional encoding) and sends it to callback. + * + * @param {String} encoding (optional - default is 'utf8') + * @param {Function} callback + * @api public + */ +cli.withStdin = function (encoding, callback) { + if (typeof encoding === 'function') { + callback = encoding; + encoding = 'utf8'; + } + var stream = process.openStdin(), data = ''; + stream.setEncoding(encoding); + stream.on('data', function (chunk) { + data += chunk; + }); + stream.on('end', function () { + callback.apply(cli, [data]); + }); +}; + +/** + * Gets all data from STDIN, splits the data into lines and sends it + * to callback (callback isn't called until all of STDIN is read. To + * process each line as it's received, see the method below + * + * @param {Function} callback + * @api public + */ +cli.withStdinLines = function (callback) { + cli.withStdin(function (data) { + var sep = data.indexOf('\r\n') !== -1 ? '\r\n' : '\n'; + callback.apply(cli, [data.split(sep), sep]); + }); +}; + +/** + * Asynchronously reads a file line by line. When a line is received, + * callback is called with (line, sep) - when EOF is reached, callback + * receives (null, null, true) + * + * @param {String} file (optional - default is 'stdin') + * @param {String} encoding (optional - default is 'utf8') + * @param {Function} callback (line, sep, eof) + * @api public + */ +cli.withInput = function (file, encoding, callback) { + if (typeof encoding === 'function') { + callback = encoding; + encoding = 'utf8'; + } else if (typeof file === 'function') { + callback = file; + encoding = 'utf8'; + file = 'stdin'; + } + if (file === 'stdin') { + file = process.openStdin(); + } else { + try { + file = cli.native.fs.createReadStream(file); + file.on('error', cli.fatal); + } catch (e) { + return cli.fatal(e); + } + } + file.setEncoding(encoding); + var lines = [], data = '', eof, sep; + file.on('data', function (chunk) { + if (eof) return; + data += chunk; + if (!sep) { + if (data.indexOf('\r\n') !== -1) { + sep = '\r\n'; + } else if (data.indexOf('\n') !== -1) { + sep = '\n'; + } else { + last_line = data; + return; + } + } + lines = data.split(sep); + data = eof ? null : lines.pop(); + while (lines.length) { + callback.apply(cli, [lines.shift(), sep, false]); + } + }); + file.on('end', function () { + eof = true; + if (data.length) { + callback.apply(cli, [data, sep || '', false]); + } + callback.apply(cli, [null, null, true]); + }); +}; + +/** + * This function does a much better job at determining the object type than the typeof operator + * @author Angus Croll - https://javascriptweblog.wordpress.com/2011/08/08/fixing-the-javascript-typeof-operator/ + * @param {Object} obj A Javascript object you wish to know the type of. + * @return {string} A string describing the Object's type if it is indeed a built in JavaScript type. + */ +cli.toType = function(obj) { + var type = ({}).toString.call(obj).match(/\s([a-zA-Z]+)/)[1].toLowerCase(); + + function isInt(n) { + return Number(n) === n && n % 1 === 0; + } + + function isFloat(n){ + return n === Number(n) && n % 1 !== 0; + } + + if ( type === 'number' ) { + if ( isInt(obj) ) { + return 'integer'; + } else if ( isFloat(obj) ) { + return 'float'; + } + } + + return type; +} + +/** + * The main entry method. `callback` receives (args, options) + * + * @param {Function} callback + * @api public + */ +cli.main = function (callback) { + callback.call(cli, cli.args, cli.options); +} + +/** + * Bind creationix's stack (https://github.com/creationix/stack). + * + * Create a simple middleware stack by calling: + * + * cli.createServer(middleware).listen(port); + * + * @return {Server} server + * @api public + */ +cli.createServer = function(/*layers*/) { + var defaultStackErrorHandler = function (req, res, err) { + if (err) { + console.error(err.stack); + res.writeHead(500, {"Content-Type": "text/plain"}); + return res.end(err.stack + "\n"); + } + res.writeHead(404, {"Content-Type": "text/plain"}); + res.end("Not Found\n"); + }; + var handle, error; + handle = error = defaultStackErrorHandler; + var layers = Array.prototype.slice.call(arguments); + + //Allow createServer(a,b,c) and createServer([a,b,c]) + if (layers.length && layers[0] instanceof Array) { + layers = layers[0]; + } + layers.reverse().forEach(function (layer) { + var child = handle; + handle = function (req, res) { + try { + layer(req, res, function (err) { + if (err) return error(req, res, err); + child(req, res); + }); + } catch (err) { + error(req, res, err); + } + }; + }); + return cli.native.http.createServer(handle); +}; + +/** + * A wrapper for child_process.exec(). + * + * If the child_process exits successfully, `callback` receives an array of + * stdout lines. The current process exits if the child process has an error + * and `errback` isn't defined. + * + * @param {String} cmd + * @param {Function} callback (optional) + * @param {Function} errback (optional) + * @api public + */ +cli.exec = function (cmd, callback, errback) { + cli.native.child_process.exec(cmd, function (err, stdout, stderr) { + err = err || stderr; + if (err) { + if (errback) { + return errback(err, stdout); + } + return cli.fatal('exec() failed\n' + err); + } + if (callback) { + callback(stdout.split('\n')); + } + }); +}; + +/** + * Helper method for outputting a progress bar to the console. + * + * @param {Number} progress (0 <= progress <= 1) + * @api public + */ +var last_progress_call, progress_len = 74, min_progress_increase = 5, last_progress_percentage = 0; +cli.progress = function (progress, decimals, stream) { + stream = stream || process.stdout; + if (progress < 0 || progress > 1 || isNaN(progress)) return; + if (!decimals) decimals = 0; + var now = (new Date()).getTime(); + if (last_progress_call && (now - last_progress_call) < 100 && progress !== 1) { + return; //Throttle progress calls + } + last_progress_call = now; + + var pwr = Math.pow(10, decimals); + var percentage_as_num = Math.floor(progress * 100 * pwr) / pwr; + if (!stream.isTTY && percentage_as_num < 100 && percentage_as_num - last_progress_percentage < min_progress_increase) { + return; //don't over-print if not TTY + } + last_progress_percentage = percentage_as_num; + var percentage = percentage_as_num + '%'; + for (var i = 0; i < decimals; i++) { + percentage += ' '; + } + if (!stream.isTTY) { + if (percentage_as_num < 100) { + stream.write(percentage + '...'); + } + else { + stream.write(percentage + '\n'); + last_progress_percentage = 0; + } + return; + } + var bar_length = Math.floor(progress_len * progress), + str = ''; + if (bar_length == 0 && progress > 0) { + bar_length = 1; + } + for (i = 1; i <= progress_len; i++) { + str += i <= bar_length ? '#' : ' '; + } + stream.clearLine(); + stream.write('[' + str + '] ' + percentage); + if (progress === 1) { + stream.write('\n'); + } else { + stream.cursorTo(0); + } +}; + +/** + * Helper method for outputting a spinner to the console. + * + * @param {String|Boolean} prefix (optional) + * @api public + */ +var spinner_interval; +cli.spinner = function (prefix, end, stream) { + stream = stream || process.stdout; + if(!stream.isTTY) { + stream.write(prefix + '\n'); + return; + } + if (end) { + stream.clearLine(); + stream.cursorTo(0); + stream.write(prefix + '\n'); + return clearInterval(spinner_interval); + } + prefix = prefix + ' ' || ''; + var spinner = ['-','\\','|','/'], i = 0, l = spinner.length; + spinner_interval = setInterval(function () { + stream.clearLine(); + stream.cursorTo(0); + stream.write(prefix + spinner[i++]); + if (i == l) i = 0; + }, 200); +}; diff --git a/node_modules/cli/examples/cat.js b/node_modules/cli/examples/cat.js new file mode 100755 index 0000000..14c4e79 --- /dev/null +++ b/node_modules/cli/examples/cat.js @@ -0,0 +1,17 @@ +#!/usr/bin/env node + +var cli = require('cli'); + +var output_file = function (file) { + cli.withInput(file, function (line, sep, eof) { + if (!eof) { + cli.output(line + sep); + } else if (cli.args.length) { + output_file(cli.args.shift()); + } + }); +}; + +if (cli.args.length) { + output_file(cli.args.shift()); +} \ No newline at end of file diff --git a/node_modules/cli/examples/command.js b/node_modules/cli/examples/command.js new file mode 100755 index 0000000..2f04491 --- /dev/null +++ b/node_modules/cli/examples/command.js @@ -0,0 +1,16 @@ +#!/usr/bin/env node + +var cli = require('cli'); + +//The second (optional) argument of cli.parse() is a command list +//Type `./command.js --help` for usage info + +//cli enables auto-completion of commands (similiar to npm), e.g. all of +//the following are equivalent and result in "Command is: install": +// $ ./command.js install +// $ ./command.js inst +// $ ./command.js i + +cli.parse(null, ['install', 'test', 'edit', 'remove', 'uninstall', 'ls']); + +console.log('Command is: ' + cli.command); diff --git a/node_modules/cli/examples/echo.js b/node_modules/cli/examples/echo.js new file mode 100755 index 0000000..9cf27d0 --- /dev/null +++ b/node_modules/cli/examples/echo.js @@ -0,0 +1,54 @@ +#!/usr/bin/env node + +/* All of the following commands are equivalent and write `foo\tbar foo` to out.txt + $ ./echo.js -n -e --output=out.txt "foo\tbar" "foo" + $ ./echo.js --newline --escape --output "out.txt" "foo\tbar" "foo" + $ ./echo.js -ne --output=out.txt "foo\tbar" "foo" + $ ./echo.js -en --output="out.txt" "foo\tbar" "foo" +*/ + +var cli = require('cli'); + +cli.parse({ + newline: ['n', 'Do not output the trailing newline'], + escape: ['e', 'Enable interpretation of backslash escapes'], + separator: ['s', 'Separate arguments using this value', 'string', ' '], + output: [false, 'Write to FILE rather than the console', 'file'] +}); + +cli.main(function (args, options) { + var output = '', i, j, l, output_stream; + + if (this.argc) { + if (options.escape) { + var replace = {'\\n':'\n','\\r':'\r','\\t':'\t','\\e':'\e','\\v':'\v','\\f':'\f','\\c':'\c','\\b':'\b','\\a':'\a','\\\\':'\\'}; + var escape = function (str) { + str += ''; + for (j in replace) { + str = str.replace(i, replace[i]); + } + return str; + } + for (i = 0, l = this.argc; i < l; i++) { + args[i] = escape(args[i]); + } + options.separator = escape(options.separator); + } + output += args.join(options.separator); + } + + if (!options.newline) { + output += '\n'; + } + + try { + if (options.output) { + output_stream = this.native.fs.createWriteStream(options.output) + } else { + output_stream = process.stdout; + } + output_stream.write(output); + } catch (e) { + this.fatal('Could not write to output stream'); + } +}); diff --git a/node_modules/cli/examples/glob.js b/node_modules/cli/examples/glob.js new file mode 100755 index 0000000..12585c0 --- /dev/null +++ b/node_modules/cli/examples/glob.js @@ -0,0 +1,6 @@ +#!/usr/bin/env node + +var cli = require('cli').enable('glob'); + +//Running `./glob.js *.js` will output a list of .js files in this directory +console.log(cli.args); \ No newline at end of file diff --git a/node_modules/cli/examples/long_desc.js b/node_modules/cli/examples/long_desc.js new file mode 100755 index 0000000..63632f4 --- /dev/null +++ b/node_modules/cli/examples/long_desc.js @@ -0,0 +1,20 @@ +#!/usr/bin/env node + +var cli = require('../'); + +//You can (optionally) boost the width of output with: +//cli.width = 120; + +//You can also adjust the width of the options/command definitions +//cli.option_width = 25; + +var long_desc = 'Lorem Ipsum is simply dummy text of the printing and typesetting industry. Lorem Ipsum has been the industry\'s ' + + 'standard dummy text ever since the 1500s, when an unknown printer took a galley of type and scrambled it to make' + + ' a type specimen book. It has survived not only five centuries, but also the leap into electronic typesetting, ' + + 'remaining essentially unchanged. It was popularised in the 1960s with the release of Letraset sheets containing ' + + 'Lorem Ipsum passages, and more recently with desktop publishing software like Aldus PageMaker including versions' + + ' of Lorem Ipsum.'; + +cli.parse({ + foo: ['f', long_desc] +}); diff --git a/node_modules/cli/examples/progress.js b/node_modules/cli/examples/progress.js new file mode 100755 index 0000000..300c674 --- /dev/null +++ b/node_modules/cli/examples/progress.js @@ -0,0 +1,11 @@ +#!/usr/bin/env node + +var cli = require('cli'); + +var i = 0, interval = setInterval(function () { + cli.progress(++i / 100); + if (i === 100) { + clearInterval(interval); + cli.ok('Finished!'); + } +}, 50); \ No newline at end of file diff --git a/node_modules/cli/examples/sort.js b/node_modules/cli/examples/sort.js new file mode 100755 index 0000000..5d22313 --- /dev/null +++ b/node_modules/cli/examples/sort.js @@ -0,0 +1,18 @@ +#!/usr/bin/env node + +var cli = require('cli'); + +var options = cli.parse({ + numeric: ['n', 'Compare using a numeric sort'], + reverse: ['r', 'Reverse the results'] +}); + +cli.withStdinLines(function (lines, newline) { + lines.sort(!options.numeric ? null : function (a, b) { + return parseInt(a) > parseInt(b); + }); + if (options.reverse) { + lines.reverse(); + } + this.output(lines.join(newline)); +}); \ No newline at end of file diff --git a/node_modules/cli/examples/spinner.js b/node_modules/cli/examples/spinner.js new file mode 100755 index 0000000..6100001 --- /dev/null +++ b/node_modules/cli/examples/spinner.js @@ -0,0 +1,9 @@ +#!/usr/bin/env node + +var cli = require('cli'); + +cli.spinner('Working..'); + +setTimeout(function () { + cli.spinner('Working.. done!', true); //End the spinner +}, 3000); \ No newline at end of file diff --git a/node_modules/cli/index.js b/node_modules/cli/index.js new file mode 100644 index 0000000..3966bd7 --- /dev/null +++ b/node_modules/cli/index.js @@ -0,0 +1 @@ +module.exports = require('./cli'); diff --git a/node_modules/cli/package.json b/node_modules/cli/package.json new file mode 100644 index 0000000..c0c889a --- /dev/null +++ b/node_modules/cli/package.json @@ -0,0 +1,99 @@ +{ + "_args": [ + [ + "cli@~1.0.0", + "/home/licence/helayelq/Integration/my-test-project/node_modules/jshint" + ] + ], + "_from": "cli@>=1.0.0 <1.1.0", + "_id": "cli@1.0.1", + "_inCache": true, + "_installable": true, + "_location": "/cli", + "_nodeVersion": "6.9.1", + "_npmOperationalInternal": { + "host": "packages-18-east.internal.npmjs.com", + "tmp": "tmp/cli-1.0.1.tgz_1477195136534_0.8342971515376121" + }, + "_npmUser": { + "email": "cohara87@gmail.com", + "name": "cohara87" + }, + "_npmVersion": "3.10.8", + "_phantomChildren": {}, + "_requested": { + "name": "cli", + "raw": "cli@~1.0.0", + "rawSpec": "~1.0.0", + "scope": null, + "spec": ">=1.0.0 <1.1.0", + "type": "range" + }, + "_requiredBy": [ + "/jshint" + ], + "_resolved": "https://registry.npmjs.org/cli/-/cli-1.0.1.tgz", + "_shasum": "22817534f24bfa4950c34d532d48ecbc621b8c14", + "_shrinkwrap": null, + "_spec": "cli@~1.0.0", + "_where": "/home/licence/helayelq/Integration/my-test-project/node_modules/jshint", + "author": { + "email": "cohara87@gmail.com", + "name": "Chris O'Hara" + }, + "bugs": { + "url": "http://github.com/node-js-libs/cli/issues" + }, + "contributors": [ + { + "name": "Douglas Meyer" + } + ], + "dependencies": { + "exit": "0.1.2", + "glob": "^7.1.1" + }, + "description": "A tool for rapidly building command line apps", + "devDependencies": {}, + "directories": {}, + "dist": { + "shasum": "22817534f24bfa4950c34d532d48ecbc621b8c14", + "tarball": "https://registry.npmjs.org/cli/-/cli-1.0.1.tgz" + }, + "engines": { + "node": ">=0.2.5" + }, + "gitHead": "470db35ec032a81a3d5aebb4f48f90f905945248", + "homepage": "http://github.com/node-js-libs/cli", + "keywords": [ + "args", + "argsparse", + "autocomplete", + "autocompletion", + "cli", + "command", + "command line", + "console", + "opt", + "optparse", + "opts", + "parseopt" + ], + "license": "MIT", + "main": "cli.js", + "maintainers": [ + { + "name": "cohara87", + "email": "cohara87@gmail.com" + } + ], + "name": "cli", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+ssh://git@github.com/node-js-libs/cli.git" + }, + "scripts": {}, + "version": "1.0.1" +} diff --git a/node_modules/commander/CHANGELOG.md b/node_modules/commander/CHANGELOG.md new file mode 100644 index 0000000..5e2f813 --- /dev/null +++ b/node_modules/commander/CHANGELOG.md @@ -0,0 +1,356 @@ + +2.15.0 / 2018-03-07 +================== + + * Update downloads badge to point to graph of downloads over time instead of duplicating link to npm + * Arguments description + +2.14.1 / 2018-02-07 +================== + + * Fix typing of help function + +2.14.0 / 2018-02-05 +================== + + * only register the option:version event once + * Fixes issue #727: Passing empty string for option on command is set to undefined + * enable eqeqeq rule + * resolves #754 add linter configuration to project + * resolves #560 respect custom name for version option + * document how to override the version flag + * document using options per command + +2.13.0 / 2018-01-09 +================== + + * Do not print default for --no- + * remove trailing spaces in command help + * Update CI's Node.js to LTS and latest version + * typedefs: Command and Option types added to commander namespace + +2.12.2 / 2017-11-28 +================== + + * fix: typings are not shipped + +2.12.1 / 2017-11-23 +================== + + * Move @types/node to dev dependency + +2.12.0 / 2017-11-22 +================== + + * add attributeName() method to Option objects + * Documentation updated for options with --no prefix + * typings: `outputHelp` takes a string as the first parameter + * typings: use overloads + * feat(typings): update to match js api + * Print default value in option help + * Fix translation error + * Fail when using same command and alias (#491) + * feat(typings): add help callback + * fix bug when description is add after command with options (#662) + * Format js code + * Rename History.md to CHANGELOG.md (#668) + * feat(typings): add typings to support TypeScript (#646) + * use current node + +2.11.0 / 2017-07-03 +================== + + * Fix help section order and padding (#652) + * feature: support for signals to subcommands (#632) + * Fixed #37, --help should not display first (#447) + * Fix translation errors. (#570) + * Add package-lock.json + * Remove engines + * Upgrade package version + * Prefix events to prevent conflicts between commands and options (#494) + * Removing dependency on graceful-readlink + * Support setting name in #name function and make it chainable + * Add .vscode directory to .gitignore (Visual Studio Code metadata) + * Updated link to ruby commander in readme files + +2.10.0 / 2017-06-19 +================== + + * Update .travis.yml. drop support for older node.js versions. + * Fix require arguments in README.md + * On SemVer you do not start from 0.0.1 + * Add missing semi colon in readme + * Add save param to npm install + * node v6 travis test + * Update Readme_zh-CN.md + * Allow literal '--' to be passed-through as an argument + * Test subcommand alias help + * link build badge to master branch + * Support the alias of Git style sub-command + * added keyword commander for better search result on npm + * Fix Sub-Subcommands + * test node.js stable + * Fixes TypeError when a command has an option called `--description` + * Update README.md to make it beginner friendly and elaborate on the difference between angled and square brackets. + * Add chinese Readme file + +2.9.0 / 2015-10-13 +================== + + * Add option `isDefault` to set default subcommand #415 @Qix- + * Add callback to allow filtering or post-processing of help text #434 @djulien + * Fix `undefined` text in help information close #414 #416 @zhiyelee + +2.8.1 / 2015-04-22 +================== + + * Back out `support multiline description` Close #396 #397 + +2.8.0 / 2015-04-07 +================== + + * Add `process.execArg` support, execution args like `--harmony` will be passed to sub-commands #387 @DigitalIO @zhiyelee + * Fix bug in Git-style sub-commands #372 @zhiyelee + * Allow commands to be hidden from help #383 @tonylukasavage + * When git-style sub-commands are in use, yet none are called, display help #382 @claylo + * Add ability to specify arguments syntax for top-level command #258 @rrthomas + * Support multiline descriptions #208 @zxqfox + +2.7.1 / 2015-03-11 +================== + + * Revert #347 (fix collisions when option and first arg have same name) which causes a bug in #367. + +2.7.0 / 2015-03-09 +================== + + * Fix git-style bug when installed globally. Close #335 #349 @zhiyelee + * Fix collisions when option and first arg have same name. Close #346 #347 @tonylukasavage + * Add support for camelCase on `opts()`. Close #353 @nkzawa + * Add node.js 0.12 and io.js to travis.yml + * Allow RegEx options. #337 @palanik + * Fixes exit code when sub-command failing. Close #260 #332 @pirelenito + * git-style `bin` files in $PATH make sense. Close #196 #327 @zhiyelee + +2.6.0 / 2014-12-30 +================== + + * added `Command#allowUnknownOption` method. Close #138 #318 @doozr @zhiyelee + * Add application description to the help msg. Close #112 @dalssoft + +2.5.1 / 2014-12-15 +================== + + * fixed two bugs incurred by variadic arguments. Close #291 @Quentin01 #302 @zhiyelee + +2.5.0 / 2014-10-24 +================== + + * add support for variadic arguments. Closes #277 @whitlockjc + +2.4.0 / 2014-10-17 +================== + + * fixed a bug on executing the coercion function of subcommands option. Closes #270 + * added `Command.prototype.name` to retrieve command name. Closes #264 #266 @tonylukasavage + * added `Command.prototype.opts` to retrieve all the options as a simple object of key-value pairs. Closes #262 @tonylukasavage + * fixed a bug on subcommand name. Closes #248 @jonathandelgado + * fixed function normalize doesn’t honor option terminator. Closes #216 @abbr + +2.3.0 / 2014-07-16 +================== + + * add command alias'. Closes PR #210 + * fix: Typos. Closes #99 + * fix: Unused fs module. Closes #217 + +2.2.0 / 2014-03-29 +================== + + * add passing of previous option value + * fix: support subcommands on windows. Closes #142 + * Now the defaultValue passed as the second argument of the coercion function. + +2.1.0 / 2013-11-21 +================== + + * add: allow cflag style option params, unit test, fixes #174 + +2.0.0 / 2013-07-18 +================== + + * remove input methods (.prompt, .confirm, etc) + +1.3.2 / 2013-07-18 +================== + + * add support for sub-commands to co-exist with the original command + +1.3.1 / 2013-07-18 +================== + + * add quick .runningCommand hack so you can opt-out of other logic when running a sub command + +1.3.0 / 2013-07-09 +================== + + * add EACCES error handling + * fix sub-command --help + +1.2.0 / 2013-06-13 +================== + + * allow "-" hyphen as an option argument + * support for RegExp coercion + +1.1.1 / 2012-11-20 +================== + + * add more sub-command padding + * fix .usage() when args are present. Closes #106 + +1.1.0 / 2012-11-16 +================== + + * add git-style executable subcommand support. Closes #94 + +1.0.5 / 2012-10-09 +================== + + * fix `--name` clobbering. Closes #92 + * fix examples/help. Closes #89 + +1.0.4 / 2012-09-03 +================== + + * add `outputHelp()` method. + +1.0.3 / 2012-08-30 +================== + + * remove invalid .version() defaulting + +1.0.2 / 2012-08-24 +================== + + * add `--foo=bar` support [arv] + * fix password on node 0.8.8. Make backward compatible with 0.6 [focusaurus] + +1.0.1 / 2012-08-03 +================== + + * fix issue #56 + * fix tty.setRawMode(mode) was moved to tty.ReadStream#setRawMode() (i.e. process.stdin.setRawMode()) + +1.0.0 / 2012-07-05 +================== + + * add support for optional option descriptions + * add defaulting of `.version()` to package.json's version + +0.6.1 / 2012-06-01 +================== + + * Added: append (yes or no) on confirmation + * Added: allow node.js v0.7.x + +0.6.0 / 2012-04-10 +================== + + * Added `.prompt(obj, callback)` support. Closes #49 + * Added default support to .choose(). Closes #41 + * Fixed the choice example + +0.5.1 / 2011-12-20 +================== + + * Fixed `password()` for recent nodes. Closes #36 + +0.5.0 / 2011-12-04 +================== + + * Added sub-command option support [itay] + +0.4.3 / 2011-12-04 +================== + + * Fixed custom help ordering. Closes #32 + +0.4.2 / 2011-11-24 +================== + + * Added travis support + * Fixed: line-buffered input automatically trimmed. Closes #31 + +0.4.1 / 2011-11-18 +================== + + * Removed listening for "close" on --help + +0.4.0 / 2011-11-15 +================== + + * Added support for `--`. Closes #24 + +0.3.3 / 2011-11-14 +================== + + * Fixed: wait for close event when writing help info [Jerry Hamlet] + +0.3.2 / 2011-11-01 +================== + + * Fixed long flag definitions with values [felixge] + +0.3.1 / 2011-10-31 +================== + + * Changed `--version` short flag to `-V` from `-v` + * Changed `.version()` so it's configurable [felixge] + +0.3.0 / 2011-10-31 +================== + + * Added support for long flags only. Closes #18 + +0.2.1 / 2011-10-24 +================== + + * "node": ">= 0.4.x < 0.7.0". Closes #20 + +0.2.0 / 2011-09-26 +================== + + * Allow for defaults that are not just boolean. Default peassignment only occurs for --no-*, optional, and required arguments. [Jim Isaacs] + +0.1.0 / 2011-08-24 +================== + + * Added support for custom `--help` output + +0.0.5 / 2011-08-18 +================== + + * Changed: when the user enters nothing prompt for password again + * Fixed issue with passwords beginning with numbers [NuckChorris] + +0.0.4 / 2011-08-15 +================== + + * Fixed `Commander#args` + +0.0.3 / 2011-08-15 +================== + + * Added default option value support + +0.0.2 / 2011-08-15 +================== + + * Added mask support to `Command#password(str[, mask], fn)` + * Added `Command#password(str, fn)` + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/commander/LICENSE b/node_modules/commander/LICENSE new file mode 100644 index 0000000..10f997a --- /dev/null +++ b/node_modules/commander/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2011 TJ Holowaychuk + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/commander/Readme.md b/node_modules/commander/Readme.md new file mode 100644 index 0000000..a29da40 --- /dev/null +++ b/node_modules/commander/Readme.md @@ -0,0 +1,408 @@ +# Commander.js + + +[![Build Status](https://api.travis-ci.org/tj/commander.js.svg?branch=master)](http://travis-ci.org/tj/commander.js) +[![NPM Version](http://img.shields.io/npm/v/commander.svg?style=flat)](https://www.npmjs.org/package/commander) +[![NPM Downloads](https://img.shields.io/npm/dm/commander.svg?style=flat)](https://npmcharts.com/compare/commander?minimal=true) +[![Join the chat at https://gitter.im/tj/commander.js](https://badges.gitter.im/Join%20Chat.svg)](https://gitter.im/tj/commander.js?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge) + + The complete solution for [node.js](http://nodejs.org) command-line interfaces, inspired by Ruby's [commander](https://github.com/commander-rb/commander). + [API documentation](http://tj.github.com/commander.js/) + + +## Installation + + $ npm install commander --save + +## Option parsing + +Options with commander are defined with the `.option()` method, also serving as documentation for the options. The example below parses args and options from `process.argv`, leaving remaining args as the `program.args` array which were not consumed by options. + +```js +#!/usr/bin/env node + +/** + * Module dependencies. + */ + +var program = require('commander'); + +program + .version('0.1.0') + .option('-p, --peppers', 'Add peppers') + .option('-P, --pineapple', 'Add pineapple') + .option('-b, --bbq-sauce', 'Add bbq sauce') + .option('-c, --cheese [type]', 'Add the specified type of cheese [marble]', 'marble') + .parse(process.argv); + +console.log('you ordered a pizza with:'); +if (program.peppers) console.log(' - peppers'); +if (program.pineapple) console.log(' - pineapple'); +if (program.bbqSauce) console.log(' - bbq'); +console.log(' - %s cheese', program.cheese); +``` + +Short flags may be passed as a single arg, for example `-abc` is equivalent to `-a -b -c`. Multi-word options such as "--template-engine" are camel-cased, becoming `program.templateEngine` etc. + +Note that multi-word options starting with `--no` prefix negate the boolean value of the following word. For example, `--no-sauce` sets the value of `program.sauce` to false. + +```js +#!/usr/bin/env node + +/** + * Module dependencies. + */ + +var program = require('commander'); + +program + .option('--no-sauce', 'Remove sauce') + .parse(process.argv); + +console.log('you ordered a pizza'); +if (program.sauce) console.log(' with sauce'); +else console.log(' without sauce'); +``` + +## Version option + +Calling the `version` implicitly adds the `-V` and `--version` options to the command. +When either of these options is present, the command prints the version number and exits. + + $ ./examples/pizza -V + 0.0.1 + +If you want your program to respond to the `-v` option instead of the `-V` option, simply pass custom flags to the `version` method using the same syntax as the `option` method. + +```js +program + .version('0.0.1', '-v, --version') +``` + +The version flags can be named anything, but the long option is required. + +## Command-specific options + +You can attach options to a command. + +```js +#!/usr/bin/env node + +var program = require('commander'); + +program + .command('rm ') + .option('-r, --recursive', 'Remove recursively') + .action(function (dir, cmd) { + console.log('remove ' + dir + (cmd.recursive ? ' recursively' : '')) + }) + +program.parse(process.argv) +``` + +A command's options are validated when the command is used. Any unknown options will be reported as an error. However, if an action-based command does not define an action, then the options are not validated. + +## Coercion + +```js +function range(val) { + return val.split('..').map(Number); +} + +function list(val) { + return val.split(','); +} + +function collect(val, memo) { + memo.push(val); + return memo; +} + +function increaseVerbosity(v, total) { + return total + 1; +} + +program + .version('0.1.0') + .usage('[options] ') + .option('-i, --integer ', 'An integer argument', parseInt) + .option('-f, --float ', 'A float argument', parseFloat) + .option('-r, --range ..', 'A range', range) + .option('-l, --list ', 'A list', list) + .option('-o, --optional [value]', 'An optional value') + .option('-c, --collect [value]', 'A repeatable value', collect, []) + .option('-v, --verbose', 'A value that can be increased', increaseVerbosity, 0) + .parse(process.argv); + +console.log(' int: %j', program.integer); +console.log(' float: %j', program.float); +console.log(' optional: %j', program.optional); +program.range = program.range || []; +console.log(' range: %j..%j', program.range[0], program.range[1]); +console.log(' list: %j', program.list); +console.log(' collect: %j', program.collect); +console.log(' verbosity: %j', program.verbose); +console.log(' args: %j', program.args); +``` + +## Regular Expression +```js +program + .version('0.1.0') + .option('-s --size ', 'Pizza size', /^(large|medium|small)$/i, 'medium') + .option('-d --drink [drink]', 'Drink', /^(coke|pepsi|izze)$/i) + .parse(process.argv); + +console.log(' size: %j', program.size); +console.log(' drink: %j', program.drink); +``` + +## Variadic arguments + + The last argument of a command can be variadic, and only the last argument. To make an argument variadic you have to + append `...` to the argument name. Here is an example: + +```js +#!/usr/bin/env node + +/** + * Module dependencies. + */ + +var program = require('commander'); + +program + .version('0.1.0') + .command('rmdir [otherDirs...]') + .action(function (dir, otherDirs) { + console.log('rmdir %s', dir); + if (otherDirs) { + otherDirs.forEach(function (oDir) { + console.log('rmdir %s', oDir); + }); + } + }); + +program.parse(process.argv); +``` + + An `Array` is used for the value of a variadic argument. This applies to `program.args` as well as the argument passed + to your action as demonstrated above. + +## Specify the argument syntax + +```js +#!/usr/bin/env node + +var program = require('commander'); + +program + .version('0.1.0') + .arguments(' [env]') + .action(function (cmd, env) { + cmdValue = cmd; + envValue = env; + }); + +program.parse(process.argv); + +if (typeof cmdValue === 'undefined') { + console.error('no command given!'); + process.exit(1); +} +console.log('command:', cmdValue); +console.log('environment:', envValue || "no environment given"); +``` +Angled brackets (e.g. ``) indicate required input. Square brackets (e.g. `[env]`) indicate optional input. + +## Git-style sub-commands + +```js +// file: ./examples/pm +var program = require('commander'); + +program + .version('0.1.0') + .command('install [name]', 'install one or more packages') + .command('search [query]', 'search with optional query') + .command('list', 'list packages installed', {isDefault: true}) + .parse(process.argv); +``` + +When `.command()` is invoked with a description argument, no `.action(callback)` should be called to handle sub-commands, otherwise there will be an error. This tells commander that you're going to use separate executables for sub-commands, much like `git(1)` and other popular tools. +The commander will try to search the executables in the directory of the entry script (like `./examples/pm`) with the name `program-command`, like `pm-install`, `pm-search`. + +Options can be passed with the call to `.command()`. Specifying `true` for `opts.noHelp` will remove the option from the generated help output. Specifying `true` for `opts.isDefault` will run the subcommand if no other subcommand is specified. + +If the program is designed to be installed globally, make sure the executables have proper modes, like `755`. + +### `--harmony` + +You can enable `--harmony` option in two ways: +* Use `#! /usr/bin/env node --harmony` in the sub-commands scripts. Note some os version don’t support this pattern. +* Use the `--harmony` option when call the command, like `node --harmony examples/pm publish`. The `--harmony` option will be preserved when spawning sub-command process. + +## Automated --help + + The help information is auto-generated based on the information commander already knows about your program, so the following `--help` info is for free: + +``` + $ ./examples/pizza --help + + Usage: pizza [options] + + An application for pizzas ordering + + Options: + + -h, --help output usage information + -V, --version output the version number + -p, --peppers Add peppers + -P, --pineapple Add pineapple + -b, --bbq Add bbq sauce + -c, --cheese Add the specified type of cheese [marble] + -C, --no-cheese You do not want any cheese + +``` + +## Custom help + + You can display arbitrary `-h, --help` information + by listening for "--help". Commander will automatically + exit once you are done so that the remainder of your program + does not execute causing undesired behaviours, for example + in the following executable "stuff" will not output when + `--help` is used. + +```js +#!/usr/bin/env node + +/** + * Module dependencies. + */ + +var program = require('commander'); + +program + .version('0.1.0') + .option('-f, --foo', 'enable some foo') + .option('-b, --bar', 'enable some bar') + .option('-B, --baz', 'enable some baz'); + +// must be before .parse() since +// node's emit() is immediate + +program.on('--help', function(){ + console.log(' Examples:'); + console.log(''); + console.log(' $ custom-help --help'); + console.log(' $ custom-help -h'); + console.log(''); +}); + +program.parse(process.argv); + +console.log('stuff'); +``` + +Yields the following help output when `node script-name.js -h` or `node script-name.js --help` are run: + +``` + +Usage: custom-help [options] + +Options: + + -h, --help output usage information + -V, --version output the version number + -f, --foo enable some foo + -b, --bar enable some bar + -B, --baz enable some baz + +Examples: + + $ custom-help --help + $ custom-help -h + +``` + +## .outputHelp(cb) + +Output help information without exiting. +Optional callback cb allows post-processing of help text before it is displayed. + +If you want to display help by default (e.g. if no command was provided), you can use something like: + +```js +var program = require('commander'); +var colors = require('colors'); + +program + .version('0.1.0') + .command('getstream [url]', 'get stream URL') + .parse(process.argv); + +if (!process.argv.slice(2).length) { + program.outputHelp(make_red); +} + +function make_red(txt) { + return colors.red(txt); //display the help text in red on the console +} +``` + +## .help(cb) + + Output help information and exit immediately. + Optional callback cb allows post-processing of help text before it is displayed. + +## Examples + +```js +var program = require('commander'); + +program + .version('0.1.0') + .option('-C, --chdir ', 'change the working directory') + .option('-c, --config ', 'set config path. defaults to ./deploy.conf') + .option('-T, --no-tests', 'ignore test hook'); + +program + .command('setup [env]') + .description('run setup commands for all envs') + .option("-s, --setup_mode [mode]", "Which setup mode to use") + .action(function(env, options){ + var mode = options.setup_mode || "normal"; + env = env || 'all'; + console.log('setup for %s env(s) with %s mode', env, mode); + }); + +program + .command('exec ') + .alias('ex') + .description('execute the given remote cmd') + .option("-e, --exec_mode ", "Which exec mode to use") + .action(function(cmd, options){ + console.log('exec "%s" using %s mode', cmd, options.exec_mode); + }).on('--help', function() { + console.log(' Examples:'); + console.log(); + console.log(' $ deploy exec sequential'); + console.log(' $ deploy exec async'); + console.log(); + }); + +program + .command('*') + .action(function(env){ + console.log('deploying "%s"', env); + }); + +program.parse(process.argv); +``` + +More Demos can be found in the [examples](https://github.com/tj/commander.js/tree/master/examples) directory. + +## License + +MIT diff --git a/node_modules/commander/index.js b/node_modules/commander/index.js new file mode 100644 index 0000000..fb648be --- /dev/null +++ b/node_modules/commander/index.js @@ -0,0 +1,1231 @@ +/** + * Module dependencies. + */ + +var EventEmitter = require('events').EventEmitter; +var spawn = require('child_process').spawn; +var path = require('path'); +var dirname = path.dirname; +var basename = path.basename; +var fs = require('fs'); + +/** + * Inherit `Command` from `EventEmitter.prototype`. + */ + +require('util').inherits(Command, EventEmitter); + +/** + * Expose the root command. + */ + +exports = module.exports = new Command(); + +/** + * Expose `Command`. + */ + +exports.Command = Command; + +/** + * Expose `Option`. + */ + +exports.Option = Option; + +/** + * Initialize a new `Option` with the given `flags` and `description`. + * + * @param {String} flags + * @param {String} description + * @api public + */ + +function Option(flags, description) { + this.flags = flags; + this.required = ~flags.indexOf('<'); + this.optional = ~flags.indexOf('['); + this.bool = !~flags.indexOf('-no-'); + flags = flags.split(/[ ,|]+/); + if (flags.length > 1 && !/^[[<]/.test(flags[1])) this.short = flags.shift(); + this.long = flags.shift(); + this.description = description || ''; +} + +/** + * Return option name. + * + * @return {String} + * @api private + */ + +Option.prototype.name = function() { + return this.long + .replace('--', '') + .replace('no-', ''); +}; + +/** + * Return option name, in a camelcase format that can be used + * as a object attribute key. + * + * @return {String} + * @api private + */ + +Option.prototype.attributeName = function() { + return camelcase(this.name()); +}; + +/** + * Check if `arg` matches the short or long flag. + * + * @param {String} arg + * @return {Boolean} + * @api private + */ + +Option.prototype.is = function(arg) { + return this.short === arg || this.long === arg; +}; + +/** + * Initialize a new `Command`. + * + * @param {String} name + * @api public + */ + +function Command(name) { + this.commands = []; + this.options = []; + this._execs = {}; + this._allowUnknownOption = false; + this._args = []; + this._name = name || ''; +} + +/** + * Add command `name`. + * + * The `.action()` callback is invoked when the + * command `name` is specified via __ARGV__, + * and the remaining arguments are applied to the + * function for access. + * + * When the `name` is "*" an un-matched command + * will be passed as the first arg, followed by + * the rest of __ARGV__ remaining. + * + * Examples: + * + * program + * .version('0.0.1') + * .option('-C, --chdir ', 'change the working directory') + * .option('-c, --config ', 'set config path. defaults to ./deploy.conf') + * .option('-T, --no-tests', 'ignore test hook') + * + * program + * .command('setup') + * .description('run remote setup commands') + * .action(function() { + * console.log('setup'); + * }); + * + * program + * .command('exec ') + * .description('run the given remote command') + * .action(function(cmd) { + * console.log('exec "%s"', cmd); + * }); + * + * program + * .command('teardown [otherDirs...]') + * .description('run teardown commands') + * .action(function(dir, otherDirs) { + * console.log('dir "%s"', dir); + * if (otherDirs) { + * otherDirs.forEach(function (oDir) { + * console.log('dir "%s"', oDir); + * }); + * } + * }); + * + * program + * .command('*') + * .description('deploy the given env') + * .action(function(env) { + * console.log('deploying "%s"', env); + * }); + * + * program.parse(process.argv); + * + * @param {String} name + * @param {String} [desc] for git-style sub-commands + * @return {Command} the new command + * @api public + */ + +Command.prototype.command = function(name, desc, opts) { + if (typeof desc === 'object' && desc !== null) { + opts = desc; + desc = null; + } + opts = opts || {}; + var args = name.split(/ +/); + var cmd = new Command(args.shift()); + + if (desc) { + cmd.description(desc); + this.executables = true; + this._execs[cmd._name] = true; + if (opts.isDefault) this.defaultExecutable = cmd._name; + } + cmd._noHelp = !!opts.noHelp; + this.commands.push(cmd); + cmd.parseExpectedArgs(args); + cmd.parent = this; + + if (desc) return this; + return cmd; +}; + +/** + * Define argument syntax for the top-level command. + * + * @api public + */ + +Command.prototype.arguments = function(desc) { + return this.parseExpectedArgs(desc.split(/ +/)); +}; + +/** + * Add an implicit `help [cmd]` subcommand + * which invokes `--help` for the given command. + * + * @api private + */ + +Command.prototype.addImplicitHelpCommand = function() { + this.command('help [cmd]', 'display help for [cmd]'); +}; + +/** + * Parse expected `args`. + * + * For example `["[type]"]` becomes `[{ required: false, name: 'type' }]`. + * + * @param {Array} args + * @return {Command} for chaining + * @api public + */ + +Command.prototype.parseExpectedArgs = function(args) { + if (!args.length) return; + var self = this; + args.forEach(function(arg) { + var argDetails = { + required: false, + name: '', + variadic: false + }; + + switch (arg[0]) { + case '<': + argDetails.required = true; + argDetails.name = arg.slice(1, -1); + break; + case '[': + argDetails.name = arg.slice(1, -1); + break; + } + + if (argDetails.name.length > 3 && argDetails.name.slice(-3) === '...') { + argDetails.variadic = true; + argDetails.name = argDetails.name.slice(0, -3); + } + if (argDetails.name) { + self._args.push(argDetails); + } + }); + return this; +}; + +/** + * Register callback `fn` for the command. + * + * Examples: + * + * program + * .command('help') + * .description('display verbose help') + * .action(function() { + * // output help here + * }); + * + * @param {Function} fn + * @return {Command} for chaining + * @api public + */ + +Command.prototype.action = function(fn) { + var self = this; + var listener = function(args, unknown) { + // Parse any so-far unknown options + args = args || []; + unknown = unknown || []; + + var parsed = self.parseOptions(unknown); + + // Output help if necessary + outputHelpIfNecessary(self, parsed.unknown); + + // If there are still any unknown options, then we simply + // die, unless someone asked for help, in which case we give it + // to them, and then we die. + if (parsed.unknown.length > 0) { + self.unknownOption(parsed.unknown[0]); + } + + // Leftover arguments need to be pushed back. Fixes issue #56 + if (parsed.args.length) args = parsed.args.concat(args); + + self._args.forEach(function(arg, i) { + if (arg.required && args[i] == null) { + self.missingArgument(arg.name); + } else if (arg.variadic) { + if (i !== self._args.length - 1) { + self.variadicArgNotLast(arg.name); + } + + args[i] = args.splice(i); + } + }); + + // Always append ourselves to the end of the arguments, + // to make sure we match the number of arguments the user + // expects + if (self._args.length) { + args[self._args.length] = self; + } else { + args.push(self); + } + + fn.apply(self, args); + }; + var parent = this.parent || this; + var name = parent === this ? '*' : this._name; + parent.on('command:' + name, listener); + if (this._alias) parent.on('command:' + this._alias, listener); + return this; +}; + +/** + * Define option with `flags`, `description` and optional + * coercion `fn`. + * + * The `flags` string should contain both the short and long flags, + * separated by comma, a pipe or space. The following are all valid + * all will output this way when `--help` is used. + * + * "-p, --pepper" + * "-p|--pepper" + * "-p --pepper" + * + * Examples: + * + * // simple boolean defaulting to false + * program.option('-p, --pepper', 'add pepper'); + * + * --pepper + * program.pepper + * // => Boolean + * + * // simple boolean defaulting to true + * program.option('-C, --no-cheese', 'remove cheese'); + * + * program.cheese + * // => true + * + * --no-cheese + * program.cheese + * // => false + * + * // required argument + * program.option('-C, --chdir ', 'change the working directory'); + * + * --chdir /tmp + * program.chdir + * // => "/tmp" + * + * // optional argument + * program.option('-c, --cheese [type]', 'add cheese [marble]'); + * + * @param {String} flags + * @param {String} description + * @param {Function|*} [fn] or default + * @param {*} [defaultValue] + * @return {Command} for chaining + * @api public + */ + +Command.prototype.option = function(flags, description, fn, defaultValue) { + var self = this, + option = new Option(flags, description), + oname = option.name(), + name = option.attributeName(); + + // default as 3rd arg + if (typeof fn !== 'function') { + if (fn instanceof RegExp) { + var regex = fn; + fn = function(val, def) { + var m = regex.exec(val); + return m ? m[0] : def; + }; + } else { + defaultValue = fn; + fn = null; + } + } + + // preassign default value only for --no-*, [optional], or + if (!option.bool || option.optional || option.required) { + // when --no-* we make sure default is true + if (!option.bool) defaultValue = true; + // preassign only if we have a default + if (defaultValue !== undefined) { + self[name] = defaultValue; + option.defaultValue = defaultValue; + } + } + + // register the option + this.options.push(option); + + // when it's passed assign the value + // and conditionally invoke the callback + this.on('option:' + oname, function(val) { + // coercion + if (val !== null && fn) { + val = fn(val, self[name] === undefined ? defaultValue : self[name]); + } + + // unassigned or bool + if (typeof self[name] === 'boolean' || typeof self[name] === 'undefined') { + // if no value, bool true, and we have a default, then use it! + if (val == null) { + self[name] = option.bool + ? defaultValue || true + : false; + } else { + self[name] = val; + } + } else if (val !== null) { + // reassign + self[name] = val; + } + }); + + return this; +}; + +/** + * Allow unknown options on the command line. + * + * @param {Boolean} arg if `true` or omitted, no error will be thrown + * for unknown options. + * @api public + */ +Command.prototype.allowUnknownOption = function(arg) { + this._allowUnknownOption = arguments.length === 0 || arg; + return this; +}; + +/** + * Parse `argv`, settings options and invoking commands when defined. + * + * @param {Array} argv + * @return {Command} for chaining + * @api public + */ + +Command.prototype.parse = function(argv) { + // implicit help + if (this.executables) this.addImplicitHelpCommand(); + + // store raw args + this.rawArgs = argv; + + // guess name + this._name = this._name || basename(argv[1], '.js'); + + // github-style sub-commands with no sub-command + if (this.executables && argv.length < 3 && !this.defaultExecutable) { + // this user needs help + argv.push('--help'); + } + + // process argv + var parsed = this.parseOptions(this.normalize(argv.slice(2))); + var args = this.args = parsed.args; + + var result = this.parseArgs(this.args, parsed.unknown); + + // executable sub-commands + var name = result.args[0]; + + var aliasCommand = null; + // check alias of sub commands + if (name) { + aliasCommand = this.commands.filter(function(command) { + return command.alias() === name; + })[0]; + } + + if (this._execs[name] && typeof this._execs[name] !== 'function') { + return this.executeSubCommand(argv, args, parsed.unknown); + } else if (aliasCommand) { + // is alias of a subCommand + args[0] = aliasCommand._name; + return this.executeSubCommand(argv, args, parsed.unknown); + } else if (this.defaultExecutable) { + // use the default subcommand + args.unshift(this.defaultExecutable); + return this.executeSubCommand(argv, args, parsed.unknown); + } + + return result; +}; + +/** + * Execute a sub-command executable. + * + * @param {Array} argv + * @param {Array} args + * @param {Array} unknown + * @api private + */ + +Command.prototype.executeSubCommand = function(argv, args, unknown) { + args = args.concat(unknown); + + if (!args.length) this.help(); + if (args[0] === 'help' && args.length === 1) this.help(); + + // --help + if (args[0] === 'help') { + args[0] = args[1]; + args[1] = '--help'; + } + + // executable + var f = argv[1]; + // name of the subcommand, link `pm-install` + var bin = basename(f, '.js') + '-' + args[0]; + + // In case of globally installed, get the base dir where executable + // subcommand file should be located at + var baseDir, + link = fs.lstatSync(f).isSymbolicLink() ? fs.readlinkSync(f) : f; + + // when symbolink is relative path + if (link !== f && link.charAt(0) !== '/') { + link = path.join(dirname(f), link); + } + baseDir = dirname(link); + + // prefer local `./` to bin in the $PATH + var localBin = path.join(baseDir, bin); + + // whether bin file is a js script with explicit `.js` extension + var isExplicitJS = false; + if (exists(localBin + '.js')) { + bin = localBin + '.js'; + isExplicitJS = true; + } else if (exists(localBin)) { + bin = localBin; + } + + args = args.slice(1); + + var proc; + if (process.platform !== 'win32') { + if (isExplicitJS) { + args.unshift(bin); + // add executable arguments to spawn + args = (process.execArgv || []).concat(args); + + proc = spawn(process.argv[0], args, { stdio: 'inherit', customFds: [0, 1, 2] }); + } else { + proc = spawn(bin, args, { stdio: 'inherit', customFds: [0, 1, 2] }); + } + } else { + args.unshift(bin); + proc = spawn(process.execPath, args, { stdio: 'inherit' }); + } + + var signals = ['SIGUSR1', 'SIGUSR2', 'SIGTERM', 'SIGINT', 'SIGHUP']; + signals.forEach(function(signal) { + process.on(signal, function() { + if (proc.killed === false && proc.exitCode === null) { + proc.kill(signal); + } + }); + }); + proc.on('close', process.exit.bind(process)); + proc.on('error', function(err) { + if (err.code === 'ENOENT') { + console.error('\n %s(1) does not exist, try --help\n', bin); + } else if (err.code === 'EACCES') { + console.error('\n %s(1) not executable. try chmod or run with root\n', bin); + } + process.exit(1); + }); + + // Store the reference to the child process + this.runningCommand = proc; +}; + +/** + * Normalize `args`, splitting joined short flags. For example + * the arg "-abc" is equivalent to "-a -b -c". + * This also normalizes equal sign and splits "--abc=def" into "--abc def". + * + * @param {Array} args + * @return {Array} + * @api private + */ + +Command.prototype.normalize = function(args) { + var ret = [], + arg, + lastOpt, + index; + + for (var i = 0, len = args.length; i < len; ++i) { + arg = args[i]; + if (i > 0) { + lastOpt = this.optionFor(args[i - 1]); + } + + if (arg === '--') { + // Honor option terminator + ret = ret.concat(args.slice(i)); + break; + } else if (lastOpt && lastOpt.required) { + ret.push(arg); + } else if (arg.length > 1 && arg[0] === '-' && arg[1] !== '-') { + arg.slice(1).split('').forEach(function(c) { + ret.push('-' + c); + }); + } else if (/^--/.test(arg) && ~(index = arg.indexOf('='))) { + ret.push(arg.slice(0, index), arg.slice(index + 1)); + } else { + ret.push(arg); + } + } + + return ret; +}; + +/** + * Parse command `args`. + * + * When listener(s) are available those + * callbacks are invoked, otherwise the "*" + * event is emitted and those actions are invoked. + * + * @param {Array} args + * @return {Command} for chaining + * @api private + */ + +Command.prototype.parseArgs = function(args, unknown) { + var name; + + if (args.length) { + name = args[0]; + if (this.listeners('command:' + name).length) { + this.emit('command:' + args.shift(), args, unknown); + } else { + this.emit('command:*', args); + } + } else { + outputHelpIfNecessary(this, unknown); + + // If there were no args and we have unknown options, + // then they are extraneous and we need to error. + if (unknown.length > 0) { + this.unknownOption(unknown[0]); + } + } + + return this; +}; + +/** + * Return an option matching `arg` if any. + * + * @param {String} arg + * @return {Option} + * @api private + */ + +Command.prototype.optionFor = function(arg) { + for (var i = 0, len = this.options.length; i < len; ++i) { + if (this.options[i].is(arg)) { + return this.options[i]; + } + } +}; + +/** + * Parse options from `argv` returning `argv` + * void of these options. + * + * @param {Array} argv + * @return {Array} + * @api public + */ + +Command.prototype.parseOptions = function(argv) { + var args = [], + len = argv.length, + literal, + option, + arg; + + var unknownOptions = []; + + // parse options + for (var i = 0; i < len; ++i) { + arg = argv[i]; + + // literal args after -- + if (literal) { + args.push(arg); + continue; + } + + if (arg === '--') { + literal = true; + continue; + } + + // find matching Option + option = this.optionFor(arg); + + // option is defined + if (option) { + // requires arg + if (option.required) { + arg = argv[++i]; + if (arg == null) return this.optionMissingArgument(option); + this.emit('option:' + option.name(), arg); + // optional arg + } else if (option.optional) { + arg = argv[i + 1]; + if (arg == null || (arg[0] === '-' && arg !== '-')) { + arg = null; + } else { + ++i; + } + this.emit('option:' + option.name(), arg); + // bool + } else { + this.emit('option:' + option.name()); + } + continue; + } + + // looks like an option + if (arg.length > 1 && arg[0] === '-') { + unknownOptions.push(arg); + + // If the next argument looks like it might be + // an argument for this option, we pass it on. + // If it isn't, then it'll simply be ignored + if ((i + 1) < argv.length && argv[i + 1][0] !== '-') { + unknownOptions.push(argv[++i]); + } + continue; + } + + // arg + args.push(arg); + } + + return { args: args, unknown: unknownOptions }; +}; + +/** + * Return an object containing options as key-value pairs + * + * @return {Object} + * @api public + */ +Command.prototype.opts = function() { + var result = {}, + len = this.options.length; + + for (var i = 0; i < len; i++) { + var key = this.options[i].attributeName(); + result[key] = key === this._versionOptionName ? this._version : this[key]; + } + return result; +}; + +/** + * Argument `name` is missing. + * + * @param {String} name + * @api private + */ + +Command.prototype.missingArgument = function(name) { + console.error(); + console.error(" error: missing required argument `%s'", name); + console.error(); + process.exit(1); +}; + +/** + * `Option` is missing an argument, but received `flag` or nothing. + * + * @param {String} option + * @param {String} flag + * @api private + */ + +Command.prototype.optionMissingArgument = function(option, flag) { + console.error(); + if (flag) { + console.error(" error: option `%s' argument missing, got `%s'", option.flags, flag); + } else { + console.error(" error: option `%s' argument missing", option.flags); + } + console.error(); + process.exit(1); +}; + +/** + * Unknown option `flag`. + * + * @param {String} flag + * @api private + */ + +Command.prototype.unknownOption = function(flag) { + if (this._allowUnknownOption) return; + console.error(); + console.error(" error: unknown option `%s'", flag); + console.error(); + process.exit(1); +}; + +/** + * Variadic argument with `name` is not the last argument as required. + * + * @param {String} name + * @api private + */ + +Command.prototype.variadicArgNotLast = function(name) { + console.error(); + console.error(" error: variadic arguments must be last `%s'", name); + console.error(); + process.exit(1); +}; + +/** + * Set the program version to `str`. + * + * This method auto-registers the "-V, --version" flag + * which will print the version number when passed. + * + * @param {String} str + * @param {String} [flags] + * @return {Command} for chaining + * @api public + */ + +Command.prototype.version = function(str, flags) { + if (arguments.length === 0) return this._version; + this._version = str; + flags = flags || '-V, --version'; + var versionOption = new Option(flags, 'output the version number'); + this._versionOptionName = versionOption.long.substr(2) || 'version'; + this.options.push(versionOption); + this.on('option:' + this._versionOptionName, function() { + process.stdout.write(str + '\n'); + process.exit(0); + }); + return this; +}; + +/** + * Set the description to `str`. + * + * @param {String} str + * @param {Object} argsDescription + * @return {String|Command} + * @api public + */ + +Command.prototype.description = function(str, argsDescription) { + if (arguments.length === 0) return this._description; + this._description = str; + this._argsDescription = argsDescription; + return this; +}; + +/** + * Set an alias for the command + * + * @param {String} alias + * @return {String|Command} + * @api public + */ + +Command.prototype.alias = function(alias) { + var command = this; + if (this.commands.length !== 0) { + command = this.commands[this.commands.length - 1]; + } + + if (arguments.length === 0) return command._alias; + + if (alias === command._name) throw new Error('Command alias can\'t be the same as its name'); + + command._alias = alias; + return this; +}; + +/** + * Set / get the command usage `str`. + * + * @param {String} str + * @return {String|Command} + * @api public + */ + +Command.prototype.usage = function(str) { + var args = this._args.map(function(arg) { + return humanReadableArgName(arg); + }); + + var usage = '[options]' + + (this.commands.length ? ' [command]' : '') + + (this._args.length ? ' ' + args.join(' ') : ''); + + if (arguments.length === 0) return this._usage || usage; + this._usage = str; + + return this; +}; + +/** + * Get or set the name of the command + * + * @param {String} str + * @return {String|Command} + * @api public + */ + +Command.prototype.name = function(str) { + if (arguments.length === 0) return this._name; + this._name = str; + return this; +}; + +/** + * Return prepared commands. + * + * @return {Array} + * @api private + */ + +Command.prototype.prepareCommands = function() { + return this.commands.filter(function(cmd) { + return !cmd._noHelp; + }).map(function(cmd) { + var args = cmd._args.map(function(arg) { + return humanReadableArgName(arg); + }).join(' '); + + return [ + cmd._name + + (cmd._alias ? '|' + cmd._alias : '') + + (cmd.options.length ? ' [options]' : '') + + (args ? ' ' + args : ''), + cmd._description + ]; + }); +}; + +/** + * Return the largest command length. + * + * @return {Number} + * @api private + */ + +Command.prototype.largestCommandLength = function() { + var commands = this.prepareCommands(); + return commands.reduce(function(max, command) { + return Math.max(max, command[0].length); + }, 0); +}; + +/** + * Return the largest option length. + * + * @return {Number} + * @api private + */ + +Command.prototype.largestOptionLength = function() { + var options = [].slice.call(this.options); + options.push({ + flags: '-h, --help' + }); + return options.reduce(function(max, option) { + return Math.max(max, option.flags.length); + }, 0); +}; + +/** + * Return the largest arg length. + * + * @return {Number} + * @api private + */ + +Command.prototype.largestArgLength = function() { + return this._args.reduce(function(max, arg) { + return Math.max(max, arg.name.length); + }, 0); +}; + +/** + * Return the pad width. + * + * @return {Number} + * @api private + */ + +Command.prototype.padWidth = function() { + var width = this.largestOptionLength(); + if (this._argsDescription && this._args.length) { + if (this.largestArgLength() > width) { + width = this.largestArgLength(); + } + } + + if (this.commands && this.commands.length) { + if (this.largestCommandLength() > width) { + width = this.largestCommandLength(); + } + } + + return width; +}; + +/** + * Return help for options. + * + * @return {String} + * @api private + */ + +Command.prototype.optionHelp = function() { + var width = this.padWidth(); + + // Append the help information + return this.options.map(function(option) { + return pad(option.flags, width) + ' ' + option.description + + ((option.bool && option.defaultValue !== undefined) ? ' (default: ' + option.defaultValue + ')' : ''); + }).concat([pad('-h, --help', width) + ' ' + 'output usage information']) + .join('\n'); +}; + +/** + * Return command help documentation. + * + * @return {String} + * @api private + */ + +Command.prototype.commandHelp = function() { + if (!this.commands.length) return ''; + + var commands = this.prepareCommands(); + var width = this.padWidth(); + + return [ + ' Commands:', + '', + commands.map(function(cmd) { + var desc = cmd[1] ? ' ' + cmd[1] : ''; + return (desc ? pad(cmd[0], width) : cmd[0]) + desc; + }).join('\n').replace(/^/gm, ' '), + '' + ].join('\n'); +}; + +/** + * Return program help documentation. + * + * @return {String} + * @api private + */ + +Command.prototype.helpInformation = function() { + var desc = []; + if (this._description) { + desc = [ + ' ' + this._description, + '' + ]; + + var argsDescription = this._argsDescription; + if (argsDescription && this._args.length) { + var width = this.padWidth(); + desc.push(' Arguments:'); + desc.push(''); + this._args.forEach(function(arg) { + desc.push(' ' + pad(arg.name, width) + ' ' + argsDescription[arg.name]); + }); + desc.push(''); + } + } + + var cmdName = this._name; + if (this._alias) { + cmdName = cmdName + '|' + this._alias; + } + var usage = [ + '', + ' Usage: ' + cmdName + ' ' + this.usage(), + '' + ]; + + var cmds = []; + var commandHelp = this.commandHelp(); + if (commandHelp) cmds = [commandHelp]; + + var options = [ + ' Options:', + '', + '' + this.optionHelp().replace(/^/gm, ' '), + '' + ]; + + return usage + .concat(desc) + .concat(options) + .concat(cmds) + .join('\n'); +}; + +/** + * Output help information for this command + * + * @api public + */ + +Command.prototype.outputHelp = function(cb) { + if (!cb) { + cb = function(passthru) { + return passthru; + }; + } + process.stdout.write(cb(this.helpInformation())); + this.emit('--help'); +}; + +/** + * Output help information and exit. + * + * @api public + */ + +Command.prototype.help = function(cb) { + this.outputHelp(cb); + process.exit(); +}; + +/** + * Camel-case the given `flag` + * + * @param {String} flag + * @return {String} + * @api private + */ + +function camelcase(flag) { + return flag.split('-').reduce(function(str, word) { + return str + word[0].toUpperCase() + word.slice(1); + }); +} + +/** + * Pad `str` to `width`. + * + * @param {String} str + * @param {Number} width + * @return {String} + * @api private + */ + +function pad(str, width) { + var len = Math.max(0, width - str.length); + return str + Array(len + 1).join(' '); +} + +/** + * Output help information if necessary + * + * @param {Command} command to output help for + * @param {Array} array of options to search for -h or --help + * @api private + */ + +function outputHelpIfNecessary(cmd, options) { + options = options || []; + for (var i = 0; i < options.length; i++) { + if (options[i] === '--help' || options[i] === '-h') { + cmd.outputHelp(); + process.exit(0); + } + } +} + +/** + * Takes an argument an returns its human readable equivalent for help usage. + * + * @param {Object} arg + * @return {String} + * @api private + */ + +function humanReadableArgName(arg) { + var nameOutput = arg.name + (arg.variadic === true ? '...' : ''); + + return arg.required + ? '<' + nameOutput + '>' + : '[' + nameOutput + ']'; +} + +// for versions before node v0.8 when there weren't `fs.existsSync` +function exists(file) { + try { + if (fs.statSync(file).isFile()) { + return true; + } + } catch (e) { + return false; + } +} diff --git a/node_modules/commander/package.json b/node_modules/commander/package.json new file mode 100644 index 0000000..5f52fe8 --- /dev/null +++ b/node_modules/commander/package.json @@ -0,0 +1,116 @@ +{ + "_args": [ + [ + "commander@2.15.1", + "/home/licence/helayelq/Integration/my-test-project/node_modules/mocha" + ] + ], + "_from": "commander@2.15.1", + "_hasShrinkwrap": false, + "_id": "commander@2.15.1", + "_inCache": true, + "_installable": true, + "_location": "/commander", + "_nodeVersion": "9.8.0", + "_npmOperationalInternal": { + "host": "s3://npm-registry-packages", + "tmp": "tmp/commander_2.15.1_1521510442790_0.20361588610282877" + }, + "_npmUser": { + "email": "abe@enzou.tokyo", + "name": "abetomo" + }, + "_npmVersion": "5.6.0", + "_phantomChildren": {}, + "_requested": { + "name": "commander", + "raw": "commander@2.15.1", + "rawSpec": "2.15.1", + "scope": null, + "spec": "2.15.1", + "type": "version" + }, + "_requiredBy": [ + "/mocha" + ], + "_resolved": "https://registry.npmjs.org/commander/-/commander-2.15.1.tgz", + "_shasum": "df46e867d0fc2aec66a34662b406a9ccafff5b0f", + "_shrinkwrap": null, + "_spec": "commander@2.15.1", + "_where": "/home/licence/helayelq/Integration/my-test-project/node_modules/mocha", + "author": { + "email": "tj@vision-media.ca", + "name": "TJ Holowaychuk" + }, + "bugs": { + "url": "https://github.com/tj/commander.js/issues" + }, + "dependencies": {}, + "description": "the complete solution for node.js command-line programs", + "devDependencies": { + "@types/node": "^7.0.55", + "eslint": "^3.19.0", + "should": "^11.2.1", + "sinon": "^2.4.1", + "standard": "^10.0.3", + "typescript": "^2.7.2" + }, + "directories": {}, + "dist": { + "fileCount": 6, + "integrity": "sha512-VlfT9F3V0v+jr4yxPc5gg9s62/fIVWsd2Bk2iD435um1NlGMYdVCq+MjcXnhYq2icNOizHr1kK+5TI6H0Hy0ag==", + "shasum": "df46e867d0fc2aec66a34662b406a9ccafff5b0f", + "tarball": "https://registry.npmjs.org/commander/-/commander-2.15.1.tgz", + "unpackedSize": 59781 + }, + "files": [ + "index.js", + "typings/index.d.ts" + ], + "gitHead": "649eaef336ddc7224eb5c73e4a958685e24de25e", + "homepage": "https://github.com/tj/commander.js#readme", + "keywords": [ + "command", + "commander", + "option", + "parser" + ], + "license": "MIT", + "main": "index", + "maintainers": [ + { + "name": "abetomo", + "email": "abe@enzou.tokyo" + }, + { + "name": "somekittens", + "email": "rkoutnik@gmail.com" + }, + { + "name": "tjholowaychuk", + "email": "tj@vision-media.ca" + }, + { + "name": "vanesyan", + "email": "romain.vanesyan@gmail.com" + }, + { + "name": "zhiyelee", + "email": "zhiyelee@gmail.com" + } + ], + "name": "commander", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/tj/commander.js.git" + }, + "scripts": { + "lint": "eslint index.js", + "test": "make test && npm run test-typings", + "test-typings": "node_modules/typescript/bin/tsc -p tsconfig.json" + }, + "typings": "typings/index.d.ts", + "version": "2.15.1" +} diff --git a/node_modules/commander/typings/index.d.ts b/node_modules/commander/typings/index.d.ts new file mode 100644 index 0000000..4830767 --- /dev/null +++ b/node_modules/commander/typings/index.d.ts @@ -0,0 +1,309 @@ +// Type definitions for commander 2.11 +// Project: https://github.com/visionmedia/commander.js +// Definitions by: Alan Agius , Marcelo Dezem , vvakame , Jules Randolph +// Definitions: https://github.com/DefinitelyTyped/DefinitelyTyped + +declare namespace local { + + class Option { + flags: string; + required: boolean; + optional: boolean; + bool: boolean; + short?: string; + long: string; + description: string; + + /** + * Initialize a new `Option` with the given `flags` and `description`. + * + * @param {string} flags + * @param {string} [description] + */ + constructor(flags: string, description?: string); + } + + class Command extends NodeJS.EventEmitter { + [key: string]: any; + + args: string[]; + + /** + * Initialize a new `Command`. + * + * @param {string} [name] + */ + constructor(name?: string); + + /** + * Set the program version to `str`. + * + * This method auto-registers the "-V, --version" flag + * which will print the version number when passed. + * + * @param {string} str + * @param {string} [flags] + * @returns {Command} for chaining + */ + version(str: string, flags?: string): Command; + + /** + * Add command `name`. + * + * The `.action()` callback is invoked when the + * command `name` is specified via __ARGV__, + * and the remaining arguments are applied to the + * function for access. + * + * When the `name` is "*" an un-matched command + * will be passed as the first arg, followed by + * the rest of __ARGV__ remaining. + * + * @example + * program + * .version('0.0.1') + * .option('-C, --chdir ', 'change the working directory') + * .option('-c, --config ', 'set config path. defaults to ./deploy.conf') + * .option('-T, --no-tests', 'ignore test hook') + * + * program + * .command('setup') + * .description('run remote setup commands') + * .action(function() { + * console.log('setup'); + * }); + * + * program + * .command('exec ') + * .description('run the given remote command') + * .action(function(cmd) { + * console.log('exec "%s"', cmd); + * }); + * + * program + * .command('teardown [otherDirs...]') + * .description('run teardown commands') + * .action(function(dir, otherDirs) { + * console.log('dir "%s"', dir); + * if (otherDirs) { + * otherDirs.forEach(function (oDir) { + * console.log('dir "%s"', oDir); + * }); + * } + * }); + * + * program + * .command('*') + * .description('deploy the given env') + * .action(function(env) { + * console.log('deploying "%s"', env); + * }); + * + * program.parse(process.argv); + * + * @param {string} name + * @param {string} [desc] for git-style sub-commands + * @param {CommandOptions} [opts] command options + * @returns {Command} the new command + */ + command(name: string, desc?: string, opts?: commander.CommandOptions): Command; + + /** + * Define argument syntax for the top-level command. + * + * @param {string} desc + * @returns {Command} for chaining + */ + arguments(desc: string): Command; + + /** + * Parse expected `args`. + * + * For example `["[type]"]` becomes `[{ required: false, name: 'type' }]`. + * + * @param {string[]} args + * @returns {Command} for chaining + */ + parseExpectedArgs(args: string[]): Command; + + /** + * Register callback `fn` for the command. + * + * @example + * program + * .command('help') + * .description('display verbose help') + * .action(function() { + * // output help here + * }); + * + * @param {(...args: any[]) => void} fn + * @returns {Command} for chaining + */ + action(fn: (...args: any[]) => void): Command; + + /** + * Define option with `flags`, `description` and optional + * coercion `fn`. + * + * The `flags` string should contain both the short and long flags, + * separated by comma, a pipe or space. The following are all valid + * all will output this way when `--help` is used. + * + * "-p, --pepper" + * "-p|--pepper" + * "-p --pepper" + * + * @example + * // simple boolean defaulting to false + * program.option('-p, --pepper', 'add pepper'); + * + * --pepper + * program.pepper + * // => Boolean + * + * // simple boolean defaulting to true + * program.option('-C, --no-cheese', 'remove cheese'); + * + * program.cheese + * // => true + * + * --no-cheese + * program.cheese + * // => false + * + * // required argument + * program.option('-C, --chdir ', 'change the working directory'); + * + * --chdir /tmp + * program.chdir + * // => "/tmp" + * + * // optional argument + * program.option('-c, --cheese [type]', 'add cheese [marble]'); + * + * @param {string} flags + * @param {string} [description] + * @param {((arg1: any, arg2: any) => void) | RegExp} [fn] function or default + * @param {*} [defaultValue] + * @returns {Command} for chaining + */ + option(flags: string, description?: string, fn?: ((arg1: any, arg2: any) => void) | RegExp, defaultValue?: any): Command; + option(flags: string, description?: string, defaultValue?: any): Command; + + /** + * Allow unknown options on the command line. + * + * @param {boolean} [arg] if `true` or omitted, no error will be thrown for unknown options. + * @returns {Command} for chaining + */ + allowUnknownOption(arg?: boolean): Command; + + /** + * Parse `argv`, settings options and invoking commands when defined. + * + * @param {string[]} argv + * @returns {Command} for chaining + */ + parse(argv: string[]): Command; + + /** + * Parse options from `argv` returning `argv` void of these options. + * + * @param {string[]} argv + * @returns {ParseOptionsResult} + */ + parseOptions(argv: string[]): commander.ParseOptionsResult; + + /** + * Return an object containing options as key-value pairs + * + * @returns {{[key: string]: string}} + */ + opts(): { [key: string]: string }; + + /** + * Set the description to `str`. + * + * @param {string} str + * @return {(Command | string)} + */ + description(str: string): Command; + description(): string; + + /** + * Set an alias for the command. + * + * @param {string} alias + * @return {(Command | string)} + */ + alias(alias: string): Command; + alias(): string; + + /** + * Set or get the command usage. + * + * @param {string} str + * @return {(Command | string)} + */ + usage(str: string): Command; + usage(): string; + + /** + * Set the name of the command. + * + * @param {string} str + * @return {Command} + */ + name(str: string): Command; + + /** + * Get the name of the command. + * + * @return {string} + */ + name(): string; + + /** + * Output help information for this command. + * + * @param {(str: string) => string} [cb] + */ + outputHelp(cb?: (str: string) => string): void; + + /** Output help information and exit. + * + * @param {(str: string) => string} [cb] + */ + help(cb?: (str: string) => string): void; + } + +} + +declare namespace commander { + + type Command = local.Command + + type Option = local.Option + + interface CommandOptions { + noHelp?: boolean; + isDefault?: boolean; + } + + interface ParseOptionsResult { + args: string[]; + unknown: string[]; + } + + interface CommanderStatic extends Command { + Command: typeof local.Command; + Option: typeof local.Option; + CommandOptions: CommandOptions; + ParseOptionsResult: ParseOptionsResult; + } + +} + +declare const commander: commander.CommanderStatic; +export = commander; diff --git a/node_modules/concat-map/.travis.yml b/node_modules/concat-map/.travis.yml new file mode 100644 index 0000000..f1d0f13 --- /dev/null +++ b/node_modules/concat-map/.travis.yml @@ -0,0 +1,4 @@ +language: node_js +node_js: + - 0.4 + - 0.6 diff --git a/node_modules/concat-map/LICENSE b/node_modules/concat-map/LICENSE new file mode 100644 index 0000000..ee27ba4 --- /dev/null +++ b/node_modules/concat-map/LICENSE @@ -0,0 +1,18 @@ +This software is released under the MIT license: + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/concat-map/README.markdown b/node_modules/concat-map/README.markdown new file mode 100644 index 0000000..408f70a --- /dev/null +++ b/node_modules/concat-map/README.markdown @@ -0,0 +1,62 @@ +concat-map +========== + +Concatenative mapdashery. + +[![browser support](http://ci.testling.com/substack/node-concat-map.png)](http://ci.testling.com/substack/node-concat-map) + +[![build status](https://secure.travis-ci.org/substack/node-concat-map.png)](http://travis-ci.org/substack/node-concat-map) + +example +======= + +``` js +var concatMap = require('concat-map'); +var xs = [ 1, 2, 3, 4, 5, 6 ]; +var ys = concatMap(xs, function (x) { + return x % 2 ? [ x - 0.1, x, x + 0.1 ] : []; +}); +console.dir(ys); +``` + +*** + +``` +[ 0.9, 1, 1.1, 2.9, 3, 3.1, 4.9, 5, 5.1 ] +``` + +methods +======= + +``` js +var concatMap = require('concat-map') +``` + +concatMap(xs, fn) +----------------- + +Return an array of concatenated elements by calling `fn(x, i)` for each element +`x` and each index `i` in the array `xs`. + +When `fn(x, i)` returns an array, its result will be concatenated with the +result array. If `fn(x, i)` returns anything else, that value will be pushed +onto the end of the result array. + +install +======= + +With [npm](http://npmjs.org) do: + +``` +npm install concat-map +``` + +license +======= + +MIT + +notes +===== + +This module was written while sitting high above the ground in a tree. diff --git a/node_modules/concat-map/example/map.js b/node_modules/concat-map/example/map.js new file mode 100644 index 0000000..3365621 --- /dev/null +++ b/node_modules/concat-map/example/map.js @@ -0,0 +1,6 @@ +var concatMap = require('../'); +var xs = [ 1, 2, 3, 4, 5, 6 ]; +var ys = concatMap(xs, function (x) { + return x % 2 ? [ x - 0.1, x, x + 0.1 ] : []; +}); +console.dir(ys); diff --git a/node_modules/concat-map/index.js b/node_modules/concat-map/index.js new file mode 100644 index 0000000..b29a781 --- /dev/null +++ b/node_modules/concat-map/index.js @@ -0,0 +1,13 @@ +module.exports = function (xs, fn) { + var res = []; + for (var i = 0; i < xs.length; i++) { + var x = fn(xs[i], i); + if (isArray(x)) res.push.apply(res, x); + else res.push(x); + } + return res; +}; + +var isArray = Array.isArray || function (xs) { + return Object.prototype.toString.call(xs) === '[object Array]'; +}; diff --git a/node_modules/concat-map/package.json b/node_modules/concat-map/package.json new file mode 100644 index 0000000..82e63cc --- /dev/null +++ b/node_modules/concat-map/package.json @@ -0,0 +1,109 @@ +{ + "_args": [ + [ + "concat-map@0.0.1", + "/home/licence/helayelq/Integration/my-test-project/node_modules/brace-expansion" + ] + ], + "_from": "concat-map@0.0.1", + "_id": "concat-map@0.0.1", + "_inCache": true, + "_installable": true, + "_location": "/concat-map", + "_npmUser": { + "email": "mail@substack.net", + "name": "substack" + }, + "_npmVersion": "1.3.21", + "_phantomChildren": {}, + "_requested": { + "name": "concat-map", + "raw": "concat-map@0.0.1", + "rawSpec": "0.0.1", + "scope": null, + "spec": "0.0.1", + "type": "version" + }, + "_requiredBy": [ + "/brace-expansion" + ], + "_resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", + "_shasum": "d8a96bd77fd68df7793a73036a3ba0d5405d477b", + "_shrinkwrap": null, + "_spec": "concat-map@0.0.1", + "_where": "/home/licence/helayelq/Integration/my-test-project/node_modules/brace-expansion", + "author": { + "email": "mail@substack.net", + "name": "James Halliday", + "url": "http://substack.net" + }, + "bugs": { + "url": "https://github.com/substack/node-concat-map/issues" + }, + "dependencies": {}, + "description": "concatenative mapdashery", + "devDependencies": { + "tape": "~2.4.0" + }, + "directories": { + "example": "example", + "test": "test" + }, + "dist": { + "shasum": "d8a96bd77fd68df7793a73036a3ba0d5405d477b", + "tarball": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz" + }, + "homepage": "https://github.com/substack/node-concat-map", + "keywords": [ + "concat", + "concatMap", + "functional", + "higher-order", + "map" + ], + "license": "MIT", + "main": "index.js", + "maintainers": [ + { + "name": "substack", + "email": "mail@substack.net" + } + ], + "name": "concat-map", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/substack/node-concat-map.git" + }, + "scripts": { + "test": "tape test/*.js" + }, + "testling": { + "browsers": { + "chrome": [ + 10, + 22 + ], + "ff": [ + 10, + 15, + 3.5 + ], + "ie": [ + 6, + 7, + 8, + 9 + ], + "opera": [ + 12 + ], + "safari": [ + 5.1 + ] + }, + "files": "test/*.js" + }, + "version": "0.0.1" +} diff --git a/node_modules/concat-map/test/map.js b/node_modules/concat-map/test/map.js new file mode 100644 index 0000000..fdbd702 --- /dev/null +++ b/node_modules/concat-map/test/map.js @@ -0,0 +1,39 @@ +var concatMap = require('../'); +var test = require('tape'); + +test('empty or not', function (t) { + var xs = [ 1, 2, 3, 4, 5, 6 ]; + var ixes = []; + var ys = concatMap(xs, function (x, ix) { + ixes.push(ix); + return x % 2 ? [ x - 0.1, x, x + 0.1 ] : []; + }); + t.same(ys, [ 0.9, 1, 1.1, 2.9, 3, 3.1, 4.9, 5, 5.1 ]); + t.same(ixes, [ 0, 1, 2, 3, 4, 5 ]); + t.end(); +}); + +test('always something', function (t) { + var xs = [ 'a', 'b', 'c', 'd' ]; + var ys = concatMap(xs, function (x) { + return x === 'b' ? [ 'B', 'B', 'B' ] : [ x ]; + }); + t.same(ys, [ 'a', 'B', 'B', 'B', 'c', 'd' ]); + t.end(); +}); + +test('scalars', function (t) { + var xs = [ 'a', 'b', 'c', 'd' ]; + var ys = concatMap(xs, function (x) { + return x === 'b' ? [ 'B', 'B', 'B' ] : x; + }); + t.same(ys, [ 'a', 'B', 'B', 'B', 'c', 'd' ]); + t.end(); +}); + +test('undefs', function (t) { + var xs = [ 'a', 'b', 'c', 'd' ]; + var ys = concatMap(xs, function () {}); + t.same(ys, [ undefined, undefined, undefined, undefined ]); + t.end(); +}); diff --git a/node_modules/console-browserify/.npmignore b/node_modules/console-browserify/.npmignore new file mode 100644 index 0000000..aa3fd4b --- /dev/null +++ b/node_modules/console-browserify/.npmignore @@ -0,0 +1,14 @@ +.DS_Store +.monitor +.*.swp +.nodemonignore +releases +*.log +*.err +fleet.json +public/browserify +bin/*.json +.bin +build +compile +.lock-wscript diff --git a/node_modules/console-browserify/.testem.json b/node_modules/console-browserify/.testem.json new file mode 100644 index 0000000..633c2ba --- /dev/null +++ b/node_modules/console-browserify/.testem.json @@ -0,0 +1,14 @@ +{ + "launchers": { + "node": { + "command": "npm test" + } + }, + "src_files": [ + "./**/*.js" + ], + "before_tests": "npm run build", + "on_exit": "rm test/static/bundle.js", + "test_page": "test/static/index.html", + "launch_in_dev": ["node", "phantomjs"] +} diff --git a/node_modules/console-browserify/.travis.yml b/node_modules/console-browserify/.travis.yml new file mode 100644 index 0000000..ed178f6 --- /dev/null +++ b/node_modules/console-browserify/.travis.yml @@ -0,0 +1,4 @@ +language: node_js +node_js: + - 0.8 + - 0.9 diff --git a/node_modules/console-browserify/LICENCE b/node_modules/console-browserify/LICENCE new file mode 100644 index 0000000..a23e08a --- /dev/null +++ b/node_modules/console-browserify/LICENCE @@ -0,0 +1,19 @@ +Copyright (c) 2012 Raynos. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. \ No newline at end of file diff --git a/node_modules/console-browserify/README.md b/node_modules/console-browserify/README.md new file mode 100644 index 0000000..572615e --- /dev/null +++ b/node_modules/console-browserify/README.md @@ -0,0 +1,33 @@ +# console-browserify + +[![build status][1]][2] + +[![browser support][3]][4] + + +Emulate console for all the browsers + +## Example + +```js +var console = require("console-browserify") + +console.log("hello world!") +``` + +## Installation + +`npm install console-browserify` + +## Contributors + + - Raynos + +## MIT Licenced + + + + [1]: https://secure.travis-ci.org/Raynos/console-browserify.png + [2]: http://travis-ci.org/Raynos/console-browserify + [3]: http://ci.testling.com/Raynos/console-browserify.png + [4]: http://ci.testling.com/Raynos/console-browserify diff --git a/node_modules/console-browserify/index.js b/node_modules/console-browserify/index.js new file mode 100644 index 0000000..af433ce --- /dev/null +++ b/node_modules/console-browserify/index.js @@ -0,0 +1,86 @@ +/*global window, global*/ +var util = require("util") +var assert = require("assert") +var now = require("date-now") + +var slice = Array.prototype.slice +var console +var times = {} + +if (typeof global !== "undefined" && global.console) { + console = global.console +} else if (typeof window !== "undefined" && window.console) { + console = window.console +} else { + console = {} +} + +var functions = [ + [log, "log"], + [info, "info"], + [warn, "warn"], + [error, "error"], + [time, "time"], + [timeEnd, "timeEnd"], + [trace, "trace"], + [dir, "dir"], + [consoleAssert, "assert"] +] + +for (var i = 0; i < functions.length; i++) { + var tuple = functions[i] + var f = tuple[0] + var name = tuple[1] + + if (!console[name]) { + console[name] = f + } +} + +module.exports = console + +function log() {} + +function info() { + console.log.apply(console, arguments) +} + +function warn() { + console.log.apply(console, arguments) +} + +function error() { + console.warn.apply(console, arguments) +} + +function time(label) { + times[label] = now() +} + +function timeEnd(label) { + var time = times[label] + if (!time) { + throw new Error("No such label: " + label) + } + + var duration = now() - time + console.log(label + ": " + duration + "ms") +} + +function trace() { + var err = new Error() + err.name = "Trace" + err.message = util.format.apply(null, arguments) + console.error(err.stack) +} + +function dir(object) { + console.log(util.inspect(object) + "\n") +} + +function consoleAssert(expression) { + if (!expression) { + var arr = slice.call(arguments, 1) + assert.ok(false, util.format.apply(null, arr)) + } +} diff --git a/node_modules/console-browserify/package.json b/node_modules/console-browserify/package.json new file mode 100644 index 0000000..24be538 --- /dev/null +++ b/node_modules/console-browserify/package.json @@ -0,0 +1,114 @@ +{ + "_args": [ + [ + "console-browserify@1.1.x", + "/home/licence/helayelq/Integration/my-test-project/node_modules/jshint" + ] + ], + "_from": "console-browserify@>=1.1.0 <1.2.0", + "_id": "console-browserify@1.1.0", + "_inCache": true, + "_installable": true, + "_location": "/console-browserify", + "_npmUser": { + "email": "raynos2@gmail.com", + "name": "raynos" + }, + "_npmVersion": "1.4.6", + "_phantomChildren": {}, + "_requested": { + "name": "console-browserify", + "raw": "console-browserify@1.1.x", + "rawSpec": "1.1.x", + "scope": null, + "spec": ">=1.1.0 <1.2.0", + "type": "range" + }, + "_requiredBy": [ + "/jshint" + ], + "_resolved": "https://registry.npmjs.org/console-browserify/-/console-browserify-1.1.0.tgz", + "_shasum": "f0241c45730a9fc6323b206dbf38edc741d0bb10", + "_shrinkwrap": null, + "_spec": "console-browserify@1.1.x", + "_where": "/home/licence/helayelq/Integration/my-test-project/node_modules/jshint", + "author": { + "email": "raynos2@gmail.com", + "name": "Raynos" + }, + "bugs": { + "email": "raynos2@gmail.com", + "url": "https://github.com/Raynos/console-browserify/issues" + }, + "contributors": [ + { + "name": "Raynos" + } + ], + "dependencies": { + "date-now": "^0.1.4" + }, + "description": "Emulate console for all the browsers", + "devDependencies": { + "jsonify": "0.0.0", + "run-browser": "^1.3.0", + "tap-dot": "^0.2.1", + "tap-spec": "^0.1.8", + "tape": "^2.12.3" + }, + "directories": {}, + "dist": { + "shasum": "f0241c45730a9fc6323b206dbf38edc741d0bb10", + "tarball": "https://registry.npmjs.org/console-browserify/-/console-browserify-1.1.0.tgz" + }, + "homepage": "https://github.com/Raynos/console-browserify", + "keywords": [], + "licenses": [ + { + "type": "MIT", + "url": "http://github.com/Raynos/console-browserify/raw/master/LICENSE" + } + ], + "main": "index", + "maintainers": [ + { + "name": "raynos", + "email": "raynos2@gmail.com" + } + ], + "name": "console-browserify", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/Raynos/console-browserify.git" + }, + "scripts": { + "browser": "run-browser test/index.js", + "build": "browserify test/index.js -o test/static/bundle.js", + "cover": "istanbul cover --report none --print detail ./test/index.js", + "dot": "node ./test/index.js | tap-dot", + "phantom": "run-browser test/index.js -b | tap-spec", + "start": "node ./index.js", + "test": "node ./test/index.js | tap-spec", + "testem": "testem", + "view-cover": "istanbul report html && google-chrome ./coverage/index.html" + }, + "testling": { + "browsers": [ + "android-browser/4.2..latest", + "chrome/22..latest", + "chrome/canary", + "firefox/16..latest", + "firefox/nightly", + "ie/8..latest", + "ipad/6.0..latest", + "iphone/6.0..latest", + "opera/12..latest", + "opera/next", + "safari/5.1..latest" + ], + "files": "test/index.js" + }, + "version": "1.1.0" +} diff --git a/node_modules/console-browserify/test/index.js b/node_modules/console-browserify/test/index.js new file mode 100644 index 0000000..26dfaad --- /dev/null +++ b/node_modules/console-browserify/test/index.js @@ -0,0 +1,67 @@ +var console = require("../index") +var test = require("tape") + +if (typeof window !== "undefined" && !window.JSON) { + window.JSON = require("jsonify") +} + +test("console has expected methods", function (assert) { + assert.ok(console.log) + assert.ok(console.info) + assert.ok(console.warn) + assert.ok(console.dir) + assert.ok(console.time, "time") + assert.ok(console.timeEnd, "timeEnd") + assert.ok(console.trace, "trace") + assert.ok(console.assert) + + assert.end() +}) + +test("invoke console.log", function (assert) { + console.log("test-log") + + assert.end() +}) + +test("invoke console.info", function (assert) { + console.info("test-info") + + assert.end() +}) + +test("invoke console.warn", function (assert) { + console.warn("test-warn") + + assert.end() +}) + +test("invoke console.time", function (assert) { + console.time("label") + + assert.end() +}) + +test("invoke console.trace", function (assert) { + console.trace("test-trace") + + assert.end() +}) + +test("invoke console.assert", function (assert) { + console.assert(true) + + assert.end() +}) + +test("invoke console.dir", function (assert) { + console.dir("test-dir") + + assert.end() +}) + +test("invoke console.timeEnd", function (assert) { + console.timeEnd("label") + + assert.end() +}) diff --git a/node_modules/console-browserify/test/static/index.html b/node_modules/console-browserify/test/static/index.html new file mode 100644 index 0000000..dd55012 --- /dev/null +++ b/node_modules/console-browserify/test/static/index.html @@ -0,0 +1,12 @@ + + + + + TAPE Example + + + + + + + diff --git a/node_modules/console-browserify/test/static/test-adapter.js b/node_modules/console-browserify/test/static/test-adapter.js new file mode 100644 index 0000000..8b4c12d --- /dev/null +++ b/node_modules/console-browserify/test/static/test-adapter.js @@ -0,0 +1,53 @@ +(function () { + var Testem = window.Testem + var regex = /^((?:not )?ok) (\d+) (.+)$/ + + Testem.useCustomAdapter(tapAdapter) + + function tapAdapter(socket){ + var results = { + failed: 0 + , passed: 0 + , total: 0 + , tests: [] + } + + socket.emit('tests-start') + + Testem.handleConsoleMessage = function(msg){ + var m = msg.match(regex) + if (m) { + var passed = m[1] === 'ok' + var test = { + passed: passed ? 1 : 0, + failed: passed ? 0 : 1, + total: 1, + id: m[2], + name: m[3], + items: [] + } + + if (passed) { + results.passed++ + } else { + console.error("failure", m) + + results.failed++ + } + + results.total++ + + // console.log("emitted test", test) + socket.emit('test-result', test) + results.tests.push(test) + } else if (msg === '# ok' || msg.match(/^# tests \d+/)){ + // console.log("emitted all test") + socket.emit('all-test-results', results) + } + + // return false if you want to prevent the console message from + // going to the console + // return false + } + } +}()) diff --git a/node_modules/core-util-is/LICENSE b/node_modules/core-util-is/LICENSE new file mode 100644 index 0000000..d8d7f94 --- /dev/null +++ b/node_modules/core-util-is/LICENSE @@ -0,0 +1,19 @@ +Copyright Node.js contributors. All rights reserved. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to +deal in the Software without restriction, including without limitation the +rights to use, copy, modify, merge, publish, distribute, sublicense, and/or +sell copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS +IN THE SOFTWARE. diff --git a/node_modules/core-util-is/README.md b/node_modules/core-util-is/README.md new file mode 100644 index 0000000..5a76b41 --- /dev/null +++ b/node_modules/core-util-is/README.md @@ -0,0 +1,3 @@ +# core-util-is + +The `util.is*` functions introduced in Node v0.12. diff --git a/node_modules/core-util-is/float.patch b/node_modules/core-util-is/float.patch new file mode 100644 index 0000000..a06d5c0 --- /dev/null +++ b/node_modules/core-util-is/float.patch @@ -0,0 +1,604 @@ +diff --git a/lib/util.js b/lib/util.js +index a03e874..9074e8e 100644 +--- a/lib/util.js ++++ b/lib/util.js +@@ -19,430 +19,6 @@ + // OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE + // USE OR OTHER DEALINGS IN THE SOFTWARE. + +-var formatRegExp = /%[sdj%]/g; +-exports.format = function(f) { +- if (!isString(f)) { +- var objects = []; +- for (var i = 0; i < arguments.length; i++) { +- objects.push(inspect(arguments[i])); +- } +- return objects.join(' '); +- } +- +- var i = 1; +- var args = arguments; +- var len = args.length; +- var str = String(f).replace(formatRegExp, function(x) { +- if (x === '%%') return '%'; +- if (i >= len) return x; +- switch (x) { +- case '%s': return String(args[i++]); +- case '%d': return Number(args[i++]); +- case '%j': +- try { +- return JSON.stringify(args[i++]); +- } catch (_) { +- return '[Circular]'; +- } +- default: +- return x; +- } +- }); +- for (var x = args[i]; i < len; x = args[++i]) { +- if (isNull(x) || !isObject(x)) { +- str += ' ' + x; +- } else { +- str += ' ' + inspect(x); +- } +- } +- return str; +-}; +- +- +-// Mark that a method should not be used. +-// Returns a modified function which warns once by default. +-// If --no-deprecation is set, then it is a no-op. +-exports.deprecate = function(fn, msg) { +- // Allow for deprecating things in the process of starting up. +- if (isUndefined(global.process)) { +- return function() { +- return exports.deprecate(fn, msg).apply(this, arguments); +- }; +- } +- +- if (process.noDeprecation === true) { +- return fn; +- } +- +- var warned = false; +- function deprecated() { +- if (!warned) { +- if (process.throwDeprecation) { +- throw new Error(msg); +- } else if (process.traceDeprecation) { +- console.trace(msg); +- } else { +- console.error(msg); +- } +- warned = true; +- } +- return fn.apply(this, arguments); +- } +- +- return deprecated; +-}; +- +- +-var debugs = {}; +-var debugEnviron; +-exports.debuglog = function(set) { +- if (isUndefined(debugEnviron)) +- debugEnviron = process.env.NODE_DEBUG || ''; +- set = set.toUpperCase(); +- if (!debugs[set]) { +- if (new RegExp('\\b' + set + '\\b', 'i').test(debugEnviron)) { +- var pid = process.pid; +- debugs[set] = function() { +- var msg = exports.format.apply(exports, arguments); +- console.error('%s %d: %s', set, pid, msg); +- }; +- } else { +- debugs[set] = function() {}; +- } +- } +- return debugs[set]; +-}; +- +- +-/** +- * Echos the value of a value. Trys to print the value out +- * in the best way possible given the different types. +- * +- * @param {Object} obj The object to print out. +- * @param {Object} opts Optional options object that alters the output. +- */ +-/* legacy: obj, showHidden, depth, colors*/ +-function inspect(obj, opts) { +- // default options +- var ctx = { +- seen: [], +- stylize: stylizeNoColor +- }; +- // legacy... +- if (arguments.length >= 3) ctx.depth = arguments[2]; +- if (arguments.length >= 4) ctx.colors = arguments[3]; +- if (isBoolean(opts)) { +- // legacy... +- ctx.showHidden = opts; +- } else if (opts) { +- // got an "options" object +- exports._extend(ctx, opts); +- } +- // set default options +- if (isUndefined(ctx.showHidden)) ctx.showHidden = false; +- if (isUndefined(ctx.depth)) ctx.depth = 2; +- if (isUndefined(ctx.colors)) ctx.colors = false; +- if (isUndefined(ctx.customInspect)) ctx.customInspect = true; +- if (ctx.colors) ctx.stylize = stylizeWithColor; +- return formatValue(ctx, obj, ctx.depth); +-} +-exports.inspect = inspect; +- +- +-// http://en.wikipedia.org/wiki/ANSI_escape_code#graphics +-inspect.colors = { +- 'bold' : [1, 22], +- 'italic' : [3, 23], +- 'underline' : [4, 24], +- 'inverse' : [7, 27], +- 'white' : [37, 39], +- 'grey' : [90, 39], +- 'black' : [30, 39], +- 'blue' : [34, 39], +- 'cyan' : [36, 39], +- 'green' : [32, 39], +- 'magenta' : [35, 39], +- 'red' : [31, 39], +- 'yellow' : [33, 39] +-}; +- +-// Don't use 'blue' not visible on cmd.exe +-inspect.styles = { +- 'special': 'cyan', +- 'number': 'yellow', +- 'boolean': 'yellow', +- 'undefined': 'grey', +- 'null': 'bold', +- 'string': 'green', +- 'date': 'magenta', +- // "name": intentionally not styling +- 'regexp': 'red' +-}; +- +- +-function stylizeWithColor(str, styleType) { +- var style = inspect.styles[styleType]; +- +- if (style) { +- return '\u001b[' + inspect.colors[style][0] + 'm' + str + +- '\u001b[' + inspect.colors[style][1] + 'm'; +- } else { +- return str; +- } +-} +- +- +-function stylizeNoColor(str, styleType) { +- return str; +-} +- +- +-function arrayToHash(array) { +- var hash = {}; +- +- array.forEach(function(val, idx) { +- hash[val] = true; +- }); +- +- return hash; +-} +- +- +-function formatValue(ctx, value, recurseTimes) { +- // Provide a hook for user-specified inspect functions. +- // Check that value is an object with an inspect function on it +- if (ctx.customInspect && +- value && +- isFunction(value.inspect) && +- // Filter out the util module, it's inspect function is special +- value.inspect !== exports.inspect && +- // Also filter out any prototype objects using the circular check. +- !(value.constructor && value.constructor.prototype === value)) { +- var ret = value.inspect(recurseTimes, ctx); +- if (!isString(ret)) { +- ret = formatValue(ctx, ret, recurseTimes); +- } +- return ret; +- } +- +- // Primitive types cannot have properties +- var primitive = formatPrimitive(ctx, value); +- if (primitive) { +- return primitive; +- } +- +- // Look up the keys of the object. +- var keys = Object.keys(value); +- var visibleKeys = arrayToHash(keys); +- +- if (ctx.showHidden) { +- keys = Object.getOwnPropertyNames(value); +- } +- +- // Some type of object without properties can be shortcutted. +- if (keys.length === 0) { +- if (isFunction(value)) { +- var name = value.name ? ': ' + value.name : ''; +- return ctx.stylize('[Function' + name + ']', 'special'); +- } +- if (isRegExp(value)) { +- return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp'); +- } +- if (isDate(value)) { +- return ctx.stylize(Date.prototype.toString.call(value), 'date'); +- } +- if (isError(value)) { +- return formatError(value); +- } +- } +- +- var base = '', array = false, braces = ['{', '}']; +- +- // Make Array say that they are Array +- if (isArray(value)) { +- array = true; +- braces = ['[', ']']; +- } +- +- // Make functions say that they are functions +- if (isFunction(value)) { +- var n = value.name ? ': ' + value.name : ''; +- base = ' [Function' + n + ']'; +- } +- +- // Make RegExps say that they are RegExps +- if (isRegExp(value)) { +- base = ' ' + RegExp.prototype.toString.call(value); +- } +- +- // Make dates with properties first say the date +- if (isDate(value)) { +- base = ' ' + Date.prototype.toUTCString.call(value); +- } +- +- // Make error with message first say the error +- if (isError(value)) { +- base = ' ' + formatError(value); +- } +- +- if (keys.length === 0 && (!array || value.length == 0)) { +- return braces[0] + base + braces[1]; +- } +- +- if (recurseTimes < 0) { +- if (isRegExp(value)) { +- return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp'); +- } else { +- return ctx.stylize('[Object]', 'special'); +- } +- } +- +- ctx.seen.push(value); +- +- var output; +- if (array) { +- output = formatArray(ctx, value, recurseTimes, visibleKeys, keys); +- } else { +- output = keys.map(function(key) { +- return formatProperty(ctx, value, recurseTimes, visibleKeys, key, array); +- }); +- } +- +- ctx.seen.pop(); +- +- return reduceToSingleString(output, base, braces); +-} +- +- +-function formatPrimitive(ctx, value) { +- if (isUndefined(value)) +- return ctx.stylize('undefined', 'undefined'); +- if (isString(value)) { +- var simple = '\'' + JSON.stringify(value).replace(/^"|"$/g, '') +- .replace(/'/g, "\\'") +- .replace(/\\"/g, '"') + '\''; +- return ctx.stylize(simple, 'string'); +- } +- if (isNumber(value)) { +- // Format -0 as '-0'. Strict equality won't distinguish 0 from -0, +- // so instead we use the fact that 1 / -0 < 0 whereas 1 / 0 > 0 . +- if (value === 0 && 1 / value < 0) +- return ctx.stylize('-0', 'number'); +- return ctx.stylize('' + value, 'number'); +- } +- if (isBoolean(value)) +- return ctx.stylize('' + value, 'boolean'); +- // For some reason typeof null is "object", so special case here. +- if (isNull(value)) +- return ctx.stylize('null', 'null'); +-} +- +- +-function formatError(value) { +- return '[' + Error.prototype.toString.call(value) + ']'; +-} +- +- +-function formatArray(ctx, value, recurseTimes, visibleKeys, keys) { +- var output = []; +- for (var i = 0, l = value.length; i < l; ++i) { +- if (hasOwnProperty(value, String(i))) { +- output.push(formatProperty(ctx, value, recurseTimes, visibleKeys, +- String(i), true)); +- } else { +- output.push(''); +- } +- } +- keys.forEach(function(key) { +- if (!key.match(/^\d+$/)) { +- output.push(formatProperty(ctx, value, recurseTimes, visibleKeys, +- key, true)); +- } +- }); +- return output; +-} +- +- +-function formatProperty(ctx, value, recurseTimes, visibleKeys, key, array) { +- var name, str, desc; +- desc = Object.getOwnPropertyDescriptor(value, key) || { value: value[key] }; +- if (desc.get) { +- if (desc.set) { +- str = ctx.stylize('[Getter/Setter]', 'special'); +- } else { +- str = ctx.stylize('[Getter]', 'special'); +- } +- } else { +- if (desc.set) { +- str = ctx.stylize('[Setter]', 'special'); +- } +- } +- if (!hasOwnProperty(visibleKeys, key)) { +- name = '[' + key + ']'; +- } +- if (!str) { +- if (ctx.seen.indexOf(desc.value) < 0) { +- if (isNull(recurseTimes)) { +- str = formatValue(ctx, desc.value, null); +- } else { +- str = formatValue(ctx, desc.value, recurseTimes - 1); +- } +- if (str.indexOf('\n') > -1) { +- if (array) { +- str = str.split('\n').map(function(line) { +- return ' ' + line; +- }).join('\n').substr(2); +- } else { +- str = '\n' + str.split('\n').map(function(line) { +- return ' ' + line; +- }).join('\n'); +- } +- } +- } else { +- str = ctx.stylize('[Circular]', 'special'); +- } +- } +- if (isUndefined(name)) { +- if (array && key.match(/^\d+$/)) { +- return str; +- } +- name = JSON.stringify('' + key); +- if (name.match(/^"([a-zA-Z_][a-zA-Z_0-9]*)"$/)) { +- name = name.substr(1, name.length - 2); +- name = ctx.stylize(name, 'name'); +- } else { +- name = name.replace(/'/g, "\\'") +- .replace(/\\"/g, '"') +- .replace(/(^"|"$)/g, "'"); +- name = ctx.stylize(name, 'string'); +- } +- } +- +- return name + ': ' + str; +-} +- +- +-function reduceToSingleString(output, base, braces) { +- var numLinesEst = 0; +- var length = output.reduce(function(prev, cur) { +- numLinesEst++; +- if (cur.indexOf('\n') >= 0) numLinesEst++; +- return prev + cur.replace(/\u001b\[\d\d?m/g, '').length + 1; +- }, 0); +- +- if (length > 60) { +- return braces[0] + +- (base === '' ? '' : base + '\n ') + +- ' ' + +- output.join(',\n ') + +- ' ' + +- braces[1]; +- } +- +- return braces[0] + base + ' ' + output.join(', ') + ' ' + braces[1]; +-} +- +- + // NOTE: These type checking functions intentionally don't use `instanceof` + // because it is fragile and can be easily faked with `Object.create()`. + function isArray(ar) { +@@ -522,166 +98,10 @@ function isPrimitive(arg) { + exports.isPrimitive = isPrimitive; + + function isBuffer(arg) { +- return arg instanceof Buffer; ++ return Buffer.isBuffer(arg); + } + exports.isBuffer = isBuffer; + + function objectToString(o) { + return Object.prototype.toString.call(o); +-} +- +- +-function pad(n) { +- return n < 10 ? '0' + n.toString(10) : n.toString(10); +-} +- +- +-var months = ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', +- 'Oct', 'Nov', 'Dec']; +- +-// 26 Feb 16:19:34 +-function timestamp() { +- var d = new Date(); +- var time = [pad(d.getHours()), +- pad(d.getMinutes()), +- pad(d.getSeconds())].join(':'); +- return [d.getDate(), months[d.getMonth()], time].join(' '); +-} +- +- +-// log is just a thin wrapper to console.log that prepends a timestamp +-exports.log = function() { +- console.log('%s - %s', timestamp(), exports.format.apply(exports, arguments)); +-}; +- +- +-/** +- * Inherit the prototype methods from one constructor into another. +- * +- * The Function.prototype.inherits from lang.js rewritten as a standalone +- * function (not on Function.prototype). NOTE: If this file is to be loaded +- * during bootstrapping this function needs to be rewritten using some native +- * functions as prototype setup using normal JavaScript does not work as +- * expected during bootstrapping (see mirror.js in r114903). +- * +- * @param {function} ctor Constructor function which needs to inherit the +- * prototype. +- * @param {function} superCtor Constructor function to inherit prototype from. +- */ +-exports.inherits = function(ctor, superCtor) { +- ctor.super_ = superCtor; +- ctor.prototype = Object.create(superCtor.prototype, { +- constructor: { +- value: ctor, +- enumerable: false, +- writable: true, +- configurable: true +- } +- }); +-}; +- +-exports._extend = function(origin, add) { +- // Don't do anything if add isn't an object +- if (!add || !isObject(add)) return origin; +- +- var keys = Object.keys(add); +- var i = keys.length; +- while (i--) { +- origin[keys[i]] = add[keys[i]]; +- } +- return origin; +-}; +- +-function hasOwnProperty(obj, prop) { +- return Object.prototype.hasOwnProperty.call(obj, prop); +-} +- +- +-// Deprecated old stuff. +- +-exports.p = exports.deprecate(function() { +- for (var i = 0, len = arguments.length; i < len; ++i) { +- console.error(exports.inspect(arguments[i])); +- } +-}, 'util.p: Use console.error() instead'); +- +- +-exports.exec = exports.deprecate(function() { +- return require('child_process').exec.apply(this, arguments); +-}, 'util.exec is now called `child_process.exec`.'); +- +- +-exports.print = exports.deprecate(function() { +- for (var i = 0, len = arguments.length; i < len; ++i) { +- process.stdout.write(String(arguments[i])); +- } +-}, 'util.print: Use console.log instead'); +- +- +-exports.puts = exports.deprecate(function() { +- for (var i = 0, len = arguments.length; i < len; ++i) { +- process.stdout.write(arguments[i] + '\n'); +- } +-}, 'util.puts: Use console.log instead'); +- +- +-exports.debug = exports.deprecate(function(x) { +- process.stderr.write('DEBUG: ' + x + '\n'); +-}, 'util.debug: Use console.error instead'); +- +- +-exports.error = exports.deprecate(function(x) { +- for (var i = 0, len = arguments.length; i < len; ++i) { +- process.stderr.write(arguments[i] + '\n'); +- } +-}, 'util.error: Use console.error instead'); +- +- +-exports.pump = exports.deprecate(function(readStream, writeStream, callback) { +- var callbackCalled = false; +- +- function call(a, b, c) { +- if (callback && !callbackCalled) { +- callback(a, b, c); +- callbackCalled = true; +- } +- } +- +- readStream.addListener('data', function(chunk) { +- if (writeStream.write(chunk) === false) readStream.pause(); +- }); +- +- writeStream.addListener('drain', function() { +- readStream.resume(); +- }); +- +- readStream.addListener('end', function() { +- writeStream.end(); +- }); +- +- readStream.addListener('close', function() { +- call(); +- }); +- +- readStream.addListener('error', function(err) { +- writeStream.end(); +- call(err); +- }); +- +- writeStream.addListener('error', function(err) { +- readStream.destroy(); +- call(err); +- }); +-}, 'util.pump(): Use readableStream.pipe() instead'); +- +- +-var uv; +-exports._errnoException = function(err, syscall) { +- if (isUndefined(uv)) uv = process.binding('uv'); +- var errname = uv.errname(err); +- var e = new Error(syscall + ' ' + errname); +- e.code = errname; +- e.errno = errname; +- e.syscall = syscall; +- return e; +-}; ++} \ No newline at end of file diff --git a/node_modules/core-util-is/lib/util.js b/node_modules/core-util-is/lib/util.js new file mode 100644 index 0000000..ff4c851 --- /dev/null +++ b/node_modules/core-util-is/lib/util.js @@ -0,0 +1,107 @@ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +// NOTE: These type checking functions intentionally don't use `instanceof` +// because it is fragile and can be easily faked with `Object.create()`. + +function isArray(arg) { + if (Array.isArray) { + return Array.isArray(arg); + } + return objectToString(arg) === '[object Array]'; +} +exports.isArray = isArray; + +function isBoolean(arg) { + return typeof arg === 'boolean'; +} +exports.isBoolean = isBoolean; + +function isNull(arg) { + return arg === null; +} +exports.isNull = isNull; + +function isNullOrUndefined(arg) { + return arg == null; +} +exports.isNullOrUndefined = isNullOrUndefined; + +function isNumber(arg) { + return typeof arg === 'number'; +} +exports.isNumber = isNumber; + +function isString(arg) { + return typeof arg === 'string'; +} +exports.isString = isString; + +function isSymbol(arg) { + return typeof arg === 'symbol'; +} +exports.isSymbol = isSymbol; + +function isUndefined(arg) { + return arg === void 0; +} +exports.isUndefined = isUndefined; + +function isRegExp(re) { + return objectToString(re) === '[object RegExp]'; +} +exports.isRegExp = isRegExp; + +function isObject(arg) { + return typeof arg === 'object' && arg !== null; +} +exports.isObject = isObject; + +function isDate(d) { + return objectToString(d) === '[object Date]'; +} +exports.isDate = isDate; + +function isError(e) { + return (objectToString(e) === '[object Error]' || e instanceof Error); +} +exports.isError = isError; + +function isFunction(arg) { + return typeof arg === 'function'; +} +exports.isFunction = isFunction; + +function isPrimitive(arg) { + return arg === null || + typeof arg === 'boolean' || + typeof arg === 'number' || + typeof arg === 'string' || + typeof arg === 'symbol' || // ES6 symbol + typeof arg === 'undefined'; +} +exports.isPrimitive = isPrimitive; + +exports.isBuffer = Buffer.isBuffer; + +function objectToString(o) { + return Object.prototype.toString.call(o); +} diff --git a/node_modules/core-util-is/package.json b/node_modules/core-util-is/package.json new file mode 100644 index 0000000..d475e61 --- /dev/null +++ b/node_modules/core-util-is/package.json @@ -0,0 +1,86 @@ +{ + "_args": [ + [ + "core-util-is@~1.0.0", + "/home/licence/helayelq/Integration/my-test-project/node_modules/readable-stream" + ] + ], + "_from": "core-util-is@>=1.0.0 <1.1.0", + "_id": "core-util-is@1.0.2", + "_inCache": true, + "_installable": true, + "_location": "/core-util-is", + "_nodeVersion": "4.0.0", + "_npmUser": { + "email": "i@izs.me", + "name": "isaacs" + }, + "_npmVersion": "3.3.2", + "_phantomChildren": {}, + "_requested": { + "name": "core-util-is", + "raw": "core-util-is@~1.0.0", + "rawSpec": "~1.0.0", + "scope": null, + "spec": ">=1.0.0 <1.1.0", + "type": "range" + }, + "_requiredBy": [ + "/readable-stream" + ], + "_resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz", + "_shasum": "b5fd54220aa2bc5ab57aab7140c940754503c1a7", + "_shrinkwrap": null, + "_spec": "core-util-is@~1.0.0", + "_where": "/home/licence/helayelq/Integration/my-test-project/node_modules/readable-stream", + "author": { + "email": "i@izs.me", + "name": "Isaac Z. Schlueter", + "url": "http://blog.izs.me/" + }, + "bugs": { + "url": "https://github.com/isaacs/core-util-is/issues" + }, + "dependencies": {}, + "description": "The `util.is*` functions introduced in Node v0.12.", + "devDependencies": { + "tap": "^2.3.0" + }, + "directories": {}, + "dist": { + "shasum": "b5fd54220aa2bc5ab57aab7140c940754503c1a7", + "tarball": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz" + }, + "gitHead": "a177da234df5638b363ddc15fa324619a38577c8", + "homepage": "https://github.com/isaacs/core-util-is#readme", + "keywords": [ + "isArray", + "isBuffer", + "isNumber", + "isRegExp", + "isString", + "isThat", + "isThis", + "polyfill", + "util" + ], + "license": "MIT", + "main": "lib/util.js", + "maintainers": [ + { + "name": "isaacs", + "email": "i@izs.me" + } + ], + "name": "core-util-is", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/isaacs/core-util-is.git" + }, + "scripts": { + "test": "tap test.js" + }, + "version": "1.0.2" +} diff --git a/node_modules/core-util-is/test.js b/node_modules/core-util-is/test.js new file mode 100644 index 0000000..1a490c6 --- /dev/null +++ b/node_modules/core-util-is/test.js @@ -0,0 +1,68 @@ +var assert = require('tap'); + +var t = require('./lib/util'); + +assert.equal(t.isArray([]), true); +assert.equal(t.isArray({}), false); + +assert.equal(t.isBoolean(null), false); +assert.equal(t.isBoolean(true), true); +assert.equal(t.isBoolean(false), true); + +assert.equal(t.isNull(null), true); +assert.equal(t.isNull(undefined), false); +assert.equal(t.isNull(false), false); +assert.equal(t.isNull(), false); + +assert.equal(t.isNullOrUndefined(null), true); +assert.equal(t.isNullOrUndefined(undefined), true); +assert.equal(t.isNullOrUndefined(false), false); +assert.equal(t.isNullOrUndefined(), true); + +assert.equal(t.isNumber(null), false); +assert.equal(t.isNumber('1'), false); +assert.equal(t.isNumber(1), true); + +assert.equal(t.isString(null), false); +assert.equal(t.isString('1'), true); +assert.equal(t.isString(1), false); + +assert.equal(t.isSymbol(null), false); +assert.equal(t.isSymbol('1'), false); +assert.equal(t.isSymbol(1), false); +assert.equal(t.isSymbol(Symbol()), true); + +assert.equal(t.isUndefined(null), false); +assert.equal(t.isUndefined(undefined), true); +assert.equal(t.isUndefined(false), false); +assert.equal(t.isUndefined(), true); + +assert.equal(t.isRegExp(null), false); +assert.equal(t.isRegExp('1'), false); +assert.equal(t.isRegExp(new RegExp()), true); + +assert.equal(t.isObject({}), true); +assert.equal(t.isObject([]), true); +assert.equal(t.isObject(new RegExp()), true); +assert.equal(t.isObject(new Date()), true); + +assert.equal(t.isDate(null), false); +assert.equal(t.isDate('1'), false); +assert.equal(t.isDate(new Date()), true); + +assert.equal(t.isError(null), false); +assert.equal(t.isError({ err: true }), false); +assert.equal(t.isError(new Error()), true); + +assert.equal(t.isFunction(null), false); +assert.equal(t.isFunction({ }), false); +assert.equal(t.isFunction(function() {}), true); + +assert.equal(t.isPrimitive(null), true); +assert.equal(t.isPrimitive(''), true); +assert.equal(t.isPrimitive(0), true); +assert.equal(t.isPrimitive(new Date()), false); + +assert.equal(t.isBuffer(null), false); +assert.equal(t.isBuffer({}), false); +assert.equal(t.isBuffer(new Buffer(0)), true); diff --git a/node_modules/date-now/.npmignore b/node_modules/date-now/.npmignore new file mode 100644 index 0000000..aa3fd4b --- /dev/null +++ b/node_modules/date-now/.npmignore @@ -0,0 +1,14 @@ +.DS_Store +.monitor +.*.swp +.nodemonignore +releases +*.log +*.err +fleet.json +public/browserify +bin/*.json +.bin +build +compile +.lock-wscript diff --git a/node_modules/date-now/.testem.json b/node_modules/date-now/.testem.json new file mode 100644 index 0000000..633c2ba --- /dev/null +++ b/node_modules/date-now/.testem.json @@ -0,0 +1,14 @@ +{ + "launchers": { + "node": { + "command": "npm test" + } + }, + "src_files": [ + "./**/*.js" + ], + "before_tests": "npm run build", + "on_exit": "rm test/static/bundle.js", + "test_page": "test/static/index.html", + "launch_in_dev": ["node", "phantomjs"] +} diff --git a/node_modules/date-now/.travis.yml b/node_modules/date-now/.travis.yml new file mode 100644 index 0000000..ed178f6 --- /dev/null +++ b/node_modules/date-now/.travis.yml @@ -0,0 +1,4 @@ +language: node_js +node_js: + - 0.8 + - 0.9 diff --git a/node_modules/date-now/LICENCE b/node_modules/date-now/LICENCE new file mode 100644 index 0000000..822d880 --- /dev/null +++ b/node_modules/date-now/LICENCE @@ -0,0 +1,19 @@ +Copyright (c) 2012 Colingo. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/date-now/README.md b/node_modules/date-now/README.md new file mode 100644 index 0000000..22d2675 --- /dev/null +++ b/node_modules/date-now/README.md @@ -0,0 +1,45 @@ +# date-now + +[![build status][1]][2] + +[![browser support][3]][4] + +A requirable version of Date.now() + +Use-case is to be able to mock out Date.now() using require interception. + +## Example + +```js +var now = require("date-now") + +var ts = now() +var ts2 = Date.now() +assert.equal(ts, ts2) +``` + +## example of seed + +``` +var now = require("date-now/seed")(timeStampFromServer) + +// ts is in "sync" with the seed value from the server +// useful if your users have their local time being a few minutes +// out of your server time. +var ts = now() +``` + +## Installation + +`npm install date-now` + +## Contributors + + - Raynos + +## MIT Licenced + + [1]: https://secure.travis-ci.org/Colingo/date-now.png + [2]: http://travis-ci.org/Colingo/date-now + [3]: http://ci.testling.com/Colingo/date-now.png + [4]: http://ci.testling.com/Colingo/date-now diff --git a/node_modules/date-now/index.js b/node_modules/date-now/index.js new file mode 100644 index 0000000..d5f143a --- /dev/null +++ b/node_modules/date-now/index.js @@ -0,0 +1,5 @@ +module.exports = now + +function now() { + return new Date().getTime() +} diff --git a/node_modules/date-now/package.json b/node_modules/date-now/package.json new file mode 100644 index 0000000..9554ba0 --- /dev/null +++ b/node_modules/date-now/package.json @@ -0,0 +1,115 @@ +{ + "_args": [ + [ + "date-now@^0.1.4", + "/home/licence/helayelq/Integration/my-test-project/node_modules/console-browserify" + ] + ], + "_from": "date-now@>=0.1.4 <0.2.0", + "_id": "date-now@0.1.4", + "_inCache": true, + "_installable": true, + "_location": "/date-now", + "_npmUser": { + "email": "raynos2@gmail.com", + "name": "raynos" + }, + "_npmVersion": "1.2.3", + "_phantomChildren": {}, + "_requested": { + "name": "date-now", + "raw": "date-now@^0.1.4", + "rawSpec": "^0.1.4", + "scope": null, + "spec": ">=0.1.4 <0.2.0", + "type": "range" + }, + "_requiredBy": [ + "/console-browserify" + ], + "_resolved": "https://registry.npmjs.org/date-now/-/date-now-0.1.4.tgz", + "_shasum": "eaf439fd4d4848ad74e5cc7dbef200672b9e345b", + "_shrinkwrap": null, + "_spec": "date-now@^0.1.4", + "_where": "/home/licence/helayelq/Integration/my-test-project/node_modules/console-browserify", + "author": { + "email": "raynos2@gmail.com", + "name": "Raynos" + }, + "bugs": { + "email": "raynos2@gmail.com", + "url": "https://github.com/Colingo/date-now/issues" + }, + "contributors": [ + { + "name": "Artem Shoobovych" + } + ], + "dependencies": {}, + "description": "A requirable version of Date.now()", + "devDependencies": { + "browserify": "https://github.com/raynos/node-browserify/tarball/master", + "tape": "~0.2.2", + "testem": "~0.2.52" + }, + "directories": {}, + "dist": { + "shasum": "eaf439fd4d4848ad74e5cc7dbef200672b9e345b", + "tarball": "https://registry.npmjs.org/date-now/-/date-now-0.1.4.tgz" + }, + "homepage": "https://github.com/Colingo/date-now", + "keywords": [], + "licenses": [ + { + "type": "MIT", + "url": "http://github.com/Colingo/date-now/raw/master/LICENSE" + } + ], + "main": "index", + "maintainers": [ + { + "name": "raynos", + "email": "raynos2@gmail.com" + } + ], + "name": "date-now", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/Colingo/date-now.git" + }, + "scripts": { + "build": "browserify test/index.js -o test/static/bundle.js", + "test": "node ./test", + "testem": "testem" + }, + "testling": { + "browsers": { + "chrome": [ + "22", + "23", + "canary" + ], + "firefox": [ + "16", + "17", + "nightly" + ], + "ie": [ + "10", + "8", + "9" + ], + "opera": [ + "12", + "next" + ], + "safari": [ + "5.1" + ] + }, + "files": "test/*.js" + }, + "version": "0.1.4" +} diff --git a/node_modules/date-now/seed.js b/node_modules/date-now/seed.js new file mode 100644 index 0000000..b9727c5 --- /dev/null +++ b/node_modules/date-now/seed.js @@ -0,0 +1,16 @@ +var now = require("./index") + +module.exports = seeded + +/* Returns a Date.now() like function that's in sync with + the seed value +*/ +function seeded(seed) { + var current = now() + + return time + + function time() { + return seed + (now() - current) + } +} diff --git a/node_modules/date-now/test/index.js b/node_modules/date-now/test/index.js new file mode 100644 index 0000000..270584c --- /dev/null +++ b/node_modules/date-now/test/index.js @@ -0,0 +1,28 @@ +var test = require("tape") +var setTimeout = require("timers").setTimeout + +var now = require("../index") +var seeded = require("../seed") + +test("date", function (assert) { + var ts = now() + var ts2 = Date.now() + assert.equal(ts, ts2) + assert.end() +}) + +test("seeded", function (assert) { + var time = seeded(40) + var ts = time() + + within(assert, time(), 40, 5) + setTimeout(function () { + within(assert, time(), 90, 10) + assert.end() + }, 50) +}) + +function within(assert, a, b, offset) { + assert.ok(a + offset > b) + assert.ok(a - offset < b) +} diff --git a/node_modules/date-now/test/static/index.html b/node_modules/date-now/test/static/index.html new file mode 100644 index 0000000..3d5384d --- /dev/null +++ b/node_modules/date-now/test/static/index.html @@ -0,0 +1,10 @@ + + + + TAPE Example + + + + + + diff --git a/node_modules/debug/.coveralls.yml b/node_modules/debug/.coveralls.yml new file mode 100644 index 0000000..20a7068 --- /dev/null +++ b/node_modules/debug/.coveralls.yml @@ -0,0 +1 @@ +repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve diff --git a/node_modules/debug/.eslintrc b/node_modules/debug/.eslintrc new file mode 100644 index 0000000..146371e --- /dev/null +++ b/node_modules/debug/.eslintrc @@ -0,0 +1,14 @@ +{ + "env": { + "browser": true, + "node": true + }, + "globals": { + "chrome": true + }, + "rules": { + "no-console": 0, + "no-empty": [1, { "allowEmptyCatch": true }] + }, + "extends": "eslint:recommended" +} diff --git a/node_modules/debug/.npmignore b/node_modules/debug/.npmignore new file mode 100644 index 0000000..5f60eec --- /dev/null +++ b/node_modules/debug/.npmignore @@ -0,0 +1,9 @@ +support +test +examples +example +*.sock +dist +yarn.lock +coverage +bower.json diff --git a/node_modules/debug/.travis.yml b/node_modules/debug/.travis.yml new file mode 100644 index 0000000..a764300 --- /dev/null +++ b/node_modules/debug/.travis.yml @@ -0,0 +1,20 @@ +sudo: false + +language: node_js + +node_js: + - "4" + - "6" + - "8" + +install: + - make install + +script: + - make lint + - make test + +matrix: + include: + - node_js: '8' + env: BROWSER=1 diff --git a/node_modules/debug/CHANGELOG.md b/node_modules/debug/CHANGELOG.md new file mode 100644 index 0000000..820d21e --- /dev/null +++ b/node_modules/debug/CHANGELOG.md @@ -0,0 +1,395 @@ + +3.1.0 / 2017-09-26 +================== + + * Add `DEBUG_HIDE_DATE` env var (#486) + * Remove ReDoS regexp in %o formatter (#504) + * Remove "component" from package.json + * Remove `component.json` + * Ignore package-lock.json + * Examples: fix colors printout + * Fix: browser detection + * Fix: spelling mistake (#496, @EdwardBetts) + +3.0.1 / 2017-08-24 +================== + + * Fix: Disable colors in Edge and Internet Explorer (#489) + +3.0.0 / 2017-08-08 +================== + + * Breaking: Remove DEBUG_FD (#406) + * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418) + * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408) + * Addition: document `enabled` flag (#465) + * Addition: add 256 colors mode (#481) + * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440) + * Update: component: update "ms" to v2.0.0 + * Update: separate the Node and Browser tests in Travis-CI + * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots + * Update: separate Node.js and web browser examples for organization + * Update: update "browserify" to v14.4.0 + * Fix: fix Readme typo (#473) + +2.6.9 / 2017-09-22 +================== + + * remove ReDoS regexp in %o formatter (#504) + +2.6.8 / 2017-05-18 +================== + + * Fix: Check for undefined on browser globals (#462, @marbemac) + +2.6.7 / 2017-05-16 +================== + + * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom) + * Fix: Inline extend function in node implementation (#452, @dougwilson) + * Docs: Fix typo (#455, @msasad) + +2.6.5 / 2017-04-27 +================== + + * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek) + * Misc: clean up browser reference checks (#447, @thebigredgeek) + * Misc: add npm-debug.log to .gitignore (@thebigredgeek) + + +2.6.4 / 2017-04-20 +================== + + * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo) + * Chore: ignore bower.json in npm installations. (#437, @joaovieira) + * Misc: update "ms" to v0.7.3 (@tootallnate) + +2.6.3 / 2017-03-13 +================== + + * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts) + * Docs: Changelog fix (@thebigredgeek) + +2.6.2 / 2017-03-10 +================== + + * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin) + * Docs: Add backers and sponsors from Open Collective (#422, @piamancini) + * Docs: Add Slackin invite badge (@tootallnate) + +2.6.1 / 2017-02-10 +================== + + * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error + * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0) + * Fix: IE8 "Expected identifier" error (#414, @vgoma) + * Fix: Namespaces would not disable once enabled (#409, @musikov) + +2.6.0 / 2016-12-28 +================== + + * Fix: added better null pointer checks for browser useColors (@thebigredgeek) + * Improvement: removed explicit `window.debug` export (#404, @tootallnate) + * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate) + +2.5.2 / 2016-12-25 +================== + + * Fix: reference error on window within webworkers (#393, @KlausTrainer) + * Docs: fixed README typo (#391, @lurch) + * Docs: added notice about v3 api discussion (@thebigredgeek) + +2.5.1 / 2016-12-20 +================== + + * Fix: babel-core compatibility + +2.5.0 / 2016-12-20 +================== + + * Fix: wrong reference in bower file (@thebigredgeek) + * Fix: webworker compatibility (@thebigredgeek) + * Fix: output formatting issue (#388, @kribblo) + * Fix: babel-loader compatibility (#383, @escwald) + * Misc: removed built asset from repo and publications (@thebigredgeek) + * Misc: moved source files to /src (#378, @yamikuronue) + * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue) + * Test: coveralls integration (#378, @yamikuronue) + * Docs: simplified language in the opening paragraph (#373, @yamikuronue) + +2.4.5 / 2016-12-17 +================== + + * Fix: `navigator` undefined in Rhino (#376, @jochenberger) + * Fix: custom log function (#379, @hsiliev) + * Improvement: bit of cleanup + linting fixes (@thebigredgeek) + * Improvement: rm non-maintainted `dist/` dir (#375, @freewil) + * Docs: simplified language in the opening paragraph. (#373, @yamikuronue) + +2.4.4 / 2016-12-14 +================== + + * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts) + +2.4.3 / 2016-12-14 +================== + + * Fix: navigation.userAgent error for react native (#364, @escwald) + +2.4.2 / 2016-12-14 +================== + + * Fix: browser colors (#367, @tootallnate) + * Misc: travis ci integration (@thebigredgeek) + * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek) + +2.4.1 / 2016-12-13 +================== + + * Fix: typo that broke the package (#356) + +2.4.0 / 2016-12-13 +================== + + * Fix: bower.json references unbuilt src entry point (#342, @justmatt) + * Fix: revert "handle regex special characters" (@tootallnate) + * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate) + * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate) + * Improvement: allow colors in workers (#335, @botverse) + * Improvement: use same color for same namespace. (#338, @lchenay) + +2.3.3 / 2016-11-09 +================== + + * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne) + * Fix: Returning `localStorage` saved values (#331, Levi Thomason) + * Improvement: Don't create an empty object when no `process` (Nathan Rajlich) + +2.3.2 / 2016-11-09 +================== + + * Fix: be super-safe in index.js as well (@TooTallNate) + * Fix: should check whether process exists (Tom Newby) + +2.3.1 / 2016-11-09 +================== + + * Fix: Added electron compatibility (#324, @paulcbetts) + * Improvement: Added performance optimizations (@tootallnate) + * Readme: Corrected PowerShell environment variable example (#252, @gimre) + * Misc: Removed yarn lock file from source control (#321, @fengmk2) + +2.3.0 / 2016-11-07 +================== + + * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic) + * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos) + * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15) + * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran) + * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom) + * Package: Update "ms" to 0.7.2 (#315, @DevSide) + * Package: removed superfluous version property from bower.json (#207 @kkirsche) + * Readme: fix USE_COLORS to DEBUG_COLORS + * Readme: Doc fixes for format string sugar (#269, @mlucool) + * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0) + * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable) + * Readme: better docs for browser support (#224, @matthewmueller) + * Tooling: Added yarn integration for development (#317, @thebigredgeek) + * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek) + * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman) + * Misc: Updated contributors (@thebigredgeek) + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/debug/LICENSE b/node_modules/debug/LICENSE new file mode 100644 index 0000000..658c933 --- /dev/null +++ b/node_modules/debug/LICENSE @@ -0,0 +1,19 @@ +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/debug/Makefile b/node_modules/debug/Makefile new file mode 100644 index 0000000..3ddd136 --- /dev/null +++ b/node_modules/debug/Makefile @@ -0,0 +1,58 @@ +# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 +THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) +THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) + +# BIN directory +BIN := $(THIS_DIR)/node_modules/.bin + +# Path +PATH := node_modules/.bin:$(PATH) +SHELL := /bin/bash + +# applications +NODE ?= $(shell which node) +YARN ?= $(shell which yarn) +PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm)) +BROWSERIFY ?= $(NODE) $(BIN)/browserify + +install: node_modules + +browser: dist/debug.js + +node_modules: package.json + @NODE_ENV= $(PKG) install + @touch node_modules + +dist/debug.js: src/*.js node_modules + @mkdir -p dist + @$(BROWSERIFY) \ + --standalone debug \ + . > dist/debug.js + +lint: + @eslint *.js src/*.js + +test-node: + @istanbul cover node_modules/mocha/bin/_mocha -- test/**.js + @cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js + +test-browser: + @$(MAKE) browser + @karma start --single-run + +test-all: + @concurrently \ + "make test-node" \ + "make test-browser" + +test: + @if [ "x$(BROWSER)" = "x" ]; then \ + $(MAKE) test-node; \ + else \ + $(MAKE) test-browser; \ + fi + +clean: + rimraf dist coverage + +.PHONY: browser install clean lint test test-all test-node test-browser diff --git a/node_modules/debug/README.md b/node_modules/debug/README.md new file mode 100644 index 0000000..8e754d1 --- /dev/null +++ b/node_modules/debug/README.md @@ -0,0 +1,368 @@ +# debug +[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug) [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master) [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) +[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) + + + +A tiny JavaScript debugging utility modelled after Node.js core's debugging +technique. Works in Node.js and web browsers. + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example [_app.js_](./examples/node/app.js): + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %o', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example [_worker.js_](./examples/node/worker.js): + +```js +var a = require('debug')('worker:a') + , b = require('debug')('worker:b'); + +function work() { + a('doing lots of uninteresting work'); + setTimeout(work, Math.random() * 1000); +} + +work(); + +function workb() { + b('doing some work'); + setTimeout(workb, Math.random() * 2000); +} + +workb(); +``` + +The `DEBUG` environment variable is then used to enable these based on space or +comma-delimited names. + +Here are some examples: + +screen shot 2017-08-08 at 12 53 04 pm +screen shot 2017-08-08 at 12 53 38 pm +screen shot 2017-08-08 at 12 53 25 pm + +#### Windows note + +On Windows the environment variable is set using the `set` command. + +```cmd +set DEBUG=*,-not_this +``` + +Note that PowerShell uses different syntax to set environment variables. + +```cmd +$env:DEBUG = "*,-not_this" +``` + +Then, run the program to be debugged as usual. + + +## Namespace Colors + +Every debug instance has a color generated for it based on its namespace name. +This helps when visually parsing the debug output to identify which debug instance +a debug line belongs to. + +#### Node.js + +In Node.js, colors are enabled when stderr is a TTY. You also _should_ install +the [`supports-color`](https://npmjs.org/supports-color) module alongside debug, +otherwise debug will only use a small handful of basic colors. + + + +#### Web Browser + +Colors are also enabled on "Web Inspectors" that understand the `%c` formatting +option. These are WebKit web inspectors, Firefox ([since version +31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) +and the Firebug plugin for Firefox (any version). + + + + +## Millisecond diff + +When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + + +When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below: + + + + +## Conventions + +If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output. + +## Wildcards + +The `*` character may be used as a wildcard. Suppose for example your library has +debuggers named "connect:bodyParser", "connect:compress", "connect:session", +instead of listing all three with +`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do +`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + +You can also exclude specific debuggers by prefixing them with a "-" character. +For example, `DEBUG=*,-connect:*` would include all debuggers except those +starting with "connect:". + +## Environment Variables + +When running through Node.js, you can set a few environment variables that will +change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + +__Note:__ The environment variables beginning with `DEBUG_` end up being +converted into an Options object that gets used with `%o`/`%O` formatters. +See the Node.js documentation for +[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) +for the complete list. + +## Formatters + +Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. +Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + + +### Custom formatters + +You can add custom formatters by extending the `debug.formatters` object. +For example, if you wanted to add support for rendering a Buffer as hex with +`%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + + +## Browser Support + +You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), +or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), +if you don't want to build it yourself. + +Debug's enable state is currently persisted by `localStorage`. +Consider the situation shown below where you have `worker:a` and `worker:b`, +and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example [_stdout.js_](./examples/node/stdout.js): + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + +## Checking whether a debug target is enabled + +After you've created a debug instance, you can determine whether or not it is +enabled by checking the `enabled` property: + +```javascript +const debug = require('debug')('http'); + +if (debug.enabled) { + // do stuff... +} +``` + +You can also manually toggle this property to force the debug instance to be +enabled or disabled. + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## License + +(The MIT License) + +Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/debug/karma.conf.js b/node_modules/debug/karma.conf.js new file mode 100644 index 0000000..103a82d --- /dev/null +++ b/node_modules/debug/karma.conf.js @@ -0,0 +1,70 @@ +// Karma configuration +// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC) + +module.exports = function(config) { + config.set({ + + // base path that will be used to resolve all patterns (eg. files, exclude) + basePath: '', + + + // frameworks to use + // available frameworks: https://npmjs.org/browse/keyword/karma-adapter + frameworks: ['mocha', 'chai', 'sinon'], + + + // list of files / patterns to load in the browser + files: [ + 'dist/debug.js', + 'test/*spec.js' + ], + + + // list of files to exclude + exclude: [ + 'src/node.js' + ], + + + // preprocess matching files before serving them to the browser + // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor + preprocessors: { + }, + + // test results reporter to use + // possible values: 'dots', 'progress' + // available reporters: https://npmjs.org/browse/keyword/karma-reporter + reporters: ['progress'], + + + // web server port + port: 9876, + + + // enable / disable colors in the output (reporters and logs) + colors: true, + + + // level of logging + // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG + logLevel: config.LOG_INFO, + + + // enable / disable watching file and executing tests whenever any file changes + autoWatch: true, + + + // start these browsers + // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher + browsers: ['PhantomJS'], + + + // Continuous Integration mode + // if true, Karma captures browsers, runs the tests and exits + singleRun: false, + + // Concurrency level + // how many browser should be started simultaneous + concurrency: Infinity + }) +} diff --git a/node_modules/debug/node.js b/node_modules/debug/node.js new file mode 100644 index 0000000..7fc36fe --- /dev/null +++ b/node_modules/debug/node.js @@ -0,0 +1 @@ +module.exports = require('./src/node'); diff --git a/node_modules/debug/package.json b/node_modules/debug/package.json new file mode 100644 index 0000000..5daf51c --- /dev/null +++ b/node_modules/debug/package.json @@ -0,0 +1,122 @@ +{ + "_args": [ + [ + "debug@3.1.0", + "/home/licence/helayelq/Integration/my-test-project/node_modules/mocha" + ] + ], + "_from": "debug@3.1.0", + "_id": "debug@3.1.0", + "_inCache": true, + "_installable": true, + "_location": "/debug", + "_nodeVersion": "8.4.0", + "_npmOperationalInternal": { + "host": "s3://npm-registry-packages", + "tmp": "tmp/debug-3.1.0.tgz_1506453230282_0.13498495938256383" + }, + "_npmUser": { + "email": "nathan@tootallnate.net", + "name": "tootallnate" + }, + "_npmVersion": "5.3.0", + "_phantomChildren": {}, + "_requested": { + "name": "debug", + "raw": "debug@3.1.0", + "rawSpec": "3.1.0", + "scope": null, + "spec": "3.1.0", + "type": "version" + }, + "_requiredBy": [ + "/mocha" + ], + "_resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz", + "_shasum": "5bb5a0672628b64149566ba16819e61518c67261", + "_shrinkwrap": null, + "_spec": "debug@3.1.0", + "_where": "/home/licence/helayelq/Integration/my-test-project/node_modules/mocha", + "author": { + "email": "tj@vision-media.ca", + "name": "TJ Holowaychuk" + }, + "browser": "./src/browser.js", + "bugs": { + "url": "https://github.com/visionmedia/debug/issues" + }, + "contributors": [ + { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io" + }, + { + "name": "Andrew Rhyne", + "email": "rhyneandrew@gmail.com" + } + ], + "dependencies": { + "ms": "2.0.0" + }, + "description": "small debugging utility", + "devDependencies": { + "browserify": "14.4.0", + "chai": "^3.5.0", + "concurrently": "^3.1.0", + "coveralls": "^2.11.15", + "eslint": "^3.12.1", + "istanbul": "^0.4.5", + "karma": "^1.3.0", + "karma-chai": "^0.1.0", + "karma-mocha": "^1.3.0", + "karma-phantomjs-launcher": "^1.0.2", + "karma-sinon": "^1.0.5", + "mocha": "^3.2.0", + "mocha-lcov-reporter": "^1.2.0", + "rimraf": "^2.5.4", + "sinon": "^1.17.6", + "sinon-chai": "^2.8.0" + }, + "directories": {}, + "dist": { + "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==", + "shasum": "5bb5a0672628b64149566ba16819e61518c67261", + "tarball": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz" + }, + "gitHead": "f073e056f33efdd5b311381eb6bca2bc850745bf", + "homepage": "https://github.com/visionmedia/debug#readme", + "keywords": [ + "debug", + "debugger", + "log" + ], + "license": "MIT", + "main": "./src/index.js", + "maintainers": [ + { + "name": "thebigredgeek", + "email": "rhyneandrew@gmail.com" + }, + { + "name": "kolban", + "email": "kolban1@kolban.com" + }, + { + "name": "tootallnate", + "email": "nathan@tootallnate.net" + }, + { + "name": "tjholowaychuk", + "email": "tj@vision-media.ca" + } + ], + "name": "debug", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "version": "3.1.0" +} diff --git a/node_modules/debug/src/browser.js b/node_modules/debug/src/browser.js new file mode 100644 index 0000000..f5149ff --- /dev/null +++ b/node_modules/debug/src/browser.js @@ -0,0 +1,195 @@ +/** + * This is the web browser implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = 'undefined' != typeof chrome + && 'undefined' != typeof chrome.storage + ? chrome.storage.local + : localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + '#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC', + '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF', + '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC', + '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF', + '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC', + '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033', + '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366', + '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933', + '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC', + '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF', + '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') { + return true; + } + + // Internet Explorer and Edge do not support colors. + if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { + return false; + } + + // is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +exports.formatters.j = function(v) { + try { + return JSON.stringify(v); + } catch (err) { + return '[UnexpectedJSONParseError]: ' + err.message; + } +}; + + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + var useColors = this.useColors; + + args[0] = (useColors ? '%c' : '') + + this.namespace + + (useColors ? ' %c' : ' ') + + args[0] + + (useColors ? '%c ' : ' ') + + '+' + exports.humanize(this.diff); + + if (!useColors) return; + + var c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit') + + // the final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + var index = 0; + var lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, function(match) { + if ('%%' === match) return; + index++; + if ('%c' === match) { + // we only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + +function log() { + // this hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return 'object' === typeof console + && console.log + && Function.prototype.apply.call(console.log, console, arguments); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + try { + if (null == namespaces) { + exports.storage.removeItem('debug'); + } else { + exports.storage.debug = namespaces; + } + } catch(e) {} +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + var r; + try { + r = exports.storage.debug; + } catch(e) {} + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Enable namespaces listed in `localStorage.debug` initially. + */ + +exports.enable(load()); + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + return window.localStorage; + } catch (e) {} +} diff --git a/node_modules/debug/src/debug.js b/node_modules/debug/src/debug.js new file mode 100644 index 0000000..77e6384 --- /dev/null +++ b/node_modules/debug/src/debug.js @@ -0,0 +1,225 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = createDebug.debug = createDebug['default'] = createDebug; +exports.coerce = coerce; +exports.disable = disable; +exports.enable = enable; +exports.enabled = enabled; +exports.humanize = require('ms'); + +/** + * Active `debug` instances. + */ +exports.instances = []; + +/** + * The currently active debug mode names, and names to skip. + */ + +exports.names = []; +exports.skips = []; + +/** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + +exports.formatters = {}; + +/** + * Select a color. + * @param {String} namespace + * @return {Number} + * @api private + */ + +function selectColor(namespace) { + var hash = 0, i; + + for (i in namespace) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return exports.colors[Math.abs(hash) % exports.colors.length]; +} + +/** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + +function createDebug(namespace) { + + var prevTime; + + function debug() { + // disabled? + if (!debug.enabled) return; + + var self = debug; + + // set `diff` timestamp + var curr = +new Date(); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + // turn the `arguments` into a proper Array + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + + args[0] = exports.coerce(args[0]); + + if ('string' !== typeof args[0]) { + // anything else let's inspect with %O + args.unshift('%O'); + } + + // apply any `formatters` transformations + var index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) { + // if we encounter an escaped % then don't increase the array index + if (match === '%%') return match; + index++; + var formatter = exports.formatters[format]; + if ('function' === typeof formatter) { + var val = args[index]; + match = formatter.call(self, val); + + // now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // apply env-specific formatting (colors, etc.) + exports.formatArgs.call(self, args); + + var logFn = debug.log || exports.log || console.log.bind(console); + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = exports.enabled(namespace); + debug.useColors = exports.useColors(); + debug.color = selectColor(namespace); + debug.destroy = destroy; + + // env-specific initialization logic for debug instances + if ('function' === typeof exports.init) { + exports.init(debug); + } + + exports.instances.push(debug); + + return debug; +} + +function destroy () { + var index = exports.instances.indexOf(this); + if (index !== -1) { + exports.instances.splice(index, 1); + return true; + } else { + return false; + } +} + +/** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + +function enable(namespaces) { + exports.save(namespaces); + + exports.names = []; + exports.skips = []; + + var i; + var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + var len = split.length; + + for (i = 0; i < len; i++) { + if (!split[i]) continue; // ignore empty strings + namespaces = split[i].replace(/\*/g, '.*?'); + if (namespaces[0] === '-') { + exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + exports.names.push(new RegExp('^' + namespaces + '$')); + } + } + + for (i = 0; i < exports.instances.length; i++) { + var instance = exports.instances[i]; + instance.enabled = exports.enabled(instance.namespace); + } +} + +/** + * Disable debug output. + * + * @api public + */ + +function disable() { + exports.enable(''); +} + +/** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + +function enabled(name) { + if (name[name.length - 1] === '*') { + return true; + } + var i, len; + for (i = 0, len = exports.skips.length; i < len; i++) { + if (exports.skips[i].test(name)) { + return false; + } + } + for (i = 0, len = exports.names.length; i < len; i++) { + if (exports.names[i].test(name)) { + return true; + } + } + return false; +} + +/** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function coerce(val) { + if (val instanceof Error) return val.stack || val.message; + return val; +} diff --git a/node_modules/debug/src/index.js b/node_modules/debug/src/index.js new file mode 100644 index 0000000..cabcbcd --- /dev/null +++ b/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer process, which is node, but we should + * treat as a browser. + */ + +if (typeof process === 'undefined' || process.type === 'renderer') { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/node_modules/debug/src/node.js b/node_modules/debug/src/node.js new file mode 100644 index 0000000..d666fb9 --- /dev/null +++ b/node_modules/debug/src/node.js @@ -0,0 +1,186 @@ +/** + * Module dependencies. + */ + +var tty = require('tty'); +var util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [ 6, 2, 3, 4, 5, 1 ]; + +try { + var supportsColor = require('supports-color'); + if (supportsColor && supportsColor.level >= 2) { + exports.colors = [ + 20, 21, 26, 27, 32, 33, 38, 39, 40, 41, 42, 43, 44, 45, 56, 57, 62, 63, 68, + 69, 74, 75, 76, 77, 78, 79, 80, 81, 92, 93, 98, 99, 112, 113, 128, 129, 134, + 135, 148, 149, 160, 161, 162, 163, 164, 165, 166, 167, 168, 169, 170, 171, + 172, 173, 178, 179, 184, 185, 196, 197, 198, 199, 200, 201, 202, 203, 204, + 205, 206, 207, 208, 209, 214, 215, 220, 221 + ]; + } +} catch (err) { + // swallow - we only care if `supports-color` is available; it doesn't have to be. +} + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(function (key) { + return /^debug_/i.test(key); +}).reduce(function (obj, key) { + // camel-case + var prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() }); + + // coerce string value into JS value + var val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) val = true; + else if (/^(no|off|false|disabled)$/i.test(val)) val = false; + else if (val === 'null') val = null; + else val = Number(val); + + obj[prop] = val; + return obj; +}, {}); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts + ? Boolean(exports.inspectOpts.colors) + : tty.isatty(process.stderr.fd); +} + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +exports.formatters.o = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .split('\n').map(function(str) { + return str.trim() + }).join(' '); +}; + +/** + * Map %o to `util.inspect()`, allowing multiple lines if needed. + */ + +exports.formatters.O = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + var name = this.namespace; + var useColors = this.useColors; + + if (useColors) { + var c = this.color; + var colorCode = '\u001b[3' + (c < 8 ? c : '8;5;' + c); + var prefix = ' ' + colorCode + ';1m' + name + ' ' + '\u001b[0m'; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push(colorCode + 'm+' + exports.humanize(this.diff) + '\u001b[0m'); + } else { + args[0] = getDate() + name + ' ' + args[0]; + } +} + +function getDate() { + if (exports.inspectOpts.hideDate) { + return ''; + } else { + return new Date().toISOString() + ' '; + } +} + +/** + * Invokes `util.format()` with the specified arguments and writes to stderr. + */ + +function log() { + return process.stderr.write(util.format.apply(util, arguments) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + if (null == namespaces) { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } else { + process.env.DEBUG = namespaces; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init (debug) { + debug.inspectOpts = {}; + + var keys = Object.keys(exports.inspectOpts); + for (var i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +/** + * Enable namespaces listed in `process.env.DEBUG` initially. + */ + +exports.enable(load()); diff --git a/node_modules/diff/CONTRIBUTING.md b/node_modules/diff/CONTRIBUTING.md new file mode 100644 index 0000000..96f4530 --- /dev/null +++ b/node_modules/diff/CONTRIBUTING.md @@ -0,0 +1,39 @@ +# How to Contribute + +## Pull Requests + +We also accept [pull requests][pull-request]! + +Generally we like to see pull requests that +- Maintain the existing code style +- Are focused on a single change (i.e. avoid large refactoring or style adjustments in untouched code if not the primary goal of the pull request) +- Have [good commit messages](http://tbaggery.com/2008/04/19/a-note-about-git-commit-messages.html) +- Have tests +- Don't decrease the current code coverage (see coverage/lcov-report/index.html) + +## Building + +``` +npm install +npm test +```` + +The `npm test -- dev` implements watching for tests within Node and `karma start` may be used for manual testing in browsers. + +If you notice any problems, please report them to the GitHub issue tracker at +[http://github.com/kpdecker/jsdiff/issues](http://github.com/kpdecker/jsdiff/issues). + +## Releasing + +JsDiff utilizes the [release yeoman generator][generator-release] to perform most release tasks. + +A full release may be completed with the following: + +``` +yo release +npm publish +yo release:publish components jsdiff dist/components/ +``` + +[generator-release]: https://github.com/walmartlabs/generator-release +[pull-request]: https://github.com/kpdecker/jsdiff/pull/new/master diff --git a/node_modules/diff/LICENSE b/node_modules/diff/LICENSE new file mode 100644 index 0000000..4e7146e --- /dev/null +++ b/node_modules/diff/LICENSE @@ -0,0 +1,31 @@ +Software License Agreement (BSD License) + +Copyright (c) 2009-2015, Kevin Decker + +All rights reserved. + +Redistribution and use of this software in source and binary forms, with or without modification, +are permitted provided that the following conditions are met: + +* Redistributions of source code must retain the above + copyright notice, this list of conditions and the + following disclaimer. + +* Redistributions in binary form must reproduce the above + copyright notice, this list of conditions and the + following disclaimer in the documentation and/or other + materials provided with the distribution. + +* Neither the name of Kevin Decker nor the names of its + contributors may be used to endorse or promote products + derived from this software without specific prior + written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR +IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND +FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR +CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL +DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER +IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT +OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. \ No newline at end of file diff --git a/node_modules/diff/README.md b/node_modules/diff/README.md new file mode 100644 index 0000000..5747fe3 --- /dev/null +++ b/node_modules/diff/README.md @@ -0,0 +1,211 @@ +# jsdiff + +[![Build Status](https://secure.travis-ci.org/kpdecker/jsdiff.svg)](http://travis-ci.org/kpdecker/jsdiff) +[![Sauce Test Status](https://saucelabs.com/buildstatus/jsdiff)](https://saucelabs.com/u/jsdiff) + +A javascript text differencing implementation. + +Based on the algorithm proposed in +["An O(ND) Difference Algorithm and its Variations" (Myers, 1986)](http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.4.6927). + +## Installation +```bash +npm install diff --save +``` +or +```bash +bower install jsdiff --save +``` + +## API + +* `JsDiff.diffChars(oldStr, newStr[, options])` - diffs two blocks of text, comparing character by character. + + Returns a list of change objects (See below). + + Options + * `ignoreCase`: `true` to ignore casing difference. Defaults to `false`. + +* `JsDiff.diffWords(oldStr, newStr[, options])` - diffs two blocks of text, comparing word by word, ignoring whitespace. + + Returns a list of change objects (See below). + + Options + * `ignoreCase`: Same as in `diffChars`. + +* `JsDiff.diffWordsWithSpace(oldStr, newStr[, options])` - diffs two blocks of text, comparing word by word, treating whitespace as significant. + + Returns a list of change objects (See below). + +* `JsDiff.diffLines(oldStr, newStr[, options])` - diffs two blocks of text, comparing line by line. + + Options + * `ignoreWhitespace`: `true` to ignore leading and trailing whitespace. This is the same as `diffTrimmedLines` + * `newlineIsToken`: `true` to treat newline characters as separate tokens. This allows for changes to the newline structure to occur independently of the line content and to be treated as such. In general this is the more human friendly form of `diffLines` and `diffLines` is better suited for patches and other computer friendly output. + + Returns a list of change objects (See below). + +* `JsDiff.diffTrimmedLines(oldStr, newStr[, options])` - diffs two blocks of text, comparing line by line, ignoring leading and trailing whitespace. + + Returns a list of change objects (See below). + +* `JsDiff.diffSentences(oldStr, newStr[, options])` - diffs two blocks of text, comparing sentence by sentence. + + Returns a list of change objects (See below). + +* `JsDiff.diffCss(oldStr, newStr[, options])` - diffs two blocks of text, comparing CSS tokens. + + Returns a list of change objects (See below). + +* `JsDiff.diffJson(oldObj, newObj[, options])` - diffs two JSON objects, comparing the fields defined on each. The order of fields, etc does not matter in this comparison. + + Returns a list of change objects (See below). + +* `JsDiff.diffArrays(oldArr, newArr[, options])` - diffs two arrays, comparing each item for strict equality (===). + + Options + * `comparator`: `function(left, right)` for custom equality checks + + Returns a list of change objects (See below). + +* `JsDiff.createTwoFilesPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader)` - creates a unified diff patch. + + Parameters: + * `oldFileName` : String to be output in the filename section of the patch for the removals + * `newFileName` : String to be output in the filename section of the patch for the additions + * `oldStr` : Original string value + * `newStr` : New string value + * `oldHeader` : Additional information to include in the old file header + * `newHeader` : Additional information to include in the new file header + * `options` : An object with options. Currently, only `context` is supported and describes how many lines of context should be included. + +* `JsDiff.createPatch(fileName, oldStr, newStr, oldHeader, newHeader)` - creates a unified diff patch. + + Just like JsDiff.createTwoFilesPatch, but with oldFileName being equal to newFileName. + + +* `JsDiff.structuredPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader, options)` - returns an object with an array of hunk objects. + + This method is similar to createTwoFilesPatch, but returns a data structure + suitable for further processing. Parameters are the same as createTwoFilesPatch. The data structure returned may look like this: + + ```js + { + oldFileName: 'oldfile', newFileName: 'newfile', + oldHeader: 'header1', newHeader: 'header2', + hunks: [{ + oldStart: 1, oldLines: 3, newStart: 1, newLines: 3, + lines: [' line2', ' line3', '-line4', '+line5', '\\ No newline at end of file'], + }] + } + ``` + +* `JsDiff.applyPatch(source, patch[, options])` - applies a unified diff patch. + + Return a string containing new version of provided data. `patch` may be a string diff or the output from the `parsePatch` or `structuredPatch` methods. + + The optional `options` object may have the following keys: + + - `fuzzFactor`: Number of lines that are allowed to differ before rejecting a patch. Defaults to 0. + - `compareLine(lineNumber, line, operation, patchContent)`: Callback used to compare to given lines to determine if they should be considered equal when patching. Defaults to strict equality but may be overridden to provide fuzzier comparison. Should return false if the lines should be rejected. + +* `JsDiff.applyPatches(patch, options)` - applies one or more patches. + + This method will iterate over the contents of the patch and apply to data provided through callbacks. The general flow for each patch index is: + + - `options.loadFile(index, callback)` is called. The caller should then load the contents of the file and then pass that to the `callback(err, data)` callback. Passing an `err` will terminate further patch execution. + - `options.patched(index, content, callback)` is called once the patch has been applied. `content` will be the return value from `applyPatch`. When it's ready, the caller should call `callback(err)` callback. Passing an `err` will terminate further patch execution. + + Once all patches have been applied or an error occurs, the `options.complete(err)` callback is made. + +* `JsDiff.parsePatch(diffStr)` - Parses a patch into structured data + + Return a JSON object representation of the a patch, suitable for use with the `applyPatch` method. This parses to the same structure returned by `JsDiff.structuredPatch`. + +* `convertChangesToXML(changes)` - converts a list of changes to a serialized XML format + + +All methods above which accept the optional `callback` method will run in sync mode when that parameter is omitted and in async mode when supplied. This allows for larger diffs without blocking the event loop. This may be passed either directly as the final parameter or as the `callback` field in the `options` object. + +### Change Objects +Many of the methods above return change objects. These objects consist of the following fields: + +* `value`: Text content +* `added`: True if the value was inserted into the new string +* `removed`: True of the value was removed from the old string + +Note that some cases may omit a particular flag field. Comparison on the flag fields should always be done in a truthy or falsy manner. + +## Examples + +Basic example in Node + +```js +require('colors'); +var jsdiff = require('diff'); + +var one = 'beep boop'; +var other = 'beep boob blah'; + +var diff = jsdiff.diffChars(one, other); + +diff.forEach(function(part){ + // green for additions, red for deletions + // grey for common parts + var color = part.added ? 'green' : + part.removed ? 'red' : 'grey'; + process.stderr.write(part.value[color]); +}); + +console.log(); +``` +Running the above program should yield + +Node Example + +Basic example in a web page + +```html +

+
+
+```
+
+Open the above .html file in a browser and you should see
+
+Node Example
+
+**[Full online demo](http://kpdecker.github.com/jsdiff)**
+
+## Compatibility
+
+[![Sauce Test Status](https://saucelabs.com/browser-matrix/jsdiff.svg)](https://saucelabs.com/u/jsdiff)
+
+jsdiff supports all ES3 environments with some known issues on IE8 and below. Under these browsers some diff algorithms such as word diff and others may fail due to lack of support for capturing groups in the `split` operation.
+
+## License
+
+See [LICENSE](https://github.com/kpdecker/jsdiff/blob/master/LICENSE).
diff --git a/node_modules/diff/dist/diff.js b/node_modules/diff/dist/diff.js
new file mode 100644
index 0000000..0b824f1
--- /dev/null
+++ b/node_modules/diff/dist/diff.js
@@ -0,0 +1,1843 @@
+/*!
+
+ diff v3.5.0
+
+Software License Agreement (BSD License)
+
+Copyright (c) 2009-2015, Kevin Decker 
+
+All rights reserved.
+
+Redistribution and use of this software in source and binary forms, with or without modification,
+are permitted provided that the following conditions are met:
+
+* Redistributions of source code must retain the above
+  copyright notice, this list of conditions and the
+  following disclaimer.
+
+* Redistributions in binary form must reproduce the above
+  copyright notice, this list of conditions and the
+  following disclaimer in the documentation and/or other
+  materials provided with the distribution.
+
+* Neither the name of Kevin Decker nor the names of its
+  contributors may be used to endorse or promote products
+  derived from this software without specific prior
+  written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR
+IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND
+FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR
+CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER
+IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT
+OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+@license
+*/
+(function webpackUniversalModuleDefinition(root, factory) {
+	if(typeof exports === 'object' && typeof module === 'object')
+		module.exports = factory();
+	else if(typeof define === 'function' && define.amd)
+		define([], factory);
+	else if(typeof exports === 'object')
+		exports["JsDiff"] = factory();
+	else
+		root["JsDiff"] = factory();
+})(this, function() {
+return /******/ (function(modules) { // webpackBootstrap
+/******/ 	// The module cache
+/******/ 	var installedModules = {};
+
+/******/ 	// The require function
+/******/ 	function __webpack_require__(moduleId) {
+
+/******/ 		// Check if module is in cache
+/******/ 		if(installedModules[moduleId])
+/******/ 			return installedModules[moduleId].exports;
+
+/******/ 		// Create a new module (and put it into the cache)
+/******/ 		var module = installedModules[moduleId] = {
+/******/ 			exports: {},
+/******/ 			id: moduleId,
+/******/ 			loaded: false
+/******/ 		};
+
+/******/ 		// Execute the module function
+/******/ 		modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
+
+/******/ 		// Flag the module as loaded
+/******/ 		module.loaded = true;
+
+/******/ 		// Return the exports of the module
+/******/ 		return module.exports;
+/******/ 	}
+
+
+/******/ 	// expose the modules object (__webpack_modules__)
+/******/ 	__webpack_require__.m = modules;
+
+/******/ 	// expose the module cache
+/******/ 	__webpack_require__.c = installedModules;
+
+/******/ 	// __webpack_public_path__
+/******/ 	__webpack_require__.p = "";
+
+/******/ 	// Load entry module and return exports
+/******/ 	return __webpack_require__(0);
+/******/ })
+/************************************************************************/
+/******/ ([
+/* 0 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.canonicalize = exports.convertChangesToXML = exports.convertChangesToDMP = exports.merge = exports.parsePatch = exports.applyPatches = exports.applyPatch = exports.createPatch = exports.createTwoFilesPatch = exports.structuredPatch = exports.diffArrays = exports.diffJson = exports.diffCss = exports.diffSentences = exports.diffTrimmedLines = exports.diffLines = exports.diffWordsWithSpace = exports.diffWords = exports.diffChars = exports.Diff = undefined;
+
+	/*istanbul ignore end*/var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	/*istanbul ignore end*/var /*istanbul ignore start*/_character = __webpack_require__(2) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_word = __webpack_require__(3) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_line = __webpack_require__(5) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_sentence = __webpack_require__(6) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_css = __webpack_require__(7) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_json = __webpack_require__(8) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_array = __webpack_require__(9) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_apply = __webpack_require__(10) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_parse = __webpack_require__(11) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_merge = __webpack_require__(13) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_create = __webpack_require__(14) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_dmp = __webpack_require__(16) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_xml = __webpack_require__(17) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/* See LICENSE file for terms of use */
+
+	/*
+	 * Text diff implementation.
+	 *
+	 * This library supports the following APIS:
+	 * JsDiff.diffChars: Character by character diff
+	 * JsDiff.diffWords: Word (as defined by \b regex) diff which ignores whitespace
+	 * JsDiff.diffLines: Line based diff
+	 *
+	 * JsDiff.diffCss: Diff targeted at CSS content
+	 *
+	 * These methods are based on the implementation proposed in
+	 * "An O(ND) Difference Algorithm and its Variations" (Myers, 1986).
+	 * http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.4.6927
+	 */
+	exports. /*istanbul ignore end*/Diff = _base2['default'];
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffChars = _character.diffChars;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffWords = _word.diffWords;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffWordsWithSpace = _word.diffWordsWithSpace;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffLines = _line.diffLines;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffTrimmedLines = _line.diffTrimmedLines;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffSentences = _sentence.diffSentences;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffCss = _css.diffCss;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffJson = _json.diffJson;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffArrays = _array.diffArrays;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/structuredPatch = _create.structuredPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/createTwoFilesPatch = _create.createTwoFilesPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/createPatch = _create.createPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/applyPatch = _apply.applyPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/applyPatches = _apply.applyPatches;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/parsePatch = _parse.parsePatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/merge = _merge.merge;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/convertChangesToDMP = _dmp.convertChangesToDMP;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/convertChangesToXML = _xml.convertChangesToXML;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/canonicalize = _json.canonicalize;
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uL3NyYy9pbmRleC5qcyJdLCJuYW1lcyI6WyJEaWZmIiwiZGlmZkNoYXJzIiwiZGlmZldvcmRzIiwiZGlmZldvcmRzV2l0aFNwYWNlIiwiZGlmZkxpbmVzIiwiZGlmZlRyaW1tZWRMaW5lcyIsImRpZmZTZW50ZW5jZXMiLCJkaWZmQ3NzIiwiZGlmZkpzb24iLCJkaWZmQXJyYXlzIiwic3RydWN0dXJlZFBhdGNoIiwiY3JlYXRlVHdvRmlsZXNQYXRjaCIsImNyZWF0ZVBhdGNoIiwiYXBwbHlQYXRjaCIsImFwcGx5UGF0Y2hlcyIsInBhcnNlUGF0Y2giLCJtZXJnZSIsImNvbnZlcnRDaGFuZ2VzVG9ETVAiLCJjb252ZXJ0Q2hhbmdlc1RvWE1MIiwiY2Fub25pY2FsaXplIl0sIm1hcHBpbmdzIjoiOzs7Ozt1QkFnQkE7Ozs7dUJBQ0E7O0FBQ0E7O0FBQ0E7O0FBQ0E7O0FBRUE7O0FBQ0E7O0FBRUE7O0FBRUE7O0FBQ0E7O0FBQ0E7O0FBQ0E7O0FBRUE7O0FBQ0E7Ozs7QUFqQ0E7O0FBRUE7Ozs7Ozs7Ozs7Ozs7O2dDQWtDRUEsSTt5REFFQUMsUzt5REFDQUMsUzt5REFDQUMsa0I7eURBQ0FDLFM7eURBQ0FDLGdCO3lEQUNBQyxhO3lEQUVBQyxPO3lEQUNBQyxRO3lEQUVBQyxVO3lEQUVBQyxlO3lEQUNBQyxtQjt5REFDQUMsVzt5REFDQUMsVTt5REFDQUMsWTt5REFDQUMsVTt5REFDQUMsSzt5REFDQUMsbUI7eURBQ0FDLG1CO3lEQUNBQyxZIiwiZmlsZSI6ImluZGV4LmpzIiwic291cmNlc0NvbnRlbnQiOlsiLyogU2VlIExJQ0VOU0UgZmlsZSBmb3IgdGVybXMgb2YgdXNlICovXG5cbi8qXG4gKiBUZXh0IGRpZmYgaW1wbGVtZW50YXRpb24uXG4gKlxuICogVGhpcyBsaWJyYXJ5IHN1cHBvcnRzIHRoZSBmb2xsb3dpbmcgQVBJUzpcbiAqIEpzRGlmZi5kaWZmQ2hhcnM6IENoYXJhY3RlciBieSBjaGFyYWN0ZXIgZGlmZlxuICogSnNEaWZmLmRpZmZXb3JkczogV29yZCAoYXMgZGVmaW5lZCBieSBcXGIgcmVnZXgpIGRpZmYgd2hpY2ggaWdub3JlcyB3aGl0ZXNwYWNlXG4gKiBKc0RpZmYuZGlmZkxpbmVzOiBMaW5lIGJhc2VkIGRpZmZcbiAqXG4gKiBKc0RpZmYuZGlmZkNzczogRGlmZiB0YXJnZXRlZCBhdCBDU1MgY29udGVudFxuICpcbiAqIFRoZXNlIG1ldGhvZHMgYXJlIGJhc2VkIG9uIHRoZSBpbXBsZW1lbnRhdGlvbiBwcm9wb3NlZCBpblxuICogXCJBbiBPKE5EKSBEaWZmZXJlbmNlIEFsZ29yaXRobSBhbmQgaXRzIFZhcmlhdGlvbnNcIiAoTXllcnMsIDE5ODYpLlxuICogaHR0cDovL2NpdGVzZWVyeC5pc3QucHN1LmVkdS92aWV3ZG9jL3N1bW1hcnk/ZG9pPTEwLjEuMS40LjY5MjdcbiAqL1xuaW1wb3J0IERpZmYgZnJvbSAnLi9kaWZmL2Jhc2UnO1xuaW1wb3J0IHtkaWZmQ2hhcnN9IGZyb20gJy4vZGlmZi9jaGFyYWN0ZXInO1xuaW1wb3J0IHtkaWZmV29yZHMsIGRpZmZXb3Jkc1dpdGhTcGFjZX0gZnJvbSAnLi9kaWZmL3dvcmQnO1xuaW1wb3J0IHtkaWZmTGluZXMsIGRpZmZUcmltbWVkTGluZXN9IGZyb20gJy4vZGlmZi9saW5lJztcbmltcG9ydCB7ZGlmZlNlbnRlbmNlc30gZnJvbSAnLi9kaWZmL3NlbnRlbmNlJztcblxuaW1wb3J0IHtkaWZmQ3NzfSBmcm9tICcuL2RpZmYvY3NzJztcbmltcG9ydCB7ZGlmZkpzb24sIGNhbm9uaWNhbGl6ZX0gZnJvbSAnLi9kaWZmL2pzb24nO1xuXG5pbXBvcnQge2RpZmZBcnJheXN9IGZyb20gJy4vZGlmZi9hcnJheSc7XG5cbmltcG9ydCB7YXBwbHlQYXRjaCwgYXBwbHlQYXRjaGVzfSBmcm9tICcuL3BhdGNoL2FwcGx5JztcbmltcG9ydCB7cGFyc2VQYXRjaH0gZnJvbSAnLi9wYXRjaC9wYXJzZSc7XG5pbXBvcnQge21lcmdlfSBmcm9tICcuL3BhdGNoL21lcmdlJztcbmltcG9ydCB7c3RydWN0dXJlZFBhdGNoLCBjcmVhdGVUd29GaWxlc1BhdGNoLCBjcmVhdGVQYXRjaH0gZnJvbSAnLi9wYXRjaC9jcmVhdGUnO1xuXG5pbXBvcnQge2NvbnZlcnRDaGFuZ2VzVG9ETVB9IGZyb20gJy4vY29udmVydC9kbXAnO1xuaW1wb3J0IHtjb252ZXJ0Q2hhbmdlc1RvWE1MfSBmcm9tICcuL2NvbnZlcnQveG1sJztcblxuZXhwb3J0IHtcbiAgRGlmZixcblxuICBkaWZmQ2hhcnMsXG4gIGRpZmZXb3JkcyxcbiAgZGlmZldvcmRzV2l0aFNwYWNlLFxuICBkaWZmTGluZXMsXG4gIGRpZmZUcmltbWVkTGluZXMsXG4gIGRpZmZTZW50ZW5jZXMsXG5cbiAgZGlmZkNzcyxcbiAgZGlmZkpzb24sXG5cbiAgZGlmZkFycmF5cyxcblxuICBzdHJ1Y3R1cmVkUGF0Y2gsXG4gIGNyZWF0ZVR3b0ZpbGVzUGF0Y2gsXG4gIGNyZWF0ZVBhdGNoLFxuICBhcHBseVBhdGNoLFxuICBhcHBseVBhdGNoZXMsXG4gIHBhcnNlUGF0Y2gsXG4gIG1lcmdlLFxuICBjb252ZXJ0Q2hhbmdlc1RvRE1QLFxuICBjb252ZXJ0Q2hhbmdlc1RvWE1MLFxuICBjYW5vbmljYWxpemVcbn07XG4iXX0=
+
+
+/***/ }),
+/* 1 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports['default'] = /*istanbul ignore end*/Diff;
+	function Diff() {}
+
+	Diff.prototype = {
+	  /*istanbul ignore start*/ /*istanbul ignore end*/diff: function diff(oldString, newString) {
+	    /*istanbul ignore start*/var /*istanbul ignore end*/options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
+
+	    var callback = options.callback;
+	    if (typeof options === 'function') {
+	      callback = options;
+	      options = {};
+	    }
+	    this.options = options;
+
+	    var self = this;
+
+	    function done(value) {
+	      if (callback) {
+	        setTimeout(function () {
+	          callback(undefined, value);
+	        }, 0);
+	        return true;
+	      } else {
+	        return value;
+	      }
+	    }
+
+	    // Allow subclasses to massage the input prior to running
+	    oldString = this.castInput(oldString);
+	    newString = this.castInput(newString);
+
+	    oldString = this.removeEmpty(this.tokenize(oldString));
+	    newString = this.removeEmpty(this.tokenize(newString));
+
+	    var newLen = newString.length,
+	        oldLen = oldString.length;
+	    var editLength = 1;
+	    var maxEditLength = newLen + oldLen;
+	    var bestPath = [{ newPos: -1, components: [] }];
+
+	    // Seed editLength = 0, i.e. the content starts with the same values
+	    var oldPos = this.extractCommon(bestPath[0], newString, oldString, 0);
+	    if (bestPath[0].newPos + 1 >= newLen && oldPos + 1 >= oldLen) {
+	      // Identity per the equality and tokenizer
+	      return done([{ value: this.join(newString), count: newString.length }]);
+	    }
+
+	    // Main worker method. checks all permutations of a given edit length for acceptance.
+	    function execEditLength() {
+	      for (var diagonalPath = -1 * editLength; diagonalPath <= editLength; diagonalPath += 2) {
+	        var basePath = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+	        var addPath = bestPath[diagonalPath - 1],
+	            removePath = bestPath[diagonalPath + 1],
+	            _oldPos = (removePath ? removePath.newPos : 0) - diagonalPath;
+	        if (addPath) {
+	          // No one else is going to attempt to use this value, clear it
+	          bestPath[diagonalPath - 1] = undefined;
+	        }
+
+	        var canAdd = addPath && addPath.newPos + 1 < newLen,
+	            canRemove = removePath && 0 <= _oldPos && _oldPos < oldLen;
+	        if (!canAdd && !canRemove) {
+	          // If this path is a terminal then prune
+	          bestPath[diagonalPath] = undefined;
+	          continue;
+	        }
+
+	        // Select the diagonal that we want to branch from. We select the prior
+	        // path whose position in the new string is the farthest from the origin
+	        // and does not pass the bounds of the diff graph
+	        if (!canAdd || canRemove && addPath.newPos < removePath.newPos) {
+	          basePath = clonePath(removePath);
+	          self.pushComponent(basePath.components, undefined, true);
+	        } else {
+	          basePath = addPath; // No need to clone, we've pulled it from the list
+	          basePath.newPos++;
+	          self.pushComponent(basePath.components, true, undefined);
+	        }
+
+	        _oldPos = self.extractCommon(basePath, newString, oldString, diagonalPath);
+
+	        // If we have hit the end of both strings, then we are done
+	        if (basePath.newPos + 1 >= newLen && _oldPos + 1 >= oldLen) {
+	          return done(buildValues(self, basePath.components, newString, oldString, self.useLongestToken));
+	        } else {
+	          // Otherwise track this path as a potential candidate and continue.
+	          bestPath[diagonalPath] = basePath;
+	        }
+	      }
+
+	      editLength++;
+	    }
+
+	    // Performs the length of edit iteration. Is a bit fugly as this has to support the
+	    // sync and async mode which is never fun. Loops over execEditLength until a value
+	    // is produced.
+	    if (callback) {
+	      (function exec() {
+	        setTimeout(function () {
+	          // This should not happen, but we want to be safe.
+	          /* istanbul ignore next */
+	          if (editLength > maxEditLength) {
+	            return callback();
+	          }
+
+	          if (!execEditLength()) {
+	            exec();
+	          }
+	        }, 0);
+	      })();
+	    } else {
+	      while (editLength <= maxEditLength) {
+	        var ret = execEditLength();
+	        if (ret) {
+	          return ret;
+	        }
+	      }
+	    }
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/pushComponent: function pushComponent(components, added, removed) {
+	    var last = components[components.length - 1];
+	    if (last && last.added === added && last.removed === removed) {
+	      // We need to clone here as the component clone operation is just
+	      // as shallow array clone
+	      components[components.length - 1] = { count: last.count + 1, added: added, removed: removed };
+	    } else {
+	      components.push({ count: 1, added: added, removed: removed });
+	    }
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/extractCommon: function extractCommon(basePath, newString, oldString, diagonalPath) {
+	    var newLen = newString.length,
+	        oldLen = oldString.length,
+	        newPos = basePath.newPos,
+	        oldPos = newPos - diagonalPath,
+	        commonCount = 0;
+	    while (newPos + 1 < newLen && oldPos + 1 < oldLen && this.equals(newString[newPos + 1], oldString[oldPos + 1])) {
+	      newPos++;
+	      oldPos++;
+	      commonCount++;
+	    }
+
+	    if (commonCount) {
+	      basePath.components.push({ count: commonCount });
+	    }
+
+	    basePath.newPos = newPos;
+	    return oldPos;
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/equals: function equals(left, right) {
+	    if (this.options.comparator) {
+	      return this.options.comparator(left, right);
+	    } else {
+	      return left === right || this.options.ignoreCase && left.toLowerCase() === right.toLowerCase();
+	    }
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/removeEmpty: function removeEmpty(array) {
+	    var ret = [];
+	    for (var i = 0; i < array.length; i++) {
+	      if (array[i]) {
+	        ret.push(array[i]);
+	      }
+	    }
+	    return ret;
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/castInput: function castInput(value) {
+	    return value;
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/tokenize: function tokenize(value) {
+	    return value.split('');
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/join: function join(chars) {
+	    return chars.join('');
+	  }
+	};
+
+	function buildValues(diff, components, newString, oldString, useLongestToken) {
+	  var componentPos = 0,
+	      componentLen = components.length,
+	      newPos = 0,
+	      oldPos = 0;
+
+	  for (; componentPos < componentLen; componentPos++) {
+	    var component = components[componentPos];
+	    if (!component.removed) {
+	      if (!component.added && useLongestToken) {
+	        var value = newString.slice(newPos, newPos + component.count);
+	        value = value.map(function (value, i) {
+	          var oldValue = oldString[oldPos + i];
+	          return oldValue.length > value.length ? oldValue : value;
+	        });
+
+	        component.value = diff.join(value);
+	      } else {
+	        component.value = diff.join(newString.slice(newPos, newPos + component.count));
+	      }
+	      newPos += component.count;
+
+	      // Common case
+	      if (!component.added) {
+	        oldPos += component.count;
+	      }
+	    } else {
+	      component.value = diff.join(oldString.slice(oldPos, oldPos + component.count));
+	      oldPos += component.count;
+
+	      // Reverse add and remove so removes are output first to match common convention
+	      // The diffing algorithm is tied to add then remove output and this is the simplest
+	      // route to get the desired output with minimal overhead.
+	      if (componentPos && components[componentPos - 1].added) {
+	        var tmp = components[componentPos - 1];
+	        components[componentPos - 1] = components[componentPos];
+	        components[componentPos] = tmp;
+	      }
+	    }
+	  }
+
+	  // Special case handle for when one terminal is ignored (i.e. whitespace).
+	  // For this case we merge the terminal into the prior string and drop the change.
+	  // This is only available for string mode.
+	  var lastComponent = components[componentLen - 1];
+	  if (componentLen > 1 && typeof lastComponent.value === 'string' && (lastComponent.added || lastComponent.removed) && diff.equals('', lastComponent.value)) {
+	    components[componentLen - 2].value += lastComponent.value;
+	    components.pop();
+	  }
+
+	  return components;
+	}
+
+	function clonePath(path) {
+	  return { newPos: path.newPos, components: path.components.slice(0) };
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2Jhc2UuanMiXSwibmFtZXMiOlsiRGlmZiIsInByb3RvdHlwZSIsImRpZmYiLCJvbGRTdHJpbmciLCJuZXdTdHJpbmciLCJvcHRpb25zIiwiY2FsbGJhY2siLCJzZWxmIiwiZG9uZSIsInZhbHVlIiwic2V0VGltZW91dCIsInVuZGVmaW5lZCIsImNhc3RJbnB1dCIsInJlbW92ZUVtcHR5IiwidG9rZW5pemUiLCJuZXdMZW4iLCJsZW5ndGgiLCJvbGRMZW4iLCJlZGl0TGVuZ3RoIiwibWF4RWRpdExlbmd0aCIsImJlc3RQYXRoIiwibmV3UG9zIiwiY29tcG9uZW50cyIsIm9sZFBvcyIsImV4dHJhY3RDb21tb24iLCJqb2luIiwiY291bnQiLCJleGVjRWRpdExlbmd0aCIsImRpYWdvbmFsUGF0aCIsImJhc2VQYXRoIiwiYWRkUGF0aCIsInJlbW92ZVBhdGgiLCJjYW5BZGQiLCJjYW5SZW1vdmUiLCJjbG9uZVBhdGgiLCJwdXNoQ29tcG9uZW50IiwiYnVpbGRWYWx1ZXMiLCJ1c2VMb25nZXN0VG9rZW4iLCJleGVjIiwicmV0IiwiYWRkZWQiLCJyZW1vdmVkIiwibGFzdCIsInB1c2giLCJjb21tb25Db3VudCIsImVxdWFscyIsImxlZnQiLCJyaWdodCIsImNvbXBhcmF0b3IiLCJpZ25vcmVDYXNlIiwidG9Mb3dlckNhc2UiLCJhcnJheSIsImkiLCJzcGxpdCIsImNoYXJzIiwiY29tcG9uZW50UG9zIiwiY29tcG9uZW50TGVuIiwiY29tcG9uZW50Iiwic2xpY2UiLCJtYXAiLCJvbGRWYWx1ZSIsInRtcCIsImxhc3RDb21wb25lbnQiLCJwb3AiLCJwYXRoIl0sIm1hcHBpbmdzIjoiOzs7NENBQXdCQSxJO0FBQVQsU0FBU0EsSUFBVCxHQUFnQixDQUFFOztBQUVqQ0EsS0FBS0MsU0FBTCxHQUFpQjtBQUFBLG1EQUNmQyxJQURlLGdCQUNWQyxTQURVLEVBQ0NDLFNBREQsRUFDMEI7QUFBQSx3REFBZEMsT0FBYyx1RUFBSixFQUFJOztBQUN2QyxRQUFJQyxXQUFXRCxRQUFRQyxRQUF2QjtBQUNBLFFBQUksT0FBT0QsT0FBUCxLQUFtQixVQUF2QixFQUFtQztBQUNqQ0MsaUJBQVdELE9BQVg7QUFDQUEsZ0JBQVUsRUFBVjtBQUNEO0FBQ0QsU0FBS0EsT0FBTCxHQUFlQSxPQUFmOztBQUVBLFFBQUlFLE9BQU8sSUFBWDs7QUFFQSxhQUFTQyxJQUFULENBQWNDLEtBQWQsRUFBcUI7QUFDbkIsVUFBSUgsUUFBSixFQUFjO0FBQ1pJLG1CQUFXLFlBQVc7QUFBRUosbUJBQVNLLFNBQVQsRUFBb0JGLEtBQXBCO0FBQTZCLFNBQXJELEVBQXVELENBQXZEO0FBQ0EsZUFBTyxJQUFQO0FBQ0QsT0FIRCxNQUdPO0FBQ0wsZUFBT0EsS0FBUDtBQUNEO0FBQ0Y7O0FBRUQ7QUFDQU4sZ0JBQVksS0FBS1MsU0FBTCxDQUFlVCxTQUFmLENBQVo7QUFDQUMsZ0JBQVksS0FBS1EsU0FBTCxDQUFlUixTQUFmLENBQVo7O0FBRUFELGdCQUFZLEtBQUtVLFdBQUwsQ0FBaUIsS0FBS0MsUUFBTCxDQUFjWCxTQUFkLENBQWpCLENBQVo7QUFDQUMsZ0JBQVksS0FBS1MsV0FBTCxDQUFpQixLQUFLQyxRQUFMLENBQWNWLFNBQWQsQ0FBakIsQ0FBWjs7QUFFQSxRQUFJVyxTQUFTWCxVQUFVWSxNQUF2QjtBQUFBLFFBQStCQyxTQUFTZCxVQUFVYSxNQUFsRDtBQUNBLFFBQUlFLGFBQWEsQ0FBakI7QUFDQSxRQUFJQyxnQkFBZ0JKLFNBQVNFLE1BQTdCO0FBQ0EsUUFBSUcsV0FBVyxDQUFDLEVBQUVDLFFBQVEsQ0FBQyxDQUFYLEVBQWNDLFlBQVksRUFBMUIsRUFBRCxDQUFmOztBQUVBO0FBQ0EsUUFBSUMsU0FBUyxLQUFLQyxhQUFMLENBQW1CSixTQUFTLENBQVQsQ0FBbkIsRUFBZ0NoQixTQUFoQyxFQUEyQ0QsU0FBM0MsRUFBc0QsQ0FBdEQsQ0FBYjtBQUNBLFFBQUlpQixTQUFTLENBQVQsRUFBWUMsTUFBWixHQUFxQixDQUFyQixJQUEwQk4sTUFBMUIsSUFBb0NRLFNBQVMsQ0FBVCxJQUFjTixNQUF0RCxFQUE4RDtBQUM1RDtBQUNBLGFBQU9ULEtBQUssQ0FBQyxFQUFDQyxPQUFPLEtBQUtnQixJQUFMLENBQVVyQixTQUFWLENBQVIsRUFBOEJzQixPQUFPdEIsVUFBVVksTUFBL0MsRUFBRCxDQUFMLENBQVA7QUFDRDs7QUFFRDtBQUNBLGFBQVNXLGNBQVQsR0FBMEI7QUFDeEIsV0FBSyxJQUFJQyxlQUFlLENBQUMsQ0FBRCxHQUFLVixVQUE3QixFQUF5Q1UsZ0JBQWdCVixVQUF6RCxFQUFxRVUsZ0JBQWdCLENBQXJGLEVBQXdGO0FBQ3RGLFlBQUlDLDBDQUFKO0FBQ0EsWUFBSUMsVUFBVVYsU0FBU1EsZUFBZSxDQUF4QixDQUFkO0FBQUEsWUFDSUcsYUFBYVgsU0FBU1EsZUFBZSxDQUF4QixDQURqQjtBQUFBLFlBRUlMLFVBQVMsQ0FBQ1EsYUFBYUEsV0FBV1YsTUFBeEIsR0FBaUMsQ0FBbEMsSUFBdUNPLFlBRnBEO0FBR0EsWUFBSUUsT0FBSixFQUFhO0FBQ1g7QUFDQVYsbUJBQVNRLGVBQWUsQ0FBeEIsSUFBNkJqQixTQUE3QjtBQUNEOztBQUVELFlBQUlxQixTQUFTRixXQUFXQSxRQUFRVCxNQUFSLEdBQWlCLENBQWpCLEdBQXFCTixNQUE3QztBQUFBLFlBQ0lrQixZQUFZRixjQUFjLEtBQUtSLE9BQW5CLElBQTZCQSxVQUFTTixNQUR0RDtBQUVBLFlBQUksQ0FBQ2UsTUFBRCxJQUFXLENBQUNDLFNBQWhCLEVBQTJCO0FBQ3pCO0FBQ0FiLG1CQUFTUSxZQUFULElBQXlCakIsU0FBekI7QUFDQTtBQUNEOztBQUVEO0FBQ0E7QUFDQTtBQUNBLFlBQUksQ0FBQ3FCLE1BQUQsSUFBWUMsYUFBYUgsUUFBUVQsTUFBUixHQUFpQlUsV0FBV1YsTUFBekQsRUFBa0U7QUFDaEVRLHFCQUFXSyxVQUFVSCxVQUFWLENBQVg7QUFDQXhCLGVBQUs0QixhQUFMLENBQW1CTixTQUFTUCxVQUE1QixFQUF3Q1gsU0FBeEMsRUFBbUQsSUFBbkQ7QUFDRCxTQUhELE1BR087QUFDTGtCLHFCQUFXQyxPQUFYLENBREssQ0FDaUI7QUFDdEJELG1CQUFTUixNQUFUO0FBQ0FkLGVBQUs0QixhQUFMLENBQW1CTixTQUFTUCxVQUE1QixFQUF3QyxJQUF4QyxFQUE4Q1gsU0FBOUM7QUFDRDs7QUFFRFksa0JBQVNoQixLQUFLaUIsYUFBTCxDQUFtQkssUUFBbkIsRUFBNkJ6QixTQUE3QixFQUF3Q0QsU0FBeEMsRUFBbUR5QixZQUFuRCxDQUFUOztBQUVBO0FBQ0EsWUFBSUMsU0FBU1IsTUFBVCxHQUFrQixDQUFsQixJQUF1Qk4sTUFBdkIsSUFBaUNRLFVBQVMsQ0FBVCxJQUFjTixNQUFuRCxFQUEyRDtBQUN6RCxpQkFBT1QsS0FBSzRCLFlBQVk3QixJQUFaLEVBQWtCc0IsU0FBU1AsVUFBM0IsRUFBdUNsQixTQUF2QyxFQUFrREQsU0FBbEQsRUFBNkRJLEtBQUs4QixlQUFsRSxDQUFMLENBQVA7QUFDRCxTQUZELE1BRU87QUFDTDtBQUNBakIsbUJBQVNRLFlBQVQsSUFBeUJDLFFBQXpCO0FBQ0Q7QUFDRjs7QUFFRFg7QUFDRDs7QUFFRDtBQUNBO0FBQ0E7QUFDQSxRQUFJWixRQUFKLEVBQWM7QUFDWCxnQkFBU2dDLElBQVQsR0FBZ0I7QUFDZjVCLG1CQUFXLFlBQVc7QUFDcEI7QUFDQTtBQUNBLGNBQUlRLGFBQWFDLGFBQWpCLEVBQWdDO0FBQzlCLG1CQUFPYixVQUFQO0FBQ0Q7O0FBRUQsY0FBSSxDQUFDcUIsZ0JBQUwsRUFBdUI7QUFDckJXO0FBQ0Q7QUFDRixTQVZELEVBVUcsQ0FWSDtBQVdELE9BWkEsR0FBRDtBQWFELEtBZEQsTUFjTztBQUNMLGFBQU9wQixjQUFjQyxhQUFyQixFQUFvQztBQUNsQyxZQUFJb0IsTUFBTVosZ0JBQVY7QUFDQSxZQUFJWSxHQUFKLEVBQVM7QUFDUCxpQkFBT0EsR0FBUDtBQUNEO0FBQ0Y7QUFDRjtBQUNGLEdBOUdjO0FBQUEsbURBZ0hmSixhQWhIZSx5QkFnSERiLFVBaEhDLEVBZ0hXa0IsS0FoSFgsRUFnSGtCQyxPQWhIbEIsRUFnSDJCO0FBQ3hDLFFBQUlDLE9BQU9wQixXQUFXQSxXQUFXTixNQUFYLEdBQW9CLENBQS9CLENBQVg7QUFDQSxRQUFJMEIsUUFBUUEsS0FBS0YsS0FBTCxLQUFlQSxLQUF2QixJQUFnQ0UsS0FBS0QsT0FBTCxLQUFpQkEsT0FBckQsRUFBOEQ7QUFDNUQ7QUFDQTtBQUNBbkIsaUJBQVdBLFdBQVdOLE1BQVgsR0FBb0IsQ0FBL0IsSUFBb0MsRUFBQ1UsT0FBT2dCLEtBQUtoQixLQUFMLEdBQWEsQ0FBckIsRUFBd0JjLE9BQU9BLEtBQS9CLEVBQXNDQyxTQUFTQSxPQUEvQyxFQUFwQztBQUNELEtBSkQsTUFJTztBQUNMbkIsaUJBQVdxQixJQUFYLENBQWdCLEVBQUNqQixPQUFPLENBQVIsRUFBV2MsT0FBT0EsS0FBbEIsRUFBeUJDLFNBQVNBLE9BQWxDLEVBQWhCO0FBQ0Q7QUFDRixHQXpIYztBQUFBLG1EQTBIZmpCLGFBMUhlLHlCQTBIREssUUExSEMsRUEwSFN6QixTQTFIVCxFQTBIb0JELFNBMUhwQixFQTBIK0J5QixZQTFIL0IsRUEwSDZDO0FBQzFELFFBQUliLFNBQVNYLFVBQVVZLE1BQXZCO0FBQUEsUUFDSUMsU0FBU2QsVUFBVWEsTUFEdkI7QUFBQSxRQUVJSyxTQUFTUSxTQUFTUixNQUZ0QjtBQUFBLFFBR0lFLFNBQVNGLFNBQVNPLFlBSHRCO0FBQUEsUUFLSWdCLGNBQWMsQ0FMbEI7QUFNQSxXQUFPdkIsU0FBUyxDQUFULEdBQWFOLE1BQWIsSUFBdUJRLFNBQVMsQ0FBVCxHQUFhTixNQUFwQyxJQUE4QyxLQUFLNEIsTUFBTCxDQUFZekMsVUFBVWlCLFNBQVMsQ0FBbkIsQ0FBWixFQUFtQ2xCLFVBQVVvQixTQUFTLENBQW5CLENBQW5DLENBQXJELEVBQWdIO0FBQzlHRjtBQUNBRTtBQUNBcUI7QUFDRDs7QUFFRCxRQUFJQSxXQUFKLEVBQWlCO0FBQ2ZmLGVBQVNQLFVBQVQsQ0FBb0JxQixJQUFwQixDQUF5QixFQUFDakIsT0FBT2tCLFdBQVIsRUFBekI7QUFDRDs7QUFFRGYsYUFBU1IsTUFBVCxHQUFrQkEsTUFBbEI7QUFDQSxXQUFPRSxNQUFQO0FBQ0QsR0E3SWM7QUFBQSxtREErSWZzQixNQS9JZSxrQkErSVJDLElBL0lRLEVBK0lGQyxLQS9JRSxFQStJSztBQUNsQixRQUFJLEtBQUsxQyxPQUFMLENBQWEyQyxVQUFqQixFQUE2QjtBQUMzQixhQUFPLEtBQUszQyxPQUFMLENBQWEyQyxVQUFiLENBQXdCRixJQUF4QixFQUE4QkMsS0FBOUIsQ0FBUDtBQUNELEtBRkQsTUFFTztBQUNMLGFBQU9ELFNBQVNDLEtBQVQsSUFDRCxLQUFLMUMsT0FBTCxDQUFhNEMsVUFBYixJQUEyQkgsS0FBS0ksV0FBTCxPQUF1QkgsTUFBTUcsV0FBTixFQUR4RDtBQUVEO0FBQ0YsR0F0SmM7QUFBQSxtREF1SmZyQyxXQXZKZSx1QkF1SkhzQyxLQXZKRyxFQXVKSTtBQUNqQixRQUFJWixNQUFNLEVBQVY7QUFDQSxTQUFLLElBQUlhLElBQUksQ0FBYixFQUFnQkEsSUFBSUQsTUFBTW5DLE1BQTFCLEVBQWtDb0MsR0FBbEMsRUFBdUM7QUFDckMsVUFBSUQsTUFBTUMsQ0FBTixDQUFKLEVBQWM7QUFDWmIsWUFBSUksSUFBSixDQUFTUSxNQUFNQyxDQUFOLENBQVQ7QUFDRDtBQUNGO0FBQ0QsV0FBT2IsR0FBUDtBQUNELEdBL0pjO0FBQUEsbURBZ0tmM0IsU0FoS2UscUJBZ0tMSCxLQWhLSyxFQWdLRTtBQUNmLFdBQU9BLEtBQVA7QUFDRCxHQWxLYztBQUFBLG1EQW1LZkssUUFuS2Usb0JBbUtOTCxLQW5LTSxFQW1LQztBQUNkLFdBQU9BLE1BQU00QyxLQUFOLENBQVksRUFBWixDQUFQO0FBQ0QsR0FyS2M7QUFBQSxtREFzS2Y1QixJQXRLZSxnQkFzS1Y2QixLQXRLVSxFQXNLSDtBQUNWLFdBQU9BLE1BQU03QixJQUFOLENBQVcsRUFBWCxDQUFQO0FBQ0Q7QUF4S2MsQ0FBakI7O0FBMktBLFNBQVNXLFdBQVQsQ0FBcUJsQyxJQUFyQixFQUEyQm9CLFVBQTNCLEVBQXVDbEIsU0FBdkMsRUFBa0RELFNBQWxELEVBQTZEa0MsZUFBN0QsRUFBOEU7QUFDNUUsTUFBSWtCLGVBQWUsQ0FBbkI7QUFBQSxNQUNJQyxlQUFlbEMsV0FBV04sTUFEOUI7QUFBQSxNQUVJSyxTQUFTLENBRmI7QUFBQSxNQUdJRSxTQUFTLENBSGI7O0FBS0EsU0FBT2dDLGVBQWVDLFlBQXRCLEVBQW9DRCxjQUFwQyxFQUFvRDtBQUNsRCxRQUFJRSxZQUFZbkMsV0FBV2lDLFlBQVgsQ0FBaEI7QUFDQSxRQUFJLENBQUNFLFVBQVVoQixPQUFmLEVBQXdCO0FBQ3RCLFVBQUksQ0FBQ2dCLFVBQVVqQixLQUFYLElBQW9CSCxlQUF4QixFQUF5QztBQUN2QyxZQUFJNUIsUUFBUUwsVUFBVXNELEtBQVYsQ0FBZ0JyQyxNQUFoQixFQUF3QkEsU0FBU29DLFVBQVUvQixLQUEzQyxDQUFaO0FBQ0FqQixnQkFBUUEsTUFBTWtELEdBQU4sQ0FBVSxVQUFTbEQsS0FBVCxFQUFnQjJDLENBQWhCLEVBQW1CO0FBQ25DLGNBQUlRLFdBQVd6RCxVQUFVb0IsU0FBUzZCLENBQW5CLENBQWY7QUFDQSxpQkFBT1EsU0FBUzVDLE1BQVQsR0FBa0JQLE1BQU1PLE1BQXhCLEdBQWlDNEMsUUFBakMsR0FBNENuRCxLQUFuRDtBQUNELFNBSE8sQ0FBUjs7QUFLQWdELGtCQUFVaEQsS0FBVixHQUFrQlAsS0FBS3VCLElBQUwsQ0FBVWhCLEtBQVYsQ0FBbEI7QUFDRCxPQVJELE1BUU87QUFDTGdELGtCQUFVaEQsS0FBVixHQUFrQlAsS0FBS3VCLElBQUwsQ0FBVXJCLFVBQVVzRCxLQUFWLENBQWdCckMsTUFBaEIsRUFBd0JBLFNBQVNvQyxVQUFVL0IsS0FBM0MsQ0FBVixDQUFsQjtBQUNEO0FBQ0RMLGdCQUFVb0MsVUFBVS9CLEtBQXBCOztBQUVBO0FBQ0EsVUFBSSxDQUFDK0IsVUFBVWpCLEtBQWYsRUFBc0I7QUFDcEJqQixrQkFBVWtDLFVBQVUvQixLQUFwQjtBQUNEO0FBQ0YsS0FsQkQsTUFrQk87QUFDTCtCLGdCQUFVaEQsS0FBVixHQUFrQlAsS0FBS3VCLElBQUwsQ0FBVXRCLFVBQVV1RCxLQUFWLENBQWdCbkMsTUFBaEIsRUFBd0JBLFNBQVNrQyxVQUFVL0IsS0FBM0MsQ0FBVixDQUFsQjtBQUNBSCxnQkFBVWtDLFVBQVUvQixLQUFwQjs7QUFFQTtBQUNBO0FBQ0E7QUFDQSxVQUFJNkIsZ0JBQWdCakMsV0FBV2lDLGVBQWUsQ0FBMUIsRUFBNkJmLEtBQWpELEVBQXdEO0FBQ3RELFlBQUlxQixNQUFNdkMsV0FBV2lDLGVBQWUsQ0FBMUIsQ0FBVjtBQUNBakMsbUJBQVdpQyxlQUFlLENBQTFCLElBQStCakMsV0FBV2lDLFlBQVgsQ0FBL0I7QUFDQWpDLG1CQUFXaUMsWUFBWCxJQUEyQk0sR0FBM0I7QUFDRDtBQUNGO0FBQ0Y7O0FBRUQ7QUFDQTtBQUNBO0FBQ0EsTUFBSUMsZ0JBQWdCeEMsV0FBV2tDLGVBQWUsQ0FBMUIsQ0FBcEI7QUFDQSxNQUFJQSxlQUFlLENBQWYsSUFDRyxPQUFPTSxjQUFjckQsS0FBckIsS0FBK0IsUUFEbEMsS0FFSXFELGNBQWN0QixLQUFkLElBQXVCc0IsY0FBY3JCLE9BRnpDLEtBR0d2QyxLQUFLMkMsTUFBTCxDQUFZLEVBQVosRUFBZ0JpQixjQUFjckQsS0FBOUIsQ0FIUCxFQUc2QztBQUMzQ2EsZUFBV2tDLGVBQWUsQ0FBMUIsRUFBNkIvQyxLQUE3QixJQUFzQ3FELGNBQWNyRCxLQUFwRDtBQUNBYSxlQUFXeUMsR0FBWDtBQUNEOztBQUVELFNBQU96QyxVQUFQO0FBQ0Q7O0FBRUQsU0FBU1ksU0FBVCxDQUFtQjhCLElBQW5CLEVBQXlCO0FBQ3ZCLFNBQU8sRUFBRTNDLFFBQVEyQyxLQUFLM0MsTUFBZixFQUF1QkMsWUFBWTBDLEtBQUsxQyxVQUFMLENBQWdCb0MsS0FBaEIsQ0FBc0IsQ0FBdEIsQ0FBbkMsRUFBUDtBQUNEIiwiZmlsZSI6ImJhc2UuanMiLCJzb3VyY2VzQ29udGVudCI6WyJleHBvcnQgZGVmYXVsdCBmdW5jdGlvbiBEaWZmKCkge31cblxuRGlmZi5wcm90b3R5cGUgPSB7XG4gIGRpZmYob2xkU3RyaW5nLCBuZXdTdHJpbmcsIG9wdGlvbnMgPSB7fSkge1xuICAgIGxldCBjYWxsYmFjayA9IG9wdGlvbnMuY2FsbGJhY2s7XG4gICAgaWYgKHR5cGVvZiBvcHRpb25zID09PSAnZnVuY3Rpb24nKSB7XG4gICAgICBjYWxsYmFjayA9IG9wdGlvbnM7XG4gICAgICBvcHRpb25zID0ge307XG4gICAgfVxuICAgIHRoaXMub3B0aW9ucyA9IG9wdGlvbnM7XG5cbiAgICBsZXQgc2VsZiA9IHRoaXM7XG5cbiAgICBmdW5jdGlvbiBkb25lKHZhbHVlKSB7XG4gICAgICBpZiAoY2FsbGJhY2spIHtcbiAgICAgICAgc2V0VGltZW91dChmdW5jdGlvbigpIHsgY2FsbGJhY2sodW5kZWZpbmVkLCB2YWx1ZSk7IH0sIDApO1xuICAgICAgICByZXR1cm4gdHJ1ZTtcbiAgICAgIH0gZWxzZSB7XG4gICAgICAgIHJldHVybiB2YWx1ZTtcbiAgICAgIH1cbiAgICB9XG5cbiAgICAvLyBBbGxvdyBzdWJjbGFzc2VzIHRvIG1hc3NhZ2UgdGhlIGlucHV0IHByaW9yIHRvIHJ1bm5pbmdcbiAgICBvbGRTdHJpbmcgPSB0aGlzLmNhc3RJbnB1dChvbGRTdHJpbmcpO1xuICAgIG5ld1N0cmluZyA9IHRoaXMuY2FzdElucHV0KG5ld1N0cmluZyk7XG5cbiAgICBvbGRTdHJpbmcgPSB0aGlzLnJlbW92ZUVtcHR5KHRoaXMudG9rZW5pemUob2xkU3RyaW5nKSk7XG4gICAgbmV3U3RyaW5nID0gdGhpcy5yZW1vdmVFbXB0eSh0aGlzLnRva2VuaXplKG5ld1N0cmluZykpO1xuXG4gICAgbGV0IG5ld0xlbiA9IG5ld1N0cmluZy5sZW5ndGgsIG9sZExlbiA9IG9sZFN0cmluZy5sZW5ndGg7XG4gICAgbGV0IGVkaXRMZW5ndGggPSAxO1xuICAgIGxldCBtYXhFZGl0TGVuZ3RoID0gbmV3TGVuICsgb2xkTGVuO1xuICAgIGxldCBiZXN0UGF0aCA9IFt7IG5ld1BvczogLTEsIGNvbXBvbmVudHM6IFtdIH1dO1xuXG4gICAgLy8gU2VlZCBlZGl0TGVuZ3RoID0gMCwgaS5lLiB0aGUgY29udGVudCBzdGFydHMgd2l0aCB0aGUgc2FtZSB2YWx1ZXNcbiAgICBsZXQgb2xkUG9zID0gdGhpcy5leHRyYWN0Q29tbW9uKGJlc3RQYXRoWzBdLCBuZXdTdHJpbmcsIG9sZFN0cmluZywgMCk7XG4gICAgaWYgKGJlc3RQYXRoWzBdLm5ld1BvcyArIDEgPj0gbmV3TGVuICYmIG9sZFBvcyArIDEgPj0gb2xkTGVuKSB7XG4gICAgICAvLyBJZGVudGl0eSBwZXIgdGhlIGVxdWFsaXR5IGFuZCB0b2tlbml6ZXJcbiAgICAgIHJldHVybiBkb25lKFt7dmFsdWU6IHRoaXMuam9pbihuZXdTdHJpbmcpLCBjb3VudDogbmV3U3RyaW5nLmxlbmd0aH1dKTtcbiAgICB9XG5cbiAgICAvLyBNYWluIHdvcmtlciBtZXRob2QuIGNoZWNrcyBhbGwgcGVybXV0YXRpb25zIG9mIGEgZ2l2ZW4gZWRpdCBsZW5ndGggZm9yIGFjY2VwdGFuY2UuXG4gICAgZnVuY3Rpb24gZXhlY0VkaXRMZW5ndGgoKSB7XG4gICAgICBmb3IgKGxldCBkaWFnb25hbFBhdGggPSAtMSAqIGVkaXRMZW5ndGg7IGRpYWdvbmFsUGF0aCA8PSBlZGl0TGVuZ3RoOyBkaWFnb25hbFBhdGggKz0gMikge1xuICAgICAgICBsZXQgYmFzZVBhdGg7XG4gICAgICAgIGxldCBhZGRQYXRoID0gYmVzdFBhdGhbZGlhZ29uYWxQYXRoIC0gMV0sXG4gICAgICAgICAgICByZW1vdmVQYXRoID0gYmVzdFBhdGhbZGlhZ29uYWxQYXRoICsgMV0sXG4gICAgICAgICAgICBvbGRQb3MgPSAocmVtb3ZlUGF0aCA/IHJlbW92ZVBhdGgubmV3UG9zIDogMCkgLSBkaWFnb25hbFBhdGg7XG4gICAgICAgIGlmIChhZGRQYXRoKSB7XG4gICAgICAgICAgLy8gTm8gb25lIGVsc2UgaXMgZ29pbmcgdG8gYXR0ZW1wdCB0byB1c2UgdGhpcyB2YWx1ZSwgY2xlYXIgaXRcbiAgICAgICAgICBiZXN0UGF0aFtkaWFnb25hbFBhdGggLSAxXSA9IHVuZGVmaW5lZDtcbiAgICAgICAgfVxuXG4gICAgICAgIGxldCBjYW5BZGQgPSBhZGRQYXRoICYmIGFkZFBhdGgubmV3UG9zICsgMSA8IG5ld0xlbixcbiAgICAgICAgICAgIGNhblJlbW92ZSA9IHJlbW92ZVBhdGggJiYgMCA8PSBvbGRQb3MgJiYgb2xkUG9zIDwgb2xkTGVuO1xuICAgICAgICBpZiAoIWNhbkFkZCAmJiAhY2FuUmVtb3ZlKSB7XG4gICAgICAgICAgLy8gSWYgdGhpcyBwYXRoIGlzIGEgdGVybWluYWwgdGhlbiBwcnVuZVxuICAgICAgICAgIGJlc3RQYXRoW2RpYWdvbmFsUGF0aF0gPSB1bmRlZmluZWQ7XG4gICAgICAgICAgY29udGludWU7XG4gICAgICAgIH1cblxuICAgICAgICAvLyBTZWxlY3QgdGhlIGRpYWdvbmFsIHRoYXQgd2Ugd2FudCB0byBicmFuY2ggZnJvbS4gV2Ugc2VsZWN0IHRoZSBwcmlvclxuICAgICAgICAvLyBwYXRoIHdob3NlIHBvc2l0aW9uIGluIHRoZSBuZXcgc3RyaW5nIGlzIHRoZSBmYXJ0aGVzdCBmcm9tIHRoZSBvcmlnaW5cbiAgICAgICAgLy8gYW5kIGRvZXMgbm90IHBhc3MgdGhlIGJvdW5kcyBvZiB0aGUgZGlmZiBncmFwaFxuICAgICAgICBpZiAoIWNhbkFkZCB8fCAoY2FuUmVtb3ZlICYmIGFkZFBhdGgubmV3UG9zIDwgcmVtb3ZlUGF0aC5uZXdQb3MpKSB7XG4gICAgICAgICAgYmFzZVBhdGggPSBjbG9uZVBhdGgocmVtb3ZlUGF0aCk7XG4gICAgICAgICAgc2VsZi5wdXNoQ29tcG9uZW50KGJhc2VQYXRoLmNvbXBvbmVudHMsIHVuZGVmaW5lZCwgdHJ1ZSk7XG4gICAgICAgIH0gZWxzZSB7XG4gICAgICAgICAgYmFzZVBhdGggPSBhZGRQYXRoOyAgIC8vIE5vIG5lZWQgdG8gY2xvbmUsIHdlJ3ZlIHB1bGxlZCBpdCBmcm9tIHRoZSBsaXN0XG4gICAgICAgICAgYmFzZVBhdGgubmV3UG9zKys7XG4gICAgICAgICAgc2VsZi5wdXNoQ29tcG9uZW50KGJhc2VQYXRoLmNvbXBvbmVudHMsIHRydWUsIHVuZGVmaW5lZCk7XG4gICAgICAgIH1cblxuICAgICAgICBvbGRQb3MgPSBzZWxmLmV4dHJhY3RDb21tb24oYmFzZVBhdGgsIG5ld1N0cmluZywgb2xkU3RyaW5nLCBkaWFnb25hbFBhdGgpO1xuXG4gICAgICAgIC8vIElmIHdlIGhhdmUgaGl0IHRoZSBlbmQgb2YgYm90aCBzdHJpbmdzLCB0aGVuIHdlIGFyZSBkb25lXG4gICAgICAgIGlmIChiYXNlUGF0aC5uZXdQb3MgKyAxID49IG5ld0xlbiAmJiBvbGRQb3MgKyAxID49IG9sZExlbikge1xuICAgICAgICAgIHJldHVybiBkb25lKGJ1aWxkVmFsdWVzKHNlbGYsIGJhc2VQYXRoLmNvbXBvbmVudHMsIG5ld1N0cmluZywgb2xkU3RyaW5nLCBzZWxmLnVzZUxvbmdlc3RUb2tlbikpO1xuICAgICAgICB9IGVsc2Uge1xuICAgICAgICAgIC8vIE90aGVyd2lzZSB0cmFjayB0aGlzIHBhdGggYXMgYSBwb3RlbnRpYWwgY2FuZGlkYXRlIGFuZCBjb250aW51ZS5cbiAgICAgICAgICBiZXN0UGF0aFtkaWFnb25hbFBhdGhdID0gYmFzZVBhdGg7XG4gICAgICAgIH1cbiAgICAgIH1cblxuICAgICAgZWRpdExlbmd0aCsrO1xuICAgIH1cblxuICAgIC8vIFBlcmZvcm1zIHRoZSBsZW5ndGggb2YgZWRpdCBpdGVyYXRpb24uIElzIGEgYml0IGZ1Z2x5IGFzIHRoaXMgaGFzIHRvIHN1cHBvcnQgdGhlXG4gICAgLy8gc3luYyBhbmQgYXN5bmMgbW9kZSB3aGljaCBpcyBuZXZlciBmdW4uIExvb3BzIG92ZXIgZXhlY0VkaXRMZW5ndGggdW50aWwgYSB2YWx1ZVxuICAgIC8vIGlzIHByb2R1Y2VkLlxuICAgIGlmIChjYWxsYmFjaykge1xuICAgICAgKGZ1bmN0aW9uIGV4ZWMoKSB7XG4gICAgICAgIHNldFRpbWVvdXQoZnVuY3Rpb24oKSB7XG4gICAgICAgICAgLy8gVGhpcyBzaG91bGQgbm90IGhhcHBlbiwgYnV0IHdlIHdhbnQgdG8gYmUgc2FmZS5cbiAgICAgICAgICAvKiBpc3RhbmJ1bCBpZ25vcmUgbmV4dCAqL1xuICAgICAgICAgIGlmIChlZGl0TGVuZ3RoID4gbWF4RWRpdExlbmd0aCkge1xuICAgICAgICAgICAgcmV0dXJuIGNhbGxiYWNrKCk7XG4gICAgICAgICAgfVxuXG4gICAgICAgICAgaWYgKCFleGVjRWRpdExlbmd0aCgpKSB7XG4gICAgICAgICAgICBleGVjKCk7XG4gICAgICAgICAgfVxuICAgICAgICB9LCAwKTtcbiAgICAgIH0oKSk7XG4gICAgfSBlbHNlIHtcbiAgICAgIHdoaWxlIChlZGl0TGVuZ3RoIDw9IG1heEVkaXRMZW5ndGgpIHtcbiAgICAgICAgbGV0IHJldCA9IGV4ZWNFZGl0TGVuZ3RoKCk7XG4gICAgICAgIGlmIChyZXQpIHtcbiAgICAgICAgICByZXR1cm4gcmV0O1xuICAgICAgICB9XG4gICAgICB9XG4gICAgfVxuICB9LFxuXG4gIHB1c2hDb21wb25lbnQoY29tcG9uZW50cywgYWRkZWQsIHJlbW92ZWQpIHtcbiAgICBsZXQgbGFzdCA9IGNvbXBvbmVudHNbY29tcG9uZW50cy5sZW5ndGggLSAxXTtcbiAgICBpZiAobGFzdCAmJiBsYXN0LmFkZGVkID09PSBhZGRlZCAmJiBsYXN0LnJlbW92ZWQgPT09IHJlbW92ZWQpIHtcbiAgICAgIC8vIFdlIG5lZWQgdG8gY2xvbmUgaGVyZSBhcyB0aGUgY29tcG9uZW50IGNsb25lIG9wZXJhdGlvbiBpcyBqdXN0XG4gICAgICAvLyBhcyBzaGFsbG93IGFycmF5IGNsb25lXG4gICAgICBjb21wb25lbnRzW2NvbXBvbmVudHMubGVuZ3RoIC0gMV0gPSB7Y291bnQ6IGxhc3QuY291bnQgKyAxLCBhZGRlZDogYWRkZWQsIHJlbW92ZWQ6IHJlbW92ZWQgfTtcbiAgICB9IGVsc2Uge1xuICAgICAgY29tcG9uZW50cy5wdXNoKHtjb3VudDogMSwgYWRkZWQ6IGFkZGVkLCByZW1vdmVkOiByZW1vdmVkIH0pO1xuICAgIH1cbiAgfSxcbiAgZXh0cmFjdENvbW1vbihiYXNlUGF0aCwgbmV3U3RyaW5nLCBvbGRTdHJpbmcsIGRpYWdvbmFsUGF0aCkge1xuICAgIGxldCBuZXdMZW4gPSBuZXdTdHJpbmcubGVuZ3RoLFxuICAgICAgICBvbGRMZW4gPSBvbGRTdHJpbmcubGVuZ3RoLFxuICAgICAgICBuZXdQb3MgPSBiYXNlUGF0aC5uZXdQb3MsXG4gICAgICAgIG9sZFBvcyA9IG5ld1BvcyAtIGRpYWdvbmFsUGF0aCxcblxuICAgICAgICBjb21tb25Db3VudCA9IDA7XG4gICAgd2hpbGUgKG5ld1BvcyArIDEgPCBuZXdMZW4gJiYgb2xkUG9zICsgMSA8IG9sZExlbiAmJiB0aGlzLmVxdWFscyhuZXdTdHJpbmdbbmV3UG9zICsgMV0sIG9sZFN0cmluZ1tvbGRQb3MgKyAxXSkpIHtcbiAgICAgIG5ld1BvcysrO1xuICAgICAgb2xkUG9zKys7XG4gICAgICBjb21tb25Db3VudCsrO1xuICAgIH1cblxuICAgIGlmIChjb21tb25Db3VudCkge1xuICAgICAgYmFzZVBhdGguY29tcG9uZW50cy5wdXNoKHtjb3VudDogY29tbW9uQ291bnR9KTtcbiAgICB9XG5cbiAgICBiYXNlUGF0aC5uZXdQb3MgPSBuZXdQb3M7XG4gICAgcmV0dXJuIG9sZFBvcztcbiAgfSxcblxuICBlcXVhbHMobGVmdCwgcmlnaHQpIHtcbiAgICBpZiAodGhpcy5vcHRpb25zLmNvbXBhcmF0b3IpIHtcbiAgICAgIHJldHVybiB0aGlzLm9wdGlvbnMuY29tcGFyYXRvcihsZWZ0LCByaWdodCk7XG4gICAgfSBlbHNlIHtcbiAgICAgIHJldHVybiBsZWZ0ID09PSByaWdodFxuICAgICAgICB8fCAodGhpcy5vcHRpb25zLmlnbm9yZUNhc2UgJiYgbGVmdC50b0xvd2VyQ2FzZSgpID09PSByaWdodC50b0xvd2VyQ2FzZSgpKTtcbiAgICB9XG4gIH0sXG4gIHJlbW92ZUVtcHR5KGFycmF5KSB7XG4gICAgbGV0IHJldCA9IFtdO1xuICAgIGZvciAobGV0IGkgPSAwOyBpIDwgYXJyYXkubGVuZ3RoOyBpKyspIHtcbiAgICAgIGlmIChhcnJheVtpXSkge1xuICAgICAgICByZXQucHVzaChhcnJheVtpXSk7XG4gICAgICB9XG4gICAgfVxuICAgIHJldHVybiByZXQ7XG4gIH0sXG4gIGNhc3RJbnB1dCh2YWx1ZSkge1xuICAgIHJldHVybiB2YWx1ZTtcbiAgfSxcbiAgdG9rZW5pemUodmFsdWUpIHtcbiAgICByZXR1cm4gdmFsdWUuc3BsaXQoJycpO1xuICB9LFxuICBqb2luKGNoYXJzKSB7XG4gICAgcmV0dXJuIGNoYXJzLmpvaW4oJycpO1xuICB9XG59O1xuXG5mdW5jdGlvbiBidWlsZFZhbHVlcyhkaWZmLCBjb21wb25lbnRzLCBuZXdTdHJpbmcsIG9sZFN0cmluZywgdXNlTG9uZ2VzdFRva2VuKSB7XG4gIGxldCBjb21wb25lbnRQb3MgPSAwLFxuICAgICAgY29tcG9uZW50TGVuID0gY29tcG9uZW50cy5sZW5ndGgsXG4gICAgICBuZXdQb3MgPSAwLFxuICAgICAgb2xkUG9zID0gMDtcblxuICBmb3IgKDsgY29tcG9uZW50UG9zIDwgY29tcG9uZW50TGVuOyBjb21wb25lbnRQb3MrKykge1xuICAgIGxldCBjb21wb25lbnQgPSBjb21wb25lbnRzW2NvbXBvbmVudFBvc107XG4gICAgaWYgKCFjb21wb25lbnQucmVtb3ZlZCkge1xuICAgICAgaWYgKCFjb21wb25lbnQuYWRkZWQgJiYgdXNlTG9uZ2VzdFRva2VuKSB7XG4gICAgICAgIGxldCB2YWx1ZSA9IG5ld1N0cmluZy5zbGljZShuZXdQb3MsIG5ld1BvcyArIGNvbXBvbmVudC5jb3VudCk7XG4gICAgICAgIHZhbHVlID0gdmFsdWUubWFwKGZ1bmN0aW9uKHZhbHVlLCBpKSB7XG4gICAgICAgICAgbGV0IG9sZFZhbHVlID0gb2xkU3RyaW5nW29sZFBvcyArIGldO1xuICAgICAgICAgIHJldHVybiBvbGRWYWx1ZS5sZW5ndGggPiB2YWx1ZS5sZW5ndGggPyBvbGRWYWx1ZSA6IHZhbHVlO1xuICAgICAgICB9KTtcblxuICAgICAgICBjb21wb25lbnQudmFsdWUgPSBkaWZmLmpvaW4odmFsdWUpO1xuICAgICAgfSBlbHNlIHtcbiAgICAgICAgY29tcG9uZW50LnZhbHVlID0gZGlmZi5qb2luKG5ld1N0cmluZy5zbGljZShuZXdQb3MsIG5ld1BvcyArIGNvbXBvbmVudC5jb3VudCkpO1xuICAgICAgfVxuICAgICAgbmV3UG9zICs9IGNvbXBvbmVudC5jb3VudDtcblxuICAgICAgLy8gQ29tbW9uIGNhc2VcbiAgICAgIGlmICghY29tcG9uZW50LmFkZGVkKSB7XG4gICAgICAgIG9sZFBvcyArPSBjb21wb25lbnQuY291bnQ7XG4gICAgICB9XG4gICAgfSBlbHNlIHtcbiAgICAgIGNvbXBvbmVudC52YWx1ZSA9IGRpZmYuam9pbihvbGRTdHJpbmcuc2xpY2Uob2xkUG9zLCBvbGRQb3MgKyBjb21wb25lbnQuY291bnQpKTtcbiAgICAgIG9sZFBvcyArPSBjb21wb25lbnQuY291bnQ7XG5cbiAgICAgIC8vIFJldmVyc2UgYWRkIGFuZCByZW1vdmUgc28gcmVtb3ZlcyBhcmUgb3V0cHV0IGZpcnN0IHRvIG1hdGNoIGNvbW1vbiBjb252ZW50aW9uXG4gICAgICAvLyBUaGUgZGlmZmluZyBhbGdvcml0aG0gaXMgdGllZCB0byBhZGQgdGhlbiByZW1vdmUgb3V0cHV0IGFuZCB0aGlzIGlzIHRoZSBzaW1wbGVzdFxuICAgICAgLy8gcm91dGUgdG8gZ2V0IHRoZSBkZXNpcmVkIG91dHB1dCB3aXRoIG1pbmltYWwgb3ZlcmhlYWQuXG4gICAgICBpZiAoY29tcG9uZW50UG9zICYmIGNvbXBvbmVudHNbY29tcG9uZW50UG9zIC0gMV0uYWRkZWQpIHtcbiAgICAgICAgbGV0IHRtcCA9IGNvbXBvbmVudHNbY29tcG9uZW50UG9zIC0gMV07XG4gICAgICAgIGNvbXBvbmVudHNbY29tcG9uZW50UG9zIC0gMV0gPSBjb21wb25lbnRzW2NvbXBvbmVudFBvc107XG4gICAgICAgIGNvbXBvbmVudHNbY29tcG9uZW50UG9zXSA9IHRtcDtcbiAgICAgIH1cbiAgICB9XG4gIH1cblxuICAvLyBTcGVjaWFsIGNhc2UgaGFuZGxlIGZvciB3aGVuIG9uZSB0ZXJtaW5hbCBpcyBpZ25vcmVkIChpLmUuIHdoaXRlc3BhY2UpLlxuICAvLyBGb3IgdGhpcyBjYXNlIHdlIG1lcmdlIHRoZSB0ZXJtaW5hbCBpbnRvIHRoZSBwcmlvciBzdHJpbmcgYW5kIGRyb3AgdGhlIGNoYW5nZS5cbiAgLy8gVGhpcyBpcyBvbmx5IGF2YWlsYWJsZSBmb3Igc3RyaW5nIG1vZGUuXG4gIGxldCBsYXN0Q29tcG9uZW50ID0gY29tcG9uZW50c1tjb21wb25lbnRMZW4gLSAxXTtcbiAgaWYgKGNvbXBvbmVudExlbiA+IDFcbiAgICAgICYmIHR5cGVvZiBsYXN0Q29tcG9uZW50LnZhbHVlID09PSAnc3RyaW5nJ1xuICAgICAgJiYgKGxhc3RDb21wb25lbnQuYWRkZWQgfHwgbGFzdENvbXBvbmVudC5yZW1vdmVkKVxuICAgICAgJiYgZGlmZi5lcXVhbHMoJycsIGxhc3RDb21wb25lbnQudmFsdWUpKSB7XG4gICAgY29tcG9uZW50c1tjb21wb25lbnRMZW4gLSAyXS52YWx1ZSArPSBsYXN0Q29tcG9uZW50LnZhbHVlO1xuICAgIGNvbXBvbmVudHMucG9wKCk7XG4gIH1cblxuICByZXR1cm4gY29tcG9uZW50cztcbn1cblxuZnVuY3Rpb24gY2xvbmVQYXRoKHBhdGgpIHtcbiAgcmV0dXJuIHsgbmV3UG9zOiBwYXRoLm5ld1BvcywgY29tcG9uZW50czogcGF0aC5jb21wb25lbnRzLnNsaWNlKDApIH07XG59XG4iXX0=
+
+
+/***/ }),
+/* 2 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.characterDiff = undefined;
+	exports. /*istanbul ignore end*/diffChars = diffChars;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/var characterDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/characterDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	function diffChars(oldStr, newStr, options) {
+	  return characterDiff.diff(oldStr, newStr, options);
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2NoYXJhY3Rlci5qcyJdLCJuYW1lcyI6WyJkaWZmQ2hhcnMiLCJjaGFyYWN0ZXJEaWZmIiwib2xkU3RyIiwibmV3U3RyIiwib3B0aW9ucyIsImRpZmYiXSwibWFwcGluZ3MiOiI7Ozs7Z0NBR2dCQSxTLEdBQUFBLFM7O0FBSGhCOzs7Ozs7dUJBRU8sSUFBTUMseUZBQWdCLHdFQUF0QjtBQUNBLFNBQVNELFNBQVQsQ0FBbUJFLE1BQW5CLEVBQTJCQyxNQUEzQixFQUFtQ0MsT0FBbkMsRUFBNEM7QUFBRSxTQUFPSCxjQUFjSSxJQUFkLENBQW1CSCxNQUFuQixFQUEyQkMsTUFBM0IsRUFBbUNDLE9BQW5DLENBQVA7QUFBcUQiLCJmaWxlIjoiY2hhcmFjdGVyLmpzIiwic291cmNlc0NvbnRlbnQiOlsiaW1wb3J0IERpZmYgZnJvbSAnLi9iYXNlJztcblxuZXhwb3J0IGNvbnN0IGNoYXJhY3RlckRpZmYgPSBuZXcgRGlmZigpO1xuZXhwb3J0IGZ1bmN0aW9uIGRpZmZDaGFycyhvbGRTdHIsIG5ld1N0ciwgb3B0aW9ucykgeyByZXR1cm4gY2hhcmFjdGVyRGlmZi5kaWZmKG9sZFN0ciwgbmV3U3RyLCBvcHRpb25zKTsgfVxuIl19
+
+
+/***/ }),
+/* 3 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.wordDiff = undefined;
+	exports. /*istanbul ignore end*/diffWords = diffWords;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffWordsWithSpace = diffWordsWithSpace;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	/*istanbul ignore end*/var /*istanbul ignore start*/_params = __webpack_require__(4) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/ // Based on https://en.wikipedia.org/wiki/Latin_script_in_Unicode
+	//
+	// Ranges and exceptions:
+	// Latin-1 Supplement, 0080–00FF
+	//  - U+00D7  × Multiplication sign
+	//  - U+00F7  ÷ Division sign
+	// Latin Extended-A, 0100–017F
+	// Latin Extended-B, 0180–024F
+	// IPA Extensions, 0250–02AF
+	// Spacing Modifier Letters, 02B0–02FF
+	//  - U+02C7  ˇ ˇ  Caron
+	//  - U+02D8  ˘ ˘  Breve
+	//  - U+02D9  ˙ ˙  Dot Above
+	//  - U+02DA  ˚ ˚  Ring Above
+	//  - U+02DB  ˛ ˛  Ogonek
+	//  - U+02DC  ˜ ˜  Small Tilde
+	//  - U+02DD  ˝ ˝  Double Acute Accent
+	// Latin Extended Additional, 1E00–1EFF
+	var extendedWordChars = /^[A-Za-z\xC0-\u02C6\u02C8-\u02D7\u02DE-\u02FF\u1E00-\u1EFF]+$/;
+
+	var reWhitespace = /\S/;
+
+	var wordDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/wordDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	wordDiff.equals = function (left, right) {
+	  if (this.options.ignoreCase) {
+	    left = left.toLowerCase();
+	    right = right.toLowerCase();
+	  }
+	  return left === right || this.options.ignoreWhitespace && !reWhitespace.test(left) && !reWhitespace.test(right);
+	};
+	wordDiff.tokenize = function (value) {
+	  var tokens = value.split(/(\s+|\b)/);
+
+	  // Join the boundary splits that we do not consider to be boundaries. This is primarily the extended Latin character set.
+	  for (var i = 0; i < tokens.length - 1; i++) {
+	    // If we have an empty string in the next field and we have only word chars before and after, merge
+	    if (!tokens[i + 1] && tokens[i + 2] && extendedWordChars.test(tokens[i]) && extendedWordChars.test(tokens[i + 2])) {
+	      tokens[i] += tokens[i + 2];
+	      tokens.splice(i + 1, 2);
+	      i--;
+	    }
+	  }
+
+	  return tokens;
+	};
+
+	function diffWords(oldStr, newStr, options) {
+	  options = /*istanbul ignore start*/(0, _params.generateOptions) /*istanbul ignore end*/(options, { ignoreWhitespace: true });
+	  return wordDiff.diff(oldStr, newStr, options);
+	}
+
+	function diffWordsWithSpace(oldStr, newStr, options) {
+	  return wordDiff.diff(oldStr, newStr, options);
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL3dvcmQuanMiXSwibmFtZXMiOlsiZGlmZldvcmRzIiwiZGlmZldvcmRzV2l0aFNwYWNlIiwiZXh0ZW5kZWRXb3JkQ2hhcnMiLCJyZVdoaXRlc3BhY2UiLCJ3b3JkRGlmZiIsImVxdWFscyIsImxlZnQiLCJyaWdodCIsIm9wdGlvbnMiLCJpZ25vcmVDYXNlIiwidG9Mb3dlckNhc2UiLCJpZ25vcmVXaGl0ZXNwYWNlIiwidGVzdCIsInRva2VuaXplIiwidmFsdWUiLCJ0b2tlbnMiLCJzcGxpdCIsImkiLCJsZW5ndGgiLCJzcGxpY2UiLCJvbGRTdHIiLCJuZXdTdHIiLCJkaWZmIl0sIm1hcHBpbmdzIjoiOzs7O2dDQW1EZ0JBLFMsR0FBQUEsUzt5REFLQUMsa0IsR0FBQUEsa0I7O0FBeERoQjs7Ozt1QkFDQTs7Ozt3QkFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxJQUFNQyxvQkFBb0IsK0RBQTFCOztBQUVBLElBQU1DLGVBQWUsSUFBckI7O0FBRU8sSUFBTUMsK0VBQVcsd0VBQWpCO0FBQ1BBLFNBQVNDLE1BQVQsR0FBa0IsVUFBU0MsSUFBVCxFQUFlQyxLQUFmLEVBQXNCO0FBQ3RDLE1BQUksS0FBS0MsT0FBTCxDQUFhQyxVQUFqQixFQUE2QjtBQUMzQkgsV0FBT0EsS0FBS0ksV0FBTCxFQUFQO0FBQ0FILFlBQVFBLE1BQU1HLFdBQU4sRUFBUjtBQUNEO0FBQ0QsU0FBT0osU0FBU0MsS0FBVCxJQUFtQixLQUFLQyxPQUFMLENBQWFHLGdCQUFiLElBQWlDLENBQUNSLGFBQWFTLElBQWIsQ0FBa0JOLElBQWxCLENBQWxDLElBQTZELENBQUNILGFBQWFTLElBQWIsQ0FBa0JMLEtBQWxCLENBQXhGO0FBQ0QsQ0FORDtBQU9BSCxTQUFTUyxRQUFULEdBQW9CLFVBQVNDLEtBQVQsRUFBZ0I7QUFDbEMsTUFBSUMsU0FBU0QsTUFBTUUsS0FBTixDQUFZLFVBQVosQ0FBYjs7QUFFQTtBQUNBLE9BQUssSUFBSUMsSUFBSSxDQUFiLEVBQWdCQSxJQUFJRixPQUFPRyxNQUFQLEdBQWdCLENBQXBDLEVBQXVDRCxHQUF2QyxFQUE0QztBQUMxQztBQUNBLFFBQUksQ0FBQ0YsT0FBT0UsSUFBSSxDQUFYLENBQUQsSUFBa0JGLE9BQU9FLElBQUksQ0FBWCxDQUFsQixJQUNLZixrQkFBa0JVLElBQWxCLENBQXVCRyxPQUFPRSxDQUFQLENBQXZCLENBREwsSUFFS2Ysa0JBQWtCVSxJQUFsQixDQUF1QkcsT0FBT0UsSUFBSSxDQUFYLENBQXZCLENBRlQsRUFFZ0Q7QUFDOUNGLGFBQU9FLENBQVAsS0FBYUYsT0FBT0UsSUFBSSxDQUFYLENBQWI7QUFDQUYsYUFBT0ksTUFBUCxDQUFjRixJQUFJLENBQWxCLEVBQXFCLENBQXJCO0FBQ0FBO0FBQ0Q7QUFDRjs7QUFFRCxTQUFPRixNQUFQO0FBQ0QsQ0FoQkQ7O0FBa0JPLFNBQVNmLFNBQVQsQ0FBbUJvQixNQUFuQixFQUEyQkMsTUFBM0IsRUFBbUNiLE9BQW5DLEVBQTRDO0FBQ2pEQSxZQUFVLDhFQUFnQkEsT0FBaEIsRUFBeUIsRUFBQ0csa0JBQWtCLElBQW5CLEVBQXpCLENBQVY7QUFDQSxTQUFPUCxTQUFTa0IsSUFBVCxDQUFjRixNQUFkLEVBQXNCQyxNQUF0QixFQUE4QmIsT0FBOUIsQ0FBUDtBQUNEOztBQUVNLFNBQVNQLGtCQUFULENBQTRCbUIsTUFBNUIsRUFBb0NDLE1BQXBDLEVBQTRDYixPQUE1QyxFQUFxRDtBQUMxRCxTQUFPSixTQUFTa0IsSUFBVCxDQUFjRixNQUFkLEVBQXNCQyxNQUF0QixFQUE4QmIsT0FBOUIsQ0FBUDtBQUNEIiwiZmlsZSI6IndvcmQuanMiLCJzb3VyY2VzQ29udGVudCI6WyJpbXBvcnQgRGlmZiBmcm9tICcuL2Jhc2UnO1xuaW1wb3J0IHtnZW5lcmF0ZU9wdGlvbnN9IGZyb20gJy4uL3V0aWwvcGFyYW1zJztcblxuLy8gQmFzZWQgb24gaHR0cHM6Ly9lbi53aWtpcGVkaWEub3JnL3dpa2kvTGF0aW5fc2NyaXB0X2luX1VuaWNvZGVcbi8vXG4vLyBSYW5nZXMgYW5kIGV4Y2VwdGlvbnM6XG4vLyBMYXRpbi0xIFN1cHBsZW1lbnQsIDAwODDigJMwMEZGXG4vLyAgLSBVKzAwRDcgIMOXIE11bHRpcGxpY2F0aW9uIHNpZ25cbi8vICAtIFUrMDBGNyAgw7cgRGl2aXNpb24gc2lnblxuLy8gTGF0aW4gRXh0ZW5kZWQtQSwgMDEwMOKAkzAxN0Zcbi8vIExhdGluIEV4dGVuZGVkLUIsIDAxODDigJMwMjRGXG4vLyBJUEEgRXh0ZW5zaW9ucywgMDI1MOKAkzAyQUZcbi8vIFNwYWNpbmcgTW9kaWZpZXIgTGV0dGVycywgMDJCMOKAkzAyRkZcbi8vICAtIFUrMDJDNyAgy4cgJiM3MTE7ICBDYXJvblxuLy8gIC0gVSswMkQ4ICDLmCAmIzcyODsgIEJyZXZlXG4vLyAgLSBVKzAyRDkgIMuZICYjNzI5OyAgRG90IEFib3ZlXG4vLyAgLSBVKzAyREEgIMuaICYjNzMwOyAgUmluZyBBYm92ZVxuLy8gIC0gVSswMkRCICDLmyAmIzczMTsgIE9nb25la1xuLy8gIC0gVSswMkRDICDLnCAmIzczMjsgIFNtYWxsIFRpbGRlXG4vLyAgLSBVKzAyREQgIMudICYjNzMzOyAgRG91YmxlIEFjdXRlIEFjY2VudFxuLy8gTGF0aW4gRXh0ZW5kZWQgQWRkaXRpb25hbCwgMUUwMOKAkzFFRkZcbmNvbnN0IGV4dGVuZGVkV29yZENoYXJzID0gL15bYS16QS1aXFx1e0MwfS1cXHV7RkZ9XFx1e0Q4fS1cXHV7RjZ9XFx1e0Y4fS1cXHV7MkM2fVxcdXsyQzh9LVxcdXsyRDd9XFx1ezJERX0tXFx1ezJGRn1cXHV7MUUwMH0tXFx1ezFFRkZ9XSskL3U7XG5cbmNvbnN0IHJlV2hpdGVzcGFjZSA9IC9cXFMvO1xuXG5leHBvcnQgY29uc3Qgd29yZERpZmYgPSBuZXcgRGlmZigpO1xud29yZERpZmYuZXF1YWxzID0gZnVuY3Rpb24obGVmdCwgcmlnaHQpIHtcbiAgaWYgKHRoaXMub3B0aW9ucy5pZ25vcmVDYXNlKSB7XG4gICAgbGVmdCA9IGxlZnQudG9Mb3dlckNhc2UoKTtcbiAgICByaWdodCA9IHJpZ2h0LnRvTG93ZXJDYXNlKCk7XG4gIH1cbiAgcmV0dXJuIGxlZnQgPT09IHJpZ2h0IHx8ICh0aGlzLm9wdGlvbnMuaWdub3JlV2hpdGVzcGFjZSAmJiAhcmVXaGl0ZXNwYWNlLnRlc3QobGVmdCkgJiYgIXJlV2hpdGVzcGFjZS50ZXN0KHJpZ2h0KSk7XG59O1xud29yZERpZmYudG9rZW5pemUgPSBmdW5jdGlvbih2YWx1ZSkge1xuICBsZXQgdG9rZW5zID0gdmFsdWUuc3BsaXQoLyhcXHMrfFxcYikvKTtcblxuICAvLyBKb2luIHRoZSBib3VuZGFyeSBzcGxpdHMgdGhhdCB3ZSBkbyBub3QgY29uc2lkZXIgdG8gYmUgYm91bmRhcmllcy4gVGhpcyBpcyBwcmltYXJpbHkgdGhlIGV4dGVuZGVkIExhdGluIGNoYXJhY3RlciBzZXQuXG4gIGZvciAobGV0IGkgPSAwOyBpIDwgdG9rZW5zLmxlbmd0aCAtIDE7IGkrKykge1xuICAgIC8vIElmIHdlIGhhdmUgYW4gZW1wdHkgc3RyaW5nIGluIHRoZSBuZXh0IGZpZWxkIGFuZCB3ZSBoYXZlIG9ubHkgd29yZCBjaGFycyBiZWZvcmUgYW5kIGFmdGVyLCBtZXJnZVxuICAgIGlmICghdG9rZW5zW2kgKyAxXSAmJiB0b2tlbnNbaSArIDJdXG4gICAgICAgICAgJiYgZXh0ZW5kZWRXb3JkQ2hhcnMudGVzdCh0b2tlbnNbaV0pXG4gICAgICAgICAgJiYgZXh0ZW5kZWRXb3JkQ2hhcnMudGVzdCh0b2tlbnNbaSArIDJdKSkge1xuICAgICAgdG9rZW5zW2ldICs9IHRva2Vuc1tpICsgMl07XG4gICAgICB0b2tlbnMuc3BsaWNlKGkgKyAxLCAyKTtcbiAgICAgIGktLTtcbiAgICB9XG4gIH1cblxuICByZXR1cm4gdG9rZW5zO1xufTtcblxuZXhwb3J0IGZ1bmN0aW9uIGRpZmZXb3JkcyhvbGRTdHIsIG5ld1N0ciwgb3B0aW9ucykge1xuICBvcHRpb25zID0gZ2VuZXJhdGVPcHRpb25zKG9wdGlvbnMsIHtpZ25vcmVXaGl0ZXNwYWNlOiB0cnVlfSk7XG4gIHJldHVybiB3b3JkRGlmZi5kaWZmKG9sZFN0ciwgbmV3U3RyLCBvcHRpb25zKTtcbn1cblxuZXhwb3J0IGZ1bmN0aW9uIGRpZmZXb3Jkc1dpdGhTcGFjZShvbGRTdHIsIG5ld1N0ciwgb3B0aW9ucykge1xuICByZXR1cm4gd29yZERpZmYuZGlmZihvbGRTdHIsIG5ld1N0ciwgb3B0aW9ucyk7XG59XG4iXX0=
+
+
+/***/ }),
+/* 4 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/generateOptions = generateOptions;
+	function generateOptions(options, defaults) {
+	  if (typeof options === 'function') {
+	    defaults.callback = options;
+	  } else if (options) {
+	    for (var name in options) {
+	      /* istanbul ignore else */
+	      if (options.hasOwnProperty(name)) {
+	        defaults[name] = options[name];
+	      }
+	    }
+	  }
+	  return defaults;
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy91dGlsL3BhcmFtcy5qcyJdLCJuYW1lcyI6WyJnZW5lcmF0ZU9wdGlvbnMiLCJvcHRpb25zIiwiZGVmYXVsdHMiLCJjYWxsYmFjayIsIm5hbWUiLCJoYXNPd25Qcm9wZXJ0eSJdLCJtYXBwaW5ncyI6Ijs7O2dDQUFnQkEsZSxHQUFBQSxlO0FBQVQsU0FBU0EsZUFBVCxDQUF5QkMsT0FBekIsRUFBa0NDLFFBQWxDLEVBQTRDO0FBQ2pELE1BQUksT0FBT0QsT0FBUCxLQUFtQixVQUF2QixFQUFtQztBQUNqQ0MsYUFBU0MsUUFBVCxHQUFvQkYsT0FBcEI7QUFDRCxHQUZELE1BRU8sSUFBSUEsT0FBSixFQUFhO0FBQ2xCLFNBQUssSUFBSUcsSUFBVCxJQUFpQkgsT0FBakIsRUFBMEI7QUFDeEI7QUFDQSxVQUFJQSxRQUFRSSxjQUFSLENBQXVCRCxJQUF2QixDQUFKLEVBQWtDO0FBQ2hDRixpQkFBU0UsSUFBVCxJQUFpQkgsUUFBUUcsSUFBUixDQUFqQjtBQUNEO0FBQ0Y7QUFDRjtBQUNELFNBQU9GLFFBQVA7QUFDRCIsImZpbGUiOiJwYXJhbXMuanMiLCJzb3VyY2VzQ29udGVudCI6WyJleHBvcnQgZnVuY3Rpb24gZ2VuZXJhdGVPcHRpb25zKG9wdGlvbnMsIGRlZmF1bHRzKSB7XG4gIGlmICh0eXBlb2Ygb3B0aW9ucyA9PT0gJ2Z1bmN0aW9uJykge1xuICAgIGRlZmF1bHRzLmNhbGxiYWNrID0gb3B0aW9ucztcbiAgfSBlbHNlIGlmIChvcHRpb25zKSB7XG4gICAgZm9yIChsZXQgbmFtZSBpbiBvcHRpb25zKSB7XG4gICAgICAvKiBpc3RhbmJ1bCBpZ25vcmUgZWxzZSAqL1xuICAgICAgaWYgKG9wdGlvbnMuaGFzT3duUHJvcGVydHkobmFtZSkpIHtcbiAgICAgICAgZGVmYXVsdHNbbmFtZV0gPSBvcHRpb25zW25hbWVdO1xuICAgICAgfVxuICAgIH1cbiAgfVxuICByZXR1cm4gZGVmYXVsdHM7XG59XG4iXX0=
+
+
+/***/ }),
+/* 5 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.lineDiff = undefined;
+	exports. /*istanbul ignore end*/diffLines = diffLines;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffTrimmedLines = diffTrimmedLines;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	/*istanbul ignore end*/var /*istanbul ignore start*/_params = __webpack_require__(4) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/var lineDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/lineDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	lineDiff.tokenize = function (value) {
+	  var retLines = [],
+	      linesAndNewlines = value.split(/(\n|\r\n)/);
+
+	  // Ignore the final empty token that occurs if the string ends with a new line
+	  if (!linesAndNewlines[linesAndNewlines.length - 1]) {
+	    linesAndNewlines.pop();
+	  }
+
+	  // Merge the content and line separators into single tokens
+	  for (var i = 0; i < linesAndNewlines.length; i++) {
+	    var line = linesAndNewlines[i];
+
+	    if (i % 2 && !this.options.newlineIsToken) {
+	      retLines[retLines.length - 1] += line;
+	    } else {
+	      if (this.options.ignoreWhitespace) {
+	        line = line.trim();
+	      }
+	      retLines.push(line);
+	    }
+	  }
+
+	  return retLines;
+	};
+
+	function diffLines(oldStr, newStr, callback) {
+	  return lineDiff.diff(oldStr, newStr, callback);
+	}
+	function diffTrimmedLines(oldStr, newStr, callback) {
+	  var options = /*istanbul ignore start*/(0, _params.generateOptions) /*istanbul ignore end*/(callback, { ignoreWhitespace: true });
+	  return lineDiff.diff(oldStr, newStr, options);
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2xpbmUuanMiXSwibmFtZXMiOlsiZGlmZkxpbmVzIiwiZGlmZlRyaW1tZWRMaW5lcyIsImxpbmVEaWZmIiwidG9rZW5pemUiLCJ2YWx1ZSIsInJldExpbmVzIiwibGluZXNBbmROZXdsaW5lcyIsInNwbGl0IiwibGVuZ3RoIiwicG9wIiwiaSIsImxpbmUiLCJvcHRpb25zIiwibmV3bGluZUlzVG9rZW4iLCJpZ25vcmVXaGl0ZXNwYWNlIiwidHJpbSIsInB1c2giLCJvbGRTdHIiLCJuZXdTdHIiLCJjYWxsYmFjayIsImRpZmYiXSwibWFwcGluZ3MiOiI7Ozs7Z0NBOEJnQkEsUyxHQUFBQSxTO3lEQUNBQyxnQixHQUFBQSxnQjs7QUEvQmhCOzs7O3VCQUNBOzs7O3VCQUVPLElBQU1DLCtFQUFXLHdFQUFqQjtBQUNQQSxTQUFTQyxRQUFULEdBQW9CLFVBQVNDLEtBQVQsRUFBZ0I7QUFDbEMsTUFBSUMsV0FBVyxFQUFmO0FBQUEsTUFDSUMsbUJBQW1CRixNQUFNRyxLQUFOLENBQVksV0FBWixDQUR2Qjs7QUFHQTtBQUNBLE1BQUksQ0FBQ0QsaUJBQWlCQSxpQkFBaUJFLE1BQWpCLEdBQTBCLENBQTNDLENBQUwsRUFBb0Q7QUFDbERGLHFCQUFpQkcsR0FBakI7QUFDRDs7QUFFRDtBQUNBLE9BQUssSUFBSUMsSUFBSSxDQUFiLEVBQWdCQSxJQUFJSixpQkFBaUJFLE1BQXJDLEVBQTZDRSxHQUE3QyxFQUFrRDtBQUNoRCxRQUFJQyxPQUFPTCxpQkFBaUJJLENBQWpCLENBQVg7O0FBRUEsUUFBSUEsSUFBSSxDQUFKLElBQVMsQ0FBQyxLQUFLRSxPQUFMLENBQWFDLGNBQTNCLEVBQTJDO0FBQ3pDUixlQUFTQSxTQUFTRyxNQUFULEdBQWtCLENBQTNCLEtBQWlDRyxJQUFqQztBQUNELEtBRkQsTUFFTztBQUNMLFVBQUksS0FBS0MsT0FBTCxDQUFhRSxnQkFBakIsRUFBbUM7QUFDakNILGVBQU9BLEtBQUtJLElBQUwsRUFBUDtBQUNEO0FBQ0RWLGVBQVNXLElBQVQsQ0FBY0wsSUFBZDtBQUNEO0FBQ0Y7O0FBRUQsU0FBT04sUUFBUDtBQUNELENBeEJEOztBQTBCTyxTQUFTTCxTQUFULENBQW1CaUIsTUFBbkIsRUFBMkJDLE1BQTNCLEVBQW1DQyxRQUFuQyxFQUE2QztBQUFFLFNBQU9qQixTQUFTa0IsSUFBVCxDQUFjSCxNQUFkLEVBQXNCQyxNQUF0QixFQUE4QkMsUUFBOUIsQ0FBUDtBQUFpRDtBQUNoRyxTQUFTbEIsZ0JBQVQsQ0FBMEJnQixNQUExQixFQUFrQ0MsTUFBbEMsRUFBMENDLFFBQTFDLEVBQW9EO0FBQ3pELE1BQUlQLFVBQVUsOEVBQWdCTyxRQUFoQixFQUEwQixFQUFDTCxrQkFBa0IsSUFBbkIsRUFBMUIsQ0FBZDtBQUNBLFNBQU9aLFNBQVNrQixJQUFULENBQWNILE1BQWQsRUFBc0JDLE1BQXRCLEVBQThCTixPQUE5QixDQUFQO0FBQ0QiLCJmaWxlIjoibGluZS5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCBEaWZmIGZyb20gJy4vYmFzZSc7XG5pbXBvcnQge2dlbmVyYXRlT3B0aW9uc30gZnJvbSAnLi4vdXRpbC9wYXJhbXMnO1xuXG5leHBvcnQgY29uc3QgbGluZURpZmYgPSBuZXcgRGlmZigpO1xubGluZURpZmYudG9rZW5pemUgPSBmdW5jdGlvbih2YWx1ZSkge1xuICBsZXQgcmV0TGluZXMgPSBbXSxcbiAgICAgIGxpbmVzQW5kTmV3bGluZXMgPSB2YWx1ZS5zcGxpdCgvKFxcbnxcXHJcXG4pLyk7XG5cbiAgLy8gSWdub3JlIHRoZSBmaW5hbCBlbXB0eSB0b2tlbiB0aGF0IG9jY3VycyBpZiB0aGUgc3RyaW5nIGVuZHMgd2l0aCBhIG5ldyBsaW5lXG4gIGlmICghbGluZXNBbmROZXdsaW5lc1tsaW5lc0FuZE5ld2xpbmVzLmxlbmd0aCAtIDFdKSB7XG4gICAgbGluZXNBbmROZXdsaW5lcy5wb3AoKTtcbiAgfVxuXG4gIC8vIE1lcmdlIHRoZSBjb250ZW50IGFuZCBsaW5lIHNlcGFyYXRvcnMgaW50byBzaW5nbGUgdG9rZW5zXG4gIGZvciAobGV0IGkgPSAwOyBpIDwgbGluZXNBbmROZXdsaW5lcy5sZW5ndGg7IGkrKykge1xuICAgIGxldCBsaW5lID0gbGluZXNBbmROZXdsaW5lc1tpXTtcblxuICAgIGlmIChpICUgMiAmJiAhdGhpcy5vcHRpb25zLm5ld2xpbmVJc1Rva2VuKSB7XG4gICAgICByZXRMaW5lc1tyZXRMaW5lcy5sZW5ndGggLSAxXSArPSBsaW5lO1xuICAgIH0gZWxzZSB7XG4gICAgICBpZiAodGhpcy5vcHRpb25zLmlnbm9yZVdoaXRlc3BhY2UpIHtcbiAgICAgICAgbGluZSA9IGxpbmUudHJpbSgpO1xuICAgICAgfVxuICAgICAgcmV0TGluZXMucHVzaChsaW5lKTtcbiAgICB9XG4gIH1cblxuICByZXR1cm4gcmV0TGluZXM7XG59O1xuXG5leHBvcnQgZnVuY3Rpb24gZGlmZkxpbmVzKG9sZFN0ciwgbmV3U3RyLCBjYWxsYmFjaykgeyByZXR1cm4gbGluZURpZmYuZGlmZihvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spOyB9XG5leHBvcnQgZnVuY3Rpb24gZGlmZlRyaW1tZWRMaW5lcyhvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spIHtcbiAgbGV0IG9wdGlvbnMgPSBnZW5lcmF0ZU9wdGlvbnMoY2FsbGJhY2ssIHtpZ25vcmVXaGl0ZXNwYWNlOiB0cnVlfSk7XG4gIHJldHVybiBsaW5lRGlmZi5kaWZmKG9sZFN0ciwgbmV3U3RyLCBvcHRpb25zKTtcbn1cbiJdfQ==
+
+
+/***/ }),
+/* 6 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.sentenceDiff = undefined;
+	exports. /*istanbul ignore end*/diffSentences = diffSentences;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/var sentenceDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/sentenceDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	sentenceDiff.tokenize = function (value) {
+	  return value.split(/(\S.+?[.!?])(?=\s+|$)/);
+	};
+
+	function diffSentences(oldStr, newStr, callback) {
+	  return sentenceDiff.diff(oldStr, newStr, callback);
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL3NlbnRlbmNlLmpzIl0sIm5hbWVzIjpbImRpZmZTZW50ZW5jZXMiLCJzZW50ZW5jZURpZmYiLCJ0b2tlbml6ZSIsInZhbHVlIiwic3BsaXQiLCJvbGRTdHIiLCJuZXdTdHIiLCJjYWxsYmFjayIsImRpZmYiXSwibWFwcGluZ3MiOiI7Ozs7Z0NBUWdCQSxhLEdBQUFBLGE7O0FBUmhCOzs7Ozs7dUJBR08sSUFBTUMsdUZBQWUsd0VBQXJCO0FBQ1BBLGFBQWFDLFFBQWIsR0FBd0IsVUFBU0MsS0FBVCxFQUFnQjtBQUN0QyxTQUFPQSxNQUFNQyxLQUFOLENBQVksdUJBQVosQ0FBUDtBQUNELENBRkQ7O0FBSU8sU0FBU0osYUFBVCxDQUF1QkssTUFBdkIsRUFBK0JDLE1BQS9CLEVBQXVDQyxRQUF2QyxFQUFpRDtBQUFFLFNBQU9OLGFBQWFPLElBQWIsQ0FBa0JILE1BQWxCLEVBQTBCQyxNQUExQixFQUFrQ0MsUUFBbEMsQ0FBUDtBQUFxRCIsImZpbGUiOiJzZW50ZW5jZS5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCBEaWZmIGZyb20gJy4vYmFzZSc7XG5cblxuZXhwb3J0IGNvbnN0IHNlbnRlbmNlRGlmZiA9IG5ldyBEaWZmKCk7XG5zZW50ZW5jZURpZmYudG9rZW5pemUgPSBmdW5jdGlvbih2YWx1ZSkge1xuICByZXR1cm4gdmFsdWUuc3BsaXQoLyhcXFMuKz9bLiE/XSkoPz1cXHMrfCQpLyk7XG59O1xuXG5leHBvcnQgZnVuY3Rpb24gZGlmZlNlbnRlbmNlcyhvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spIHsgcmV0dXJuIHNlbnRlbmNlRGlmZi5kaWZmKG9sZFN0ciwgbmV3U3RyLCBjYWxsYmFjayk7IH1cbiJdfQ==
+
+
+/***/ }),
+/* 7 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.cssDiff = undefined;
+	exports. /*istanbul ignore end*/diffCss = diffCss;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/var cssDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/cssDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	cssDiff.tokenize = function (value) {
+	  return value.split(/([{}:;,]|\s+)/);
+	};
+
+	function diffCss(oldStr, newStr, callback) {
+	  return cssDiff.diff(oldStr, newStr, callback);
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2Nzcy5qcyJdLCJuYW1lcyI6WyJkaWZmQ3NzIiwiY3NzRGlmZiIsInRva2VuaXplIiwidmFsdWUiLCJzcGxpdCIsIm9sZFN0ciIsIm5ld1N0ciIsImNhbGxiYWNrIiwiZGlmZiJdLCJtYXBwaW5ncyI6Ijs7OztnQ0FPZ0JBLE8sR0FBQUEsTzs7QUFQaEI7Ozs7Ozt1QkFFTyxJQUFNQyw2RUFBVSx3RUFBaEI7QUFDUEEsUUFBUUMsUUFBUixHQUFtQixVQUFTQyxLQUFULEVBQWdCO0FBQ2pDLFNBQU9BLE1BQU1DLEtBQU4sQ0FBWSxlQUFaLENBQVA7QUFDRCxDQUZEOztBQUlPLFNBQVNKLE9BQVQsQ0FBaUJLLE1BQWpCLEVBQXlCQyxNQUF6QixFQUFpQ0MsUUFBakMsRUFBMkM7QUFBRSxTQUFPTixRQUFRTyxJQUFSLENBQWFILE1BQWIsRUFBcUJDLE1BQXJCLEVBQTZCQyxRQUE3QixDQUFQO0FBQWdEIiwiZmlsZSI6ImNzcy5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCBEaWZmIGZyb20gJy4vYmFzZSc7XG5cbmV4cG9ydCBjb25zdCBjc3NEaWZmID0gbmV3IERpZmYoKTtcbmNzc0RpZmYudG9rZW5pemUgPSBmdW5jdGlvbih2YWx1ZSkge1xuICByZXR1cm4gdmFsdWUuc3BsaXQoLyhbe306OyxdfFxccyspLyk7XG59O1xuXG5leHBvcnQgZnVuY3Rpb24gZGlmZkNzcyhvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spIHsgcmV0dXJuIGNzc0RpZmYuZGlmZihvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spOyB9XG4iXX0=
+
+
+/***/ }),
+/* 8 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.jsonDiff = undefined;
+
+	var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
+
+	exports. /*istanbul ignore end*/diffJson = diffJson;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/canonicalize = canonicalize;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	/*istanbul ignore end*/var /*istanbul ignore start*/_line = __webpack_require__(5) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/var objectPrototypeToString = Object.prototype.toString;
+
+	var jsonDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/jsonDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	// Discriminate between two lines of pretty-printed, serialized JSON where one of them has a
+	// dangling comma and the other doesn't. Turns out including the dangling comma yields the nicest output:
+	jsonDiff.useLongestToken = true;
+
+	jsonDiff.tokenize = /*istanbul ignore start*/_line.lineDiff /*istanbul ignore end*/.tokenize;
+	jsonDiff.castInput = function (value) {
+	  /*istanbul ignore start*/var _options = /*istanbul ignore end*/this.options,
+	      undefinedReplacement = _options.undefinedReplacement,
+	      _options$stringifyRep = _options.stringifyReplacer,
+	      stringifyReplacer = _options$stringifyRep === undefined ? function (k, v) /*istanbul ignore start*/{
+	    return (/*istanbul ignore end*/typeof v === 'undefined' ? undefinedReplacement : v
+	    );
+	  } : _options$stringifyRep;
+
+
+	  return typeof value === 'string' ? value : JSON.stringify(canonicalize(value, null, null, stringifyReplacer), stringifyReplacer, '  ');
+	};
+	jsonDiff.equals = function (left, right) {
+	  return (/*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/.prototype.equals.call(jsonDiff, left.replace(/,([\r\n])/g, '$1'), right.replace(/,([\r\n])/g, '$1'))
+	  );
+	};
+
+	function diffJson(oldObj, newObj, options) {
+	  return jsonDiff.diff(oldObj, newObj, options);
+	}
+
+	// This function handles the presence of circular references by bailing out when encountering an
+	// object that is already on the "stack" of items being processed. Accepts an optional replacer
+	function canonicalize(obj, stack, replacementStack, replacer, key) {
+	  stack = stack || [];
+	  replacementStack = replacementStack || [];
+
+	  if (replacer) {
+	    obj = replacer(key, obj);
+	  }
+
+	  var i = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+
+	  for (i = 0; i < stack.length; i += 1) {
+	    if (stack[i] === obj) {
+	      return replacementStack[i];
+	    }
+	  }
+
+	  var canonicalizedObj = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+
+	  if ('[object Array]' === objectPrototypeToString.call(obj)) {
+	    stack.push(obj);
+	    canonicalizedObj = new Array(obj.length);
+	    replacementStack.push(canonicalizedObj);
+	    for (i = 0; i < obj.length; i += 1) {
+	      canonicalizedObj[i] = canonicalize(obj[i], stack, replacementStack, replacer, key);
+	    }
+	    stack.pop();
+	    replacementStack.pop();
+	    return canonicalizedObj;
+	  }
+
+	  if (obj && obj.toJSON) {
+	    obj = obj.toJSON();
+	  }
+
+	  if ( /*istanbul ignore start*/(typeof /*istanbul ignore end*/obj === 'undefined' ? 'undefined' : _typeof(obj)) === 'object' && obj !== null) {
+	    stack.push(obj);
+	    canonicalizedObj = {};
+	    replacementStack.push(canonicalizedObj);
+	    var sortedKeys = [],
+	        _key = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+	    for (_key in obj) {
+	      /* istanbul ignore else */
+	      if (obj.hasOwnProperty(_key)) {
+	        sortedKeys.push(_key);
+	      }
+	    }
+	    sortedKeys.sort();
+	    for (i = 0; i < sortedKeys.length; i += 1) {
+	      _key = sortedKeys[i];
+	      canonicalizedObj[_key] = canonicalize(obj[_key], stack, replacementStack, replacer, _key);
+	    }
+	    stack.pop();
+	    replacementStack.pop();
+	  } else {
+	    canonicalizedObj = obj;
+	  }
+	  return canonicalizedObj;
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2pzb24uanMiXSwibmFtZXMiOlsiZGlmZkpzb24iLCJjYW5vbmljYWxpemUiLCJvYmplY3RQcm90b3R5cGVUb1N0cmluZyIsIk9iamVjdCIsInByb3RvdHlwZSIsInRvU3RyaW5nIiwianNvbkRpZmYiLCJ1c2VMb25nZXN0VG9rZW4iLCJ0b2tlbml6ZSIsImNhc3RJbnB1dCIsInZhbHVlIiwib3B0aW9ucyIsInVuZGVmaW5lZFJlcGxhY2VtZW50Iiwic3RyaW5naWZ5UmVwbGFjZXIiLCJrIiwidiIsIkpTT04iLCJzdHJpbmdpZnkiLCJlcXVhbHMiLCJsZWZ0IiwicmlnaHQiLCJjYWxsIiwicmVwbGFjZSIsIm9sZE9iaiIsIm5ld09iaiIsImRpZmYiLCJvYmoiLCJzdGFjayIsInJlcGxhY2VtZW50U3RhY2siLCJyZXBsYWNlciIsImtleSIsImkiLCJsZW5ndGgiLCJjYW5vbmljYWxpemVkT2JqIiwicHVzaCIsIkFycmF5IiwicG9wIiwidG9KU09OIiwic29ydGVkS2V5cyIsImhhc093blByb3BlcnR5Iiwic29ydCJdLCJtYXBwaW5ncyI6Ijs7Ozs7OztnQ0FxQmdCQSxRLEdBQUFBLFE7eURBSUFDLFksR0FBQUEsWTs7QUF6QmhCOzs7O3VCQUNBOzs7O3VCQUVBLElBQU1DLDBCQUEwQkMsT0FBT0MsU0FBUCxDQUFpQkMsUUFBakQ7O0FBR08sSUFBTUMsK0VBQVcsd0VBQWpCO0FBQ1A7QUFDQTtBQUNBQSxTQUFTQyxlQUFULEdBQTJCLElBQTNCOztBQUVBRCxTQUFTRSxRQUFULEdBQW9CLGdFQUFTQSxRQUE3QjtBQUNBRixTQUFTRyxTQUFULEdBQXFCLFVBQVNDLEtBQVQsRUFBZ0I7QUFBQSxpRUFDK0UsS0FBS0MsT0FEcEY7QUFBQSxNQUM1QkMsb0JBRDRCLFlBQzVCQSxvQkFENEI7QUFBQSx1Q0FDTkMsaUJBRE07QUFBQSxNQUNOQSxpQkFETSx5Q0FDYyxVQUFDQyxDQUFELEVBQUlDLENBQUo7QUFBQSxtQ0FBVSxPQUFPQSxDQUFQLEtBQWEsV0FBYixHQUEyQkgsb0JBQTNCLEdBQWtERztBQUE1RDtBQUFBLEdBRGQ7OztBQUduQyxTQUFPLE9BQU9MLEtBQVAsS0FBaUIsUUFBakIsR0FBNEJBLEtBQTVCLEdBQW9DTSxLQUFLQyxTQUFMLENBQWVoQixhQUFhUyxLQUFiLEVBQW9CLElBQXBCLEVBQTBCLElBQTFCLEVBQWdDRyxpQkFBaEMsQ0FBZixFQUFtRUEsaUJBQW5FLEVBQXNGLElBQXRGLENBQTNDO0FBQ0QsQ0FKRDtBQUtBUCxTQUFTWSxNQUFULEdBQWtCLFVBQVNDLElBQVQsRUFBZUMsS0FBZixFQUFzQjtBQUN0QyxTQUFPLG9FQUFLaEIsU0FBTCxDQUFlYyxNQUFmLENBQXNCRyxJQUF0QixDQUEyQmYsUUFBM0IsRUFBcUNhLEtBQUtHLE9BQUwsQ0FBYSxZQUFiLEVBQTJCLElBQTNCLENBQXJDLEVBQXVFRixNQUFNRSxPQUFOLENBQWMsWUFBZCxFQUE0QixJQUE1QixDQUF2RTtBQUFQO0FBQ0QsQ0FGRDs7QUFJTyxTQUFTdEIsUUFBVCxDQUFrQnVCLE1BQWxCLEVBQTBCQyxNQUExQixFQUFrQ2IsT0FBbEMsRUFBMkM7QUFBRSxTQUFPTCxTQUFTbUIsSUFBVCxDQUFjRixNQUFkLEVBQXNCQyxNQUF0QixFQUE4QmIsT0FBOUIsQ0FBUDtBQUFnRDs7QUFFcEc7QUFDQTtBQUNPLFNBQVNWLFlBQVQsQ0FBc0J5QixHQUF0QixFQUEyQkMsS0FBM0IsRUFBa0NDLGdCQUFsQyxFQUFvREMsUUFBcEQsRUFBOERDLEdBQTlELEVBQW1FO0FBQ3hFSCxVQUFRQSxTQUFTLEVBQWpCO0FBQ0FDLHFCQUFtQkEsb0JBQW9CLEVBQXZDOztBQUVBLE1BQUlDLFFBQUosRUFBYztBQUNaSCxVQUFNRyxTQUFTQyxHQUFULEVBQWNKLEdBQWQsQ0FBTjtBQUNEOztBQUVELE1BQUlLLG1DQUFKOztBQUVBLE9BQUtBLElBQUksQ0FBVCxFQUFZQSxJQUFJSixNQUFNSyxNQUF0QixFQUE4QkQsS0FBSyxDQUFuQyxFQUFzQztBQUNwQyxRQUFJSixNQUFNSSxDQUFOLE1BQWFMLEdBQWpCLEVBQXNCO0FBQ3BCLGFBQU9FLGlCQUFpQkcsQ0FBakIsQ0FBUDtBQUNEO0FBQ0Y7O0FBRUQsTUFBSUUsa0RBQUo7O0FBRUEsTUFBSSxxQkFBcUIvQix3QkFBd0JtQixJQUF4QixDQUE2QkssR0FBN0IsQ0FBekIsRUFBNEQ7QUFDMURDLFVBQU1PLElBQU4sQ0FBV1IsR0FBWDtBQUNBTyx1QkFBbUIsSUFBSUUsS0FBSixDQUFVVCxJQUFJTSxNQUFkLENBQW5CO0FBQ0FKLHFCQUFpQk0sSUFBakIsQ0FBc0JELGdCQUF0QjtBQUNBLFNBQUtGLElBQUksQ0FBVCxFQUFZQSxJQUFJTCxJQUFJTSxNQUFwQixFQUE0QkQsS0FBSyxDQUFqQyxFQUFvQztBQUNsQ0UsdUJBQWlCRixDQUFqQixJQUFzQjlCLGFBQWF5QixJQUFJSyxDQUFKLENBQWIsRUFBcUJKLEtBQXJCLEVBQTRCQyxnQkFBNUIsRUFBOENDLFFBQTlDLEVBQXdEQyxHQUF4RCxDQUF0QjtBQUNEO0FBQ0RILFVBQU1TLEdBQU47QUFDQVIscUJBQWlCUSxHQUFqQjtBQUNBLFdBQU9ILGdCQUFQO0FBQ0Q7O0FBRUQsTUFBSVAsT0FBT0EsSUFBSVcsTUFBZixFQUF1QjtBQUNyQlgsVUFBTUEsSUFBSVcsTUFBSixFQUFOO0FBQ0Q7O0FBRUQsTUFBSSx5REFBT1gsR0FBUCx5Q0FBT0EsR0FBUCxPQUFlLFFBQWYsSUFBMkJBLFFBQVEsSUFBdkMsRUFBNkM7QUFDM0NDLFVBQU1PLElBQU4sQ0FBV1IsR0FBWDtBQUNBTyx1QkFBbUIsRUFBbkI7QUFDQUwscUJBQWlCTSxJQUFqQixDQUFzQkQsZ0JBQXRCO0FBQ0EsUUFBSUssYUFBYSxFQUFqQjtBQUFBLFFBQ0lSLHNDQURKO0FBRUEsU0FBS0EsSUFBTCxJQUFZSixHQUFaLEVBQWlCO0FBQ2Y7QUFDQSxVQUFJQSxJQUFJYSxjQUFKLENBQW1CVCxJQUFuQixDQUFKLEVBQTZCO0FBQzNCUSxtQkFBV0osSUFBWCxDQUFnQkosSUFBaEI7QUFDRDtBQUNGO0FBQ0RRLGVBQVdFLElBQVg7QUFDQSxTQUFLVCxJQUFJLENBQVQsRUFBWUEsSUFBSU8sV0FBV04sTUFBM0IsRUFBbUNELEtBQUssQ0FBeEMsRUFBMkM7QUFDekNELGFBQU1RLFdBQVdQLENBQVgsQ0FBTjtBQUNBRSx1QkFBaUJILElBQWpCLElBQXdCN0IsYUFBYXlCLElBQUlJLElBQUosQ0FBYixFQUF1QkgsS0FBdkIsRUFBOEJDLGdCQUE5QixFQUFnREMsUUFBaEQsRUFBMERDLElBQTFELENBQXhCO0FBQ0Q7QUFDREgsVUFBTVMsR0FBTjtBQUNBUixxQkFBaUJRLEdBQWpCO0FBQ0QsR0FuQkQsTUFtQk87QUFDTEgsdUJBQW1CUCxHQUFuQjtBQUNEO0FBQ0QsU0FBT08sZ0JBQVA7QUFDRCIsImZpbGUiOiJqc29uLmpzIiwic291cmNlc0NvbnRlbnQiOlsiaW1wb3J0IERpZmYgZnJvbSAnLi9iYXNlJztcbmltcG9ydCB7bGluZURpZmZ9IGZyb20gJy4vbGluZSc7XG5cbmNvbnN0IG9iamVjdFByb3RvdHlwZVRvU3RyaW5nID0gT2JqZWN0LnByb3RvdHlwZS50b1N0cmluZztcblxuXG5leHBvcnQgY29uc3QganNvbkRpZmYgPSBuZXcgRGlmZigpO1xuLy8gRGlzY3JpbWluYXRlIGJldHdlZW4gdHdvIGxpbmVzIG9mIHByZXR0eS1wcmludGVkLCBzZXJpYWxpemVkIEpTT04gd2hlcmUgb25lIG9mIHRoZW0gaGFzIGFcbi8vIGRhbmdsaW5nIGNvbW1hIGFuZCB0aGUgb3RoZXIgZG9lc24ndC4gVHVybnMgb3V0IGluY2x1ZGluZyB0aGUgZGFuZ2xpbmcgY29tbWEgeWllbGRzIHRoZSBuaWNlc3Qgb3V0cHV0OlxuanNvbkRpZmYudXNlTG9uZ2VzdFRva2VuID0gdHJ1ZTtcblxuanNvbkRpZmYudG9rZW5pemUgPSBsaW5lRGlmZi50b2tlbml6ZTtcbmpzb25EaWZmLmNhc3RJbnB1dCA9IGZ1bmN0aW9uKHZhbHVlKSB7XG4gIGNvbnN0IHt1bmRlZmluZWRSZXBsYWNlbWVudCwgc3RyaW5naWZ5UmVwbGFjZXIgPSAoaywgdikgPT4gdHlwZW9mIHYgPT09ICd1bmRlZmluZWQnID8gdW5kZWZpbmVkUmVwbGFjZW1lbnQgOiB2fSA9IHRoaXMub3B0aW9ucztcblxuICByZXR1cm4gdHlwZW9mIHZhbHVlID09PSAnc3RyaW5nJyA/IHZhbHVlIDogSlNPTi5zdHJpbmdpZnkoY2Fub25pY2FsaXplKHZhbHVlLCBudWxsLCBudWxsLCBzdHJpbmdpZnlSZXBsYWNlciksIHN0cmluZ2lmeVJlcGxhY2VyLCAnICAnKTtcbn07XG5qc29uRGlmZi5lcXVhbHMgPSBmdW5jdGlvbihsZWZ0LCByaWdodCkge1xuICByZXR1cm4gRGlmZi5wcm90b3R5cGUuZXF1YWxzLmNhbGwoanNvbkRpZmYsIGxlZnQucmVwbGFjZSgvLChbXFxyXFxuXSkvZywgJyQxJyksIHJpZ2h0LnJlcGxhY2UoLywoW1xcclxcbl0pL2csICckMScpKTtcbn07XG5cbmV4cG9ydCBmdW5jdGlvbiBkaWZmSnNvbihvbGRPYmosIG5ld09iaiwgb3B0aW9ucykgeyByZXR1cm4ganNvbkRpZmYuZGlmZihvbGRPYmosIG5ld09iaiwgb3B0aW9ucyk7IH1cblxuLy8gVGhpcyBmdW5jdGlvbiBoYW5kbGVzIHRoZSBwcmVzZW5jZSBvZiBjaXJjdWxhciByZWZlcmVuY2VzIGJ5IGJhaWxpbmcgb3V0IHdoZW4gZW5jb3VudGVyaW5nIGFuXG4vLyBvYmplY3QgdGhhdCBpcyBhbHJlYWR5IG9uIHRoZSBcInN0YWNrXCIgb2YgaXRlbXMgYmVpbmcgcHJvY2Vzc2VkLiBBY2NlcHRzIGFuIG9wdGlvbmFsIHJlcGxhY2VyXG5leHBvcnQgZnVuY3Rpb24gY2Fub25pY2FsaXplKG9iaiwgc3RhY2ssIHJlcGxhY2VtZW50U3RhY2ssIHJlcGxhY2VyLCBrZXkpIHtcbiAgc3RhY2sgPSBzdGFjayB8fCBbXTtcbiAgcmVwbGFjZW1lbnRTdGFjayA9IHJlcGxhY2VtZW50U3RhY2sgfHwgW107XG5cbiAgaWYgKHJlcGxhY2VyKSB7XG4gICAgb2JqID0gcmVwbGFjZXIoa2V5LCBvYmopO1xuICB9XG5cbiAgbGV0IGk7XG5cbiAgZm9yIChpID0gMDsgaSA8IHN0YWNrLmxlbmd0aDsgaSArPSAxKSB7XG4gICAgaWYgKHN0YWNrW2ldID09PSBvYmopIHtcbiAgICAgIHJldHVybiByZXBsYWNlbWVudFN0YWNrW2ldO1xuICAgIH1cbiAgfVxuXG4gIGxldCBjYW5vbmljYWxpemVkT2JqO1xuXG4gIGlmICgnW29iamVjdCBBcnJheV0nID09PSBvYmplY3RQcm90b3R5cGVUb1N0cmluZy5jYWxsKG9iaikpIHtcbiAgICBzdGFjay5wdXNoKG9iaik7XG4gICAgY2Fub25pY2FsaXplZE9iaiA9IG5ldyBBcnJheShvYmoubGVuZ3RoKTtcbiAgICByZXBsYWNlbWVudFN0YWNrLnB1c2goY2Fub25pY2FsaXplZE9iaik7XG4gICAgZm9yIChpID0gMDsgaSA8IG9iai5sZW5ndGg7IGkgKz0gMSkge1xuICAgICAgY2Fub25pY2FsaXplZE9ialtpXSA9IGNhbm9uaWNhbGl6ZShvYmpbaV0sIHN0YWNrLCByZXBsYWNlbWVudFN0YWNrLCByZXBsYWNlciwga2V5KTtcbiAgICB9XG4gICAgc3RhY2sucG9wKCk7XG4gICAgcmVwbGFjZW1lbnRTdGFjay5wb3AoKTtcbiAgICByZXR1cm4gY2Fub25pY2FsaXplZE9iajtcbiAgfVxuXG4gIGlmIChvYmogJiYgb2JqLnRvSlNPTikge1xuICAgIG9iaiA9IG9iai50b0pTT04oKTtcbiAgfVxuXG4gIGlmICh0eXBlb2Ygb2JqID09PSAnb2JqZWN0JyAmJiBvYmogIT09IG51bGwpIHtcbiAgICBzdGFjay5wdXNoKG9iaik7XG4gICAgY2Fub25pY2FsaXplZE9iaiA9IHt9O1xuICAgIHJlcGxhY2VtZW50U3RhY2sucHVzaChjYW5vbmljYWxpemVkT2JqKTtcbiAgICBsZXQgc29ydGVkS2V5cyA9IFtdLFxuICAgICAgICBrZXk7XG4gICAgZm9yIChrZXkgaW4gb2JqKSB7XG4gICAgICAvKiBpc3RhbmJ1bCBpZ25vcmUgZWxzZSAqL1xuICAgICAgaWYgKG9iai5oYXNPd25Qcm9wZXJ0eShrZXkpKSB7XG4gICAgICAgIHNvcnRlZEtleXMucHVzaChrZXkpO1xuICAgICAgfVxuICAgIH1cbiAgICBzb3J0ZWRLZXlzLnNvcnQoKTtcbiAgICBmb3IgKGkgPSAwOyBpIDwgc29ydGVkS2V5cy5sZW5ndGg7IGkgKz0gMSkge1xuICAgICAga2V5ID0gc29ydGVkS2V5c1tpXTtcbiAgICAgIGNhbm9uaWNhbGl6ZWRPYmpba2V5XSA9IGNhbm9uaWNhbGl6ZShvYmpba2V5XSwgc3RhY2ssIHJlcGxhY2VtZW50U3RhY2ssIHJlcGxhY2VyLCBrZXkpO1xuICAgIH1cbiAgICBzdGFjay5wb3AoKTtcbiAgICByZXBsYWNlbWVudFN0YWNrLnBvcCgpO1xuICB9IGVsc2Uge1xuICAgIGNhbm9uaWNhbGl6ZWRPYmogPSBvYmo7XG4gIH1cbiAgcmV0dXJuIGNhbm9uaWNhbGl6ZWRPYmo7XG59XG4iXX0=
+
+
+/***/ }),
+/* 9 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.arrayDiff = undefined;
+	exports. /*istanbul ignore end*/diffArrays = diffArrays;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/var arrayDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/arrayDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	arrayDiff.tokenize = function (value) {
+	  return value.slice();
+	};
+	arrayDiff.join = arrayDiff.removeEmpty = function (value) {
+	  return value;
+	};
+
+	function diffArrays(oldArr, newArr, callback) {
+	  return arrayDiff.diff(oldArr, newArr, callback);
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2FycmF5LmpzIl0sIm5hbWVzIjpbImRpZmZBcnJheXMiLCJhcnJheURpZmYiLCJ0b2tlbml6ZSIsInZhbHVlIiwic2xpY2UiLCJqb2luIiwicmVtb3ZlRW1wdHkiLCJvbGRBcnIiLCJuZXdBcnIiLCJjYWxsYmFjayIsImRpZmYiXSwibWFwcGluZ3MiOiI7Ozs7Z0NBVWdCQSxVLEdBQUFBLFU7O0FBVmhCOzs7Ozs7dUJBRU8sSUFBTUMsaUZBQVksd0VBQWxCO0FBQ1BBLFVBQVVDLFFBQVYsR0FBcUIsVUFBU0MsS0FBVCxFQUFnQjtBQUNuQyxTQUFPQSxNQUFNQyxLQUFOLEVBQVA7QUFDRCxDQUZEO0FBR0FILFVBQVVJLElBQVYsR0FBaUJKLFVBQVVLLFdBQVYsR0FBd0IsVUFBU0gsS0FBVCxFQUFnQjtBQUN2RCxTQUFPQSxLQUFQO0FBQ0QsQ0FGRDs7QUFJTyxTQUFTSCxVQUFULENBQW9CTyxNQUFwQixFQUE0QkMsTUFBNUIsRUFBb0NDLFFBQXBDLEVBQThDO0FBQUUsU0FBT1IsVUFBVVMsSUFBVixDQUFlSCxNQUFmLEVBQXVCQyxNQUF2QixFQUErQkMsUUFBL0IsQ0FBUDtBQUFrRCIsImZpbGUiOiJhcnJheS5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCBEaWZmIGZyb20gJy4vYmFzZSc7XG5cbmV4cG9ydCBjb25zdCBhcnJheURpZmYgPSBuZXcgRGlmZigpO1xuYXJyYXlEaWZmLnRva2VuaXplID0gZnVuY3Rpb24odmFsdWUpIHtcbiAgcmV0dXJuIHZhbHVlLnNsaWNlKCk7XG59O1xuYXJyYXlEaWZmLmpvaW4gPSBhcnJheURpZmYucmVtb3ZlRW1wdHkgPSBmdW5jdGlvbih2YWx1ZSkge1xuICByZXR1cm4gdmFsdWU7XG59O1xuXG5leHBvcnQgZnVuY3Rpb24gZGlmZkFycmF5cyhvbGRBcnIsIG5ld0FyciwgY2FsbGJhY2spIHsgcmV0dXJuIGFycmF5RGlmZi5kaWZmKG9sZEFyciwgbmV3QXJyLCBjYWxsYmFjayk7IH1cbiJdfQ==
+
+
+/***/ }),
+/* 10 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/applyPatch = applyPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/applyPatches = applyPatches;
+
+	var /*istanbul ignore start*/_parse = __webpack_require__(11) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_distanceIterator = __webpack_require__(12) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _distanceIterator2 = _interopRequireDefault(_distanceIterator);
+
+	function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/function applyPatch(source, uniDiff) {
+	  /*istanbul ignore start*/var /*istanbul ignore end*/options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
+
+	  if (typeof uniDiff === 'string') {
+	    uniDiff = /*istanbul ignore start*/(0, _parse.parsePatch) /*istanbul ignore end*/(uniDiff);
+	  }
+
+	  if (Array.isArray(uniDiff)) {
+	    if (uniDiff.length > 1) {
+	      throw new Error('applyPatch only works with a single input.');
+	    }
+
+	    uniDiff = uniDiff[0];
+	  }
+
+	  // Apply the diff to the input
+	  var lines = source.split(/\r\n|[\n\v\f\r\x85]/),
+	      delimiters = source.match(/\r\n|[\n\v\f\r\x85]/g) || [],
+	      hunks = uniDiff.hunks,
+	      compareLine = options.compareLine || function (lineNumber, line, operation, patchContent) /*istanbul ignore start*/{
+	    return (/*istanbul ignore end*/line === patchContent
+	    );
+	  },
+	      errorCount = 0,
+	      fuzzFactor = options.fuzzFactor || 0,
+	      minLine = 0,
+	      offset = 0,
+	      removeEOFNL = /*istanbul ignore start*/void 0 /*istanbul ignore end*/,
+	      addEOFNL = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+
+	  /**
+	   * Checks if the hunk exactly fits on the provided location
+	   */
+	  function hunkFits(hunk, toPos) {
+	    for (var j = 0; j < hunk.lines.length; j++) {
+	      var line = hunk.lines[j],
+	          operation = line.length > 0 ? line[0] : ' ',
+	          content = line.length > 0 ? line.substr(1) : line;
+
+	      if (operation === ' ' || operation === '-') {
+	        // Context sanity check
+	        if (!compareLine(toPos + 1, lines[toPos], operation, content)) {
+	          errorCount++;
+
+	          if (errorCount > fuzzFactor) {
+	            return false;
+	          }
+	        }
+	        toPos++;
+	      }
+	    }
+
+	    return true;
+	  }
+
+	  // Search best fit offsets for each hunk based on the previous ones
+	  for (var i = 0; i < hunks.length; i++) {
+	    var hunk = hunks[i],
+	        maxLine = lines.length - hunk.oldLines,
+	        localOffset = 0,
+	        toPos = offset + hunk.oldStart - 1;
+
+	    var iterator = /*istanbul ignore start*/(0, _distanceIterator2['default']) /*istanbul ignore end*/(toPos, minLine, maxLine);
+
+	    for (; localOffset !== undefined; localOffset = iterator()) {
+	      if (hunkFits(hunk, toPos + localOffset)) {
+	        hunk.offset = offset += localOffset;
+	        break;
+	      }
+	    }
+
+	    if (localOffset === undefined) {
+	      return false;
+	    }
+
+	    // Set lower text limit to end of the current hunk, so next ones don't try
+	    // to fit over already patched text
+	    minLine = hunk.offset + hunk.oldStart + hunk.oldLines;
+	  }
+
+	  // Apply patch hunks
+	  var diffOffset = 0;
+	  for (var _i = 0; _i < hunks.length; _i++) {
+	    var _hunk = hunks[_i],
+	        _toPos = _hunk.oldStart + _hunk.offset + diffOffset - 1;
+	    diffOffset += _hunk.newLines - _hunk.oldLines;
+
+	    if (_toPos < 0) {
+	      // Creating a new file
+	      _toPos = 0;
+	    }
+
+	    for (var j = 0; j < _hunk.lines.length; j++) {
+	      var line = _hunk.lines[j],
+	          operation = line.length > 0 ? line[0] : ' ',
+	          content = line.length > 0 ? line.substr(1) : line,
+	          delimiter = _hunk.linedelimiters[j];
+
+	      if (operation === ' ') {
+	        _toPos++;
+	      } else if (operation === '-') {
+	        lines.splice(_toPos, 1);
+	        delimiters.splice(_toPos, 1);
+	        /* istanbul ignore else */
+	      } else if (operation === '+') {
+	        lines.splice(_toPos, 0, content);
+	        delimiters.splice(_toPos, 0, delimiter);
+	        _toPos++;
+	      } else if (operation === '\\') {
+	        var previousOperation = _hunk.lines[j - 1] ? _hunk.lines[j - 1][0] : null;
+	        if (previousOperation === '+') {
+	          removeEOFNL = true;
+	        } else if (previousOperation === '-') {
+	          addEOFNL = true;
+	        }
+	      }
+	    }
+	  }
+
+	  // Handle EOFNL insertion/removal
+	  if (removeEOFNL) {
+	    while (!lines[lines.length - 1]) {
+	      lines.pop();
+	      delimiters.pop();
+	    }
+	  } else if (addEOFNL) {
+	    lines.push('');
+	    delimiters.push('\n');
+	  }
+	  for (var _k = 0; _k < lines.length - 1; _k++) {
+	    lines[_k] = lines[_k] + delimiters[_k];
+	  }
+	  return lines.join('');
+	}
+
+	// Wrapper that supports multiple file patches via callbacks.
+	function applyPatches(uniDiff, options) {
+	  if (typeof uniDiff === 'string') {
+	    uniDiff = /*istanbul ignore start*/(0, _parse.parsePatch) /*istanbul ignore end*/(uniDiff);
+	  }
+
+	  var currentIndex = 0;
+	  function processIndex() {
+	    var index = uniDiff[currentIndex++];
+	    if (!index) {
+	      return options.complete();
+	    }
+
+	    options.loadFile(index, function (err, data) {
+	      if (err) {
+	        return options.complete(err);
+	      }
+
+	      var updatedContent = applyPatch(data, index, options);
+	      options.patched(index, updatedContent, function (err) {
+	        if (err) {
+	          return options.complete(err);
+	        }
+
+	        processIndex();
+	      });
+	    });
+	  }
+	  processIndex();
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9wYXRjaC9hcHBseS5qcyJdLCJuYW1lcyI6WyJhcHBseVBhdGNoIiwiYXBwbHlQYXRjaGVzIiwic291cmNlIiwidW5pRGlmZiIsIm9wdGlvbnMiLCJBcnJheSIsImlzQXJyYXkiLCJsZW5ndGgiLCJFcnJvciIsImxpbmVzIiwic3BsaXQiLCJkZWxpbWl0ZXJzIiwibWF0Y2giLCJodW5rcyIsImNvbXBhcmVMaW5lIiwibGluZU51bWJlciIsImxpbmUiLCJvcGVyYXRpb24iLCJwYXRjaENvbnRlbnQiLCJlcnJvckNvdW50IiwiZnV6ekZhY3RvciIsIm1pbkxpbmUiLCJvZmZzZXQiLCJyZW1vdmVFT0ZOTCIsImFkZEVPRk5MIiwiaHVua0ZpdHMiLCJodW5rIiwidG9Qb3MiLCJqIiwiY29udGVudCIsInN1YnN0ciIsImkiLCJtYXhMaW5lIiwib2xkTGluZXMiLCJsb2NhbE9mZnNldCIsIm9sZFN0YXJ0IiwiaXRlcmF0b3IiLCJ1bmRlZmluZWQiLCJkaWZmT2Zmc2V0IiwibmV3TGluZXMiLCJkZWxpbWl0ZXIiLCJsaW5lZGVsaW1pdGVycyIsInNwbGljZSIsInByZXZpb3VzT3BlcmF0aW9uIiwicG9wIiwicHVzaCIsIl9rIiwiam9pbiIsImN1cnJlbnRJbmRleCIsInByb2Nlc3NJbmRleCIsImluZGV4IiwiY29tcGxldGUiLCJsb2FkRmlsZSIsImVyciIsImRhdGEiLCJ1cGRhdGVkQ29udGVudCIsInBhdGNoZWQiXSwibWFwcGluZ3MiOiI7OztnQ0FHZ0JBLFUsR0FBQUEsVTt5REFvSUFDLFksR0FBQUEsWTs7QUF2SWhCOztBQUNBOzs7Ozs7dUJBRU8sU0FBU0QsVUFBVCxDQUFvQkUsTUFBcEIsRUFBNEJDLE9BQTVCLEVBQW1EO0FBQUEsc0RBQWRDLE9BQWMsdUVBQUosRUFBSTs7QUFDeEQsTUFBSSxPQUFPRCxPQUFQLEtBQW1CLFFBQXZCLEVBQWlDO0FBQy9CQSxjQUFVLHdFQUFXQSxPQUFYLENBQVY7QUFDRDs7QUFFRCxNQUFJRSxNQUFNQyxPQUFOLENBQWNILE9BQWQsQ0FBSixFQUE0QjtBQUMxQixRQUFJQSxRQUFRSSxNQUFSLEdBQWlCLENBQXJCLEVBQXdCO0FBQ3RCLFlBQU0sSUFBSUMsS0FBSixDQUFVLDRDQUFWLENBQU47QUFDRDs7QUFFREwsY0FBVUEsUUFBUSxDQUFSLENBQVY7QUFDRDs7QUFFRDtBQUNBLE1BQUlNLFFBQVFQLE9BQU9RLEtBQVAsQ0FBYSxxQkFBYixDQUFaO0FBQUEsTUFDSUMsYUFBYVQsT0FBT1UsS0FBUCxDQUFhLHNCQUFiLEtBQXdDLEVBRHpEO0FBQUEsTUFFSUMsUUFBUVYsUUFBUVUsS0FGcEI7QUFBQSxNQUlJQyxjQUFjVixRQUFRVSxXQUFSLElBQXdCLFVBQUNDLFVBQUQsRUFBYUMsSUFBYixFQUFtQkMsU0FBbkIsRUFBOEJDLFlBQTlCO0FBQUEsbUNBQStDRixTQUFTRTtBQUF4RDtBQUFBLEdBSjFDO0FBQUEsTUFLSUMsYUFBYSxDQUxqQjtBQUFBLE1BTUlDLGFBQWFoQixRQUFRZ0IsVUFBUixJQUFzQixDQU52QztBQUFBLE1BT0lDLFVBQVUsQ0FQZDtBQUFBLE1BUUlDLFNBQVMsQ0FSYjtBQUFBLE1BVUlDLDZDQVZKO0FBQUEsTUFXSUMsMENBWEo7O0FBYUE7OztBQUdBLFdBQVNDLFFBQVQsQ0FBa0JDLElBQWxCLEVBQXdCQyxLQUF4QixFQUErQjtBQUM3QixTQUFLLElBQUlDLElBQUksQ0FBYixFQUFnQkEsSUFBSUYsS0FBS2pCLEtBQUwsQ0FBV0YsTUFBL0IsRUFBdUNxQixHQUF2QyxFQUE0QztBQUMxQyxVQUFJWixPQUFPVSxLQUFLakIsS0FBTCxDQUFXbUIsQ0FBWCxDQUFYO0FBQUEsVUFDSVgsWUFBYUQsS0FBS1QsTUFBTCxHQUFjLENBQWQsR0FBa0JTLEtBQUssQ0FBTCxDQUFsQixHQUE0QixHQUQ3QztBQUFBLFVBRUlhLFVBQVdiLEtBQUtULE1BQUwsR0FBYyxDQUFkLEdBQWtCUyxLQUFLYyxNQUFMLENBQVksQ0FBWixDQUFsQixHQUFtQ2QsSUFGbEQ7O0FBSUEsVUFBSUMsY0FBYyxHQUFkLElBQXFCQSxjQUFjLEdBQXZDLEVBQTRDO0FBQzFDO0FBQ0EsWUFBSSxDQUFDSCxZQUFZYSxRQUFRLENBQXBCLEVBQXVCbEIsTUFBTWtCLEtBQU4sQ0FBdkIsRUFBcUNWLFNBQXJDLEVBQWdEWSxPQUFoRCxDQUFMLEVBQStEO0FBQzdEVjs7QUFFQSxjQUFJQSxhQUFhQyxVQUFqQixFQUE2QjtBQUMzQixtQkFBTyxLQUFQO0FBQ0Q7QUFDRjtBQUNETztBQUNEO0FBQ0Y7O0FBRUQsV0FBTyxJQUFQO0FBQ0Q7O0FBRUQ7QUFDQSxPQUFLLElBQUlJLElBQUksQ0FBYixFQUFnQkEsSUFBSWxCLE1BQU1OLE1BQTFCLEVBQWtDd0IsR0FBbEMsRUFBdUM7QUFDckMsUUFBSUwsT0FBT2IsTUFBTWtCLENBQU4sQ0FBWDtBQUFBLFFBQ0lDLFVBQVV2QixNQUFNRixNQUFOLEdBQWVtQixLQUFLTyxRQURsQztBQUFBLFFBRUlDLGNBQWMsQ0FGbEI7QUFBQSxRQUdJUCxRQUFRTCxTQUFTSSxLQUFLUyxRQUFkLEdBQXlCLENBSHJDOztBQUtBLFFBQUlDLFdBQVcsb0ZBQWlCVCxLQUFqQixFQUF3Qk4sT0FBeEIsRUFBaUNXLE9BQWpDLENBQWY7O0FBRUEsV0FBT0UsZ0JBQWdCRyxTQUF2QixFQUFrQ0gsY0FBY0UsVUFBaEQsRUFBNEQ7QUFDMUQsVUFBSVgsU0FBU0MsSUFBVCxFQUFlQyxRQUFRTyxXQUF2QixDQUFKLEVBQXlDO0FBQ3ZDUixhQUFLSixNQUFMLEdBQWNBLFVBQVVZLFdBQXhCO0FBQ0E7QUFDRDtBQUNGOztBQUVELFFBQUlBLGdCQUFnQkcsU0FBcEIsRUFBK0I7QUFDN0IsYUFBTyxLQUFQO0FBQ0Q7O0FBRUQ7QUFDQTtBQUNBaEIsY0FBVUssS0FBS0osTUFBTCxHQUFjSSxLQUFLUyxRQUFuQixHQUE4QlQsS0FBS08sUUFBN0M7QUFDRDs7QUFFRDtBQUNBLE1BQUlLLGFBQWEsQ0FBakI7QUFDQSxPQUFLLElBQUlQLEtBQUksQ0FBYixFQUFnQkEsS0FBSWxCLE1BQU1OLE1BQTFCLEVBQWtDd0IsSUFBbEMsRUFBdUM7QUFDckMsUUFBSUwsUUFBT2IsTUFBTWtCLEVBQU4sQ0FBWDtBQUFBLFFBQ0lKLFNBQVFELE1BQUtTLFFBQUwsR0FBZ0JULE1BQUtKLE1BQXJCLEdBQThCZ0IsVUFBOUIsR0FBMkMsQ0FEdkQ7QUFFQUEsa0JBQWNaLE1BQUthLFFBQUwsR0FBZ0JiLE1BQUtPLFFBQW5DOztBQUVBLFFBQUlOLFNBQVEsQ0FBWixFQUFlO0FBQUU7QUFDZkEsZUFBUSxDQUFSO0FBQ0Q7O0FBRUQsU0FBSyxJQUFJQyxJQUFJLENBQWIsRUFBZ0JBLElBQUlGLE1BQUtqQixLQUFMLENBQVdGLE1BQS9CLEVBQXVDcUIsR0FBdkMsRUFBNEM7QUFDMUMsVUFBSVosT0FBT1UsTUFBS2pCLEtBQUwsQ0FBV21CLENBQVgsQ0FBWDtBQUFBLFVBQ0lYLFlBQWFELEtBQUtULE1BQUwsR0FBYyxDQUFkLEdBQWtCUyxLQUFLLENBQUwsQ0FBbEIsR0FBNEIsR0FEN0M7QUFBQSxVQUVJYSxVQUFXYixLQUFLVCxNQUFMLEdBQWMsQ0FBZCxHQUFrQlMsS0FBS2MsTUFBTCxDQUFZLENBQVosQ0FBbEIsR0FBbUNkLElBRmxEO0FBQUEsVUFHSXdCLFlBQVlkLE1BQUtlLGNBQUwsQ0FBb0JiLENBQXBCLENBSGhCOztBQUtBLFVBQUlYLGNBQWMsR0FBbEIsRUFBdUI7QUFDckJVO0FBQ0QsT0FGRCxNQUVPLElBQUlWLGNBQWMsR0FBbEIsRUFBdUI7QUFDNUJSLGNBQU1pQyxNQUFOLENBQWFmLE1BQWIsRUFBb0IsQ0FBcEI7QUFDQWhCLG1CQUFXK0IsTUFBWCxDQUFrQmYsTUFBbEIsRUFBeUIsQ0FBekI7QUFDRjtBQUNDLE9BSk0sTUFJQSxJQUFJVixjQUFjLEdBQWxCLEVBQXVCO0FBQzVCUixjQUFNaUMsTUFBTixDQUFhZixNQUFiLEVBQW9CLENBQXBCLEVBQXVCRSxPQUF2QjtBQUNBbEIsbUJBQVcrQixNQUFYLENBQWtCZixNQUFsQixFQUF5QixDQUF6QixFQUE0QmEsU0FBNUI7QUFDQWI7QUFDRCxPQUpNLE1BSUEsSUFBSVYsY0FBYyxJQUFsQixFQUF3QjtBQUM3QixZQUFJMEIsb0JBQW9CakIsTUFBS2pCLEtBQUwsQ0FBV21CLElBQUksQ0FBZixJQUFvQkYsTUFBS2pCLEtBQUwsQ0FBV21CLElBQUksQ0FBZixFQUFrQixDQUFsQixDQUFwQixHQUEyQyxJQUFuRTtBQUNBLFlBQUllLHNCQUFzQixHQUExQixFQUErQjtBQUM3QnBCLHdCQUFjLElBQWQ7QUFDRCxTQUZELE1BRU8sSUFBSW9CLHNCQUFzQixHQUExQixFQUErQjtBQUNwQ25CLHFCQUFXLElBQVg7QUFDRDtBQUNGO0FBQ0Y7QUFDRjs7QUFFRDtBQUNBLE1BQUlELFdBQUosRUFBaUI7QUFDZixXQUFPLENBQUNkLE1BQU1BLE1BQU1GLE1BQU4sR0FBZSxDQUFyQixDQUFSLEVBQWlDO0FBQy9CRSxZQUFNbUMsR0FBTjtBQUNBakMsaUJBQVdpQyxHQUFYO0FBQ0Q7QUFDRixHQUxELE1BS08sSUFBSXBCLFFBQUosRUFBYztBQUNuQmYsVUFBTW9DLElBQU4sQ0FBVyxFQUFYO0FBQ0FsQyxlQUFXa0MsSUFBWCxDQUFnQixJQUFoQjtBQUNEO0FBQ0QsT0FBSyxJQUFJQyxLQUFLLENBQWQsRUFBaUJBLEtBQUtyQyxNQUFNRixNQUFOLEdBQWUsQ0FBckMsRUFBd0N1QyxJQUF4QyxFQUE4QztBQUM1Q3JDLFVBQU1xQyxFQUFOLElBQVlyQyxNQUFNcUMsRUFBTixJQUFZbkMsV0FBV21DLEVBQVgsQ0FBeEI7QUFDRDtBQUNELFNBQU9yQyxNQUFNc0MsSUFBTixDQUFXLEVBQVgsQ0FBUDtBQUNEOztBQUVEO0FBQ08sU0FBUzlDLFlBQVQsQ0FBc0JFLE9BQXRCLEVBQStCQyxPQUEvQixFQUF3QztBQUM3QyxNQUFJLE9BQU9ELE9BQVAsS0FBbUIsUUFBdkIsRUFBaUM7QUFDL0JBLGNBQVUsd0VBQVdBLE9BQVgsQ0FBVjtBQUNEOztBQUVELE1BQUk2QyxlQUFlLENBQW5CO0FBQ0EsV0FBU0MsWUFBVCxHQUF3QjtBQUN0QixRQUFJQyxRQUFRL0MsUUFBUTZDLGNBQVIsQ0FBWjtBQUNBLFFBQUksQ0FBQ0UsS0FBTCxFQUFZO0FBQ1YsYUFBTzlDLFFBQVErQyxRQUFSLEVBQVA7QUFDRDs7QUFFRC9DLFlBQVFnRCxRQUFSLENBQWlCRixLQUFqQixFQUF3QixVQUFTRyxHQUFULEVBQWNDLElBQWQsRUFBb0I7QUFDMUMsVUFBSUQsR0FBSixFQUFTO0FBQ1AsZUFBT2pELFFBQVErQyxRQUFSLENBQWlCRSxHQUFqQixDQUFQO0FBQ0Q7O0FBRUQsVUFBSUUsaUJBQWlCdkQsV0FBV3NELElBQVgsRUFBaUJKLEtBQWpCLEVBQXdCOUMsT0FBeEIsQ0FBckI7QUFDQUEsY0FBUW9ELE9BQVIsQ0FBZ0JOLEtBQWhCLEVBQXVCSyxjQUF2QixFQUF1QyxVQUFTRixHQUFULEVBQWM7QUFDbkQsWUFBSUEsR0FBSixFQUFTO0FBQ1AsaUJBQU9qRCxRQUFRK0MsUUFBUixDQUFpQkUsR0FBakIsQ0FBUDtBQUNEOztBQUVESjtBQUNELE9BTkQ7QUFPRCxLQWJEO0FBY0Q7QUFDREE7QUFDRCIsImZpbGUiOiJhcHBseS5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCB7cGFyc2VQYXRjaH0gZnJvbSAnLi9wYXJzZSc7XG5pbXBvcnQgZGlzdGFuY2VJdGVyYXRvciBmcm9tICcuLi91dGlsL2Rpc3RhbmNlLWl0ZXJhdG9yJztcblxuZXhwb3J0IGZ1bmN0aW9uIGFwcGx5UGF0Y2goc291cmNlLCB1bmlEaWZmLCBvcHRpb25zID0ge30pIHtcbiAgaWYgKHR5cGVvZiB1bmlEaWZmID09PSAnc3RyaW5nJykge1xuICAgIHVuaURpZmYgPSBwYXJzZVBhdGNoKHVuaURpZmYpO1xuICB9XG5cbiAgaWYgKEFycmF5LmlzQXJyYXkodW5pRGlmZikpIHtcbiAgICBpZiAodW5pRGlmZi5sZW5ndGggPiAxKSB7XG4gICAgICB0aHJvdyBuZXcgRXJyb3IoJ2FwcGx5UGF0Y2ggb25seSB3b3JrcyB3aXRoIGEgc2luZ2xlIGlucHV0LicpO1xuICAgIH1cblxuICAgIHVuaURpZmYgPSB1bmlEaWZmWzBdO1xuICB9XG5cbiAgLy8gQXBwbHkgdGhlIGRpZmYgdG8gdGhlIGlucHV0XG4gIGxldCBsaW5lcyA9IHNvdXJjZS5zcGxpdCgvXFxyXFxufFtcXG5cXHZcXGZcXHJcXHg4NV0vKSxcbiAgICAgIGRlbGltaXRlcnMgPSBzb3VyY2UubWF0Y2goL1xcclxcbnxbXFxuXFx2XFxmXFxyXFx4ODVdL2cpIHx8IFtdLFxuICAgICAgaHVua3MgPSB1bmlEaWZmLmh1bmtzLFxuXG4gICAgICBjb21wYXJlTGluZSA9IG9wdGlvbnMuY29tcGFyZUxpbmUgfHwgKChsaW5lTnVtYmVyLCBsaW5lLCBvcGVyYXRpb24sIHBhdGNoQ29udGVudCkgPT4gbGluZSA9PT0gcGF0Y2hDb250ZW50KSxcbiAgICAgIGVycm9yQ291bnQgPSAwLFxuICAgICAgZnV6ekZhY3RvciA9IG9wdGlvbnMuZnV6ekZhY3RvciB8fCAwLFxuICAgICAgbWluTGluZSA9IDAsXG4gICAgICBvZmZzZXQgPSAwLFxuXG4gICAgICByZW1vdmVFT0ZOTCxcbiAgICAgIGFkZEVPRk5MO1xuXG4gIC8qKlxuICAgKiBDaGVja3MgaWYgdGhlIGh1bmsgZXhhY3RseSBmaXRzIG9uIHRoZSBwcm92aWRlZCBsb2NhdGlvblxuICAgKi9cbiAgZnVuY3Rpb24gaHVua0ZpdHMoaHVuaywgdG9Qb3MpIHtcbiAgICBmb3IgKGxldCBqID0gMDsgaiA8IGh1bmsubGluZXMubGVuZ3RoOyBqKyspIHtcbiAgICAgIGxldCBsaW5lID0gaHVuay5saW5lc1tqXSxcbiAgICAgICAgICBvcGVyYXRpb24gPSAobGluZS5sZW5ndGggPiAwID8gbGluZVswXSA6ICcgJyksXG4gICAgICAgICAgY29udGVudCA9IChsaW5lLmxlbmd0aCA+IDAgPyBsaW5lLnN1YnN0cigxKSA6IGxpbmUpO1xuXG4gICAgICBpZiAob3BlcmF0aW9uID09PSAnICcgfHwgb3BlcmF0aW9uID09PSAnLScpIHtcbiAgICAgICAgLy8gQ29udGV4dCBzYW5pdHkgY2hlY2tcbiAgICAgICAgaWYgKCFjb21wYXJlTGluZSh0b1BvcyArIDEsIGxpbmVzW3RvUG9zXSwgb3BlcmF0aW9uLCBjb250ZW50KSkge1xuICAgICAgICAgIGVycm9yQ291bnQrKztcblxuICAgICAgICAgIGlmIChlcnJvckNvdW50ID4gZnV6ekZhY3Rvcikge1xuICAgICAgICAgICAgcmV0dXJuIGZhbHNlO1xuICAgICAgICAgIH1cbiAgICAgICAgfVxuICAgICAgICB0b1BvcysrO1xuICAgICAgfVxuICAgIH1cblxuICAgIHJldHVybiB0cnVlO1xuICB9XG5cbiAgLy8gU2VhcmNoIGJlc3QgZml0IG9mZnNldHMgZm9yIGVhY2ggaHVuayBiYXNlZCBvbiB0aGUgcHJldmlvdXMgb25lc1xuICBmb3IgKGxldCBpID0gMDsgaSA8IGh1bmtzLmxlbmd0aDsgaSsrKSB7XG4gICAgbGV0IGh1bmsgPSBodW5rc1tpXSxcbiAgICAgICAgbWF4TGluZSA9IGxpbmVzLmxlbmd0aCAtIGh1bmsub2xkTGluZXMsXG4gICAgICAgIGxvY2FsT2Zmc2V0ID0gMCxcbiAgICAgICAgdG9Qb3MgPSBvZmZzZXQgKyBodW5rLm9sZFN0YXJ0IC0gMTtcblxuICAgIGxldCBpdGVyYXRvciA9IGRpc3RhbmNlSXRlcmF0b3IodG9Qb3MsIG1pbkxpbmUsIG1heExpbmUpO1xuXG4gICAgZm9yICg7IGxvY2FsT2Zmc2V0ICE9PSB1bmRlZmluZWQ7IGxvY2FsT2Zmc2V0ID0gaXRlcmF0b3IoKSkge1xuICAgICAgaWYgKGh1bmtGaXRzKGh1bmssIHRvUG9zICsgbG9jYWxPZmZzZXQpKSB7XG4gICAgICAgIGh1bmsub2Zmc2V0ID0gb2Zmc2V0ICs9IGxvY2FsT2Zmc2V0O1xuICAgICAgICBicmVhaztcbiAgICAgIH1cbiAgICB9XG5cbiAgICBpZiAobG9jYWxPZmZzZXQgPT09IHVuZGVmaW5lZCkge1xuICAgICAgcmV0dXJuIGZhbHNlO1xuICAgIH1cblxuICAgIC8vIFNldCBsb3dlciB0ZXh0IGxpbWl0IHRvIGVuZCBvZiB0aGUgY3VycmVudCBodW5rLCBzbyBuZXh0IG9uZXMgZG9uJ3QgdHJ5XG4gICAgLy8gdG8gZml0IG92ZXIgYWxyZWFkeSBwYXRjaGVkIHRleHRcbiAgICBtaW5MaW5lID0gaHVuay5vZmZzZXQgKyBodW5rLm9sZFN0YXJ0ICsgaHVuay5vbGRMaW5lcztcbiAgfVxuXG4gIC8vIEFwcGx5IHBhdGNoIGh1bmtzXG4gIGxldCBkaWZmT2Zmc2V0ID0gMDtcbiAgZm9yIChsZXQgaSA9IDA7IGkgPCBodW5rcy5sZW5ndGg7IGkrKykge1xuICAgIGxldCBodW5rID0gaHVua3NbaV0sXG4gICAgICAgIHRvUG9zID0gaHVuay5vbGRTdGFydCArIGh1bmsub2Zmc2V0ICsgZGlmZk9mZnNldCAtIDE7XG4gICAgZGlmZk9mZnNldCArPSBodW5rLm5ld0xpbmVzIC0gaHVuay5vbGRMaW5lcztcblxuICAgIGlmICh0b1BvcyA8IDApIHsgLy8gQ3JlYXRpbmcgYSBuZXcgZmlsZVxuICAgICAgdG9Qb3MgPSAwO1xuICAgIH1cblxuICAgIGZvciAobGV0IGogPSAwOyBqIDwgaHVuay5saW5lcy5sZW5ndGg7IGorKykge1xuICAgICAgbGV0IGxpbmUgPSBodW5rLmxpbmVzW2pdLFxuICAgICAgICAgIG9wZXJhdGlvbiA9IChsaW5lLmxlbmd0aCA+IDAgPyBsaW5lWzBdIDogJyAnKSxcbiAgICAgICAgICBjb250ZW50ID0gKGxpbmUubGVuZ3RoID4gMCA/IGxpbmUuc3Vic3RyKDEpIDogbGluZSksXG4gICAgICAgICAgZGVsaW1pdGVyID0gaHVuay5saW5lZGVsaW1pdGVyc1tqXTtcblxuICAgICAgaWYgKG9wZXJhdGlvbiA9PT0gJyAnKSB7XG4gICAgICAgIHRvUG9zKys7XG4gICAgICB9IGVsc2UgaWYgKG9wZXJhdGlvbiA9PT0gJy0nKSB7XG4gICAgICAgIGxpbmVzLnNwbGljZSh0b1BvcywgMSk7XG4gICAgICAgIGRlbGltaXRlcnMuc3BsaWNlKHRvUG9zLCAxKTtcbiAgICAgIC8qIGlzdGFuYnVsIGlnbm9yZSBlbHNlICovXG4gICAgICB9IGVsc2UgaWYgKG9wZXJhdGlvbiA9PT0gJysnKSB7XG4gICAgICAgIGxpbmVzLnNwbGljZSh0b1BvcywgMCwgY29udGVudCk7XG4gICAgICAgIGRlbGltaXRlcnMuc3BsaWNlKHRvUG9zLCAwLCBkZWxpbWl0ZXIpO1xuICAgICAgICB0b1BvcysrO1xuICAgICAgfSBlbHNlIGlmIChvcGVyYXRpb24gPT09ICdcXFxcJykge1xuICAgICAgICBsZXQgcHJldmlvdXNPcGVyYXRpb24gPSBodW5rLmxpbmVzW2ogLSAxXSA/IGh1bmsubGluZXNbaiAtIDFdWzBdIDogbnVsbDtcbiAgICAgICAgaWYgKHByZXZpb3VzT3BlcmF0aW9uID09PSAnKycpIHtcbiAgICAgICAgICByZW1vdmVFT0ZOTCA9IHRydWU7XG4gICAgICAgIH0gZWxzZSBpZiAocHJldmlvdXNPcGVyYXRpb24gPT09ICctJykge1xuICAgICAgICAgIGFkZEVPRk5MID0gdHJ1ZTtcbiAgICAgICAgfVxuICAgICAgfVxuICAgIH1cbiAgfVxuXG4gIC8vIEhhbmRsZSBFT0ZOTCBpbnNlcnRpb24vcmVtb3ZhbFxuICBpZiAocmVtb3ZlRU9GTkwpIHtcbiAgICB3aGlsZSAoIWxpbmVzW2xpbmVzLmxlbmd0aCAtIDFdKSB7XG4gICAgICBsaW5lcy5wb3AoKTtcbiAgICAgIGRlbGltaXRlcnMucG9wKCk7XG4gICAgfVxuICB9IGVsc2UgaWYgKGFkZEVPRk5MKSB7XG4gICAgbGluZXMucHVzaCgnJyk7XG4gICAgZGVsaW1pdGVycy5wdXNoKCdcXG4nKTtcbiAgfVxuICBmb3IgKGxldCBfayA9IDA7IF9rIDwgbGluZXMubGVuZ3RoIC0gMTsgX2srKykge1xuICAgIGxpbmVzW19rXSA9IGxpbmVzW19rXSArIGRlbGltaXRlcnNbX2tdO1xuICB9XG4gIHJldHVybiBsaW5lcy5qb2luKCcnKTtcbn1cblxuLy8gV3JhcHBlciB0aGF0IHN1cHBvcnRzIG11bHRpcGxlIGZpbGUgcGF0Y2hlcyB2aWEgY2FsbGJhY2tzLlxuZXhwb3J0IGZ1bmN0aW9uIGFwcGx5UGF0Y2hlcyh1bmlEaWZmLCBvcHRpb25zKSB7XG4gIGlmICh0eXBlb2YgdW5pRGlmZiA9PT0gJ3N0cmluZycpIHtcbiAgICB1bmlEaWZmID0gcGFyc2VQYXRjaCh1bmlEaWZmKTtcbiAgfVxuXG4gIGxldCBjdXJyZW50SW5kZXggPSAwO1xuICBmdW5jdGlvbiBwcm9jZXNzSW5kZXgoKSB7XG4gICAgbGV0IGluZGV4ID0gdW5pRGlmZltjdXJyZW50SW5kZXgrK107XG4gICAgaWYgKCFpbmRleCkge1xuICAgICAgcmV0dXJuIG9wdGlvbnMuY29tcGxldGUoKTtcbiAgICB9XG5cbiAgICBvcHRpb25zLmxvYWRGaWxlKGluZGV4LCBmdW5jdGlvbihlcnIsIGRhdGEpIHtcbiAgICAgIGlmIChlcnIpIHtcbiAgICAgICAgcmV0dXJuIG9wdGlvbnMuY29tcGxldGUoZXJyKTtcbiAgICAgIH1cblxuICAgICAgbGV0IHVwZGF0ZWRDb250ZW50ID0gYXBwbHlQYXRjaChkYXRhLCBpbmRleCwgb3B0aW9ucyk7XG4gICAgICBvcHRpb25zLnBhdGNoZWQoaW5kZXgsIHVwZGF0ZWRDb250ZW50LCBmdW5jdGlvbihlcnIpIHtcbiAgICAgICAgaWYgKGVycikge1xuICAgICAgICAgIHJldHVybiBvcHRpb25zLmNvbXBsZXRlKGVycik7XG4gICAgICAgIH1cblxuICAgICAgICBwcm9jZXNzSW5kZXgoKTtcbiAgICAgIH0pO1xuICAgIH0pO1xuICB9XG4gIHByb2Nlc3NJbmRleCgpO1xufVxuIl19
+
+
+/***/ }),
+/* 11 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/parsePatch = parsePatch;
+	function parsePatch(uniDiff) {
+	  /*istanbul ignore start*/var /*istanbul ignore end*/options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
+
+	  var diffstr = uniDiff.split(/\r\n|[\n\v\f\r\x85]/),
+	      delimiters = uniDiff.match(/\r\n|[\n\v\f\r\x85]/g) || [],
+	      list = [],
+	      i = 0;
+
+	  function parseIndex() {
+	    var index = {};
+	    list.push(index);
+
+	    // Parse diff metadata
+	    while (i < diffstr.length) {
+	      var line = diffstr[i];
+
+	      // File header found, end parsing diff metadata
+	      if (/^(\-\-\-|\+\+\+|@@)\s/.test(line)) {
+	        break;
+	      }
+
+	      // Diff index
+	      var header = /^(?:Index:|diff(?: -r \w+)+)\s+(.+?)\s*$/.exec(line);
+	      if (header) {
+	        index.index = header[1];
+	      }
+
+	      i++;
+	    }
+
+	    // Parse file headers if they are defined. Unified diff requires them, but
+	    // there's no technical issues to have an isolated hunk without file header
+	    parseFileHeader(index);
+	    parseFileHeader(index);
+
+	    // Parse hunks
+	    index.hunks = [];
+
+	    while (i < diffstr.length) {
+	      var _line = diffstr[i];
+
+	      if (/^(Index:|diff|\-\-\-|\+\+\+)\s/.test(_line)) {
+	        break;
+	      } else if (/^@@/.test(_line)) {
+	        index.hunks.push(parseHunk());
+	      } else if (_line && options.strict) {
+	        // Ignore unexpected content unless in strict mode
+	        throw new Error('Unknown line ' + (i + 1) + ' ' + JSON.stringify(_line));
+	      } else {
+	        i++;
+	      }
+	    }
+	  }
+
+	  // Parses the --- and +++ headers, if none are found, no lines
+	  // are consumed.
+	  function parseFileHeader(index) {
+	    var fileHeader = /^(---|\+\+\+)\s+(.*)$/.exec(diffstr[i]);
+	    if (fileHeader) {
+	      var keyPrefix = fileHeader[1] === '---' ? 'old' : 'new';
+	      var data = fileHeader[2].split('\t', 2);
+	      var fileName = data[0].replace(/\\\\/g, '\\');
+	      if (/^".*"$/.test(fileName)) {
+	        fileName = fileName.substr(1, fileName.length - 2);
+	      }
+	      index[keyPrefix + 'FileName'] = fileName;
+	      index[keyPrefix + 'Header'] = (data[1] || '').trim();
+
+	      i++;
+	    }
+	  }
+
+	  // Parses a hunk
+	  // This assumes that we are at the start of a hunk.
+	  function parseHunk() {
+	    var chunkHeaderIndex = i,
+	        chunkHeaderLine = diffstr[i++],
+	        chunkHeader = chunkHeaderLine.split(/@@ -(\d+)(?:,(\d+))? \+(\d+)(?:,(\d+))? @@/);
+
+	    var hunk = {
+	      oldStart: +chunkHeader[1],
+	      oldLines: +chunkHeader[2] || 1,
+	      newStart: +chunkHeader[3],
+	      newLines: +chunkHeader[4] || 1,
+	      lines: [],
+	      linedelimiters: []
+	    };
+
+	    var addCount = 0,
+	        removeCount = 0;
+	    for (; i < diffstr.length; i++) {
+	      // Lines starting with '---' could be mistaken for the "remove line" operation
+	      // But they could be the header for the next file. Therefore prune such cases out.
+	      if (diffstr[i].indexOf('--- ') === 0 && i + 2 < diffstr.length && diffstr[i + 1].indexOf('+++ ') === 0 && diffstr[i + 2].indexOf('@@') === 0) {
+	        break;
+	      }
+	      var operation = diffstr[i].length == 0 && i != diffstr.length - 1 ? ' ' : diffstr[i][0];
+
+	      if (operation === '+' || operation === '-' || operation === ' ' || operation === '\\') {
+	        hunk.lines.push(diffstr[i]);
+	        hunk.linedelimiters.push(delimiters[i] || '\n');
+
+	        if (operation === '+') {
+	          addCount++;
+	        } else if (operation === '-') {
+	          removeCount++;
+	        } else if (operation === ' ') {
+	          addCount++;
+	          removeCount++;
+	        }
+	      } else {
+	        break;
+	      }
+	    }
+
+	    // Handle the empty block count case
+	    if (!addCount && hunk.newLines === 1) {
+	      hunk.newLines = 0;
+	    }
+	    if (!removeCount && hunk.oldLines === 1) {
+	      hunk.oldLines = 0;
+	    }
+
+	    // Perform optional sanity checking
+	    if (options.strict) {
+	      if (addCount !== hunk.newLines) {
+	        throw new Error('Added line count did not match for hunk at line ' + (chunkHeaderIndex + 1));
+	      }
+	      if (removeCount !== hunk.oldLines) {
+	        throw new Error('Removed line count did not match for hunk at line ' + (chunkHeaderIndex + 1));
+	      }
+	    }
+
+	    return hunk;
+	  }
+
+	  while (i < diffstr.length) {
+	    parseIndex();
+	  }
+
+	  return list;
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9wYXRjaC9wYXJzZS5qcyJdLCJuYW1lcyI6WyJwYXJzZVBhdGNoIiwidW5pRGlmZiIsIm9wdGlvbnMiLCJkaWZmc3RyIiwic3BsaXQiLCJkZWxpbWl0ZXJzIiwibWF0Y2giLCJsaXN0IiwiaSIsInBhcnNlSW5kZXgiLCJpbmRleCIsInB1c2giLCJsZW5ndGgiLCJsaW5lIiwidGVzdCIsImhlYWRlciIsImV4ZWMiLCJwYXJzZUZpbGVIZWFkZXIiLCJodW5rcyIsInBhcnNlSHVuayIsInN0cmljdCIsIkVycm9yIiwiSlNPTiIsInN0cmluZ2lmeSIsImZpbGVIZWFkZXIiLCJrZXlQcmVmaXgiLCJkYXRhIiwiZmlsZU5hbWUiLCJyZXBsYWNlIiwic3Vic3RyIiwidHJpbSIsImNodW5rSGVhZGVySW5kZXgiLCJjaHVua0hlYWRlckxpbmUiLCJjaHVua0hlYWRlciIsImh1bmsiLCJvbGRTdGFydCIsIm9sZExpbmVzIiwibmV3U3RhcnQiLCJuZXdMaW5lcyIsImxpbmVzIiwibGluZWRlbGltaXRlcnMiLCJhZGRDb3VudCIsInJlbW92ZUNvdW50IiwiaW5kZXhPZiIsIm9wZXJhdGlvbiJdLCJtYXBwaW5ncyI6Ijs7O2dDQUFnQkEsVSxHQUFBQSxVO0FBQVQsU0FBU0EsVUFBVCxDQUFvQkMsT0FBcEIsRUFBMkM7QUFBQSxzREFBZEMsT0FBYyx1RUFBSixFQUFJOztBQUNoRCxNQUFJQyxVQUFVRixRQUFRRyxLQUFSLENBQWMscUJBQWQsQ0FBZDtBQUFBLE1BQ0lDLGFBQWFKLFFBQVFLLEtBQVIsQ0FBYyxzQkFBZCxLQUF5QyxFQUQxRDtBQUFBLE1BRUlDLE9BQU8sRUFGWDtBQUFBLE1BR0lDLElBQUksQ0FIUjs7QUFLQSxXQUFTQyxVQUFULEdBQXNCO0FBQ3BCLFFBQUlDLFFBQVEsRUFBWjtBQUNBSCxTQUFLSSxJQUFMLENBQVVELEtBQVY7O0FBRUE7QUFDQSxXQUFPRixJQUFJTCxRQUFRUyxNQUFuQixFQUEyQjtBQUN6QixVQUFJQyxPQUFPVixRQUFRSyxDQUFSLENBQVg7O0FBRUE7QUFDQSxVQUFJLHdCQUF3Qk0sSUFBeEIsQ0FBNkJELElBQTdCLENBQUosRUFBd0M7QUFDdEM7QUFDRDs7QUFFRDtBQUNBLFVBQUlFLFNBQVUsMENBQUQsQ0FBNkNDLElBQTdDLENBQWtESCxJQUFsRCxDQUFiO0FBQ0EsVUFBSUUsTUFBSixFQUFZO0FBQ1ZMLGNBQU1BLEtBQU4sR0FBY0ssT0FBTyxDQUFQLENBQWQ7QUFDRDs7QUFFRFA7QUFDRDs7QUFFRDtBQUNBO0FBQ0FTLG9CQUFnQlAsS0FBaEI7QUFDQU8sb0JBQWdCUCxLQUFoQjs7QUFFQTtBQUNBQSxVQUFNUSxLQUFOLEdBQWMsRUFBZDs7QUFFQSxXQUFPVixJQUFJTCxRQUFRUyxNQUFuQixFQUEyQjtBQUN6QixVQUFJQyxRQUFPVixRQUFRSyxDQUFSLENBQVg7O0FBRUEsVUFBSSxpQ0FBaUNNLElBQWpDLENBQXNDRCxLQUF0QyxDQUFKLEVBQWlEO0FBQy9DO0FBQ0QsT0FGRCxNQUVPLElBQUksTUFBTUMsSUFBTixDQUFXRCxLQUFYLENBQUosRUFBc0I7QUFDM0JILGNBQU1RLEtBQU4sQ0FBWVAsSUFBWixDQUFpQlEsV0FBakI7QUFDRCxPQUZNLE1BRUEsSUFBSU4sU0FBUVgsUUFBUWtCLE1BQXBCLEVBQTRCO0FBQ2pDO0FBQ0EsY0FBTSxJQUFJQyxLQUFKLENBQVUsbUJBQW1CYixJQUFJLENBQXZCLElBQTRCLEdBQTVCLEdBQWtDYyxLQUFLQyxTQUFMLENBQWVWLEtBQWYsQ0FBNUMsQ0FBTjtBQUNELE9BSE0sTUFHQTtBQUNMTDtBQUNEO0FBQ0Y7QUFDRjs7QUFFRDtBQUNBO0FBQ0EsV0FBU1MsZUFBVCxDQUF5QlAsS0FBekIsRUFBZ0M7QUFDOUIsUUFBTWMsYUFBYyx1QkFBRCxDQUEwQlIsSUFBMUIsQ0FBK0JiLFFBQVFLLENBQVIsQ0FBL0IsQ0FBbkI7QUFDQSxRQUFJZ0IsVUFBSixFQUFnQjtBQUNkLFVBQUlDLFlBQVlELFdBQVcsQ0FBWCxNQUFrQixLQUFsQixHQUEwQixLQUExQixHQUFrQyxLQUFsRDtBQUNBLFVBQU1FLE9BQU9GLFdBQVcsQ0FBWCxFQUFjcEIsS0FBZCxDQUFvQixJQUFwQixFQUEwQixDQUExQixDQUFiO0FBQ0EsVUFBSXVCLFdBQVdELEtBQUssQ0FBTCxFQUFRRSxPQUFSLENBQWdCLE9BQWhCLEVBQXlCLElBQXpCLENBQWY7QUFDQSxVQUFJLFNBQVNkLElBQVQsQ0FBY2EsUUFBZCxDQUFKLEVBQTZCO0FBQzNCQSxtQkFBV0EsU0FBU0UsTUFBVCxDQUFnQixDQUFoQixFQUFtQkYsU0FBU2YsTUFBVCxHQUFrQixDQUFyQyxDQUFYO0FBQ0Q7QUFDREYsWUFBTWUsWUFBWSxVQUFsQixJQUFnQ0UsUUFBaEM7QUFDQWpCLFlBQU1lLFlBQVksUUFBbEIsSUFBOEIsQ0FBQ0MsS0FBSyxDQUFMLEtBQVcsRUFBWixFQUFnQkksSUFBaEIsRUFBOUI7O0FBRUF0QjtBQUNEO0FBQ0Y7O0FBRUQ7QUFDQTtBQUNBLFdBQVNXLFNBQVQsR0FBcUI7QUFDbkIsUUFBSVksbUJBQW1CdkIsQ0FBdkI7QUFBQSxRQUNJd0Isa0JBQWtCN0IsUUFBUUssR0FBUixDQUR0QjtBQUFBLFFBRUl5QixjQUFjRCxnQkFBZ0I1QixLQUFoQixDQUFzQiw0Q0FBdEIsQ0FGbEI7O0FBSUEsUUFBSThCLE9BQU87QUFDVEMsZ0JBQVUsQ0FBQ0YsWUFBWSxDQUFaLENBREY7QUFFVEcsZ0JBQVUsQ0FBQ0gsWUFBWSxDQUFaLENBQUQsSUFBbUIsQ0FGcEI7QUFHVEksZ0JBQVUsQ0FBQ0osWUFBWSxDQUFaLENBSEY7QUFJVEssZ0JBQVUsQ0FBQ0wsWUFBWSxDQUFaLENBQUQsSUFBbUIsQ0FKcEI7QUFLVE0sYUFBTyxFQUxFO0FBTVRDLHNCQUFnQjtBQU5QLEtBQVg7O0FBU0EsUUFBSUMsV0FBVyxDQUFmO0FBQUEsUUFDSUMsY0FBYyxDQURsQjtBQUVBLFdBQU9sQyxJQUFJTCxRQUFRUyxNQUFuQixFQUEyQkosR0FBM0IsRUFBZ0M7QUFDOUI7QUFDQTtBQUNBLFVBQUlMLFFBQVFLLENBQVIsRUFBV21DLE9BQVgsQ0FBbUIsTUFBbkIsTUFBK0IsQ0FBL0IsSUFDTW5DLElBQUksQ0FBSixHQUFRTCxRQUFRUyxNQUR0QixJQUVLVCxRQUFRSyxJQUFJLENBQVosRUFBZW1DLE9BQWYsQ0FBdUIsTUFBdkIsTUFBbUMsQ0FGeEMsSUFHS3hDLFFBQVFLLElBQUksQ0FBWixFQUFlbUMsT0FBZixDQUF1QixJQUF2QixNQUFpQyxDQUgxQyxFQUc2QztBQUN6QztBQUNIO0FBQ0QsVUFBSUMsWUFBYXpDLFFBQVFLLENBQVIsRUFBV0ksTUFBWCxJQUFxQixDQUFyQixJQUEwQkosS0FBTUwsUUFBUVMsTUFBUixHQUFpQixDQUFsRCxHQUF3RCxHQUF4RCxHQUE4RFQsUUFBUUssQ0FBUixFQUFXLENBQVgsQ0FBOUU7O0FBRUEsVUFBSW9DLGNBQWMsR0FBZCxJQUFxQkEsY0FBYyxHQUFuQyxJQUEwQ0EsY0FBYyxHQUF4RCxJQUErREEsY0FBYyxJQUFqRixFQUF1RjtBQUNyRlYsYUFBS0ssS0FBTCxDQUFXNUIsSUFBWCxDQUFnQlIsUUFBUUssQ0FBUixDQUFoQjtBQUNBMEIsYUFBS00sY0FBTCxDQUFvQjdCLElBQXBCLENBQXlCTixXQUFXRyxDQUFYLEtBQWlCLElBQTFDOztBQUVBLFlBQUlvQyxjQUFjLEdBQWxCLEVBQXVCO0FBQ3JCSDtBQUNELFNBRkQsTUFFTyxJQUFJRyxjQUFjLEdBQWxCLEVBQXVCO0FBQzVCRjtBQUNELFNBRk0sTUFFQSxJQUFJRSxjQUFjLEdBQWxCLEVBQXVCO0FBQzVCSDtBQUNBQztBQUNEO0FBQ0YsT0FaRCxNQVlPO0FBQ0w7QUFDRDtBQUNGOztBQUVEO0FBQ0EsUUFBSSxDQUFDRCxRQUFELElBQWFQLEtBQUtJLFFBQUwsS0FBa0IsQ0FBbkMsRUFBc0M7QUFDcENKLFdBQUtJLFFBQUwsR0FBZ0IsQ0FBaEI7QUFDRDtBQUNELFFBQUksQ0FBQ0ksV0FBRCxJQUFnQlIsS0FBS0UsUUFBTCxLQUFrQixDQUF0QyxFQUF5QztBQUN2Q0YsV0FBS0UsUUFBTCxHQUFnQixDQUFoQjtBQUNEOztBQUVEO0FBQ0EsUUFBSWxDLFFBQVFrQixNQUFaLEVBQW9CO0FBQ2xCLFVBQUlxQixhQUFhUCxLQUFLSSxRQUF0QixFQUFnQztBQUM5QixjQUFNLElBQUlqQixLQUFKLENBQVUsc0RBQXNEVSxtQkFBbUIsQ0FBekUsQ0FBVixDQUFOO0FBQ0Q7QUFDRCxVQUFJVyxnQkFBZ0JSLEtBQUtFLFFBQXpCLEVBQW1DO0FBQ2pDLGNBQU0sSUFBSWYsS0FBSixDQUFVLHdEQUF3RFUsbUJBQW1CLENBQTNFLENBQVYsQ0FBTjtBQUNEO0FBQ0Y7O0FBRUQsV0FBT0csSUFBUDtBQUNEOztBQUVELFNBQU8xQixJQUFJTCxRQUFRUyxNQUFuQixFQUEyQjtBQUN6Qkg7QUFDRDs7QUFFRCxTQUFPRixJQUFQO0FBQ0QiLCJmaWxlIjoicGFyc2UuanMiLCJzb3VyY2VzQ29udGVudCI6WyJleHBvcnQgZnVuY3Rpb24gcGFyc2VQYXRjaCh1bmlEaWZmLCBvcHRpb25zID0ge30pIHtcbiAgbGV0IGRpZmZzdHIgPSB1bmlEaWZmLnNwbGl0KC9cXHJcXG58W1xcblxcdlxcZlxcclxceDg1XS8pLFxuICAgICAgZGVsaW1pdGVycyA9IHVuaURpZmYubWF0Y2goL1xcclxcbnxbXFxuXFx2XFxmXFxyXFx4ODVdL2cpIHx8IFtdLFxuICAgICAgbGlzdCA9IFtdLFxuICAgICAgaSA9IDA7XG5cbiAgZnVuY3Rpb24gcGFyc2VJbmRleCgpIHtcbiAgICBsZXQgaW5kZXggPSB7fTtcbiAgICBsaXN0LnB1c2goaW5kZXgpO1xuXG4gICAgLy8gUGFyc2UgZGlmZiBtZXRhZGF0YVxuICAgIHdoaWxlIChpIDwgZGlmZnN0ci5sZW5ndGgpIHtcbiAgICAgIGxldCBsaW5lID0gZGlmZnN0cltpXTtcblxuICAgICAgLy8gRmlsZSBoZWFkZXIgZm91bmQsIGVuZCBwYXJzaW5nIGRpZmYgbWV0YWRhdGFcbiAgICAgIGlmICgvXihcXC1cXC1cXC18XFwrXFwrXFwrfEBAKVxccy8udGVzdChsaW5lKSkge1xuICAgICAgICBicmVhaztcbiAgICAgIH1cblxuICAgICAgLy8gRGlmZiBpbmRleFxuICAgICAgbGV0IGhlYWRlciA9ICgvXig/OkluZGV4OnxkaWZmKD86IC1yIFxcdyspKylcXHMrKC4rPylcXHMqJC8pLmV4ZWMobGluZSk7XG4gICAgICBpZiAoaGVhZGVyKSB7XG4gICAgICAgIGluZGV4LmluZGV4ID0gaGVhZGVyWzFdO1xuICAgICAgfVxuXG4gICAgICBpKys7XG4gICAgfVxuXG4gICAgLy8gUGFyc2UgZmlsZSBoZWFkZXJzIGlmIHRoZXkgYXJlIGRlZmluZWQuIFVuaWZpZWQgZGlmZiByZXF1aXJlcyB0aGVtLCBidXRcbiAgICAvLyB0aGVyZSdzIG5vIHRlY2huaWNhbCBpc3N1ZXMgdG8gaGF2ZSBhbiBpc29sYXRlZCBodW5rIHdpdGhvdXQgZmlsZSBoZWFkZXJcbiAgICBwYXJzZUZpbGVIZWFkZXIoaW5kZXgpO1xuICAgIHBhcnNlRmlsZUhlYWRlcihpbmRleCk7XG5cbiAgICAvLyBQYXJzZSBodW5rc1xuICAgIGluZGV4Lmh1bmtzID0gW107XG5cbiAgICB3aGlsZSAoaSA8IGRpZmZzdHIubGVuZ3RoKSB7XG4gICAgICBsZXQgbGluZSA9IGRpZmZzdHJbaV07XG5cbiAgICAgIGlmICgvXihJbmRleDp8ZGlmZnxcXC1cXC1cXC18XFwrXFwrXFwrKVxccy8udGVzdChsaW5lKSkge1xuICAgICAgICBicmVhaztcbiAgICAgIH0gZWxzZSBpZiAoL15AQC8udGVzdChsaW5lKSkge1xuICAgICAgICBpbmRleC5odW5rcy5wdXNoKHBhcnNlSHVuaygpKTtcbiAgICAgIH0gZWxzZSBpZiAobGluZSAmJiBvcHRpb25zLnN0cmljdCkge1xuICAgICAgICAvLyBJZ25vcmUgdW5leHBlY3RlZCBjb250ZW50IHVubGVzcyBpbiBzdHJpY3QgbW9kZVxuICAgICAgICB0aHJvdyBuZXcgRXJyb3IoJ1Vua25vd24gbGluZSAnICsgKGkgKyAxKSArICcgJyArIEpTT04uc3RyaW5naWZ5KGxpbmUpKTtcbiAgICAgIH0gZWxzZSB7XG4gICAgICAgIGkrKztcbiAgICAgIH1cbiAgICB9XG4gIH1cblxuICAvLyBQYXJzZXMgdGhlIC0tLSBhbmQgKysrIGhlYWRlcnMsIGlmIG5vbmUgYXJlIGZvdW5kLCBubyBsaW5lc1xuICAvLyBhcmUgY29uc3VtZWQuXG4gIGZ1bmN0aW9uIHBhcnNlRmlsZUhlYWRlcihpbmRleCkge1xuICAgIGNvbnN0IGZpbGVIZWFkZXIgPSAoL14oLS0tfFxcK1xcK1xcKylcXHMrKC4qKSQvKS5leGVjKGRpZmZzdHJbaV0pO1xuICAgIGlmIChmaWxlSGVhZGVyKSB7XG4gICAgICBsZXQga2V5UHJlZml4ID0gZmlsZUhlYWRlclsxXSA9PT0gJy0tLScgPyAnb2xkJyA6ICduZXcnO1xuICAgICAgY29uc3QgZGF0YSA9IGZpbGVIZWFkZXJbMl0uc3BsaXQoJ1xcdCcsIDIpO1xuICAgICAgbGV0IGZpbGVOYW1lID0gZGF0YVswXS5yZXBsYWNlKC9cXFxcXFxcXC9nLCAnXFxcXCcpO1xuICAgICAgaWYgKC9eXCIuKlwiJC8udGVzdChmaWxlTmFtZSkpIHtcbiAgICAgICAgZmlsZU5hbWUgPSBmaWxlTmFtZS5zdWJzdHIoMSwgZmlsZU5hbWUubGVuZ3RoIC0gMik7XG4gICAgICB9XG4gICAgICBpbmRleFtrZXlQcmVmaXggKyAnRmlsZU5hbWUnXSA9IGZpbGVOYW1lO1xuICAgICAgaW5kZXhba2V5UHJlZml4ICsgJ0hlYWRlciddID0gKGRhdGFbMV0gfHwgJycpLnRyaW0oKTtcblxuICAgICAgaSsrO1xuICAgIH1cbiAgfVxuXG4gIC8vIFBhcnNlcyBhIGh1bmtcbiAgLy8gVGhpcyBhc3N1bWVzIHRoYXQgd2UgYXJlIGF0IHRoZSBzdGFydCBvZiBhIGh1bmsuXG4gIGZ1bmN0aW9uIHBhcnNlSHVuaygpIHtcbiAgICBsZXQgY2h1bmtIZWFkZXJJbmRleCA9IGksXG4gICAgICAgIGNodW5rSGVhZGVyTGluZSA9IGRpZmZzdHJbaSsrXSxcbiAgICAgICAgY2h1bmtIZWFkZXIgPSBjaHVua0hlYWRlckxpbmUuc3BsaXQoL0BAIC0oXFxkKykoPzosKFxcZCspKT8gXFwrKFxcZCspKD86LChcXGQrKSk/IEBALyk7XG5cbiAgICBsZXQgaHVuayA9IHtcbiAgICAgIG9sZFN0YXJ0OiArY2h1bmtIZWFkZXJbMV0sXG4gICAgICBvbGRMaW5lczogK2NodW5rSGVhZGVyWzJdIHx8IDEsXG4gICAgICBuZXdTdGFydDogK2NodW5rSGVhZGVyWzNdLFxuICAgICAgbmV3TGluZXM6ICtjaHVua0hlYWRlcls0XSB8fCAxLFxuICAgICAgbGluZXM6IFtdLFxuICAgICAgbGluZWRlbGltaXRlcnM6IFtdXG4gICAgfTtcblxuICAgIGxldCBhZGRDb3VudCA9IDAsXG4gICAgICAgIHJlbW92ZUNvdW50ID0gMDtcbiAgICBmb3IgKDsgaSA8IGRpZmZzdHIubGVuZ3RoOyBpKyspIHtcbiAgICAgIC8vIExpbmVzIHN0YXJ0aW5nIHdpdGggJy0tLScgY291bGQgYmUgbWlzdGFrZW4gZm9yIHRoZSBcInJlbW92ZSBsaW5lXCIgb3BlcmF0aW9uXG4gICAgICAvLyBCdXQgdGhleSBjb3VsZCBiZSB0aGUgaGVhZGVyIGZvciB0aGUgbmV4dCBmaWxlLiBUaGVyZWZvcmUgcHJ1bmUgc3VjaCBjYXNlcyBvdXQuXG4gICAgICBpZiAoZGlmZnN0cltpXS5pbmRleE9mKCctLS0gJykgPT09IDBcbiAgICAgICAgICAgICYmIChpICsgMiA8IGRpZmZzdHIubGVuZ3RoKVxuICAgICAgICAgICAgJiYgZGlmZnN0cltpICsgMV0uaW5kZXhPZignKysrICcpID09PSAwXG4gICAgICAgICAgICAmJiBkaWZmc3RyW2kgKyAyXS5pbmRleE9mKCdAQCcpID09PSAwKSB7XG4gICAgICAgICAgYnJlYWs7XG4gICAgICB9XG4gICAgICBsZXQgb3BlcmF0aW9uID0gKGRpZmZzdHJbaV0ubGVuZ3RoID09IDAgJiYgaSAhPSAoZGlmZnN0ci5sZW5ndGggLSAxKSkgPyAnICcgOiBkaWZmc3RyW2ldWzBdO1xuXG4gICAgICBpZiAob3BlcmF0aW9uID09PSAnKycgfHwgb3BlcmF0aW9uID09PSAnLScgfHwgb3BlcmF0aW9uID09PSAnICcgfHwgb3BlcmF0aW9uID09PSAnXFxcXCcpIHtcbiAgICAgICAgaHVuay5saW5lcy5wdXNoKGRpZmZzdHJbaV0pO1xuICAgICAgICBodW5rLmxpbmVkZWxpbWl0ZXJzLnB1c2goZGVsaW1pdGVyc1tpXSB8fCAnXFxuJyk7XG5cbiAgICAgICAgaWYgKG9wZXJhdGlvbiA9PT0gJysnKSB7XG4gICAgICAgICAgYWRkQ291bnQrKztcbiAgICAgICAgfSBlbHNlIGlmIChvcGVyYXRpb24gPT09ICctJykge1xuICAgICAgICAgIHJlbW92ZUNvdW50Kys7XG4gICAgICAgIH0gZWxzZSBpZiAob3BlcmF0aW9uID09PSAnICcpIHtcbiAgICAgICAgICBhZGRDb3VudCsrO1xuICAgICAgICAgIHJlbW92ZUNvdW50Kys7XG4gICAgICAgIH1cbiAgICAgIH0gZWxzZSB7XG4gICAgICAgIGJyZWFrO1xuICAgICAgfVxuICAgIH1cblxuICAgIC8vIEhhbmRsZSB0aGUgZW1wdHkgYmxvY2sgY291bnQgY2FzZVxuICAgIGlmICghYWRkQ291bnQgJiYgaHVuay5uZXdMaW5lcyA9PT0gMSkge1xuICAgICAgaHVuay5uZXdMaW5lcyA9IDA7XG4gICAgfVxuICAgIGlmICghcmVtb3ZlQ291bnQgJiYgaHVuay5vbGRMaW5lcyA9PT0gMSkge1xuICAgICAgaHVuay5vbGRMaW5lcyA9IDA7XG4gICAgfVxuXG4gICAgLy8gUGVyZm9ybSBvcHRpb25hbCBzYW5pdHkgY2hlY2tpbmdcbiAgICBpZiAob3B0aW9ucy5zdHJpY3QpIHtcbiAgICAgIGlmIChhZGRDb3VudCAhPT0gaHVuay5uZXdMaW5lcykge1xuICAgICAgICB0aHJvdyBuZXcgRXJyb3IoJ0FkZGVkIGxpbmUgY291bnQgZGlkIG5vdCBtYXRjaCBmb3IgaHVuayBhdCBsaW5lICcgKyAoY2h1bmtIZWFkZXJJbmRleCArIDEpKTtcbiAgICAgIH1cbiAgICAgIGlmIChyZW1vdmVDb3VudCAhPT0gaHVuay5vbGRMaW5lcykge1xuICAgICAgICB0aHJvdyBuZXcgRXJyb3IoJ1JlbW92ZWQgbGluZSBjb3VudCBkaWQgbm90IG1hdGNoIGZvciBodW5rIGF0IGxpbmUgJyArIChjaHVua0hlYWRlckluZGV4ICsgMSkpO1xuICAgICAgfVxuICAgIH1cblxuICAgIHJldHVybiBodW5rO1xuICB9XG5cbiAgd2hpbGUgKGkgPCBkaWZmc3RyLmxlbmd0aCkge1xuICAgIHBhcnNlSW5kZXgoKTtcbiAgfVxuXG4gIHJldHVybiBsaXN0O1xufVxuIl19
+
+
+/***/ }),
+/* 12 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/"use strict";
+
+	exports.__esModule = true;
+
+	exports["default"] = /*istanbul ignore end*/function (start, minLine, maxLine) {
+	  var wantForward = true,
+	      backwardExhausted = false,
+	      forwardExhausted = false,
+	      localOffset = 1;
+
+	  return function iterator() {
+	    if (wantForward && !forwardExhausted) {
+	      if (backwardExhausted) {
+	        localOffset++;
+	      } else {
+	        wantForward = false;
+	      }
+
+	      // Check if trying to fit beyond text length, and if not, check it fits
+	      // after offset location (or desired location on first iteration)
+	      if (start + localOffset <= maxLine) {
+	        return localOffset;
+	      }
+
+	      forwardExhausted = true;
+	    }
+
+	    if (!backwardExhausted) {
+	      if (!forwardExhausted) {
+	        wantForward = true;
+	      }
+
+	      // Check if trying to fit before text beginning, and if not, check it fits
+	      // before offset location
+	      if (minLine <= start - localOffset) {
+	        return -localOffset++;
+	      }
+
+	      backwardExhausted = true;
+	      return iterator();
+	    }
+
+	    // We tried to fit hunk before text beginning and beyond text length, then
+	    // hunk can't fit on the text. Return undefined
+	  };
+	};
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy91dGlsL2Rpc3RhbmNlLWl0ZXJhdG9yLmpzIl0sIm5hbWVzIjpbInN0YXJ0IiwibWluTGluZSIsIm1heExpbmUiLCJ3YW50Rm9yd2FyZCIsImJhY2t3YXJkRXhoYXVzdGVkIiwiZm9yd2FyZEV4aGF1c3RlZCIsImxvY2FsT2Zmc2V0IiwiaXRlcmF0b3IiXSwibWFwcGluZ3MiOiI7Ozs7NENBR2UsVUFBU0EsS0FBVCxFQUFnQkMsT0FBaEIsRUFBeUJDLE9BQXpCLEVBQWtDO0FBQy9DLE1BQUlDLGNBQWMsSUFBbEI7QUFBQSxNQUNJQyxvQkFBb0IsS0FEeEI7QUFBQSxNQUVJQyxtQkFBbUIsS0FGdkI7QUFBQSxNQUdJQyxjQUFjLENBSGxCOztBQUtBLFNBQU8sU0FBU0MsUUFBVCxHQUFvQjtBQUN6QixRQUFJSixlQUFlLENBQUNFLGdCQUFwQixFQUFzQztBQUNwQyxVQUFJRCxpQkFBSixFQUF1QjtBQUNyQkU7QUFDRCxPQUZELE1BRU87QUFDTEgsc0JBQWMsS0FBZDtBQUNEOztBQUVEO0FBQ0E7QUFDQSxVQUFJSCxRQUFRTSxXQUFSLElBQXVCSixPQUEzQixFQUFvQztBQUNsQyxlQUFPSSxXQUFQO0FBQ0Q7O0FBRURELHlCQUFtQixJQUFuQjtBQUNEOztBQUVELFFBQUksQ0FBQ0QsaUJBQUwsRUFBd0I7QUFDdEIsVUFBSSxDQUFDQyxnQkFBTCxFQUF1QjtBQUNyQkYsc0JBQWMsSUFBZDtBQUNEOztBQUVEO0FBQ0E7QUFDQSxVQUFJRixXQUFXRCxRQUFRTSxXQUF2QixFQUFvQztBQUNsQyxlQUFPLENBQUNBLGFBQVI7QUFDRDs7QUFFREYsMEJBQW9CLElBQXBCO0FBQ0EsYUFBT0csVUFBUDtBQUNEOztBQUVEO0FBQ0E7QUFDRCxHQWxDRDtBQW1DRCxDIiwiZmlsZSI6ImRpc3RhbmNlLWl0ZXJhdG9yLmpzIiwic291cmNlc0NvbnRlbnQiOlsiLy8gSXRlcmF0b3IgdGhhdCB0cmF2ZXJzZXMgaW4gdGhlIHJhbmdlIG9mIFttaW4sIG1heF0sIHN0ZXBwaW5nXG4vLyBieSBkaXN0YW5jZSBmcm9tIGEgZ2l2ZW4gc3RhcnQgcG9zaXRpb24uIEkuZS4gZm9yIFswLCA0XSwgd2l0aFxuLy8gc3RhcnQgb2YgMiwgdGhpcyB3aWxsIGl0ZXJhdGUgMiwgMywgMSwgNCwgMC5cbmV4cG9ydCBkZWZhdWx0IGZ1bmN0aW9uKHN0YXJ0LCBtaW5MaW5lLCBtYXhMaW5lKSB7XG4gIGxldCB3YW50Rm9yd2FyZCA9IHRydWUsXG4gICAgICBiYWNrd2FyZEV4aGF1c3RlZCA9IGZhbHNlLFxuICAgICAgZm9yd2FyZEV4aGF1c3RlZCA9IGZhbHNlLFxuICAgICAgbG9jYWxPZmZzZXQgPSAxO1xuXG4gIHJldHVybiBmdW5jdGlvbiBpdGVyYXRvcigpIHtcbiAgICBpZiAod2FudEZvcndhcmQgJiYgIWZvcndhcmRFeGhhdXN0ZWQpIHtcbiAgICAgIGlmIChiYWNrd2FyZEV4aGF1c3RlZCkge1xuICAgICAgICBsb2NhbE9mZnNldCsrO1xuICAgICAgfSBlbHNlIHtcbiAgICAgICAgd2FudEZvcndhcmQgPSBmYWxzZTtcbiAgICAgIH1cblxuICAgICAgLy8gQ2hlY2sgaWYgdHJ5aW5nIHRvIGZpdCBiZXlvbmQgdGV4dCBsZW5ndGgsIGFuZCBpZiBub3QsIGNoZWNrIGl0IGZpdHNcbiAgICAgIC8vIGFmdGVyIG9mZnNldCBsb2NhdGlvbiAob3IgZGVzaXJlZCBsb2NhdGlvbiBvbiBmaXJzdCBpdGVyYXRpb24pXG4gICAgICBpZiAoc3RhcnQgKyBsb2NhbE9mZnNldCA8PSBtYXhMaW5lKSB7XG4gICAgICAgIHJldHVybiBsb2NhbE9mZnNldDtcbiAgICAgIH1cblxuICAgICAgZm9yd2FyZEV4aGF1c3RlZCA9IHRydWU7XG4gICAgfVxuXG4gICAgaWYgKCFiYWNrd2FyZEV4aGF1c3RlZCkge1xuICAgICAgaWYgKCFmb3J3YXJkRXhoYXVzdGVkKSB7XG4gICAgICAgIHdhbnRGb3J3YXJkID0gdHJ1ZTtcbiAgICAgIH1cblxuICAgICAgLy8gQ2hlY2sgaWYgdHJ5aW5nIHRvIGZpdCBiZWZvcmUgdGV4dCBiZWdpbm5pbmcsIGFuZCBpZiBub3QsIGNoZWNrIGl0IGZpdHNcbiAgICAgIC8vIGJlZm9yZSBvZmZzZXQgbG9jYXRpb25cbiAgICAgIGlmIChtaW5MaW5lIDw9IHN0YXJ0IC0gbG9jYWxPZmZzZXQpIHtcbiAgICAgICAgcmV0dXJuIC1sb2NhbE9mZnNldCsrO1xuICAgICAgfVxuXG4gICAgICBiYWNrd2FyZEV4aGF1c3RlZCA9IHRydWU7XG4gICAgICByZXR1cm4gaXRlcmF0b3IoKTtcbiAgICB9XG5cbiAgICAvLyBXZSB0cmllZCB0byBmaXQgaHVuayBiZWZvcmUgdGV4dCBiZWdpbm5pbmcgYW5kIGJleW9uZCB0ZXh0IGxlbmd0aCwgdGhlblxuICAgIC8vIGh1bmsgY2FuJ3QgZml0IG9uIHRoZSB0ZXh0LiBSZXR1cm4gdW5kZWZpbmVkXG4gIH07XG59XG4iXX0=
+
+
+/***/ }),
+/* 13 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/calcLineCount = calcLineCount;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/merge = merge;
+
+	var /*istanbul ignore start*/_create = __webpack_require__(14) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_parse = __webpack_require__(11) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_array = __webpack_require__(15) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/function _toConsumableArray(arr) { if (Array.isArray(arr)) { for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) { arr2[i] = arr[i]; } return arr2; } else { return Array.from(arr); } }
+
+	/*istanbul ignore end*/function calcLineCount(hunk) {
+	  /*istanbul ignore start*/var _calcOldNewLineCount = /*istanbul ignore end*/calcOldNewLineCount(hunk.lines),
+	      oldLines = _calcOldNewLineCount.oldLines,
+	      newLines = _calcOldNewLineCount.newLines;
+
+	  if (oldLines !== undefined) {
+	    hunk.oldLines = oldLines;
+	  } else {
+	    delete hunk.oldLines;
+	  }
+
+	  if (newLines !== undefined) {
+	    hunk.newLines = newLines;
+	  } else {
+	    delete hunk.newLines;
+	  }
+	}
+
+	function merge(mine, theirs, base) {
+	  mine = loadPatch(mine, base);
+	  theirs = loadPatch(theirs, base);
+
+	  var ret = {};
+
+	  // For index we just let it pass through as it doesn't have any necessary meaning.
+	  // Leaving sanity checks on this to the API consumer that may know more about the
+	  // meaning in their own context.
+	  if (mine.index || theirs.index) {
+	    ret.index = mine.index || theirs.index;
+	  }
+
+	  if (mine.newFileName || theirs.newFileName) {
+	    if (!fileNameChanged(mine)) {
+	      // No header or no change in ours, use theirs (and ours if theirs does not exist)
+	      ret.oldFileName = theirs.oldFileName || mine.oldFileName;
+	      ret.newFileName = theirs.newFileName || mine.newFileName;
+	      ret.oldHeader = theirs.oldHeader || mine.oldHeader;
+	      ret.newHeader = theirs.newHeader || mine.newHeader;
+	    } else if (!fileNameChanged(theirs)) {
+	      // No header or no change in theirs, use ours
+	      ret.oldFileName = mine.oldFileName;
+	      ret.newFileName = mine.newFileName;
+	      ret.oldHeader = mine.oldHeader;
+	      ret.newHeader = mine.newHeader;
+	    } else {
+	      // Both changed... figure it out
+	      ret.oldFileName = selectField(ret, mine.oldFileName, theirs.oldFileName);
+	      ret.newFileName = selectField(ret, mine.newFileName, theirs.newFileName);
+	      ret.oldHeader = selectField(ret, mine.oldHeader, theirs.oldHeader);
+	      ret.newHeader = selectField(ret, mine.newHeader, theirs.newHeader);
+	    }
+	  }
+
+	  ret.hunks = [];
+
+	  var mineIndex = 0,
+	      theirsIndex = 0,
+	      mineOffset = 0,
+	      theirsOffset = 0;
+
+	  while (mineIndex < mine.hunks.length || theirsIndex < theirs.hunks.length) {
+	    var mineCurrent = mine.hunks[mineIndex] || { oldStart: Infinity },
+	        theirsCurrent = theirs.hunks[theirsIndex] || { oldStart: Infinity };
+
+	    if (hunkBefore(mineCurrent, theirsCurrent)) {
+	      // This patch does not overlap with any of the others, yay.
+	      ret.hunks.push(cloneHunk(mineCurrent, mineOffset));
+	      mineIndex++;
+	      theirsOffset += mineCurrent.newLines - mineCurrent.oldLines;
+	    } else if (hunkBefore(theirsCurrent, mineCurrent)) {
+	      // This patch does not overlap with any of the others, yay.
+	      ret.hunks.push(cloneHunk(theirsCurrent, theirsOffset));
+	      theirsIndex++;
+	      mineOffset += theirsCurrent.newLines - theirsCurrent.oldLines;
+	    } else {
+	      // Overlap, merge as best we can
+	      var mergedHunk = {
+	        oldStart: Math.min(mineCurrent.oldStart, theirsCurrent.oldStart),
+	        oldLines: 0,
+	        newStart: Math.min(mineCurrent.newStart + mineOffset, theirsCurrent.oldStart + theirsOffset),
+	        newLines: 0,
+	        lines: []
+	      };
+	      mergeLines(mergedHunk, mineCurrent.oldStart, mineCurrent.lines, theirsCurrent.oldStart, theirsCurrent.lines);
+	      theirsIndex++;
+	      mineIndex++;
+
+	      ret.hunks.push(mergedHunk);
+	    }
+	  }
+
+	  return ret;
+	}
+
+	function loadPatch(param, base) {
+	  if (typeof param === 'string') {
+	    if (/^@@/m.test(param) || /^Index:/m.test(param)) {
+	      return (/*istanbul ignore start*/(0, _parse.parsePatch) /*istanbul ignore end*/(param)[0]
+	      );
+	    }
+
+	    if (!base) {
+	      throw new Error('Must provide a base reference or pass in a patch');
+	    }
+	    return (/*istanbul ignore start*/(0, _create.structuredPatch) /*istanbul ignore end*/(undefined, undefined, base, param)
+	    );
+	  }
+
+	  return param;
+	}
+
+	function fileNameChanged(patch) {
+	  return patch.newFileName && patch.newFileName !== patch.oldFileName;
+	}
+
+	function selectField(index, mine, theirs) {
+	  if (mine === theirs) {
+	    return mine;
+	  } else {
+	    index.conflict = true;
+	    return { mine: mine, theirs: theirs };
+	  }
+	}
+
+	function hunkBefore(test, check) {
+	  return test.oldStart < check.oldStart && test.oldStart + test.oldLines < check.oldStart;
+	}
+
+	function cloneHunk(hunk, offset) {
+	  return {
+	    oldStart: hunk.oldStart, oldLines: hunk.oldLines,
+	    newStart: hunk.newStart + offset, newLines: hunk.newLines,
+	    lines: hunk.lines
+	  };
+	}
+
+	function mergeLines(hunk, mineOffset, mineLines, theirOffset, theirLines) {
+	  // This will generally result in a conflicted hunk, but there are cases where the context
+	  // is the only overlap where we can successfully merge the content here.
+	  var mine = { offset: mineOffset, lines: mineLines, index: 0 },
+	      their = { offset: theirOffset, lines: theirLines, index: 0 };
+
+	  // Handle any leading content
+	  insertLeading(hunk, mine, their);
+	  insertLeading(hunk, their, mine);
+
+	  // Now in the overlap content. Scan through and select the best changes from each.
+	  while (mine.index < mine.lines.length && their.index < their.lines.length) {
+	    var mineCurrent = mine.lines[mine.index],
+	        theirCurrent = their.lines[their.index];
+
+	    if ((mineCurrent[0] === '-' || mineCurrent[0] === '+') && (theirCurrent[0] === '-' || theirCurrent[0] === '+')) {
+	      // Both modified ...
+	      mutualChange(hunk, mine, their);
+	    } else if (mineCurrent[0] === '+' && theirCurrent[0] === ' ') {
+	      /*istanbul ignore start*/var _hunk$lines;
+
+	      /*istanbul ignore end*/ // Mine inserted
+	      /*istanbul ignore start*/(_hunk$lines = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/collectChange(mine)));
+	    } else if (theirCurrent[0] === '+' && mineCurrent[0] === ' ') {
+	      /*istanbul ignore start*/var _hunk$lines2;
+
+	      /*istanbul ignore end*/ // Theirs inserted
+	      /*istanbul ignore start*/(_hunk$lines2 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines2 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/collectChange(their)));
+	    } else if (mineCurrent[0] === '-' && theirCurrent[0] === ' ') {
+	      // Mine removed or edited
+	      removal(hunk, mine, their);
+	    } else if (theirCurrent[0] === '-' && mineCurrent[0] === ' ') {
+	      // Their removed or edited
+	      removal(hunk, their, mine, true);
+	    } else if (mineCurrent === theirCurrent) {
+	      // Context identity
+	      hunk.lines.push(mineCurrent);
+	      mine.index++;
+	      their.index++;
+	    } else {
+	      // Context mismatch
+	      conflict(hunk, collectChange(mine), collectChange(their));
+	    }
+	  }
+
+	  // Now push anything that may be remaining
+	  insertTrailing(hunk, mine);
+	  insertTrailing(hunk, their);
+
+	  calcLineCount(hunk);
+	}
+
+	function mutualChange(hunk, mine, their) {
+	  var myChanges = collectChange(mine),
+	      theirChanges = collectChange(their);
+
+	  if (allRemoves(myChanges) && allRemoves(theirChanges)) {
+	    // Special case for remove changes that are supersets of one another
+	    if ( /*istanbul ignore start*/(0, _array.arrayStartsWith) /*istanbul ignore end*/(myChanges, theirChanges) && skipRemoveSuperset(their, myChanges, myChanges.length - theirChanges.length)) {
+	      /*istanbul ignore start*/var _hunk$lines3;
+
+	      /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines3 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines3 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/myChanges));
+	      return;
+	    } else if ( /*istanbul ignore start*/(0, _array.arrayStartsWith) /*istanbul ignore end*/(theirChanges, myChanges) && skipRemoveSuperset(mine, theirChanges, theirChanges.length - myChanges.length)) {
+	      /*istanbul ignore start*/var _hunk$lines4;
+
+	      /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines4 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines4 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/theirChanges));
+	      return;
+	    }
+	  } else if ( /*istanbul ignore start*/(0, _array.arrayEqual) /*istanbul ignore end*/(myChanges, theirChanges)) {
+	    /*istanbul ignore start*/var _hunk$lines5;
+
+	    /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines5 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines5 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/myChanges));
+	    return;
+	  }
+
+	  conflict(hunk, myChanges, theirChanges);
+	}
+
+	function removal(hunk, mine, their, swap) {
+	  var myChanges = collectChange(mine),
+	      theirChanges = collectContext(their, myChanges);
+	  if (theirChanges.merged) {
+	    /*istanbul ignore start*/var _hunk$lines6;
+
+	    /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines6 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines6 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/theirChanges.merged));
+	  } else {
+	    conflict(hunk, swap ? theirChanges : myChanges, swap ? myChanges : theirChanges);
+	  }
+	}
+
+	function conflict(hunk, mine, their) {
+	  hunk.conflict = true;
+	  hunk.lines.push({
+	    conflict: true,
+	    mine: mine,
+	    theirs: their
+	  });
+	}
+
+	function insertLeading(hunk, insert, their) {
+	  while (insert.offset < their.offset && insert.index < insert.lines.length) {
+	    var line = insert.lines[insert.index++];
+	    hunk.lines.push(line);
+	    insert.offset++;
+	  }
+	}
+	function insertTrailing(hunk, insert) {
+	  while (insert.index < insert.lines.length) {
+	    var line = insert.lines[insert.index++];
+	    hunk.lines.push(line);
+	  }
+	}
+
+	function collectChange(state) {
+	  var ret = [],
+	      operation = state.lines[state.index][0];
+	  while (state.index < state.lines.length) {
+	    var line = state.lines[state.index];
+
+	    // Group additions that are immediately after subtractions and treat them as one "atomic" modify change.
+	    if (operation === '-' && line[0] === '+') {
+	      operation = '+';
+	    }
+
+	    if (operation === line[0]) {
+	      ret.push(line);
+	      state.index++;
+	    } else {
+	      break;
+	    }
+	  }
+
+	  return ret;
+	}
+	function collectContext(state, matchChanges) {
+	  var changes = [],
+	      merged = [],
+	      matchIndex = 0,
+	      contextChanges = false,
+	      conflicted = false;
+	  while (matchIndex < matchChanges.length && state.index < state.lines.length) {
+	    var change = state.lines[state.index],
+	        match = matchChanges[matchIndex];
+
+	    // Once we've hit our add, then we are done
+	    if (match[0] === '+') {
+	      break;
+	    }
+
+	    contextChanges = contextChanges || change[0] !== ' ';
+
+	    merged.push(match);
+	    matchIndex++;
+
+	    // Consume any additions in the other block as a conflict to attempt
+	    // to pull in the remaining context after this
+	    if (change[0] === '+') {
+	      conflicted = true;
+
+	      while (change[0] === '+') {
+	        changes.push(change);
+	        change = state.lines[++state.index];
+	      }
+	    }
+
+	    if (match.substr(1) === change.substr(1)) {
+	      changes.push(change);
+	      state.index++;
+	    } else {
+	      conflicted = true;
+	    }
+	  }
+
+	  if ((matchChanges[matchIndex] || '')[0] === '+' && contextChanges) {
+	    conflicted = true;
+	  }
+
+	  if (conflicted) {
+	    return changes;
+	  }
+
+	  while (matchIndex < matchChanges.length) {
+	    merged.push(matchChanges[matchIndex++]);
+	  }
+
+	  return {
+	    merged: merged,
+	    changes: changes
+	  };
+	}
+
+	function allRemoves(changes) {
+	  return changes.reduce(function (prev, change) {
+	    return prev && change[0] === '-';
+	  }, true);
+	}
+	function skipRemoveSuperset(state, removeChanges, delta) {
+	  for (var i = 0; i < delta; i++) {
+	    var changeContent = removeChanges[removeChanges.length - delta + i].substr(1);
+	    if (state.lines[state.index + i] !== ' ' + changeContent) {
+	      return false;
+	    }
+	  }
+
+	  state.index += delta;
+	  return true;
+	}
+
+	function calcOldNewLineCount(lines) {
+	  var oldLines = 0;
+	  var newLines = 0;
+
+	  lines.forEach(function (line) {
+	    if (typeof line !== 'string') {
+	      var myCount = calcOldNewLineCount(line.mine);
+	      var theirCount = calcOldNewLineCount(line.theirs);
+
+	      if (oldLines !== undefined) {
+	        if (myCount.oldLines === theirCount.oldLines) {
+	          oldLines += myCount.oldLines;
+	        } else {
+	          oldLines = undefined;
+	        }
+	      }
+
+	      if (newLines !== undefined) {
+	        if (myCount.newLines === theirCount.newLines) {
+	          newLines += myCount.newLines;
+	        } else {
+	          newLines = undefined;
+	        }
+	      }
+	    } else {
+	      if (newLines !== undefined && (line[0] === '+' || line[0] === ' ')) {
+	        newLines++;
+	      }
+	      if (oldLines !== undefined && (line[0] === '-' || line[0] === ' ')) {
+	        oldLines++;
+	      }
+	    }
+	  });
+
+	  return { oldLines: oldLines, newLines: newLines };
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9wYXRjaC9tZXJnZS5qcyJdLCJuYW1lcyI6WyJjYWxjTGluZUNvdW50IiwibWVyZ2UiLCJodW5rIiwiY2FsY09sZE5ld0xpbmVDb3VudCIsImxpbmVzIiwib2xkTGluZXMiLCJuZXdMaW5lcyIsInVuZGVmaW5lZCIsIm1pbmUiLCJ0aGVpcnMiLCJiYXNlIiwibG9hZFBhdGNoIiwicmV0IiwiaW5kZXgiLCJuZXdGaWxlTmFtZSIsImZpbGVOYW1lQ2hhbmdlZCIsIm9sZEZpbGVOYW1lIiwib2xkSGVhZGVyIiwibmV3SGVhZGVyIiwic2VsZWN0RmllbGQiLCJodW5rcyIsIm1pbmVJbmRleCIsInRoZWlyc0luZGV4IiwibWluZU9mZnNldCIsInRoZWlyc09mZnNldCIsImxlbmd0aCIsIm1pbmVDdXJyZW50Iiwib2xkU3RhcnQiLCJJbmZpbml0eSIsInRoZWlyc0N1cnJlbnQiLCJodW5rQmVmb3JlIiwicHVzaCIsImNsb25lSHVuayIsIm1lcmdlZEh1bmsiLCJNYXRoIiwibWluIiwibmV3U3RhcnQiLCJtZXJnZUxpbmVzIiwicGFyYW0iLCJ0ZXN0IiwiRXJyb3IiLCJwYXRjaCIsImNvbmZsaWN0IiwiY2hlY2siLCJvZmZzZXQiLCJtaW5lTGluZXMiLCJ0aGVpck9mZnNldCIsInRoZWlyTGluZXMiLCJ0aGVpciIsImluc2VydExlYWRpbmciLCJ0aGVpckN1cnJlbnQiLCJtdXR1YWxDaGFuZ2UiLCJjb2xsZWN0Q2hhbmdlIiwicmVtb3ZhbCIsImluc2VydFRyYWlsaW5nIiwibXlDaGFuZ2VzIiwidGhlaXJDaGFuZ2VzIiwiYWxsUmVtb3ZlcyIsInNraXBSZW1vdmVTdXBlcnNldCIsInN3YXAiLCJjb2xsZWN0Q29udGV4dCIsIm1lcmdlZCIsImluc2VydCIsImxpbmUiLCJzdGF0ZSIsIm9wZXJhdGlvbiIsIm1hdGNoQ2hhbmdlcyIsImNoYW5nZXMiLCJtYXRjaEluZGV4IiwiY29udGV4dENoYW5nZXMiLCJjb25mbGljdGVkIiwiY2hhbmdlIiwibWF0Y2giLCJzdWJzdHIiLCJyZWR1Y2UiLCJwcmV2IiwicmVtb3ZlQ2hhbmdlcyIsImRlbHRhIiwiaSIsImNoYW5nZUNvbnRlbnQiLCJmb3JFYWNoIiwibXlDb3VudCIsInRoZWlyQ291bnQiXSwibWFwcGluZ3MiOiI7OztnQ0FLZ0JBLGEsR0FBQUEsYTt5REFnQkFDLEssR0FBQUEsSzs7QUFyQmhCOztBQUNBOztBQUVBOzs7O3VCQUVPLFNBQVNELGFBQVQsQ0FBdUJFLElBQXZCLEVBQTZCO0FBQUEsNkVBQ0xDLG9CQUFvQkQsS0FBS0UsS0FBekIsQ0FESztBQUFBLE1BQzNCQyxRQUQyQix3QkFDM0JBLFFBRDJCO0FBQUEsTUFDakJDLFFBRGlCLHdCQUNqQkEsUUFEaUI7O0FBR2xDLE1BQUlELGFBQWFFLFNBQWpCLEVBQTRCO0FBQzFCTCxTQUFLRyxRQUFMLEdBQWdCQSxRQUFoQjtBQUNELEdBRkQsTUFFTztBQUNMLFdBQU9ILEtBQUtHLFFBQVo7QUFDRDs7QUFFRCxNQUFJQyxhQUFhQyxTQUFqQixFQUE0QjtBQUMxQkwsU0FBS0ksUUFBTCxHQUFnQkEsUUFBaEI7QUFDRCxHQUZELE1BRU87QUFDTCxXQUFPSixLQUFLSSxRQUFaO0FBQ0Q7QUFDRjs7QUFFTSxTQUFTTCxLQUFULENBQWVPLElBQWYsRUFBcUJDLE1BQXJCLEVBQTZCQyxJQUE3QixFQUFtQztBQUN4Q0YsU0FBT0csVUFBVUgsSUFBVixFQUFnQkUsSUFBaEIsQ0FBUDtBQUNBRCxXQUFTRSxVQUFVRixNQUFWLEVBQWtCQyxJQUFsQixDQUFUOztBQUVBLE1BQUlFLE1BQU0sRUFBVjs7QUFFQTtBQUNBO0FBQ0E7QUFDQSxNQUFJSixLQUFLSyxLQUFMLElBQWNKLE9BQU9JLEtBQXpCLEVBQWdDO0FBQzlCRCxRQUFJQyxLQUFKLEdBQVlMLEtBQUtLLEtBQUwsSUFBY0osT0FBT0ksS0FBakM7QUFDRDs7QUFFRCxNQUFJTCxLQUFLTSxXQUFMLElBQW9CTCxPQUFPSyxXQUEvQixFQUE0QztBQUMxQyxRQUFJLENBQUNDLGdCQUFnQlAsSUFBaEIsQ0FBTCxFQUE0QjtBQUMxQjtBQUNBSSxVQUFJSSxXQUFKLEdBQWtCUCxPQUFPTyxXQUFQLElBQXNCUixLQUFLUSxXQUE3QztBQUNBSixVQUFJRSxXQUFKLEdBQWtCTCxPQUFPSyxXQUFQLElBQXNCTixLQUFLTSxXQUE3QztBQUNBRixVQUFJSyxTQUFKLEdBQWdCUixPQUFPUSxTQUFQLElBQW9CVCxLQUFLUyxTQUF6QztBQUNBTCxVQUFJTSxTQUFKLEdBQWdCVCxPQUFPUyxTQUFQLElBQW9CVixLQUFLVSxTQUF6QztBQUNELEtBTkQsTUFNTyxJQUFJLENBQUNILGdCQUFnQk4sTUFBaEIsQ0FBTCxFQUE4QjtBQUNuQztBQUNBRyxVQUFJSSxXQUFKLEdBQWtCUixLQUFLUSxXQUF2QjtBQUNBSixVQUFJRSxXQUFKLEdBQWtCTixLQUFLTSxXQUF2QjtBQUNBRixVQUFJSyxTQUFKLEdBQWdCVCxLQUFLUyxTQUFyQjtBQUNBTCxVQUFJTSxTQUFKLEdBQWdCVixLQUFLVSxTQUFyQjtBQUNELEtBTk0sTUFNQTtBQUNMO0FBQ0FOLFVBQUlJLFdBQUosR0FBa0JHLFlBQVlQLEdBQVosRUFBaUJKLEtBQUtRLFdBQXRCLEVBQW1DUCxPQUFPTyxXQUExQyxDQUFsQjtBQUNBSixVQUFJRSxXQUFKLEdBQWtCSyxZQUFZUCxHQUFaLEVBQWlCSixLQUFLTSxXQUF0QixFQUFtQ0wsT0FBT0ssV0FBMUMsQ0FBbEI7QUFDQUYsVUFBSUssU0FBSixHQUFnQkUsWUFBWVAsR0FBWixFQUFpQkosS0FBS1MsU0FBdEIsRUFBaUNSLE9BQU9RLFNBQXhDLENBQWhCO0FBQ0FMLFVBQUlNLFNBQUosR0FBZ0JDLFlBQVlQLEdBQVosRUFBaUJKLEtBQUtVLFNBQXRCLEVBQWlDVCxPQUFPUyxTQUF4QyxDQUFoQjtBQUNEO0FBQ0Y7O0FBRUROLE1BQUlRLEtBQUosR0FBWSxFQUFaOztBQUVBLE1BQUlDLFlBQVksQ0FBaEI7QUFBQSxNQUNJQyxjQUFjLENBRGxCO0FBQUEsTUFFSUMsYUFBYSxDQUZqQjtBQUFBLE1BR0lDLGVBQWUsQ0FIbkI7O0FBS0EsU0FBT0gsWUFBWWIsS0FBS1ksS0FBTCxDQUFXSyxNQUF2QixJQUFpQ0gsY0FBY2IsT0FBT1csS0FBUCxDQUFhSyxNQUFuRSxFQUEyRTtBQUN6RSxRQUFJQyxjQUFjbEIsS0FBS1ksS0FBTCxDQUFXQyxTQUFYLEtBQXlCLEVBQUNNLFVBQVVDLFFBQVgsRUFBM0M7QUFBQSxRQUNJQyxnQkFBZ0JwQixPQUFPVyxLQUFQLENBQWFFLFdBQWIsS0FBNkIsRUFBQ0ssVUFBVUMsUUFBWCxFQURqRDs7QUFHQSxRQUFJRSxXQUFXSixXQUFYLEVBQXdCRyxhQUF4QixDQUFKLEVBQTRDO0FBQzFDO0FBQ0FqQixVQUFJUSxLQUFKLENBQVVXLElBQVYsQ0FBZUMsVUFBVU4sV0FBVixFQUF1QkgsVUFBdkIsQ0FBZjtBQUNBRjtBQUNBRyxzQkFBZ0JFLFlBQVlwQixRQUFaLEdBQXVCb0IsWUFBWXJCLFFBQW5EO0FBQ0QsS0FMRCxNQUtPLElBQUl5QixXQUFXRCxhQUFYLEVBQTBCSCxXQUExQixDQUFKLEVBQTRDO0FBQ2pEO0FBQ0FkLFVBQUlRLEtBQUosQ0FBVVcsSUFBVixDQUFlQyxVQUFVSCxhQUFWLEVBQXlCTCxZQUF6QixDQUFmO0FBQ0FGO0FBQ0FDLG9CQUFjTSxjQUFjdkIsUUFBZCxHQUF5QnVCLGNBQWN4QixRQUFyRDtBQUNELEtBTE0sTUFLQTtBQUNMO0FBQ0EsVUFBSTRCLGFBQWE7QUFDZk4sa0JBQVVPLEtBQUtDLEdBQUwsQ0FBU1QsWUFBWUMsUUFBckIsRUFBK0JFLGNBQWNGLFFBQTdDLENBREs7QUFFZnRCLGtCQUFVLENBRks7QUFHZitCLGtCQUFVRixLQUFLQyxHQUFMLENBQVNULFlBQVlVLFFBQVosR0FBdUJiLFVBQWhDLEVBQTRDTSxjQUFjRixRQUFkLEdBQXlCSCxZQUFyRSxDQUhLO0FBSWZsQixrQkFBVSxDQUpLO0FBS2ZGLGVBQU87QUFMUSxPQUFqQjtBQU9BaUMsaUJBQVdKLFVBQVgsRUFBdUJQLFlBQVlDLFFBQW5DLEVBQTZDRCxZQUFZdEIsS0FBekQsRUFBZ0V5QixjQUFjRixRQUE5RSxFQUF3RkUsY0FBY3pCLEtBQXRHO0FBQ0FrQjtBQUNBRDs7QUFFQVQsVUFBSVEsS0FBSixDQUFVVyxJQUFWLENBQWVFLFVBQWY7QUFDRDtBQUNGOztBQUVELFNBQU9yQixHQUFQO0FBQ0Q7O0FBRUQsU0FBU0QsU0FBVCxDQUFtQjJCLEtBQW5CLEVBQTBCNUIsSUFBMUIsRUFBZ0M7QUFDOUIsTUFBSSxPQUFPNEIsS0FBUCxLQUFpQixRQUFyQixFQUErQjtBQUM3QixRQUFJLE9BQU9DLElBQVAsQ0FBWUQsS0FBWixLQUF1QixXQUFXQyxJQUFYLENBQWdCRCxLQUFoQixDQUEzQixFQUFvRDtBQUNsRCxhQUFPLHlFQUFXQSxLQUFYLEVBQWtCLENBQWxCO0FBQVA7QUFDRDs7QUFFRCxRQUFJLENBQUM1QixJQUFMLEVBQVc7QUFDVCxZQUFNLElBQUk4QixLQUFKLENBQVUsa0RBQVYsQ0FBTjtBQUNEO0FBQ0QsV0FBTywrRUFBZ0JqQyxTQUFoQixFQUEyQkEsU0FBM0IsRUFBc0NHLElBQXRDLEVBQTRDNEIsS0FBNUM7QUFBUDtBQUNEOztBQUVELFNBQU9BLEtBQVA7QUFDRDs7QUFFRCxTQUFTdkIsZUFBVCxDQUF5QjBCLEtBQXpCLEVBQWdDO0FBQzlCLFNBQU9BLE1BQU0zQixXQUFOLElBQXFCMkIsTUFBTTNCLFdBQU4sS0FBc0IyQixNQUFNekIsV0FBeEQ7QUFDRDs7QUFFRCxTQUFTRyxXQUFULENBQXFCTixLQUFyQixFQUE0QkwsSUFBNUIsRUFBa0NDLE1BQWxDLEVBQTBDO0FBQ3hDLE1BQUlELFNBQVNDLE1BQWIsRUFBcUI7QUFDbkIsV0FBT0QsSUFBUDtBQUNELEdBRkQsTUFFTztBQUNMSyxVQUFNNkIsUUFBTixHQUFpQixJQUFqQjtBQUNBLFdBQU8sRUFBQ2xDLFVBQUQsRUFBT0MsY0FBUCxFQUFQO0FBQ0Q7QUFDRjs7QUFFRCxTQUFTcUIsVUFBVCxDQUFvQlMsSUFBcEIsRUFBMEJJLEtBQTFCLEVBQWlDO0FBQy9CLFNBQU9KLEtBQUtaLFFBQUwsR0FBZ0JnQixNQUFNaEIsUUFBdEIsSUFDRFksS0FBS1osUUFBTCxHQUFnQlksS0FBS2xDLFFBQXRCLEdBQWtDc0MsTUFBTWhCLFFBRDdDO0FBRUQ7O0FBRUQsU0FBU0ssU0FBVCxDQUFtQjlCLElBQW5CLEVBQXlCMEMsTUFBekIsRUFBaUM7QUFDL0IsU0FBTztBQUNMakIsY0FBVXpCLEtBQUt5QixRQURWLEVBQ29CdEIsVUFBVUgsS0FBS0csUUFEbkM7QUFFTCtCLGNBQVVsQyxLQUFLa0MsUUFBTCxHQUFnQlEsTUFGckIsRUFFNkJ0QyxVQUFVSixLQUFLSSxRQUY1QztBQUdMRixXQUFPRixLQUFLRTtBQUhQLEdBQVA7QUFLRDs7QUFFRCxTQUFTaUMsVUFBVCxDQUFvQm5DLElBQXBCLEVBQTBCcUIsVUFBMUIsRUFBc0NzQixTQUF0QyxFQUFpREMsV0FBakQsRUFBOERDLFVBQTlELEVBQTBFO0FBQ3hFO0FBQ0E7QUFDQSxNQUFJdkMsT0FBTyxFQUFDb0MsUUFBUXJCLFVBQVQsRUFBcUJuQixPQUFPeUMsU0FBNUIsRUFBdUNoQyxPQUFPLENBQTlDLEVBQVg7QUFBQSxNQUNJbUMsUUFBUSxFQUFDSixRQUFRRSxXQUFULEVBQXNCMUMsT0FBTzJDLFVBQTdCLEVBQXlDbEMsT0FBTyxDQUFoRCxFQURaOztBQUdBO0FBQ0FvQyxnQkFBYy9DLElBQWQsRUFBb0JNLElBQXBCLEVBQTBCd0MsS0FBMUI7QUFDQUMsZ0JBQWMvQyxJQUFkLEVBQW9COEMsS0FBcEIsRUFBMkJ4QyxJQUEzQjs7QUFFQTtBQUNBLFNBQU9BLEtBQUtLLEtBQUwsR0FBYUwsS0FBS0osS0FBTCxDQUFXcUIsTUFBeEIsSUFBa0N1QixNQUFNbkMsS0FBTixHQUFjbUMsTUFBTTVDLEtBQU4sQ0FBWXFCLE1BQW5FLEVBQTJFO0FBQ3pFLFFBQUlDLGNBQWNsQixLQUFLSixLQUFMLENBQVdJLEtBQUtLLEtBQWhCLENBQWxCO0FBQUEsUUFDSXFDLGVBQWVGLE1BQU01QyxLQUFOLENBQVk0QyxNQUFNbkMsS0FBbEIsQ0FEbkI7O0FBR0EsUUFBSSxDQUFDYSxZQUFZLENBQVosTUFBbUIsR0FBbkIsSUFBMEJBLFlBQVksQ0FBWixNQUFtQixHQUE5QyxNQUNJd0IsYUFBYSxDQUFiLE1BQW9CLEdBQXBCLElBQTJCQSxhQUFhLENBQWIsTUFBb0IsR0FEbkQsQ0FBSixFQUM2RDtBQUMzRDtBQUNBQyxtQkFBYWpELElBQWIsRUFBbUJNLElBQW5CLEVBQXlCd0MsS0FBekI7QUFDRCxLQUpELE1BSU8sSUFBSXRCLFlBQVksQ0FBWixNQUFtQixHQUFuQixJQUEwQndCLGFBQWEsQ0FBYixNQUFvQixHQUFsRCxFQUF1RDtBQUFBOztBQUFBLDhCQUM1RDtBQUNBLDBFQUFLOUMsS0FBTCxFQUFXMkIsSUFBWCw0TEFBb0JxQixjQUFjNUMsSUFBZCxDQUFwQjtBQUNELEtBSE0sTUFHQSxJQUFJMEMsYUFBYSxDQUFiLE1BQW9CLEdBQXBCLElBQTJCeEIsWUFBWSxDQUFaLE1BQW1CLEdBQWxELEVBQXVEO0FBQUE7O0FBQUEsOEJBQzVEO0FBQ0EsMkVBQUt0QixLQUFMLEVBQVcyQixJQUFYLDZMQUFvQnFCLGNBQWNKLEtBQWQsQ0FBcEI7QUFDRCxLQUhNLE1BR0EsSUFBSXRCLFlBQVksQ0FBWixNQUFtQixHQUFuQixJQUEwQndCLGFBQWEsQ0FBYixNQUFvQixHQUFsRCxFQUF1RDtBQUM1RDtBQUNBRyxjQUFRbkQsSUFBUixFQUFjTSxJQUFkLEVBQW9Cd0MsS0FBcEI7QUFDRCxLQUhNLE1BR0EsSUFBSUUsYUFBYSxDQUFiLE1BQW9CLEdBQXBCLElBQTJCeEIsWUFBWSxDQUFaLE1BQW1CLEdBQWxELEVBQXVEO0FBQzVEO0FBQ0EyQixjQUFRbkQsSUFBUixFQUFjOEMsS0FBZCxFQUFxQnhDLElBQXJCLEVBQTJCLElBQTNCO0FBQ0QsS0FITSxNQUdBLElBQUlrQixnQkFBZ0J3QixZQUFwQixFQUFrQztBQUN2QztBQUNBaEQsV0FBS0UsS0FBTCxDQUFXMkIsSUFBWCxDQUFnQkwsV0FBaEI7QUFDQWxCLFdBQUtLLEtBQUw7QUFDQW1DLFlBQU1uQyxLQUFOO0FBQ0QsS0FMTSxNQUtBO0FBQ0w7QUFDQTZCLGVBQVN4QyxJQUFULEVBQWVrRCxjQUFjNUMsSUFBZCxDQUFmLEVBQW9DNEMsY0FBY0osS0FBZCxDQUFwQztBQUNEO0FBQ0Y7O0FBRUQ7QUFDQU0saUJBQWVwRCxJQUFmLEVBQXFCTSxJQUFyQjtBQUNBOEMsaUJBQWVwRCxJQUFmLEVBQXFCOEMsS0FBckI7O0FBRUFoRCxnQkFBY0UsSUFBZDtBQUNEOztBQUVELFNBQVNpRCxZQUFULENBQXNCakQsSUFBdEIsRUFBNEJNLElBQTVCLEVBQWtDd0MsS0FBbEMsRUFBeUM7QUFDdkMsTUFBSU8sWUFBWUgsY0FBYzVDLElBQWQsQ0FBaEI7QUFBQSxNQUNJZ0QsZUFBZUosY0FBY0osS0FBZCxDQURuQjs7QUFHQSxNQUFJUyxXQUFXRixTQUFYLEtBQXlCRSxXQUFXRCxZQUFYLENBQTdCLEVBQXVEO0FBQ3JEO0FBQ0EsUUFBSSw4RUFBZ0JELFNBQWhCLEVBQTJCQyxZQUEzQixLQUNHRSxtQkFBbUJWLEtBQW5CLEVBQTBCTyxTQUExQixFQUFxQ0EsVUFBVTlCLE1BQVYsR0FBbUIrQixhQUFhL0IsTUFBckUsQ0FEUCxFQUNxRjtBQUFBOztBQUFBLDZCQUNuRixzRUFBS3JCLEtBQUwsRUFBVzJCLElBQVgsNkxBQW9Cd0IsU0FBcEI7QUFDQTtBQUNELEtBSkQsTUFJTyxJQUFJLDhFQUFnQkMsWUFBaEIsRUFBOEJELFNBQTlCLEtBQ0pHLG1CQUFtQmxELElBQW5CLEVBQXlCZ0QsWUFBekIsRUFBdUNBLGFBQWEvQixNQUFiLEdBQXNCOEIsVUFBVTlCLE1BQXZFLENBREEsRUFDZ0Y7QUFBQTs7QUFBQSw2QkFDckYsc0VBQUtyQixLQUFMLEVBQVcyQixJQUFYLDZMQUFvQnlCLFlBQXBCO0FBQ0E7QUFDRDtBQUNGLEdBWEQsTUFXTyxJQUFJLHlFQUFXRCxTQUFYLEVBQXNCQyxZQUF0QixDQUFKLEVBQXlDO0FBQUE7O0FBQUEsMkJBQzlDLHNFQUFLcEQsS0FBTCxFQUFXMkIsSUFBWCw2TEFBb0J3QixTQUFwQjtBQUNBO0FBQ0Q7O0FBRURiLFdBQVN4QyxJQUFULEVBQWVxRCxTQUFmLEVBQTBCQyxZQUExQjtBQUNEOztBQUVELFNBQVNILE9BQVQsQ0FBaUJuRCxJQUFqQixFQUF1Qk0sSUFBdkIsRUFBNkJ3QyxLQUE3QixFQUFvQ1csSUFBcEMsRUFBMEM7QUFDeEMsTUFBSUosWUFBWUgsY0FBYzVDLElBQWQsQ0FBaEI7QUFBQSxNQUNJZ0QsZUFBZUksZUFBZVosS0FBZixFQUFzQk8sU0FBdEIsQ0FEbkI7QUFFQSxNQUFJQyxhQUFhSyxNQUFqQixFQUF5QjtBQUFBOztBQUFBLDJCQUN2QixzRUFBS3pELEtBQUwsRUFBVzJCLElBQVgsNkxBQW9CeUIsYUFBYUssTUFBakM7QUFDRCxHQUZELE1BRU87QUFDTG5CLGFBQVN4QyxJQUFULEVBQWV5RCxPQUFPSCxZQUFQLEdBQXNCRCxTQUFyQyxFQUFnREksT0FBT0osU0FBUCxHQUFtQkMsWUFBbkU7QUFDRDtBQUNGOztBQUVELFNBQVNkLFFBQVQsQ0FBa0J4QyxJQUFsQixFQUF3Qk0sSUFBeEIsRUFBOEJ3QyxLQUE5QixFQUFxQztBQUNuQzlDLE9BQUt3QyxRQUFMLEdBQWdCLElBQWhCO0FBQ0F4QyxPQUFLRSxLQUFMLENBQVcyQixJQUFYLENBQWdCO0FBQ2RXLGNBQVUsSUFESTtBQUVkbEMsVUFBTUEsSUFGUTtBQUdkQyxZQUFRdUM7QUFITSxHQUFoQjtBQUtEOztBQUVELFNBQVNDLGFBQVQsQ0FBdUIvQyxJQUF2QixFQUE2QjRELE1BQTdCLEVBQXFDZCxLQUFyQyxFQUE0QztBQUMxQyxTQUFPYyxPQUFPbEIsTUFBUCxHQUFnQkksTUFBTUosTUFBdEIsSUFBZ0NrQixPQUFPakQsS0FBUCxHQUFlaUQsT0FBTzFELEtBQVAsQ0FBYXFCLE1BQW5FLEVBQTJFO0FBQ3pFLFFBQUlzQyxPQUFPRCxPQUFPMUQsS0FBUCxDQUFhMEQsT0FBT2pELEtBQVAsRUFBYixDQUFYO0FBQ0FYLFNBQUtFLEtBQUwsQ0FBVzJCLElBQVgsQ0FBZ0JnQyxJQUFoQjtBQUNBRCxXQUFPbEIsTUFBUDtBQUNEO0FBQ0Y7QUFDRCxTQUFTVSxjQUFULENBQXdCcEQsSUFBeEIsRUFBOEI0RCxNQUE5QixFQUFzQztBQUNwQyxTQUFPQSxPQUFPakQsS0FBUCxHQUFlaUQsT0FBTzFELEtBQVAsQ0FBYXFCLE1BQW5DLEVBQTJDO0FBQ3pDLFFBQUlzQyxPQUFPRCxPQUFPMUQsS0FBUCxDQUFhMEQsT0FBT2pELEtBQVAsRUFBYixDQUFYO0FBQ0FYLFNBQUtFLEtBQUwsQ0FBVzJCLElBQVgsQ0FBZ0JnQyxJQUFoQjtBQUNEO0FBQ0Y7O0FBRUQsU0FBU1gsYUFBVCxDQUF1QlksS0FBdkIsRUFBOEI7QUFDNUIsTUFBSXBELE1BQU0sRUFBVjtBQUFBLE1BQ0lxRCxZQUFZRCxNQUFNNUQsS0FBTixDQUFZNEQsTUFBTW5ELEtBQWxCLEVBQXlCLENBQXpCLENBRGhCO0FBRUEsU0FBT21ELE1BQU1uRCxLQUFOLEdBQWNtRCxNQUFNNUQsS0FBTixDQUFZcUIsTUFBakMsRUFBeUM7QUFDdkMsUUFBSXNDLE9BQU9DLE1BQU01RCxLQUFOLENBQVk0RCxNQUFNbkQsS0FBbEIsQ0FBWDs7QUFFQTtBQUNBLFFBQUlvRCxjQUFjLEdBQWQsSUFBcUJGLEtBQUssQ0FBTCxNQUFZLEdBQXJDLEVBQTBDO0FBQ3hDRSxrQkFBWSxHQUFaO0FBQ0Q7O0FBRUQsUUFBSUEsY0FBY0YsS0FBSyxDQUFMLENBQWxCLEVBQTJCO0FBQ3pCbkQsVUFBSW1CLElBQUosQ0FBU2dDLElBQVQ7QUFDQUMsWUFBTW5ELEtBQU47QUFDRCxLQUhELE1BR087QUFDTDtBQUNEO0FBQ0Y7O0FBRUQsU0FBT0QsR0FBUDtBQUNEO0FBQ0QsU0FBU2dELGNBQVQsQ0FBd0JJLEtBQXhCLEVBQStCRSxZQUEvQixFQUE2QztBQUMzQyxNQUFJQyxVQUFVLEVBQWQ7QUFBQSxNQUNJTixTQUFTLEVBRGI7QUFBQSxNQUVJTyxhQUFhLENBRmpCO0FBQUEsTUFHSUMsaUJBQWlCLEtBSHJCO0FBQUEsTUFJSUMsYUFBYSxLQUpqQjtBQUtBLFNBQU9GLGFBQWFGLGFBQWF6QyxNQUExQixJQUNFdUMsTUFBTW5ELEtBQU4sR0FBY21ELE1BQU01RCxLQUFOLENBQVlxQixNQURuQyxFQUMyQztBQUN6QyxRQUFJOEMsU0FBU1AsTUFBTTVELEtBQU4sQ0FBWTRELE1BQU1uRCxLQUFsQixDQUFiO0FBQUEsUUFDSTJELFFBQVFOLGFBQWFFLFVBQWIsQ0FEWjs7QUFHQTtBQUNBLFFBQUlJLE1BQU0sQ0FBTixNQUFhLEdBQWpCLEVBQXNCO0FBQ3BCO0FBQ0Q7O0FBRURILHFCQUFpQkEsa0JBQWtCRSxPQUFPLENBQVAsTUFBYyxHQUFqRDs7QUFFQVYsV0FBTzlCLElBQVAsQ0FBWXlDLEtBQVo7QUFDQUo7O0FBRUE7QUFDQTtBQUNBLFFBQUlHLE9BQU8sQ0FBUCxNQUFjLEdBQWxCLEVBQXVCO0FBQ3JCRCxtQkFBYSxJQUFiOztBQUVBLGFBQU9DLE9BQU8sQ0FBUCxNQUFjLEdBQXJCLEVBQTBCO0FBQ3hCSixnQkFBUXBDLElBQVIsQ0FBYXdDLE1BQWI7QUFDQUEsaUJBQVNQLE1BQU01RCxLQUFOLENBQVksRUFBRTRELE1BQU1uRCxLQUFwQixDQUFUO0FBQ0Q7QUFDRjs7QUFFRCxRQUFJMkQsTUFBTUMsTUFBTixDQUFhLENBQWIsTUFBb0JGLE9BQU9FLE1BQVAsQ0FBYyxDQUFkLENBQXhCLEVBQTBDO0FBQ3hDTixjQUFRcEMsSUFBUixDQUFhd0MsTUFBYjtBQUNBUCxZQUFNbkQsS0FBTjtBQUNELEtBSEQsTUFHTztBQUNMeUQsbUJBQWEsSUFBYjtBQUNEO0FBQ0Y7O0FBRUQsTUFBSSxDQUFDSixhQUFhRSxVQUFiLEtBQTRCLEVBQTdCLEVBQWlDLENBQWpDLE1BQXdDLEdBQXhDLElBQ0dDLGNBRFAsRUFDdUI7QUFDckJDLGlCQUFhLElBQWI7QUFDRDs7QUFFRCxNQUFJQSxVQUFKLEVBQWdCO0FBQ2QsV0FBT0gsT0FBUDtBQUNEOztBQUVELFNBQU9DLGFBQWFGLGFBQWF6QyxNQUFqQyxFQUF5QztBQUN2Q29DLFdBQU85QixJQUFQLENBQVltQyxhQUFhRSxZQUFiLENBQVo7QUFDRDs7QUFFRCxTQUFPO0FBQ0xQLGtCQURLO0FBRUxNO0FBRkssR0FBUDtBQUlEOztBQUVELFNBQVNWLFVBQVQsQ0FBb0JVLE9BQXBCLEVBQTZCO0FBQzNCLFNBQU9BLFFBQVFPLE1BQVIsQ0FBZSxVQUFTQyxJQUFULEVBQWVKLE1BQWYsRUFBdUI7QUFDM0MsV0FBT0ksUUFBUUosT0FBTyxDQUFQLE1BQWMsR0FBN0I7QUFDRCxHQUZNLEVBRUosSUFGSSxDQUFQO0FBR0Q7QUFDRCxTQUFTYixrQkFBVCxDQUE0Qk0sS0FBNUIsRUFBbUNZLGFBQW5DLEVBQWtEQyxLQUFsRCxFQUF5RDtBQUN2RCxPQUFLLElBQUlDLElBQUksQ0FBYixFQUFnQkEsSUFBSUQsS0FBcEIsRUFBMkJDLEdBQTNCLEVBQWdDO0FBQzlCLFFBQUlDLGdCQUFnQkgsY0FBY0EsY0FBY25ELE1BQWQsR0FBdUJvRCxLQUF2QixHQUErQkMsQ0FBN0MsRUFBZ0RMLE1BQWhELENBQXVELENBQXZELENBQXBCO0FBQ0EsUUFBSVQsTUFBTTVELEtBQU4sQ0FBWTRELE1BQU1uRCxLQUFOLEdBQWNpRSxDQUExQixNQUFpQyxNQUFNQyxhQUEzQyxFQUEwRDtBQUN4RCxhQUFPLEtBQVA7QUFDRDtBQUNGOztBQUVEZixRQUFNbkQsS0FBTixJQUFlZ0UsS0FBZjtBQUNBLFNBQU8sSUFBUDtBQUNEOztBQUVELFNBQVMxRSxtQkFBVCxDQUE2QkMsS0FBN0IsRUFBb0M7QUFDbEMsTUFBSUMsV0FBVyxDQUFmO0FBQ0EsTUFBSUMsV0FBVyxDQUFmOztBQUVBRixRQUFNNEUsT0FBTixDQUFjLFVBQVNqQixJQUFULEVBQWU7QUFDM0IsUUFBSSxPQUFPQSxJQUFQLEtBQWdCLFFBQXBCLEVBQThCO0FBQzVCLFVBQUlrQixVQUFVOUUsb0JBQW9CNEQsS0FBS3ZELElBQXpCLENBQWQ7QUFDQSxVQUFJMEUsYUFBYS9FLG9CQUFvQjRELEtBQUt0RCxNQUF6QixDQUFqQjs7QUFFQSxVQUFJSixhQUFhRSxTQUFqQixFQUE0QjtBQUMxQixZQUFJMEUsUUFBUTVFLFFBQVIsS0FBcUI2RSxXQUFXN0UsUUFBcEMsRUFBOEM7QUFDNUNBLHNCQUFZNEUsUUFBUTVFLFFBQXBCO0FBQ0QsU0FGRCxNQUVPO0FBQ0xBLHFCQUFXRSxTQUFYO0FBQ0Q7QUFDRjs7QUFFRCxVQUFJRCxhQUFhQyxTQUFqQixFQUE0QjtBQUMxQixZQUFJMEUsUUFBUTNFLFFBQVIsS0FBcUI0RSxXQUFXNUUsUUFBcEMsRUFBOEM7QUFDNUNBLHNCQUFZMkUsUUFBUTNFLFFBQXBCO0FBQ0QsU0FGRCxNQUVPO0FBQ0xBLHFCQUFXQyxTQUFYO0FBQ0Q7QUFDRjtBQUNGLEtBbkJELE1BbUJPO0FBQ0wsVUFBSUQsYUFBYUMsU0FBYixLQUEyQndELEtBQUssQ0FBTCxNQUFZLEdBQVosSUFBbUJBLEtBQUssQ0FBTCxNQUFZLEdBQTFELENBQUosRUFBb0U7QUFDbEV6RDtBQUNEO0FBQ0QsVUFBSUQsYUFBYUUsU0FBYixLQUEyQndELEtBQUssQ0FBTCxNQUFZLEdBQVosSUFBbUJBLEtBQUssQ0FBTCxNQUFZLEdBQTFELENBQUosRUFBb0U7QUFDbEUxRDtBQUNEO0FBQ0Y7QUFDRixHQTVCRDs7QUE4QkEsU0FBTyxFQUFDQSxrQkFBRCxFQUFXQyxrQkFBWCxFQUFQO0FBQ0QiLCJmaWxlIjoibWVyZ2UuanMiLCJzb3VyY2VzQ29udGVudCI6WyJpbXBvcnQge3N0cnVjdHVyZWRQYXRjaH0gZnJvbSAnLi9jcmVhdGUnO1xuaW1wb3J0IHtwYXJzZVBhdGNofSBmcm9tICcuL3BhcnNlJztcblxuaW1wb3J0IHthcnJheUVxdWFsLCBhcnJheVN0YXJ0c1dpdGh9IGZyb20gJy4uL3V0aWwvYXJyYXknO1xuXG5leHBvcnQgZnVuY3Rpb24gY2FsY0xpbmVDb3VudChodW5rKSB7XG4gIGNvbnN0IHtvbGRMaW5lcywgbmV3TGluZXN9ID0gY2FsY09sZE5ld0xpbmVDb3VudChodW5rLmxpbmVzKTtcblxuICBpZiAob2xkTGluZXMgIT09IHVuZGVmaW5lZCkge1xuICAgIGh1bmsub2xkTGluZXMgPSBvbGRMaW5lcztcbiAgfSBlbHNlIHtcbiAgICBkZWxldGUgaHVuay5vbGRMaW5lcztcbiAgfVxuXG4gIGlmIChuZXdMaW5lcyAhPT0gdW5kZWZpbmVkKSB7XG4gICAgaHVuay5uZXdMaW5lcyA9IG5ld0xpbmVzO1xuICB9IGVsc2Uge1xuICAgIGRlbGV0ZSBodW5rLm5ld0xpbmVzO1xuICB9XG59XG5cbmV4cG9ydCBmdW5jdGlvbiBtZXJnZShtaW5lLCB0aGVpcnMsIGJhc2UpIHtcbiAgbWluZSA9IGxvYWRQYXRjaChtaW5lLCBiYXNlKTtcbiAgdGhlaXJzID0gbG9hZFBhdGNoKHRoZWlycywgYmFzZSk7XG5cbiAgbGV0IHJldCA9IHt9O1xuXG4gIC8vIEZvciBpbmRleCB3ZSBqdXN0IGxldCBpdCBwYXNzIHRocm91Z2ggYXMgaXQgZG9lc24ndCBoYXZlIGFueSBuZWNlc3NhcnkgbWVhbmluZy5cbiAgLy8gTGVhdmluZyBzYW5pdHkgY2hlY2tzIG9uIHRoaXMgdG8gdGhlIEFQSSBjb25zdW1lciB0aGF0IG1heSBrbm93IG1vcmUgYWJvdXQgdGhlXG4gIC8vIG1lYW5pbmcgaW4gdGhlaXIgb3duIGNvbnRleHQuXG4gIGlmIChtaW5lLmluZGV4IHx8IHRoZWlycy5pbmRleCkge1xuICAgIHJldC5pbmRleCA9IG1pbmUuaW5kZXggfHwgdGhlaXJzLmluZGV4O1xuICB9XG5cbiAgaWYgKG1pbmUubmV3RmlsZU5hbWUgfHwgdGhlaXJzLm5ld0ZpbGVOYW1lKSB7XG4gICAgaWYgKCFmaWxlTmFtZUNoYW5nZWQobWluZSkpIHtcbiAgICAgIC8vIE5vIGhlYWRlciBvciBubyBjaGFuZ2UgaW4gb3VycywgdXNlIHRoZWlycyAoYW5kIG91cnMgaWYgdGhlaXJzIGRvZXMgbm90IGV4aXN0KVxuICAgICAgcmV0Lm9sZEZpbGVOYW1lID0gdGhlaXJzLm9sZEZpbGVOYW1lIHx8IG1pbmUub2xkRmlsZU5hbWU7XG4gICAgICByZXQubmV3RmlsZU5hbWUgPSB0aGVpcnMubmV3RmlsZU5hbWUgfHwgbWluZS5uZXdGaWxlTmFtZTtcbiAgICAgIHJldC5vbGRIZWFkZXIgPSB0aGVpcnMub2xkSGVhZGVyIHx8IG1pbmUub2xkSGVhZGVyO1xuICAgICAgcmV0Lm5ld0hlYWRlciA9IHRoZWlycy5uZXdIZWFkZXIgfHwgbWluZS5uZXdIZWFkZXI7XG4gICAgfSBlbHNlIGlmICghZmlsZU5hbWVDaGFuZ2VkKHRoZWlycykpIHtcbiAgICAgIC8vIE5vIGhlYWRlciBvciBubyBjaGFuZ2UgaW4gdGhlaXJzLCB1c2Ugb3Vyc1xuICAgICAgcmV0Lm9sZEZpbGVOYW1lID0gbWluZS5vbGRGaWxlTmFtZTtcbiAgICAgIHJldC5uZXdGaWxlTmFtZSA9IG1pbmUubmV3RmlsZU5hbWU7XG4gICAgICByZXQub2xkSGVhZGVyID0gbWluZS5vbGRIZWFkZXI7XG4gICAgICByZXQubmV3SGVhZGVyID0gbWluZS5uZXdIZWFkZXI7XG4gICAgfSBlbHNlIHtcbiAgICAgIC8vIEJvdGggY2hhbmdlZC4uLiBmaWd1cmUgaXQgb3V0XG4gICAgICByZXQub2xkRmlsZU5hbWUgPSBzZWxlY3RGaWVsZChyZXQsIG1pbmUub2xkRmlsZU5hbWUsIHRoZWlycy5vbGRGaWxlTmFtZSk7XG4gICAgICByZXQubmV3RmlsZU5hbWUgPSBzZWxlY3RGaWVsZChyZXQsIG1pbmUubmV3RmlsZU5hbWUsIHRoZWlycy5uZXdGaWxlTmFtZSk7XG4gICAgICByZXQub2xkSGVhZGVyID0gc2VsZWN0RmllbGQocmV0LCBtaW5lLm9sZEhlYWRlciwgdGhlaXJzLm9sZEhlYWRlcik7XG4gICAgICByZXQubmV3SGVhZGVyID0gc2VsZWN0RmllbGQocmV0LCBtaW5lLm5ld0hlYWRlciwgdGhlaXJzLm5ld0hlYWRlcik7XG4gICAgfVxuICB9XG5cbiAgcmV0Lmh1bmtzID0gW107XG5cbiAgbGV0IG1pbmVJbmRleCA9IDAsXG4gICAgICB0aGVpcnNJbmRleCA9IDAsXG4gICAgICBtaW5lT2Zmc2V0ID0gMCxcbiAgICAgIHRoZWlyc09mZnNldCA9IDA7XG5cbiAgd2hpbGUgKG1pbmVJbmRleCA8IG1pbmUuaHVua3MubGVuZ3RoIHx8IHRoZWlyc0luZGV4IDwgdGhlaXJzLmh1bmtzLmxlbmd0aCkge1xuICAgIGxldCBtaW5lQ3VycmVudCA9IG1pbmUuaHVua3NbbWluZUluZGV4XSB8fCB7b2xkU3RhcnQ6IEluZmluaXR5fSxcbiAgICAgICAgdGhlaXJzQ3VycmVudCA9IHRoZWlycy5odW5rc1t0aGVpcnNJbmRleF0gfHwge29sZFN0YXJ0OiBJbmZpbml0eX07XG5cbiAgICBpZiAoaHVua0JlZm9yZShtaW5lQ3VycmVudCwgdGhlaXJzQ3VycmVudCkpIHtcbiAgICAgIC8vIFRoaXMgcGF0Y2ggZG9lcyBub3Qgb3ZlcmxhcCB3aXRoIGFueSBvZiB0aGUgb3RoZXJzLCB5YXkuXG4gICAgICByZXQuaHVua3MucHVzaChjbG9uZUh1bmsobWluZUN1cnJlbnQsIG1pbmVPZmZzZXQpKTtcbiAgICAgIG1pbmVJbmRleCsrO1xuICAgICAgdGhlaXJzT2Zmc2V0ICs9IG1pbmVDdXJyZW50Lm5ld0xpbmVzIC0gbWluZUN1cnJlbnQub2xkTGluZXM7XG4gICAgfSBlbHNlIGlmIChodW5rQmVmb3JlKHRoZWlyc0N1cnJlbnQsIG1pbmVDdXJyZW50KSkge1xuICAgICAgLy8gVGhpcyBwYXRjaCBkb2VzIG5vdCBvdmVybGFwIHdpdGggYW55IG9mIHRoZSBvdGhlcnMsIHlheS5cbiAgICAgIHJldC5odW5rcy5wdXNoKGNsb25lSHVuayh0aGVpcnNDdXJyZW50LCB0aGVpcnNPZmZzZXQpKTtcbiAgICAgIHRoZWlyc0luZGV4Kys7XG4gICAgICBtaW5lT2Zmc2V0ICs9IHRoZWlyc0N1cnJlbnQubmV3TGluZXMgLSB0aGVpcnNDdXJyZW50Lm9sZExpbmVzO1xuICAgIH0gZWxzZSB7XG4gICAgICAvLyBPdmVybGFwLCBtZXJnZSBhcyBiZXN0IHdlIGNhblxuICAgICAgbGV0IG1lcmdlZEh1bmsgPSB7XG4gICAgICAgIG9sZFN0YXJ0OiBNYXRoLm1pbihtaW5lQ3VycmVudC5vbGRTdGFydCwgdGhlaXJzQ3VycmVudC5vbGRTdGFydCksXG4gICAgICAgIG9sZExpbmVzOiAwLFxuICAgICAgICBuZXdTdGFydDogTWF0aC5taW4obWluZUN1cnJlbnQubmV3U3RhcnQgKyBtaW5lT2Zmc2V0LCB0aGVpcnNDdXJyZW50Lm9sZFN0YXJ0ICsgdGhlaXJzT2Zmc2V0KSxcbiAgICAgICAgbmV3TGluZXM6IDAsXG4gICAgICAgIGxpbmVzOiBbXVxuICAgICAgfTtcbiAgICAgIG1lcmdlTGluZXMobWVyZ2VkSHVuaywgbWluZUN1cnJlbnQub2xkU3RhcnQsIG1pbmVDdXJyZW50LmxpbmVzLCB0aGVpcnNDdXJyZW50Lm9sZFN0YXJ0LCB0aGVpcnNDdXJyZW50LmxpbmVzKTtcbiAgICAgIHRoZWlyc0luZGV4Kys7XG4gICAgICBtaW5lSW5kZXgrKztcblxuICAgICAgcmV0Lmh1bmtzLnB1c2gobWVyZ2VkSHVuayk7XG4gICAgfVxuICB9XG5cbiAgcmV0dXJuIHJldDtcbn1cblxuZnVuY3Rpb24gbG9hZFBhdGNoKHBhcmFtLCBiYXNlKSB7XG4gIGlmICh0eXBlb2YgcGFyYW0gPT09ICdzdHJpbmcnKSB7XG4gICAgaWYgKC9eQEAvbS50ZXN0KHBhcmFtKSB8fCAoL15JbmRleDovbS50ZXN0KHBhcmFtKSkpIHtcbiAgICAgIHJldHVybiBwYXJzZVBhdGNoKHBhcmFtKVswXTtcbiAgICB9XG5cbiAgICBpZiAoIWJhc2UpIHtcbiAgICAgIHRocm93IG5ldyBFcnJvcignTXVzdCBwcm92aWRlIGEgYmFzZSByZWZlcmVuY2Ugb3IgcGFzcyBpbiBhIHBhdGNoJyk7XG4gICAgfVxuICAgIHJldHVybiBzdHJ1Y3R1cmVkUGF0Y2godW5kZWZpbmVkLCB1bmRlZmluZWQsIGJhc2UsIHBhcmFtKTtcbiAgfVxuXG4gIHJldHVybiBwYXJhbTtcbn1cblxuZnVuY3Rpb24gZmlsZU5hbWVDaGFuZ2VkKHBhdGNoKSB7XG4gIHJldHVybiBwYXRjaC5uZXdGaWxlTmFtZSAmJiBwYXRjaC5uZXdGaWxlTmFtZSAhPT0gcGF0Y2gub2xkRmlsZU5hbWU7XG59XG5cbmZ1bmN0aW9uIHNlbGVjdEZpZWxkKGluZGV4LCBtaW5lLCB0aGVpcnMpIHtcbiAgaWYgKG1pbmUgPT09IHRoZWlycykge1xuICAgIHJldHVybiBtaW5lO1xuICB9IGVsc2Uge1xuICAgIGluZGV4LmNvbmZsaWN0ID0gdHJ1ZTtcbiAgICByZXR1cm4ge21pbmUsIHRoZWlyc307XG4gIH1cbn1cblxuZnVuY3Rpb24gaHVua0JlZm9yZSh0ZXN0LCBjaGVjaykge1xuICByZXR1cm4gdGVzdC5vbGRTdGFydCA8IGNoZWNrLm9sZFN0YXJ0XG4gICAgJiYgKHRlc3Qub2xkU3RhcnQgKyB0ZXN0Lm9sZExpbmVzKSA8IGNoZWNrLm9sZFN0YXJ0O1xufVxuXG5mdW5jdGlvbiBjbG9uZUh1bmsoaHVuaywgb2Zmc2V0KSB7XG4gIHJldHVybiB7XG4gICAgb2xkU3RhcnQ6IGh1bmsub2xkU3RhcnQsIG9sZExpbmVzOiBodW5rLm9sZExpbmVzLFxuICAgIG5ld1N0YXJ0OiBodW5rLm5ld1N0YXJ0ICsgb2Zmc2V0LCBuZXdMaW5lczogaHVuay5uZXdMaW5lcyxcbiAgICBsaW5lczogaHVuay5saW5lc1xuICB9O1xufVxuXG5mdW5jdGlvbiBtZXJnZUxpbmVzKGh1bmssIG1pbmVPZmZzZXQsIG1pbmVMaW5lcywgdGhlaXJPZmZzZXQsIHRoZWlyTGluZXMpIHtcbiAgLy8gVGhpcyB3aWxsIGdlbmVyYWxseSByZXN1bHQgaW4gYSBjb25mbGljdGVkIGh1bmssIGJ1dCB0aGVyZSBhcmUgY2FzZXMgd2hlcmUgdGhlIGNvbnRleHRcbiAgLy8gaXMgdGhlIG9ubHkgb3ZlcmxhcCB3aGVyZSB3ZSBjYW4gc3VjY2Vzc2Z1bGx5IG1lcmdlIHRoZSBjb250ZW50IGhlcmUuXG4gIGxldCBtaW5lID0ge29mZnNldDogbWluZU9mZnNldCwgbGluZXM6IG1pbmVMaW5lcywgaW5kZXg6IDB9LFxuICAgICAgdGhlaXIgPSB7b2Zmc2V0OiB0aGVpck9mZnNldCwgbGluZXM6IHRoZWlyTGluZXMsIGluZGV4OiAwfTtcblxuICAvLyBIYW5kbGUgYW55IGxlYWRpbmcgY29udGVudFxuICBpbnNlcnRMZWFkaW5nKGh1bmssIG1pbmUsIHRoZWlyKTtcbiAgaW5zZXJ0TGVhZGluZyhodW5rLCB0aGVpciwgbWluZSk7XG5cbiAgLy8gTm93IGluIHRoZSBvdmVybGFwIGNvbnRlbnQuIFNjYW4gdGhyb3VnaCBhbmQgc2VsZWN0IHRoZSBiZXN0IGNoYW5nZXMgZnJvbSBlYWNoLlxuICB3aGlsZSAobWluZS5pbmRleCA8IG1pbmUubGluZXMubGVuZ3RoICYmIHRoZWlyLmluZGV4IDwgdGhlaXIubGluZXMubGVuZ3RoKSB7XG4gICAgbGV0IG1pbmVDdXJyZW50ID0gbWluZS5saW5lc1ttaW5lLmluZGV4XSxcbiAgICAgICAgdGhlaXJDdXJyZW50ID0gdGhlaXIubGluZXNbdGhlaXIuaW5kZXhdO1xuXG4gICAgaWYgKChtaW5lQ3VycmVudFswXSA9PT0gJy0nIHx8IG1pbmVDdXJyZW50WzBdID09PSAnKycpXG4gICAgICAgICYmICh0aGVpckN1cnJlbnRbMF0gPT09ICctJyB8fCB0aGVpckN1cnJlbnRbMF0gPT09ICcrJykpIHtcbiAgICAgIC8vIEJvdGggbW9kaWZpZWQgLi4uXG4gICAgICBtdXR1YWxDaGFuZ2UoaHVuaywgbWluZSwgdGhlaXIpO1xuICAgIH0gZWxzZSBpZiAobWluZUN1cnJlbnRbMF0gPT09ICcrJyAmJiB0aGVpckN1cnJlbnRbMF0gPT09ICcgJykge1xuICAgICAgLy8gTWluZSBpbnNlcnRlZFxuICAgICAgaHVuay5saW5lcy5wdXNoKC4uLiBjb2xsZWN0Q2hhbmdlKG1pbmUpKTtcbiAgICB9IGVsc2UgaWYgKHRoZWlyQ3VycmVudFswXSA9PT0gJysnICYmIG1pbmVDdXJyZW50WzBdID09PSAnICcpIHtcbiAgICAgIC8vIFRoZWlycyBpbnNlcnRlZFxuICAgICAgaHVuay5saW5lcy5wdXNoKC4uLiBjb2xsZWN0Q2hhbmdlKHRoZWlyKSk7XG4gICAgfSBlbHNlIGlmIChtaW5lQ3VycmVudFswXSA9PT0gJy0nICYmIHRoZWlyQ3VycmVudFswXSA9PT0gJyAnKSB7XG4gICAgICAvLyBNaW5lIHJlbW92ZWQgb3IgZWRpdGVkXG4gICAgICByZW1vdmFsKGh1bmssIG1pbmUsIHRoZWlyKTtcbiAgICB9IGVsc2UgaWYgKHRoZWlyQ3VycmVudFswXSA9PT0gJy0nICYmIG1pbmVDdXJyZW50WzBdID09PSAnICcpIHtcbiAgICAgIC8vIFRoZWlyIHJlbW92ZWQgb3IgZWRpdGVkXG4gICAgICByZW1vdmFsKGh1bmssIHRoZWlyLCBtaW5lLCB0cnVlKTtcbiAgICB9IGVsc2UgaWYgKG1pbmVDdXJyZW50ID09PSB0aGVpckN1cnJlbnQpIHtcbiAgICAgIC8vIENvbnRleHQgaWRlbnRpdHlcbiAgICAgIGh1bmsubGluZXMucHVzaChtaW5lQ3VycmVudCk7XG4gICAgICBtaW5lLmluZGV4Kys7XG4gICAgICB0aGVpci5pbmRleCsrO1xuICAgIH0gZWxzZSB7XG4gICAgICAvLyBDb250ZXh0IG1pc21hdGNoXG4gICAgICBjb25mbGljdChodW5rLCBjb2xsZWN0Q2hhbmdlKG1pbmUpLCBjb2xsZWN0Q2hhbmdlKHRoZWlyKSk7XG4gICAgfVxuICB9XG5cbiAgLy8gTm93IHB1c2ggYW55dGhpbmcgdGhhdCBtYXkgYmUgcmVtYWluaW5nXG4gIGluc2VydFRyYWlsaW5nKGh1bmssIG1pbmUpO1xuICBpbnNlcnRUcmFpbGluZyhodW5rLCB0aGVpcik7XG5cbiAgY2FsY0xpbmVDb3VudChodW5rKTtcbn1cblxuZnVuY3Rpb24gbXV0dWFsQ2hhbmdlKGh1bmssIG1pbmUsIHRoZWlyKSB7XG4gIGxldCBteUNoYW5nZXMgPSBjb2xsZWN0Q2hhbmdlKG1pbmUpLFxuICAgICAgdGhlaXJDaGFuZ2VzID0gY29sbGVjdENoYW5nZSh0aGVpcik7XG5cbiAgaWYgKGFsbFJlbW92ZXMobXlDaGFuZ2VzKSAmJiBhbGxSZW1vdmVzKHRoZWlyQ2hhbmdlcykpIHtcbiAgICAvLyBTcGVjaWFsIGNhc2UgZm9yIHJlbW92ZSBjaGFuZ2VzIHRoYXQgYXJlIHN1cGVyc2V0cyBvZiBvbmUgYW5vdGhlclxuICAgIGlmIChhcnJheVN0YXJ0c1dpdGgobXlDaGFuZ2VzLCB0aGVpckNoYW5nZXMpXG4gICAgICAgICYmIHNraXBSZW1vdmVTdXBlcnNldCh0aGVpciwgbXlDaGFuZ2VzLCBteUNoYW5nZXMubGVuZ3RoIC0gdGhlaXJDaGFuZ2VzLmxlbmd0aCkpIHtcbiAgICAgIGh1bmsubGluZXMucHVzaCguLi4gbXlDaGFuZ2VzKTtcbiAgICAgIHJldHVybjtcbiAgICB9IGVsc2UgaWYgKGFycmF5U3RhcnRzV2l0aCh0aGVpckNoYW5nZXMsIG15Q2hhbmdlcylcbiAgICAgICAgJiYgc2tpcFJlbW92ZVN1cGVyc2V0KG1pbmUsIHRoZWlyQ2hhbmdlcywgdGhlaXJDaGFuZ2VzLmxlbmd0aCAtIG15Q2hhbmdlcy5sZW5ndGgpKSB7XG4gICAgICBodW5rLmxpbmVzLnB1c2goLi4uIHRoZWlyQ2hhbmdlcyk7XG4gICAgICByZXR1cm47XG4gICAgfVxuICB9IGVsc2UgaWYgKGFycmF5RXF1YWwobXlDaGFuZ2VzLCB0aGVpckNoYW5nZXMpKSB7XG4gICAgaHVuay5saW5lcy5wdXNoKC4uLiBteUNoYW5nZXMpO1xuICAgIHJldHVybjtcbiAgfVxuXG4gIGNvbmZsaWN0KGh1bmssIG15Q2hhbmdlcywgdGhlaXJDaGFuZ2VzKTtcbn1cblxuZnVuY3Rpb24gcmVtb3ZhbChodW5rLCBtaW5lLCB0aGVpciwgc3dhcCkge1xuICBsZXQgbXlDaGFuZ2VzID0gY29sbGVjdENoYW5nZShtaW5lKSxcbiAgICAgIHRoZWlyQ2hhbmdlcyA9IGNvbGxlY3RDb250ZXh0KHRoZWlyLCBteUNoYW5nZXMpO1xuICBpZiAodGhlaXJDaGFuZ2VzLm1lcmdlZCkge1xuICAgIGh1bmsubGluZXMucHVzaCguLi4gdGhlaXJDaGFuZ2VzLm1lcmdlZCk7XG4gIH0gZWxzZSB7XG4gICAgY29uZmxpY3QoaHVuaywgc3dhcCA/IHRoZWlyQ2hhbmdlcyA6IG15Q2hhbmdlcywgc3dhcCA/IG15Q2hhbmdlcyA6IHRoZWlyQ2hhbmdlcyk7XG4gIH1cbn1cblxuZnVuY3Rpb24gY29uZmxpY3QoaHVuaywgbWluZSwgdGhlaXIpIHtcbiAgaHVuay5jb25mbGljdCA9IHRydWU7XG4gIGh1bmsubGluZXMucHVzaCh7XG4gICAgY29uZmxpY3Q6IHRydWUsXG4gICAgbWluZTogbWluZSxcbiAgICB0aGVpcnM6IHRoZWlyXG4gIH0pO1xufVxuXG5mdW5jdGlvbiBpbnNlcnRMZWFkaW5nKGh1bmssIGluc2VydCwgdGhlaXIpIHtcbiAgd2hpbGUgKGluc2VydC5vZmZzZXQgPCB0aGVpci5vZmZzZXQgJiYgaW5zZXJ0LmluZGV4IDwgaW5zZXJ0LmxpbmVzLmxlbmd0aCkge1xuICAgIGxldCBsaW5lID0gaW5zZXJ0LmxpbmVzW2luc2VydC5pbmRleCsrXTtcbiAgICBodW5rLmxpbmVzLnB1c2gobGluZSk7XG4gICAgaW5zZXJ0Lm9mZnNldCsrO1xuICB9XG59XG5mdW5jdGlvbiBpbnNlcnRUcmFpbGluZyhodW5rLCBpbnNlcnQpIHtcbiAgd2hpbGUgKGluc2VydC5pbmRleCA8IGluc2VydC5saW5lcy5sZW5ndGgpIHtcbiAgICBsZXQgbGluZSA9IGluc2VydC5saW5lc1tpbnNlcnQuaW5kZXgrK107XG4gICAgaHVuay5saW5lcy5wdXNoKGxpbmUpO1xuICB9XG59XG5cbmZ1bmN0aW9uIGNvbGxlY3RDaGFuZ2Uoc3RhdGUpIHtcbiAgbGV0IHJldCA9IFtdLFxuICAgICAgb3BlcmF0aW9uID0gc3RhdGUubGluZXNbc3RhdGUuaW5kZXhdWzBdO1xuICB3aGlsZSAoc3RhdGUuaW5kZXggPCBzdGF0ZS5saW5lcy5sZW5ndGgpIHtcbiAgICBsZXQgbGluZSA9IHN0YXRlLmxpbmVzW3N0YXRlLmluZGV4XTtcblxuICAgIC8vIEdyb3VwIGFkZGl0aW9ucyB0aGF0IGFyZSBpbW1lZGlhdGVseSBhZnRlciBzdWJ0cmFjdGlvbnMgYW5kIHRyZWF0IHRoZW0gYXMgb25lIFwiYXRvbWljXCIgbW9kaWZ5IGNoYW5nZS5cbiAgICBpZiAob3BlcmF0aW9uID09PSAnLScgJiYgbGluZVswXSA9PT0gJysnKSB7XG4gICAgICBvcGVyYXRpb24gPSAnKyc7XG4gICAgfVxuXG4gICAgaWYgKG9wZXJhdGlvbiA9PT0gbGluZVswXSkge1xuICAgICAgcmV0LnB1c2gobGluZSk7XG4gICAgICBzdGF0ZS5pbmRleCsrO1xuICAgIH0gZWxzZSB7XG4gICAgICBicmVhaztcbiAgICB9XG4gIH1cblxuICByZXR1cm4gcmV0O1xufVxuZnVuY3Rpb24gY29sbGVjdENvbnRleHQoc3RhdGUsIG1hdGNoQ2hhbmdlcykge1xuICBsZXQgY2hhbmdlcyA9IFtdLFxuICAgICAgbWVyZ2VkID0gW10sXG4gICAgICBtYXRjaEluZGV4ID0gMCxcbiAgICAgIGNvbnRleHRDaGFuZ2VzID0gZmFsc2UsXG4gICAgICBjb25mbGljdGVkID0gZmFsc2U7XG4gIHdoaWxlIChtYXRjaEluZGV4IDwgbWF0Y2hDaGFuZ2VzLmxlbmd0aFxuICAgICAgICAmJiBzdGF0ZS5pbmRleCA8IHN0YXRlLmxpbmVzLmxlbmd0aCkge1xuICAgIGxldCBjaGFuZ2UgPSBzdGF0ZS5saW5lc1tzdGF0ZS5pbmRleF0sXG4gICAgICAgIG1hdGNoID0gbWF0Y2hDaGFuZ2VzW21hdGNoSW5kZXhdO1xuXG4gICAgLy8gT25jZSB3ZSd2ZSBoaXQgb3VyIGFkZCwgdGhlbiB3ZSBhcmUgZG9uZVxuICAgIGlmIChtYXRjaFswXSA9PT0gJysnKSB7XG4gICAgICBicmVhaztcbiAgICB9XG5cbiAgICBjb250ZXh0Q2hhbmdlcyA9IGNvbnRleHRDaGFuZ2VzIHx8IGNoYW5nZVswXSAhPT0gJyAnO1xuXG4gICAgbWVyZ2VkLnB1c2gobWF0Y2gpO1xuICAgIG1hdGNoSW5kZXgrKztcblxuICAgIC8vIENvbnN1bWUgYW55IGFkZGl0aW9ucyBpbiB0aGUgb3RoZXIgYmxvY2sgYXMgYSBjb25mbGljdCB0byBhdHRlbXB0XG4gICAgLy8gdG8gcHVsbCBpbiB0aGUgcmVtYWluaW5nIGNvbnRleHQgYWZ0ZXIgdGhpc1xuICAgIGlmIChjaGFuZ2VbMF0gPT09ICcrJykge1xuICAgICAgY29uZmxpY3RlZCA9IHRydWU7XG5cbiAgICAgIHdoaWxlIChjaGFuZ2VbMF0gPT09ICcrJykge1xuICAgICAgICBjaGFuZ2VzLnB1c2goY2hhbmdlKTtcbiAgICAgICAgY2hhbmdlID0gc3RhdGUubGluZXNbKytzdGF0ZS5pbmRleF07XG4gICAgICB9XG4gICAgfVxuXG4gICAgaWYgKG1hdGNoLnN1YnN0cigxKSA9PT0gY2hhbmdlLnN1YnN0cigxKSkge1xuICAgICAgY2hhbmdlcy5wdXNoKGNoYW5nZSk7XG4gICAgICBzdGF0ZS5pbmRleCsrO1xuICAgIH0gZWxzZSB7XG4gICAgICBjb25mbGljdGVkID0gdHJ1ZTtcbiAgICB9XG4gIH1cblxuICBpZiAoKG1hdGNoQ2hhbmdlc1ttYXRjaEluZGV4XSB8fCAnJylbMF0gPT09ICcrJ1xuICAgICAgJiYgY29udGV4dENoYW5nZXMpIHtcbiAgICBjb25mbGljdGVkID0gdHJ1ZTtcbiAgfVxuXG4gIGlmIChjb25mbGljdGVkKSB7XG4gICAgcmV0dXJuIGNoYW5nZXM7XG4gIH1cblxuICB3aGlsZSAobWF0Y2hJbmRleCA8IG1hdGNoQ2hhbmdlcy5sZW5ndGgpIHtcbiAgICBtZXJnZWQucHVzaChtYXRjaENoYW5nZXNbbWF0Y2hJbmRleCsrXSk7XG4gIH1cblxuICByZXR1cm4ge1xuICAgIG1lcmdlZCxcbiAgICBjaGFuZ2VzXG4gIH07XG59XG5cbmZ1bmN0aW9uIGFsbFJlbW92ZXMoY2hhbmdlcykge1xuICByZXR1cm4gY2hhbmdlcy5yZWR1Y2UoZnVuY3Rpb24ocHJldiwgY2hhbmdlKSB7XG4gICAgcmV0dXJuIHByZXYgJiYgY2hhbmdlWzBdID09PSAnLSc7XG4gIH0sIHRydWUpO1xufVxuZnVuY3Rpb24gc2tpcFJlbW92ZVN1cGVyc2V0KHN0YXRlLCByZW1vdmVDaGFuZ2VzLCBkZWx0YSkge1xuICBmb3IgKGxldCBpID0gMDsgaSA8IGRlbHRhOyBpKyspIHtcbiAgICBsZXQgY2hhbmdlQ29udGVudCA9IHJlbW92ZUNoYW5nZXNbcmVtb3ZlQ2hhbmdlcy5sZW5ndGggLSBkZWx0YSArIGldLnN1YnN0cigxKTtcbiAgICBpZiAoc3RhdGUubGluZXNbc3RhdGUuaW5kZXggKyBpXSAhPT0gJyAnICsgY2hhbmdlQ29udGVudCkge1xuICAgICAgcmV0dXJuIGZhbHNlO1xuICAgIH1cbiAgfVxuXG4gIHN0YXRlLmluZGV4ICs9IGRlbHRhO1xuICByZXR1cm4gdHJ1ZTtcbn1cblxuZnVuY3Rpb24gY2FsY09sZE5ld0xpbmVDb3VudChsaW5lcykge1xuICBsZXQgb2xkTGluZXMgPSAwO1xuICBsZXQgbmV3TGluZXMgPSAwO1xuXG4gIGxpbmVzLmZvckVhY2goZnVuY3Rpb24obGluZSkge1xuICAgIGlmICh0eXBlb2YgbGluZSAhPT0gJ3N0cmluZycpIHtcbiAgICAgIGxldCBteUNvdW50ID0gY2FsY09sZE5ld0xpbmVDb3VudChsaW5lLm1pbmUpO1xuICAgICAgbGV0IHRoZWlyQ291bnQgPSBjYWxjT2xkTmV3TGluZUNvdW50KGxpbmUudGhlaXJzKTtcblxuICAgICAgaWYgKG9sZExpbmVzICE9PSB1bmRlZmluZWQpIHtcbiAgICAgICAgaWYgKG15Q291bnQub2xkTGluZXMgPT09IHRoZWlyQ291bnQub2xkTGluZXMpIHtcbiAgICAgICAgICBvbGRMaW5lcyArPSBteUNvdW50Lm9sZExpbmVzO1xuICAgICAgICB9IGVsc2Uge1xuICAgICAgICAgIG9sZExpbmVzID0gdW5kZWZpbmVkO1xuICAgICAgICB9XG4gICAgICB9XG5cbiAgICAgIGlmIChuZXdMaW5lcyAhPT0gdW5kZWZpbmVkKSB7XG4gICAgICAgIGlmIChteUNvdW50Lm5ld0xpbmVzID09PSB0aGVpckNvdW50Lm5ld0xpbmVzKSB7XG4gICAgICAgICAgbmV3TGluZXMgKz0gbXlDb3VudC5uZXdMaW5lcztcbiAgICAgICAgfSBlbHNlIHtcbiAgICAgICAgICBuZXdMaW5lcyA9IHVuZGVmaW5lZDtcbiAgICAgICAgfVxuICAgICAgfVxuICAgIH0gZWxzZSB7XG4gICAgICBpZiAobmV3TGluZXMgIT09IHVuZGVmaW5lZCAmJiAobGluZVswXSA9PT0gJysnIHx8IGxpbmVbMF0gPT09ICcgJykpIHtcbiAgICAgICAgbmV3TGluZXMrKztcbiAgICAgIH1cbiAgICAgIGlmIChvbGRMaW5lcyAhPT0gdW5kZWZpbmVkICYmIChsaW5lWzBdID09PSAnLScgfHwgbGluZVswXSA9PT0gJyAnKSkge1xuICAgICAgICBvbGRMaW5lcysrO1xuICAgICAgfVxuICAgIH1cbiAgfSk7XG5cbiAgcmV0dXJuIHtvbGRMaW5lcywgbmV3TGluZXN9O1xufVxuIl19
+
+
+/***/ }),
+/* 14 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/structuredPatch = structuredPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/createTwoFilesPatch = createTwoFilesPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/createPatch = createPatch;
+
+	var /*istanbul ignore start*/_line = __webpack_require__(5) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/function _toConsumableArray(arr) { if (Array.isArray(arr)) { for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) { arr2[i] = arr[i]; } return arr2; } else { return Array.from(arr); } }
+
+	/*istanbul ignore end*/function structuredPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader, options) {
+	  if (!options) {
+	    options = {};
+	  }
+	  if (typeof options.context === 'undefined') {
+	    options.context = 4;
+	  }
+
+	  var diff = /*istanbul ignore start*/(0, _line.diffLines) /*istanbul ignore end*/(oldStr, newStr, options);
+	  diff.push({ value: '', lines: [] }); // Append an empty value to make cleanup easier
+
+	  function contextLines(lines) {
+	    return lines.map(function (entry) {
+	      return ' ' + entry;
+	    });
+	  }
+
+	  var hunks = [];
+	  var oldRangeStart = 0,
+	      newRangeStart = 0,
+	      curRange = [],
+	      oldLine = 1,
+	      newLine = 1;
+
+	  /*istanbul ignore start*/var _loop = function _loop( /*istanbul ignore end*/i) {
+	    var current = diff[i],
+	        lines = current.lines || current.value.replace(/\n$/, '').split('\n');
+	    current.lines = lines;
+
+	    if (current.added || current.removed) {
+	      /*istanbul ignore start*/var _curRange;
+
+	      /*istanbul ignore end*/ // If we have previous context, start with that
+	      if (!oldRangeStart) {
+	        var prev = diff[i - 1];
+	        oldRangeStart = oldLine;
+	        newRangeStart = newLine;
+
+	        if (prev) {
+	          curRange = options.context > 0 ? contextLines(prev.lines.slice(-options.context)) : [];
+	          oldRangeStart -= curRange.length;
+	          newRangeStart -= curRange.length;
+	        }
+	      }
+
+	      // Output our changes
+	      /*istanbul ignore start*/(_curRange = /*istanbul ignore end*/curRange).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_curRange /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/lines.map(function (entry) {
+	        return (current.added ? '+' : '-') + entry;
+	      })));
+
+	      // Track the updated file position
+	      if (current.added) {
+	        newLine += lines.length;
+	      } else {
+	        oldLine += lines.length;
+	      }
+	    } else {
+	      // Identical context lines. Track line changes
+	      if (oldRangeStart) {
+	        // Close out any changes that have been output (or join overlapping)
+	        if (lines.length <= options.context * 2 && i < diff.length - 2) {
+	          /*istanbul ignore start*/var _curRange2;
+
+	          /*istanbul ignore end*/ // Overlapping
+	          /*istanbul ignore start*/(_curRange2 = /*istanbul ignore end*/curRange).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_curRange2 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/contextLines(lines)));
+	        } else {
+	          /*istanbul ignore start*/var _curRange3;
+
+	          /*istanbul ignore end*/ // end the range and output
+	          var contextSize = Math.min(lines.length, options.context);
+	          /*istanbul ignore start*/(_curRange3 = /*istanbul ignore end*/curRange).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_curRange3 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/contextLines(lines.slice(0, contextSize))));
+
+	          var hunk = {
+	            oldStart: oldRangeStart,
+	            oldLines: oldLine - oldRangeStart + contextSize,
+	            newStart: newRangeStart,
+	            newLines: newLine - newRangeStart + contextSize,
+	            lines: curRange
+	          };
+	          if (i >= diff.length - 2 && lines.length <= options.context) {
+	            // EOF is inside this hunk
+	            var oldEOFNewline = /\n$/.test(oldStr);
+	            var newEOFNewline = /\n$/.test(newStr);
+	            if (lines.length == 0 && !oldEOFNewline) {
+	              // special case: old has no eol and no trailing context; no-nl can end up before adds
+	              curRange.splice(hunk.oldLines, 0, '\\ No newline at end of file');
+	            } else if (!oldEOFNewline || !newEOFNewline) {
+	              curRange.push('\\ No newline at end of file');
+	            }
+	          }
+	          hunks.push(hunk);
+
+	          oldRangeStart = 0;
+	          newRangeStart = 0;
+	          curRange = [];
+	        }
+	      }
+	      oldLine += lines.length;
+	      newLine += lines.length;
+	    }
+	  };
+
+	  for (var i = 0; i < diff.length; i++) {
+	    /*istanbul ignore start*/_loop( /*istanbul ignore end*/i);
+	  }
+
+	  return {
+	    oldFileName: oldFileName, newFileName: newFileName,
+	    oldHeader: oldHeader, newHeader: newHeader,
+	    hunks: hunks
+	  };
+	}
+
+	function createTwoFilesPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader, options) {
+	  var diff = structuredPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader, options);
+
+	  var ret = [];
+	  if (oldFileName == newFileName) {
+	    ret.push('Index: ' + oldFileName);
+	  }
+	  ret.push('===================================================================');
+	  ret.push('--- ' + diff.oldFileName + (typeof diff.oldHeader === 'undefined' ? '' : '\t' + diff.oldHeader));
+	  ret.push('+++ ' + diff.newFileName + (typeof diff.newHeader === 'undefined' ? '' : '\t' + diff.newHeader));
+
+	  for (var i = 0; i < diff.hunks.length; i++) {
+	    var hunk = diff.hunks[i];
+	    ret.push('@@ -' + hunk.oldStart + ',' + hunk.oldLines + ' +' + hunk.newStart + ',' + hunk.newLines + ' @@');
+	    ret.push.apply(ret, hunk.lines);
+	  }
+
+	  return ret.join('\n') + '\n';
+	}
+
+	function createPatch(fileName, oldStr, newStr, oldHeader, newHeader, options) {
+	  return createTwoFilesPatch(fileName, fileName, oldStr, newStr, oldHeader, newHeader, options);
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9wYXRjaC9jcmVhdGUuanMiXSwibmFtZXMiOlsic3RydWN0dXJlZFBhdGNoIiwiY3JlYXRlVHdvRmlsZXNQYXRjaCIsImNyZWF0ZVBhdGNoIiwib2xkRmlsZU5hbWUiLCJuZXdGaWxlTmFtZSIsIm9sZFN0ciIsIm5ld1N0ciIsIm9sZEhlYWRlciIsIm5ld0hlYWRlciIsIm9wdGlvbnMiLCJjb250ZXh0IiwiZGlmZiIsInB1c2giLCJ2YWx1ZSIsImxpbmVzIiwiY29udGV4dExpbmVzIiwibWFwIiwiZW50cnkiLCJodW5rcyIsIm9sZFJhbmdlU3RhcnQiLCJuZXdSYW5nZVN0YXJ0IiwiY3VyUmFuZ2UiLCJvbGRMaW5lIiwibmV3TGluZSIsImkiLCJjdXJyZW50IiwicmVwbGFjZSIsInNwbGl0IiwiYWRkZWQiLCJyZW1vdmVkIiwicHJldiIsInNsaWNlIiwibGVuZ3RoIiwiY29udGV4dFNpemUiLCJNYXRoIiwibWluIiwiaHVuayIsIm9sZFN0YXJ0Iiwib2xkTGluZXMiLCJuZXdTdGFydCIsIm5ld0xpbmVzIiwib2xkRU9GTmV3bGluZSIsInRlc3QiLCJuZXdFT0ZOZXdsaW5lIiwic3BsaWNlIiwicmV0IiwiYXBwbHkiLCJqb2luIiwiZmlsZU5hbWUiXSwibWFwcGluZ3MiOiI7OztnQ0FFZ0JBLGUsR0FBQUEsZTt5REFpR0FDLG1CLEdBQUFBLG1CO3lEQXdCQUMsVyxHQUFBQSxXOztBQTNIaEI7Ozs7dUJBRU8sU0FBU0YsZUFBVCxDQUF5QkcsV0FBekIsRUFBc0NDLFdBQXRDLEVBQW1EQyxNQUFuRCxFQUEyREMsTUFBM0QsRUFBbUVDLFNBQW5FLEVBQThFQyxTQUE5RSxFQUF5RkMsT0FBekYsRUFBa0c7QUFDdkcsTUFBSSxDQUFDQSxPQUFMLEVBQWM7QUFDWkEsY0FBVSxFQUFWO0FBQ0Q7QUFDRCxNQUFJLE9BQU9BLFFBQVFDLE9BQWYsS0FBMkIsV0FBL0IsRUFBNEM7QUFDMUNELFlBQVFDLE9BQVIsR0FBa0IsQ0FBbEI7QUFDRDs7QUFFRCxNQUFNQyxPQUFPLHNFQUFVTixNQUFWLEVBQWtCQyxNQUFsQixFQUEwQkcsT0FBMUIsQ0FBYjtBQUNBRSxPQUFLQyxJQUFMLENBQVUsRUFBQ0MsT0FBTyxFQUFSLEVBQVlDLE9BQU8sRUFBbkIsRUFBVixFQVR1RyxDQVNsRTs7QUFFckMsV0FBU0MsWUFBVCxDQUFzQkQsS0FBdEIsRUFBNkI7QUFDM0IsV0FBT0EsTUFBTUUsR0FBTixDQUFVLFVBQVNDLEtBQVQsRUFBZ0I7QUFBRSxhQUFPLE1BQU1BLEtBQWI7QUFBcUIsS0FBakQsQ0FBUDtBQUNEOztBQUVELE1BQUlDLFFBQVEsRUFBWjtBQUNBLE1BQUlDLGdCQUFnQixDQUFwQjtBQUFBLE1BQXVCQyxnQkFBZ0IsQ0FBdkM7QUFBQSxNQUEwQ0MsV0FBVyxFQUFyRDtBQUFBLE1BQ0lDLFVBQVUsQ0FEZDtBQUFBLE1BQ2lCQyxVQUFVLENBRDNCOztBQWhCdUcsOEVBa0I5RkMsQ0FsQjhGO0FBbUJyRyxRQUFNQyxVQUFVZCxLQUFLYSxDQUFMLENBQWhCO0FBQUEsUUFDTVYsUUFBUVcsUUFBUVgsS0FBUixJQUFpQlcsUUFBUVosS0FBUixDQUFjYSxPQUFkLENBQXNCLEtBQXRCLEVBQTZCLEVBQTdCLEVBQWlDQyxLQUFqQyxDQUF1QyxJQUF2QyxDQUQvQjtBQUVBRixZQUFRWCxLQUFSLEdBQWdCQSxLQUFoQjs7QUFFQSxRQUFJVyxRQUFRRyxLQUFSLElBQWlCSCxRQUFRSSxPQUE3QixFQUFzQztBQUFBOztBQUFBLDhCQUNwQztBQUNBLFVBQUksQ0FBQ1YsYUFBTCxFQUFvQjtBQUNsQixZQUFNVyxPQUFPbkIsS0FBS2EsSUFBSSxDQUFULENBQWI7QUFDQUwsd0JBQWdCRyxPQUFoQjtBQUNBRix3QkFBZ0JHLE9BQWhCOztBQUVBLFlBQUlPLElBQUosRUFBVTtBQUNSVCxxQkFBV1osUUFBUUMsT0FBUixHQUFrQixDQUFsQixHQUFzQkssYUFBYWUsS0FBS2hCLEtBQUwsQ0FBV2lCLEtBQVgsQ0FBaUIsQ0FBQ3RCLFFBQVFDLE9BQTFCLENBQWIsQ0FBdEIsR0FBeUUsRUFBcEY7QUFDQVMsMkJBQWlCRSxTQUFTVyxNQUExQjtBQUNBWiwyQkFBaUJDLFNBQVNXLE1BQTFCO0FBQ0Q7QUFDRjs7QUFFRDtBQUNBLDZFQUFTcEIsSUFBVCwwTEFBa0JFLE1BQU1FLEdBQU4sQ0FBVSxVQUFTQyxLQUFULEVBQWdCO0FBQzFDLGVBQU8sQ0FBQ1EsUUFBUUcsS0FBUixHQUFnQixHQUFoQixHQUFzQixHQUF2QixJQUE4QlgsS0FBckM7QUFDRCxPQUZpQixDQUFsQjs7QUFJQTtBQUNBLFVBQUlRLFFBQVFHLEtBQVosRUFBbUI7QUFDakJMLG1CQUFXVCxNQUFNa0IsTUFBakI7QUFDRCxPQUZELE1BRU87QUFDTFYsbUJBQVdSLE1BQU1rQixNQUFqQjtBQUNEO0FBQ0YsS0F6QkQsTUF5Qk87QUFDTDtBQUNBLFVBQUliLGFBQUosRUFBbUI7QUFDakI7QUFDQSxZQUFJTCxNQUFNa0IsTUFBTixJQUFnQnZCLFFBQVFDLE9BQVIsR0FBa0IsQ0FBbEMsSUFBdUNjLElBQUliLEtBQUtxQixNQUFMLEdBQWMsQ0FBN0QsRUFBZ0U7QUFBQTs7QUFBQSxrQ0FDOUQ7QUFDQSxrRkFBU3BCLElBQVQsMkxBQWtCRyxhQUFhRCxLQUFiLENBQWxCO0FBQ0QsU0FIRCxNQUdPO0FBQUE7O0FBQUEsa0NBQ0w7QUFDQSxjQUFJbUIsY0FBY0MsS0FBS0MsR0FBTCxDQUFTckIsTUFBTWtCLE1BQWYsRUFBdUJ2QixRQUFRQyxPQUEvQixDQUFsQjtBQUNBLGtGQUFTRSxJQUFULDJMQUFrQkcsYUFBYUQsTUFBTWlCLEtBQU4sQ0FBWSxDQUFaLEVBQWVFLFdBQWYsQ0FBYixDQUFsQjs7QUFFQSxjQUFJRyxPQUFPO0FBQ1RDLHNCQUFVbEIsYUFERDtBQUVUbUIsc0JBQVdoQixVQUFVSCxhQUFWLEdBQTBCYyxXQUY1QjtBQUdUTSxzQkFBVW5CLGFBSEQ7QUFJVG9CLHNCQUFXakIsVUFBVUgsYUFBVixHQUEwQmEsV0FKNUI7QUFLVG5CLG1CQUFPTztBQUxFLFdBQVg7QUFPQSxjQUFJRyxLQUFLYixLQUFLcUIsTUFBTCxHQUFjLENBQW5CLElBQXdCbEIsTUFBTWtCLE1BQU4sSUFBZ0J2QixRQUFRQyxPQUFwRCxFQUE2RDtBQUMzRDtBQUNBLGdCQUFJK0IsZ0JBQWlCLE1BQU1DLElBQU4sQ0FBV3JDLE1BQVgsQ0FBckI7QUFDQSxnQkFBSXNDLGdCQUFpQixNQUFNRCxJQUFOLENBQVdwQyxNQUFYLENBQXJCO0FBQ0EsZ0JBQUlRLE1BQU1rQixNQUFOLElBQWdCLENBQWhCLElBQXFCLENBQUNTLGFBQTFCLEVBQXlDO0FBQ3ZDO0FBQ0FwQix1QkFBU3VCLE1BQVQsQ0FBZ0JSLEtBQUtFLFFBQXJCLEVBQStCLENBQS9CLEVBQWtDLDhCQUFsQztBQUNELGFBSEQsTUFHTyxJQUFJLENBQUNHLGFBQUQsSUFBa0IsQ0FBQ0UsYUFBdkIsRUFBc0M7QUFDM0N0Qix1QkFBU1QsSUFBVCxDQUFjLDhCQUFkO0FBQ0Q7QUFDRjtBQUNETSxnQkFBTU4sSUFBTixDQUFXd0IsSUFBWDs7QUFFQWpCLDBCQUFnQixDQUFoQjtBQUNBQywwQkFBZ0IsQ0FBaEI7QUFDQUMscUJBQVcsRUFBWDtBQUNEO0FBQ0Y7QUFDREMsaUJBQVdSLE1BQU1rQixNQUFqQjtBQUNBVCxpQkFBV1QsTUFBTWtCLE1BQWpCO0FBQ0Q7QUF2Rm9HOztBQWtCdkcsT0FBSyxJQUFJUixJQUFJLENBQWIsRUFBZ0JBLElBQUliLEtBQUtxQixNQUF6QixFQUFpQ1IsR0FBakMsRUFBc0M7QUFBQSwyREFBN0JBLENBQTZCO0FBc0VyQzs7QUFFRCxTQUFPO0FBQ0xyQixpQkFBYUEsV0FEUixFQUNxQkMsYUFBYUEsV0FEbEM7QUFFTEcsZUFBV0EsU0FGTixFQUVpQkMsV0FBV0EsU0FGNUI7QUFHTFUsV0FBT0E7QUFIRixHQUFQO0FBS0Q7O0FBRU0sU0FBU2pCLG1CQUFULENBQTZCRSxXQUE3QixFQUEwQ0MsV0FBMUMsRUFBdURDLE1BQXZELEVBQStEQyxNQUEvRCxFQUF1RUMsU0FBdkUsRUFBa0ZDLFNBQWxGLEVBQTZGQyxPQUE3RixFQUFzRztBQUMzRyxNQUFNRSxPQUFPWCxnQkFBZ0JHLFdBQWhCLEVBQTZCQyxXQUE3QixFQUEwQ0MsTUFBMUMsRUFBa0RDLE1BQWxELEVBQTBEQyxTQUExRCxFQUFxRUMsU0FBckUsRUFBZ0ZDLE9BQWhGLENBQWI7O0FBRUEsTUFBTW9DLE1BQU0sRUFBWjtBQUNBLE1BQUkxQyxlQUFlQyxXQUFuQixFQUFnQztBQUM5QnlDLFFBQUlqQyxJQUFKLENBQVMsWUFBWVQsV0FBckI7QUFDRDtBQUNEMEMsTUFBSWpDLElBQUosQ0FBUyxxRUFBVDtBQUNBaUMsTUFBSWpDLElBQUosQ0FBUyxTQUFTRCxLQUFLUixXQUFkLElBQTZCLE9BQU9RLEtBQUtKLFNBQVosS0FBMEIsV0FBMUIsR0FBd0MsRUFBeEMsR0FBNkMsT0FBT0ksS0FBS0osU0FBdEYsQ0FBVDtBQUNBc0MsTUFBSWpDLElBQUosQ0FBUyxTQUFTRCxLQUFLUCxXQUFkLElBQTZCLE9BQU9PLEtBQUtILFNBQVosS0FBMEIsV0FBMUIsR0FBd0MsRUFBeEMsR0FBNkMsT0FBT0csS0FBS0gsU0FBdEYsQ0FBVDs7QUFFQSxPQUFLLElBQUlnQixJQUFJLENBQWIsRUFBZ0JBLElBQUliLEtBQUtPLEtBQUwsQ0FBV2MsTUFBL0IsRUFBdUNSLEdBQXZDLEVBQTRDO0FBQzFDLFFBQU1ZLE9BQU96QixLQUFLTyxLQUFMLENBQVdNLENBQVgsQ0FBYjtBQUNBcUIsUUFBSWpDLElBQUosQ0FDRSxTQUFTd0IsS0FBS0MsUUFBZCxHQUF5QixHQUF6QixHQUErQkQsS0FBS0UsUUFBcEMsR0FDRSxJQURGLEdBQ1NGLEtBQUtHLFFBRGQsR0FDeUIsR0FEekIsR0FDK0JILEtBQUtJLFFBRHBDLEdBRUUsS0FISjtBQUtBSyxRQUFJakMsSUFBSixDQUFTa0MsS0FBVCxDQUFlRCxHQUFmLEVBQW9CVCxLQUFLdEIsS0FBekI7QUFDRDs7QUFFRCxTQUFPK0IsSUFBSUUsSUFBSixDQUFTLElBQVQsSUFBaUIsSUFBeEI7QUFDRDs7QUFFTSxTQUFTN0MsV0FBVCxDQUFxQjhDLFFBQXJCLEVBQStCM0MsTUFBL0IsRUFBdUNDLE1BQXZDLEVBQStDQyxTQUEvQyxFQUEwREMsU0FBMUQsRUFBcUVDLE9BQXJFLEVBQThFO0FBQ25GLFNBQU9SLG9CQUFvQitDLFFBQXBCLEVBQThCQSxRQUE5QixFQUF3QzNDLE1BQXhDLEVBQWdEQyxNQUFoRCxFQUF3REMsU0FBeEQsRUFBbUVDLFNBQW5FLEVBQThFQyxPQUE5RSxDQUFQO0FBQ0QiLCJmaWxlIjoiY3JlYXRlLmpzIiwic291cmNlc0NvbnRlbnQiOlsiaW1wb3J0IHtkaWZmTGluZXN9IGZyb20gJy4uL2RpZmYvbGluZSc7XG5cbmV4cG9ydCBmdW5jdGlvbiBzdHJ1Y3R1cmVkUGF0Y2gob2xkRmlsZU5hbWUsIG5ld0ZpbGVOYW1lLCBvbGRTdHIsIG5ld1N0ciwgb2xkSGVhZGVyLCBuZXdIZWFkZXIsIG9wdGlvbnMpIHtcbiAgaWYgKCFvcHRpb25zKSB7XG4gICAgb3B0aW9ucyA9IHt9O1xuICB9XG4gIGlmICh0eXBlb2Ygb3B0aW9ucy5jb250ZXh0ID09PSAndW5kZWZpbmVkJykge1xuICAgIG9wdGlvbnMuY29udGV4dCA9IDQ7XG4gIH1cblxuICBjb25zdCBkaWZmID0gZGlmZkxpbmVzKG9sZFN0ciwgbmV3U3RyLCBvcHRpb25zKTtcbiAgZGlmZi5wdXNoKHt2YWx1ZTogJycsIGxpbmVzOiBbXX0pOyAgIC8vIEFwcGVuZCBhbiBlbXB0eSB2YWx1ZSB0byBtYWtlIGNsZWFudXAgZWFzaWVyXG5cbiAgZnVuY3Rpb24gY29udGV4dExpbmVzKGxpbmVzKSB7XG4gICAgcmV0dXJuIGxpbmVzLm1hcChmdW5jdGlvbihlbnRyeSkgeyByZXR1cm4gJyAnICsgZW50cnk7IH0pO1xuICB9XG5cbiAgbGV0IGh1bmtzID0gW107XG4gIGxldCBvbGRSYW5nZVN0YXJ0ID0gMCwgbmV3UmFuZ2VTdGFydCA9IDAsIGN1clJhbmdlID0gW10sXG4gICAgICBvbGRMaW5lID0gMSwgbmV3TGluZSA9IDE7XG4gIGZvciAobGV0IGkgPSAwOyBpIDwgZGlmZi5sZW5ndGg7IGkrKykge1xuICAgIGNvbnN0IGN1cnJlbnQgPSBkaWZmW2ldLFxuICAgICAgICAgIGxpbmVzID0gY3VycmVudC5saW5lcyB8fCBjdXJyZW50LnZhbHVlLnJlcGxhY2UoL1xcbiQvLCAnJykuc3BsaXQoJ1xcbicpO1xuICAgIGN1cnJlbnQubGluZXMgPSBsaW5lcztcblxuICAgIGlmIChjdXJyZW50LmFkZGVkIHx8IGN1cnJlbnQucmVtb3ZlZCkge1xuICAgICAgLy8gSWYgd2UgaGF2ZSBwcmV2aW91cyBjb250ZXh0LCBzdGFydCB3aXRoIHRoYXRcbiAgICAgIGlmICghb2xkUmFuZ2VTdGFydCkge1xuICAgICAgICBjb25zdCBwcmV2ID0gZGlmZltpIC0gMV07XG4gICAgICAgIG9sZFJhbmdlU3RhcnQgPSBvbGRMaW5lO1xuICAgICAgICBuZXdSYW5nZVN0YXJ0ID0gbmV3TGluZTtcblxuICAgICAgICBpZiAocHJldikge1xuICAgICAgICAgIGN1clJhbmdlID0gb3B0aW9ucy5jb250ZXh0ID4gMCA/IGNvbnRleHRMaW5lcyhwcmV2LmxpbmVzLnNsaWNlKC1vcHRpb25zLmNvbnRleHQpKSA6IFtdO1xuICAgICAgICAgIG9sZFJhbmdlU3RhcnQgLT0gY3VyUmFuZ2UubGVuZ3RoO1xuICAgICAgICAgIG5ld1JhbmdlU3RhcnQgLT0gY3VyUmFuZ2UubGVuZ3RoO1xuICAgICAgICB9XG4gICAgICB9XG5cbiAgICAgIC8vIE91dHB1dCBvdXIgY2hhbmdlc1xuICAgICAgY3VyUmFuZ2UucHVzaCguLi4gbGluZXMubWFwKGZ1bmN0aW9uKGVudHJ5KSB7XG4gICAgICAgIHJldHVybiAoY3VycmVudC5hZGRlZCA/ICcrJyA6ICctJykgKyBlbnRyeTtcbiAgICAgIH0pKTtcblxuICAgICAgLy8gVHJhY2sgdGhlIHVwZGF0ZWQgZmlsZSBwb3NpdGlvblxuICAgICAgaWYgKGN1cnJlbnQuYWRkZWQpIHtcbiAgICAgICAgbmV3TGluZSArPSBsaW5lcy5sZW5ndGg7XG4gICAgICB9IGVsc2Uge1xuICAgICAgICBvbGRMaW5lICs9IGxpbmVzLmxlbmd0aDtcbiAgICAgIH1cbiAgICB9IGVsc2Uge1xuICAgICAgLy8gSWRlbnRpY2FsIGNvbnRleHQgbGluZXMuIFRyYWNrIGxpbmUgY2hhbmdlc1xuICAgICAgaWYgKG9sZFJhbmdlU3RhcnQpIHtcbiAgICAgICAgLy8gQ2xvc2Ugb3V0IGFueSBjaGFuZ2VzIHRoYXQgaGF2ZSBiZWVuIG91dHB1dCAob3Igam9pbiBvdmVybGFwcGluZylcbiAgICAgICAgaWYgKGxpbmVzLmxlbmd0aCA8PSBvcHRpb25zLmNvbnRleHQgKiAyICYmIGkgPCBkaWZmLmxlbmd0aCAtIDIpIHtcbiAgICAgICAgICAvLyBPdmVybGFwcGluZ1xuICAgICAgICAgIGN1clJhbmdlLnB1c2goLi4uIGNvbnRleHRMaW5lcyhsaW5lcykpO1xuICAgICAgICB9IGVsc2Uge1xuICAgICAgICAgIC8vIGVuZCB0aGUgcmFuZ2UgYW5kIG91dHB1dFxuICAgICAgICAgIGxldCBjb250ZXh0U2l6ZSA9IE1hdGgubWluKGxpbmVzLmxlbmd0aCwgb3B0aW9ucy5jb250ZXh0KTtcbiAgICAgICAgICBjdXJSYW5nZS5wdXNoKC4uLiBjb250ZXh0TGluZXMobGluZXMuc2xpY2UoMCwgY29udGV4dFNpemUpKSk7XG5cbiAgICAgICAgICBsZXQgaHVuayA9IHtcbiAgICAgICAgICAgIG9sZFN0YXJ0OiBvbGRSYW5nZVN0YXJ0LFxuICAgICAgICAgICAgb2xkTGluZXM6IChvbGRMaW5lIC0gb2xkUmFuZ2VTdGFydCArIGNvbnRleHRTaXplKSxcbiAgICAgICAgICAgIG5ld1N0YXJ0OiBuZXdSYW5nZVN0YXJ0LFxuICAgICAgICAgICAgbmV3TGluZXM6IChuZXdMaW5lIC0gbmV3UmFuZ2VTdGFydCArIGNvbnRleHRTaXplKSxcbiAgICAgICAgICAgIGxpbmVzOiBjdXJSYW5nZVxuICAgICAgICAgIH07XG4gICAgICAgICAgaWYgKGkgPj0gZGlmZi5sZW5ndGggLSAyICYmIGxpbmVzLmxlbmd0aCA8PSBvcHRpb25zLmNvbnRleHQpIHtcbiAgICAgICAgICAgIC8vIEVPRiBpcyBpbnNpZGUgdGhpcyBodW5rXG4gICAgICAgICAgICBsZXQgb2xkRU9GTmV3bGluZSA9ICgvXFxuJC8udGVzdChvbGRTdHIpKTtcbiAgICAgICAgICAgIGxldCBuZXdFT0ZOZXdsaW5lID0gKC9cXG4kLy50ZXN0KG5ld1N0cikpO1xuICAgICAgICAgICAgaWYgKGxpbmVzLmxlbmd0aCA9PSAwICYmICFvbGRFT0ZOZXdsaW5lKSB7XG4gICAgICAgICAgICAgIC8vIHNwZWNpYWwgY2FzZTogb2xkIGhhcyBubyBlb2wgYW5kIG5vIHRyYWlsaW5nIGNvbnRleHQ7IG5vLW5sIGNhbiBlbmQgdXAgYmVmb3JlIGFkZHNcbiAgICAgICAgICAgICAgY3VyUmFuZ2Uuc3BsaWNlKGh1bmsub2xkTGluZXMsIDAsICdcXFxcIE5vIG5ld2xpbmUgYXQgZW5kIG9mIGZpbGUnKTtcbiAgICAgICAgICAgIH0gZWxzZSBpZiAoIW9sZEVPRk5ld2xpbmUgfHwgIW5ld0VPRk5ld2xpbmUpIHtcbiAgICAgICAgICAgICAgY3VyUmFuZ2UucHVzaCgnXFxcXCBObyBuZXdsaW5lIGF0IGVuZCBvZiBmaWxlJyk7XG4gICAgICAgICAgICB9XG4gICAgICAgICAgfVxuICAgICAgICAgIGh1bmtzLnB1c2goaHVuayk7XG5cbiAgICAgICAgICBvbGRSYW5nZVN0YXJ0ID0gMDtcbiAgICAgICAgICBuZXdSYW5nZVN0YXJ0ID0gMDtcbiAgICAgICAgICBjdXJSYW5nZSA9IFtdO1xuICAgICAgICB9XG4gICAgICB9XG4gICAgICBvbGRMaW5lICs9IGxpbmVzLmxlbmd0aDtcbiAgICAgIG5ld0xpbmUgKz0gbGluZXMubGVuZ3RoO1xuICAgIH1cbiAgfVxuXG4gIHJldHVybiB7XG4gICAgb2xkRmlsZU5hbWU6IG9sZEZpbGVOYW1lLCBuZXdGaWxlTmFtZTogbmV3RmlsZU5hbWUsXG4gICAgb2xkSGVhZGVyOiBvbGRIZWFkZXIsIG5ld0hlYWRlcjogbmV3SGVhZGVyLFxuICAgIGh1bmtzOiBodW5rc1xuICB9O1xufVxuXG5leHBvcnQgZnVuY3Rpb24gY3JlYXRlVHdvRmlsZXNQYXRjaChvbGRGaWxlTmFtZSwgbmV3RmlsZU5hbWUsIG9sZFN0ciwgbmV3U3RyLCBvbGRIZWFkZXIsIG5ld0hlYWRlciwgb3B0aW9ucykge1xuICBjb25zdCBkaWZmID0gc3RydWN0dXJlZFBhdGNoKG9sZEZpbGVOYW1lLCBuZXdGaWxlTmFtZSwgb2xkU3RyLCBuZXdTdHIsIG9sZEhlYWRlciwgbmV3SGVhZGVyLCBvcHRpb25zKTtcblxuICBjb25zdCByZXQgPSBbXTtcbiAgaWYgKG9sZEZpbGVOYW1lID09IG5ld0ZpbGVOYW1lKSB7XG4gICAgcmV0LnB1c2goJ0luZGV4OiAnICsgb2xkRmlsZU5hbWUpO1xuICB9XG4gIHJldC5wdXNoKCc9PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09Jyk7XG4gIHJldC5wdXNoKCctLS0gJyArIGRpZmYub2xkRmlsZU5hbWUgKyAodHlwZW9mIGRpZmYub2xkSGVhZGVyID09PSAndW5kZWZpbmVkJyA/ICcnIDogJ1xcdCcgKyBkaWZmLm9sZEhlYWRlcikpO1xuICByZXQucHVzaCgnKysrICcgKyBkaWZmLm5ld0ZpbGVOYW1lICsgKHR5cGVvZiBkaWZmLm5ld0hlYWRlciA9PT0gJ3VuZGVmaW5lZCcgPyAnJyA6ICdcXHQnICsgZGlmZi5uZXdIZWFkZXIpKTtcblxuICBmb3IgKGxldCBpID0gMDsgaSA8IGRpZmYuaHVua3MubGVuZ3RoOyBpKyspIHtcbiAgICBjb25zdCBodW5rID0gZGlmZi5odW5rc1tpXTtcbiAgICByZXQucHVzaChcbiAgICAgICdAQCAtJyArIGh1bmsub2xkU3RhcnQgKyAnLCcgKyBodW5rLm9sZExpbmVzXG4gICAgICArICcgKycgKyBodW5rLm5ld1N0YXJ0ICsgJywnICsgaHVuay5uZXdMaW5lc1xuICAgICAgKyAnIEBAJ1xuICAgICk7XG4gICAgcmV0LnB1c2guYXBwbHkocmV0LCBodW5rLmxpbmVzKTtcbiAgfVxuXG4gIHJldHVybiByZXQuam9pbignXFxuJykgKyAnXFxuJztcbn1cblxuZXhwb3J0IGZ1bmN0aW9uIGNyZWF0ZVBhdGNoKGZpbGVOYW1lLCBvbGRTdHIsIG5ld1N0ciwgb2xkSGVhZGVyLCBuZXdIZWFkZXIsIG9wdGlvbnMpIHtcbiAgcmV0dXJuIGNyZWF0ZVR3b0ZpbGVzUGF0Y2goZmlsZU5hbWUsIGZpbGVOYW1lLCBvbGRTdHIsIG5ld1N0ciwgb2xkSGVhZGVyLCBuZXdIZWFkZXIsIG9wdGlvbnMpO1xufVxuIl19
+
+
+/***/ }),
+/* 15 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/"use strict";
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/arrayEqual = arrayEqual;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/arrayStartsWith = arrayStartsWith;
+	function arrayEqual(a, b) {
+	  if (a.length !== b.length) {
+	    return false;
+	  }
+
+	  return arrayStartsWith(a, b);
+	}
+
+	function arrayStartsWith(array, start) {
+	  if (start.length > array.length) {
+	    return false;
+	  }
+
+	  for (var i = 0; i < start.length; i++) {
+	    if (start[i] !== array[i]) {
+	      return false;
+	    }
+	  }
+
+	  return true;
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy91dGlsL2FycmF5LmpzIl0sIm5hbWVzIjpbImFycmF5RXF1YWwiLCJhcnJheVN0YXJ0c1dpdGgiLCJhIiwiYiIsImxlbmd0aCIsImFycmF5Iiwic3RhcnQiLCJpIl0sIm1hcHBpbmdzIjoiOzs7Z0NBQWdCQSxVLEdBQUFBLFU7eURBUUFDLGUsR0FBQUEsZTtBQVJULFNBQVNELFVBQVQsQ0FBb0JFLENBQXBCLEVBQXVCQyxDQUF2QixFQUEwQjtBQUMvQixNQUFJRCxFQUFFRSxNQUFGLEtBQWFELEVBQUVDLE1BQW5CLEVBQTJCO0FBQ3pCLFdBQU8sS0FBUDtBQUNEOztBQUVELFNBQU9ILGdCQUFnQkMsQ0FBaEIsRUFBbUJDLENBQW5CLENBQVA7QUFDRDs7QUFFTSxTQUFTRixlQUFULENBQXlCSSxLQUF6QixFQUFnQ0MsS0FBaEMsRUFBdUM7QUFDNUMsTUFBSUEsTUFBTUYsTUFBTixHQUFlQyxNQUFNRCxNQUF6QixFQUFpQztBQUMvQixXQUFPLEtBQVA7QUFDRDs7QUFFRCxPQUFLLElBQUlHLElBQUksQ0FBYixFQUFnQkEsSUFBSUQsTUFBTUYsTUFBMUIsRUFBa0NHLEdBQWxDLEVBQXVDO0FBQ3JDLFFBQUlELE1BQU1DLENBQU4sTUFBYUYsTUFBTUUsQ0FBTixDQUFqQixFQUEyQjtBQUN6QixhQUFPLEtBQVA7QUFDRDtBQUNGOztBQUVELFNBQU8sSUFBUDtBQUNEIiwiZmlsZSI6ImFycmF5LmpzIiwic291cmNlc0NvbnRlbnQiOlsiZXhwb3J0IGZ1bmN0aW9uIGFycmF5RXF1YWwoYSwgYikge1xuICBpZiAoYS5sZW5ndGggIT09IGIubGVuZ3RoKSB7XG4gICAgcmV0dXJuIGZhbHNlO1xuICB9XG5cbiAgcmV0dXJuIGFycmF5U3RhcnRzV2l0aChhLCBiKTtcbn1cblxuZXhwb3J0IGZ1bmN0aW9uIGFycmF5U3RhcnRzV2l0aChhcnJheSwgc3RhcnQpIHtcbiAgaWYgKHN0YXJ0Lmxlbmd0aCA+IGFycmF5Lmxlbmd0aCkge1xuICAgIHJldHVybiBmYWxzZTtcbiAgfVxuXG4gIGZvciAobGV0IGkgPSAwOyBpIDwgc3RhcnQubGVuZ3RoOyBpKyspIHtcbiAgICBpZiAoc3RhcnRbaV0gIT09IGFycmF5W2ldKSB7XG4gICAgICByZXR1cm4gZmFsc2U7XG4gICAgfVxuICB9XG5cbiAgcmV0dXJuIHRydWU7XG59XG4iXX0=
+
+
+/***/ }),
+/* 16 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/"use strict";
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/convertChangesToDMP = convertChangesToDMP;
+	// See: http://code.google.com/p/google-diff-match-patch/wiki/API
+	function convertChangesToDMP(changes) {
+	  var ret = [],
+	      change = /*istanbul ignore start*/void 0 /*istanbul ignore end*/,
+	      operation = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+	  for (var i = 0; i < changes.length; i++) {
+	    change = changes[i];
+	    if (change.added) {
+	      operation = 1;
+	    } else if (change.removed) {
+	      operation = -1;
+	    } else {
+	      operation = 0;
+	    }
+
+	    ret.push([operation, change.value]);
+	  }
+	  return ret;
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9jb252ZXJ0L2RtcC5qcyJdLCJuYW1lcyI6WyJjb252ZXJ0Q2hhbmdlc1RvRE1QIiwiY2hhbmdlcyIsInJldCIsImNoYW5nZSIsIm9wZXJhdGlvbiIsImkiLCJsZW5ndGgiLCJhZGRlZCIsInJlbW92ZWQiLCJwdXNoIiwidmFsdWUiXSwibWFwcGluZ3MiOiI7OztnQ0FDZ0JBLG1CLEdBQUFBLG1CO0FBRGhCO0FBQ08sU0FBU0EsbUJBQVQsQ0FBNkJDLE9BQTdCLEVBQXNDO0FBQzNDLE1BQUlDLE1BQU0sRUFBVjtBQUFBLE1BQ0lDLHdDQURKO0FBQUEsTUFFSUMsMkNBRko7QUFHQSxPQUFLLElBQUlDLElBQUksQ0FBYixFQUFnQkEsSUFBSUosUUFBUUssTUFBNUIsRUFBb0NELEdBQXBDLEVBQXlDO0FBQ3ZDRixhQUFTRixRQUFRSSxDQUFSLENBQVQ7QUFDQSxRQUFJRixPQUFPSSxLQUFYLEVBQWtCO0FBQ2hCSCxrQkFBWSxDQUFaO0FBQ0QsS0FGRCxNQUVPLElBQUlELE9BQU9LLE9BQVgsRUFBb0I7QUFDekJKLGtCQUFZLENBQUMsQ0FBYjtBQUNELEtBRk0sTUFFQTtBQUNMQSxrQkFBWSxDQUFaO0FBQ0Q7O0FBRURGLFFBQUlPLElBQUosQ0FBUyxDQUFDTCxTQUFELEVBQVlELE9BQU9PLEtBQW5CLENBQVQ7QUFDRDtBQUNELFNBQU9SLEdBQVA7QUFDRCIsImZpbGUiOiJkbXAuanMiLCJzb3VyY2VzQ29udGVudCI6WyIvLyBTZWU6IGh0dHA6Ly9jb2RlLmdvb2dsZS5jb20vcC9nb29nbGUtZGlmZi1tYXRjaC1wYXRjaC93aWtpL0FQSVxuZXhwb3J0IGZ1bmN0aW9uIGNvbnZlcnRDaGFuZ2VzVG9ETVAoY2hhbmdlcykge1xuICBsZXQgcmV0ID0gW10sXG4gICAgICBjaGFuZ2UsXG4gICAgICBvcGVyYXRpb247XG4gIGZvciAobGV0IGkgPSAwOyBpIDwgY2hhbmdlcy5sZW5ndGg7IGkrKykge1xuICAgIGNoYW5nZSA9IGNoYW5nZXNbaV07XG4gICAgaWYgKGNoYW5nZS5hZGRlZCkge1xuICAgICAgb3BlcmF0aW9uID0gMTtcbiAgICB9IGVsc2UgaWYgKGNoYW5nZS5yZW1vdmVkKSB7XG4gICAgICBvcGVyYXRpb24gPSAtMTtcbiAgICB9IGVsc2Uge1xuICAgICAgb3BlcmF0aW9uID0gMDtcbiAgICB9XG5cbiAgICByZXQucHVzaChbb3BlcmF0aW9uLCBjaGFuZ2UudmFsdWVdKTtcbiAgfVxuICByZXR1cm4gcmV0O1xufVxuIl19
+
+
+/***/ }),
+/* 17 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/convertChangesToXML = convertChangesToXML;
+	function convertChangesToXML(changes) {
+	  var ret = [];
+	  for (var i = 0; i < changes.length; i++) {
+	    var change = changes[i];
+	    if (change.added) {
+	      ret.push('');
+	    } else if (change.removed) {
+	      ret.push('');
+	    }
+
+	    ret.push(escapeHTML(change.value));
+
+	    if (change.added) {
+	      ret.push('');
+	    } else if (change.removed) {
+	      ret.push('');
+	    }
+	  }
+	  return ret.join('');
+	}
+
+	function escapeHTML(s) {
+	  var n = s;
+	  n = n.replace(/&/g, '&');
+	  n = n.replace(//g, '>');
+	  n = n.replace(/"/g, '"');
+
+	  return n;
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9jb252ZXJ0L3htbC5qcyJdLCJuYW1lcyI6WyJjb252ZXJ0Q2hhbmdlc1RvWE1MIiwiY2hhbmdlcyIsInJldCIsImkiLCJsZW5ndGgiLCJjaGFuZ2UiLCJhZGRlZCIsInB1c2giLCJyZW1vdmVkIiwiZXNjYXBlSFRNTCIsInZhbHVlIiwiam9pbiIsInMiLCJuIiwicmVwbGFjZSJdLCJtYXBwaW5ncyI6Ijs7O2dDQUFnQkEsbUIsR0FBQUEsbUI7QUFBVCxTQUFTQSxtQkFBVCxDQUE2QkMsT0FBN0IsRUFBc0M7QUFDM0MsTUFBSUMsTUFBTSxFQUFWO0FBQ0EsT0FBSyxJQUFJQyxJQUFJLENBQWIsRUFBZ0JBLElBQUlGLFFBQVFHLE1BQTVCLEVBQW9DRCxHQUFwQyxFQUF5QztBQUN2QyxRQUFJRSxTQUFTSixRQUFRRSxDQUFSLENBQWI7QUFDQSxRQUFJRSxPQUFPQyxLQUFYLEVBQWtCO0FBQ2hCSixVQUFJSyxJQUFKLENBQVMsT0FBVDtBQUNELEtBRkQsTUFFTyxJQUFJRixPQUFPRyxPQUFYLEVBQW9CO0FBQ3pCTixVQUFJSyxJQUFKLENBQVMsT0FBVDtBQUNEOztBQUVETCxRQUFJSyxJQUFKLENBQVNFLFdBQVdKLE9BQU9LLEtBQWxCLENBQVQ7O0FBRUEsUUFBSUwsT0FBT0MsS0FBWCxFQUFrQjtBQUNoQkosVUFBSUssSUFBSixDQUFTLFFBQVQ7QUFDRCxLQUZELE1BRU8sSUFBSUYsT0FBT0csT0FBWCxFQUFvQjtBQUN6Qk4sVUFBSUssSUFBSixDQUFTLFFBQVQ7QUFDRDtBQUNGO0FBQ0QsU0FBT0wsSUFBSVMsSUFBSixDQUFTLEVBQVQsQ0FBUDtBQUNEOztBQUVELFNBQVNGLFVBQVQsQ0FBb0JHLENBQXBCLEVBQXVCO0FBQ3JCLE1BQUlDLElBQUlELENBQVI7QUFDQUMsTUFBSUEsRUFBRUMsT0FBRixDQUFVLElBQVYsRUFBZ0IsT0FBaEIsQ0FBSjtBQUNBRCxNQUFJQSxFQUFFQyxPQUFGLENBQVUsSUFBVixFQUFnQixNQUFoQixDQUFKO0FBQ0FELE1BQUlBLEVBQUVDLE9BQUYsQ0FBVSxJQUFWLEVBQWdCLE1BQWhCLENBQUo7QUFDQUQsTUFBSUEsRUFBRUMsT0FBRixDQUFVLElBQVYsRUFBZ0IsUUFBaEIsQ0FBSjs7QUFFQSxTQUFPRCxDQUFQO0FBQ0QiLCJmaWxlIjoieG1sLmpzIiwic291cmNlc0NvbnRlbnQiOlsiZXhwb3J0IGZ1bmN0aW9uIGNvbnZlcnRDaGFuZ2VzVG9YTUwoY2hhbmdlcykge1xuICBsZXQgcmV0ID0gW107XG4gIGZvciAobGV0IGkgPSAwOyBpIDwgY2hhbmdlcy5sZW5ndGg7IGkrKykge1xuICAgIGxldCBjaGFuZ2UgPSBjaGFuZ2VzW2ldO1xuICAgIGlmIChjaGFuZ2UuYWRkZWQpIHtcbiAgICAgIHJldC5wdXNoKCc8aW5zPicpO1xuICAgIH0gZWxzZSBpZiAoY2hhbmdlLnJlbW92ZWQpIHtcbiAgICAgIHJldC5wdXNoKCc8ZGVsPicpO1xuICAgIH1cblxuICAgIHJldC5wdXNoKGVzY2FwZUhUTUwoY2hhbmdlLnZhbHVlKSk7XG5cbiAgICBpZiAoY2hhbmdlLmFkZGVkKSB7XG4gICAgICByZXQucHVzaCgnPC9pbnM+Jyk7XG4gICAgfSBlbHNlIGlmIChjaGFuZ2UucmVtb3ZlZCkge1xuICAgICAgcmV0LnB1c2goJzwvZGVsPicpO1xuICAgIH1cbiAgfVxuICByZXR1cm4gcmV0LmpvaW4oJycpO1xufVxuXG5mdW5jdGlvbiBlc2NhcGVIVE1MKHMpIHtcbiAgbGV0IG4gPSBzO1xuICBuID0gbi5yZXBsYWNlKC8mL2csICcmYW1wOycpO1xuICBuID0gbi5yZXBsYWNlKC88L2csICcmbHQ7Jyk7XG4gIG4gPSBuLnJlcGxhY2UoLz4vZywgJyZndDsnKTtcbiAgbiA9IG4ucmVwbGFjZSgvXCIvZywgJyZxdW90OycpO1xuXG4gIHJldHVybiBuO1xufVxuIl19
+
+
+/***/ })
+/******/ ])
+});
+;
\ No newline at end of file
diff --git a/node_modules/diff/dist/diff.min.js b/node_modules/diff/dist/diff.min.js
new file mode 100644
index 0000000..5049f84
--- /dev/null
+++ b/node_modules/diff/dist/diff.min.js
@@ -0,0 +1,416 @@
+/*!
+
+ diff v3.5.0
+
+Software License Agreement (BSD License)
+
+Copyright (c) 2009-2015, Kevin Decker 
+
+All rights reserved.
+
+Redistribution and use of this software in source and binary forms, with or without modification,
+are permitted provided that the following conditions are met:
+
+* Redistributions of source code must retain the above
+  copyright notice, this list of conditions and the
+  following disclaimer.
+
+* Redistributions in binary form must reproduce the above
+  copyright notice, this list of conditions and the
+  following disclaimer in the documentation and/or other
+  materials provided with the distribution.
+
+* Neither the name of Kevin Decker nor the names of its
+  contributors may be used to endorse or promote products
+  derived from this software without specific prior
+  written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR
+IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND
+FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR
+CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER
+IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT
+OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+@license
+*/
+!function(a,b){"object"==typeof exports&&"object"==typeof module?module.exports=b():"function"==typeof define&&define.amd?define([],b):"object"==typeof exports?exports.JsDiff=b():a.JsDiff=b()}(this,function(){/******/
+return function(a){/******/
+// The require function
+/******/
+function b(d){/******/
+// Check if module is in cache
+/******/
+if(c[d])/******/
+return c[d].exports;/******/
+// Create a new module (and put it into the cache)
+/******/
+var e=c[d]={/******/
+exports:{},/******/
+id:d,/******/
+loaded:!1};/******/
+// Return the exports of the module
+/******/
+/******/
+// Execute the module function
+/******/
+/******/
+// Flag the module as loaded
+/******/
+return a[d].call(e.exports,e,e.exports,b),e.loaded=!0,e.exports}// webpackBootstrap
+/******/
+// The module cache
+/******/
+var c={};/******/
+// Load entry module and return exports
+/******/
+/******/
+// expose the modules object (__webpack_modules__)
+/******/
+/******/
+// expose the module cache
+/******/
+/******/
+// __webpack_public_path__
+/******/
+return b.m=a,b.c=c,b.p="",b(0)}([/* 0 */
+/***/
+function(a,b,c){/*istanbul ignore start*/
+"use strict";/*istanbul ignore start*/
+function d(a){return a&&a.__esModule?a:{"default":a}}b.__esModule=!0,b.canonicalize=b.convertChangesToXML=b.convertChangesToDMP=b.merge=b.parsePatch=b.applyPatches=b.applyPatch=b.createPatch=b.createTwoFilesPatch=b.structuredPatch=b.diffArrays=b.diffJson=b.diffCss=b.diffSentences=b.diffTrimmedLines=b.diffLines=b.diffWordsWithSpace=b.diffWords=b.diffChars=b.Diff=void 0;/*istanbul ignore end*/
+var/*istanbul ignore start*/e=c(1),f=d(e),/*istanbul ignore start*/g=c(2),/*istanbul ignore start*/h=c(3),/*istanbul ignore start*/i=c(5),/*istanbul ignore start*/j=c(6),/*istanbul ignore start*/k=c(7),/*istanbul ignore start*/l=c(8),/*istanbul ignore start*/m=c(9),/*istanbul ignore start*/n=c(10),/*istanbul ignore start*/o=c(11),/*istanbul ignore start*/p=c(13),/*istanbul ignore start*/q=c(14),/*istanbul ignore start*/r=c(16),/*istanbul ignore start*/s=c(17);/* See LICENSE file for terms of use */
+/*
+	 * Text diff implementation.
+	 *
+	 * This library supports the following APIS:
+	 * JsDiff.diffChars: Character by character diff
+	 * JsDiff.diffWords: Word (as defined by \b regex) diff which ignores whitespace
+	 * JsDiff.diffLines: Line based diff
+	 *
+	 * JsDiff.diffCss: Diff targeted at CSS content
+	 *
+	 * These methods are based on the implementation proposed in
+	 * "An O(ND) Difference Algorithm and its Variations" (Myers, 1986).
+	 * http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.4.6927
+	 */
+b.Diff=f["default"],/*istanbul ignore start*/
+b.diffChars=g.diffChars,/*istanbul ignore start*/
+b.diffWords=h.diffWords,/*istanbul ignore start*/
+b.diffWordsWithSpace=h.diffWordsWithSpace,/*istanbul ignore start*/
+b.diffLines=i.diffLines,/*istanbul ignore start*/
+b.diffTrimmedLines=i.diffTrimmedLines,/*istanbul ignore start*/
+b.diffSentences=j.diffSentences,/*istanbul ignore start*/
+b.diffCss=k.diffCss,/*istanbul ignore start*/
+b.diffJson=l.diffJson,/*istanbul ignore start*/
+b.diffArrays=m.diffArrays,/*istanbul ignore start*/
+b.structuredPatch=q.structuredPatch,/*istanbul ignore start*/
+b.createTwoFilesPatch=q.createTwoFilesPatch,/*istanbul ignore start*/
+b.createPatch=q.createPatch,/*istanbul ignore start*/
+b.applyPatch=n.applyPatch,/*istanbul ignore start*/
+b.applyPatches=n.applyPatches,/*istanbul ignore start*/
+b.parsePatch=o.parsePatch,/*istanbul ignore start*/
+b.merge=p.merge,/*istanbul ignore start*/
+b.convertChangesToDMP=r.convertChangesToDMP,/*istanbul ignore start*/
+b.convertChangesToXML=s.convertChangesToXML,/*istanbul ignore start*/
+b.canonicalize=l.canonicalize},/* 1 */
+/***/
+function(a,b){/*istanbul ignore start*/
+"use strict";function c(){}function d(a,b,c,d,e){for(var f=0,g=b.length,h=0,i=0;fa.length?c:a}),j.value=a.join(l)}else j.value=a.join(c.slice(h,h+j.count));h+=j.count,
+// Common case
+j.added||(i+=j.count)}}
+// Special case handle for when one terminal is ignored (i.e. whitespace).
+// For this case we merge the terminal into the prior string and drop the change.
+// This is only available for string mode.
+var m=b[g-1];return g>1&&"string"==typeof m.value&&(m.added||m.removed)&&a.equals("",m.value)&&(b[g-2].value+=m.value,b.pop()),b}function e(a){return{newPos:a.newPos,components:a.components.slice(0)}}b.__esModule=!0,b["default"]=/*istanbul ignore end*/c,c.prototype={/*istanbul ignore start*/
+/*istanbul ignore end*/
+diff:function(a,b){function c(a){return h?(setTimeout(function(){h(void 0,a)},0),!0):a}
+// Main worker method. checks all permutations of a given edit length for acceptance.
+function f(){for(var f=-1*l;f<=l;f+=2){var g=/*istanbul ignore start*/void 0,h=n[f-1],m=n[f+1],o=(m?m.newPos:0)-f;h&&(
+// No one else is going to attempt to use this value, clear it
+n[f-1]=void 0);var p=h&&h.newPos+1=j&&o+1>=k)return c(d(i,g.components,b,a,i.useLongestToken));
+// Otherwise track this path as a potential candidate and continue.
+n[f]=g}else
+// If this path is a terminal then prune
+n[f]=void 0}l++}/*istanbul ignore start*/
+var/*istanbul ignore end*/g=arguments.length>2&&void 0!==arguments[2]?arguments[2]:{},h=g.callback;"function"==typeof g&&(h=g,g={}),this.options=g;var i=this;
+// Allow subclasses to massage the input prior to running
+a=this.castInput(a),b=this.castInput(b),a=this.removeEmpty(this.tokenize(a)),b=this.removeEmpty(this.tokenize(b));var j=b.length,k=a.length,l=1,m=j+k,n=[{newPos:-1,components:[]}],o=this.extractCommon(n[0],b,a,0);if(n[0].newPos+1>=j&&o+1>=k)
+// Identity per the equality and tokenizer
+return c([{value:this.join(b),count:b.length}]);
+// Performs the length of edit iteration. Is a bit fugly as this has to support the
+// sync and async mode which is never fun. Loops over execEditLength until a value
+// is produced.
+if(h)!function q(){setTimeout(function(){
+// This should not happen, but we want to be safe.
+/* istanbul ignore next */
+// This should not happen, but we want to be safe.
+/* istanbul ignore next */
+return l>m?h():void(f()||q())},0)}();else for(;l<=m;){var p=f();if(p)return p}},/*istanbul ignore start*/
+/*istanbul ignore end*/
+pushComponent:function(a,b,c){var d=a[a.length-1];d&&d.added===b&&d.removed===c?
+// We need to clone here as the component clone operation is just
+// as shallow array clone
+a[a.length-1]={count:d.count+1,added:b,removed:c}:a.push({count:1,added:b,removed:c})},/*istanbul ignore start*/
+/*istanbul ignore end*/
+extractCommon:function(a,b,c,d){for(var e=b.length,f=c.length,g=a.newPos,h=g-d,i=0;g+10?d[0]:" ",g=d.length>0?d.substr(1):d;if(" "===f||"-"===f){
+// Context sanity check
+if(!j(b+1,e[b],f,g)&&(k++,k>l))return!1;b++}}return!0}/*istanbul ignore start*/
+var/*istanbul ignore end*/d=arguments.length>2&&void 0!==arguments[2]?arguments[2]:{};if("string"==typeof b&&(b=/*istanbul ignore start*/(0,g.parsePatch)(b)),Array.isArray(b)){if(b.length>1)throw new Error("applyPatch only works with a single input.");b=b[0]}
+// Search best fit offsets for each hunk based on the previous ones
+for(var e=a.split(/\r\n|[\n\v\f\r\x85]/),f=a.match(/\r\n|[\n\v\f\r\x85]/g)||[],h=b.hunks,j=d.compareLine||function(a,b,c,d){/*istanbul ignore end*/
+return b===d},k=0,l=d.fuzzFactor||0,m=0,n=0,o=/*istanbul ignore start*/void 0,p=/*istanbul ignore start*/void 0,q=0;q0?B[0]:" ",D=B.length>0?B.substr(1):B,E=y.linedelimiters[A];if(" "===C)z++;else if("-"===C)e.splice(z,1),f.splice(z,1);else if("+"===C)e.splice(z,0,D),f.splice(z,0,E),z++;else if("\\"===C){var F=y.lines[A-1]?y.lines[A-1][0]:null;"+"===F?o=!0:"-"===F&&(p=!0)}}}
+// Handle EOFNL insertion/removal
+if(o)for(;!e[e.length-1];)e.pop(),f.pop();else p&&(e.push(""),f.push("\n"));for(var G=0;G1&&void 0!==arguments[1]?arguments[1]:{},f=a.split(/\r\n|[\n\v\f\r\x85]/),g=a.match(/\r\n|[\n\v\f\r\x85]/g)||[],h=[],i=0;i0?j(h.lines.slice(-i.context)):[],m-=o.length,n-=o.length)}
+// Output our changes
+/*istanbul ignore start*/
+(g=/*istanbul ignore end*/o).push.apply(/*istanbul ignore start*/g,/*istanbul ignore start*/d(/*istanbul ignore end*/f.map(function(a){return(b.added?"+":"-")+a}))),
+// Track the updated file position
+b.added?q+=f.length:p+=f.length}else{
+// Identical context lines. Track line changes
+if(m)
+// Close out any changes that have been output (or join overlapping)
+if(f.length<=2*i.context&&a=k.length-2&&f.length<=i.context){
+// EOF is inside this hunk
+var v=/\n$/.test(c),w=/\n$/.test(e);0!=f.length||v?v&&w||o.push("\\ No newline at end of file"):
+// special case: old has no eol and no trailing context; no-nl can end up before adds
+o.splice(u.oldLines,0,"\\ No newline at end of file")}l.push(u),m=0,n=0,o=[]}p+=f.length,q+=f.length}},s=0;sa.length)return!1;for(var c=0;c"):e.removed&&b.push(""),b.push(d(e.value)),e.added?b.push(""):e.removed&&b.push("")}return b.join("")}function d(a){var b=a;return b=b.replace(/&/g,"&"),b=b.replace(//g,">"),b=b.replace(/"/g,""")}b.__esModule=!0,b.convertChangesToXML=c}])});
\ No newline at end of file
diff --git a/node_modules/diff/lib/convert/dmp.js b/node_modules/diff/lib/convert/dmp.js
new file mode 100644
index 0000000..b9b646f
--- /dev/null
+++ b/node_modules/diff/lib/convert/dmp.js
@@ -0,0 +1,24 @@
+/*istanbul ignore start*/"use strict";
+
+exports.__esModule = true;
+exports. /*istanbul ignore end*/convertChangesToDMP = convertChangesToDMP;
+// See: http://code.google.com/p/google-diff-match-patch/wiki/API
+function convertChangesToDMP(changes) {
+  var ret = [],
+      change = /*istanbul ignore start*/void 0 /*istanbul ignore end*/,
+      operation = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+  for (var i = 0; i < changes.length; i++) {
+    change = changes[i];
+    if (change.added) {
+      operation = 1;
+    } else if (change.removed) {
+      operation = -1;
+    } else {
+      operation = 0;
+    }
+
+    ret.push([operation, change.value]);
+  }
+  return ret;
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9jb252ZXJ0L2RtcC5qcyJdLCJuYW1lcyI6WyJjb252ZXJ0Q2hhbmdlc1RvRE1QIiwiY2hhbmdlcyIsInJldCIsImNoYW5nZSIsIm9wZXJhdGlvbiIsImkiLCJsZW5ndGgiLCJhZGRlZCIsInJlbW92ZWQiLCJwdXNoIiwidmFsdWUiXSwibWFwcGluZ3MiOiI7OztnQ0FDZ0JBLG1CLEdBQUFBLG1CO0FBRGhCO0FBQ08sU0FBU0EsbUJBQVQsQ0FBNkJDLE9BQTdCLEVBQXNDO0FBQzNDLE1BQUlDLE1BQU0sRUFBVjtBQUFBLE1BQ0lDLHdDQURKO0FBQUEsTUFFSUMsMkNBRko7QUFHQSxPQUFLLElBQUlDLElBQUksQ0FBYixFQUFnQkEsSUFBSUosUUFBUUssTUFBNUIsRUFBb0NELEdBQXBDLEVBQXlDO0FBQ3ZDRixhQUFTRixRQUFRSSxDQUFSLENBQVQ7QUFDQSxRQUFJRixPQUFPSSxLQUFYLEVBQWtCO0FBQ2hCSCxrQkFBWSxDQUFaO0FBQ0QsS0FGRCxNQUVPLElBQUlELE9BQU9LLE9BQVgsRUFBb0I7QUFDekJKLGtCQUFZLENBQUMsQ0FBYjtBQUNELEtBRk0sTUFFQTtBQUNMQSxrQkFBWSxDQUFaO0FBQ0Q7O0FBRURGLFFBQUlPLElBQUosQ0FBUyxDQUFDTCxTQUFELEVBQVlELE9BQU9PLEtBQW5CLENBQVQ7QUFDRDtBQUNELFNBQU9SLEdBQVA7QUFDRCIsImZpbGUiOiJkbXAuanMiLCJzb3VyY2VzQ29udGVudCI6WyIvLyBTZWU6IGh0dHA6Ly9jb2RlLmdvb2dsZS5jb20vcC9nb29nbGUtZGlmZi1tYXRjaC1wYXRjaC93aWtpL0FQSVxuZXhwb3J0IGZ1bmN0aW9uIGNvbnZlcnRDaGFuZ2VzVG9ETVAoY2hhbmdlcykge1xuICBsZXQgcmV0ID0gW10sXG4gICAgICBjaGFuZ2UsXG4gICAgICBvcGVyYXRpb247XG4gIGZvciAobGV0IGkgPSAwOyBpIDwgY2hhbmdlcy5sZW5ndGg7IGkrKykge1xuICAgIGNoYW5nZSA9IGNoYW5nZXNbaV07XG4gICAgaWYgKGNoYW5nZS5hZGRlZCkge1xuICAgICAgb3BlcmF0aW9uID0gMTtcbiAgICB9IGVsc2UgaWYgKGNoYW5nZS5yZW1vdmVkKSB7XG4gICAgICBvcGVyYXRpb24gPSAtMTtcbiAgICB9IGVsc2Uge1xuICAgICAgb3BlcmF0aW9uID0gMDtcbiAgICB9XG5cbiAgICByZXQucHVzaChbb3BlcmF0aW9uLCBjaGFuZ2UudmFsdWVdKTtcbiAgfVxuICByZXR1cm4gcmV0O1xufVxuIl19
diff --git a/node_modules/diff/lib/convert/xml.js b/node_modules/diff/lib/convert/xml.js
new file mode 100644
index 0000000..331827a
--- /dev/null
+++ b/node_modules/diff/lib/convert/xml.js
@@ -0,0 +1,35 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports. /*istanbul ignore end*/convertChangesToXML = convertChangesToXML;
+function convertChangesToXML(changes) {
+  var ret = [];
+  for (var i = 0; i < changes.length; i++) {
+    var change = changes[i];
+    if (change.added) {
+      ret.push('');
+    } else if (change.removed) {
+      ret.push('');
+    }
+
+    ret.push(escapeHTML(change.value));
+
+    if (change.added) {
+      ret.push('');
+    } else if (change.removed) {
+      ret.push('');
+    }
+  }
+  return ret.join('');
+}
+
+function escapeHTML(s) {
+  var n = s;
+  n = n.replace(/&/g, '&');
+  n = n.replace(//g, '>');
+  n = n.replace(/"/g, '"');
+
+  return n;
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9jb252ZXJ0L3htbC5qcyJdLCJuYW1lcyI6WyJjb252ZXJ0Q2hhbmdlc1RvWE1MIiwiY2hhbmdlcyIsInJldCIsImkiLCJsZW5ndGgiLCJjaGFuZ2UiLCJhZGRlZCIsInB1c2giLCJyZW1vdmVkIiwiZXNjYXBlSFRNTCIsInZhbHVlIiwiam9pbiIsInMiLCJuIiwicmVwbGFjZSJdLCJtYXBwaW5ncyI6Ijs7O2dDQUFnQkEsbUIsR0FBQUEsbUI7QUFBVCxTQUFTQSxtQkFBVCxDQUE2QkMsT0FBN0IsRUFBc0M7QUFDM0MsTUFBSUMsTUFBTSxFQUFWO0FBQ0EsT0FBSyxJQUFJQyxJQUFJLENBQWIsRUFBZ0JBLElBQUlGLFFBQVFHLE1BQTVCLEVBQW9DRCxHQUFwQyxFQUF5QztBQUN2QyxRQUFJRSxTQUFTSixRQUFRRSxDQUFSLENBQWI7QUFDQSxRQUFJRSxPQUFPQyxLQUFYLEVBQWtCO0FBQ2hCSixVQUFJSyxJQUFKLENBQVMsT0FBVDtBQUNELEtBRkQsTUFFTyxJQUFJRixPQUFPRyxPQUFYLEVBQW9CO0FBQ3pCTixVQUFJSyxJQUFKLENBQVMsT0FBVDtBQUNEOztBQUVETCxRQUFJSyxJQUFKLENBQVNFLFdBQVdKLE9BQU9LLEtBQWxCLENBQVQ7O0FBRUEsUUFBSUwsT0FBT0MsS0FBWCxFQUFrQjtBQUNoQkosVUFBSUssSUFBSixDQUFTLFFBQVQ7QUFDRCxLQUZELE1BRU8sSUFBSUYsT0FBT0csT0FBWCxFQUFvQjtBQUN6Qk4sVUFBSUssSUFBSixDQUFTLFFBQVQ7QUFDRDtBQUNGO0FBQ0QsU0FBT0wsSUFBSVMsSUFBSixDQUFTLEVBQVQsQ0FBUDtBQUNEOztBQUVELFNBQVNGLFVBQVQsQ0FBb0JHLENBQXBCLEVBQXVCO0FBQ3JCLE1BQUlDLElBQUlELENBQVI7QUFDQUMsTUFBSUEsRUFBRUMsT0FBRixDQUFVLElBQVYsRUFBZ0IsT0FBaEIsQ0FBSjtBQUNBRCxNQUFJQSxFQUFFQyxPQUFGLENBQVUsSUFBVixFQUFnQixNQUFoQixDQUFKO0FBQ0FELE1BQUlBLEVBQUVDLE9BQUYsQ0FBVSxJQUFWLEVBQWdCLE1BQWhCLENBQUo7QUFDQUQsTUFBSUEsRUFBRUMsT0FBRixDQUFVLElBQVYsRUFBZ0IsUUFBaEIsQ0FBSjs7QUFFQSxTQUFPRCxDQUFQO0FBQ0QiLCJmaWxlIjoieG1sLmpzIiwic291cmNlc0NvbnRlbnQiOlsiZXhwb3J0IGZ1bmN0aW9uIGNvbnZlcnRDaGFuZ2VzVG9YTUwoY2hhbmdlcykge1xuICBsZXQgcmV0ID0gW107XG4gIGZvciAobGV0IGkgPSAwOyBpIDwgY2hhbmdlcy5sZW5ndGg7IGkrKykge1xuICAgIGxldCBjaGFuZ2UgPSBjaGFuZ2VzW2ldO1xuICAgIGlmIChjaGFuZ2UuYWRkZWQpIHtcbiAgICAgIHJldC5wdXNoKCc8aW5zPicpO1xuICAgIH0gZWxzZSBpZiAoY2hhbmdlLnJlbW92ZWQpIHtcbiAgICAgIHJldC5wdXNoKCc8ZGVsPicpO1xuICAgIH1cblxuICAgIHJldC5wdXNoKGVzY2FwZUhUTUwoY2hhbmdlLnZhbHVlKSk7XG5cbiAgICBpZiAoY2hhbmdlLmFkZGVkKSB7XG4gICAgICByZXQucHVzaCgnPC9pbnM+Jyk7XG4gICAgfSBlbHNlIGlmIChjaGFuZ2UucmVtb3ZlZCkge1xuICAgICAgcmV0LnB1c2goJzwvZGVsPicpO1xuICAgIH1cbiAgfVxuICByZXR1cm4gcmV0LmpvaW4oJycpO1xufVxuXG5mdW5jdGlvbiBlc2NhcGVIVE1MKHMpIHtcbiAgbGV0IG4gPSBzO1xuICBuID0gbi5yZXBsYWNlKC8mL2csICcmYW1wOycpO1xuICBuID0gbi5yZXBsYWNlKC88L2csICcmbHQ7Jyk7XG4gIG4gPSBuLnJlcGxhY2UoLz4vZywgJyZndDsnKTtcbiAgbiA9IG4ucmVwbGFjZSgvXCIvZywgJyZxdW90OycpO1xuXG4gIHJldHVybiBuO1xufVxuIl19
diff --git a/node_modules/diff/lib/diff/array.js b/node_modules/diff/lib/diff/array.js
new file mode 100644
index 0000000..f3daa4e
--- /dev/null
+++ b/node_modules/diff/lib/diff/array.js
@@ -0,0 +1,24 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports.arrayDiff = undefined;
+exports. /*istanbul ignore end*/diffArrays = diffArrays;
+
+var /*istanbul ignore start*/_base = require('./base') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+/*istanbul ignore end*/var arrayDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/arrayDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+arrayDiff.tokenize = function (value) {
+  return value.slice();
+};
+arrayDiff.join = arrayDiff.removeEmpty = function (value) {
+  return value;
+};
+
+function diffArrays(oldArr, newArr, callback) {
+  return arrayDiff.diff(oldArr, newArr, callback);
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2FycmF5LmpzIl0sIm5hbWVzIjpbImRpZmZBcnJheXMiLCJhcnJheURpZmYiLCJ0b2tlbml6ZSIsInZhbHVlIiwic2xpY2UiLCJqb2luIiwicmVtb3ZlRW1wdHkiLCJvbGRBcnIiLCJuZXdBcnIiLCJjYWxsYmFjayIsImRpZmYiXSwibWFwcGluZ3MiOiI7Ozs7Z0NBVWdCQSxVLEdBQUFBLFU7O0FBVmhCOzs7Ozs7dUJBRU8sSUFBTUMsaUZBQVksd0VBQWxCO0FBQ1BBLFVBQVVDLFFBQVYsR0FBcUIsVUFBU0MsS0FBVCxFQUFnQjtBQUNuQyxTQUFPQSxNQUFNQyxLQUFOLEVBQVA7QUFDRCxDQUZEO0FBR0FILFVBQVVJLElBQVYsR0FBaUJKLFVBQVVLLFdBQVYsR0FBd0IsVUFBU0gsS0FBVCxFQUFnQjtBQUN2RCxTQUFPQSxLQUFQO0FBQ0QsQ0FGRDs7QUFJTyxTQUFTSCxVQUFULENBQW9CTyxNQUFwQixFQUE0QkMsTUFBNUIsRUFBb0NDLFFBQXBDLEVBQThDO0FBQUUsU0FBT1IsVUFBVVMsSUFBVixDQUFlSCxNQUFmLEVBQXVCQyxNQUF2QixFQUErQkMsUUFBL0IsQ0FBUDtBQUFrRCIsImZpbGUiOiJhcnJheS5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCBEaWZmIGZyb20gJy4vYmFzZSc7XG5cbmV4cG9ydCBjb25zdCBhcnJheURpZmYgPSBuZXcgRGlmZigpO1xuYXJyYXlEaWZmLnRva2VuaXplID0gZnVuY3Rpb24odmFsdWUpIHtcbiAgcmV0dXJuIHZhbHVlLnNsaWNlKCk7XG59O1xuYXJyYXlEaWZmLmpvaW4gPSBhcnJheURpZmYucmVtb3ZlRW1wdHkgPSBmdW5jdGlvbih2YWx1ZSkge1xuICByZXR1cm4gdmFsdWU7XG59O1xuXG5leHBvcnQgZnVuY3Rpb24gZGlmZkFycmF5cyhvbGRBcnIsIG5ld0FyciwgY2FsbGJhY2spIHsgcmV0dXJuIGFycmF5RGlmZi5kaWZmKG9sZEFyciwgbmV3QXJyLCBjYWxsYmFjayk7IH1cbiJdfQ==
diff --git a/node_modules/diff/lib/diff/base.js b/node_modules/diff/lib/diff/base.js
new file mode 100644
index 0000000..763daec
--- /dev/null
+++ b/node_modules/diff/lib/diff/base.js
@@ -0,0 +1,235 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports['default'] = /*istanbul ignore end*/Diff;
+function Diff() {}
+
+Diff.prototype = {
+  /*istanbul ignore start*/ /*istanbul ignore end*/diff: function diff(oldString, newString) {
+    /*istanbul ignore start*/var /*istanbul ignore end*/options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
+
+    var callback = options.callback;
+    if (typeof options === 'function') {
+      callback = options;
+      options = {};
+    }
+    this.options = options;
+
+    var self = this;
+
+    function done(value) {
+      if (callback) {
+        setTimeout(function () {
+          callback(undefined, value);
+        }, 0);
+        return true;
+      } else {
+        return value;
+      }
+    }
+
+    // Allow subclasses to massage the input prior to running
+    oldString = this.castInput(oldString);
+    newString = this.castInput(newString);
+
+    oldString = this.removeEmpty(this.tokenize(oldString));
+    newString = this.removeEmpty(this.tokenize(newString));
+
+    var newLen = newString.length,
+        oldLen = oldString.length;
+    var editLength = 1;
+    var maxEditLength = newLen + oldLen;
+    var bestPath = [{ newPos: -1, components: [] }];
+
+    // Seed editLength = 0, i.e. the content starts with the same values
+    var oldPos = this.extractCommon(bestPath[0], newString, oldString, 0);
+    if (bestPath[0].newPos + 1 >= newLen && oldPos + 1 >= oldLen) {
+      // Identity per the equality and tokenizer
+      return done([{ value: this.join(newString), count: newString.length }]);
+    }
+
+    // Main worker method. checks all permutations of a given edit length for acceptance.
+    function execEditLength() {
+      for (var diagonalPath = -1 * editLength; diagonalPath <= editLength; diagonalPath += 2) {
+        var basePath = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+        var addPath = bestPath[diagonalPath - 1],
+            removePath = bestPath[diagonalPath + 1],
+            _oldPos = (removePath ? removePath.newPos : 0) - diagonalPath;
+        if (addPath) {
+          // No one else is going to attempt to use this value, clear it
+          bestPath[diagonalPath - 1] = undefined;
+        }
+
+        var canAdd = addPath && addPath.newPos + 1 < newLen,
+            canRemove = removePath && 0 <= _oldPos && _oldPos < oldLen;
+        if (!canAdd && !canRemove) {
+          // If this path is a terminal then prune
+          bestPath[diagonalPath] = undefined;
+          continue;
+        }
+
+        // Select the diagonal that we want to branch from. We select the prior
+        // path whose position in the new string is the farthest from the origin
+        // and does not pass the bounds of the diff graph
+        if (!canAdd || canRemove && addPath.newPos < removePath.newPos) {
+          basePath = clonePath(removePath);
+          self.pushComponent(basePath.components, undefined, true);
+        } else {
+          basePath = addPath; // No need to clone, we've pulled it from the list
+          basePath.newPos++;
+          self.pushComponent(basePath.components, true, undefined);
+        }
+
+        _oldPos = self.extractCommon(basePath, newString, oldString, diagonalPath);
+
+        // If we have hit the end of both strings, then we are done
+        if (basePath.newPos + 1 >= newLen && _oldPos + 1 >= oldLen) {
+          return done(buildValues(self, basePath.components, newString, oldString, self.useLongestToken));
+        } else {
+          // Otherwise track this path as a potential candidate and continue.
+          bestPath[diagonalPath] = basePath;
+        }
+      }
+
+      editLength++;
+    }
+
+    // Performs the length of edit iteration. Is a bit fugly as this has to support the
+    // sync and async mode which is never fun. Loops over execEditLength until a value
+    // is produced.
+    if (callback) {
+      (function exec() {
+        setTimeout(function () {
+          // This should not happen, but we want to be safe.
+          /* istanbul ignore next */
+          if (editLength > maxEditLength) {
+            return callback();
+          }
+
+          if (!execEditLength()) {
+            exec();
+          }
+        }, 0);
+      })();
+    } else {
+      while (editLength <= maxEditLength) {
+        var ret = execEditLength();
+        if (ret) {
+          return ret;
+        }
+      }
+    }
+  },
+  /*istanbul ignore start*/ /*istanbul ignore end*/pushComponent: function pushComponent(components, added, removed) {
+    var last = components[components.length - 1];
+    if (last && last.added === added && last.removed === removed) {
+      // We need to clone here as the component clone operation is just
+      // as shallow array clone
+      components[components.length - 1] = { count: last.count + 1, added: added, removed: removed };
+    } else {
+      components.push({ count: 1, added: added, removed: removed });
+    }
+  },
+  /*istanbul ignore start*/ /*istanbul ignore end*/extractCommon: function extractCommon(basePath, newString, oldString, diagonalPath) {
+    var newLen = newString.length,
+        oldLen = oldString.length,
+        newPos = basePath.newPos,
+        oldPos = newPos - diagonalPath,
+        commonCount = 0;
+    while (newPos + 1 < newLen && oldPos + 1 < oldLen && this.equals(newString[newPos + 1], oldString[oldPos + 1])) {
+      newPos++;
+      oldPos++;
+      commonCount++;
+    }
+
+    if (commonCount) {
+      basePath.components.push({ count: commonCount });
+    }
+
+    basePath.newPos = newPos;
+    return oldPos;
+  },
+  /*istanbul ignore start*/ /*istanbul ignore end*/equals: function equals(left, right) {
+    if (this.options.comparator) {
+      return this.options.comparator(left, right);
+    } else {
+      return left === right || this.options.ignoreCase && left.toLowerCase() === right.toLowerCase();
+    }
+  },
+  /*istanbul ignore start*/ /*istanbul ignore end*/removeEmpty: function removeEmpty(array) {
+    var ret = [];
+    for (var i = 0; i < array.length; i++) {
+      if (array[i]) {
+        ret.push(array[i]);
+      }
+    }
+    return ret;
+  },
+  /*istanbul ignore start*/ /*istanbul ignore end*/castInput: function castInput(value) {
+    return value;
+  },
+  /*istanbul ignore start*/ /*istanbul ignore end*/tokenize: function tokenize(value) {
+    return value.split('');
+  },
+  /*istanbul ignore start*/ /*istanbul ignore end*/join: function join(chars) {
+    return chars.join('');
+  }
+};
+
+function buildValues(diff, components, newString, oldString, useLongestToken) {
+  var componentPos = 0,
+      componentLen = components.length,
+      newPos = 0,
+      oldPos = 0;
+
+  for (; componentPos < componentLen; componentPos++) {
+    var component = components[componentPos];
+    if (!component.removed) {
+      if (!component.added && useLongestToken) {
+        var value = newString.slice(newPos, newPos + component.count);
+        value = value.map(function (value, i) {
+          var oldValue = oldString[oldPos + i];
+          return oldValue.length > value.length ? oldValue : value;
+        });
+
+        component.value = diff.join(value);
+      } else {
+        component.value = diff.join(newString.slice(newPos, newPos + component.count));
+      }
+      newPos += component.count;
+
+      // Common case
+      if (!component.added) {
+        oldPos += component.count;
+      }
+    } else {
+      component.value = diff.join(oldString.slice(oldPos, oldPos + component.count));
+      oldPos += component.count;
+
+      // Reverse add and remove so removes are output first to match common convention
+      // The diffing algorithm is tied to add then remove output and this is the simplest
+      // route to get the desired output with minimal overhead.
+      if (componentPos && components[componentPos - 1].added) {
+        var tmp = components[componentPos - 1];
+        components[componentPos - 1] = components[componentPos];
+        components[componentPos] = tmp;
+      }
+    }
+  }
+
+  // Special case handle for when one terminal is ignored (i.e. whitespace).
+  // For this case we merge the terminal into the prior string and drop the change.
+  // This is only available for string mode.
+  var lastComponent = components[componentLen - 1];
+  if (componentLen > 1 && typeof lastComponent.value === 'string' && (lastComponent.added || lastComponent.removed) && diff.equals('', lastComponent.value)) {
+    components[componentLen - 2].value += lastComponent.value;
+    components.pop();
+  }
+
+  return components;
+}
+
+function clonePath(path) {
+  return { newPos: path.newPos, components: path.components.slice(0) };
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2Jhc2UuanMiXSwibmFtZXMiOlsiRGlmZiIsInByb3RvdHlwZSIsImRpZmYiLCJvbGRTdHJpbmciLCJuZXdTdHJpbmciLCJvcHRpb25zIiwiY2FsbGJhY2siLCJzZWxmIiwiZG9uZSIsInZhbHVlIiwic2V0VGltZW91dCIsInVuZGVmaW5lZCIsImNhc3RJbnB1dCIsInJlbW92ZUVtcHR5IiwidG9rZW5pemUiLCJuZXdMZW4iLCJsZW5ndGgiLCJvbGRMZW4iLCJlZGl0TGVuZ3RoIiwibWF4RWRpdExlbmd0aCIsImJlc3RQYXRoIiwibmV3UG9zIiwiY29tcG9uZW50cyIsIm9sZFBvcyIsImV4dHJhY3RDb21tb24iLCJqb2luIiwiY291bnQiLCJleGVjRWRpdExlbmd0aCIsImRpYWdvbmFsUGF0aCIsImJhc2VQYXRoIiwiYWRkUGF0aCIsInJlbW92ZVBhdGgiLCJjYW5BZGQiLCJjYW5SZW1vdmUiLCJjbG9uZVBhdGgiLCJwdXNoQ29tcG9uZW50IiwiYnVpbGRWYWx1ZXMiLCJ1c2VMb25nZXN0VG9rZW4iLCJleGVjIiwicmV0IiwiYWRkZWQiLCJyZW1vdmVkIiwibGFzdCIsInB1c2giLCJjb21tb25Db3VudCIsImVxdWFscyIsImxlZnQiLCJyaWdodCIsImNvbXBhcmF0b3IiLCJpZ25vcmVDYXNlIiwidG9Mb3dlckNhc2UiLCJhcnJheSIsImkiLCJzcGxpdCIsImNoYXJzIiwiY29tcG9uZW50UG9zIiwiY29tcG9uZW50TGVuIiwiY29tcG9uZW50Iiwic2xpY2UiLCJtYXAiLCJvbGRWYWx1ZSIsInRtcCIsImxhc3RDb21wb25lbnQiLCJwb3AiLCJwYXRoIl0sIm1hcHBpbmdzIjoiOzs7NENBQXdCQSxJO0FBQVQsU0FBU0EsSUFBVCxHQUFnQixDQUFFOztBQUVqQ0EsS0FBS0MsU0FBTCxHQUFpQjtBQUFBLG1EQUNmQyxJQURlLGdCQUNWQyxTQURVLEVBQ0NDLFNBREQsRUFDMEI7QUFBQSx3REFBZEMsT0FBYyx1RUFBSixFQUFJOztBQUN2QyxRQUFJQyxXQUFXRCxRQUFRQyxRQUF2QjtBQUNBLFFBQUksT0FBT0QsT0FBUCxLQUFtQixVQUF2QixFQUFtQztBQUNqQ0MsaUJBQVdELE9BQVg7QUFDQUEsZ0JBQVUsRUFBVjtBQUNEO0FBQ0QsU0FBS0EsT0FBTCxHQUFlQSxPQUFmOztBQUVBLFFBQUlFLE9BQU8sSUFBWDs7QUFFQSxhQUFTQyxJQUFULENBQWNDLEtBQWQsRUFBcUI7QUFDbkIsVUFBSUgsUUFBSixFQUFjO0FBQ1pJLG1CQUFXLFlBQVc7QUFBRUosbUJBQVNLLFNBQVQsRUFBb0JGLEtBQXBCO0FBQTZCLFNBQXJELEVBQXVELENBQXZEO0FBQ0EsZUFBTyxJQUFQO0FBQ0QsT0FIRCxNQUdPO0FBQ0wsZUFBT0EsS0FBUDtBQUNEO0FBQ0Y7O0FBRUQ7QUFDQU4sZ0JBQVksS0FBS1MsU0FBTCxDQUFlVCxTQUFmLENBQVo7QUFDQUMsZ0JBQVksS0FBS1EsU0FBTCxDQUFlUixTQUFmLENBQVo7O0FBRUFELGdCQUFZLEtBQUtVLFdBQUwsQ0FBaUIsS0FBS0MsUUFBTCxDQUFjWCxTQUFkLENBQWpCLENBQVo7QUFDQUMsZ0JBQVksS0FBS1MsV0FBTCxDQUFpQixLQUFLQyxRQUFMLENBQWNWLFNBQWQsQ0FBakIsQ0FBWjs7QUFFQSxRQUFJVyxTQUFTWCxVQUFVWSxNQUF2QjtBQUFBLFFBQStCQyxTQUFTZCxVQUFVYSxNQUFsRDtBQUNBLFFBQUlFLGFBQWEsQ0FBakI7QUFDQSxRQUFJQyxnQkFBZ0JKLFNBQVNFLE1BQTdCO0FBQ0EsUUFBSUcsV0FBVyxDQUFDLEVBQUVDLFFBQVEsQ0FBQyxDQUFYLEVBQWNDLFlBQVksRUFBMUIsRUFBRCxDQUFmOztBQUVBO0FBQ0EsUUFBSUMsU0FBUyxLQUFLQyxhQUFMLENBQW1CSixTQUFTLENBQVQsQ0FBbkIsRUFBZ0NoQixTQUFoQyxFQUEyQ0QsU0FBM0MsRUFBc0QsQ0FBdEQsQ0FBYjtBQUNBLFFBQUlpQixTQUFTLENBQVQsRUFBWUMsTUFBWixHQUFxQixDQUFyQixJQUEwQk4sTUFBMUIsSUFBb0NRLFNBQVMsQ0FBVCxJQUFjTixNQUF0RCxFQUE4RDtBQUM1RDtBQUNBLGFBQU9ULEtBQUssQ0FBQyxFQUFDQyxPQUFPLEtBQUtnQixJQUFMLENBQVVyQixTQUFWLENBQVIsRUFBOEJzQixPQUFPdEIsVUFBVVksTUFBL0MsRUFBRCxDQUFMLENBQVA7QUFDRDs7QUFFRDtBQUNBLGFBQVNXLGNBQVQsR0FBMEI7QUFDeEIsV0FBSyxJQUFJQyxlQUFlLENBQUMsQ0FBRCxHQUFLVixVQUE3QixFQUF5Q1UsZ0JBQWdCVixVQUF6RCxFQUFxRVUsZ0JBQWdCLENBQXJGLEVBQXdGO0FBQ3RGLFlBQUlDLDBDQUFKO0FBQ0EsWUFBSUMsVUFBVVYsU0FBU1EsZUFBZSxDQUF4QixDQUFkO0FBQUEsWUFDSUcsYUFBYVgsU0FBU1EsZUFBZSxDQUF4QixDQURqQjtBQUFBLFlBRUlMLFVBQVMsQ0FBQ1EsYUFBYUEsV0FBV1YsTUFBeEIsR0FBaUMsQ0FBbEMsSUFBdUNPLFlBRnBEO0FBR0EsWUFBSUUsT0FBSixFQUFhO0FBQ1g7QUFDQVYsbUJBQVNRLGVBQWUsQ0FBeEIsSUFBNkJqQixTQUE3QjtBQUNEOztBQUVELFlBQUlxQixTQUFTRixXQUFXQSxRQUFRVCxNQUFSLEdBQWlCLENBQWpCLEdBQXFCTixNQUE3QztBQUFBLFlBQ0lrQixZQUFZRixjQUFjLEtBQUtSLE9BQW5CLElBQTZCQSxVQUFTTixNQUR0RDtBQUVBLFlBQUksQ0FBQ2UsTUFBRCxJQUFXLENBQUNDLFNBQWhCLEVBQTJCO0FBQ3pCO0FBQ0FiLG1CQUFTUSxZQUFULElBQXlCakIsU0FBekI7QUFDQTtBQUNEOztBQUVEO0FBQ0E7QUFDQTtBQUNBLFlBQUksQ0FBQ3FCLE1BQUQsSUFBWUMsYUFBYUgsUUFBUVQsTUFBUixHQUFpQlUsV0FBV1YsTUFBekQsRUFBa0U7QUFDaEVRLHFCQUFXSyxVQUFVSCxVQUFWLENBQVg7QUFDQXhCLGVBQUs0QixhQUFMLENBQW1CTixTQUFTUCxVQUE1QixFQUF3Q1gsU0FBeEMsRUFBbUQsSUFBbkQ7QUFDRCxTQUhELE1BR087QUFDTGtCLHFCQUFXQyxPQUFYLENBREssQ0FDaUI7QUFDdEJELG1CQUFTUixNQUFUO0FBQ0FkLGVBQUs0QixhQUFMLENBQW1CTixTQUFTUCxVQUE1QixFQUF3QyxJQUF4QyxFQUE4Q1gsU0FBOUM7QUFDRDs7QUFFRFksa0JBQVNoQixLQUFLaUIsYUFBTCxDQUFtQkssUUFBbkIsRUFBNkJ6QixTQUE3QixFQUF3Q0QsU0FBeEMsRUFBbUR5QixZQUFuRCxDQUFUOztBQUVBO0FBQ0EsWUFBSUMsU0FBU1IsTUFBVCxHQUFrQixDQUFsQixJQUF1Qk4sTUFBdkIsSUFBaUNRLFVBQVMsQ0FBVCxJQUFjTixNQUFuRCxFQUEyRDtBQUN6RCxpQkFBT1QsS0FBSzRCLFlBQVk3QixJQUFaLEVBQWtCc0IsU0FBU1AsVUFBM0IsRUFBdUNsQixTQUF2QyxFQUFrREQsU0FBbEQsRUFBNkRJLEtBQUs4QixlQUFsRSxDQUFMLENBQVA7QUFDRCxTQUZELE1BRU87QUFDTDtBQUNBakIsbUJBQVNRLFlBQVQsSUFBeUJDLFFBQXpCO0FBQ0Q7QUFDRjs7QUFFRFg7QUFDRDs7QUFFRDtBQUNBO0FBQ0E7QUFDQSxRQUFJWixRQUFKLEVBQWM7QUFDWCxnQkFBU2dDLElBQVQsR0FBZ0I7QUFDZjVCLG1CQUFXLFlBQVc7QUFDcEI7QUFDQTtBQUNBLGNBQUlRLGFBQWFDLGFBQWpCLEVBQWdDO0FBQzlCLG1CQUFPYixVQUFQO0FBQ0Q7O0FBRUQsY0FBSSxDQUFDcUIsZ0JBQUwsRUFBdUI7QUFDckJXO0FBQ0Q7QUFDRixTQVZELEVBVUcsQ0FWSDtBQVdELE9BWkEsR0FBRDtBQWFELEtBZEQsTUFjTztBQUNMLGFBQU9wQixjQUFjQyxhQUFyQixFQUFvQztBQUNsQyxZQUFJb0IsTUFBTVosZ0JBQVY7QUFDQSxZQUFJWSxHQUFKLEVBQVM7QUFDUCxpQkFBT0EsR0FBUDtBQUNEO0FBQ0Y7QUFDRjtBQUNGLEdBOUdjO0FBQUEsbURBZ0hmSixhQWhIZSx5QkFnSERiLFVBaEhDLEVBZ0hXa0IsS0FoSFgsRUFnSGtCQyxPQWhIbEIsRUFnSDJCO0FBQ3hDLFFBQUlDLE9BQU9wQixXQUFXQSxXQUFXTixNQUFYLEdBQW9CLENBQS9CLENBQVg7QUFDQSxRQUFJMEIsUUFBUUEsS0FBS0YsS0FBTCxLQUFlQSxLQUF2QixJQUFnQ0UsS0FBS0QsT0FBTCxLQUFpQkEsT0FBckQsRUFBOEQ7QUFDNUQ7QUFDQTtBQUNBbkIsaUJBQVdBLFdBQVdOLE1BQVgsR0FBb0IsQ0FBL0IsSUFBb0MsRUFBQ1UsT0FBT2dCLEtBQUtoQixLQUFMLEdBQWEsQ0FBckIsRUFBd0JjLE9BQU9BLEtBQS9CLEVBQXNDQyxTQUFTQSxPQUEvQyxFQUFwQztBQUNELEtBSkQsTUFJTztBQUNMbkIsaUJBQVdxQixJQUFYLENBQWdCLEVBQUNqQixPQUFPLENBQVIsRUFBV2MsT0FBT0EsS0FBbEIsRUFBeUJDLFNBQVNBLE9BQWxDLEVBQWhCO0FBQ0Q7QUFDRixHQXpIYztBQUFBLG1EQTBIZmpCLGFBMUhlLHlCQTBIREssUUExSEMsRUEwSFN6QixTQTFIVCxFQTBIb0JELFNBMUhwQixFQTBIK0J5QixZQTFIL0IsRUEwSDZDO0FBQzFELFFBQUliLFNBQVNYLFVBQVVZLE1BQXZCO0FBQUEsUUFDSUMsU0FBU2QsVUFBVWEsTUFEdkI7QUFBQSxRQUVJSyxTQUFTUSxTQUFTUixNQUZ0QjtBQUFBLFFBR0lFLFNBQVNGLFNBQVNPLFlBSHRCO0FBQUEsUUFLSWdCLGNBQWMsQ0FMbEI7QUFNQSxXQUFPdkIsU0FBUyxDQUFULEdBQWFOLE1BQWIsSUFBdUJRLFNBQVMsQ0FBVCxHQUFhTixNQUFwQyxJQUE4QyxLQUFLNEIsTUFBTCxDQUFZekMsVUFBVWlCLFNBQVMsQ0FBbkIsQ0FBWixFQUFtQ2xCLFVBQVVvQixTQUFTLENBQW5CLENBQW5DLENBQXJELEVBQWdIO0FBQzlHRjtBQUNBRTtBQUNBcUI7QUFDRDs7QUFFRCxRQUFJQSxXQUFKLEVBQWlCO0FBQ2ZmLGVBQVNQLFVBQVQsQ0FBb0JxQixJQUFwQixDQUF5QixFQUFDakIsT0FBT2tCLFdBQVIsRUFBekI7QUFDRDs7QUFFRGYsYUFBU1IsTUFBVCxHQUFrQkEsTUFBbEI7QUFDQSxXQUFPRSxNQUFQO0FBQ0QsR0E3SWM7QUFBQSxtREErSWZzQixNQS9JZSxrQkErSVJDLElBL0lRLEVBK0lGQyxLQS9JRSxFQStJSztBQUNsQixRQUFJLEtBQUsxQyxPQUFMLENBQWEyQyxVQUFqQixFQUE2QjtBQUMzQixhQUFPLEtBQUszQyxPQUFMLENBQWEyQyxVQUFiLENBQXdCRixJQUF4QixFQUE4QkMsS0FBOUIsQ0FBUDtBQUNELEtBRkQsTUFFTztBQUNMLGFBQU9ELFNBQVNDLEtBQVQsSUFDRCxLQUFLMUMsT0FBTCxDQUFhNEMsVUFBYixJQUEyQkgsS0FBS0ksV0FBTCxPQUF1QkgsTUFBTUcsV0FBTixFQUR4RDtBQUVEO0FBQ0YsR0F0SmM7QUFBQSxtREF1SmZyQyxXQXZKZSx1QkF1SkhzQyxLQXZKRyxFQXVKSTtBQUNqQixRQUFJWixNQUFNLEVBQVY7QUFDQSxTQUFLLElBQUlhLElBQUksQ0FBYixFQUFnQkEsSUFBSUQsTUFBTW5DLE1BQTFCLEVBQWtDb0MsR0FBbEMsRUFBdUM7QUFDckMsVUFBSUQsTUFBTUMsQ0FBTixDQUFKLEVBQWM7QUFDWmIsWUFBSUksSUFBSixDQUFTUSxNQUFNQyxDQUFOLENBQVQ7QUFDRDtBQUNGO0FBQ0QsV0FBT2IsR0FBUDtBQUNELEdBL0pjO0FBQUEsbURBZ0tmM0IsU0FoS2UscUJBZ0tMSCxLQWhLSyxFQWdLRTtBQUNmLFdBQU9BLEtBQVA7QUFDRCxHQWxLYztBQUFBLG1EQW1LZkssUUFuS2Usb0JBbUtOTCxLQW5LTSxFQW1LQztBQUNkLFdBQU9BLE1BQU00QyxLQUFOLENBQVksRUFBWixDQUFQO0FBQ0QsR0FyS2M7QUFBQSxtREFzS2Y1QixJQXRLZSxnQkFzS1Y2QixLQXRLVSxFQXNLSDtBQUNWLFdBQU9BLE1BQU03QixJQUFOLENBQVcsRUFBWCxDQUFQO0FBQ0Q7QUF4S2MsQ0FBakI7O0FBMktBLFNBQVNXLFdBQVQsQ0FBcUJsQyxJQUFyQixFQUEyQm9CLFVBQTNCLEVBQXVDbEIsU0FBdkMsRUFBa0RELFNBQWxELEVBQTZEa0MsZUFBN0QsRUFBOEU7QUFDNUUsTUFBSWtCLGVBQWUsQ0FBbkI7QUFBQSxNQUNJQyxlQUFlbEMsV0FBV04sTUFEOUI7QUFBQSxNQUVJSyxTQUFTLENBRmI7QUFBQSxNQUdJRSxTQUFTLENBSGI7O0FBS0EsU0FBT2dDLGVBQWVDLFlBQXRCLEVBQW9DRCxjQUFwQyxFQUFvRDtBQUNsRCxRQUFJRSxZQUFZbkMsV0FBV2lDLFlBQVgsQ0FBaEI7QUFDQSxRQUFJLENBQUNFLFVBQVVoQixPQUFmLEVBQXdCO0FBQ3RCLFVBQUksQ0FBQ2dCLFVBQVVqQixLQUFYLElBQW9CSCxlQUF4QixFQUF5QztBQUN2QyxZQUFJNUIsUUFBUUwsVUFBVXNELEtBQVYsQ0FBZ0JyQyxNQUFoQixFQUF3QkEsU0FBU29DLFVBQVUvQixLQUEzQyxDQUFaO0FBQ0FqQixnQkFBUUEsTUFBTWtELEdBQU4sQ0FBVSxVQUFTbEQsS0FBVCxFQUFnQjJDLENBQWhCLEVBQW1CO0FBQ25DLGNBQUlRLFdBQVd6RCxVQUFVb0IsU0FBUzZCLENBQW5CLENBQWY7QUFDQSxpQkFBT1EsU0FBUzVDLE1BQVQsR0FBa0JQLE1BQU1PLE1BQXhCLEdBQWlDNEMsUUFBakMsR0FBNENuRCxLQUFuRDtBQUNELFNBSE8sQ0FBUjs7QUFLQWdELGtCQUFVaEQsS0FBVixHQUFrQlAsS0FBS3VCLElBQUwsQ0FBVWhCLEtBQVYsQ0FBbEI7QUFDRCxPQVJELE1BUU87QUFDTGdELGtCQUFVaEQsS0FBVixHQUFrQlAsS0FBS3VCLElBQUwsQ0FBVXJCLFVBQVVzRCxLQUFWLENBQWdCckMsTUFBaEIsRUFBd0JBLFNBQVNvQyxVQUFVL0IsS0FBM0MsQ0FBVixDQUFsQjtBQUNEO0FBQ0RMLGdCQUFVb0MsVUFBVS9CLEtBQXBCOztBQUVBO0FBQ0EsVUFBSSxDQUFDK0IsVUFBVWpCLEtBQWYsRUFBc0I7QUFDcEJqQixrQkFBVWtDLFVBQVUvQixLQUFwQjtBQUNEO0FBQ0YsS0FsQkQsTUFrQk87QUFDTCtCLGdCQUFVaEQsS0FBVixHQUFrQlAsS0FBS3VCLElBQUwsQ0FBVXRCLFVBQVV1RCxLQUFWLENBQWdCbkMsTUFBaEIsRUFBd0JBLFNBQVNrQyxVQUFVL0IsS0FBM0MsQ0FBVixDQUFsQjtBQUNBSCxnQkFBVWtDLFVBQVUvQixLQUFwQjs7QUFFQTtBQUNBO0FBQ0E7QUFDQSxVQUFJNkIsZ0JBQWdCakMsV0FBV2lDLGVBQWUsQ0FBMUIsRUFBNkJmLEtBQWpELEVBQXdEO0FBQ3RELFlBQUlxQixNQUFNdkMsV0FBV2lDLGVBQWUsQ0FBMUIsQ0FBVjtBQUNBakMsbUJBQVdpQyxlQUFlLENBQTFCLElBQStCakMsV0FBV2lDLFlBQVgsQ0FBL0I7QUFDQWpDLG1CQUFXaUMsWUFBWCxJQUEyQk0sR0FBM0I7QUFDRDtBQUNGO0FBQ0Y7O0FBRUQ7QUFDQTtBQUNBO0FBQ0EsTUFBSUMsZ0JBQWdCeEMsV0FBV2tDLGVBQWUsQ0FBMUIsQ0FBcEI7QUFDQSxNQUFJQSxlQUFlLENBQWYsSUFDRyxPQUFPTSxjQUFjckQsS0FBckIsS0FBK0IsUUFEbEMsS0FFSXFELGNBQWN0QixLQUFkLElBQXVCc0IsY0FBY3JCLE9BRnpDLEtBR0d2QyxLQUFLMkMsTUFBTCxDQUFZLEVBQVosRUFBZ0JpQixjQUFjckQsS0FBOUIsQ0FIUCxFQUc2QztBQUMzQ2EsZUFBV2tDLGVBQWUsQ0FBMUIsRUFBNkIvQyxLQUE3QixJQUFzQ3FELGNBQWNyRCxLQUFwRDtBQUNBYSxlQUFXeUMsR0FBWDtBQUNEOztBQUVELFNBQU96QyxVQUFQO0FBQ0Q7O0FBRUQsU0FBU1ksU0FBVCxDQUFtQjhCLElBQW5CLEVBQXlCO0FBQ3ZCLFNBQU8sRUFBRTNDLFFBQVEyQyxLQUFLM0MsTUFBZixFQUF1QkMsWUFBWTBDLEtBQUsxQyxVQUFMLENBQWdCb0MsS0FBaEIsQ0FBc0IsQ0FBdEIsQ0FBbkMsRUFBUDtBQUNEIiwiZmlsZSI6ImJhc2UuanMiLCJzb3VyY2VzQ29udGVudCI6WyJleHBvcnQgZGVmYXVsdCBmdW5jdGlvbiBEaWZmKCkge31cblxuRGlmZi5wcm90b3R5cGUgPSB7XG4gIGRpZmYob2xkU3RyaW5nLCBuZXdTdHJpbmcsIG9wdGlvbnMgPSB7fSkge1xuICAgIGxldCBjYWxsYmFjayA9IG9wdGlvbnMuY2FsbGJhY2s7XG4gICAgaWYgKHR5cGVvZiBvcHRpb25zID09PSAnZnVuY3Rpb24nKSB7XG4gICAgICBjYWxsYmFjayA9IG9wdGlvbnM7XG4gICAgICBvcHRpb25zID0ge307XG4gICAgfVxuICAgIHRoaXMub3B0aW9ucyA9IG9wdGlvbnM7XG5cbiAgICBsZXQgc2VsZiA9IHRoaXM7XG5cbiAgICBmdW5jdGlvbiBkb25lKHZhbHVlKSB7XG4gICAgICBpZiAoY2FsbGJhY2spIHtcbiAgICAgICAgc2V0VGltZW91dChmdW5jdGlvbigpIHsgY2FsbGJhY2sodW5kZWZpbmVkLCB2YWx1ZSk7IH0sIDApO1xuICAgICAgICByZXR1cm4gdHJ1ZTtcbiAgICAgIH0gZWxzZSB7XG4gICAgICAgIHJldHVybiB2YWx1ZTtcbiAgICAgIH1cbiAgICB9XG5cbiAgICAvLyBBbGxvdyBzdWJjbGFzc2VzIHRvIG1hc3NhZ2UgdGhlIGlucHV0IHByaW9yIHRvIHJ1bm5pbmdcbiAgICBvbGRTdHJpbmcgPSB0aGlzLmNhc3RJbnB1dChvbGRTdHJpbmcpO1xuICAgIG5ld1N0cmluZyA9IHRoaXMuY2FzdElucHV0KG5ld1N0cmluZyk7XG5cbiAgICBvbGRTdHJpbmcgPSB0aGlzLnJlbW92ZUVtcHR5KHRoaXMudG9rZW5pemUob2xkU3RyaW5nKSk7XG4gICAgbmV3U3RyaW5nID0gdGhpcy5yZW1vdmVFbXB0eSh0aGlzLnRva2VuaXplKG5ld1N0cmluZykpO1xuXG4gICAgbGV0IG5ld0xlbiA9IG5ld1N0cmluZy5sZW5ndGgsIG9sZExlbiA9IG9sZFN0cmluZy5sZW5ndGg7XG4gICAgbGV0IGVkaXRMZW5ndGggPSAxO1xuICAgIGxldCBtYXhFZGl0TGVuZ3RoID0gbmV3TGVuICsgb2xkTGVuO1xuICAgIGxldCBiZXN0UGF0aCA9IFt7IG5ld1BvczogLTEsIGNvbXBvbmVudHM6IFtdIH1dO1xuXG4gICAgLy8gU2VlZCBlZGl0TGVuZ3RoID0gMCwgaS5lLiB0aGUgY29udGVudCBzdGFydHMgd2l0aCB0aGUgc2FtZSB2YWx1ZXNcbiAgICBsZXQgb2xkUG9zID0gdGhpcy5leHRyYWN0Q29tbW9uKGJlc3RQYXRoWzBdLCBuZXdTdHJpbmcsIG9sZFN0cmluZywgMCk7XG4gICAgaWYgKGJlc3RQYXRoWzBdLm5ld1BvcyArIDEgPj0gbmV3TGVuICYmIG9sZFBvcyArIDEgPj0gb2xkTGVuKSB7XG4gICAgICAvLyBJZGVudGl0eSBwZXIgdGhlIGVxdWFsaXR5IGFuZCB0b2tlbml6ZXJcbiAgICAgIHJldHVybiBkb25lKFt7dmFsdWU6IHRoaXMuam9pbihuZXdTdHJpbmcpLCBjb3VudDogbmV3U3RyaW5nLmxlbmd0aH1dKTtcbiAgICB9XG5cbiAgICAvLyBNYWluIHdvcmtlciBtZXRob2QuIGNoZWNrcyBhbGwgcGVybXV0YXRpb25zIG9mIGEgZ2l2ZW4gZWRpdCBsZW5ndGggZm9yIGFjY2VwdGFuY2UuXG4gICAgZnVuY3Rpb24gZXhlY0VkaXRMZW5ndGgoKSB7XG4gICAgICBmb3IgKGxldCBkaWFnb25hbFBhdGggPSAtMSAqIGVkaXRMZW5ndGg7IGRpYWdvbmFsUGF0aCA8PSBlZGl0TGVuZ3RoOyBkaWFnb25hbFBhdGggKz0gMikge1xuICAgICAgICBsZXQgYmFzZVBhdGg7XG4gICAgICAgIGxldCBhZGRQYXRoID0gYmVzdFBhdGhbZGlhZ29uYWxQYXRoIC0gMV0sXG4gICAgICAgICAgICByZW1vdmVQYXRoID0gYmVzdFBhdGhbZGlhZ29uYWxQYXRoICsgMV0sXG4gICAgICAgICAgICBvbGRQb3MgPSAocmVtb3ZlUGF0aCA/IHJlbW92ZVBhdGgubmV3UG9zIDogMCkgLSBkaWFnb25hbFBhdGg7XG4gICAgICAgIGlmIChhZGRQYXRoKSB7XG4gICAgICAgICAgLy8gTm8gb25lIGVsc2UgaXMgZ29pbmcgdG8gYXR0ZW1wdCB0byB1c2UgdGhpcyB2YWx1ZSwgY2xlYXIgaXRcbiAgICAgICAgICBiZXN0UGF0aFtkaWFnb25hbFBhdGggLSAxXSA9IHVuZGVmaW5lZDtcbiAgICAgICAgfVxuXG4gICAgICAgIGxldCBjYW5BZGQgPSBhZGRQYXRoICYmIGFkZFBhdGgubmV3UG9zICsgMSA8IG5ld0xlbixcbiAgICAgICAgICAgIGNhblJlbW92ZSA9IHJlbW92ZVBhdGggJiYgMCA8PSBvbGRQb3MgJiYgb2xkUG9zIDwgb2xkTGVuO1xuICAgICAgICBpZiAoIWNhbkFkZCAmJiAhY2FuUmVtb3ZlKSB7XG4gICAgICAgICAgLy8gSWYgdGhpcyBwYXRoIGlzIGEgdGVybWluYWwgdGhlbiBwcnVuZVxuICAgICAgICAgIGJlc3RQYXRoW2RpYWdvbmFsUGF0aF0gPSB1bmRlZmluZWQ7XG4gICAgICAgICAgY29udGludWU7XG4gICAgICAgIH1cblxuICAgICAgICAvLyBTZWxlY3QgdGhlIGRpYWdvbmFsIHRoYXQgd2Ugd2FudCB0byBicmFuY2ggZnJvbS4gV2Ugc2VsZWN0IHRoZSBwcmlvclxuICAgICAgICAvLyBwYXRoIHdob3NlIHBvc2l0aW9uIGluIHRoZSBuZXcgc3RyaW5nIGlzIHRoZSBmYXJ0aGVzdCBmcm9tIHRoZSBvcmlnaW5cbiAgICAgICAgLy8gYW5kIGRvZXMgbm90IHBhc3MgdGhlIGJvdW5kcyBvZiB0aGUgZGlmZiBncmFwaFxuICAgICAgICBpZiAoIWNhbkFkZCB8fCAoY2FuUmVtb3ZlICYmIGFkZFBhdGgubmV3UG9zIDwgcmVtb3ZlUGF0aC5uZXdQb3MpKSB7XG4gICAgICAgICAgYmFzZVBhdGggPSBjbG9uZVBhdGgocmVtb3ZlUGF0aCk7XG4gICAgICAgICAgc2VsZi5wdXNoQ29tcG9uZW50KGJhc2VQYXRoLmNvbXBvbmVudHMsIHVuZGVmaW5lZCwgdHJ1ZSk7XG4gICAgICAgIH0gZWxzZSB7XG4gICAgICAgICAgYmFzZVBhdGggPSBhZGRQYXRoOyAgIC8vIE5vIG5lZWQgdG8gY2xvbmUsIHdlJ3ZlIHB1bGxlZCBpdCBmcm9tIHRoZSBsaXN0XG4gICAgICAgICAgYmFzZVBhdGgubmV3UG9zKys7XG4gICAgICAgICAgc2VsZi5wdXNoQ29tcG9uZW50KGJhc2VQYXRoLmNvbXBvbmVudHMsIHRydWUsIHVuZGVmaW5lZCk7XG4gICAgICAgIH1cblxuICAgICAgICBvbGRQb3MgPSBzZWxmLmV4dHJhY3RDb21tb24oYmFzZVBhdGgsIG5ld1N0cmluZywgb2xkU3RyaW5nLCBkaWFnb25hbFBhdGgpO1xuXG4gICAgICAgIC8vIElmIHdlIGhhdmUgaGl0IHRoZSBlbmQgb2YgYm90aCBzdHJpbmdzLCB0aGVuIHdlIGFyZSBkb25lXG4gICAgICAgIGlmIChiYXNlUGF0aC5uZXdQb3MgKyAxID49IG5ld0xlbiAmJiBvbGRQb3MgKyAxID49IG9sZExlbikge1xuICAgICAgICAgIHJldHVybiBkb25lKGJ1aWxkVmFsdWVzKHNlbGYsIGJhc2VQYXRoLmNvbXBvbmVudHMsIG5ld1N0cmluZywgb2xkU3RyaW5nLCBzZWxmLnVzZUxvbmdlc3RUb2tlbikpO1xuICAgICAgICB9IGVsc2Uge1xuICAgICAgICAgIC8vIE90aGVyd2lzZSB0cmFjayB0aGlzIHBhdGggYXMgYSBwb3RlbnRpYWwgY2FuZGlkYXRlIGFuZCBjb250aW51ZS5cbiAgICAgICAgICBiZXN0UGF0aFtkaWFnb25hbFBhdGhdID0gYmFzZVBhdGg7XG4gICAgICAgIH1cbiAgICAgIH1cblxuICAgICAgZWRpdExlbmd0aCsrO1xuICAgIH1cblxuICAgIC8vIFBlcmZvcm1zIHRoZSBsZW5ndGggb2YgZWRpdCBpdGVyYXRpb24uIElzIGEgYml0IGZ1Z2x5IGFzIHRoaXMgaGFzIHRvIHN1cHBvcnQgdGhlXG4gICAgLy8gc3luYyBhbmQgYXN5bmMgbW9kZSB3aGljaCBpcyBuZXZlciBmdW4uIExvb3BzIG92ZXIgZXhlY0VkaXRMZW5ndGggdW50aWwgYSB2YWx1ZVxuICAgIC8vIGlzIHByb2R1Y2VkLlxuICAgIGlmIChjYWxsYmFjaykge1xuICAgICAgKGZ1bmN0aW9uIGV4ZWMoKSB7XG4gICAgICAgIHNldFRpbWVvdXQoZnVuY3Rpb24oKSB7XG4gICAgICAgICAgLy8gVGhpcyBzaG91bGQgbm90IGhhcHBlbiwgYnV0IHdlIHdhbnQgdG8gYmUgc2FmZS5cbiAgICAgICAgICAvKiBpc3RhbmJ1bCBpZ25vcmUgbmV4dCAqL1xuICAgICAgICAgIGlmIChlZGl0TGVuZ3RoID4gbWF4RWRpdExlbmd0aCkge1xuICAgICAgICAgICAgcmV0dXJuIGNhbGxiYWNrKCk7XG4gICAgICAgICAgfVxuXG4gICAgICAgICAgaWYgKCFleGVjRWRpdExlbmd0aCgpKSB7XG4gICAgICAgICAgICBleGVjKCk7XG4gICAgICAgICAgfVxuICAgICAgICB9LCAwKTtcbiAgICAgIH0oKSk7XG4gICAgfSBlbHNlIHtcbiAgICAgIHdoaWxlIChlZGl0TGVuZ3RoIDw9IG1heEVkaXRMZW5ndGgpIHtcbiAgICAgICAgbGV0IHJldCA9IGV4ZWNFZGl0TGVuZ3RoKCk7XG4gICAgICAgIGlmIChyZXQpIHtcbiAgICAgICAgICByZXR1cm4gcmV0O1xuICAgICAgICB9XG4gICAgICB9XG4gICAgfVxuICB9LFxuXG4gIHB1c2hDb21wb25lbnQoY29tcG9uZW50cywgYWRkZWQsIHJlbW92ZWQpIHtcbiAgICBsZXQgbGFzdCA9IGNvbXBvbmVudHNbY29tcG9uZW50cy5sZW5ndGggLSAxXTtcbiAgICBpZiAobGFzdCAmJiBsYXN0LmFkZGVkID09PSBhZGRlZCAmJiBsYXN0LnJlbW92ZWQgPT09IHJlbW92ZWQpIHtcbiAgICAgIC8vIFdlIG5lZWQgdG8gY2xvbmUgaGVyZSBhcyB0aGUgY29tcG9uZW50IGNsb25lIG9wZXJhdGlvbiBpcyBqdXN0XG4gICAgICAvLyBhcyBzaGFsbG93IGFycmF5IGNsb25lXG4gICAgICBjb21wb25lbnRzW2NvbXBvbmVudHMubGVuZ3RoIC0gMV0gPSB7Y291bnQ6IGxhc3QuY291bnQgKyAxLCBhZGRlZDogYWRkZWQsIHJlbW92ZWQ6IHJlbW92ZWQgfTtcbiAgICB9IGVsc2Uge1xuICAgICAgY29tcG9uZW50cy5wdXNoKHtjb3VudDogMSwgYWRkZWQ6IGFkZGVkLCByZW1vdmVkOiByZW1vdmVkIH0pO1xuICAgIH1cbiAgfSxcbiAgZXh0cmFjdENvbW1vbihiYXNlUGF0aCwgbmV3U3RyaW5nLCBvbGRTdHJpbmcsIGRpYWdvbmFsUGF0aCkge1xuICAgIGxldCBuZXdMZW4gPSBuZXdTdHJpbmcubGVuZ3RoLFxuICAgICAgICBvbGRMZW4gPSBvbGRTdHJpbmcubGVuZ3RoLFxuICAgICAgICBuZXdQb3MgPSBiYXNlUGF0aC5uZXdQb3MsXG4gICAgICAgIG9sZFBvcyA9IG5ld1BvcyAtIGRpYWdvbmFsUGF0aCxcblxuICAgICAgICBjb21tb25Db3VudCA9IDA7XG4gICAgd2hpbGUgKG5ld1BvcyArIDEgPCBuZXdMZW4gJiYgb2xkUG9zICsgMSA8IG9sZExlbiAmJiB0aGlzLmVxdWFscyhuZXdTdHJpbmdbbmV3UG9zICsgMV0sIG9sZFN0cmluZ1tvbGRQb3MgKyAxXSkpIHtcbiAgICAgIG5ld1BvcysrO1xuICAgICAgb2xkUG9zKys7XG4gICAgICBjb21tb25Db3VudCsrO1xuICAgIH1cblxuICAgIGlmIChjb21tb25Db3VudCkge1xuICAgICAgYmFzZVBhdGguY29tcG9uZW50cy5wdXNoKHtjb3VudDogY29tbW9uQ291bnR9KTtcbiAgICB9XG5cbiAgICBiYXNlUGF0aC5uZXdQb3MgPSBuZXdQb3M7XG4gICAgcmV0dXJuIG9sZFBvcztcbiAgfSxcblxuICBlcXVhbHMobGVmdCwgcmlnaHQpIHtcbiAgICBpZiAodGhpcy5vcHRpb25zLmNvbXBhcmF0b3IpIHtcbiAgICAgIHJldHVybiB0aGlzLm9wdGlvbnMuY29tcGFyYXRvcihsZWZ0LCByaWdodCk7XG4gICAgfSBlbHNlIHtcbiAgICAgIHJldHVybiBsZWZ0ID09PSByaWdodFxuICAgICAgICB8fCAodGhpcy5vcHRpb25zLmlnbm9yZUNhc2UgJiYgbGVmdC50b0xvd2VyQ2FzZSgpID09PSByaWdodC50b0xvd2VyQ2FzZSgpKTtcbiAgICB9XG4gIH0sXG4gIHJlbW92ZUVtcHR5KGFycmF5KSB7XG4gICAgbGV0IHJldCA9IFtdO1xuICAgIGZvciAobGV0IGkgPSAwOyBpIDwgYXJyYXkubGVuZ3RoOyBpKyspIHtcbiAgICAgIGlmIChhcnJheVtpXSkge1xuICAgICAgICByZXQucHVzaChhcnJheVtpXSk7XG4gICAgICB9XG4gICAgfVxuICAgIHJldHVybiByZXQ7XG4gIH0sXG4gIGNhc3RJbnB1dCh2YWx1ZSkge1xuICAgIHJldHVybiB2YWx1ZTtcbiAgfSxcbiAgdG9rZW5pemUodmFsdWUpIHtcbiAgICByZXR1cm4gdmFsdWUuc3BsaXQoJycpO1xuICB9LFxuICBqb2luKGNoYXJzKSB7XG4gICAgcmV0dXJuIGNoYXJzLmpvaW4oJycpO1xuICB9XG59O1xuXG5mdW5jdGlvbiBidWlsZFZhbHVlcyhkaWZmLCBjb21wb25lbnRzLCBuZXdTdHJpbmcsIG9sZFN0cmluZywgdXNlTG9uZ2VzdFRva2VuKSB7XG4gIGxldCBjb21wb25lbnRQb3MgPSAwLFxuICAgICAgY29tcG9uZW50TGVuID0gY29tcG9uZW50cy5sZW5ndGgsXG4gICAgICBuZXdQb3MgPSAwLFxuICAgICAgb2xkUG9zID0gMDtcblxuICBmb3IgKDsgY29tcG9uZW50UG9zIDwgY29tcG9uZW50TGVuOyBjb21wb25lbnRQb3MrKykge1xuICAgIGxldCBjb21wb25lbnQgPSBjb21wb25lbnRzW2NvbXBvbmVudFBvc107XG4gICAgaWYgKCFjb21wb25lbnQucmVtb3ZlZCkge1xuICAgICAgaWYgKCFjb21wb25lbnQuYWRkZWQgJiYgdXNlTG9uZ2VzdFRva2VuKSB7XG4gICAgICAgIGxldCB2YWx1ZSA9IG5ld1N0cmluZy5zbGljZShuZXdQb3MsIG5ld1BvcyArIGNvbXBvbmVudC5jb3VudCk7XG4gICAgICAgIHZhbHVlID0gdmFsdWUubWFwKGZ1bmN0aW9uKHZhbHVlLCBpKSB7XG4gICAgICAgICAgbGV0IG9sZFZhbHVlID0gb2xkU3RyaW5nW29sZFBvcyArIGldO1xuICAgICAgICAgIHJldHVybiBvbGRWYWx1ZS5sZW5ndGggPiB2YWx1ZS5sZW5ndGggPyBvbGRWYWx1ZSA6IHZhbHVlO1xuICAgICAgICB9KTtcblxuICAgICAgICBjb21wb25lbnQudmFsdWUgPSBkaWZmLmpvaW4odmFsdWUpO1xuICAgICAgfSBlbHNlIHtcbiAgICAgICAgY29tcG9uZW50LnZhbHVlID0gZGlmZi5qb2luKG5ld1N0cmluZy5zbGljZShuZXdQb3MsIG5ld1BvcyArIGNvbXBvbmVudC5jb3VudCkpO1xuICAgICAgfVxuICAgICAgbmV3UG9zICs9IGNvbXBvbmVudC5jb3VudDtcblxuICAgICAgLy8gQ29tbW9uIGNhc2VcbiAgICAgIGlmICghY29tcG9uZW50LmFkZGVkKSB7XG4gICAgICAgIG9sZFBvcyArPSBjb21wb25lbnQuY291bnQ7XG4gICAgICB9XG4gICAgfSBlbHNlIHtcbiAgICAgIGNvbXBvbmVudC52YWx1ZSA9IGRpZmYuam9pbihvbGRTdHJpbmcuc2xpY2Uob2xkUG9zLCBvbGRQb3MgKyBjb21wb25lbnQuY291bnQpKTtcbiAgICAgIG9sZFBvcyArPSBjb21wb25lbnQuY291bnQ7XG5cbiAgICAgIC8vIFJldmVyc2UgYWRkIGFuZCByZW1vdmUgc28gcmVtb3ZlcyBhcmUgb3V0cHV0IGZpcnN0IHRvIG1hdGNoIGNvbW1vbiBjb252ZW50aW9uXG4gICAgICAvLyBUaGUgZGlmZmluZyBhbGdvcml0aG0gaXMgdGllZCB0byBhZGQgdGhlbiByZW1vdmUgb3V0cHV0IGFuZCB0aGlzIGlzIHRoZSBzaW1wbGVzdFxuICAgICAgLy8gcm91dGUgdG8gZ2V0IHRoZSBkZXNpcmVkIG91dHB1dCB3aXRoIG1pbmltYWwgb3ZlcmhlYWQuXG4gICAgICBpZiAoY29tcG9uZW50UG9zICYmIGNvbXBvbmVudHNbY29tcG9uZW50UG9zIC0gMV0uYWRkZWQpIHtcbiAgICAgICAgbGV0IHRtcCA9IGNvbXBvbmVudHNbY29tcG9uZW50UG9zIC0gMV07XG4gICAgICAgIGNvbXBvbmVudHNbY29tcG9uZW50UG9zIC0gMV0gPSBjb21wb25lbnRzW2NvbXBvbmVudFBvc107XG4gICAgICAgIGNvbXBvbmVudHNbY29tcG9uZW50UG9zXSA9IHRtcDtcbiAgICAgIH1cbiAgICB9XG4gIH1cblxuICAvLyBTcGVjaWFsIGNhc2UgaGFuZGxlIGZvciB3aGVuIG9uZSB0ZXJtaW5hbCBpcyBpZ25vcmVkIChpLmUuIHdoaXRlc3BhY2UpLlxuICAvLyBGb3IgdGhpcyBjYXNlIHdlIG1lcmdlIHRoZSB0ZXJtaW5hbCBpbnRvIHRoZSBwcmlvciBzdHJpbmcgYW5kIGRyb3AgdGhlIGNoYW5nZS5cbiAgLy8gVGhpcyBpcyBvbmx5IGF2YWlsYWJsZSBmb3Igc3RyaW5nIG1vZGUuXG4gIGxldCBsYXN0Q29tcG9uZW50ID0gY29tcG9uZW50c1tjb21wb25lbnRMZW4gLSAxXTtcbiAgaWYgKGNvbXBvbmVudExlbiA+IDFcbiAgICAgICYmIHR5cGVvZiBsYXN0Q29tcG9uZW50LnZhbHVlID09PSAnc3RyaW5nJ1xuICAgICAgJiYgKGxhc3RDb21wb25lbnQuYWRkZWQgfHwgbGFzdENvbXBvbmVudC5yZW1vdmVkKVxuICAgICAgJiYgZGlmZi5lcXVhbHMoJycsIGxhc3RDb21wb25lbnQudmFsdWUpKSB7XG4gICAgY29tcG9uZW50c1tjb21wb25lbnRMZW4gLSAyXS52YWx1ZSArPSBsYXN0Q29tcG9uZW50LnZhbHVlO1xuICAgIGNvbXBvbmVudHMucG9wKCk7XG4gIH1cblxuICByZXR1cm4gY29tcG9uZW50cztcbn1cblxuZnVuY3Rpb24gY2xvbmVQYXRoKHBhdGgpIHtcbiAgcmV0dXJuIHsgbmV3UG9zOiBwYXRoLm5ld1BvcywgY29tcG9uZW50czogcGF0aC5jb21wb25lbnRzLnNsaWNlKDApIH07XG59XG4iXX0=
diff --git a/node_modules/diff/lib/diff/character.js b/node_modules/diff/lib/diff/character.js
new file mode 100644
index 0000000..e15da7a
--- /dev/null
+++ b/node_modules/diff/lib/diff/character.js
@@ -0,0 +1,17 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports.characterDiff = undefined;
+exports. /*istanbul ignore end*/diffChars = diffChars;
+
+var /*istanbul ignore start*/_base = require('./base') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+/*istanbul ignore end*/var characterDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/characterDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+function diffChars(oldStr, newStr, options) {
+  return characterDiff.diff(oldStr, newStr, options);
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2NoYXJhY3Rlci5qcyJdLCJuYW1lcyI6WyJkaWZmQ2hhcnMiLCJjaGFyYWN0ZXJEaWZmIiwib2xkU3RyIiwibmV3U3RyIiwib3B0aW9ucyIsImRpZmYiXSwibWFwcGluZ3MiOiI7Ozs7Z0NBR2dCQSxTLEdBQUFBLFM7O0FBSGhCOzs7Ozs7dUJBRU8sSUFBTUMseUZBQWdCLHdFQUF0QjtBQUNBLFNBQVNELFNBQVQsQ0FBbUJFLE1BQW5CLEVBQTJCQyxNQUEzQixFQUFtQ0MsT0FBbkMsRUFBNEM7QUFBRSxTQUFPSCxjQUFjSSxJQUFkLENBQW1CSCxNQUFuQixFQUEyQkMsTUFBM0IsRUFBbUNDLE9BQW5DLENBQVA7QUFBcUQiLCJmaWxlIjoiY2hhcmFjdGVyLmpzIiwic291cmNlc0NvbnRlbnQiOlsiaW1wb3J0IERpZmYgZnJvbSAnLi9iYXNlJztcblxuZXhwb3J0IGNvbnN0IGNoYXJhY3RlckRpZmYgPSBuZXcgRGlmZigpO1xuZXhwb3J0IGZ1bmN0aW9uIGRpZmZDaGFycyhvbGRTdHIsIG5ld1N0ciwgb3B0aW9ucykgeyByZXR1cm4gY2hhcmFjdGVyRGlmZi5kaWZmKG9sZFN0ciwgbmV3U3RyLCBvcHRpb25zKTsgfVxuIl19
diff --git a/node_modules/diff/lib/diff/css.js b/node_modules/diff/lib/diff/css.js
new file mode 100644
index 0000000..640af5e
--- /dev/null
+++ b/node_modules/diff/lib/diff/css.js
@@ -0,0 +1,21 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports.cssDiff = undefined;
+exports. /*istanbul ignore end*/diffCss = diffCss;
+
+var /*istanbul ignore start*/_base = require('./base') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+/*istanbul ignore end*/var cssDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/cssDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+cssDiff.tokenize = function (value) {
+  return value.split(/([{}:;,]|\s+)/);
+};
+
+function diffCss(oldStr, newStr, callback) {
+  return cssDiff.diff(oldStr, newStr, callback);
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2Nzcy5qcyJdLCJuYW1lcyI6WyJkaWZmQ3NzIiwiY3NzRGlmZiIsInRva2VuaXplIiwidmFsdWUiLCJzcGxpdCIsIm9sZFN0ciIsIm5ld1N0ciIsImNhbGxiYWNrIiwiZGlmZiJdLCJtYXBwaW5ncyI6Ijs7OztnQ0FPZ0JBLE8sR0FBQUEsTzs7QUFQaEI7Ozs7Ozt1QkFFTyxJQUFNQyw2RUFBVSx3RUFBaEI7QUFDUEEsUUFBUUMsUUFBUixHQUFtQixVQUFTQyxLQUFULEVBQWdCO0FBQ2pDLFNBQU9BLE1BQU1DLEtBQU4sQ0FBWSxlQUFaLENBQVA7QUFDRCxDQUZEOztBQUlPLFNBQVNKLE9BQVQsQ0FBaUJLLE1BQWpCLEVBQXlCQyxNQUF6QixFQUFpQ0MsUUFBakMsRUFBMkM7QUFBRSxTQUFPTixRQUFRTyxJQUFSLENBQWFILE1BQWIsRUFBcUJDLE1BQXJCLEVBQTZCQyxRQUE3QixDQUFQO0FBQWdEIiwiZmlsZSI6ImNzcy5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCBEaWZmIGZyb20gJy4vYmFzZSc7XG5cbmV4cG9ydCBjb25zdCBjc3NEaWZmID0gbmV3IERpZmYoKTtcbmNzc0RpZmYudG9rZW5pemUgPSBmdW5jdGlvbih2YWx1ZSkge1xuICByZXR1cm4gdmFsdWUuc3BsaXQoLyhbe306OyxdfFxccyspLyk7XG59O1xuXG5leHBvcnQgZnVuY3Rpb24gZGlmZkNzcyhvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spIHsgcmV0dXJuIGNzc0RpZmYuZGlmZihvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spOyB9XG4iXX0=
diff --git a/node_modules/diff/lib/diff/json.js b/node_modules/diff/lib/diff/json.js
new file mode 100644
index 0000000..ca21739
--- /dev/null
+++ b/node_modules/diff/lib/diff/json.js
@@ -0,0 +1,108 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports.jsonDiff = undefined;
+
+var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
+
+exports. /*istanbul ignore end*/diffJson = diffJson;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/canonicalize = canonicalize;
+
+var /*istanbul ignore start*/_base = require('./base') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+/*istanbul ignore end*/var /*istanbul ignore start*/_line = require('./line') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+/*istanbul ignore end*/var objectPrototypeToString = Object.prototype.toString;
+
+var jsonDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/jsonDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+// Discriminate between two lines of pretty-printed, serialized JSON where one of them has a
+// dangling comma and the other doesn't. Turns out including the dangling comma yields the nicest output:
+jsonDiff.useLongestToken = true;
+
+jsonDiff.tokenize = /*istanbul ignore start*/_line.lineDiff /*istanbul ignore end*/.tokenize;
+jsonDiff.castInput = function (value) {
+  /*istanbul ignore start*/var _options = /*istanbul ignore end*/this.options,
+      undefinedReplacement = _options.undefinedReplacement,
+      _options$stringifyRep = _options.stringifyReplacer,
+      stringifyReplacer = _options$stringifyRep === undefined ? function (k, v) /*istanbul ignore start*/{
+    return (/*istanbul ignore end*/typeof v === 'undefined' ? undefinedReplacement : v
+    );
+  } : _options$stringifyRep;
+
+
+  return typeof value === 'string' ? value : JSON.stringify(canonicalize(value, null, null, stringifyReplacer), stringifyReplacer, '  ');
+};
+jsonDiff.equals = function (left, right) {
+  return (/*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/.prototype.equals.call(jsonDiff, left.replace(/,([\r\n])/g, '$1'), right.replace(/,([\r\n])/g, '$1'))
+  );
+};
+
+function diffJson(oldObj, newObj, options) {
+  return jsonDiff.diff(oldObj, newObj, options);
+}
+
+// This function handles the presence of circular references by bailing out when encountering an
+// object that is already on the "stack" of items being processed. Accepts an optional replacer
+function canonicalize(obj, stack, replacementStack, replacer, key) {
+  stack = stack || [];
+  replacementStack = replacementStack || [];
+
+  if (replacer) {
+    obj = replacer(key, obj);
+  }
+
+  var i = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+
+  for (i = 0; i < stack.length; i += 1) {
+    if (stack[i] === obj) {
+      return replacementStack[i];
+    }
+  }
+
+  var canonicalizedObj = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+
+  if ('[object Array]' === objectPrototypeToString.call(obj)) {
+    stack.push(obj);
+    canonicalizedObj = new Array(obj.length);
+    replacementStack.push(canonicalizedObj);
+    for (i = 0; i < obj.length; i += 1) {
+      canonicalizedObj[i] = canonicalize(obj[i], stack, replacementStack, replacer, key);
+    }
+    stack.pop();
+    replacementStack.pop();
+    return canonicalizedObj;
+  }
+
+  if (obj && obj.toJSON) {
+    obj = obj.toJSON();
+  }
+
+  if ( /*istanbul ignore start*/(typeof /*istanbul ignore end*/obj === 'undefined' ? 'undefined' : _typeof(obj)) === 'object' && obj !== null) {
+    stack.push(obj);
+    canonicalizedObj = {};
+    replacementStack.push(canonicalizedObj);
+    var sortedKeys = [],
+        _key = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+    for (_key in obj) {
+      /* istanbul ignore else */
+      if (obj.hasOwnProperty(_key)) {
+        sortedKeys.push(_key);
+      }
+    }
+    sortedKeys.sort();
+    for (i = 0; i < sortedKeys.length; i += 1) {
+      _key = sortedKeys[i];
+      canonicalizedObj[_key] = canonicalize(obj[_key], stack, replacementStack, replacer, _key);
+    }
+    stack.pop();
+    replacementStack.pop();
+  } else {
+    canonicalizedObj = obj;
+  }
+  return canonicalizedObj;
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2pzb24uanMiXSwibmFtZXMiOlsiZGlmZkpzb24iLCJjYW5vbmljYWxpemUiLCJvYmplY3RQcm90b3R5cGVUb1N0cmluZyIsIk9iamVjdCIsInByb3RvdHlwZSIsInRvU3RyaW5nIiwianNvbkRpZmYiLCJ1c2VMb25nZXN0VG9rZW4iLCJ0b2tlbml6ZSIsImNhc3RJbnB1dCIsInZhbHVlIiwib3B0aW9ucyIsInVuZGVmaW5lZFJlcGxhY2VtZW50Iiwic3RyaW5naWZ5UmVwbGFjZXIiLCJrIiwidiIsIkpTT04iLCJzdHJpbmdpZnkiLCJlcXVhbHMiLCJsZWZ0IiwicmlnaHQiLCJjYWxsIiwicmVwbGFjZSIsIm9sZE9iaiIsIm5ld09iaiIsImRpZmYiLCJvYmoiLCJzdGFjayIsInJlcGxhY2VtZW50U3RhY2siLCJyZXBsYWNlciIsImtleSIsImkiLCJsZW5ndGgiLCJjYW5vbmljYWxpemVkT2JqIiwicHVzaCIsIkFycmF5IiwicG9wIiwidG9KU09OIiwic29ydGVkS2V5cyIsImhhc093blByb3BlcnR5Iiwic29ydCJdLCJtYXBwaW5ncyI6Ijs7Ozs7OztnQ0FxQmdCQSxRLEdBQUFBLFE7eURBSUFDLFksR0FBQUEsWTs7QUF6QmhCOzs7O3VCQUNBOzs7O3VCQUVBLElBQU1DLDBCQUEwQkMsT0FBT0MsU0FBUCxDQUFpQkMsUUFBakQ7O0FBR08sSUFBTUMsK0VBQVcsd0VBQWpCO0FBQ1A7QUFDQTtBQUNBQSxTQUFTQyxlQUFULEdBQTJCLElBQTNCOztBQUVBRCxTQUFTRSxRQUFULEdBQW9CLGdFQUFTQSxRQUE3QjtBQUNBRixTQUFTRyxTQUFULEdBQXFCLFVBQVNDLEtBQVQsRUFBZ0I7QUFBQSxpRUFDK0UsS0FBS0MsT0FEcEY7QUFBQSxNQUM1QkMsb0JBRDRCLFlBQzVCQSxvQkFENEI7QUFBQSx1Q0FDTkMsaUJBRE07QUFBQSxNQUNOQSxpQkFETSx5Q0FDYyxVQUFDQyxDQUFELEVBQUlDLENBQUo7QUFBQSxtQ0FBVSxPQUFPQSxDQUFQLEtBQWEsV0FBYixHQUEyQkgsb0JBQTNCLEdBQWtERztBQUE1RDtBQUFBLEdBRGQ7OztBQUduQyxTQUFPLE9BQU9MLEtBQVAsS0FBaUIsUUFBakIsR0FBNEJBLEtBQTVCLEdBQW9DTSxLQUFLQyxTQUFMLENBQWVoQixhQUFhUyxLQUFiLEVBQW9CLElBQXBCLEVBQTBCLElBQTFCLEVBQWdDRyxpQkFBaEMsQ0FBZixFQUFtRUEsaUJBQW5FLEVBQXNGLElBQXRGLENBQTNDO0FBQ0QsQ0FKRDtBQUtBUCxTQUFTWSxNQUFULEdBQWtCLFVBQVNDLElBQVQsRUFBZUMsS0FBZixFQUFzQjtBQUN0QyxTQUFPLG9FQUFLaEIsU0FBTCxDQUFlYyxNQUFmLENBQXNCRyxJQUF0QixDQUEyQmYsUUFBM0IsRUFBcUNhLEtBQUtHLE9BQUwsQ0FBYSxZQUFiLEVBQTJCLElBQTNCLENBQXJDLEVBQXVFRixNQUFNRSxPQUFOLENBQWMsWUFBZCxFQUE0QixJQUE1QixDQUF2RTtBQUFQO0FBQ0QsQ0FGRDs7QUFJTyxTQUFTdEIsUUFBVCxDQUFrQnVCLE1BQWxCLEVBQTBCQyxNQUExQixFQUFrQ2IsT0FBbEMsRUFBMkM7QUFBRSxTQUFPTCxTQUFTbUIsSUFBVCxDQUFjRixNQUFkLEVBQXNCQyxNQUF0QixFQUE4QmIsT0FBOUIsQ0FBUDtBQUFnRDs7QUFFcEc7QUFDQTtBQUNPLFNBQVNWLFlBQVQsQ0FBc0J5QixHQUF0QixFQUEyQkMsS0FBM0IsRUFBa0NDLGdCQUFsQyxFQUFvREMsUUFBcEQsRUFBOERDLEdBQTlELEVBQW1FO0FBQ3hFSCxVQUFRQSxTQUFTLEVBQWpCO0FBQ0FDLHFCQUFtQkEsb0JBQW9CLEVBQXZDOztBQUVBLE1BQUlDLFFBQUosRUFBYztBQUNaSCxVQUFNRyxTQUFTQyxHQUFULEVBQWNKLEdBQWQsQ0FBTjtBQUNEOztBQUVELE1BQUlLLG1DQUFKOztBQUVBLE9BQUtBLElBQUksQ0FBVCxFQUFZQSxJQUFJSixNQUFNSyxNQUF0QixFQUE4QkQsS0FBSyxDQUFuQyxFQUFzQztBQUNwQyxRQUFJSixNQUFNSSxDQUFOLE1BQWFMLEdBQWpCLEVBQXNCO0FBQ3BCLGFBQU9FLGlCQUFpQkcsQ0FBakIsQ0FBUDtBQUNEO0FBQ0Y7O0FBRUQsTUFBSUUsa0RBQUo7O0FBRUEsTUFBSSxxQkFBcUIvQix3QkFBd0JtQixJQUF4QixDQUE2QkssR0FBN0IsQ0FBekIsRUFBNEQ7QUFDMURDLFVBQU1PLElBQU4sQ0FBV1IsR0FBWDtBQUNBTyx1QkFBbUIsSUFBSUUsS0FBSixDQUFVVCxJQUFJTSxNQUFkLENBQW5CO0FBQ0FKLHFCQUFpQk0sSUFBakIsQ0FBc0JELGdCQUF0QjtBQUNBLFNBQUtGLElBQUksQ0FBVCxFQUFZQSxJQUFJTCxJQUFJTSxNQUFwQixFQUE0QkQsS0FBSyxDQUFqQyxFQUFvQztBQUNsQ0UsdUJBQWlCRixDQUFqQixJQUFzQjlCLGFBQWF5QixJQUFJSyxDQUFKLENBQWIsRUFBcUJKLEtBQXJCLEVBQTRCQyxnQkFBNUIsRUFBOENDLFFBQTlDLEVBQXdEQyxHQUF4RCxDQUF0QjtBQUNEO0FBQ0RILFVBQU1TLEdBQU47QUFDQVIscUJBQWlCUSxHQUFqQjtBQUNBLFdBQU9ILGdCQUFQO0FBQ0Q7O0FBRUQsTUFBSVAsT0FBT0EsSUFBSVcsTUFBZixFQUF1QjtBQUNyQlgsVUFBTUEsSUFBSVcsTUFBSixFQUFOO0FBQ0Q7O0FBRUQsTUFBSSx5REFBT1gsR0FBUCx5Q0FBT0EsR0FBUCxPQUFlLFFBQWYsSUFBMkJBLFFBQVEsSUFBdkMsRUFBNkM7QUFDM0NDLFVBQU1PLElBQU4sQ0FBV1IsR0FBWDtBQUNBTyx1QkFBbUIsRUFBbkI7QUFDQUwscUJBQWlCTSxJQUFqQixDQUFzQkQsZ0JBQXRCO0FBQ0EsUUFBSUssYUFBYSxFQUFqQjtBQUFBLFFBQ0lSLHNDQURKO0FBRUEsU0FBS0EsSUFBTCxJQUFZSixHQUFaLEVBQWlCO0FBQ2Y7QUFDQSxVQUFJQSxJQUFJYSxjQUFKLENBQW1CVCxJQUFuQixDQUFKLEVBQTZCO0FBQzNCUSxtQkFBV0osSUFBWCxDQUFnQkosSUFBaEI7QUFDRDtBQUNGO0FBQ0RRLGVBQVdFLElBQVg7QUFDQSxTQUFLVCxJQUFJLENBQVQsRUFBWUEsSUFBSU8sV0FBV04sTUFBM0IsRUFBbUNELEtBQUssQ0FBeEMsRUFBMkM7QUFDekNELGFBQU1RLFdBQVdQLENBQVgsQ0FBTjtBQUNBRSx1QkFBaUJILElBQWpCLElBQXdCN0IsYUFBYXlCLElBQUlJLElBQUosQ0FBYixFQUF1QkgsS0FBdkIsRUFBOEJDLGdCQUE5QixFQUFnREMsUUFBaEQsRUFBMERDLElBQTFELENBQXhCO0FBQ0Q7QUFDREgsVUFBTVMsR0FBTjtBQUNBUixxQkFBaUJRLEdBQWpCO0FBQ0QsR0FuQkQsTUFtQk87QUFDTEgsdUJBQW1CUCxHQUFuQjtBQUNEO0FBQ0QsU0FBT08sZ0JBQVA7QUFDRCIsImZpbGUiOiJqc29uLmpzIiwic291cmNlc0NvbnRlbnQiOlsiaW1wb3J0IERpZmYgZnJvbSAnLi9iYXNlJztcbmltcG9ydCB7bGluZURpZmZ9IGZyb20gJy4vbGluZSc7XG5cbmNvbnN0IG9iamVjdFByb3RvdHlwZVRvU3RyaW5nID0gT2JqZWN0LnByb3RvdHlwZS50b1N0cmluZztcblxuXG5leHBvcnQgY29uc3QganNvbkRpZmYgPSBuZXcgRGlmZigpO1xuLy8gRGlzY3JpbWluYXRlIGJldHdlZW4gdHdvIGxpbmVzIG9mIHByZXR0eS1wcmludGVkLCBzZXJpYWxpemVkIEpTT04gd2hlcmUgb25lIG9mIHRoZW0gaGFzIGFcbi8vIGRhbmdsaW5nIGNvbW1hIGFuZCB0aGUgb3RoZXIgZG9lc24ndC4gVHVybnMgb3V0IGluY2x1ZGluZyB0aGUgZGFuZ2xpbmcgY29tbWEgeWllbGRzIHRoZSBuaWNlc3Qgb3V0cHV0OlxuanNvbkRpZmYudXNlTG9uZ2VzdFRva2VuID0gdHJ1ZTtcblxuanNvbkRpZmYudG9rZW5pemUgPSBsaW5lRGlmZi50b2tlbml6ZTtcbmpzb25EaWZmLmNhc3RJbnB1dCA9IGZ1bmN0aW9uKHZhbHVlKSB7XG4gIGNvbnN0IHt1bmRlZmluZWRSZXBsYWNlbWVudCwgc3RyaW5naWZ5UmVwbGFjZXIgPSAoaywgdikgPT4gdHlwZW9mIHYgPT09ICd1bmRlZmluZWQnID8gdW5kZWZpbmVkUmVwbGFjZW1lbnQgOiB2fSA9IHRoaXMub3B0aW9ucztcblxuICByZXR1cm4gdHlwZW9mIHZhbHVlID09PSAnc3RyaW5nJyA/IHZhbHVlIDogSlNPTi5zdHJpbmdpZnkoY2Fub25pY2FsaXplKHZhbHVlLCBudWxsLCBudWxsLCBzdHJpbmdpZnlSZXBsYWNlciksIHN0cmluZ2lmeVJlcGxhY2VyLCAnICAnKTtcbn07XG5qc29uRGlmZi5lcXVhbHMgPSBmdW5jdGlvbihsZWZ0LCByaWdodCkge1xuICByZXR1cm4gRGlmZi5wcm90b3R5cGUuZXF1YWxzLmNhbGwoanNvbkRpZmYsIGxlZnQucmVwbGFjZSgvLChbXFxyXFxuXSkvZywgJyQxJyksIHJpZ2h0LnJlcGxhY2UoLywoW1xcclxcbl0pL2csICckMScpKTtcbn07XG5cbmV4cG9ydCBmdW5jdGlvbiBkaWZmSnNvbihvbGRPYmosIG5ld09iaiwgb3B0aW9ucykgeyByZXR1cm4ganNvbkRpZmYuZGlmZihvbGRPYmosIG5ld09iaiwgb3B0aW9ucyk7IH1cblxuLy8gVGhpcyBmdW5jdGlvbiBoYW5kbGVzIHRoZSBwcmVzZW5jZSBvZiBjaXJjdWxhciByZWZlcmVuY2VzIGJ5IGJhaWxpbmcgb3V0IHdoZW4gZW5jb3VudGVyaW5nIGFuXG4vLyBvYmplY3QgdGhhdCBpcyBhbHJlYWR5IG9uIHRoZSBcInN0YWNrXCIgb2YgaXRlbXMgYmVpbmcgcHJvY2Vzc2VkLiBBY2NlcHRzIGFuIG9wdGlvbmFsIHJlcGxhY2VyXG5leHBvcnQgZnVuY3Rpb24gY2Fub25pY2FsaXplKG9iaiwgc3RhY2ssIHJlcGxhY2VtZW50U3RhY2ssIHJlcGxhY2VyLCBrZXkpIHtcbiAgc3RhY2sgPSBzdGFjayB8fCBbXTtcbiAgcmVwbGFjZW1lbnRTdGFjayA9IHJlcGxhY2VtZW50U3RhY2sgfHwgW107XG5cbiAgaWYgKHJlcGxhY2VyKSB7XG4gICAgb2JqID0gcmVwbGFjZXIoa2V5LCBvYmopO1xuICB9XG5cbiAgbGV0IGk7XG5cbiAgZm9yIChpID0gMDsgaSA8IHN0YWNrLmxlbmd0aDsgaSArPSAxKSB7XG4gICAgaWYgKHN0YWNrW2ldID09PSBvYmopIHtcbiAgICAgIHJldHVybiByZXBsYWNlbWVudFN0YWNrW2ldO1xuICAgIH1cbiAgfVxuXG4gIGxldCBjYW5vbmljYWxpemVkT2JqO1xuXG4gIGlmICgnW29iamVjdCBBcnJheV0nID09PSBvYmplY3RQcm90b3R5cGVUb1N0cmluZy5jYWxsKG9iaikpIHtcbiAgICBzdGFjay5wdXNoKG9iaik7XG4gICAgY2Fub25pY2FsaXplZE9iaiA9IG5ldyBBcnJheShvYmoubGVuZ3RoKTtcbiAgICByZXBsYWNlbWVudFN0YWNrLnB1c2goY2Fub25pY2FsaXplZE9iaik7XG4gICAgZm9yIChpID0gMDsgaSA8IG9iai5sZW5ndGg7IGkgKz0gMSkge1xuICAgICAgY2Fub25pY2FsaXplZE9ialtpXSA9IGNhbm9uaWNhbGl6ZShvYmpbaV0sIHN0YWNrLCByZXBsYWNlbWVudFN0YWNrLCByZXBsYWNlciwga2V5KTtcbiAgICB9XG4gICAgc3RhY2sucG9wKCk7XG4gICAgcmVwbGFjZW1lbnRTdGFjay5wb3AoKTtcbiAgICByZXR1cm4gY2Fub25pY2FsaXplZE9iajtcbiAgfVxuXG4gIGlmIChvYmogJiYgb2JqLnRvSlNPTikge1xuICAgIG9iaiA9IG9iai50b0pTT04oKTtcbiAgfVxuXG4gIGlmICh0eXBlb2Ygb2JqID09PSAnb2JqZWN0JyAmJiBvYmogIT09IG51bGwpIHtcbiAgICBzdGFjay5wdXNoKG9iaik7XG4gICAgY2Fub25pY2FsaXplZE9iaiA9IHt9O1xuICAgIHJlcGxhY2VtZW50U3RhY2sucHVzaChjYW5vbmljYWxpemVkT2JqKTtcbiAgICBsZXQgc29ydGVkS2V5cyA9IFtdLFxuICAgICAgICBrZXk7XG4gICAgZm9yIChrZXkgaW4gb2JqKSB7XG4gICAgICAvKiBpc3RhbmJ1bCBpZ25vcmUgZWxzZSAqL1xuICAgICAgaWYgKG9iai5oYXNPd25Qcm9wZXJ0eShrZXkpKSB7XG4gICAgICAgIHNvcnRlZEtleXMucHVzaChrZXkpO1xuICAgICAgfVxuICAgIH1cbiAgICBzb3J0ZWRLZXlzLnNvcnQoKTtcbiAgICBmb3IgKGkgPSAwOyBpIDwgc29ydGVkS2V5cy5sZW5ndGg7IGkgKz0gMSkge1xuICAgICAga2V5ID0gc29ydGVkS2V5c1tpXTtcbiAgICAgIGNhbm9uaWNhbGl6ZWRPYmpba2V5XSA9IGNhbm9uaWNhbGl6ZShvYmpba2V5XSwgc3RhY2ssIHJlcGxhY2VtZW50U3RhY2ssIHJlcGxhY2VyLCBrZXkpO1xuICAgIH1cbiAgICBzdGFjay5wb3AoKTtcbiAgICByZXBsYWNlbWVudFN0YWNrLnBvcCgpO1xuICB9IGVsc2Uge1xuICAgIGNhbm9uaWNhbGl6ZWRPYmogPSBvYmo7XG4gIH1cbiAgcmV0dXJuIGNhbm9uaWNhbGl6ZWRPYmo7XG59XG4iXX0=
diff --git a/node_modules/diff/lib/diff/line.js b/node_modules/diff/lib/diff/line.js
new file mode 100644
index 0000000..f03eedb
--- /dev/null
+++ b/node_modules/diff/lib/diff/line.js
@@ -0,0 +1,50 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports.lineDiff = undefined;
+exports. /*istanbul ignore end*/diffLines = diffLines;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffTrimmedLines = diffTrimmedLines;
+
+var /*istanbul ignore start*/_base = require('./base') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+/*istanbul ignore end*/var /*istanbul ignore start*/_params = require('../util/params') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+/*istanbul ignore end*/var lineDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/lineDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+lineDiff.tokenize = function (value) {
+  var retLines = [],
+      linesAndNewlines = value.split(/(\n|\r\n)/);
+
+  // Ignore the final empty token that occurs if the string ends with a new line
+  if (!linesAndNewlines[linesAndNewlines.length - 1]) {
+    linesAndNewlines.pop();
+  }
+
+  // Merge the content and line separators into single tokens
+  for (var i = 0; i < linesAndNewlines.length; i++) {
+    var line = linesAndNewlines[i];
+
+    if (i % 2 && !this.options.newlineIsToken) {
+      retLines[retLines.length - 1] += line;
+    } else {
+      if (this.options.ignoreWhitespace) {
+        line = line.trim();
+      }
+      retLines.push(line);
+    }
+  }
+
+  return retLines;
+};
+
+function diffLines(oldStr, newStr, callback) {
+  return lineDiff.diff(oldStr, newStr, callback);
+}
+function diffTrimmedLines(oldStr, newStr, callback) {
+  var options = /*istanbul ignore start*/(0, _params.generateOptions) /*istanbul ignore end*/(callback, { ignoreWhitespace: true });
+  return lineDiff.diff(oldStr, newStr, options);
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2xpbmUuanMiXSwibmFtZXMiOlsiZGlmZkxpbmVzIiwiZGlmZlRyaW1tZWRMaW5lcyIsImxpbmVEaWZmIiwidG9rZW5pemUiLCJ2YWx1ZSIsInJldExpbmVzIiwibGluZXNBbmROZXdsaW5lcyIsInNwbGl0IiwibGVuZ3RoIiwicG9wIiwiaSIsImxpbmUiLCJvcHRpb25zIiwibmV3bGluZUlzVG9rZW4iLCJpZ25vcmVXaGl0ZXNwYWNlIiwidHJpbSIsInB1c2giLCJvbGRTdHIiLCJuZXdTdHIiLCJjYWxsYmFjayIsImRpZmYiXSwibWFwcGluZ3MiOiI7Ozs7Z0NBOEJnQkEsUyxHQUFBQSxTO3lEQUNBQyxnQixHQUFBQSxnQjs7QUEvQmhCOzs7O3VCQUNBOzs7O3VCQUVPLElBQU1DLCtFQUFXLHdFQUFqQjtBQUNQQSxTQUFTQyxRQUFULEdBQW9CLFVBQVNDLEtBQVQsRUFBZ0I7QUFDbEMsTUFBSUMsV0FBVyxFQUFmO0FBQUEsTUFDSUMsbUJBQW1CRixNQUFNRyxLQUFOLENBQVksV0FBWixDQUR2Qjs7QUFHQTtBQUNBLE1BQUksQ0FBQ0QsaUJBQWlCQSxpQkFBaUJFLE1BQWpCLEdBQTBCLENBQTNDLENBQUwsRUFBb0Q7QUFDbERGLHFCQUFpQkcsR0FBakI7QUFDRDs7QUFFRDtBQUNBLE9BQUssSUFBSUMsSUFBSSxDQUFiLEVBQWdCQSxJQUFJSixpQkFBaUJFLE1BQXJDLEVBQTZDRSxHQUE3QyxFQUFrRDtBQUNoRCxRQUFJQyxPQUFPTCxpQkFBaUJJLENBQWpCLENBQVg7O0FBRUEsUUFBSUEsSUFBSSxDQUFKLElBQVMsQ0FBQyxLQUFLRSxPQUFMLENBQWFDLGNBQTNCLEVBQTJDO0FBQ3pDUixlQUFTQSxTQUFTRyxNQUFULEdBQWtCLENBQTNCLEtBQWlDRyxJQUFqQztBQUNELEtBRkQsTUFFTztBQUNMLFVBQUksS0FBS0MsT0FBTCxDQUFhRSxnQkFBakIsRUFBbUM7QUFDakNILGVBQU9BLEtBQUtJLElBQUwsRUFBUDtBQUNEO0FBQ0RWLGVBQVNXLElBQVQsQ0FBY0wsSUFBZDtBQUNEO0FBQ0Y7O0FBRUQsU0FBT04sUUFBUDtBQUNELENBeEJEOztBQTBCTyxTQUFTTCxTQUFULENBQW1CaUIsTUFBbkIsRUFBMkJDLE1BQTNCLEVBQW1DQyxRQUFuQyxFQUE2QztBQUFFLFNBQU9qQixTQUFTa0IsSUFBVCxDQUFjSCxNQUFkLEVBQXNCQyxNQUF0QixFQUE4QkMsUUFBOUIsQ0FBUDtBQUFpRDtBQUNoRyxTQUFTbEIsZ0JBQVQsQ0FBMEJnQixNQUExQixFQUFrQ0MsTUFBbEMsRUFBMENDLFFBQTFDLEVBQW9EO0FBQ3pELE1BQUlQLFVBQVUsOEVBQWdCTyxRQUFoQixFQUEwQixFQUFDTCxrQkFBa0IsSUFBbkIsRUFBMUIsQ0FBZDtBQUNBLFNBQU9aLFNBQVNrQixJQUFULENBQWNILE1BQWQsRUFBc0JDLE1BQXRCLEVBQThCTixPQUE5QixDQUFQO0FBQ0QiLCJmaWxlIjoibGluZS5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCBEaWZmIGZyb20gJy4vYmFzZSc7XG5pbXBvcnQge2dlbmVyYXRlT3B0aW9uc30gZnJvbSAnLi4vdXRpbC9wYXJhbXMnO1xuXG5leHBvcnQgY29uc3QgbGluZURpZmYgPSBuZXcgRGlmZigpO1xubGluZURpZmYudG9rZW5pemUgPSBmdW5jdGlvbih2YWx1ZSkge1xuICBsZXQgcmV0TGluZXMgPSBbXSxcbiAgICAgIGxpbmVzQW5kTmV3bGluZXMgPSB2YWx1ZS5zcGxpdCgvKFxcbnxcXHJcXG4pLyk7XG5cbiAgLy8gSWdub3JlIHRoZSBmaW5hbCBlbXB0eSB0b2tlbiB0aGF0IG9jY3VycyBpZiB0aGUgc3RyaW5nIGVuZHMgd2l0aCBhIG5ldyBsaW5lXG4gIGlmICghbGluZXNBbmROZXdsaW5lc1tsaW5lc0FuZE5ld2xpbmVzLmxlbmd0aCAtIDFdKSB7XG4gICAgbGluZXNBbmROZXdsaW5lcy5wb3AoKTtcbiAgfVxuXG4gIC8vIE1lcmdlIHRoZSBjb250ZW50IGFuZCBsaW5lIHNlcGFyYXRvcnMgaW50byBzaW5nbGUgdG9rZW5zXG4gIGZvciAobGV0IGkgPSAwOyBpIDwgbGluZXNBbmROZXdsaW5lcy5sZW5ndGg7IGkrKykge1xuICAgIGxldCBsaW5lID0gbGluZXNBbmROZXdsaW5lc1tpXTtcblxuICAgIGlmIChpICUgMiAmJiAhdGhpcy5vcHRpb25zLm5ld2xpbmVJc1Rva2VuKSB7XG4gICAgICByZXRMaW5lc1tyZXRMaW5lcy5sZW5ndGggLSAxXSArPSBsaW5lO1xuICAgIH0gZWxzZSB7XG4gICAgICBpZiAodGhpcy5vcHRpb25zLmlnbm9yZVdoaXRlc3BhY2UpIHtcbiAgICAgICAgbGluZSA9IGxpbmUudHJpbSgpO1xuICAgICAgfVxuICAgICAgcmV0TGluZXMucHVzaChsaW5lKTtcbiAgICB9XG4gIH1cblxuICByZXR1cm4gcmV0TGluZXM7XG59O1xuXG5leHBvcnQgZnVuY3Rpb24gZGlmZkxpbmVzKG9sZFN0ciwgbmV3U3RyLCBjYWxsYmFjaykgeyByZXR1cm4gbGluZURpZmYuZGlmZihvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spOyB9XG5leHBvcnQgZnVuY3Rpb24gZGlmZlRyaW1tZWRMaW5lcyhvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spIHtcbiAgbGV0IG9wdGlvbnMgPSBnZW5lcmF0ZU9wdGlvbnMoY2FsbGJhY2ssIHtpZ25vcmVXaGl0ZXNwYWNlOiB0cnVlfSk7XG4gIHJldHVybiBsaW5lRGlmZi5kaWZmKG9sZFN0ciwgbmV3U3RyLCBvcHRpb25zKTtcbn1cbiJdfQ==
diff --git a/node_modules/diff/lib/diff/sentence.js b/node_modules/diff/lib/diff/sentence.js
new file mode 100644
index 0000000..c1dcb20
--- /dev/null
+++ b/node_modules/diff/lib/diff/sentence.js
@@ -0,0 +1,21 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports.sentenceDiff = undefined;
+exports. /*istanbul ignore end*/diffSentences = diffSentences;
+
+var /*istanbul ignore start*/_base = require('./base') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+/*istanbul ignore end*/var sentenceDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/sentenceDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+sentenceDiff.tokenize = function (value) {
+  return value.split(/(\S.+?[.!?])(?=\s+|$)/);
+};
+
+function diffSentences(oldStr, newStr, callback) {
+  return sentenceDiff.diff(oldStr, newStr, callback);
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL3NlbnRlbmNlLmpzIl0sIm5hbWVzIjpbImRpZmZTZW50ZW5jZXMiLCJzZW50ZW5jZURpZmYiLCJ0b2tlbml6ZSIsInZhbHVlIiwic3BsaXQiLCJvbGRTdHIiLCJuZXdTdHIiLCJjYWxsYmFjayIsImRpZmYiXSwibWFwcGluZ3MiOiI7Ozs7Z0NBUWdCQSxhLEdBQUFBLGE7O0FBUmhCOzs7Ozs7dUJBR08sSUFBTUMsdUZBQWUsd0VBQXJCO0FBQ1BBLGFBQWFDLFFBQWIsR0FBd0IsVUFBU0MsS0FBVCxFQUFnQjtBQUN0QyxTQUFPQSxNQUFNQyxLQUFOLENBQVksdUJBQVosQ0FBUDtBQUNELENBRkQ7O0FBSU8sU0FBU0osYUFBVCxDQUF1QkssTUFBdkIsRUFBK0JDLE1BQS9CLEVBQXVDQyxRQUF2QyxFQUFpRDtBQUFFLFNBQU9OLGFBQWFPLElBQWIsQ0FBa0JILE1BQWxCLEVBQTBCQyxNQUExQixFQUFrQ0MsUUFBbEMsQ0FBUDtBQUFxRCIsImZpbGUiOiJzZW50ZW5jZS5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCBEaWZmIGZyb20gJy4vYmFzZSc7XG5cblxuZXhwb3J0IGNvbnN0IHNlbnRlbmNlRGlmZiA9IG5ldyBEaWZmKCk7XG5zZW50ZW5jZURpZmYudG9rZW5pemUgPSBmdW5jdGlvbih2YWx1ZSkge1xuICByZXR1cm4gdmFsdWUuc3BsaXQoLyhcXFMuKz9bLiE/XSkoPz1cXHMrfCQpLyk7XG59O1xuXG5leHBvcnQgZnVuY3Rpb24gZGlmZlNlbnRlbmNlcyhvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spIHsgcmV0dXJuIHNlbnRlbmNlRGlmZi5kaWZmKG9sZFN0ciwgbmV3U3RyLCBjYWxsYmFjayk7IH1cbiJdfQ==
diff --git a/node_modules/diff/lib/diff/word.js b/node_modules/diff/lib/diff/word.js
new file mode 100644
index 0000000..4af1b05
--- /dev/null
+++ b/node_modules/diff/lib/diff/word.js
@@ -0,0 +1,70 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports.wordDiff = undefined;
+exports. /*istanbul ignore end*/diffWords = diffWords;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffWordsWithSpace = diffWordsWithSpace;
+
+var /*istanbul ignore start*/_base = require('./base') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+/*istanbul ignore end*/var /*istanbul ignore start*/_params = require('../util/params') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+/*istanbul ignore end*/ // Based on https://en.wikipedia.org/wiki/Latin_script_in_Unicode
+//
+// Ranges and exceptions:
+// Latin-1 Supplement, 0080–00FF
+//  - U+00D7  × Multiplication sign
+//  - U+00F7  ÷ Division sign
+// Latin Extended-A, 0100–017F
+// Latin Extended-B, 0180–024F
+// IPA Extensions, 0250–02AF
+// Spacing Modifier Letters, 02B0–02FF
+//  - U+02C7  ˇ ˇ  Caron
+//  - U+02D8  ˘ ˘  Breve
+//  - U+02D9  ˙ ˙  Dot Above
+//  - U+02DA  ˚ ˚  Ring Above
+//  - U+02DB  ˛ ˛  Ogonek
+//  - U+02DC  ˜ ˜  Small Tilde
+//  - U+02DD  ˝ ˝  Double Acute Accent
+// Latin Extended Additional, 1E00–1EFF
+var extendedWordChars = /^[A-Za-z\xC0-\u02C6\u02C8-\u02D7\u02DE-\u02FF\u1E00-\u1EFF]+$/;
+
+var reWhitespace = /\S/;
+
+var wordDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/wordDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+wordDiff.equals = function (left, right) {
+  if (this.options.ignoreCase) {
+    left = left.toLowerCase();
+    right = right.toLowerCase();
+  }
+  return left === right || this.options.ignoreWhitespace && !reWhitespace.test(left) && !reWhitespace.test(right);
+};
+wordDiff.tokenize = function (value) {
+  var tokens = value.split(/(\s+|\b)/);
+
+  // Join the boundary splits that we do not consider to be boundaries. This is primarily the extended Latin character set.
+  for (var i = 0; i < tokens.length - 1; i++) {
+    // If we have an empty string in the next field and we have only word chars before and after, merge
+    if (!tokens[i + 1] && tokens[i + 2] && extendedWordChars.test(tokens[i]) && extendedWordChars.test(tokens[i + 2])) {
+      tokens[i] += tokens[i + 2];
+      tokens.splice(i + 1, 2);
+      i--;
+    }
+  }
+
+  return tokens;
+};
+
+function diffWords(oldStr, newStr, options) {
+  options = /*istanbul ignore start*/(0, _params.generateOptions) /*istanbul ignore end*/(options, { ignoreWhitespace: true });
+  return wordDiff.diff(oldStr, newStr, options);
+}
+
+function diffWordsWithSpace(oldStr, newStr, options) {
+  return wordDiff.diff(oldStr, newStr, options);
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL3dvcmQuanMiXSwibmFtZXMiOlsiZGlmZldvcmRzIiwiZGlmZldvcmRzV2l0aFNwYWNlIiwiZXh0ZW5kZWRXb3JkQ2hhcnMiLCJyZVdoaXRlc3BhY2UiLCJ3b3JkRGlmZiIsImVxdWFscyIsImxlZnQiLCJyaWdodCIsIm9wdGlvbnMiLCJpZ25vcmVDYXNlIiwidG9Mb3dlckNhc2UiLCJpZ25vcmVXaGl0ZXNwYWNlIiwidGVzdCIsInRva2VuaXplIiwidmFsdWUiLCJ0b2tlbnMiLCJzcGxpdCIsImkiLCJsZW5ndGgiLCJzcGxpY2UiLCJvbGRTdHIiLCJuZXdTdHIiLCJkaWZmIl0sIm1hcHBpbmdzIjoiOzs7O2dDQW1EZ0JBLFMsR0FBQUEsUzt5REFLQUMsa0IsR0FBQUEsa0I7O0FBeERoQjs7Ozt1QkFDQTs7Ozt3QkFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxJQUFNQyxvQkFBb0IsK0RBQTFCOztBQUVBLElBQU1DLGVBQWUsSUFBckI7O0FBRU8sSUFBTUMsK0VBQVcsd0VBQWpCO0FBQ1BBLFNBQVNDLE1BQVQsR0FBa0IsVUFBU0MsSUFBVCxFQUFlQyxLQUFmLEVBQXNCO0FBQ3RDLE1BQUksS0FBS0MsT0FBTCxDQUFhQyxVQUFqQixFQUE2QjtBQUMzQkgsV0FBT0EsS0FBS0ksV0FBTCxFQUFQO0FBQ0FILFlBQVFBLE1BQU1HLFdBQU4sRUFBUjtBQUNEO0FBQ0QsU0FBT0osU0FBU0MsS0FBVCxJQUFtQixLQUFLQyxPQUFMLENBQWFHLGdCQUFiLElBQWlDLENBQUNSLGFBQWFTLElBQWIsQ0FBa0JOLElBQWxCLENBQWxDLElBQTZELENBQUNILGFBQWFTLElBQWIsQ0FBa0JMLEtBQWxCLENBQXhGO0FBQ0QsQ0FORDtBQU9BSCxTQUFTUyxRQUFULEdBQW9CLFVBQVNDLEtBQVQsRUFBZ0I7QUFDbEMsTUFBSUMsU0FBU0QsTUFBTUUsS0FBTixDQUFZLFVBQVosQ0FBYjs7QUFFQTtBQUNBLE9BQUssSUFBSUMsSUFBSSxDQUFiLEVBQWdCQSxJQUFJRixPQUFPRyxNQUFQLEdBQWdCLENBQXBDLEVBQXVDRCxHQUF2QyxFQUE0QztBQUMxQztBQUNBLFFBQUksQ0FBQ0YsT0FBT0UsSUFBSSxDQUFYLENBQUQsSUFBa0JGLE9BQU9FLElBQUksQ0FBWCxDQUFsQixJQUNLZixrQkFBa0JVLElBQWxCLENBQXVCRyxPQUFPRSxDQUFQLENBQXZCLENBREwsSUFFS2Ysa0JBQWtCVSxJQUFsQixDQUF1QkcsT0FBT0UsSUFBSSxDQUFYLENBQXZCLENBRlQsRUFFZ0Q7QUFDOUNGLGFBQU9FLENBQVAsS0FBYUYsT0FBT0UsSUFBSSxDQUFYLENBQWI7QUFDQUYsYUFBT0ksTUFBUCxDQUFjRixJQUFJLENBQWxCLEVBQXFCLENBQXJCO0FBQ0FBO0FBQ0Q7QUFDRjs7QUFFRCxTQUFPRixNQUFQO0FBQ0QsQ0FoQkQ7O0FBa0JPLFNBQVNmLFNBQVQsQ0FBbUJvQixNQUFuQixFQUEyQkMsTUFBM0IsRUFBbUNiLE9BQW5DLEVBQTRDO0FBQ2pEQSxZQUFVLDhFQUFnQkEsT0FBaEIsRUFBeUIsRUFBQ0csa0JBQWtCLElBQW5CLEVBQXpCLENBQVY7QUFDQSxTQUFPUCxTQUFTa0IsSUFBVCxDQUFjRixNQUFkLEVBQXNCQyxNQUF0QixFQUE4QmIsT0FBOUIsQ0FBUDtBQUNEOztBQUVNLFNBQVNQLGtCQUFULENBQTRCbUIsTUFBNUIsRUFBb0NDLE1BQXBDLEVBQTRDYixPQUE1QyxFQUFxRDtBQUMxRCxTQUFPSixTQUFTa0IsSUFBVCxDQUFjRixNQUFkLEVBQXNCQyxNQUF0QixFQUE4QmIsT0FBOUIsQ0FBUDtBQUNEIiwiZmlsZSI6IndvcmQuanMiLCJzb3VyY2VzQ29udGVudCI6WyJpbXBvcnQgRGlmZiBmcm9tICcuL2Jhc2UnO1xuaW1wb3J0IHtnZW5lcmF0ZU9wdGlvbnN9IGZyb20gJy4uL3V0aWwvcGFyYW1zJztcblxuLy8gQmFzZWQgb24gaHR0cHM6Ly9lbi53aWtpcGVkaWEub3JnL3dpa2kvTGF0aW5fc2NyaXB0X2luX1VuaWNvZGVcbi8vXG4vLyBSYW5nZXMgYW5kIGV4Y2VwdGlvbnM6XG4vLyBMYXRpbi0xIFN1cHBsZW1lbnQsIDAwODDigJMwMEZGXG4vLyAgLSBVKzAwRDcgIMOXIE11bHRpcGxpY2F0aW9uIHNpZ25cbi8vICAtIFUrMDBGNyAgw7cgRGl2aXNpb24gc2lnblxuLy8gTGF0aW4gRXh0ZW5kZWQtQSwgMDEwMOKAkzAxN0Zcbi8vIExhdGluIEV4dGVuZGVkLUIsIDAxODDigJMwMjRGXG4vLyBJUEEgRXh0ZW5zaW9ucywgMDI1MOKAkzAyQUZcbi8vIFNwYWNpbmcgTW9kaWZpZXIgTGV0dGVycywgMDJCMOKAkzAyRkZcbi8vICAtIFUrMDJDNyAgy4cgJiM3MTE7ICBDYXJvblxuLy8gIC0gVSswMkQ4ICDLmCAmIzcyODsgIEJyZXZlXG4vLyAgLSBVKzAyRDkgIMuZICYjNzI5OyAgRG90IEFib3ZlXG4vLyAgLSBVKzAyREEgIMuaICYjNzMwOyAgUmluZyBBYm92ZVxuLy8gIC0gVSswMkRCICDLmyAmIzczMTsgIE9nb25la1xuLy8gIC0gVSswMkRDICDLnCAmIzczMjsgIFNtYWxsIFRpbGRlXG4vLyAgLSBVKzAyREQgIMudICYjNzMzOyAgRG91YmxlIEFjdXRlIEFjY2VudFxuLy8gTGF0aW4gRXh0ZW5kZWQgQWRkaXRpb25hbCwgMUUwMOKAkzFFRkZcbmNvbnN0IGV4dGVuZGVkV29yZENoYXJzID0gL15bYS16QS1aXFx1e0MwfS1cXHV7RkZ9XFx1e0Q4fS1cXHV7RjZ9XFx1e0Y4fS1cXHV7MkM2fVxcdXsyQzh9LVxcdXsyRDd9XFx1ezJERX0tXFx1ezJGRn1cXHV7MUUwMH0tXFx1ezFFRkZ9XSskL3U7XG5cbmNvbnN0IHJlV2hpdGVzcGFjZSA9IC9cXFMvO1xuXG5leHBvcnQgY29uc3Qgd29yZERpZmYgPSBuZXcgRGlmZigpO1xud29yZERpZmYuZXF1YWxzID0gZnVuY3Rpb24obGVmdCwgcmlnaHQpIHtcbiAgaWYgKHRoaXMub3B0aW9ucy5pZ25vcmVDYXNlKSB7XG4gICAgbGVmdCA9IGxlZnQudG9Mb3dlckNhc2UoKTtcbiAgICByaWdodCA9IHJpZ2h0LnRvTG93ZXJDYXNlKCk7XG4gIH1cbiAgcmV0dXJuIGxlZnQgPT09IHJpZ2h0IHx8ICh0aGlzLm9wdGlvbnMuaWdub3JlV2hpdGVzcGFjZSAmJiAhcmVXaGl0ZXNwYWNlLnRlc3QobGVmdCkgJiYgIXJlV2hpdGVzcGFjZS50ZXN0KHJpZ2h0KSk7XG59O1xud29yZERpZmYudG9rZW5pemUgPSBmdW5jdGlvbih2YWx1ZSkge1xuICBsZXQgdG9rZW5zID0gdmFsdWUuc3BsaXQoLyhcXHMrfFxcYikvKTtcblxuICAvLyBKb2luIHRoZSBib3VuZGFyeSBzcGxpdHMgdGhhdCB3ZSBkbyBub3QgY29uc2lkZXIgdG8gYmUgYm91bmRhcmllcy4gVGhpcyBpcyBwcmltYXJpbHkgdGhlIGV4dGVuZGVkIExhdGluIGNoYXJhY3RlciBzZXQuXG4gIGZvciAobGV0IGkgPSAwOyBpIDwgdG9rZW5zLmxlbmd0aCAtIDE7IGkrKykge1xuICAgIC8vIElmIHdlIGhhdmUgYW4gZW1wdHkgc3RyaW5nIGluIHRoZSBuZXh0IGZpZWxkIGFuZCB3ZSBoYXZlIG9ubHkgd29yZCBjaGFycyBiZWZvcmUgYW5kIGFmdGVyLCBtZXJnZVxuICAgIGlmICghdG9rZW5zW2kgKyAxXSAmJiB0b2tlbnNbaSArIDJdXG4gICAgICAgICAgJiYgZXh0ZW5kZWRXb3JkQ2hhcnMudGVzdCh0b2tlbnNbaV0pXG4gICAgICAgICAgJiYgZXh0ZW5kZWRXb3JkQ2hhcnMudGVzdCh0b2tlbnNbaSArIDJdKSkge1xuICAgICAgdG9rZW5zW2ldICs9IHRva2Vuc1tpICsgMl07XG4gICAgICB0b2tlbnMuc3BsaWNlKGkgKyAxLCAyKTtcbiAgICAgIGktLTtcbiAgICB9XG4gIH1cblxuICByZXR1cm4gdG9rZW5zO1xufTtcblxuZXhwb3J0IGZ1bmN0aW9uIGRpZmZXb3JkcyhvbGRTdHIsIG5ld1N0ciwgb3B0aW9ucykge1xuICBvcHRpb25zID0gZ2VuZXJhdGVPcHRpb25zKG9wdGlvbnMsIHtpZ25vcmVXaGl0ZXNwYWNlOiB0cnVlfSk7XG4gIHJldHVybiB3b3JkRGlmZi5kaWZmKG9sZFN0ciwgbmV3U3RyLCBvcHRpb25zKTtcbn1cblxuZXhwb3J0IGZ1bmN0aW9uIGRpZmZXb3Jkc1dpdGhTcGFjZShvbGRTdHIsIG5ld1N0ciwgb3B0aW9ucykge1xuICByZXR1cm4gd29yZERpZmYuZGlmZihvbGRTdHIsIG5ld1N0ciwgb3B0aW9ucyk7XG59XG4iXX0=
diff --git a/node_modules/diff/lib/index.js b/node_modules/diff/lib/index.js
new file mode 100644
index 0000000..8608caf
--- /dev/null
+++ b/node_modules/diff/lib/index.js
@@ -0,0 +1,74 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports.canonicalize = exports.convertChangesToXML = exports.convertChangesToDMP = exports.merge = exports.parsePatch = exports.applyPatches = exports.applyPatch = exports.createPatch = exports.createTwoFilesPatch = exports.structuredPatch = exports.diffArrays = exports.diffJson = exports.diffCss = exports.diffSentences = exports.diffTrimmedLines = exports.diffLines = exports.diffWordsWithSpace = exports.diffWords = exports.diffChars = exports.Diff = undefined;
+
+/*istanbul ignore end*/var /*istanbul ignore start*/_base = require('./diff/base') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+/*istanbul ignore end*/var /*istanbul ignore start*/_character = require('./diff/character') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_word = require('./diff/word') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_line = require('./diff/line') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_sentence = require('./diff/sentence') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_css = require('./diff/css') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_json = require('./diff/json') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_array = require('./diff/array') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_apply = require('./patch/apply') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_parse = require('./patch/parse') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_merge = require('./patch/merge') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_create = require('./patch/create') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_dmp = require('./convert/dmp') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_xml = require('./convert/xml') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+/* See LICENSE file for terms of use */
+
+/*
+ * Text diff implementation.
+ *
+ * This library supports the following APIS:
+ * JsDiff.diffChars: Character by character diff
+ * JsDiff.diffWords: Word (as defined by \b regex) diff which ignores whitespace
+ * JsDiff.diffLines: Line based diff
+ *
+ * JsDiff.diffCss: Diff targeted at CSS content
+ *
+ * These methods are based on the implementation proposed in
+ * "An O(ND) Difference Algorithm and its Variations" (Myers, 1986).
+ * http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.4.6927
+ */
+exports. /*istanbul ignore end*/Diff = _base2['default'];
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffChars = _character.diffChars;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffWords = _word.diffWords;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffWordsWithSpace = _word.diffWordsWithSpace;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffLines = _line.diffLines;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffTrimmedLines = _line.diffTrimmedLines;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffSentences = _sentence.diffSentences;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffCss = _css.diffCss;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffJson = _json.diffJson;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffArrays = _array.diffArrays;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/structuredPatch = _create.structuredPatch;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/createTwoFilesPatch = _create.createTwoFilesPatch;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/createPatch = _create.createPatch;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/applyPatch = _apply.applyPatch;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/applyPatches = _apply.applyPatches;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/parsePatch = _parse.parsePatch;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/merge = _merge.merge;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/convertChangesToDMP = _dmp.convertChangesToDMP;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/convertChangesToXML = _xml.convertChangesToXML;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/canonicalize = _json.canonicalize;
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uL3NyYy9pbmRleC5qcyJdLCJuYW1lcyI6WyJEaWZmIiwiZGlmZkNoYXJzIiwiZGlmZldvcmRzIiwiZGlmZldvcmRzV2l0aFNwYWNlIiwiZGlmZkxpbmVzIiwiZGlmZlRyaW1tZWRMaW5lcyIsImRpZmZTZW50ZW5jZXMiLCJkaWZmQ3NzIiwiZGlmZkpzb24iLCJkaWZmQXJyYXlzIiwic3RydWN0dXJlZFBhdGNoIiwiY3JlYXRlVHdvRmlsZXNQYXRjaCIsImNyZWF0ZVBhdGNoIiwiYXBwbHlQYXRjaCIsImFwcGx5UGF0Y2hlcyIsInBhcnNlUGF0Y2giLCJtZXJnZSIsImNvbnZlcnRDaGFuZ2VzVG9ETVAiLCJjb252ZXJ0Q2hhbmdlc1RvWE1MIiwiY2Fub25pY2FsaXplIl0sIm1hcHBpbmdzIjoiOzs7Ozt1QkFnQkE7Ozs7dUJBQ0E7O0FBQ0E7O0FBQ0E7O0FBQ0E7O0FBRUE7O0FBQ0E7O0FBRUE7O0FBRUE7O0FBQ0E7O0FBQ0E7O0FBQ0E7O0FBRUE7O0FBQ0E7Ozs7QUFqQ0E7O0FBRUE7Ozs7Ozs7Ozs7Ozs7O2dDQWtDRUEsSTt5REFFQUMsUzt5REFDQUMsUzt5REFDQUMsa0I7eURBQ0FDLFM7eURBQ0FDLGdCO3lEQUNBQyxhO3lEQUVBQyxPO3lEQUNBQyxRO3lEQUVBQyxVO3lEQUVBQyxlO3lEQUNBQyxtQjt5REFDQUMsVzt5REFDQUMsVTt5REFDQUMsWTt5REFDQUMsVTt5REFDQUMsSzt5REFDQUMsbUI7eURBQ0FDLG1CO3lEQUNBQyxZIiwiZmlsZSI6ImluZGV4LmpzIiwic291cmNlc0NvbnRlbnQiOlsiLyogU2VlIExJQ0VOU0UgZmlsZSBmb3IgdGVybXMgb2YgdXNlICovXG5cbi8qXG4gKiBUZXh0IGRpZmYgaW1wbGVtZW50YXRpb24uXG4gKlxuICogVGhpcyBsaWJyYXJ5IHN1cHBvcnRzIHRoZSBmb2xsb3dpbmcgQVBJUzpcbiAqIEpzRGlmZi5kaWZmQ2hhcnM6IENoYXJhY3RlciBieSBjaGFyYWN0ZXIgZGlmZlxuICogSnNEaWZmLmRpZmZXb3JkczogV29yZCAoYXMgZGVmaW5lZCBieSBcXGIgcmVnZXgpIGRpZmYgd2hpY2ggaWdub3JlcyB3aGl0ZXNwYWNlXG4gKiBKc0RpZmYuZGlmZkxpbmVzOiBMaW5lIGJhc2VkIGRpZmZcbiAqXG4gKiBKc0RpZmYuZGlmZkNzczogRGlmZiB0YXJnZXRlZCBhdCBDU1MgY29udGVudFxuICpcbiAqIFRoZXNlIG1ldGhvZHMgYXJlIGJhc2VkIG9uIHRoZSBpbXBsZW1lbnRhdGlvbiBwcm9wb3NlZCBpblxuICogXCJBbiBPKE5EKSBEaWZmZXJlbmNlIEFsZ29yaXRobSBhbmQgaXRzIFZhcmlhdGlvbnNcIiAoTXllcnMsIDE5ODYpLlxuICogaHR0cDovL2NpdGVzZWVyeC5pc3QucHN1LmVkdS92aWV3ZG9jL3N1bW1hcnk/ZG9pPTEwLjEuMS40LjY5MjdcbiAqL1xuaW1wb3J0IERpZmYgZnJvbSAnLi9kaWZmL2Jhc2UnO1xuaW1wb3J0IHtkaWZmQ2hhcnN9IGZyb20gJy4vZGlmZi9jaGFyYWN0ZXInO1xuaW1wb3J0IHtkaWZmV29yZHMsIGRpZmZXb3Jkc1dpdGhTcGFjZX0gZnJvbSAnLi9kaWZmL3dvcmQnO1xuaW1wb3J0IHtkaWZmTGluZXMsIGRpZmZUcmltbWVkTGluZXN9IGZyb20gJy4vZGlmZi9saW5lJztcbmltcG9ydCB7ZGlmZlNlbnRlbmNlc30gZnJvbSAnLi9kaWZmL3NlbnRlbmNlJztcblxuaW1wb3J0IHtkaWZmQ3NzfSBmcm9tICcuL2RpZmYvY3NzJztcbmltcG9ydCB7ZGlmZkpzb24sIGNhbm9uaWNhbGl6ZX0gZnJvbSAnLi9kaWZmL2pzb24nO1xuXG5pbXBvcnQge2RpZmZBcnJheXN9IGZyb20gJy4vZGlmZi9hcnJheSc7XG5cbmltcG9ydCB7YXBwbHlQYXRjaCwgYXBwbHlQYXRjaGVzfSBmcm9tICcuL3BhdGNoL2FwcGx5JztcbmltcG9ydCB7cGFyc2VQYXRjaH0gZnJvbSAnLi9wYXRjaC9wYXJzZSc7XG5pbXBvcnQge21lcmdlfSBmcm9tICcuL3BhdGNoL21lcmdlJztcbmltcG9ydCB7c3RydWN0dXJlZFBhdGNoLCBjcmVhdGVUd29GaWxlc1BhdGNoLCBjcmVhdGVQYXRjaH0gZnJvbSAnLi9wYXRjaC9jcmVhdGUnO1xuXG5pbXBvcnQge2NvbnZlcnRDaGFuZ2VzVG9ETVB9IGZyb20gJy4vY29udmVydC9kbXAnO1xuaW1wb3J0IHtjb252ZXJ0Q2hhbmdlc1RvWE1MfSBmcm9tICcuL2NvbnZlcnQveG1sJztcblxuZXhwb3J0IHtcbiAgRGlmZixcblxuICBkaWZmQ2hhcnMsXG4gIGRpZmZXb3JkcyxcbiAgZGlmZldvcmRzV2l0aFNwYWNlLFxuICBkaWZmTGluZXMsXG4gIGRpZmZUcmltbWVkTGluZXMsXG4gIGRpZmZTZW50ZW5jZXMsXG5cbiAgZGlmZkNzcyxcbiAgZGlmZkpzb24sXG5cbiAgZGlmZkFycmF5cyxcblxuICBzdHJ1Y3R1cmVkUGF0Y2gsXG4gIGNyZWF0ZVR3b0ZpbGVzUGF0Y2gsXG4gIGNyZWF0ZVBhdGNoLFxuICBhcHBseVBhdGNoLFxuICBhcHBseVBhdGNoZXMsXG4gIHBhcnNlUGF0Y2gsXG4gIG1lcmdlLFxuICBjb252ZXJ0Q2hhbmdlc1RvRE1QLFxuICBjb252ZXJ0Q2hhbmdlc1RvWE1MLFxuICBjYW5vbmljYWxpemVcbn07XG4iXX0=
diff --git a/node_modules/diff/lib/patch/apply.js b/node_modules/diff/lib/patch/apply.js
new file mode 100644
index 0000000..fa83015
--- /dev/null
+++ b/node_modules/diff/lib/patch/apply.js
@@ -0,0 +1,180 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports. /*istanbul ignore end*/applyPatch = applyPatch;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/applyPatches = applyPatches;
+
+var /*istanbul ignore start*/_parse = require('./parse') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_distanceIterator = require('../util/distance-iterator') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/var _distanceIterator2 = _interopRequireDefault(_distanceIterator);
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+/*istanbul ignore end*/function applyPatch(source, uniDiff) {
+  /*istanbul ignore start*/var /*istanbul ignore end*/options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
+
+  if (typeof uniDiff === 'string') {
+    uniDiff = /*istanbul ignore start*/(0, _parse.parsePatch) /*istanbul ignore end*/(uniDiff);
+  }
+
+  if (Array.isArray(uniDiff)) {
+    if (uniDiff.length > 1) {
+      throw new Error('applyPatch only works with a single input.');
+    }
+
+    uniDiff = uniDiff[0];
+  }
+
+  // Apply the diff to the input
+  var lines = source.split(/\r\n|[\n\v\f\r\x85]/),
+      delimiters = source.match(/\r\n|[\n\v\f\r\x85]/g) || [],
+      hunks = uniDiff.hunks,
+      compareLine = options.compareLine || function (lineNumber, line, operation, patchContent) /*istanbul ignore start*/{
+    return (/*istanbul ignore end*/line === patchContent
+    );
+  },
+      errorCount = 0,
+      fuzzFactor = options.fuzzFactor || 0,
+      minLine = 0,
+      offset = 0,
+      removeEOFNL = /*istanbul ignore start*/void 0 /*istanbul ignore end*/,
+      addEOFNL = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+
+  /**
+   * Checks if the hunk exactly fits on the provided location
+   */
+  function hunkFits(hunk, toPos) {
+    for (var j = 0; j < hunk.lines.length; j++) {
+      var line = hunk.lines[j],
+          operation = line.length > 0 ? line[0] : ' ',
+          content = line.length > 0 ? line.substr(1) : line;
+
+      if (operation === ' ' || operation === '-') {
+        // Context sanity check
+        if (!compareLine(toPos + 1, lines[toPos], operation, content)) {
+          errorCount++;
+
+          if (errorCount > fuzzFactor) {
+            return false;
+          }
+        }
+        toPos++;
+      }
+    }
+
+    return true;
+  }
+
+  // Search best fit offsets for each hunk based on the previous ones
+  for (var i = 0; i < hunks.length; i++) {
+    var hunk = hunks[i],
+        maxLine = lines.length - hunk.oldLines,
+        localOffset = 0,
+        toPos = offset + hunk.oldStart - 1;
+
+    var iterator = /*istanbul ignore start*/(0, _distanceIterator2['default']) /*istanbul ignore end*/(toPos, minLine, maxLine);
+
+    for (; localOffset !== undefined; localOffset = iterator()) {
+      if (hunkFits(hunk, toPos + localOffset)) {
+        hunk.offset = offset += localOffset;
+        break;
+      }
+    }
+
+    if (localOffset === undefined) {
+      return false;
+    }
+
+    // Set lower text limit to end of the current hunk, so next ones don't try
+    // to fit over already patched text
+    minLine = hunk.offset + hunk.oldStart + hunk.oldLines;
+  }
+
+  // Apply patch hunks
+  var diffOffset = 0;
+  for (var _i = 0; _i < hunks.length; _i++) {
+    var _hunk = hunks[_i],
+        _toPos = _hunk.oldStart + _hunk.offset + diffOffset - 1;
+    diffOffset += _hunk.newLines - _hunk.oldLines;
+
+    if (_toPos < 0) {
+      // Creating a new file
+      _toPos = 0;
+    }
+
+    for (var j = 0; j < _hunk.lines.length; j++) {
+      var line = _hunk.lines[j],
+          operation = line.length > 0 ? line[0] : ' ',
+          content = line.length > 0 ? line.substr(1) : line,
+          delimiter = _hunk.linedelimiters[j];
+
+      if (operation === ' ') {
+        _toPos++;
+      } else if (operation === '-') {
+        lines.splice(_toPos, 1);
+        delimiters.splice(_toPos, 1);
+        /* istanbul ignore else */
+      } else if (operation === '+') {
+        lines.splice(_toPos, 0, content);
+        delimiters.splice(_toPos, 0, delimiter);
+        _toPos++;
+      } else if (operation === '\\') {
+        var previousOperation = _hunk.lines[j - 1] ? _hunk.lines[j - 1][0] : null;
+        if (previousOperation === '+') {
+          removeEOFNL = true;
+        } else if (previousOperation === '-') {
+          addEOFNL = true;
+        }
+      }
+    }
+  }
+
+  // Handle EOFNL insertion/removal
+  if (removeEOFNL) {
+    while (!lines[lines.length - 1]) {
+      lines.pop();
+      delimiters.pop();
+    }
+  } else if (addEOFNL) {
+    lines.push('');
+    delimiters.push('\n');
+  }
+  for (var _k = 0; _k < lines.length - 1; _k++) {
+    lines[_k] = lines[_k] + delimiters[_k];
+  }
+  return lines.join('');
+}
+
+// Wrapper that supports multiple file patches via callbacks.
+function applyPatches(uniDiff, options) {
+  if (typeof uniDiff === 'string') {
+    uniDiff = /*istanbul ignore start*/(0, _parse.parsePatch) /*istanbul ignore end*/(uniDiff);
+  }
+
+  var currentIndex = 0;
+  function processIndex() {
+    var index = uniDiff[currentIndex++];
+    if (!index) {
+      return options.complete();
+    }
+
+    options.loadFile(index, function (err, data) {
+      if (err) {
+        return options.complete(err);
+      }
+
+      var updatedContent = applyPatch(data, index, options);
+      options.patched(index, updatedContent, function (err) {
+        if (err) {
+          return options.complete(err);
+        }
+
+        processIndex();
+      });
+    });
+  }
+  processIndex();
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9wYXRjaC9hcHBseS5qcyJdLCJuYW1lcyI6WyJhcHBseVBhdGNoIiwiYXBwbHlQYXRjaGVzIiwic291cmNlIiwidW5pRGlmZiIsIm9wdGlvbnMiLCJBcnJheSIsImlzQXJyYXkiLCJsZW5ndGgiLCJFcnJvciIsImxpbmVzIiwic3BsaXQiLCJkZWxpbWl0ZXJzIiwibWF0Y2giLCJodW5rcyIsImNvbXBhcmVMaW5lIiwibGluZU51bWJlciIsImxpbmUiLCJvcGVyYXRpb24iLCJwYXRjaENvbnRlbnQiLCJlcnJvckNvdW50IiwiZnV6ekZhY3RvciIsIm1pbkxpbmUiLCJvZmZzZXQiLCJyZW1vdmVFT0ZOTCIsImFkZEVPRk5MIiwiaHVua0ZpdHMiLCJodW5rIiwidG9Qb3MiLCJqIiwiY29udGVudCIsInN1YnN0ciIsImkiLCJtYXhMaW5lIiwib2xkTGluZXMiLCJsb2NhbE9mZnNldCIsIm9sZFN0YXJ0IiwiaXRlcmF0b3IiLCJ1bmRlZmluZWQiLCJkaWZmT2Zmc2V0IiwibmV3TGluZXMiLCJkZWxpbWl0ZXIiLCJsaW5lZGVsaW1pdGVycyIsInNwbGljZSIsInByZXZpb3VzT3BlcmF0aW9uIiwicG9wIiwicHVzaCIsIl9rIiwiam9pbiIsImN1cnJlbnRJbmRleCIsInByb2Nlc3NJbmRleCIsImluZGV4IiwiY29tcGxldGUiLCJsb2FkRmlsZSIsImVyciIsImRhdGEiLCJ1cGRhdGVkQ29udGVudCIsInBhdGNoZWQiXSwibWFwcGluZ3MiOiI7OztnQ0FHZ0JBLFUsR0FBQUEsVTt5REFvSUFDLFksR0FBQUEsWTs7QUF2SWhCOztBQUNBOzs7Ozs7dUJBRU8sU0FBU0QsVUFBVCxDQUFvQkUsTUFBcEIsRUFBNEJDLE9BQTVCLEVBQW1EO0FBQUEsc0RBQWRDLE9BQWMsdUVBQUosRUFBSTs7QUFDeEQsTUFBSSxPQUFPRCxPQUFQLEtBQW1CLFFBQXZCLEVBQWlDO0FBQy9CQSxjQUFVLHdFQUFXQSxPQUFYLENBQVY7QUFDRDs7QUFFRCxNQUFJRSxNQUFNQyxPQUFOLENBQWNILE9BQWQsQ0FBSixFQUE0QjtBQUMxQixRQUFJQSxRQUFRSSxNQUFSLEdBQWlCLENBQXJCLEVBQXdCO0FBQ3RCLFlBQU0sSUFBSUMsS0FBSixDQUFVLDRDQUFWLENBQU47QUFDRDs7QUFFREwsY0FBVUEsUUFBUSxDQUFSLENBQVY7QUFDRDs7QUFFRDtBQUNBLE1BQUlNLFFBQVFQLE9BQU9RLEtBQVAsQ0FBYSxxQkFBYixDQUFaO0FBQUEsTUFDSUMsYUFBYVQsT0FBT1UsS0FBUCxDQUFhLHNCQUFiLEtBQXdDLEVBRHpEO0FBQUEsTUFFSUMsUUFBUVYsUUFBUVUsS0FGcEI7QUFBQSxNQUlJQyxjQUFjVixRQUFRVSxXQUFSLElBQXdCLFVBQUNDLFVBQUQsRUFBYUMsSUFBYixFQUFtQkMsU0FBbkIsRUFBOEJDLFlBQTlCO0FBQUEsbUNBQStDRixTQUFTRTtBQUF4RDtBQUFBLEdBSjFDO0FBQUEsTUFLSUMsYUFBYSxDQUxqQjtBQUFBLE1BTUlDLGFBQWFoQixRQUFRZ0IsVUFBUixJQUFzQixDQU52QztBQUFBLE1BT0lDLFVBQVUsQ0FQZDtBQUFBLE1BUUlDLFNBQVMsQ0FSYjtBQUFBLE1BVUlDLDZDQVZKO0FBQUEsTUFXSUMsMENBWEo7O0FBYUE7OztBQUdBLFdBQVNDLFFBQVQsQ0FBa0JDLElBQWxCLEVBQXdCQyxLQUF4QixFQUErQjtBQUM3QixTQUFLLElBQUlDLElBQUksQ0FBYixFQUFnQkEsSUFBSUYsS0FBS2pCLEtBQUwsQ0FBV0YsTUFBL0IsRUFBdUNxQixHQUF2QyxFQUE0QztBQUMxQyxVQUFJWixPQUFPVSxLQUFLakIsS0FBTCxDQUFXbUIsQ0FBWCxDQUFYO0FBQUEsVUFDSVgsWUFBYUQsS0FBS1QsTUFBTCxHQUFjLENBQWQsR0FBa0JTLEtBQUssQ0FBTCxDQUFsQixHQUE0QixHQUQ3QztBQUFBLFVBRUlhLFVBQVdiLEtBQUtULE1BQUwsR0FBYyxDQUFkLEdBQWtCUyxLQUFLYyxNQUFMLENBQVksQ0FBWixDQUFsQixHQUFtQ2QsSUFGbEQ7O0FBSUEsVUFBSUMsY0FBYyxHQUFkLElBQXFCQSxjQUFjLEdBQXZDLEVBQTRDO0FBQzFDO0FBQ0EsWUFBSSxDQUFDSCxZQUFZYSxRQUFRLENBQXBCLEVBQXVCbEIsTUFBTWtCLEtBQU4sQ0FBdkIsRUFBcUNWLFNBQXJDLEVBQWdEWSxPQUFoRCxDQUFMLEVBQStEO0FBQzdEVjs7QUFFQSxjQUFJQSxhQUFhQyxVQUFqQixFQUE2QjtBQUMzQixtQkFBTyxLQUFQO0FBQ0Q7QUFDRjtBQUNETztBQUNEO0FBQ0Y7O0FBRUQsV0FBTyxJQUFQO0FBQ0Q7O0FBRUQ7QUFDQSxPQUFLLElBQUlJLElBQUksQ0FBYixFQUFnQkEsSUFBSWxCLE1BQU1OLE1BQTFCLEVBQWtDd0IsR0FBbEMsRUFBdUM7QUFDckMsUUFBSUwsT0FBT2IsTUFBTWtCLENBQU4sQ0FBWDtBQUFBLFFBQ0lDLFVBQVV2QixNQUFNRixNQUFOLEdBQWVtQixLQUFLTyxRQURsQztBQUFBLFFBRUlDLGNBQWMsQ0FGbEI7QUFBQSxRQUdJUCxRQUFRTCxTQUFTSSxLQUFLUyxRQUFkLEdBQXlCLENBSHJDOztBQUtBLFFBQUlDLFdBQVcsb0ZBQWlCVCxLQUFqQixFQUF3Qk4sT0FBeEIsRUFBaUNXLE9BQWpDLENBQWY7O0FBRUEsV0FBT0UsZ0JBQWdCRyxTQUF2QixFQUFrQ0gsY0FBY0UsVUFBaEQsRUFBNEQ7QUFDMUQsVUFBSVgsU0FBU0MsSUFBVCxFQUFlQyxRQUFRTyxXQUF2QixDQUFKLEVBQXlDO0FBQ3ZDUixhQUFLSixNQUFMLEdBQWNBLFVBQVVZLFdBQXhCO0FBQ0E7QUFDRDtBQUNGOztBQUVELFFBQUlBLGdCQUFnQkcsU0FBcEIsRUFBK0I7QUFDN0IsYUFBTyxLQUFQO0FBQ0Q7O0FBRUQ7QUFDQTtBQUNBaEIsY0FBVUssS0FBS0osTUFBTCxHQUFjSSxLQUFLUyxRQUFuQixHQUE4QlQsS0FBS08sUUFBN0M7QUFDRDs7QUFFRDtBQUNBLE1BQUlLLGFBQWEsQ0FBakI7QUFDQSxPQUFLLElBQUlQLEtBQUksQ0FBYixFQUFnQkEsS0FBSWxCLE1BQU1OLE1BQTFCLEVBQWtDd0IsSUFBbEMsRUFBdUM7QUFDckMsUUFBSUwsUUFBT2IsTUFBTWtCLEVBQU4sQ0FBWDtBQUFBLFFBQ0lKLFNBQVFELE1BQUtTLFFBQUwsR0FBZ0JULE1BQUtKLE1BQXJCLEdBQThCZ0IsVUFBOUIsR0FBMkMsQ0FEdkQ7QUFFQUEsa0JBQWNaLE1BQUthLFFBQUwsR0FBZ0JiLE1BQUtPLFFBQW5DOztBQUVBLFFBQUlOLFNBQVEsQ0FBWixFQUFlO0FBQUU7QUFDZkEsZUFBUSxDQUFSO0FBQ0Q7O0FBRUQsU0FBSyxJQUFJQyxJQUFJLENBQWIsRUFBZ0JBLElBQUlGLE1BQUtqQixLQUFMLENBQVdGLE1BQS9CLEVBQXVDcUIsR0FBdkMsRUFBNEM7QUFDMUMsVUFBSVosT0FBT1UsTUFBS2pCLEtBQUwsQ0FBV21CLENBQVgsQ0FBWDtBQUFBLFVBQ0lYLFlBQWFELEtBQUtULE1BQUwsR0FBYyxDQUFkLEdBQWtCUyxLQUFLLENBQUwsQ0FBbEIsR0FBNEIsR0FEN0M7QUFBQSxVQUVJYSxVQUFXYixLQUFLVCxNQUFMLEdBQWMsQ0FBZCxHQUFrQlMsS0FBS2MsTUFBTCxDQUFZLENBQVosQ0FBbEIsR0FBbUNkLElBRmxEO0FBQUEsVUFHSXdCLFlBQVlkLE1BQUtlLGNBQUwsQ0FBb0JiLENBQXBCLENBSGhCOztBQUtBLFVBQUlYLGNBQWMsR0FBbEIsRUFBdUI7QUFDckJVO0FBQ0QsT0FGRCxNQUVPLElBQUlWLGNBQWMsR0FBbEIsRUFBdUI7QUFDNUJSLGNBQU1pQyxNQUFOLENBQWFmLE1BQWIsRUFBb0IsQ0FBcEI7QUFDQWhCLG1CQUFXK0IsTUFBWCxDQUFrQmYsTUFBbEIsRUFBeUIsQ0FBekI7QUFDRjtBQUNDLE9BSk0sTUFJQSxJQUFJVixjQUFjLEdBQWxCLEVBQXVCO0FBQzVCUixjQUFNaUMsTUFBTixDQUFhZixNQUFiLEVBQW9CLENBQXBCLEVBQXVCRSxPQUF2QjtBQUNBbEIsbUJBQVcrQixNQUFYLENBQWtCZixNQUFsQixFQUF5QixDQUF6QixFQUE0QmEsU0FBNUI7QUFDQWI7QUFDRCxPQUpNLE1BSUEsSUFBSVYsY0FBYyxJQUFsQixFQUF3QjtBQUM3QixZQUFJMEIsb0JBQW9CakIsTUFBS2pCLEtBQUwsQ0FBV21CLElBQUksQ0FBZixJQUFvQkYsTUFBS2pCLEtBQUwsQ0FBV21CLElBQUksQ0FBZixFQUFrQixDQUFsQixDQUFwQixHQUEyQyxJQUFuRTtBQUNBLFlBQUllLHNCQUFzQixHQUExQixFQUErQjtBQUM3QnBCLHdCQUFjLElBQWQ7QUFDRCxTQUZELE1BRU8sSUFBSW9CLHNCQUFzQixHQUExQixFQUErQjtBQUNwQ25CLHFCQUFXLElBQVg7QUFDRDtBQUNGO0FBQ0Y7QUFDRjs7QUFFRDtBQUNBLE1BQUlELFdBQUosRUFBaUI7QUFDZixXQUFPLENBQUNkLE1BQU1BLE1BQU1GLE1BQU4sR0FBZSxDQUFyQixDQUFSLEVBQWlDO0FBQy9CRSxZQUFNbUMsR0FBTjtBQUNBakMsaUJBQVdpQyxHQUFYO0FBQ0Q7QUFDRixHQUxELE1BS08sSUFBSXBCLFFBQUosRUFBYztBQUNuQmYsVUFBTW9DLElBQU4sQ0FBVyxFQUFYO0FBQ0FsQyxlQUFXa0MsSUFBWCxDQUFnQixJQUFoQjtBQUNEO0FBQ0QsT0FBSyxJQUFJQyxLQUFLLENBQWQsRUFBaUJBLEtBQUtyQyxNQUFNRixNQUFOLEdBQWUsQ0FBckMsRUFBd0N1QyxJQUF4QyxFQUE4QztBQUM1Q3JDLFVBQU1xQyxFQUFOLElBQVlyQyxNQUFNcUMsRUFBTixJQUFZbkMsV0FBV21DLEVBQVgsQ0FBeEI7QUFDRDtBQUNELFNBQU9yQyxNQUFNc0MsSUFBTixDQUFXLEVBQVgsQ0FBUDtBQUNEOztBQUVEO0FBQ08sU0FBUzlDLFlBQVQsQ0FBc0JFLE9BQXRCLEVBQStCQyxPQUEvQixFQUF3QztBQUM3QyxNQUFJLE9BQU9ELE9BQVAsS0FBbUIsUUFBdkIsRUFBaUM7QUFDL0JBLGNBQVUsd0VBQVdBLE9BQVgsQ0FBVjtBQUNEOztBQUVELE1BQUk2QyxlQUFlLENBQW5CO0FBQ0EsV0FBU0MsWUFBVCxHQUF3QjtBQUN0QixRQUFJQyxRQUFRL0MsUUFBUTZDLGNBQVIsQ0FBWjtBQUNBLFFBQUksQ0FBQ0UsS0FBTCxFQUFZO0FBQ1YsYUFBTzlDLFFBQVErQyxRQUFSLEVBQVA7QUFDRDs7QUFFRC9DLFlBQVFnRCxRQUFSLENBQWlCRixLQUFqQixFQUF3QixVQUFTRyxHQUFULEVBQWNDLElBQWQsRUFBb0I7QUFDMUMsVUFBSUQsR0FBSixFQUFTO0FBQ1AsZUFBT2pELFFBQVErQyxRQUFSLENBQWlCRSxHQUFqQixDQUFQO0FBQ0Q7O0FBRUQsVUFBSUUsaUJBQWlCdkQsV0FBV3NELElBQVgsRUFBaUJKLEtBQWpCLEVBQXdCOUMsT0FBeEIsQ0FBckI7QUFDQUEsY0FBUW9ELE9BQVIsQ0FBZ0JOLEtBQWhCLEVBQXVCSyxjQUF2QixFQUF1QyxVQUFTRixHQUFULEVBQWM7QUFDbkQsWUFBSUEsR0FBSixFQUFTO0FBQ1AsaUJBQU9qRCxRQUFRK0MsUUFBUixDQUFpQkUsR0FBakIsQ0FBUDtBQUNEOztBQUVESjtBQUNELE9BTkQ7QUFPRCxLQWJEO0FBY0Q7QUFDREE7QUFDRCIsImZpbGUiOiJhcHBseS5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCB7cGFyc2VQYXRjaH0gZnJvbSAnLi9wYXJzZSc7XG5pbXBvcnQgZGlzdGFuY2VJdGVyYXRvciBmcm9tICcuLi91dGlsL2Rpc3RhbmNlLWl0ZXJhdG9yJztcblxuZXhwb3J0IGZ1bmN0aW9uIGFwcGx5UGF0Y2goc291cmNlLCB1bmlEaWZmLCBvcHRpb25zID0ge30pIHtcbiAgaWYgKHR5cGVvZiB1bmlEaWZmID09PSAnc3RyaW5nJykge1xuICAgIHVuaURpZmYgPSBwYXJzZVBhdGNoKHVuaURpZmYpO1xuICB9XG5cbiAgaWYgKEFycmF5LmlzQXJyYXkodW5pRGlmZikpIHtcbiAgICBpZiAodW5pRGlmZi5sZW5ndGggPiAxKSB7XG4gICAgICB0aHJvdyBuZXcgRXJyb3IoJ2FwcGx5UGF0Y2ggb25seSB3b3JrcyB3aXRoIGEgc2luZ2xlIGlucHV0LicpO1xuICAgIH1cblxuICAgIHVuaURpZmYgPSB1bmlEaWZmWzBdO1xuICB9XG5cbiAgLy8gQXBwbHkgdGhlIGRpZmYgdG8gdGhlIGlucHV0XG4gIGxldCBsaW5lcyA9IHNvdXJjZS5zcGxpdCgvXFxyXFxufFtcXG5cXHZcXGZcXHJcXHg4NV0vKSxcbiAgICAgIGRlbGltaXRlcnMgPSBzb3VyY2UubWF0Y2goL1xcclxcbnxbXFxuXFx2XFxmXFxyXFx4ODVdL2cpIHx8IFtdLFxuICAgICAgaHVua3MgPSB1bmlEaWZmLmh1bmtzLFxuXG4gICAgICBjb21wYXJlTGluZSA9IG9wdGlvbnMuY29tcGFyZUxpbmUgfHwgKChsaW5lTnVtYmVyLCBsaW5lLCBvcGVyYXRpb24sIHBhdGNoQ29udGVudCkgPT4gbGluZSA9PT0gcGF0Y2hDb250ZW50KSxcbiAgICAgIGVycm9yQ291bnQgPSAwLFxuICAgICAgZnV6ekZhY3RvciA9IG9wdGlvbnMuZnV6ekZhY3RvciB8fCAwLFxuICAgICAgbWluTGluZSA9IDAsXG4gICAgICBvZmZzZXQgPSAwLFxuXG4gICAgICByZW1vdmVFT0ZOTCxcbiAgICAgIGFkZEVPRk5MO1xuXG4gIC8qKlxuICAgKiBDaGVja3MgaWYgdGhlIGh1bmsgZXhhY3RseSBmaXRzIG9uIHRoZSBwcm92aWRlZCBsb2NhdGlvblxuICAgKi9cbiAgZnVuY3Rpb24gaHVua0ZpdHMoaHVuaywgdG9Qb3MpIHtcbiAgICBmb3IgKGxldCBqID0gMDsgaiA8IGh1bmsubGluZXMubGVuZ3RoOyBqKyspIHtcbiAgICAgIGxldCBsaW5lID0gaHVuay5saW5lc1tqXSxcbiAgICAgICAgICBvcGVyYXRpb24gPSAobGluZS5sZW5ndGggPiAwID8gbGluZVswXSA6ICcgJyksXG4gICAgICAgICAgY29udGVudCA9IChsaW5lLmxlbmd0aCA+IDAgPyBsaW5lLnN1YnN0cigxKSA6IGxpbmUpO1xuXG4gICAgICBpZiAob3BlcmF0aW9uID09PSAnICcgfHwgb3BlcmF0aW9uID09PSAnLScpIHtcbiAgICAgICAgLy8gQ29udGV4dCBzYW5pdHkgY2hlY2tcbiAgICAgICAgaWYgKCFjb21wYXJlTGluZSh0b1BvcyArIDEsIGxpbmVzW3RvUG9zXSwgb3BlcmF0aW9uLCBjb250ZW50KSkge1xuICAgICAgICAgIGVycm9yQ291bnQrKztcblxuICAgICAgICAgIGlmIChlcnJvckNvdW50ID4gZnV6ekZhY3Rvcikge1xuICAgICAgICAgICAgcmV0dXJuIGZhbHNlO1xuICAgICAgICAgIH1cbiAgICAgICAgfVxuICAgICAgICB0b1BvcysrO1xuICAgICAgfVxuICAgIH1cblxuICAgIHJldHVybiB0cnVlO1xuICB9XG5cbiAgLy8gU2VhcmNoIGJlc3QgZml0IG9mZnNldHMgZm9yIGVhY2ggaHVuayBiYXNlZCBvbiB0aGUgcHJldmlvdXMgb25lc1xuICBmb3IgKGxldCBpID0gMDsgaSA8IGh1bmtzLmxlbmd0aDsgaSsrKSB7XG4gICAgbGV0IGh1bmsgPSBodW5rc1tpXSxcbiAgICAgICAgbWF4TGluZSA9IGxpbmVzLmxlbmd0aCAtIGh1bmsub2xkTGluZXMsXG4gICAgICAgIGxvY2FsT2Zmc2V0ID0gMCxcbiAgICAgICAgdG9Qb3MgPSBvZmZzZXQgKyBodW5rLm9sZFN0YXJ0IC0gMTtcblxuICAgIGxldCBpdGVyYXRvciA9IGRpc3RhbmNlSXRlcmF0b3IodG9Qb3MsIG1pbkxpbmUsIG1heExpbmUpO1xuXG4gICAgZm9yICg7IGxvY2FsT2Zmc2V0ICE9PSB1bmRlZmluZWQ7IGxvY2FsT2Zmc2V0ID0gaXRlcmF0b3IoKSkge1xuICAgICAgaWYgKGh1bmtGaXRzKGh1bmssIHRvUG9zICsgbG9jYWxPZmZzZXQpKSB7XG4gICAgICAgIGh1bmsub2Zmc2V0ID0gb2Zmc2V0ICs9IGxvY2FsT2Zmc2V0O1xuICAgICAgICBicmVhaztcbiAgICAgIH1cbiAgICB9XG5cbiAgICBpZiAobG9jYWxPZmZzZXQgPT09IHVuZGVmaW5lZCkge1xuICAgICAgcmV0dXJuIGZhbHNlO1xuICAgIH1cblxuICAgIC8vIFNldCBsb3dlciB0ZXh0IGxpbWl0IHRvIGVuZCBvZiB0aGUgY3VycmVudCBodW5rLCBzbyBuZXh0IG9uZXMgZG9uJ3QgdHJ5XG4gICAgLy8gdG8gZml0IG92ZXIgYWxyZWFkeSBwYXRjaGVkIHRleHRcbiAgICBtaW5MaW5lID0gaHVuay5vZmZzZXQgKyBodW5rLm9sZFN0YXJ0ICsgaHVuay5vbGRMaW5lcztcbiAgfVxuXG4gIC8vIEFwcGx5IHBhdGNoIGh1bmtzXG4gIGxldCBkaWZmT2Zmc2V0ID0gMDtcbiAgZm9yIChsZXQgaSA9IDA7IGkgPCBodW5rcy5sZW5ndGg7IGkrKykge1xuICAgIGxldCBodW5rID0gaHVua3NbaV0sXG4gICAgICAgIHRvUG9zID0gaHVuay5vbGRTdGFydCArIGh1bmsub2Zmc2V0ICsgZGlmZk9mZnNldCAtIDE7XG4gICAgZGlmZk9mZnNldCArPSBodW5rLm5ld0xpbmVzIC0gaHVuay5vbGRMaW5lcztcblxuICAgIGlmICh0b1BvcyA8IDApIHsgLy8gQ3JlYXRpbmcgYSBuZXcgZmlsZVxuICAgICAgdG9Qb3MgPSAwO1xuICAgIH1cblxuICAgIGZvciAobGV0IGogPSAwOyBqIDwgaHVuay5saW5lcy5sZW5ndGg7IGorKykge1xuICAgICAgbGV0IGxpbmUgPSBodW5rLmxpbmVzW2pdLFxuICAgICAgICAgIG9wZXJhdGlvbiA9IChsaW5lLmxlbmd0aCA+IDAgPyBsaW5lWzBdIDogJyAnKSxcbiAgICAgICAgICBjb250ZW50ID0gKGxpbmUubGVuZ3RoID4gMCA/IGxpbmUuc3Vic3RyKDEpIDogbGluZSksXG4gICAgICAgICAgZGVsaW1pdGVyID0gaHVuay5saW5lZGVsaW1pdGVyc1tqXTtcblxuICAgICAgaWYgKG9wZXJhdGlvbiA9PT0gJyAnKSB7XG4gICAgICAgIHRvUG9zKys7XG4gICAgICB9IGVsc2UgaWYgKG9wZXJhdGlvbiA9PT0gJy0nKSB7XG4gICAgICAgIGxpbmVzLnNwbGljZSh0b1BvcywgMSk7XG4gICAgICAgIGRlbGltaXRlcnMuc3BsaWNlKHRvUG9zLCAxKTtcbiAgICAgIC8qIGlzdGFuYnVsIGlnbm9yZSBlbHNlICovXG4gICAgICB9IGVsc2UgaWYgKG9wZXJhdGlvbiA9PT0gJysnKSB7XG4gICAgICAgIGxpbmVzLnNwbGljZSh0b1BvcywgMCwgY29udGVudCk7XG4gICAgICAgIGRlbGltaXRlcnMuc3BsaWNlKHRvUG9zLCAwLCBkZWxpbWl0ZXIpO1xuICAgICAgICB0b1BvcysrO1xuICAgICAgfSBlbHNlIGlmIChvcGVyYXRpb24gPT09ICdcXFxcJykge1xuICAgICAgICBsZXQgcHJldmlvdXNPcGVyYXRpb24gPSBodW5rLmxpbmVzW2ogLSAxXSA/IGh1bmsubGluZXNbaiAtIDFdWzBdIDogbnVsbDtcbiAgICAgICAgaWYgKHByZXZpb3VzT3BlcmF0aW9uID09PSAnKycpIHtcbiAgICAgICAgICByZW1vdmVFT0ZOTCA9IHRydWU7XG4gICAgICAgIH0gZWxzZSBpZiAocHJldmlvdXNPcGVyYXRpb24gPT09ICctJykge1xuICAgICAgICAgIGFkZEVPRk5MID0gdHJ1ZTtcbiAgICAgICAgfVxuICAgICAgfVxuICAgIH1cbiAgfVxuXG4gIC8vIEhhbmRsZSBFT0ZOTCBpbnNlcnRpb24vcmVtb3ZhbFxuICBpZiAocmVtb3ZlRU9GTkwpIHtcbiAgICB3aGlsZSAoIWxpbmVzW2xpbmVzLmxlbmd0aCAtIDFdKSB7XG4gICAgICBsaW5lcy5wb3AoKTtcbiAgICAgIGRlbGltaXRlcnMucG9wKCk7XG4gICAgfVxuICB9IGVsc2UgaWYgKGFkZEVPRk5MKSB7XG4gICAgbGluZXMucHVzaCgnJyk7XG4gICAgZGVsaW1pdGVycy5wdXNoKCdcXG4nKTtcbiAgfVxuICBmb3IgKGxldCBfayA9IDA7IF9rIDwgbGluZXMubGVuZ3RoIC0gMTsgX2srKykge1xuICAgIGxpbmVzW19rXSA9IGxpbmVzW19rXSArIGRlbGltaXRlcnNbX2tdO1xuICB9XG4gIHJldHVybiBsaW5lcy5qb2luKCcnKTtcbn1cblxuLy8gV3JhcHBlciB0aGF0IHN1cHBvcnRzIG11bHRpcGxlIGZpbGUgcGF0Y2hlcyB2aWEgY2FsbGJhY2tzLlxuZXhwb3J0IGZ1bmN0aW9uIGFwcGx5UGF0Y2hlcyh1bmlEaWZmLCBvcHRpb25zKSB7XG4gIGlmICh0eXBlb2YgdW5pRGlmZiA9PT0gJ3N0cmluZycpIHtcbiAgICB1bmlEaWZmID0gcGFyc2VQYXRjaCh1bmlEaWZmKTtcbiAgfVxuXG4gIGxldCBjdXJyZW50SW5kZXggPSAwO1xuICBmdW5jdGlvbiBwcm9jZXNzSW5kZXgoKSB7XG4gICAgbGV0IGluZGV4ID0gdW5pRGlmZltjdXJyZW50SW5kZXgrK107XG4gICAgaWYgKCFpbmRleCkge1xuICAgICAgcmV0dXJuIG9wdGlvbnMuY29tcGxldGUoKTtcbiAgICB9XG5cbiAgICBvcHRpb25zLmxvYWRGaWxlKGluZGV4LCBmdW5jdGlvbihlcnIsIGRhdGEpIHtcbiAgICAgIGlmIChlcnIpIHtcbiAgICAgICAgcmV0dXJuIG9wdGlvbnMuY29tcGxldGUoZXJyKTtcbiAgICAgIH1cblxuICAgICAgbGV0IHVwZGF0ZWRDb250ZW50ID0gYXBwbHlQYXRjaChkYXRhLCBpbmRleCwgb3B0aW9ucyk7XG4gICAgICBvcHRpb25zLnBhdGNoZWQoaW5kZXgsIHVwZGF0ZWRDb250ZW50LCBmdW5jdGlvbihlcnIpIHtcbiAgICAgICAgaWYgKGVycikge1xuICAgICAgICAgIHJldHVybiBvcHRpb25zLmNvbXBsZXRlKGVycik7XG4gICAgICAgIH1cblxuICAgICAgICBwcm9jZXNzSW5kZXgoKTtcbiAgICAgIH0pO1xuICAgIH0pO1xuICB9XG4gIHByb2Nlc3NJbmRleCgpO1xufVxuIl19
diff --git a/node_modules/diff/lib/patch/create.js b/node_modules/diff/lib/patch/create.js
new file mode 100644
index 0000000..be4d187
--- /dev/null
+++ b/node_modules/diff/lib/patch/create.js
@@ -0,0 +1,148 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports. /*istanbul ignore end*/structuredPatch = structuredPatch;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/createTwoFilesPatch = createTwoFilesPatch;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/createPatch = createPatch;
+
+var /*istanbul ignore start*/_line = require('../diff/line') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/function _toConsumableArray(arr) { if (Array.isArray(arr)) { for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) { arr2[i] = arr[i]; } return arr2; } else { return Array.from(arr); } }
+
+/*istanbul ignore end*/function structuredPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader, options) {
+  if (!options) {
+    options = {};
+  }
+  if (typeof options.context === 'undefined') {
+    options.context = 4;
+  }
+
+  var diff = /*istanbul ignore start*/(0, _line.diffLines) /*istanbul ignore end*/(oldStr, newStr, options);
+  diff.push({ value: '', lines: [] }); // Append an empty value to make cleanup easier
+
+  function contextLines(lines) {
+    return lines.map(function (entry) {
+      return ' ' + entry;
+    });
+  }
+
+  var hunks = [];
+  var oldRangeStart = 0,
+      newRangeStart = 0,
+      curRange = [],
+      oldLine = 1,
+      newLine = 1;
+
+  /*istanbul ignore start*/var _loop = function _loop( /*istanbul ignore end*/i) {
+    var current = diff[i],
+        lines = current.lines || current.value.replace(/\n$/, '').split('\n');
+    current.lines = lines;
+
+    if (current.added || current.removed) {
+      /*istanbul ignore start*/var _curRange;
+
+      /*istanbul ignore end*/ // If we have previous context, start with that
+      if (!oldRangeStart) {
+        var prev = diff[i - 1];
+        oldRangeStart = oldLine;
+        newRangeStart = newLine;
+
+        if (prev) {
+          curRange = options.context > 0 ? contextLines(prev.lines.slice(-options.context)) : [];
+          oldRangeStart -= curRange.length;
+          newRangeStart -= curRange.length;
+        }
+      }
+
+      // Output our changes
+      /*istanbul ignore start*/(_curRange = /*istanbul ignore end*/curRange).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_curRange /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/lines.map(function (entry) {
+        return (current.added ? '+' : '-') + entry;
+      })));
+
+      // Track the updated file position
+      if (current.added) {
+        newLine += lines.length;
+      } else {
+        oldLine += lines.length;
+      }
+    } else {
+      // Identical context lines. Track line changes
+      if (oldRangeStart) {
+        // Close out any changes that have been output (or join overlapping)
+        if (lines.length <= options.context * 2 && i < diff.length - 2) {
+          /*istanbul ignore start*/var _curRange2;
+
+          /*istanbul ignore end*/ // Overlapping
+          /*istanbul ignore start*/(_curRange2 = /*istanbul ignore end*/curRange).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_curRange2 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/contextLines(lines)));
+        } else {
+          /*istanbul ignore start*/var _curRange3;
+
+          /*istanbul ignore end*/ // end the range and output
+          var contextSize = Math.min(lines.length, options.context);
+          /*istanbul ignore start*/(_curRange3 = /*istanbul ignore end*/curRange).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_curRange3 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/contextLines(lines.slice(0, contextSize))));
+
+          var hunk = {
+            oldStart: oldRangeStart,
+            oldLines: oldLine - oldRangeStart + contextSize,
+            newStart: newRangeStart,
+            newLines: newLine - newRangeStart + contextSize,
+            lines: curRange
+          };
+          if (i >= diff.length - 2 && lines.length <= options.context) {
+            // EOF is inside this hunk
+            var oldEOFNewline = /\n$/.test(oldStr);
+            var newEOFNewline = /\n$/.test(newStr);
+            if (lines.length == 0 && !oldEOFNewline) {
+              // special case: old has no eol and no trailing context; no-nl can end up before adds
+              curRange.splice(hunk.oldLines, 0, '\\ No newline at end of file');
+            } else if (!oldEOFNewline || !newEOFNewline) {
+              curRange.push('\\ No newline at end of file');
+            }
+          }
+          hunks.push(hunk);
+
+          oldRangeStart = 0;
+          newRangeStart = 0;
+          curRange = [];
+        }
+      }
+      oldLine += lines.length;
+      newLine += lines.length;
+    }
+  };
+
+  for (var i = 0; i < diff.length; i++) {
+    /*istanbul ignore start*/_loop( /*istanbul ignore end*/i);
+  }
+
+  return {
+    oldFileName: oldFileName, newFileName: newFileName,
+    oldHeader: oldHeader, newHeader: newHeader,
+    hunks: hunks
+  };
+}
+
+function createTwoFilesPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader, options) {
+  var diff = structuredPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader, options);
+
+  var ret = [];
+  if (oldFileName == newFileName) {
+    ret.push('Index: ' + oldFileName);
+  }
+  ret.push('===================================================================');
+  ret.push('--- ' + diff.oldFileName + (typeof diff.oldHeader === 'undefined' ? '' : '\t' + diff.oldHeader));
+  ret.push('+++ ' + diff.newFileName + (typeof diff.newHeader === 'undefined' ? '' : '\t' + diff.newHeader));
+
+  for (var i = 0; i < diff.hunks.length; i++) {
+    var hunk = diff.hunks[i];
+    ret.push('@@ -' + hunk.oldStart + ',' + hunk.oldLines + ' +' + hunk.newStart + ',' + hunk.newLines + ' @@');
+    ret.push.apply(ret, hunk.lines);
+  }
+
+  return ret.join('\n') + '\n';
+}
+
+function createPatch(fileName, oldStr, newStr, oldHeader, newHeader, options) {
+  return createTwoFilesPatch(fileName, fileName, oldStr, newStr, oldHeader, newHeader, options);
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9wYXRjaC9jcmVhdGUuanMiXSwibmFtZXMiOlsic3RydWN0dXJlZFBhdGNoIiwiY3JlYXRlVHdvRmlsZXNQYXRjaCIsImNyZWF0ZVBhdGNoIiwib2xkRmlsZU5hbWUiLCJuZXdGaWxlTmFtZSIsIm9sZFN0ciIsIm5ld1N0ciIsIm9sZEhlYWRlciIsIm5ld0hlYWRlciIsIm9wdGlvbnMiLCJjb250ZXh0IiwiZGlmZiIsInB1c2giLCJ2YWx1ZSIsImxpbmVzIiwiY29udGV4dExpbmVzIiwibWFwIiwiZW50cnkiLCJodW5rcyIsIm9sZFJhbmdlU3RhcnQiLCJuZXdSYW5nZVN0YXJ0IiwiY3VyUmFuZ2UiLCJvbGRMaW5lIiwibmV3TGluZSIsImkiLCJjdXJyZW50IiwicmVwbGFjZSIsInNwbGl0IiwiYWRkZWQiLCJyZW1vdmVkIiwicHJldiIsInNsaWNlIiwibGVuZ3RoIiwiY29udGV4dFNpemUiLCJNYXRoIiwibWluIiwiaHVuayIsIm9sZFN0YXJ0Iiwib2xkTGluZXMiLCJuZXdTdGFydCIsIm5ld0xpbmVzIiwib2xkRU9GTmV3bGluZSIsInRlc3QiLCJuZXdFT0ZOZXdsaW5lIiwic3BsaWNlIiwicmV0IiwiYXBwbHkiLCJqb2luIiwiZmlsZU5hbWUiXSwibWFwcGluZ3MiOiI7OztnQ0FFZ0JBLGUsR0FBQUEsZTt5REFpR0FDLG1CLEdBQUFBLG1CO3lEQXdCQUMsVyxHQUFBQSxXOztBQTNIaEI7Ozs7dUJBRU8sU0FBU0YsZUFBVCxDQUF5QkcsV0FBekIsRUFBc0NDLFdBQXRDLEVBQW1EQyxNQUFuRCxFQUEyREMsTUFBM0QsRUFBbUVDLFNBQW5FLEVBQThFQyxTQUE5RSxFQUF5RkMsT0FBekYsRUFBa0c7QUFDdkcsTUFBSSxDQUFDQSxPQUFMLEVBQWM7QUFDWkEsY0FBVSxFQUFWO0FBQ0Q7QUFDRCxNQUFJLE9BQU9BLFFBQVFDLE9BQWYsS0FBMkIsV0FBL0IsRUFBNEM7QUFDMUNELFlBQVFDLE9BQVIsR0FBa0IsQ0FBbEI7QUFDRDs7QUFFRCxNQUFNQyxPQUFPLHNFQUFVTixNQUFWLEVBQWtCQyxNQUFsQixFQUEwQkcsT0FBMUIsQ0FBYjtBQUNBRSxPQUFLQyxJQUFMLENBQVUsRUFBQ0MsT0FBTyxFQUFSLEVBQVlDLE9BQU8sRUFBbkIsRUFBVixFQVR1RyxDQVNsRTs7QUFFckMsV0FBU0MsWUFBVCxDQUFzQkQsS0FBdEIsRUFBNkI7QUFDM0IsV0FBT0EsTUFBTUUsR0FBTixDQUFVLFVBQVNDLEtBQVQsRUFBZ0I7QUFBRSxhQUFPLE1BQU1BLEtBQWI7QUFBcUIsS0FBakQsQ0FBUDtBQUNEOztBQUVELE1BQUlDLFFBQVEsRUFBWjtBQUNBLE1BQUlDLGdCQUFnQixDQUFwQjtBQUFBLE1BQXVCQyxnQkFBZ0IsQ0FBdkM7QUFBQSxNQUEwQ0MsV0FBVyxFQUFyRDtBQUFBLE1BQ0lDLFVBQVUsQ0FEZDtBQUFBLE1BQ2lCQyxVQUFVLENBRDNCOztBQWhCdUcsOEVBa0I5RkMsQ0FsQjhGO0FBbUJyRyxRQUFNQyxVQUFVZCxLQUFLYSxDQUFMLENBQWhCO0FBQUEsUUFDTVYsUUFBUVcsUUFBUVgsS0FBUixJQUFpQlcsUUFBUVosS0FBUixDQUFjYSxPQUFkLENBQXNCLEtBQXRCLEVBQTZCLEVBQTdCLEVBQWlDQyxLQUFqQyxDQUF1QyxJQUF2QyxDQUQvQjtBQUVBRixZQUFRWCxLQUFSLEdBQWdCQSxLQUFoQjs7QUFFQSxRQUFJVyxRQUFRRyxLQUFSLElBQWlCSCxRQUFRSSxPQUE3QixFQUFzQztBQUFBOztBQUFBLDhCQUNwQztBQUNBLFVBQUksQ0FBQ1YsYUFBTCxFQUFvQjtBQUNsQixZQUFNVyxPQUFPbkIsS0FBS2EsSUFBSSxDQUFULENBQWI7QUFDQUwsd0JBQWdCRyxPQUFoQjtBQUNBRix3QkFBZ0JHLE9BQWhCOztBQUVBLFlBQUlPLElBQUosRUFBVTtBQUNSVCxxQkFBV1osUUFBUUMsT0FBUixHQUFrQixDQUFsQixHQUFzQkssYUFBYWUsS0FBS2hCLEtBQUwsQ0FBV2lCLEtBQVgsQ0FBaUIsQ0FBQ3RCLFFBQVFDLE9BQTFCLENBQWIsQ0FBdEIsR0FBeUUsRUFBcEY7QUFDQVMsMkJBQWlCRSxTQUFTVyxNQUExQjtBQUNBWiwyQkFBaUJDLFNBQVNXLE1BQTFCO0FBQ0Q7QUFDRjs7QUFFRDtBQUNBLDZFQUFTcEIsSUFBVCwwTEFBa0JFLE1BQU1FLEdBQU4sQ0FBVSxVQUFTQyxLQUFULEVBQWdCO0FBQzFDLGVBQU8sQ0FBQ1EsUUFBUUcsS0FBUixHQUFnQixHQUFoQixHQUFzQixHQUF2QixJQUE4QlgsS0FBckM7QUFDRCxPQUZpQixDQUFsQjs7QUFJQTtBQUNBLFVBQUlRLFFBQVFHLEtBQVosRUFBbUI7QUFDakJMLG1CQUFXVCxNQUFNa0IsTUFBakI7QUFDRCxPQUZELE1BRU87QUFDTFYsbUJBQVdSLE1BQU1rQixNQUFqQjtBQUNEO0FBQ0YsS0F6QkQsTUF5Qk87QUFDTDtBQUNBLFVBQUliLGFBQUosRUFBbUI7QUFDakI7QUFDQSxZQUFJTCxNQUFNa0IsTUFBTixJQUFnQnZCLFFBQVFDLE9BQVIsR0FBa0IsQ0FBbEMsSUFBdUNjLElBQUliLEtBQUtxQixNQUFMLEdBQWMsQ0FBN0QsRUFBZ0U7QUFBQTs7QUFBQSxrQ0FDOUQ7QUFDQSxrRkFBU3BCLElBQVQsMkxBQWtCRyxhQUFhRCxLQUFiLENBQWxCO0FBQ0QsU0FIRCxNQUdPO0FBQUE7O0FBQUEsa0NBQ0w7QUFDQSxjQUFJbUIsY0FBY0MsS0FBS0MsR0FBTCxDQUFTckIsTUFBTWtCLE1BQWYsRUFBdUJ2QixRQUFRQyxPQUEvQixDQUFsQjtBQUNBLGtGQUFTRSxJQUFULDJMQUFrQkcsYUFBYUQsTUFBTWlCLEtBQU4sQ0FBWSxDQUFaLEVBQWVFLFdBQWYsQ0FBYixDQUFsQjs7QUFFQSxjQUFJRyxPQUFPO0FBQ1RDLHNCQUFVbEIsYUFERDtBQUVUbUIsc0JBQVdoQixVQUFVSCxhQUFWLEdBQTBCYyxXQUY1QjtBQUdUTSxzQkFBVW5CLGFBSEQ7QUFJVG9CLHNCQUFXakIsVUFBVUgsYUFBVixHQUEwQmEsV0FKNUI7QUFLVG5CLG1CQUFPTztBQUxFLFdBQVg7QUFPQSxjQUFJRyxLQUFLYixLQUFLcUIsTUFBTCxHQUFjLENBQW5CLElBQXdCbEIsTUFBTWtCLE1BQU4sSUFBZ0J2QixRQUFRQyxPQUFwRCxFQUE2RDtBQUMzRDtBQUNBLGdCQUFJK0IsZ0JBQWlCLE1BQU1DLElBQU4sQ0FBV3JDLE1BQVgsQ0FBckI7QUFDQSxnQkFBSXNDLGdCQUFpQixNQUFNRCxJQUFOLENBQVdwQyxNQUFYLENBQXJCO0FBQ0EsZ0JBQUlRLE1BQU1rQixNQUFOLElBQWdCLENBQWhCLElBQXFCLENBQUNTLGFBQTFCLEVBQXlDO0FBQ3ZDO0FBQ0FwQix1QkFBU3VCLE1BQVQsQ0FBZ0JSLEtBQUtFLFFBQXJCLEVBQStCLENBQS9CLEVBQWtDLDhCQUFsQztBQUNELGFBSEQsTUFHTyxJQUFJLENBQUNHLGFBQUQsSUFBa0IsQ0FBQ0UsYUFBdkIsRUFBc0M7QUFDM0N0Qix1QkFBU1QsSUFBVCxDQUFjLDhCQUFkO0FBQ0Q7QUFDRjtBQUNETSxnQkFBTU4sSUFBTixDQUFXd0IsSUFBWDs7QUFFQWpCLDBCQUFnQixDQUFoQjtBQUNBQywwQkFBZ0IsQ0FBaEI7QUFDQUMscUJBQVcsRUFBWDtBQUNEO0FBQ0Y7QUFDREMsaUJBQVdSLE1BQU1rQixNQUFqQjtBQUNBVCxpQkFBV1QsTUFBTWtCLE1BQWpCO0FBQ0Q7QUF2Rm9HOztBQWtCdkcsT0FBSyxJQUFJUixJQUFJLENBQWIsRUFBZ0JBLElBQUliLEtBQUtxQixNQUF6QixFQUFpQ1IsR0FBakMsRUFBc0M7QUFBQSwyREFBN0JBLENBQTZCO0FBc0VyQzs7QUFFRCxTQUFPO0FBQ0xyQixpQkFBYUEsV0FEUixFQUNxQkMsYUFBYUEsV0FEbEM7QUFFTEcsZUFBV0EsU0FGTixFQUVpQkMsV0FBV0EsU0FGNUI7QUFHTFUsV0FBT0E7QUFIRixHQUFQO0FBS0Q7O0FBRU0sU0FBU2pCLG1CQUFULENBQTZCRSxXQUE3QixFQUEwQ0MsV0FBMUMsRUFBdURDLE1BQXZELEVBQStEQyxNQUEvRCxFQUF1RUMsU0FBdkUsRUFBa0ZDLFNBQWxGLEVBQTZGQyxPQUE3RixFQUFzRztBQUMzRyxNQUFNRSxPQUFPWCxnQkFBZ0JHLFdBQWhCLEVBQTZCQyxXQUE3QixFQUEwQ0MsTUFBMUMsRUFBa0RDLE1BQWxELEVBQTBEQyxTQUExRCxFQUFxRUMsU0FBckUsRUFBZ0ZDLE9BQWhGLENBQWI7O0FBRUEsTUFBTW9DLE1BQU0sRUFBWjtBQUNBLE1BQUkxQyxlQUFlQyxXQUFuQixFQUFnQztBQUM5QnlDLFFBQUlqQyxJQUFKLENBQVMsWUFBWVQsV0FBckI7QUFDRDtBQUNEMEMsTUFBSWpDLElBQUosQ0FBUyxxRUFBVDtBQUNBaUMsTUFBSWpDLElBQUosQ0FBUyxTQUFTRCxLQUFLUixXQUFkLElBQTZCLE9BQU9RLEtBQUtKLFNBQVosS0FBMEIsV0FBMUIsR0FBd0MsRUFBeEMsR0FBNkMsT0FBT0ksS0FBS0osU0FBdEYsQ0FBVDtBQUNBc0MsTUFBSWpDLElBQUosQ0FBUyxTQUFTRCxLQUFLUCxXQUFkLElBQTZCLE9BQU9PLEtBQUtILFNBQVosS0FBMEIsV0FBMUIsR0FBd0MsRUFBeEMsR0FBNkMsT0FBT0csS0FBS0gsU0FBdEYsQ0FBVDs7QUFFQSxPQUFLLElBQUlnQixJQUFJLENBQWIsRUFBZ0JBLElBQUliLEtBQUtPLEtBQUwsQ0FBV2MsTUFBL0IsRUFBdUNSLEdBQXZDLEVBQTRDO0FBQzFDLFFBQU1ZLE9BQU96QixLQUFLTyxLQUFMLENBQVdNLENBQVgsQ0FBYjtBQUNBcUIsUUFBSWpDLElBQUosQ0FDRSxTQUFTd0IsS0FBS0MsUUFBZCxHQUF5QixHQUF6QixHQUErQkQsS0FBS0UsUUFBcEMsR0FDRSxJQURGLEdBQ1NGLEtBQUtHLFFBRGQsR0FDeUIsR0FEekIsR0FDK0JILEtBQUtJLFFBRHBDLEdBRUUsS0FISjtBQUtBSyxRQUFJakMsSUFBSixDQUFTa0MsS0FBVCxDQUFlRCxHQUFmLEVBQW9CVCxLQUFLdEIsS0FBekI7QUFDRDs7QUFFRCxTQUFPK0IsSUFBSUUsSUFBSixDQUFTLElBQVQsSUFBaUIsSUFBeEI7QUFDRDs7QUFFTSxTQUFTN0MsV0FBVCxDQUFxQjhDLFFBQXJCLEVBQStCM0MsTUFBL0IsRUFBdUNDLE1BQXZDLEVBQStDQyxTQUEvQyxFQUEwREMsU0FBMUQsRUFBcUVDLE9BQXJFLEVBQThFO0FBQ25GLFNBQU9SLG9CQUFvQitDLFFBQXBCLEVBQThCQSxRQUE5QixFQUF3QzNDLE1BQXhDLEVBQWdEQyxNQUFoRCxFQUF3REMsU0FBeEQsRUFBbUVDLFNBQW5FLEVBQThFQyxPQUE5RSxDQUFQO0FBQ0QiLCJmaWxlIjoiY3JlYXRlLmpzIiwic291cmNlc0NvbnRlbnQiOlsiaW1wb3J0IHtkaWZmTGluZXN9IGZyb20gJy4uL2RpZmYvbGluZSc7XG5cbmV4cG9ydCBmdW5jdGlvbiBzdHJ1Y3R1cmVkUGF0Y2gob2xkRmlsZU5hbWUsIG5ld0ZpbGVOYW1lLCBvbGRTdHIsIG5ld1N0ciwgb2xkSGVhZGVyLCBuZXdIZWFkZXIsIG9wdGlvbnMpIHtcbiAgaWYgKCFvcHRpb25zKSB7XG4gICAgb3B0aW9ucyA9IHt9O1xuICB9XG4gIGlmICh0eXBlb2Ygb3B0aW9ucy5jb250ZXh0ID09PSAndW5kZWZpbmVkJykge1xuICAgIG9wdGlvbnMuY29udGV4dCA9IDQ7XG4gIH1cblxuICBjb25zdCBkaWZmID0gZGlmZkxpbmVzKG9sZFN0ciwgbmV3U3RyLCBvcHRpb25zKTtcbiAgZGlmZi5wdXNoKHt2YWx1ZTogJycsIGxpbmVzOiBbXX0pOyAgIC8vIEFwcGVuZCBhbiBlbXB0eSB2YWx1ZSB0byBtYWtlIGNsZWFudXAgZWFzaWVyXG5cbiAgZnVuY3Rpb24gY29udGV4dExpbmVzKGxpbmVzKSB7XG4gICAgcmV0dXJuIGxpbmVzLm1hcChmdW5jdGlvbihlbnRyeSkgeyByZXR1cm4gJyAnICsgZW50cnk7IH0pO1xuICB9XG5cbiAgbGV0IGh1bmtzID0gW107XG4gIGxldCBvbGRSYW5nZVN0YXJ0ID0gMCwgbmV3UmFuZ2VTdGFydCA9IDAsIGN1clJhbmdlID0gW10sXG4gICAgICBvbGRMaW5lID0gMSwgbmV3TGluZSA9IDE7XG4gIGZvciAobGV0IGkgPSAwOyBpIDwgZGlmZi5sZW5ndGg7IGkrKykge1xuICAgIGNvbnN0IGN1cnJlbnQgPSBkaWZmW2ldLFxuICAgICAgICAgIGxpbmVzID0gY3VycmVudC5saW5lcyB8fCBjdXJyZW50LnZhbHVlLnJlcGxhY2UoL1xcbiQvLCAnJykuc3BsaXQoJ1xcbicpO1xuICAgIGN1cnJlbnQubGluZXMgPSBsaW5lcztcblxuICAgIGlmIChjdXJyZW50LmFkZGVkIHx8IGN1cnJlbnQucmVtb3ZlZCkge1xuICAgICAgLy8gSWYgd2UgaGF2ZSBwcmV2aW91cyBjb250ZXh0LCBzdGFydCB3aXRoIHRoYXRcbiAgICAgIGlmICghb2xkUmFuZ2VTdGFydCkge1xuICAgICAgICBjb25zdCBwcmV2ID0gZGlmZltpIC0gMV07XG4gICAgICAgIG9sZFJhbmdlU3RhcnQgPSBvbGRMaW5lO1xuICAgICAgICBuZXdSYW5nZVN0YXJ0ID0gbmV3TGluZTtcblxuICAgICAgICBpZiAocHJldikge1xuICAgICAgICAgIGN1clJhbmdlID0gb3B0aW9ucy5jb250ZXh0ID4gMCA/IGNvbnRleHRMaW5lcyhwcmV2LmxpbmVzLnNsaWNlKC1vcHRpb25zLmNvbnRleHQpKSA6IFtdO1xuICAgICAgICAgIG9sZFJhbmdlU3RhcnQgLT0gY3VyUmFuZ2UubGVuZ3RoO1xuICAgICAgICAgIG5ld1JhbmdlU3RhcnQgLT0gY3VyUmFuZ2UubGVuZ3RoO1xuICAgICAgICB9XG4gICAgICB9XG5cbiAgICAgIC8vIE91dHB1dCBvdXIgY2hhbmdlc1xuICAgICAgY3VyUmFuZ2UucHVzaCguLi4gbGluZXMubWFwKGZ1bmN0aW9uKGVudHJ5KSB7XG4gICAgICAgIHJldHVybiAoY3VycmVudC5hZGRlZCA/ICcrJyA6ICctJykgKyBlbnRyeTtcbiAgICAgIH0pKTtcblxuICAgICAgLy8gVHJhY2sgdGhlIHVwZGF0ZWQgZmlsZSBwb3NpdGlvblxuICAgICAgaWYgKGN1cnJlbnQuYWRkZWQpIHtcbiAgICAgICAgbmV3TGluZSArPSBsaW5lcy5sZW5ndGg7XG4gICAgICB9IGVsc2Uge1xuICAgICAgICBvbGRMaW5lICs9IGxpbmVzLmxlbmd0aDtcbiAgICAgIH1cbiAgICB9IGVsc2Uge1xuICAgICAgLy8gSWRlbnRpY2FsIGNvbnRleHQgbGluZXMuIFRyYWNrIGxpbmUgY2hhbmdlc1xuICAgICAgaWYgKG9sZFJhbmdlU3RhcnQpIHtcbiAgICAgICAgLy8gQ2xvc2Ugb3V0IGFueSBjaGFuZ2VzIHRoYXQgaGF2ZSBiZWVuIG91dHB1dCAob3Igam9pbiBvdmVybGFwcGluZylcbiAgICAgICAgaWYgKGxpbmVzLmxlbmd0aCA8PSBvcHRpb25zLmNvbnRleHQgKiAyICYmIGkgPCBkaWZmLmxlbmd0aCAtIDIpIHtcbiAgICAgICAgICAvLyBPdmVybGFwcGluZ1xuICAgICAgICAgIGN1clJhbmdlLnB1c2goLi4uIGNvbnRleHRMaW5lcyhsaW5lcykpO1xuICAgICAgICB9IGVsc2Uge1xuICAgICAgICAgIC8vIGVuZCB0aGUgcmFuZ2UgYW5kIG91dHB1dFxuICAgICAgICAgIGxldCBjb250ZXh0U2l6ZSA9IE1hdGgubWluKGxpbmVzLmxlbmd0aCwgb3B0aW9ucy5jb250ZXh0KTtcbiAgICAgICAgICBjdXJSYW5nZS5wdXNoKC4uLiBjb250ZXh0TGluZXMobGluZXMuc2xpY2UoMCwgY29udGV4dFNpemUpKSk7XG5cbiAgICAgICAgICBsZXQgaHVuayA9IHtcbiAgICAgICAgICAgIG9sZFN0YXJ0OiBvbGRSYW5nZVN0YXJ0LFxuICAgICAgICAgICAgb2xkTGluZXM6IChvbGRMaW5lIC0gb2xkUmFuZ2VTdGFydCArIGNvbnRleHRTaXplKSxcbiAgICAgICAgICAgIG5ld1N0YXJ0OiBuZXdSYW5nZVN0YXJ0LFxuICAgICAgICAgICAgbmV3TGluZXM6IChuZXdMaW5lIC0gbmV3UmFuZ2VTdGFydCArIGNvbnRleHRTaXplKSxcbiAgICAgICAgICAgIGxpbmVzOiBjdXJSYW5nZVxuICAgICAgICAgIH07XG4gICAgICAgICAgaWYgKGkgPj0gZGlmZi5sZW5ndGggLSAyICYmIGxpbmVzLmxlbmd0aCA8PSBvcHRpb25zLmNvbnRleHQpIHtcbiAgICAgICAgICAgIC8vIEVPRiBpcyBpbnNpZGUgdGhpcyBodW5rXG4gICAgICAgICAgICBsZXQgb2xkRU9GTmV3bGluZSA9ICgvXFxuJC8udGVzdChvbGRTdHIpKTtcbiAgICAgICAgICAgIGxldCBuZXdFT0ZOZXdsaW5lID0gKC9cXG4kLy50ZXN0KG5ld1N0cikpO1xuICAgICAgICAgICAgaWYgKGxpbmVzLmxlbmd0aCA9PSAwICYmICFvbGRFT0ZOZXdsaW5lKSB7XG4gICAgICAgICAgICAgIC8vIHNwZWNpYWwgY2FzZTogb2xkIGhhcyBubyBlb2wgYW5kIG5vIHRyYWlsaW5nIGNvbnRleHQ7IG5vLW5sIGNhbiBlbmQgdXAgYmVmb3JlIGFkZHNcbiAgICAgICAgICAgICAgY3VyUmFuZ2Uuc3BsaWNlKGh1bmsub2xkTGluZXMsIDAsICdcXFxcIE5vIG5ld2xpbmUgYXQgZW5kIG9mIGZpbGUnKTtcbiAgICAgICAgICAgIH0gZWxzZSBpZiAoIW9sZEVPRk5ld2xpbmUgfHwgIW5ld0VPRk5ld2xpbmUpIHtcbiAgICAgICAgICAgICAgY3VyUmFuZ2UucHVzaCgnXFxcXCBObyBuZXdsaW5lIGF0IGVuZCBvZiBmaWxlJyk7XG4gICAgICAgICAgICB9XG4gICAgICAgICAgfVxuICAgICAgICAgIGh1bmtzLnB1c2goaHVuayk7XG5cbiAgICAgICAgICBvbGRSYW5nZVN0YXJ0ID0gMDtcbiAgICAgICAgICBuZXdSYW5nZVN0YXJ0ID0gMDtcbiAgICAgICAgICBjdXJSYW5nZSA9IFtdO1xuICAgICAgICB9XG4gICAgICB9XG4gICAgICBvbGRMaW5lICs9IGxpbmVzLmxlbmd0aDtcbiAgICAgIG5ld0xpbmUgKz0gbGluZXMubGVuZ3RoO1xuICAgIH1cbiAgfVxuXG4gIHJldHVybiB7XG4gICAgb2xkRmlsZU5hbWU6IG9sZEZpbGVOYW1lLCBuZXdGaWxlTmFtZTogbmV3RmlsZU5hbWUsXG4gICAgb2xkSGVhZGVyOiBvbGRIZWFkZXIsIG5ld0hlYWRlcjogbmV3SGVhZGVyLFxuICAgIGh1bmtzOiBodW5rc1xuICB9O1xufVxuXG5leHBvcnQgZnVuY3Rpb24gY3JlYXRlVHdvRmlsZXNQYXRjaChvbGRGaWxlTmFtZSwgbmV3RmlsZU5hbWUsIG9sZFN0ciwgbmV3U3RyLCBvbGRIZWFkZXIsIG5ld0hlYWRlciwgb3B0aW9ucykge1xuICBjb25zdCBkaWZmID0gc3RydWN0dXJlZFBhdGNoKG9sZEZpbGVOYW1lLCBuZXdGaWxlTmFtZSwgb2xkU3RyLCBuZXdTdHIsIG9sZEhlYWRlciwgbmV3SGVhZGVyLCBvcHRpb25zKTtcblxuICBjb25zdCByZXQgPSBbXTtcbiAgaWYgKG9sZEZpbGVOYW1lID09IG5ld0ZpbGVOYW1lKSB7XG4gICAgcmV0LnB1c2goJ0luZGV4OiAnICsgb2xkRmlsZU5hbWUpO1xuICB9XG4gIHJldC5wdXNoKCc9PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09Jyk7XG4gIHJldC5wdXNoKCctLS0gJyArIGRpZmYub2xkRmlsZU5hbWUgKyAodHlwZW9mIGRpZmYub2xkSGVhZGVyID09PSAndW5kZWZpbmVkJyA/ICcnIDogJ1xcdCcgKyBkaWZmLm9sZEhlYWRlcikpO1xuICByZXQucHVzaCgnKysrICcgKyBkaWZmLm5ld0ZpbGVOYW1lICsgKHR5cGVvZiBkaWZmLm5ld0hlYWRlciA9PT0gJ3VuZGVmaW5lZCcgPyAnJyA6ICdcXHQnICsgZGlmZi5uZXdIZWFkZXIpKTtcblxuICBmb3IgKGxldCBpID0gMDsgaSA8IGRpZmYuaHVua3MubGVuZ3RoOyBpKyspIHtcbiAgICBjb25zdCBodW5rID0gZGlmZi5odW5rc1tpXTtcbiAgICByZXQucHVzaChcbiAgICAgICdAQCAtJyArIGh1bmsub2xkU3RhcnQgKyAnLCcgKyBodW5rLm9sZExpbmVzXG4gICAgICArICcgKycgKyBodW5rLm5ld1N0YXJ0ICsgJywnICsgaHVuay5uZXdMaW5lc1xuICAgICAgKyAnIEBAJ1xuICAgICk7XG4gICAgcmV0LnB1c2guYXBwbHkocmV0LCBodW5rLmxpbmVzKTtcbiAgfVxuXG4gIHJldHVybiByZXQuam9pbignXFxuJykgKyAnXFxuJztcbn1cblxuZXhwb3J0IGZ1bmN0aW9uIGNyZWF0ZVBhdGNoKGZpbGVOYW1lLCBvbGRTdHIsIG5ld1N0ciwgb2xkSGVhZGVyLCBuZXdIZWFkZXIsIG9wdGlvbnMpIHtcbiAgcmV0dXJuIGNyZWF0ZVR3b0ZpbGVzUGF0Y2goZmlsZU5hbWUsIGZpbGVOYW1lLCBvbGRTdHIsIG5ld1N0ciwgb2xkSGVhZGVyLCBuZXdIZWFkZXIsIG9wdGlvbnMpO1xufVxuIl19
diff --git a/node_modules/diff/lib/patch/merge.js b/node_modules/diff/lib/patch/merge.js
new file mode 100644
index 0000000..074c4bc
--- /dev/null
+++ b/node_modules/diff/lib/patch/merge.js
@@ -0,0 +1,396 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports. /*istanbul ignore end*/calcLineCount = calcLineCount;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/merge = merge;
+
+var /*istanbul ignore start*/_create = require('./create') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_parse = require('./parse') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_array = require('../util/array') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/function _toConsumableArray(arr) { if (Array.isArray(arr)) { for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) { arr2[i] = arr[i]; } return arr2; } else { return Array.from(arr); } }
+
+/*istanbul ignore end*/function calcLineCount(hunk) {
+  /*istanbul ignore start*/var _calcOldNewLineCount = /*istanbul ignore end*/calcOldNewLineCount(hunk.lines),
+      oldLines = _calcOldNewLineCount.oldLines,
+      newLines = _calcOldNewLineCount.newLines;
+
+  if (oldLines !== undefined) {
+    hunk.oldLines = oldLines;
+  } else {
+    delete hunk.oldLines;
+  }
+
+  if (newLines !== undefined) {
+    hunk.newLines = newLines;
+  } else {
+    delete hunk.newLines;
+  }
+}
+
+function merge(mine, theirs, base) {
+  mine = loadPatch(mine, base);
+  theirs = loadPatch(theirs, base);
+
+  var ret = {};
+
+  // For index we just let it pass through as it doesn't have any necessary meaning.
+  // Leaving sanity checks on this to the API consumer that may know more about the
+  // meaning in their own context.
+  if (mine.index || theirs.index) {
+    ret.index = mine.index || theirs.index;
+  }
+
+  if (mine.newFileName || theirs.newFileName) {
+    if (!fileNameChanged(mine)) {
+      // No header or no change in ours, use theirs (and ours if theirs does not exist)
+      ret.oldFileName = theirs.oldFileName || mine.oldFileName;
+      ret.newFileName = theirs.newFileName || mine.newFileName;
+      ret.oldHeader = theirs.oldHeader || mine.oldHeader;
+      ret.newHeader = theirs.newHeader || mine.newHeader;
+    } else if (!fileNameChanged(theirs)) {
+      // No header or no change in theirs, use ours
+      ret.oldFileName = mine.oldFileName;
+      ret.newFileName = mine.newFileName;
+      ret.oldHeader = mine.oldHeader;
+      ret.newHeader = mine.newHeader;
+    } else {
+      // Both changed... figure it out
+      ret.oldFileName = selectField(ret, mine.oldFileName, theirs.oldFileName);
+      ret.newFileName = selectField(ret, mine.newFileName, theirs.newFileName);
+      ret.oldHeader = selectField(ret, mine.oldHeader, theirs.oldHeader);
+      ret.newHeader = selectField(ret, mine.newHeader, theirs.newHeader);
+    }
+  }
+
+  ret.hunks = [];
+
+  var mineIndex = 0,
+      theirsIndex = 0,
+      mineOffset = 0,
+      theirsOffset = 0;
+
+  while (mineIndex < mine.hunks.length || theirsIndex < theirs.hunks.length) {
+    var mineCurrent = mine.hunks[mineIndex] || { oldStart: Infinity },
+        theirsCurrent = theirs.hunks[theirsIndex] || { oldStart: Infinity };
+
+    if (hunkBefore(mineCurrent, theirsCurrent)) {
+      // This patch does not overlap with any of the others, yay.
+      ret.hunks.push(cloneHunk(mineCurrent, mineOffset));
+      mineIndex++;
+      theirsOffset += mineCurrent.newLines - mineCurrent.oldLines;
+    } else if (hunkBefore(theirsCurrent, mineCurrent)) {
+      // This patch does not overlap with any of the others, yay.
+      ret.hunks.push(cloneHunk(theirsCurrent, theirsOffset));
+      theirsIndex++;
+      mineOffset += theirsCurrent.newLines - theirsCurrent.oldLines;
+    } else {
+      // Overlap, merge as best we can
+      var mergedHunk = {
+        oldStart: Math.min(mineCurrent.oldStart, theirsCurrent.oldStart),
+        oldLines: 0,
+        newStart: Math.min(mineCurrent.newStart + mineOffset, theirsCurrent.oldStart + theirsOffset),
+        newLines: 0,
+        lines: []
+      };
+      mergeLines(mergedHunk, mineCurrent.oldStart, mineCurrent.lines, theirsCurrent.oldStart, theirsCurrent.lines);
+      theirsIndex++;
+      mineIndex++;
+
+      ret.hunks.push(mergedHunk);
+    }
+  }
+
+  return ret;
+}
+
+function loadPatch(param, base) {
+  if (typeof param === 'string') {
+    if (/^@@/m.test(param) || /^Index:/m.test(param)) {
+      return (/*istanbul ignore start*/(0, _parse.parsePatch) /*istanbul ignore end*/(param)[0]
+      );
+    }
+
+    if (!base) {
+      throw new Error('Must provide a base reference or pass in a patch');
+    }
+    return (/*istanbul ignore start*/(0, _create.structuredPatch) /*istanbul ignore end*/(undefined, undefined, base, param)
+    );
+  }
+
+  return param;
+}
+
+function fileNameChanged(patch) {
+  return patch.newFileName && patch.newFileName !== patch.oldFileName;
+}
+
+function selectField(index, mine, theirs) {
+  if (mine === theirs) {
+    return mine;
+  } else {
+    index.conflict = true;
+    return { mine: mine, theirs: theirs };
+  }
+}
+
+function hunkBefore(test, check) {
+  return test.oldStart < check.oldStart && test.oldStart + test.oldLines < check.oldStart;
+}
+
+function cloneHunk(hunk, offset) {
+  return {
+    oldStart: hunk.oldStart, oldLines: hunk.oldLines,
+    newStart: hunk.newStart + offset, newLines: hunk.newLines,
+    lines: hunk.lines
+  };
+}
+
+function mergeLines(hunk, mineOffset, mineLines, theirOffset, theirLines) {
+  // This will generally result in a conflicted hunk, but there are cases where the context
+  // is the only overlap where we can successfully merge the content here.
+  var mine = { offset: mineOffset, lines: mineLines, index: 0 },
+      their = { offset: theirOffset, lines: theirLines, index: 0 };
+
+  // Handle any leading content
+  insertLeading(hunk, mine, their);
+  insertLeading(hunk, their, mine);
+
+  // Now in the overlap content. Scan through and select the best changes from each.
+  while (mine.index < mine.lines.length && their.index < their.lines.length) {
+    var mineCurrent = mine.lines[mine.index],
+        theirCurrent = their.lines[their.index];
+
+    if ((mineCurrent[0] === '-' || mineCurrent[0] === '+') && (theirCurrent[0] === '-' || theirCurrent[0] === '+')) {
+      // Both modified ...
+      mutualChange(hunk, mine, their);
+    } else if (mineCurrent[0] === '+' && theirCurrent[0] === ' ') {
+      /*istanbul ignore start*/var _hunk$lines;
+
+      /*istanbul ignore end*/ // Mine inserted
+      /*istanbul ignore start*/(_hunk$lines = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/collectChange(mine)));
+    } else if (theirCurrent[0] === '+' && mineCurrent[0] === ' ') {
+      /*istanbul ignore start*/var _hunk$lines2;
+
+      /*istanbul ignore end*/ // Theirs inserted
+      /*istanbul ignore start*/(_hunk$lines2 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines2 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/collectChange(their)));
+    } else if (mineCurrent[0] === '-' && theirCurrent[0] === ' ') {
+      // Mine removed or edited
+      removal(hunk, mine, their);
+    } else if (theirCurrent[0] === '-' && mineCurrent[0] === ' ') {
+      // Their removed or edited
+      removal(hunk, their, mine, true);
+    } else if (mineCurrent === theirCurrent) {
+      // Context identity
+      hunk.lines.push(mineCurrent);
+      mine.index++;
+      their.index++;
+    } else {
+      // Context mismatch
+      conflict(hunk, collectChange(mine), collectChange(their));
+    }
+  }
+
+  // Now push anything that may be remaining
+  insertTrailing(hunk, mine);
+  insertTrailing(hunk, their);
+
+  calcLineCount(hunk);
+}
+
+function mutualChange(hunk, mine, their) {
+  var myChanges = collectChange(mine),
+      theirChanges = collectChange(their);
+
+  if (allRemoves(myChanges) && allRemoves(theirChanges)) {
+    // Special case for remove changes that are supersets of one another
+    if ( /*istanbul ignore start*/(0, _array.arrayStartsWith) /*istanbul ignore end*/(myChanges, theirChanges) && skipRemoveSuperset(their, myChanges, myChanges.length - theirChanges.length)) {
+      /*istanbul ignore start*/var _hunk$lines3;
+
+      /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines3 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines3 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/myChanges));
+      return;
+    } else if ( /*istanbul ignore start*/(0, _array.arrayStartsWith) /*istanbul ignore end*/(theirChanges, myChanges) && skipRemoveSuperset(mine, theirChanges, theirChanges.length - myChanges.length)) {
+      /*istanbul ignore start*/var _hunk$lines4;
+
+      /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines4 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines4 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/theirChanges));
+      return;
+    }
+  } else if ( /*istanbul ignore start*/(0, _array.arrayEqual) /*istanbul ignore end*/(myChanges, theirChanges)) {
+    /*istanbul ignore start*/var _hunk$lines5;
+
+    /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines5 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines5 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/myChanges));
+    return;
+  }
+
+  conflict(hunk, myChanges, theirChanges);
+}
+
+function removal(hunk, mine, their, swap) {
+  var myChanges = collectChange(mine),
+      theirChanges = collectContext(their, myChanges);
+  if (theirChanges.merged) {
+    /*istanbul ignore start*/var _hunk$lines6;
+
+    /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines6 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines6 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/theirChanges.merged));
+  } else {
+    conflict(hunk, swap ? theirChanges : myChanges, swap ? myChanges : theirChanges);
+  }
+}
+
+function conflict(hunk, mine, their) {
+  hunk.conflict = true;
+  hunk.lines.push({
+    conflict: true,
+    mine: mine,
+    theirs: their
+  });
+}
+
+function insertLeading(hunk, insert, their) {
+  while (insert.offset < their.offset && insert.index < insert.lines.length) {
+    var line = insert.lines[insert.index++];
+    hunk.lines.push(line);
+    insert.offset++;
+  }
+}
+function insertTrailing(hunk, insert) {
+  while (insert.index < insert.lines.length) {
+    var line = insert.lines[insert.index++];
+    hunk.lines.push(line);
+  }
+}
+
+function collectChange(state) {
+  var ret = [],
+      operation = state.lines[state.index][0];
+  while (state.index < state.lines.length) {
+    var line = state.lines[state.index];
+
+    // Group additions that are immediately after subtractions and treat them as one "atomic" modify change.
+    if (operation === '-' && line[0] === '+') {
+      operation = '+';
+    }
+
+    if (operation === line[0]) {
+      ret.push(line);
+      state.index++;
+    } else {
+      break;
+    }
+  }
+
+  return ret;
+}
+function collectContext(state, matchChanges) {
+  var changes = [],
+      merged = [],
+      matchIndex = 0,
+      contextChanges = false,
+      conflicted = false;
+  while (matchIndex < matchChanges.length && state.index < state.lines.length) {
+    var change = state.lines[state.index],
+        match = matchChanges[matchIndex];
+
+    // Once we've hit our add, then we are done
+    if (match[0] === '+') {
+      break;
+    }
+
+    contextChanges = contextChanges || change[0] !== ' ';
+
+    merged.push(match);
+    matchIndex++;
+
+    // Consume any additions in the other block as a conflict to attempt
+    // to pull in the remaining context after this
+    if (change[0] === '+') {
+      conflicted = true;
+
+      while (change[0] === '+') {
+        changes.push(change);
+        change = state.lines[++state.index];
+      }
+    }
+
+    if (match.substr(1) === change.substr(1)) {
+      changes.push(change);
+      state.index++;
+    } else {
+      conflicted = true;
+    }
+  }
+
+  if ((matchChanges[matchIndex] || '')[0] === '+' && contextChanges) {
+    conflicted = true;
+  }
+
+  if (conflicted) {
+    return changes;
+  }
+
+  while (matchIndex < matchChanges.length) {
+    merged.push(matchChanges[matchIndex++]);
+  }
+
+  return {
+    merged: merged,
+    changes: changes
+  };
+}
+
+function allRemoves(changes) {
+  return changes.reduce(function (prev, change) {
+    return prev && change[0] === '-';
+  }, true);
+}
+function skipRemoveSuperset(state, removeChanges, delta) {
+  for (var i = 0; i < delta; i++) {
+    var changeContent = removeChanges[removeChanges.length - delta + i].substr(1);
+    if (state.lines[state.index + i] !== ' ' + changeContent) {
+      return false;
+    }
+  }
+
+  state.index += delta;
+  return true;
+}
+
+function calcOldNewLineCount(lines) {
+  var oldLines = 0;
+  var newLines = 0;
+
+  lines.forEach(function (line) {
+    if (typeof line !== 'string') {
+      var myCount = calcOldNewLineCount(line.mine);
+      var theirCount = calcOldNewLineCount(line.theirs);
+
+      if (oldLines !== undefined) {
+        if (myCount.oldLines === theirCount.oldLines) {
+          oldLines += myCount.oldLines;
+        } else {
+          oldLines = undefined;
+        }
+      }
+
+      if (newLines !== undefined) {
+        if (myCount.newLines === theirCount.newLines) {
+          newLines += myCount.newLines;
+        } else {
+          newLines = undefined;
+        }
+      }
+    } else {
+      if (newLines !== undefined && (line[0] === '+' || line[0] === ' ')) {
+        newLines++;
+      }
+      if (oldLines !== undefined && (line[0] === '-' || line[0] === ' ')) {
+        oldLines++;
+      }
+    }
+  });
+
+  return { oldLines: oldLines, newLines: newLines };
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9wYXRjaC9tZXJnZS5qcyJdLCJuYW1lcyI6WyJjYWxjTGluZUNvdW50IiwibWVyZ2UiLCJodW5rIiwiY2FsY09sZE5ld0xpbmVDb3VudCIsImxpbmVzIiwib2xkTGluZXMiLCJuZXdMaW5lcyIsInVuZGVmaW5lZCIsIm1pbmUiLCJ0aGVpcnMiLCJiYXNlIiwibG9hZFBhdGNoIiwicmV0IiwiaW5kZXgiLCJuZXdGaWxlTmFtZSIsImZpbGVOYW1lQ2hhbmdlZCIsIm9sZEZpbGVOYW1lIiwib2xkSGVhZGVyIiwibmV3SGVhZGVyIiwic2VsZWN0RmllbGQiLCJodW5rcyIsIm1pbmVJbmRleCIsInRoZWlyc0luZGV4IiwibWluZU9mZnNldCIsInRoZWlyc09mZnNldCIsImxlbmd0aCIsIm1pbmVDdXJyZW50Iiwib2xkU3RhcnQiLCJJbmZpbml0eSIsInRoZWlyc0N1cnJlbnQiLCJodW5rQmVmb3JlIiwicHVzaCIsImNsb25lSHVuayIsIm1lcmdlZEh1bmsiLCJNYXRoIiwibWluIiwibmV3U3RhcnQiLCJtZXJnZUxpbmVzIiwicGFyYW0iLCJ0ZXN0IiwiRXJyb3IiLCJwYXRjaCIsImNvbmZsaWN0IiwiY2hlY2siLCJvZmZzZXQiLCJtaW5lTGluZXMiLCJ0aGVpck9mZnNldCIsInRoZWlyTGluZXMiLCJ0aGVpciIsImluc2VydExlYWRpbmciLCJ0aGVpckN1cnJlbnQiLCJtdXR1YWxDaGFuZ2UiLCJjb2xsZWN0Q2hhbmdlIiwicmVtb3ZhbCIsImluc2VydFRyYWlsaW5nIiwibXlDaGFuZ2VzIiwidGhlaXJDaGFuZ2VzIiwiYWxsUmVtb3ZlcyIsInNraXBSZW1vdmVTdXBlcnNldCIsInN3YXAiLCJjb2xsZWN0Q29udGV4dCIsIm1lcmdlZCIsImluc2VydCIsImxpbmUiLCJzdGF0ZSIsIm9wZXJhdGlvbiIsIm1hdGNoQ2hhbmdlcyIsImNoYW5nZXMiLCJtYXRjaEluZGV4IiwiY29udGV4dENoYW5nZXMiLCJjb25mbGljdGVkIiwiY2hhbmdlIiwibWF0Y2giLCJzdWJzdHIiLCJyZWR1Y2UiLCJwcmV2IiwicmVtb3ZlQ2hhbmdlcyIsImRlbHRhIiwiaSIsImNoYW5nZUNvbnRlbnQiLCJmb3JFYWNoIiwibXlDb3VudCIsInRoZWlyQ291bnQiXSwibWFwcGluZ3MiOiI7OztnQ0FLZ0JBLGEsR0FBQUEsYTt5REFnQkFDLEssR0FBQUEsSzs7QUFyQmhCOztBQUNBOztBQUVBOzs7O3VCQUVPLFNBQVNELGFBQVQsQ0FBdUJFLElBQXZCLEVBQTZCO0FBQUEsNkVBQ0xDLG9CQUFvQkQsS0FBS0UsS0FBekIsQ0FESztBQUFBLE1BQzNCQyxRQUQyQix3QkFDM0JBLFFBRDJCO0FBQUEsTUFDakJDLFFBRGlCLHdCQUNqQkEsUUFEaUI7O0FBR2xDLE1BQUlELGFBQWFFLFNBQWpCLEVBQTRCO0FBQzFCTCxTQUFLRyxRQUFMLEdBQWdCQSxRQUFoQjtBQUNELEdBRkQsTUFFTztBQUNMLFdBQU9ILEtBQUtHLFFBQVo7QUFDRDs7QUFFRCxNQUFJQyxhQUFhQyxTQUFqQixFQUE0QjtBQUMxQkwsU0FBS0ksUUFBTCxHQUFnQkEsUUFBaEI7QUFDRCxHQUZELE1BRU87QUFDTCxXQUFPSixLQUFLSSxRQUFaO0FBQ0Q7QUFDRjs7QUFFTSxTQUFTTCxLQUFULENBQWVPLElBQWYsRUFBcUJDLE1BQXJCLEVBQTZCQyxJQUE3QixFQUFtQztBQUN4Q0YsU0FBT0csVUFBVUgsSUFBVixFQUFnQkUsSUFBaEIsQ0FBUDtBQUNBRCxXQUFTRSxVQUFVRixNQUFWLEVBQWtCQyxJQUFsQixDQUFUOztBQUVBLE1BQUlFLE1BQU0sRUFBVjs7QUFFQTtBQUNBO0FBQ0E7QUFDQSxNQUFJSixLQUFLSyxLQUFMLElBQWNKLE9BQU9JLEtBQXpCLEVBQWdDO0FBQzlCRCxRQUFJQyxLQUFKLEdBQVlMLEtBQUtLLEtBQUwsSUFBY0osT0FBT0ksS0FBakM7QUFDRDs7QUFFRCxNQUFJTCxLQUFLTSxXQUFMLElBQW9CTCxPQUFPSyxXQUEvQixFQUE0QztBQUMxQyxRQUFJLENBQUNDLGdCQUFnQlAsSUFBaEIsQ0FBTCxFQUE0QjtBQUMxQjtBQUNBSSxVQUFJSSxXQUFKLEdBQWtCUCxPQUFPTyxXQUFQLElBQXNCUixLQUFLUSxXQUE3QztBQUNBSixVQUFJRSxXQUFKLEdBQWtCTCxPQUFPSyxXQUFQLElBQXNCTixLQUFLTSxXQUE3QztBQUNBRixVQUFJSyxTQUFKLEdBQWdCUixPQUFPUSxTQUFQLElBQW9CVCxLQUFLUyxTQUF6QztBQUNBTCxVQUFJTSxTQUFKLEdBQWdCVCxPQUFPUyxTQUFQLElBQW9CVixLQUFLVSxTQUF6QztBQUNELEtBTkQsTUFNTyxJQUFJLENBQUNILGdCQUFnQk4sTUFBaEIsQ0FBTCxFQUE4QjtBQUNuQztBQUNBRyxVQUFJSSxXQUFKLEdBQWtCUixLQUFLUSxXQUF2QjtBQUNBSixVQUFJRSxXQUFKLEdBQWtCTixLQUFLTSxXQUF2QjtBQUNBRixVQUFJSyxTQUFKLEdBQWdCVCxLQUFLUyxTQUFyQjtBQUNBTCxVQUFJTSxTQUFKLEdBQWdCVixLQUFLVSxTQUFyQjtBQUNELEtBTk0sTUFNQTtBQUNMO0FBQ0FOLFVBQUlJLFdBQUosR0FBa0JHLFlBQVlQLEdBQVosRUFBaUJKLEtBQUtRLFdBQXRCLEVBQW1DUCxPQUFPTyxXQUExQyxDQUFsQjtBQUNBSixVQUFJRSxXQUFKLEdBQWtCSyxZQUFZUCxHQUFaLEVBQWlCSixLQUFLTSxXQUF0QixFQUFtQ0wsT0FBT0ssV0FBMUMsQ0FBbEI7QUFDQUYsVUFBSUssU0FBSixHQUFnQkUsWUFBWVAsR0FBWixFQUFpQkosS0FBS1MsU0FBdEIsRUFBaUNSLE9BQU9RLFNBQXhDLENBQWhCO0FBQ0FMLFVBQUlNLFNBQUosR0FBZ0JDLFlBQVlQLEdBQVosRUFBaUJKLEtBQUtVLFNBQXRCLEVBQWlDVCxPQUFPUyxTQUF4QyxDQUFoQjtBQUNEO0FBQ0Y7O0FBRUROLE1BQUlRLEtBQUosR0FBWSxFQUFaOztBQUVBLE1BQUlDLFlBQVksQ0FBaEI7QUFBQSxNQUNJQyxjQUFjLENBRGxCO0FBQUEsTUFFSUMsYUFBYSxDQUZqQjtBQUFBLE1BR0lDLGVBQWUsQ0FIbkI7O0FBS0EsU0FBT0gsWUFBWWIsS0FBS1ksS0FBTCxDQUFXSyxNQUF2QixJQUFpQ0gsY0FBY2IsT0FBT1csS0FBUCxDQUFhSyxNQUFuRSxFQUEyRTtBQUN6RSxRQUFJQyxjQUFjbEIsS0FBS1ksS0FBTCxDQUFXQyxTQUFYLEtBQXlCLEVBQUNNLFVBQVVDLFFBQVgsRUFBM0M7QUFBQSxRQUNJQyxnQkFBZ0JwQixPQUFPVyxLQUFQLENBQWFFLFdBQWIsS0FBNkIsRUFBQ0ssVUFBVUMsUUFBWCxFQURqRDs7QUFHQSxRQUFJRSxXQUFXSixXQUFYLEVBQXdCRyxhQUF4QixDQUFKLEVBQTRDO0FBQzFDO0FBQ0FqQixVQUFJUSxLQUFKLENBQVVXLElBQVYsQ0FBZUMsVUFBVU4sV0FBVixFQUF1QkgsVUFBdkIsQ0FBZjtBQUNBRjtBQUNBRyxzQkFBZ0JFLFlBQVlwQixRQUFaLEdBQXVCb0IsWUFBWXJCLFFBQW5EO0FBQ0QsS0FMRCxNQUtPLElBQUl5QixXQUFXRCxhQUFYLEVBQTBCSCxXQUExQixDQUFKLEVBQTRDO0FBQ2pEO0FBQ0FkLFVBQUlRLEtBQUosQ0FBVVcsSUFBVixDQUFlQyxVQUFVSCxhQUFWLEVBQXlCTCxZQUF6QixDQUFmO0FBQ0FGO0FBQ0FDLG9CQUFjTSxjQUFjdkIsUUFBZCxHQUF5QnVCLGNBQWN4QixRQUFyRDtBQUNELEtBTE0sTUFLQTtBQUNMO0FBQ0EsVUFBSTRCLGFBQWE7QUFDZk4sa0JBQVVPLEtBQUtDLEdBQUwsQ0FBU1QsWUFBWUMsUUFBckIsRUFBK0JFLGNBQWNGLFFBQTdDLENBREs7QUFFZnRCLGtCQUFVLENBRks7QUFHZitCLGtCQUFVRixLQUFLQyxHQUFMLENBQVNULFlBQVlVLFFBQVosR0FBdUJiLFVBQWhDLEVBQTRDTSxjQUFjRixRQUFkLEdBQXlCSCxZQUFyRSxDQUhLO0FBSWZsQixrQkFBVSxDQUpLO0FBS2ZGLGVBQU87QUFMUSxPQUFqQjtBQU9BaUMsaUJBQVdKLFVBQVgsRUFBdUJQLFlBQVlDLFFBQW5DLEVBQTZDRCxZQUFZdEIsS0FBekQsRUFBZ0V5QixjQUFjRixRQUE5RSxFQUF3RkUsY0FBY3pCLEtBQXRHO0FBQ0FrQjtBQUNBRDs7QUFFQVQsVUFBSVEsS0FBSixDQUFVVyxJQUFWLENBQWVFLFVBQWY7QUFDRDtBQUNGOztBQUVELFNBQU9yQixHQUFQO0FBQ0Q7O0FBRUQsU0FBU0QsU0FBVCxDQUFtQjJCLEtBQW5CLEVBQTBCNUIsSUFBMUIsRUFBZ0M7QUFDOUIsTUFBSSxPQUFPNEIsS0FBUCxLQUFpQixRQUFyQixFQUErQjtBQUM3QixRQUFJLE9BQU9DLElBQVAsQ0FBWUQsS0FBWixLQUF1QixXQUFXQyxJQUFYLENBQWdCRCxLQUFoQixDQUEzQixFQUFvRDtBQUNsRCxhQUFPLHlFQUFXQSxLQUFYLEVBQWtCLENBQWxCO0FBQVA7QUFDRDs7QUFFRCxRQUFJLENBQUM1QixJQUFMLEVBQVc7QUFDVCxZQUFNLElBQUk4QixLQUFKLENBQVUsa0RBQVYsQ0FBTjtBQUNEO0FBQ0QsV0FBTywrRUFBZ0JqQyxTQUFoQixFQUEyQkEsU0FBM0IsRUFBc0NHLElBQXRDLEVBQTRDNEIsS0FBNUM7QUFBUDtBQUNEOztBQUVELFNBQU9BLEtBQVA7QUFDRDs7QUFFRCxTQUFTdkIsZUFBVCxDQUF5QjBCLEtBQXpCLEVBQWdDO0FBQzlCLFNBQU9BLE1BQU0zQixXQUFOLElBQXFCMkIsTUFBTTNCLFdBQU4sS0FBc0IyQixNQUFNekIsV0FBeEQ7QUFDRDs7QUFFRCxTQUFTRyxXQUFULENBQXFCTixLQUFyQixFQUE0QkwsSUFBNUIsRUFBa0NDLE1BQWxDLEVBQTBDO0FBQ3hDLE1BQUlELFNBQVNDLE1BQWIsRUFBcUI7QUFDbkIsV0FBT0QsSUFBUDtBQUNELEdBRkQsTUFFTztBQUNMSyxVQUFNNkIsUUFBTixHQUFpQixJQUFqQjtBQUNBLFdBQU8sRUFBQ2xDLFVBQUQsRUFBT0MsY0FBUCxFQUFQO0FBQ0Q7QUFDRjs7QUFFRCxTQUFTcUIsVUFBVCxDQUFvQlMsSUFBcEIsRUFBMEJJLEtBQTFCLEVBQWlDO0FBQy9CLFNBQU9KLEtBQUtaLFFBQUwsR0FBZ0JnQixNQUFNaEIsUUFBdEIsSUFDRFksS0FBS1osUUFBTCxHQUFnQlksS0FBS2xDLFFBQXRCLEdBQWtDc0MsTUFBTWhCLFFBRDdDO0FBRUQ7O0FBRUQsU0FBU0ssU0FBVCxDQUFtQjlCLElBQW5CLEVBQXlCMEMsTUFBekIsRUFBaUM7QUFDL0IsU0FBTztBQUNMakIsY0FBVXpCLEtBQUt5QixRQURWLEVBQ29CdEIsVUFBVUgsS0FBS0csUUFEbkM7QUFFTCtCLGNBQVVsQyxLQUFLa0MsUUFBTCxHQUFnQlEsTUFGckIsRUFFNkJ0QyxVQUFVSixLQUFLSSxRQUY1QztBQUdMRixXQUFPRixLQUFLRTtBQUhQLEdBQVA7QUFLRDs7QUFFRCxTQUFTaUMsVUFBVCxDQUFvQm5DLElBQXBCLEVBQTBCcUIsVUFBMUIsRUFBc0NzQixTQUF0QyxFQUFpREMsV0FBakQsRUFBOERDLFVBQTlELEVBQTBFO0FBQ3hFO0FBQ0E7QUFDQSxNQUFJdkMsT0FBTyxFQUFDb0MsUUFBUXJCLFVBQVQsRUFBcUJuQixPQUFPeUMsU0FBNUIsRUFBdUNoQyxPQUFPLENBQTlDLEVBQVg7QUFBQSxNQUNJbUMsUUFBUSxFQUFDSixRQUFRRSxXQUFULEVBQXNCMUMsT0FBTzJDLFVBQTdCLEVBQXlDbEMsT0FBTyxDQUFoRCxFQURaOztBQUdBO0FBQ0FvQyxnQkFBYy9DLElBQWQsRUFBb0JNLElBQXBCLEVBQTBCd0MsS0FBMUI7QUFDQUMsZ0JBQWMvQyxJQUFkLEVBQW9COEMsS0FBcEIsRUFBMkJ4QyxJQUEzQjs7QUFFQTtBQUNBLFNBQU9BLEtBQUtLLEtBQUwsR0FBYUwsS0FBS0osS0FBTCxDQUFXcUIsTUFBeEIsSUFBa0N1QixNQUFNbkMsS0FBTixHQUFjbUMsTUFBTTVDLEtBQU4sQ0FBWXFCLE1BQW5FLEVBQTJFO0FBQ3pFLFFBQUlDLGNBQWNsQixLQUFLSixLQUFMLENBQVdJLEtBQUtLLEtBQWhCLENBQWxCO0FBQUEsUUFDSXFDLGVBQWVGLE1BQU01QyxLQUFOLENBQVk0QyxNQUFNbkMsS0FBbEIsQ0FEbkI7O0FBR0EsUUFBSSxDQUFDYSxZQUFZLENBQVosTUFBbUIsR0FBbkIsSUFBMEJBLFlBQVksQ0FBWixNQUFtQixHQUE5QyxNQUNJd0IsYUFBYSxDQUFiLE1BQW9CLEdBQXBCLElBQTJCQSxhQUFhLENBQWIsTUFBb0IsR0FEbkQsQ0FBSixFQUM2RDtBQUMzRDtBQUNBQyxtQkFBYWpELElBQWIsRUFBbUJNLElBQW5CLEVBQXlCd0MsS0FBekI7QUFDRCxLQUpELE1BSU8sSUFBSXRCLFlBQVksQ0FBWixNQUFtQixHQUFuQixJQUEwQndCLGFBQWEsQ0FBYixNQUFvQixHQUFsRCxFQUF1RDtBQUFBOztBQUFBLDhCQUM1RDtBQUNBLDBFQUFLOUMsS0FBTCxFQUFXMkIsSUFBWCw0TEFBb0JxQixjQUFjNUMsSUFBZCxDQUFwQjtBQUNELEtBSE0sTUFHQSxJQUFJMEMsYUFBYSxDQUFiLE1BQW9CLEdBQXBCLElBQTJCeEIsWUFBWSxDQUFaLE1BQW1CLEdBQWxELEVBQXVEO0FBQUE7O0FBQUEsOEJBQzVEO0FBQ0EsMkVBQUt0QixLQUFMLEVBQVcyQixJQUFYLDZMQUFvQnFCLGNBQWNKLEtBQWQsQ0FBcEI7QUFDRCxLQUhNLE1BR0EsSUFBSXRCLFlBQVksQ0FBWixNQUFtQixHQUFuQixJQUEwQndCLGFBQWEsQ0FBYixNQUFvQixHQUFsRCxFQUF1RDtBQUM1RDtBQUNBRyxjQUFRbkQsSUFBUixFQUFjTSxJQUFkLEVBQW9Cd0MsS0FBcEI7QUFDRCxLQUhNLE1BR0EsSUFBSUUsYUFBYSxDQUFiLE1BQW9CLEdBQXBCLElBQTJCeEIsWUFBWSxDQUFaLE1BQW1CLEdBQWxELEVBQXVEO0FBQzVEO0FBQ0EyQixjQUFRbkQsSUFBUixFQUFjOEMsS0FBZCxFQUFxQnhDLElBQXJCLEVBQTJCLElBQTNCO0FBQ0QsS0FITSxNQUdBLElBQUlrQixnQkFBZ0J3QixZQUFwQixFQUFrQztBQUN2QztBQUNBaEQsV0FBS0UsS0FBTCxDQUFXMkIsSUFBWCxDQUFnQkwsV0FBaEI7QUFDQWxCLFdBQUtLLEtBQUw7QUFDQW1DLFlBQU1uQyxLQUFOO0FBQ0QsS0FMTSxNQUtBO0FBQ0w7QUFDQTZCLGVBQVN4QyxJQUFULEVBQWVrRCxjQUFjNUMsSUFBZCxDQUFmLEVBQW9DNEMsY0FBY0osS0FBZCxDQUFwQztBQUNEO0FBQ0Y7O0FBRUQ7QUFDQU0saUJBQWVwRCxJQUFmLEVBQXFCTSxJQUFyQjtBQUNBOEMsaUJBQWVwRCxJQUFmLEVBQXFCOEMsS0FBckI7O0FBRUFoRCxnQkFBY0UsSUFBZDtBQUNEOztBQUVELFNBQVNpRCxZQUFULENBQXNCakQsSUFBdEIsRUFBNEJNLElBQTVCLEVBQWtDd0MsS0FBbEMsRUFBeUM7QUFDdkMsTUFBSU8sWUFBWUgsY0FBYzVDLElBQWQsQ0FBaEI7QUFBQSxNQUNJZ0QsZUFBZUosY0FBY0osS0FBZCxDQURuQjs7QUFHQSxNQUFJUyxXQUFXRixTQUFYLEtBQXlCRSxXQUFXRCxZQUFYLENBQTdCLEVBQXVEO0FBQ3JEO0FBQ0EsUUFBSSw4RUFBZ0JELFNBQWhCLEVBQTJCQyxZQUEzQixLQUNHRSxtQkFBbUJWLEtBQW5CLEVBQTBCTyxTQUExQixFQUFxQ0EsVUFBVTlCLE1BQVYsR0FBbUIrQixhQUFhL0IsTUFBckUsQ0FEUCxFQUNxRjtBQUFBOztBQUFBLDZCQUNuRixzRUFBS3JCLEtBQUwsRUFBVzJCLElBQVgsNkxBQW9Cd0IsU0FBcEI7QUFDQTtBQUNELEtBSkQsTUFJTyxJQUFJLDhFQUFnQkMsWUFBaEIsRUFBOEJELFNBQTlCLEtBQ0pHLG1CQUFtQmxELElBQW5CLEVBQXlCZ0QsWUFBekIsRUFBdUNBLGFBQWEvQixNQUFiLEdBQXNCOEIsVUFBVTlCLE1BQXZFLENBREEsRUFDZ0Y7QUFBQTs7QUFBQSw2QkFDckYsc0VBQUtyQixLQUFMLEVBQVcyQixJQUFYLDZMQUFvQnlCLFlBQXBCO0FBQ0E7QUFDRDtBQUNGLEdBWEQsTUFXTyxJQUFJLHlFQUFXRCxTQUFYLEVBQXNCQyxZQUF0QixDQUFKLEVBQXlDO0FBQUE7O0FBQUEsMkJBQzlDLHNFQUFLcEQsS0FBTCxFQUFXMkIsSUFBWCw2TEFBb0J3QixTQUFwQjtBQUNBO0FBQ0Q7O0FBRURiLFdBQVN4QyxJQUFULEVBQWVxRCxTQUFmLEVBQTBCQyxZQUExQjtBQUNEOztBQUVELFNBQVNILE9BQVQsQ0FBaUJuRCxJQUFqQixFQUF1Qk0sSUFBdkIsRUFBNkJ3QyxLQUE3QixFQUFvQ1csSUFBcEMsRUFBMEM7QUFDeEMsTUFBSUosWUFBWUgsY0FBYzVDLElBQWQsQ0FBaEI7QUFBQSxNQUNJZ0QsZUFBZUksZUFBZVosS0FBZixFQUFzQk8sU0FBdEIsQ0FEbkI7QUFFQSxNQUFJQyxhQUFhSyxNQUFqQixFQUF5QjtBQUFBOztBQUFBLDJCQUN2QixzRUFBS3pELEtBQUwsRUFBVzJCLElBQVgsNkxBQW9CeUIsYUFBYUssTUFBakM7QUFDRCxHQUZELE1BRU87QUFDTG5CLGFBQVN4QyxJQUFULEVBQWV5RCxPQUFPSCxZQUFQLEdBQXNCRCxTQUFyQyxFQUFnREksT0FBT0osU0FBUCxHQUFtQkMsWUFBbkU7QUFDRDtBQUNGOztBQUVELFNBQVNkLFFBQVQsQ0FBa0J4QyxJQUFsQixFQUF3Qk0sSUFBeEIsRUFBOEJ3QyxLQUE5QixFQUFxQztBQUNuQzlDLE9BQUt3QyxRQUFMLEdBQWdCLElBQWhCO0FBQ0F4QyxPQUFLRSxLQUFMLENBQVcyQixJQUFYLENBQWdCO0FBQ2RXLGNBQVUsSUFESTtBQUVkbEMsVUFBTUEsSUFGUTtBQUdkQyxZQUFRdUM7QUFITSxHQUFoQjtBQUtEOztBQUVELFNBQVNDLGFBQVQsQ0FBdUIvQyxJQUF2QixFQUE2QjRELE1BQTdCLEVBQXFDZCxLQUFyQyxFQUE0QztBQUMxQyxTQUFPYyxPQUFPbEIsTUFBUCxHQUFnQkksTUFBTUosTUFBdEIsSUFBZ0NrQixPQUFPakQsS0FBUCxHQUFlaUQsT0FBTzFELEtBQVAsQ0FBYXFCLE1BQW5FLEVBQTJFO0FBQ3pFLFFBQUlzQyxPQUFPRCxPQUFPMUQsS0FBUCxDQUFhMEQsT0FBT2pELEtBQVAsRUFBYixDQUFYO0FBQ0FYLFNBQUtFLEtBQUwsQ0FBVzJCLElBQVgsQ0FBZ0JnQyxJQUFoQjtBQUNBRCxXQUFPbEIsTUFBUDtBQUNEO0FBQ0Y7QUFDRCxTQUFTVSxjQUFULENBQXdCcEQsSUFBeEIsRUFBOEI0RCxNQUE5QixFQUFzQztBQUNwQyxTQUFPQSxPQUFPakQsS0FBUCxHQUFlaUQsT0FBTzFELEtBQVAsQ0FBYXFCLE1BQW5DLEVBQTJDO0FBQ3pDLFFBQUlzQyxPQUFPRCxPQUFPMUQsS0FBUCxDQUFhMEQsT0FBT2pELEtBQVAsRUFBYixDQUFYO0FBQ0FYLFNBQUtFLEtBQUwsQ0FBVzJCLElBQVgsQ0FBZ0JnQyxJQUFoQjtBQUNEO0FBQ0Y7O0FBRUQsU0FBU1gsYUFBVCxDQUF1QlksS0FBdkIsRUFBOEI7QUFDNUIsTUFBSXBELE1BQU0sRUFBVjtBQUFBLE1BQ0lxRCxZQUFZRCxNQUFNNUQsS0FBTixDQUFZNEQsTUFBTW5ELEtBQWxCLEVBQXlCLENBQXpCLENBRGhCO0FBRUEsU0FBT21ELE1BQU1uRCxLQUFOLEdBQWNtRCxNQUFNNUQsS0FBTixDQUFZcUIsTUFBakMsRUFBeUM7QUFDdkMsUUFBSXNDLE9BQU9DLE1BQU01RCxLQUFOLENBQVk0RCxNQUFNbkQsS0FBbEIsQ0FBWDs7QUFFQTtBQUNBLFFBQUlvRCxjQUFjLEdBQWQsSUFBcUJGLEtBQUssQ0FBTCxNQUFZLEdBQXJDLEVBQTBDO0FBQ3hDRSxrQkFBWSxHQUFaO0FBQ0Q7O0FBRUQsUUFBSUEsY0FBY0YsS0FBSyxDQUFMLENBQWxCLEVBQTJCO0FBQ3pCbkQsVUFBSW1CLElBQUosQ0FBU2dDLElBQVQ7QUFDQUMsWUFBTW5ELEtBQU47QUFDRCxLQUhELE1BR087QUFDTDtBQUNEO0FBQ0Y7O0FBRUQsU0FBT0QsR0FBUDtBQUNEO0FBQ0QsU0FBU2dELGNBQVQsQ0FBd0JJLEtBQXhCLEVBQStCRSxZQUEvQixFQUE2QztBQUMzQyxNQUFJQyxVQUFVLEVBQWQ7QUFBQSxNQUNJTixTQUFTLEVBRGI7QUFBQSxNQUVJTyxhQUFhLENBRmpCO0FBQUEsTUFHSUMsaUJBQWlCLEtBSHJCO0FBQUEsTUFJSUMsYUFBYSxLQUpqQjtBQUtBLFNBQU9GLGFBQWFGLGFBQWF6QyxNQUExQixJQUNFdUMsTUFBTW5ELEtBQU4sR0FBY21ELE1BQU01RCxLQUFOLENBQVlxQixNQURuQyxFQUMyQztBQUN6QyxRQUFJOEMsU0FBU1AsTUFBTTVELEtBQU4sQ0FBWTRELE1BQU1uRCxLQUFsQixDQUFiO0FBQUEsUUFDSTJELFFBQVFOLGFBQWFFLFVBQWIsQ0FEWjs7QUFHQTtBQUNBLFFBQUlJLE1BQU0sQ0FBTixNQUFhLEdBQWpCLEVBQXNCO0FBQ3BCO0FBQ0Q7O0FBRURILHFCQUFpQkEsa0JBQWtCRSxPQUFPLENBQVAsTUFBYyxHQUFqRDs7QUFFQVYsV0FBTzlCLElBQVAsQ0FBWXlDLEtBQVo7QUFDQUo7O0FBRUE7QUFDQTtBQUNBLFFBQUlHLE9BQU8sQ0FBUCxNQUFjLEdBQWxCLEVBQXVCO0FBQ3JCRCxtQkFBYSxJQUFiOztBQUVBLGFBQU9DLE9BQU8sQ0FBUCxNQUFjLEdBQXJCLEVBQTBCO0FBQ3hCSixnQkFBUXBDLElBQVIsQ0FBYXdDLE1BQWI7QUFDQUEsaUJBQVNQLE1BQU01RCxLQUFOLENBQVksRUFBRTRELE1BQU1uRCxLQUFwQixDQUFUO0FBQ0Q7QUFDRjs7QUFFRCxRQUFJMkQsTUFBTUMsTUFBTixDQUFhLENBQWIsTUFBb0JGLE9BQU9FLE1BQVAsQ0FBYyxDQUFkLENBQXhCLEVBQTBDO0FBQ3hDTixjQUFRcEMsSUFBUixDQUFhd0MsTUFBYjtBQUNBUCxZQUFNbkQsS0FBTjtBQUNELEtBSEQsTUFHTztBQUNMeUQsbUJBQWEsSUFBYjtBQUNEO0FBQ0Y7O0FBRUQsTUFBSSxDQUFDSixhQUFhRSxVQUFiLEtBQTRCLEVBQTdCLEVBQWlDLENBQWpDLE1BQXdDLEdBQXhDLElBQ0dDLGNBRFAsRUFDdUI7QUFDckJDLGlCQUFhLElBQWI7QUFDRDs7QUFFRCxNQUFJQSxVQUFKLEVBQWdCO0FBQ2QsV0FBT0gsT0FBUDtBQUNEOztBQUVELFNBQU9DLGFBQWFGLGFBQWF6QyxNQUFqQyxFQUF5QztBQUN2Q29DLFdBQU85QixJQUFQLENBQVltQyxhQUFhRSxZQUFiLENBQVo7QUFDRDs7QUFFRCxTQUFPO0FBQ0xQLGtCQURLO0FBRUxNO0FBRkssR0FBUDtBQUlEOztBQUVELFNBQVNWLFVBQVQsQ0FBb0JVLE9BQXBCLEVBQTZCO0FBQzNCLFNBQU9BLFFBQVFPLE1BQVIsQ0FBZSxVQUFTQyxJQUFULEVBQWVKLE1BQWYsRUFBdUI7QUFDM0MsV0FBT0ksUUFBUUosT0FBTyxDQUFQLE1BQWMsR0FBN0I7QUFDRCxHQUZNLEVBRUosSUFGSSxDQUFQO0FBR0Q7QUFDRCxTQUFTYixrQkFBVCxDQUE0Qk0sS0FBNUIsRUFBbUNZLGFBQW5DLEVBQWtEQyxLQUFsRCxFQUF5RDtBQUN2RCxPQUFLLElBQUlDLElBQUksQ0FBYixFQUFnQkEsSUFBSUQsS0FBcEIsRUFBMkJDLEdBQTNCLEVBQWdDO0FBQzlCLFFBQUlDLGdCQUFnQkgsY0FBY0EsY0FBY25ELE1BQWQsR0FBdUJvRCxLQUF2QixHQUErQkMsQ0FBN0MsRUFBZ0RMLE1BQWhELENBQXVELENBQXZELENBQXBCO0FBQ0EsUUFBSVQsTUFBTTVELEtBQU4sQ0FBWTRELE1BQU1uRCxLQUFOLEdBQWNpRSxDQUExQixNQUFpQyxNQUFNQyxhQUEzQyxFQUEwRDtBQUN4RCxhQUFPLEtBQVA7QUFDRDtBQUNGOztBQUVEZixRQUFNbkQsS0FBTixJQUFlZ0UsS0FBZjtBQUNBLFNBQU8sSUFBUDtBQUNEOztBQUVELFNBQVMxRSxtQkFBVCxDQUE2QkMsS0FBN0IsRUFBb0M7QUFDbEMsTUFBSUMsV0FBVyxDQUFmO0FBQ0EsTUFBSUMsV0FBVyxDQUFmOztBQUVBRixRQUFNNEUsT0FBTixDQUFjLFVBQVNqQixJQUFULEVBQWU7QUFDM0IsUUFBSSxPQUFPQSxJQUFQLEtBQWdCLFFBQXBCLEVBQThCO0FBQzVCLFVBQUlrQixVQUFVOUUsb0JBQW9CNEQsS0FBS3ZELElBQXpCLENBQWQ7QUFDQSxVQUFJMEUsYUFBYS9FLG9CQUFvQjRELEtBQUt0RCxNQUF6QixDQUFqQjs7QUFFQSxVQUFJSixhQUFhRSxTQUFqQixFQUE0QjtBQUMxQixZQUFJMEUsUUFBUTVFLFFBQVIsS0FBcUI2RSxXQUFXN0UsUUFBcEMsRUFBOEM7QUFDNUNBLHNCQUFZNEUsUUFBUTVFLFFBQXBCO0FBQ0QsU0FGRCxNQUVPO0FBQ0xBLHFCQUFXRSxTQUFYO0FBQ0Q7QUFDRjs7QUFFRCxVQUFJRCxhQUFhQyxTQUFqQixFQUE0QjtBQUMxQixZQUFJMEUsUUFBUTNFLFFBQVIsS0FBcUI0RSxXQUFXNUUsUUFBcEMsRUFBOEM7QUFDNUNBLHNCQUFZMkUsUUFBUTNFLFFBQXBCO0FBQ0QsU0FGRCxNQUVPO0FBQ0xBLHFCQUFXQyxTQUFYO0FBQ0Q7QUFDRjtBQUNGLEtBbkJELE1BbUJPO0FBQ0wsVUFBSUQsYUFBYUMsU0FBYixLQUEyQndELEtBQUssQ0FBTCxNQUFZLEdBQVosSUFBbUJBLEtBQUssQ0FBTCxNQUFZLEdBQTFELENBQUosRUFBb0U7QUFDbEV6RDtBQUNEO0FBQ0QsVUFBSUQsYUFBYUUsU0FBYixLQUEyQndELEtBQUssQ0FBTCxNQUFZLEdBQVosSUFBbUJBLEtBQUssQ0FBTCxNQUFZLEdBQTFELENBQUosRUFBb0U7QUFDbEUxRDtBQUNEO0FBQ0Y7QUFDRixHQTVCRDs7QUE4QkEsU0FBTyxFQUFDQSxrQkFBRCxFQUFXQyxrQkFBWCxFQUFQO0FBQ0QiLCJmaWxlIjoibWVyZ2UuanMiLCJzb3VyY2VzQ29udGVudCI6WyJpbXBvcnQge3N0cnVjdHVyZWRQYXRjaH0gZnJvbSAnLi9jcmVhdGUnO1xuaW1wb3J0IHtwYXJzZVBhdGNofSBmcm9tICcuL3BhcnNlJztcblxuaW1wb3J0IHthcnJheUVxdWFsLCBhcnJheVN0YXJ0c1dpdGh9IGZyb20gJy4uL3V0aWwvYXJyYXknO1xuXG5leHBvcnQgZnVuY3Rpb24gY2FsY0xpbmVDb3VudChodW5rKSB7XG4gIGNvbnN0IHtvbGRMaW5lcywgbmV3TGluZXN9ID0gY2FsY09sZE5ld0xpbmVDb3VudChodW5rLmxpbmVzKTtcblxuICBpZiAob2xkTGluZXMgIT09IHVuZGVmaW5lZCkge1xuICAgIGh1bmsub2xkTGluZXMgPSBvbGRMaW5lcztcbiAgfSBlbHNlIHtcbiAgICBkZWxldGUgaHVuay5vbGRMaW5lcztcbiAgfVxuXG4gIGlmIChuZXdMaW5lcyAhPT0gdW5kZWZpbmVkKSB7XG4gICAgaHVuay5uZXdMaW5lcyA9IG5ld0xpbmVzO1xuICB9IGVsc2Uge1xuICAgIGRlbGV0ZSBodW5rLm5ld0xpbmVzO1xuICB9XG59XG5cbmV4cG9ydCBmdW5jdGlvbiBtZXJnZShtaW5lLCB0aGVpcnMsIGJhc2UpIHtcbiAgbWluZSA9IGxvYWRQYXRjaChtaW5lLCBiYXNlKTtcbiAgdGhlaXJzID0gbG9hZFBhdGNoKHRoZWlycywgYmFzZSk7XG5cbiAgbGV0IHJldCA9IHt9O1xuXG4gIC8vIEZvciBpbmRleCB3ZSBqdXN0IGxldCBpdCBwYXNzIHRocm91Z2ggYXMgaXQgZG9lc24ndCBoYXZlIGFueSBuZWNlc3NhcnkgbWVhbmluZy5cbiAgLy8gTGVhdmluZyBzYW5pdHkgY2hlY2tzIG9uIHRoaXMgdG8gdGhlIEFQSSBjb25zdW1lciB0aGF0IG1heSBrbm93IG1vcmUgYWJvdXQgdGhlXG4gIC8vIG1lYW5pbmcgaW4gdGhlaXIgb3duIGNvbnRleHQuXG4gIGlmIChtaW5lLmluZGV4IHx8IHRoZWlycy5pbmRleCkge1xuICAgIHJldC5pbmRleCA9IG1pbmUuaW5kZXggfHwgdGhlaXJzLmluZGV4O1xuICB9XG5cbiAgaWYgKG1pbmUubmV3RmlsZU5hbWUgfHwgdGhlaXJzLm5ld0ZpbGVOYW1lKSB7XG4gICAgaWYgKCFmaWxlTmFtZUNoYW5nZWQobWluZSkpIHtcbiAgICAgIC8vIE5vIGhlYWRlciBvciBubyBjaGFuZ2UgaW4gb3VycywgdXNlIHRoZWlycyAoYW5kIG91cnMgaWYgdGhlaXJzIGRvZXMgbm90IGV4aXN0KVxuICAgICAgcmV0Lm9sZEZpbGVOYW1lID0gdGhlaXJzLm9sZEZpbGVOYW1lIHx8IG1pbmUub2xkRmlsZU5hbWU7XG4gICAgICByZXQubmV3RmlsZU5hbWUgPSB0aGVpcnMubmV3RmlsZU5hbWUgfHwgbWluZS5uZXdGaWxlTmFtZTtcbiAgICAgIHJldC5vbGRIZWFkZXIgPSB0aGVpcnMub2xkSGVhZGVyIHx8IG1pbmUub2xkSGVhZGVyO1xuICAgICAgcmV0Lm5ld0hlYWRlciA9IHRoZWlycy5uZXdIZWFkZXIgfHwgbWluZS5uZXdIZWFkZXI7XG4gICAgfSBlbHNlIGlmICghZmlsZU5hbWVDaGFuZ2VkKHRoZWlycykpIHtcbiAgICAgIC8vIE5vIGhlYWRlciBvciBubyBjaGFuZ2UgaW4gdGhlaXJzLCB1c2Ugb3Vyc1xuICAgICAgcmV0Lm9sZEZpbGVOYW1lID0gbWluZS5vbGRGaWxlTmFtZTtcbiAgICAgIHJldC5uZXdGaWxlTmFtZSA9IG1pbmUubmV3RmlsZU5hbWU7XG4gICAgICByZXQub2xkSGVhZGVyID0gbWluZS5vbGRIZWFkZXI7XG4gICAgICByZXQubmV3SGVhZGVyID0gbWluZS5uZXdIZWFkZXI7XG4gICAgfSBlbHNlIHtcbiAgICAgIC8vIEJvdGggY2hhbmdlZC4uLiBmaWd1cmUgaXQgb3V0XG4gICAgICByZXQub2xkRmlsZU5hbWUgPSBzZWxlY3RGaWVsZChyZXQsIG1pbmUub2xkRmlsZU5hbWUsIHRoZWlycy5vbGRGaWxlTmFtZSk7XG4gICAgICByZXQubmV3RmlsZU5hbWUgPSBzZWxlY3RGaWVsZChyZXQsIG1pbmUubmV3RmlsZU5hbWUsIHRoZWlycy5uZXdGaWxlTmFtZSk7XG4gICAgICByZXQub2xkSGVhZGVyID0gc2VsZWN0RmllbGQocmV0LCBtaW5lLm9sZEhlYWRlciwgdGhlaXJzLm9sZEhlYWRlcik7XG4gICAgICByZXQubmV3SGVhZGVyID0gc2VsZWN0RmllbGQocmV0LCBtaW5lLm5ld0hlYWRlciwgdGhlaXJzLm5ld0hlYWRlcik7XG4gICAgfVxuICB9XG5cbiAgcmV0Lmh1bmtzID0gW107XG5cbiAgbGV0IG1pbmVJbmRleCA9IDAsXG4gICAgICB0aGVpcnNJbmRleCA9IDAsXG4gICAgICBtaW5lT2Zmc2V0ID0gMCxcbiAgICAgIHRoZWlyc09mZnNldCA9IDA7XG5cbiAgd2hpbGUgKG1pbmVJbmRleCA8IG1pbmUuaHVua3MubGVuZ3RoIHx8IHRoZWlyc0luZGV4IDwgdGhlaXJzLmh1bmtzLmxlbmd0aCkge1xuICAgIGxldCBtaW5lQ3VycmVudCA9IG1pbmUuaHVua3NbbWluZUluZGV4XSB8fCB7b2xkU3RhcnQ6IEluZmluaXR5fSxcbiAgICAgICAgdGhlaXJzQ3VycmVudCA9IHRoZWlycy5odW5rc1t0aGVpcnNJbmRleF0gfHwge29sZFN0YXJ0OiBJbmZpbml0eX07XG5cbiAgICBpZiAoaHVua0JlZm9yZShtaW5lQ3VycmVudCwgdGhlaXJzQ3VycmVudCkpIHtcbiAgICAgIC8vIFRoaXMgcGF0Y2ggZG9lcyBub3Qgb3ZlcmxhcCB3aXRoIGFueSBvZiB0aGUgb3RoZXJzLCB5YXkuXG4gICAgICByZXQuaHVua3MucHVzaChjbG9uZUh1bmsobWluZUN1cnJlbnQsIG1pbmVPZmZzZXQpKTtcbiAgICAgIG1pbmVJbmRleCsrO1xuICAgICAgdGhlaXJzT2Zmc2V0ICs9IG1pbmVDdXJyZW50Lm5ld0xpbmVzIC0gbWluZUN1cnJlbnQub2xkTGluZXM7XG4gICAgfSBlbHNlIGlmIChodW5rQmVmb3JlKHRoZWlyc0N1cnJlbnQsIG1pbmVDdXJyZW50KSkge1xuICAgICAgLy8gVGhpcyBwYXRjaCBkb2VzIG5vdCBvdmVybGFwIHdpdGggYW55IG9mIHRoZSBvdGhlcnMsIHlheS5cbiAgICAgIHJldC5odW5rcy5wdXNoKGNsb25lSHVuayh0aGVpcnNDdXJyZW50LCB0aGVpcnNPZmZzZXQpKTtcbiAgICAgIHRoZWlyc0luZGV4Kys7XG4gICAgICBtaW5lT2Zmc2V0ICs9IHRoZWlyc0N1cnJlbnQubmV3TGluZXMgLSB0aGVpcnNDdXJyZW50Lm9sZExpbmVzO1xuICAgIH0gZWxzZSB7XG4gICAgICAvLyBPdmVybGFwLCBtZXJnZSBhcyBiZXN0IHdlIGNhblxuICAgICAgbGV0IG1lcmdlZEh1bmsgPSB7XG4gICAgICAgIG9sZFN0YXJ0OiBNYXRoLm1pbihtaW5lQ3VycmVudC5vbGRTdGFydCwgdGhlaXJzQ3VycmVudC5vbGRTdGFydCksXG4gICAgICAgIG9sZExpbmVzOiAwLFxuICAgICAgICBuZXdTdGFydDogTWF0aC5taW4obWluZUN1cnJlbnQubmV3U3RhcnQgKyBtaW5lT2Zmc2V0LCB0aGVpcnNDdXJyZW50Lm9sZFN0YXJ0ICsgdGhlaXJzT2Zmc2V0KSxcbiAgICAgICAgbmV3TGluZXM6IDAsXG4gICAgICAgIGxpbmVzOiBbXVxuICAgICAgfTtcbiAgICAgIG1lcmdlTGluZXMobWVyZ2VkSHVuaywgbWluZUN1cnJlbnQub2xkU3RhcnQsIG1pbmVDdXJyZW50LmxpbmVzLCB0aGVpcnNDdXJyZW50Lm9sZFN0YXJ0LCB0aGVpcnNDdXJyZW50LmxpbmVzKTtcbiAgICAgIHRoZWlyc0luZGV4Kys7XG4gICAgICBtaW5lSW5kZXgrKztcblxuICAgICAgcmV0Lmh1bmtzLnB1c2gobWVyZ2VkSHVuayk7XG4gICAgfVxuICB9XG5cbiAgcmV0dXJuIHJldDtcbn1cblxuZnVuY3Rpb24gbG9hZFBhdGNoKHBhcmFtLCBiYXNlKSB7XG4gIGlmICh0eXBlb2YgcGFyYW0gPT09ICdzdHJpbmcnKSB7XG4gICAgaWYgKC9eQEAvbS50ZXN0KHBhcmFtKSB8fCAoL15JbmRleDovbS50ZXN0KHBhcmFtKSkpIHtcbiAgICAgIHJldHVybiBwYXJzZVBhdGNoKHBhcmFtKVswXTtcbiAgICB9XG5cbiAgICBpZiAoIWJhc2UpIHtcbiAgICAgIHRocm93IG5ldyBFcnJvcignTXVzdCBwcm92aWRlIGEgYmFzZSByZWZlcmVuY2Ugb3IgcGFzcyBpbiBhIHBhdGNoJyk7XG4gICAgfVxuICAgIHJldHVybiBzdHJ1Y3R1cmVkUGF0Y2godW5kZWZpbmVkLCB1bmRlZmluZWQsIGJhc2UsIHBhcmFtKTtcbiAgfVxuXG4gIHJldHVybiBwYXJhbTtcbn1cblxuZnVuY3Rpb24gZmlsZU5hbWVDaGFuZ2VkKHBhdGNoKSB7XG4gIHJldHVybiBwYXRjaC5uZXdGaWxlTmFtZSAmJiBwYXRjaC5uZXdGaWxlTmFtZSAhPT0gcGF0Y2gub2xkRmlsZU5hbWU7XG59XG5cbmZ1bmN0aW9uIHNlbGVjdEZpZWxkKGluZGV4LCBtaW5lLCB0aGVpcnMpIHtcbiAgaWYgKG1pbmUgPT09IHRoZWlycykge1xuICAgIHJldHVybiBtaW5lO1xuICB9IGVsc2Uge1xuICAgIGluZGV4LmNvbmZsaWN0ID0gdHJ1ZTtcbiAgICByZXR1cm4ge21pbmUsIHRoZWlyc307XG4gIH1cbn1cblxuZnVuY3Rpb24gaHVua0JlZm9yZSh0ZXN0LCBjaGVjaykge1xuICByZXR1cm4gdGVzdC5vbGRTdGFydCA8IGNoZWNrLm9sZFN0YXJ0XG4gICAgJiYgKHRlc3Qub2xkU3RhcnQgKyB0ZXN0Lm9sZExpbmVzKSA8IGNoZWNrLm9sZFN0YXJ0O1xufVxuXG5mdW5jdGlvbiBjbG9uZUh1bmsoaHVuaywgb2Zmc2V0KSB7XG4gIHJldHVybiB7XG4gICAgb2xkU3RhcnQ6IGh1bmsub2xkU3RhcnQsIG9sZExpbmVzOiBodW5rLm9sZExpbmVzLFxuICAgIG5ld1N0YXJ0OiBodW5rLm5ld1N0YXJ0ICsgb2Zmc2V0LCBuZXdMaW5lczogaHVuay5uZXdMaW5lcyxcbiAgICBsaW5lczogaHVuay5saW5lc1xuICB9O1xufVxuXG5mdW5jdGlvbiBtZXJnZUxpbmVzKGh1bmssIG1pbmVPZmZzZXQsIG1pbmVMaW5lcywgdGhlaXJPZmZzZXQsIHRoZWlyTGluZXMpIHtcbiAgLy8gVGhpcyB3aWxsIGdlbmVyYWxseSByZXN1bHQgaW4gYSBjb25mbGljdGVkIGh1bmssIGJ1dCB0aGVyZSBhcmUgY2FzZXMgd2hlcmUgdGhlIGNvbnRleHRcbiAgLy8gaXMgdGhlIG9ubHkgb3ZlcmxhcCB3aGVyZSB3ZSBjYW4gc3VjY2Vzc2Z1bGx5IG1lcmdlIHRoZSBjb250ZW50IGhlcmUuXG4gIGxldCBtaW5lID0ge29mZnNldDogbWluZU9mZnNldCwgbGluZXM6IG1pbmVMaW5lcywgaW5kZXg6IDB9LFxuICAgICAgdGhlaXIgPSB7b2Zmc2V0OiB0aGVpck9mZnNldCwgbGluZXM6IHRoZWlyTGluZXMsIGluZGV4OiAwfTtcblxuICAvLyBIYW5kbGUgYW55IGxlYWRpbmcgY29udGVudFxuICBpbnNlcnRMZWFkaW5nKGh1bmssIG1pbmUsIHRoZWlyKTtcbiAgaW5zZXJ0TGVhZGluZyhodW5rLCB0aGVpciwgbWluZSk7XG5cbiAgLy8gTm93IGluIHRoZSBvdmVybGFwIGNvbnRlbnQuIFNjYW4gdGhyb3VnaCBhbmQgc2VsZWN0IHRoZSBiZXN0IGNoYW5nZXMgZnJvbSBlYWNoLlxuICB3aGlsZSAobWluZS5pbmRleCA8IG1pbmUubGluZXMubGVuZ3RoICYmIHRoZWlyLmluZGV4IDwgdGhlaXIubGluZXMubGVuZ3RoKSB7XG4gICAgbGV0IG1pbmVDdXJyZW50ID0gbWluZS5saW5lc1ttaW5lLmluZGV4XSxcbiAgICAgICAgdGhlaXJDdXJyZW50ID0gdGhlaXIubGluZXNbdGhlaXIuaW5kZXhdO1xuXG4gICAgaWYgKChtaW5lQ3VycmVudFswXSA9PT0gJy0nIHx8IG1pbmVDdXJyZW50WzBdID09PSAnKycpXG4gICAgICAgICYmICh0aGVpckN1cnJlbnRbMF0gPT09ICctJyB8fCB0aGVpckN1cnJlbnRbMF0gPT09ICcrJykpIHtcbiAgICAgIC8vIEJvdGggbW9kaWZpZWQgLi4uXG4gICAgICBtdXR1YWxDaGFuZ2UoaHVuaywgbWluZSwgdGhlaXIpO1xuICAgIH0gZWxzZSBpZiAobWluZUN1cnJlbnRbMF0gPT09ICcrJyAmJiB0aGVpckN1cnJlbnRbMF0gPT09ICcgJykge1xuICAgICAgLy8gTWluZSBpbnNlcnRlZFxuICAgICAgaHVuay5saW5lcy5wdXNoKC4uLiBjb2xsZWN0Q2hhbmdlKG1pbmUpKTtcbiAgICB9IGVsc2UgaWYgKHRoZWlyQ3VycmVudFswXSA9PT0gJysnICYmIG1pbmVDdXJyZW50WzBdID09PSAnICcpIHtcbiAgICAgIC8vIFRoZWlycyBpbnNlcnRlZFxuICAgICAgaHVuay5saW5lcy5wdXNoKC4uLiBjb2xsZWN0Q2hhbmdlKHRoZWlyKSk7XG4gICAgfSBlbHNlIGlmIChtaW5lQ3VycmVudFswXSA9PT0gJy0nICYmIHRoZWlyQ3VycmVudFswXSA9PT0gJyAnKSB7XG4gICAgICAvLyBNaW5lIHJlbW92ZWQgb3IgZWRpdGVkXG4gICAgICByZW1vdmFsKGh1bmssIG1pbmUsIHRoZWlyKTtcbiAgICB9IGVsc2UgaWYgKHRoZWlyQ3VycmVudFswXSA9PT0gJy0nICYmIG1pbmVDdXJyZW50WzBdID09PSAnICcpIHtcbiAgICAgIC8vIFRoZWlyIHJlbW92ZWQgb3IgZWRpdGVkXG4gICAgICByZW1vdmFsKGh1bmssIHRoZWlyLCBtaW5lLCB0cnVlKTtcbiAgICB9IGVsc2UgaWYgKG1pbmVDdXJyZW50ID09PSB0aGVpckN1cnJlbnQpIHtcbiAgICAgIC8vIENvbnRleHQgaWRlbnRpdHlcbiAgICAgIGh1bmsubGluZXMucHVzaChtaW5lQ3VycmVudCk7XG4gICAgICBtaW5lLmluZGV4Kys7XG4gICAgICB0aGVpci5pbmRleCsrO1xuICAgIH0gZWxzZSB7XG4gICAgICAvLyBDb250ZXh0IG1pc21hdGNoXG4gICAgICBjb25mbGljdChodW5rLCBjb2xsZWN0Q2hhbmdlKG1pbmUpLCBjb2xsZWN0Q2hhbmdlKHRoZWlyKSk7XG4gICAgfVxuICB9XG5cbiAgLy8gTm93IHB1c2ggYW55dGhpbmcgdGhhdCBtYXkgYmUgcmVtYWluaW5nXG4gIGluc2VydFRyYWlsaW5nKGh1bmssIG1pbmUpO1xuICBpbnNlcnRUcmFpbGluZyhodW5rLCB0aGVpcik7XG5cbiAgY2FsY0xpbmVDb3VudChodW5rKTtcbn1cblxuZnVuY3Rpb24gbXV0dWFsQ2hhbmdlKGh1bmssIG1pbmUsIHRoZWlyKSB7XG4gIGxldCBteUNoYW5nZXMgPSBjb2xsZWN0Q2hhbmdlKG1pbmUpLFxuICAgICAgdGhlaXJDaGFuZ2VzID0gY29sbGVjdENoYW5nZSh0aGVpcik7XG5cbiAgaWYgKGFsbFJlbW92ZXMobXlDaGFuZ2VzKSAmJiBhbGxSZW1vdmVzKHRoZWlyQ2hhbmdlcykpIHtcbiAgICAvLyBTcGVjaWFsIGNhc2UgZm9yIHJlbW92ZSBjaGFuZ2VzIHRoYXQgYXJlIHN1cGVyc2V0cyBvZiBvbmUgYW5vdGhlclxuICAgIGlmIChhcnJheVN0YXJ0c1dpdGgobXlDaGFuZ2VzLCB0aGVpckNoYW5nZXMpXG4gICAgICAgICYmIHNraXBSZW1vdmVTdXBlcnNldCh0aGVpciwgbXlDaGFuZ2VzLCBteUNoYW5nZXMubGVuZ3RoIC0gdGhlaXJDaGFuZ2VzLmxlbmd0aCkpIHtcbiAgICAgIGh1bmsubGluZXMucHVzaCguLi4gbXlDaGFuZ2VzKTtcbiAgICAgIHJldHVybjtcbiAgICB9IGVsc2UgaWYgKGFycmF5U3RhcnRzV2l0aCh0aGVpckNoYW5nZXMsIG15Q2hhbmdlcylcbiAgICAgICAgJiYgc2tpcFJlbW92ZVN1cGVyc2V0KG1pbmUsIHRoZWlyQ2hhbmdlcywgdGhlaXJDaGFuZ2VzLmxlbmd0aCAtIG15Q2hhbmdlcy5sZW5ndGgpKSB7XG4gICAgICBodW5rLmxpbmVzLnB1c2goLi4uIHRoZWlyQ2hhbmdlcyk7XG4gICAgICByZXR1cm47XG4gICAgfVxuICB9IGVsc2UgaWYgKGFycmF5RXF1YWwobXlDaGFuZ2VzLCB0aGVpckNoYW5nZXMpKSB7XG4gICAgaHVuay5saW5lcy5wdXNoKC4uLiBteUNoYW5nZXMpO1xuICAgIHJldHVybjtcbiAgfVxuXG4gIGNvbmZsaWN0KGh1bmssIG15Q2hhbmdlcywgdGhlaXJDaGFuZ2VzKTtcbn1cblxuZnVuY3Rpb24gcmVtb3ZhbChodW5rLCBtaW5lLCB0aGVpciwgc3dhcCkge1xuICBsZXQgbXlDaGFuZ2VzID0gY29sbGVjdENoYW5nZShtaW5lKSxcbiAgICAgIHRoZWlyQ2hhbmdlcyA9IGNvbGxlY3RDb250ZXh0KHRoZWlyLCBteUNoYW5nZXMpO1xuICBpZiAodGhlaXJDaGFuZ2VzLm1lcmdlZCkge1xuICAgIGh1bmsubGluZXMucHVzaCguLi4gdGhlaXJDaGFuZ2VzLm1lcmdlZCk7XG4gIH0gZWxzZSB7XG4gICAgY29uZmxpY3QoaHVuaywgc3dhcCA/IHRoZWlyQ2hhbmdlcyA6IG15Q2hhbmdlcywgc3dhcCA/IG15Q2hhbmdlcyA6IHRoZWlyQ2hhbmdlcyk7XG4gIH1cbn1cblxuZnVuY3Rpb24gY29uZmxpY3QoaHVuaywgbWluZSwgdGhlaXIpIHtcbiAgaHVuay5jb25mbGljdCA9IHRydWU7XG4gIGh1bmsubGluZXMucHVzaCh7XG4gICAgY29uZmxpY3Q6IHRydWUsXG4gICAgbWluZTogbWluZSxcbiAgICB0aGVpcnM6IHRoZWlyXG4gIH0pO1xufVxuXG5mdW5jdGlvbiBpbnNlcnRMZWFkaW5nKGh1bmssIGluc2VydCwgdGhlaXIpIHtcbiAgd2hpbGUgKGluc2VydC5vZmZzZXQgPCB0aGVpci5vZmZzZXQgJiYgaW5zZXJ0LmluZGV4IDwgaW5zZXJ0LmxpbmVzLmxlbmd0aCkge1xuICAgIGxldCBsaW5lID0gaW5zZXJ0LmxpbmVzW2luc2VydC5pbmRleCsrXTtcbiAgICBodW5rLmxpbmVzLnB1c2gobGluZSk7XG4gICAgaW5zZXJ0Lm9mZnNldCsrO1xuICB9XG59XG5mdW5jdGlvbiBpbnNlcnRUcmFpbGluZyhodW5rLCBpbnNlcnQpIHtcbiAgd2hpbGUgKGluc2VydC5pbmRleCA8IGluc2VydC5saW5lcy5sZW5ndGgpIHtcbiAgICBsZXQgbGluZSA9IGluc2VydC5saW5lc1tpbnNlcnQuaW5kZXgrK107XG4gICAgaHVuay5saW5lcy5wdXNoKGxpbmUpO1xuICB9XG59XG5cbmZ1bmN0aW9uIGNvbGxlY3RDaGFuZ2Uoc3RhdGUpIHtcbiAgbGV0IHJldCA9IFtdLFxuICAgICAgb3BlcmF0aW9uID0gc3RhdGUubGluZXNbc3RhdGUuaW5kZXhdWzBdO1xuICB3aGlsZSAoc3RhdGUuaW5kZXggPCBzdGF0ZS5saW5lcy5sZW5ndGgpIHtcbiAgICBsZXQgbGluZSA9IHN0YXRlLmxpbmVzW3N0YXRlLmluZGV4XTtcblxuICAgIC8vIEdyb3VwIGFkZGl0aW9ucyB0aGF0IGFyZSBpbW1lZGlhdGVseSBhZnRlciBzdWJ0cmFjdGlvbnMgYW5kIHRyZWF0IHRoZW0gYXMgb25lIFwiYXRvbWljXCIgbW9kaWZ5IGNoYW5nZS5cbiAgICBpZiAob3BlcmF0aW9uID09PSAnLScgJiYgbGluZVswXSA9PT0gJysnKSB7XG4gICAgICBvcGVyYXRpb24gPSAnKyc7XG4gICAgfVxuXG4gICAgaWYgKG9wZXJhdGlvbiA9PT0gbGluZVswXSkge1xuICAgICAgcmV0LnB1c2gobGluZSk7XG4gICAgICBzdGF0ZS5pbmRleCsrO1xuICAgIH0gZWxzZSB7XG4gICAgICBicmVhaztcbiAgICB9XG4gIH1cblxuICByZXR1cm4gcmV0O1xufVxuZnVuY3Rpb24gY29sbGVjdENvbnRleHQoc3RhdGUsIG1hdGNoQ2hhbmdlcykge1xuICBsZXQgY2hhbmdlcyA9IFtdLFxuICAgICAgbWVyZ2VkID0gW10sXG4gICAgICBtYXRjaEluZGV4ID0gMCxcbiAgICAgIGNvbnRleHRDaGFuZ2VzID0gZmFsc2UsXG4gICAgICBjb25mbGljdGVkID0gZmFsc2U7XG4gIHdoaWxlIChtYXRjaEluZGV4IDwgbWF0Y2hDaGFuZ2VzLmxlbmd0aFxuICAgICAgICAmJiBzdGF0ZS5pbmRleCA8IHN0YXRlLmxpbmVzLmxlbmd0aCkge1xuICAgIGxldCBjaGFuZ2UgPSBzdGF0ZS5saW5lc1tzdGF0ZS5pbmRleF0sXG4gICAgICAgIG1hdGNoID0gbWF0Y2hDaGFuZ2VzW21hdGNoSW5kZXhdO1xuXG4gICAgLy8gT25jZSB3ZSd2ZSBoaXQgb3VyIGFkZCwgdGhlbiB3ZSBhcmUgZG9uZVxuICAgIGlmIChtYXRjaFswXSA9PT0gJysnKSB7XG4gICAgICBicmVhaztcbiAgICB9XG5cbiAgICBjb250ZXh0Q2hhbmdlcyA9IGNvbnRleHRDaGFuZ2VzIHx8IGNoYW5nZVswXSAhPT0gJyAnO1xuXG4gICAgbWVyZ2VkLnB1c2gobWF0Y2gpO1xuICAgIG1hdGNoSW5kZXgrKztcblxuICAgIC8vIENvbnN1bWUgYW55IGFkZGl0aW9ucyBpbiB0aGUgb3RoZXIgYmxvY2sgYXMgYSBjb25mbGljdCB0byBhdHRlbXB0XG4gICAgLy8gdG8gcHVsbCBpbiB0aGUgcmVtYWluaW5nIGNvbnRleHQgYWZ0ZXIgdGhpc1xuICAgIGlmIChjaGFuZ2VbMF0gPT09ICcrJykge1xuICAgICAgY29uZmxpY3RlZCA9IHRydWU7XG5cbiAgICAgIHdoaWxlIChjaGFuZ2VbMF0gPT09ICcrJykge1xuICAgICAgICBjaGFuZ2VzLnB1c2goY2hhbmdlKTtcbiAgICAgICAgY2hhbmdlID0gc3RhdGUubGluZXNbKytzdGF0ZS5pbmRleF07XG4gICAgICB9XG4gICAgfVxuXG4gICAgaWYgKG1hdGNoLnN1YnN0cigxKSA9PT0gY2hhbmdlLnN1YnN0cigxKSkge1xuICAgICAgY2hhbmdlcy5wdXNoKGNoYW5nZSk7XG4gICAgICBzdGF0ZS5pbmRleCsrO1xuICAgIH0gZWxzZSB7XG4gICAgICBjb25mbGljdGVkID0gdHJ1ZTtcbiAgICB9XG4gIH1cblxuICBpZiAoKG1hdGNoQ2hhbmdlc1ttYXRjaEluZGV4XSB8fCAnJylbMF0gPT09ICcrJ1xuICAgICAgJiYgY29udGV4dENoYW5nZXMpIHtcbiAgICBjb25mbGljdGVkID0gdHJ1ZTtcbiAgfVxuXG4gIGlmIChjb25mbGljdGVkKSB7XG4gICAgcmV0dXJuIGNoYW5nZXM7XG4gIH1cblxuICB3aGlsZSAobWF0Y2hJbmRleCA8IG1hdGNoQ2hhbmdlcy5sZW5ndGgpIHtcbiAgICBtZXJnZWQucHVzaChtYXRjaENoYW5nZXNbbWF0Y2hJbmRleCsrXSk7XG4gIH1cblxuICByZXR1cm4ge1xuICAgIG1lcmdlZCxcbiAgICBjaGFuZ2VzXG4gIH07XG59XG5cbmZ1bmN0aW9uIGFsbFJlbW92ZXMoY2hhbmdlcykge1xuICByZXR1cm4gY2hhbmdlcy5yZWR1Y2UoZnVuY3Rpb24ocHJldiwgY2hhbmdlKSB7XG4gICAgcmV0dXJuIHByZXYgJiYgY2hhbmdlWzBdID09PSAnLSc7XG4gIH0sIHRydWUpO1xufVxuZnVuY3Rpb24gc2tpcFJlbW92ZVN1cGVyc2V0KHN0YXRlLCByZW1vdmVDaGFuZ2VzLCBkZWx0YSkge1xuICBmb3IgKGxldCBpID0gMDsgaSA8IGRlbHRhOyBpKyspIHtcbiAgICBsZXQgY2hhbmdlQ29udGVudCA9IHJlbW92ZUNoYW5nZXNbcmVtb3ZlQ2hhbmdlcy5sZW5ndGggLSBkZWx0YSArIGldLnN1YnN0cigxKTtcbiAgICBpZiAoc3RhdGUubGluZXNbc3RhdGUuaW5kZXggKyBpXSAhPT0gJyAnICsgY2hhbmdlQ29udGVudCkge1xuICAgICAgcmV0dXJuIGZhbHNlO1xuICAgIH1cbiAgfVxuXG4gIHN0YXRlLmluZGV4ICs9IGRlbHRhO1xuICByZXR1cm4gdHJ1ZTtcbn1cblxuZnVuY3Rpb24gY2FsY09sZE5ld0xpbmVDb3VudChsaW5lcykge1xuICBsZXQgb2xkTGluZXMgPSAwO1xuICBsZXQgbmV3TGluZXMgPSAwO1xuXG4gIGxpbmVzLmZvckVhY2goZnVuY3Rpb24obGluZSkge1xuICAgIGlmICh0eXBlb2YgbGluZSAhPT0gJ3N0cmluZycpIHtcbiAgICAgIGxldCBteUNvdW50ID0gY2FsY09sZE5ld0xpbmVDb3VudChsaW5lLm1pbmUpO1xuICAgICAgbGV0IHRoZWlyQ291bnQgPSBjYWxjT2xkTmV3TGluZUNvdW50KGxpbmUudGhlaXJzKTtcblxuICAgICAgaWYgKG9sZExpbmVzICE9PSB1bmRlZmluZWQpIHtcbiAgICAgICAgaWYgKG15Q291bnQub2xkTGluZXMgPT09IHRoZWlyQ291bnQub2xkTGluZXMpIHtcbiAgICAgICAgICBvbGRMaW5lcyArPSBteUNvdW50Lm9sZExpbmVzO1xuICAgICAgICB9IGVsc2Uge1xuICAgICAgICAgIG9sZExpbmVzID0gdW5kZWZpbmVkO1xuICAgICAgICB9XG4gICAgICB9XG5cbiAgICAgIGlmIChuZXdMaW5lcyAhPT0gdW5kZWZpbmVkKSB7XG4gICAgICAgIGlmIChteUNvdW50Lm5ld0xpbmVzID09PSB0aGVpckNvdW50Lm5ld0xpbmVzKSB7XG4gICAgICAgICAgbmV3TGluZXMgKz0gbXlDb3VudC5uZXdMaW5lcztcbiAgICAgICAgfSBlbHNlIHtcbiAgICAgICAgICBuZXdMaW5lcyA9IHVuZGVmaW5lZDtcbiAgICAgICAgfVxuICAgICAgfVxuICAgIH0gZWxzZSB7XG4gICAgICBpZiAobmV3TGluZXMgIT09IHVuZGVmaW5lZCAmJiAobGluZVswXSA9PT0gJysnIHx8IGxpbmVbMF0gPT09ICcgJykpIHtcbiAgICAgICAgbmV3TGluZXMrKztcbiAgICAgIH1cbiAgICAgIGlmIChvbGRMaW5lcyAhPT0gdW5kZWZpbmVkICYmIChsaW5lWzBdID09PSAnLScgfHwgbGluZVswXSA9PT0gJyAnKSkge1xuICAgICAgICBvbGRMaW5lcysrO1xuICAgICAgfVxuICAgIH1cbiAgfSk7XG5cbiAgcmV0dXJuIHtvbGRMaW5lcywgbmV3TGluZXN9O1xufVxuIl19
diff --git a/node_modules/diff/lib/patch/parse.js b/node_modules/diff/lib/patch/parse.js
new file mode 100644
index 0000000..e5f1730
--- /dev/null
+++ b/node_modules/diff/lib/patch/parse.js
@@ -0,0 +1,147 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports. /*istanbul ignore end*/parsePatch = parsePatch;
+function parsePatch(uniDiff) {
+  /*istanbul ignore start*/var /*istanbul ignore end*/options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
+
+  var diffstr = uniDiff.split(/\r\n|[\n\v\f\r\x85]/),
+      delimiters = uniDiff.match(/\r\n|[\n\v\f\r\x85]/g) || [],
+      list = [],
+      i = 0;
+
+  function parseIndex() {
+    var index = {};
+    list.push(index);
+
+    // Parse diff metadata
+    while (i < diffstr.length) {
+      var line = diffstr[i];
+
+      // File header found, end parsing diff metadata
+      if (/^(\-\-\-|\+\+\+|@@)\s/.test(line)) {
+        break;
+      }
+
+      // Diff index
+      var header = /^(?:Index:|diff(?: -r \w+)+)\s+(.+?)\s*$/.exec(line);
+      if (header) {
+        index.index = header[1];
+      }
+
+      i++;
+    }
+
+    // Parse file headers if they are defined. Unified diff requires them, but
+    // there's no technical issues to have an isolated hunk without file header
+    parseFileHeader(index);
+    parseFileHeader(index);
+
+    // Parse hunks
+    index.hunks = [];
+
+    while (i < diffstr.length) {
+      var _line = diffstr[i];
+
+      if (/^(Index:|diff|\-\-\-|\+\+\+)\s/.test(_line)) {
+        break;
+      } else if (/^@@/.test(_line)) {
+        index.hunks.push(parseHunk());
+      } else if (_line && options.strict) {
+        // Ignore unexpected content unless in strict mode
+        throw new Error('Unknown line ' + (i + 1) + ' ' + JSON.stringify(_line));
+      } else {
+        i++;
+      }
+    }
+  }
+
+  // Parses the --- and +++ headers, if none are found, no lines
+  // are consumed.
+  function parseFileHeader(index) {
+    var fileHeader = /^(---|\+\+\+)\s+(.*)$/.exec(diffstr[i]);
+    if (fileHeader) {
+      var keyPrefix = fileHeader[1] === '---' ? 'old' : 'new';
+      var data = fileHeader[2].split('\t', 2);
+      var fileName = data[0].replace(/\\\\/g, '\\');
+      if (/^".*"$/.test(fileName)) {
+        fileName = fileName.substr(1, fileName.length - 2);
+      }
+      index[keyPrefix + 'FileName'] = fileName;
+      index[keyPrefix + 'Header'] = (data[1] || '').trim();
+
+      i++;
+    }
+  }
+
+  // Parses a hunk
+  // This assumes that we are at the start of a hunk.
+  function parseHunk() {
+    var chunkHeaderIndex = i,
+        chunkHeaderLine = diffstr[i++],
+        chunkHeader = chunkHeaderLine.split(/@@ -(\d+)(?:,(\d+))? \+(\d+)(?:,(\d+))? @@/);
+
+    var hunk = {
+      oldStart: +chunkHeader[1],
+      oldLines: +chunkHeader[2] || 1,
+      newStart: +chunkHeader[3],
+      newLines: +chunkHeader[4] || 1,
+      lines: [],
+      linedelimiters: []
+    };
+
+    var addCount = 0,
+        removeCount = 0;
+    for (; i < diffstr.length; i++) {
+      // Lines starting with '---' could be mistaken for the "remove line" operation
+      // But they could be the header for the next file. Therefore prune such cases out.
+      if (diffstr[i].indexOf('--- ') === 0 && i + 2 < diffstr.length && diffstr[i + 1].indexOf('+++ ') === 0 && diffstr[i + 2].indexOf('@@') === 0) {
+        break;
+      }
+      var operation = diffstr[i].length == 0 && i != diffstr.length - 1 ? ' ' : diffstr[i][0];
+
+      if (operation === '+' || operation === '-' || operation === ' ' || operation === '\\') {
+        hunk.lines.push(diffstr[i]);
+        hunk.linedelimiters.push(delimiters[i] || '\n');
+
+        if (operation === '+') {
+          addCount++;
+        } else if (operation === '-') {
+          removeCount++;
+        } else if (operation === ' ') {
+          addCount++;
+          removeCount++;
+        }
+      } else {
+        break;
+      }
+    }
+
+    // Handle the empty block count case
+    if (!addCount && hunk.newLines === 1) {
+      hunk.newLines = 0;
+    }
+    if (!removeCount && hunk.oldLines === 1) {
+      hunk.oldLines = 0;
+    }
+
+    // Perform optional sanity checking
+    if (options.strict) {
+      if (addCount !== hunk.newLines) {
+        throw new Error('Added line count did not match for hunk at line ' + (chunkHeaderIndex + 1));
+      }
+      if (removeCount !== hunk.oldLines) {
+        throw new Error('Removed line count did not match for hunk at line ' + (chunkHeaderIndex + 1));
+      }
+    }
+
+    return hunk;
+  }
+
+  while (i < diffstr.length) {
+    parseIndex();
+  }
+
+  return list;
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9wYXRjaC9wYXJzZS5qcyJdLCJuYW1lcyI6WyJwYXJzZVBhdGNoIiwidW5pRGlmZiIsIm9wdGlvbnMiLCJkaWZmc3RyIiwic3BsaXQiLCJkZWxpbWl0ZXJzIiwibWF0Y2giLCJsaXN0IiwiaSIsInBhcnNlSW5kZXgiLCJpbmRleCIsInB1c2giLCJsZW5ndGgiLCJsaW5lIiwidGVzdCIsImhlYWRlciIsImV4ZWMiLCJwYXJzZUZpbGVIZWFkZXIiLCJodW5rcyIsInBhcnNlSHVuayIsInN0cmljdCIsIkVycm9yIiwiSlNPTiIsInN0cmluZ2lmeSIsImZpbGVIZWFkZXIiLCJrZXlQcmVmaXgiLCJkYXRhIiwiZmlsZU5hbWUiLCJyZXBsYWNlIiwic3Vic3RyIiwidHJpbSIsImNodW5rSGVhZGVySW5kZXgiLCJjaHVua0hlYWRlckxpbmUiLCJjaHVua0hlYWRlciIsImh1bmsiLCJvbGRTdGFydCIsIm9sZExpbmVzIiwibmV3U3RhcnQiLCJuZXdMaW5lcyIsImxpbmVzIiwibGluZWRlbGltaXRlcnMiLCJhZGRDb3VudCIsInJlbW92ZUNvdW50IiwiaW5kZXhPZiIsIm9wZXJhdGlvbiJdLCJtYXBwaW5ncyI6Ijs7O2dDQUFnQkEsVSxHQUFBQSxVO0FBQVQsU0FBU0EsVUFBVCxDQUFvQkMsT0FBcEIsRUFBMkM7QUFBQSxzREFBZEMsT0FBYyx1RUFBSixFQUFJOztBQUNoRCxNQUFJQyxVQUFVRixRQUFRRyxLQUFSLENBQWMscUJBQWQsQ0FBZDtBQUFBLE1BQ0lDLGFBQWFKLFFBQVFLLEtBQVIsQ0FBYyxzQkFBZCxLQUF5QyxFQUQxRDtBQUFBLE1BRUlDLE9BQU8sRUFGWDtBQUFBLE1BR0lDLElBQUksQ0FIUjs7QUFLQSxXQUFTQyxVQUFULEdBQXNCO0FBQ3BCLFFBQUlDLFFBQVEsRUFBWjtBQUNBSCxTQUFLSSxJQUFMLENBQVVELEtBQVY7O0FBRUE7QUFDQSxXQUFPRixJQUFJTCxRQUFRUyxNQUFuQixFQUEyQjtBQUN6QixVQUFJQyxPQUFPVixRQUFRSyxDQUFSLENBQVg7O0FBRUE7QUFDQSxVQUFJLHdCQUF3Qk0sSUFBeEIsQ0FBNkJELElBQTdCLENBQUosRUFBd0M7QUFDdEM7QUFDRDs7QUFFRDtBQUNBLFVBQUlFLFNBQVUsMENBQUQsQ0FBNkNDLElBQTdDLENBQWtESCxJQUFsRCxDQUFiO0FBQ0EsVUFBSUUsTUFBSixFQUFZO0FBQ1ZMLGNBQU1BLEtBQU4sR0FBY0ssT0FBTyxDQUFQLENBQWQ7QUFDRDs7QUFFRFA7QUFDRDs7QUFFRDtBQUNBO0FBQ0FTLG9CQUFnQlAsS0FBaEI7QUFDQU8sb0JBQWdCUCxLQUFoQjs7QUFFQTtBQUNBQSxVQUFNUSxLQUFOLEdBQWMsRUFBZDs7QUFFQSxXQUFPVixJQUFJTCxRQUFRUyxNQUFuQixFQUEyQjtBQUN6QixVQUFJQyxRQUFPVixRQUFRSyxDQUFSLENBQVg7O0FBRUEsVUFBSSxpQ0FBaUNNLElBQWpDLENBQXNDRCxLQUF0QyxDQUFKLEVBQWlEO0FBQy9DO0FBQ0QsT0FGRCxNQUVPLElBQUksTUFBTUMsSUFBTixDQUFXRCxLQUFYLENBQUosRUFBc0I7QUFDM0JILGNBQU1RLEtBQU4sQ0FBWVAsSUFBWixDQUFpQlEsV0FBakI7QUFDRCxPQUZNLE1BRUEsSUFBSU4sU0FBUVgsUUFBUWtCLE1BQXBCLEVBQTRCO0FBQ2pDO0FBQ0EsY0FBTSxJQUFJQyxLQUFKLENBQVUsbUJBQW1CYixJQUFJLENBQXZCLElBQTRCLEdBQTVCLEdBQWtDYyxLQUFLQyxTQUFMLENBQWVWLEtBQWYsQ0FBNUMsQ0FBTjtBQUNELE9BSE0sTUFHQTtBQUNMTDtBQUNEO0FBQ0Y7QUFDRjs7QUFFRDtBQUNBO0FBQ0EsV0FBU1MsZUFBVCxDQUF5QlAsS0FBekIsRUFBZ0M7QUFDOUIsUUFBTWMsYUFBYyx1QkFBRCxDQUEwQlIsSUFBMUIsQ0FBK0JiLFFBQVFLLENBQVIsQ0FBL0IsQ0FBbkI7QUFDQSxRQUFJZ0IsVUFBSixFQUFnQjtBQUNkLFVBQUlDLFlBQVlELFdBQVcsQ0FBWCxNQUFrQixLQUFsQixHQUEwQixLQUExQixHQUFrQyxLQUFsRDtBQUNBLFVBQU1FLE9BQU9GLFdBQVcsQ0FBWCxFQUFjcEIsS0FBZCxDQUFvQixJQUFwQixFQUEwQixDQUExQixDQUFiO0FBQ0EsVUFBSXVCLFdBQVdELEtBQUssQ0FBTCxFQUFRRSxPQUFSLENBQWdCLE9BQWhCLEVBQXlCLElBQXpCLENBQWY7QUFDQSxVQUFJLFNBQVNkLElBQVQsQ0FBY2EsUUFBZCxDQUFKLEVBQTZCO0FBQzNCQSxtQkFBV0EsU0FBU0UsTUFBVCxDQUFnQixDQUFoQixFQUFtQkYsU0FBU2YsTUFBVCxHQUFrQixDQUFyQyxDQUFYO0FBQ0Q7QUFDREYsWUFBTWUsWUFBWSxVQUFsQixJQUFnQ0UsUUFBaEM7QUFDQWpCLFlBQU1lLFlBQVksUUFBbEIsSUFBOEIsQ0FBQ0MsS0FBSyxDQUFMLEtBQVcsRUFBWixFQUFnQkksSUFBaEIsRUFBOUI7O0FBRUF0QjtBQUNEO0FBQ0Y7O0FBRUQ7QUFDQTtBQUNBLFdBQVNXLFNBQVQsR0FBcUI7QUFDbkIsUUFBSVksbUJBQW1CdkIsQ0FBdkI7QUFBQSxRQUNJd0Isa0JBQWtCN0IsUUFBUUssR0FBUixDQUR0QjtBQUFBLFFBRUl5QixjQUFjRCxnQkFBZ0I1QixLQUFoQixDQUFzQiw0Q0FBdEIsQ0FGbEI7O0FBSUEsUUFBSThCLE9BQU87QUFDVEMsZ0JBQVUsQ0FBQ0YsWUFBWSxDQUFaLENBREY7QUFFVEcsZ0JBQVUsQ0FBQ0gsWUFBWSxDQUFaLENBQUQsSUFBbUIsQ0FGcEI7QUFHVEksZ0JBQVUsQ0FBQ0osWUFBWSxDQUFaLENBSEY7QUFJVEssZ0JBQVUsQ0FBQ0wsWUFBWSxDQUFaLENBQUQsSUFBbUIsQ0FKcEI7QUFLVE0sYUFBTyxFQUxFO0FBTVRDLHNCQUFnQjtBQU5QLEtBQVg7O0FBU0EsUUFBSUMsV0FBVyxDQUFmO0FBQUEsUUFDSUMsY0FBYyxDQURsQjtBQUVBLFdBQU9sQyxJQUFJTCxRQUFRUyxNQUFuQixFQUEyQkosR0FBM0IsRUFBZ0M7QUFDOUI7QUFDQTtBQUNBLFVBQUlMLFFBQVFLLENBQVIsRUFBV21DLE9BQVgsQ0FBbUIsTUFBbkIsTUFBK0IsQ0FBL0IsSUFDTW5DLElBQUksQ0FBSixHQUFRTCxRQUFRUyxNQUR0QixJQUVLVCxRQUFRSyxJQUFJLENBQVosRUFBZW1DLE9BQWYsQ0FBdUIsTUFBdkIsTUFBbUMsQ0FGeEMsSUFHS3hDLFFBQVFLLElBQUksQ0FBWixFQUFlbUMsT0FBZixDQUF1QixJQUF2QixNQUFpQyxDQUgxQyxFQUc2QztBQUN6QztBQUNIO0FBQ0QsVUFBSUMsWUFBYXpDLFFBQVFLLENBQVIsRUFBV0ksTUFBWCxJQUFxQixDQUFyQixJQUEwQkosS0FBTUwsUUFBUVMsTUFBUixHQUFpQixDQUFsRCxHQUF3RCxHQUF4RCxHQUE4RFQsUUFBUUssQ0FBUixFQUFXLENBQVgsQ0FBOUU7O0FBRUEsVUFBSW9DLGNBQWMsR0FBZCxJQUFxQkEsY0FBYyxHQUFuQyxJQUEwQ0EsY0FBYyxHQUF4RCxJQUErREEsY0FBYyxJQUFqRixFQUF1RjtBQUNyRlYsYUFBS0ssS0FBTCxDQUFXNUIsSUFBWCxDQUFnQlIsUUFBUUssQ0FBUixDQUFoQjtBQUNBMEIsYUFBS00sY0FBTCxDQUFvQjdCLElBQXBCLENBQXlCTixXQUFXRyxDQUFYLEtBQWlCLElBQTFDOztBQUVBLFlBQUlvQyxjQUFjLEdBQWxCLEVBQXVCO0FBQ3JCSDtBQUNELFNBRkQsTUFFTyxJQUFJRyxjQUFjLEdBQWxCLEVBQXVCO0FBQzVCRjtBQUNELFNBRk0sTUFFQSxJQUFJRSxjQUFjLEdBQWxCLEVBQXVCO0FBQzVCSDtBQUNBQztBQUNEO0FBQ0YsT0FaRCxNQVlPO0FBQ0w7QUFDRDtBQUNGOztBQUVEO0FBQ0EsUUFBSSxDQUFDRCxRQUFELElBQWFQLEtBQUtJLFFBQUwsS0FBa0IsQ0FBbkMsRUFBc0M7QUFDcENKLFdBQUtJLFFBQUwsR0FBZ0IsQ0FBaEI7QUFDRDtBQUNELFFBQUksQ0FBQ0ksV0FBRCxJQUFnQlIsS0FBS0UsUUFBTCxLQUFrQixDQUF0QyxFQUF5QztBQUN2Q0YsV0FBS0UsUUFBTCxHQUFnQixDQUFoQjtBQUNEOztBQUVEO0FBQ0EsUUFBSWxDLFFBQVFrQixNQUFaLEVBQW9CO0FBQ2xCLFVBQUlxQixhQUFhUCxLQUFLSSxRQUF0QixFQUFnQztBQUM5QixjQUFNLElBQUlqQixLQUFKLENBQVUsc0RBQXNEVSxtQkFBbUIsQ0FBekUsQ0FBVixDQUFOO0FBQ0Q7QUFDRCxVQUFJVyxnQkFBZ0JSLEtBQUtFLFFBQXpCLEVBQW1DO0FBQ2pDLGNBQU0sSUFBSWYsS0FBSixDQUFVLHdEQUF3RFUsbUJBQW1CLENBQTNFLENBQVYsQ0FBTjtBQUNEO0FBQ0Y7O0FBRUQsV0FBT0csSUFBUDtBQUNEOztBQUVELFNBQU8xQixJQUFJTCxRQUFRUyxNQUFuQixFQUEyQjtBQUN6Qkg7QUFDRDs7QUFFRCxTQUFPRixJQUFQO0FBQ0QiLCJmaWxlIjoicGFyc2UuanMiLCJzb3VyY2VzQ29udGVudCI6WyJleHBvcnQgZnVuY3Rpb24gcGFyc2VQYXRjaCh1bmlEaWZmLCBvcHRpb25zID0ge30pIHtcbiAgbGV0IGRpZmZzdHIgPSB1bmlEaWZmLnNwbGl0KC9cXHJcXG58W1xcblxcdlxcZlxcclxceDg1XS8pLFxuICAgICAgZGVsaW1pdGVycyA9IHVuaURpZmYubWF0Y2goL1xcclxcbnxbXFxuXFx2XFxmXFxyXFx4ODVdL2cpIHx8IFtdLFxuICAgICAgbGlzdCA9IFtdLFxuICAgICAgaSA9IDA7XG5cbiAgZnVuY3Rpb24gcGFyc2VJbmRleCgpIHtcbiAgICBsZXQgaW5kZXggPSB7fTtcbiAgICBsaXN0LnB1c2goaW5kZXgpO1xuXG4gICAgLy8gUGFyc2UgZGlmZiBtZXRhZGF0YVxuICAgIHdoaWxlIChpIDwgZGlmZnN0ci5sZW5ndGgpIHtcbiAgICAgIGxldCBsaW5lID0gZGlmZnN0cltpXTtcblxuICAgICAgLy8gRmlsZSBoZWFkZXIgZm91bmQsIGVuZCBwYXJzaW5nIGRpZmYgbWV0YWRhdGFcbiAgICAgIGlmICgvXihcXC1cXC1cXC18XFwrXFwrXFwrfEBAKVxccy8udGVzdChsaW5lKSkge1xuICAgICAgICBicmVhaztcbiAgICAgIH1cblxuICAgICAgLy8gRGlmZiBpbmRleFxuICAgICAgbGV0IGhlYWRlciA9ICgvXig/OkluZGV4OnxkaWZmKD86IC1yIFxcdyspKylcXHMrKC4rPylcXHMqJC8pLmV4ZWMobGluZSk7XG4gICAgICBpZiAoaGVhZGVyKSB7XG4gICAgICAgIGluZGV4LmluZGV4ID0gaGVhZGVyWzFdO1xuICAgICAgfVxuXG4gICAgICBpKys7XG4gICAgfVxuXG4gICAgLy8gUGFyc2UgZmlsZSBoZWFkZXJzIGlmIHRoZXkgYXJlIGRlZmluZWQuIFVuaWZpZWQgZGlmZiByZXF1aXJlcyB0aGVtLCBidXRcbiAgICAvLyB0aGVyZSdzIG5vIHRlY2huaWNhbCBpc3N1ZXMgdG8gaGF2ZSBhbiBpc29sYXRlZCBodW5rIHdpdGhvdXQgZmlsZSBoZWFkZXJcbiAgICBwYXJzZUZpbGVIZWFkZXIoaW5kZXgpO1xuICAgIHBhcnNlRmlsZUhlYWRlcihpbmRleCk7XG5cbiAgICAvLyBQYXJzZSBodW5rc1xuICAgIGluZGV4Lmh1bmtzID0gW107XG5cbiAgICB3aGlsZSAoaSA8IGRpZmZzdHIubGVuZ3RoKSB7XG4gICAgICBsZXQgbGluZSA9IGRpZmZzdHJbaV07XG5cbiAgICAgIGlmICgvXihJbmRleDp8ZGlmZnxcXC1cXC1cXC18XFwrXFwrXFwrKVxccy8udGVzdChsaW5lKSkge1xuICAgICAgICBicmVhaztcbiAgICAgIH0gZWxzZSBpZiAoL15AQC8udGVzdChsaW5lKSkge1xuICAgICAgICBpbmRleC5odW5rcy5wdXNoKHBhcnNlSHVuaygpKTtcbiAgICAgIH0gZWxzZSBpZiAobGluZSAmJiBvcHRpb25zLnN0cmljdCkge1xuICAgICAgICAvLyBJZ25vcmUgdW5leHBlY3RlZCBjb250ZW50IHVubGVzcyBpbiBzdHJpY3QgbW9kZVxuICAgICAgICB0aHJvdyBuZXcgRXJyb3IoJ1Vua25vd24gbGluZSAnICsgKGkgKyAxKSArICcgJyArIEpTT04uc3RyaW5naWZ5KGxpbmUpKTtcbiAgICAgIH0gZWxzZSB7XG4gICAgICAgIGkrKztcbiAgICAgIH1cbiAgICB9XG4gIH1cblxuICAvLyBQYXJzZXMgdGhlIC0tLSBhbmQgKysrIGhlYWRlcnMsIGlmIG5vbmUgYXJlIGZvdW5kLCBubyBsaW5lc1xuICAvLyBhcmUgY29uc3VtZWQuXG4gIGZ1bmN0aW9uIHBhcnNlRmlsZUhlYWRlcihpbmRleCkge1xuICAgIGNvbnN0IGZpbGVIZWFkZXIgPSAoL14oLS0tfFxcK1xcK1xcKylcXHMrKC4qKSQvKS5leGVjKGRpZmZzdHJbaV0pO1xuICAgIGlmIChmaWxlSGVhZGVyKSB7XG4gICAgICBsZXQga2V5UHJlZml4ID0gZmlsZUhlYWRlclsxXSA9PT0gJy0tLScgPyAnb2xkJyA6ICduZXcnO1xuICAgICAgY29uc3QgZGF0YSA9IGZpbGVIZWFkZXJbMl0uc3BsaXQoJ1xcdCcsIDIpO1xuICAgICAgbGV0IGZpbGVOYW1lID0gZGF0YVswXS5yZXBsYWNlKC9cXFxcXFxcXC9nLCAnXFxcXCcpO1xuICAgICAgaWYgKC9eXCIuKlwiJC8udGVzdChmaWxlTmFtZSkpIHtcbiAgICAgICAgZmlsZU5hbWUgPSBmaWxlTmFtZS5zdWJzdHIoMSwgZmlsZU5hbWUubGVuZ3RoIC0gMik7XG4gICAgICB9XG4gICAgICBpbmRleFtrZXlQcmVmaXggKyAnRmlsZU5hbWUnXSA9IGZpbGVOYW1lO1xuICAgICAgaW5kZXhba2V5UHJlZml4ICsgJ0hlYWRlciddID0gKGRhdGFbMV0gfHwgJycpLnRyaW0oKTtcblxuICAgICAgaSsrO1xuICAgIH1cbiAgfVxuXG4gIC8vIFBhcnNlcyBhIGh1bmtcbiAgLy8gVGhpcyBhc3N1bWVzIHRoYXQgd2UgYXJlIGF0IHRoZSBzdGFydCBvZiBhIGh1bmsuXG4gIGZ1bmN0aW9uIHBhcnNlSHVuaygpIHtcbiAgICBsZXQgY2h1bmtIZWFkZXJJbmRleCA9IGksXG4gICAgICAgIGNodW5rSGVhZGVyTGluZSA9IGRpZmZzdHJbaSsrXSxcbiAgICAgICAgY2h1bmtIZWFkZXIgPSBjaHVua0hlYWRlckxpbmUuc3BsaXQoL0BAIC0oXFxkKykoPzosKFxcZCspKT8gXFwrKFxcZCspKD86LChcXGQrKSk/IEBALyk7XG5cbiAgICBsZXQgaHVuayA9IHtcbiAgICAgIG9sZFN0YXJ0OiArY2h1bmtIZWFkZXJbMV0sXG4gICAgICBvbGRMaW5lczogK2NodW5rSGVhZGVyWzJdIHx8IDEsXG4gICAgICBuZXdTdGFydDogK2NodW5rSGVhZGVyWzNdLFxuICAgICAgbmV3TGluZXM6ICtjaHVua0hlYWRlcls0XSB8fCAxLFxuICAgICAgbGluZXM6IFtdLFxuICAgICAgbGluZWRlbGltaXRlcnM6IFtdXG4gICAgfTtcblxuICAgIGxldCBhZGRDb3VudCA9IDAsXG4gICAgICAgIHJlbW92ZUNvdW50ID0gMDtcbiAgICBmb3IgKDsgaSA8IGRpZmZzdHIubGVuZ3RoOyBpKyspIHtcbiAgICAgIC8vIExpbmVzIHN0YXJ0aW5nIHdpdGggJy0tLScgY291bGQgYmUgbWlzdGFrZW4gZm9yIHRoZSBcInJlbW92ZSBsaW5lXCIgb3BlcmF0aW9uXG4gICAgICAvLyBCdXQgdGhleSBjb3VsZCBiZSB0aGUgaGVhZGVyIGZvciB0aGUgbmV4dCBmaWxlLiBUaGVyZWZvcmUgcHJ1bmUgc3VjaCBjYXNlcyBvdXQuXG4gICAgICBpZiAoZGlmZnN0cltpXS5pbmRleE9mKCctLS0gJykgPT09IDBcbiAgICAgICAgICAgICYmIChpICsgMiA8IGRpZmZzdHIubGVuZ3RoKVxuICAgICAgICAgICAgJiYgZGlmZnN0cltpICsgMV0uaW5kZXhPZignKysrICcpID09PSAwXG4gICAgICAgICAgICAmJiBkaWZmc3RyW2kgKyAyXS5pbmRleE9mKCdAQCcpID09PSAwKSB7XG4gICAgICAgICAgYnJlYWs7XG4gICAgICB9XG4gICAgICBsZXQgb3BlcmF0aW9uID0gKGRpZmZzdHJbaV0ubGVuZ3RoID09IDAgJiYgaSAhPSAoZGlmZnN0ci5sZW5ndGggLSAxKSkgPyAnICcgOiBkaWZmc3RyW2ldWzBdO1xuXG4gICAgICBpZiAob3BlcmF0aW9uID09PSAnKycgfHwgb3BlcmF0aW9uID09PSAnLScgfHwgb3BlcmF0aW9uID09PSAnICcgfHwgb3BlcmF0aW9uID09PSAnXFxcXCcpIHtcbiAgICAgICAgaHVuay5saW5lcy5wdXNoKGRpZmZzdHJbaV0pO1xuICAgICAgICBodW5rLmxpbmVkZWxpbWl0ZXJzLnB1c2goZGVsaW1pdGVyc1tpXSB8fCAnXFxuJyk7XG5cbiAgICAgICAgaWYgKG9wZXJhdGlvbiA9PT0gJysnKSB7XG4gICAgICAgICAgYWRkQ291bnQrKztcbiAgICAgICAgfSBlbHNlIGlmIChvcGVyYXRpb24gPT09ICctJykge1xuICAgICAgICAgIHJlbW92ZUNvdW50Kys7XG4gICAgICAgIH0gZWxzZSBpZiAob3BlcmF0aW9uID09PSAnICcpIHtcbiAgICAgICAgICBhZGRDb3VudCsrO1xuICAgICAgICAgIHJlbW92ZUNvdW50Kys7XG4gICAgICAgIH1cbiAgICAgIH0gZWxzZSB7XG4gICAgICAgIGJyZWFrO1xuICAgICAgfVxuICAgIH1cblxuICAgIC8vIEhhbmRsZSB0aGUgZW1wdHkgYmxvY2sgY291bnQgY2FzZVxuICAgIGlmICghYWRkQ291bnQgJiYgaHVuay5uZXdMaW5lcyA9PT0gMSkge1xuICAgICAgaHVuay5uZXdMaW5lcyA9IDA7XG4gICAgfVxuICAgIGlmICghcmVtb3ZlQ291bnQgJiYgaHVuay5vbGRMaW5lcyA9PT0gMSkge1xuICAgICAgaHVuay5vbGRMaW5lcyA9IDA7XG4gICAgfVxuXG4gICAgLy8gUGVyZm9ybSBvcHRpb25hbCBzYW5pdHkgY2hlY2tpbmdcbiAgICBpZiAob3B0aW9ucy5zdHJpY3QpIHtcbiAgICAgIGlmIChhZGRDb3VudCAhPT0gaHVuay5uZXdMaW5lcykge1xuICAgICAgICB0aHJvdyBuZXcgRXJyb3IoJ0FkZGVkIGxpbmUgY291bnQgZGlkIG5vdCBtYXRjaCBmb3IgaHVuayBhdCBsaW5lICcgKyAoY2h1bmtIZWFkZXJJbmRleCArIDEpKTtcbiAgICAgIH1cbiAgICAgIGlmIChyZW1vdmVDb3VudCAhPT0gaHVuay5vbGRMaW5lcykge1xuICAgICAgICB0aHJvdyBuZXcgRXJyb3IoJ1JlbW92ZWQgbGluZSBjb3VudCBkaWQgbm90IG1hdGNoIGZvciBodW5rIGF0IGxpbmUgJyArIChjaHVua0hlYWRlckluZGV4ICsgMSkpO1xuICAgICAgfVxuICAgIH1cblxuICAgIHJldHVybiBodW5rO1xuICB9XG5cbiAgd2hpbGUgKGkgPCBkaWZmc3RyLmxlbmd0aCkge1xuICAgIHBhcnNlSW5kZXgoKTtcbiAgfVxuXG4gIHJldHVybiBsaXN0O1xufVxuIl19
diff --git a/node_modules/diff/lib/util/array.js b/node_modules/diff/lib/util/array.js
new file mode 100644
index 0000000..1bb4256
--- /dev/null
+++ b/node_modules/diff/lib/util/array.js
@@ -0,0 +1,27 @@
+/*istanbul ignore start*/"use strict";
+
+exports.__esModule = true;
+exports. /*istanbul ignore end*/arrayEqual = arrayEqual;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/arrayStartsWith = arrayStartsWith;
+function arrayEqual(a, b) {
+  if (a.length !== b.length) {
+    return false;
+  }
+
+  return arrayStartsWith(a, b);
+}
+
+function arrayStartsWith(array, start) {
+  if (start.length > array.length) {
+    return false;
+  }
+
+  for (var i = 0; i < start.length; i++) {
+    if (start[i] !== array[i]) {
+      return false;
+    }
+  }
+
+  return true;
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy91dGlsL2FycmF5LmpzIl0sIm5hbWVzIjpbImFycmF5RXF1YWwiLCJhcnJheVN0YXJ0c1dpdGgiLCJhIiwiYiIsImxlbmd0aCIsImFycmF5Iiwic3RhcnQiLCJpIl0sIm1hcHBpbmdzIjoiOzs7Z0NBQWdCQSxVLEdBQUFBLFU7eURBUUFDLGUsR0FBQUEsZTtBQVJULFNBQVNELFVBQVQsQ0FBb0JFLENBQXBCLEVBQXVCQyxDQUF2QixFQUEwQjtBQUMvQixNQUFJRCxFQUFFRSxNQUFGLEtBQWFELEVBQUVDLE1BQW5CLEVBQTJCO0FBQ3pCLFdBQU8sS0FBUDtBQUNEOztBQUVELFNBQU9ILGdCQUFnQkMsQ0FBaEIsRUFBbUJDLENBQW5CLENBQVA7QUFDRDs7QUFFTSxTQUFTRixlQUFULENBQXlCSSxLQUF6QixFQUFnQ0MsS0FBaEMsRUFBdUM7QUFDNUMsTUFBSUEsTUFBTUYsTUFBTixHQUFlQyxNQUFNRCxNQUF6QixFQUFpQztBQUMvQixXQUFPLEtBQVA7QUFDRDs7QUFFRCxPQUFLLElBQUlHLElBQUksQ0FBYixFQUFnQkEsSUFBSUQsTUFBTUYsTUFBMUIsRUFBa0NHLEdBQWxDLEVBQXVDO0FBQ3JDLFFBQUlELE1BQU1DLENBQU4sTUFBYUYsTUFBTUUsQ0FBTixDQUFqQixFQUEyQjtBQUN6QixhQUFPLEtBQVA7QUFDRDtBQUNGOztBQUVELFNBQU8sSUFBUDtBQUNEIiwiZmlsZSI6ImFycmF5LmpzIiwic291cmNlc0NvbnRlbnQiOlsiZXhwb3J0IGZ1bmN0aW9uIGFycmF5RXF1YWwoYSwgYikge1xuICBpZiAoYS5sZW5ndGggIT09IGIubGVuZ3RoKSB7XG4gICAgcmV0dXJuIGZhbHNlO1xuICB9XG5cbiAgcmV0dXJuIGFycmF5U3RhcnRzV2l0aChhLCBiKTtcbn1cblxuZXhwb3J0IGZ1bmN0aW9uIGFycmF5U3RhcnRzV2l0aChhcnJheSwgc3RhcnQpIHtcbiAgaWYgKHN0YXJ0Lmxlbmd0aCA+IGFycmF5Lmxlbmd0aCkge1xuICAgIHJldHVybiBmYWxzZTtcbiAgfVxuXG4gIGZvciAobGV0IGkgPSAwOyBpIDwgc3RhcnQubGVuZ3RoOyBpKyspIHtcbiAgICBpZiAoc3RhcnRbaV0gIT09IGFycmF5W2ldKSB7XG4gICAgICByZXR1cm4gZmFsc2U7XG4gICAgfVxuICB9XG5cbiAgcmV0dXJuIHRydWU7XG59XG4iXX0=
diff --git a/node_modules/diff/lib/util/distance-iterator.js b/node_modules/diff/lib/util/distance-iterator.js
new file mode 100644
index 0000000..95e4675
--- /dev/null
+++ b/node_modules/diff/lib/util/distance-iterator.js
@@ -0,0 +1,47 @@
+/*istanbul ignore start*/"use strict";
+
+exports.__esModule = true;
+
+exports["default"] = /*istanbul ignore end*/function (start, minLine, maxLine) {
+  var wantForward = true,
+      backwardExhausted = false,
+      forwardExhausted = false,
+      localOffset = 1;
+
+  return function iterator() {
+    if (wantForward && !forwardExhausted) {
+      if (backwardExhausted) {
+        localOffset++;
+      } else {
+        wantForward = false;
+      }
+
+      // Check if trying to fit beyond text length, and if not, check it fits
+      // after offset location (or desired location on first iteration)
+      if (start + localOffset <= maxLine) {
+        return localOffset;
+      }
+
+      forwardExhausted = true;
+    }
+
+    if (!backwardExhausted) {
+      if (!forwardExhausted) {
+        wantForward = true;
+      }
+
+      // Check if trying to fit before text beginning, and if not, check it fits
+      // before offset location
+      if (minLine <= start - localOffset) {
+        return -localOffset++;
+      }
+
+      backwardExhausted = true;
+      return iterator();
+    }
+
+    // We tried to fit hunk before text beginning and beyond text length, then
+    // hunk can't fit on the text. Return undefined
+  };
+};
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy91dGlsL2Rpc3RhbmNlLWl0ZXJhdG9yLmpzIl0sIm5hbWVzIjpbInN0YXJ0IiwibWluTGluZSIsIm1heExpbmUiLCJ3YW50Rm9yd2FyZCIsImJhY2t3YXJkRXhoYXVzdGVkIiwiZm9yd2FyZEV4aGF1c3RlZCIsImxvY2FsT2Zmc2V0IiwiaXRlcmF0b3IiXSwibWFwcGluZ3MiOiI7Ozs7NENBR2UsVUFBU0EsS0FBVCxFQUFnQkMsT0FBaEIsRUFBeUJDLE9BQXpCLEVBQWtDO0FBQy9DLE1BQUlDLGNBQWMsSUFBbEI7QUFBQSxNQUNJQyxvQkFBb0IsS0FEeEI7QUFBQSxNQUVJQyxtQkFBbUIsS0FGdkI7QUFBQSxNQUdJQyxjQUFjLENBSGxCOztBQUtBLFNBQU8sU0FBU0MsUUFBVCxHQUFvQjtBQUN6QixRQUFJSixlQUFlLENBQUNFLGdCQUFwQixFQUFzQztBQUNwQyxVQUFJRCxpQkFBSixFQUF1QjtBQUNyQkU7QUFDRCxPQUZELE1BRU87QUFDTEgsc0JBQWMsS0FBZDtBQUNEOztBQUVEO0FBQ0E7QUFDQSxVQUFJSCxRQUFRTSxXQUFSLElBQXVCSixPQUEzQixFQUFvQztBQUNsQyxlQUFPSSxXQUFQO0FBQ0Q7O0FBRURELHlCQUFtQixJQUFuQjtBQUNEOztBQUVELFFBQUksQ0FBQ0QsaUJBQUwsRUFBd0I7QUFDdEIsVUFBSSxDQUFDQyxnQkFBTCxFQUF1QjtBQUNyQkYsc0JBQWMsSUFBZDtBQUNEOztBQUVEO0FBQ0E7QUFDQSxVQUFJRixXQUFXRCxRQUFRTSxXQUF2QixFQUFvQztBQUNsQyxlQUFPLENBQUNBLGFBQVI7QUFDRDs7QUFFREYsMEJBQW9CLElBQXBCO0FBQ0EsYUFBT0csVUFBUDtBQUNEOztBQUVEO0FBQ0E7QUFDRCxHQWxDRDtBQW1DRCxDIiwiZmlsZSI6ImRpc3RhbmNlLWl0ZXJhdG9yLmpzIiwic291cmNlc0NvbnRlbnQiOlsiLy8gSXRlcmF0b3IgdGhhdCB0cmF2ZXJzZXMgaW4gdGhlIHJhbmdlIG9mIFttaW4sIG1heF0sIHN0ZXBwaW5nXG4vLyBieSBkaXN0YW5jZSBmcm9tIGEgZ2l2ZW4gc3RhcnQgcG9zaXRpb24uIEkuZS4gZm9yIFswLCA0XSwgd2l0aFxuLy8gc3RhcnQgb2YgMiwgdGhpcyB3aWxsIGl0ZXJhdGUgMiwgMywgMSwgNCwgMC5cbmV4cG9ydCBkZWZhdWx0IGZ1bmN0aW9uKHN0YXJ0LCBtaW5MaW5lLCBtYXhMaW5lKSB7XG4gIGxldCB3YW50Rm9yd2FyZCA9IHRydWUsXG4gICAgICBiYWNrd2FyZEV4aGF1c3RlZCA9IGZhbHNlLFxuICAgICAgZm9yd2FyZEV4aGF1c3RlZCA9IGZhbHNlLFxuICAgICAgbG9jYWxPZmZzZXQgPSAxO1xuXG4gIHJldHVybiBmdW5jdGlvbiBpdGVyYXRvcigpIHtcbiAgICBpZiAod2FudEZvcndhcmQgJiYgIWZvcndhcmRFeGhhdXN0ZWQpIHtcbiAgICAgIGlmIChiYWNrd2FyZEV4aGF1c3RlZCkge1xuICAgICAgICBsb2NhbE9mZnNldCsrO1xuICAgICAgfSBlbHNlIHtcbiAgICAgICAgd2FudEZvcndhcmQgPSBmYWxzZTtcbiAgICAgIH1cblxuICAgICAgLy8gQ2hlY2sgaWYgdHJ5aW5nIHRvIGZpdCBiZXlvbmQgdGV4dCBsZW5ndGgsIGFuZCBpZiBub3QsIGNoZWNrIGl0IGZpdHNcbiAgICAgIC8vIGFmdGVyIG9mZnNldCBsb2NhdGlvbiAob3IgZGVzaXJlZCBsb2NhdGlvbiBvbiBmaXJzdCBpdGVyYXRpb24pXG4gICAgICBpZiAoc3RhcnQgKyBsb2NhbE9mZnNldCA8PSBtYXhMaW5lKSB7XG4gICAgICAgIHJldHVybiBsb2NhbE9mZnNldDtcbiAgICAgIH1cblxuICAgICAgZm9yd2FyZEV4aGF1c3RlZCA9IHRydWU7XG4gICAgfVxuXG4gICAgaWYgKCFiYWNrd2FyZEV4aGF1c3RlZCkge1xuICAgICAgaWYgKCFmb3J3YXJkRXhoYXVzdGVkKSB7XG4gICAgICAgIHdhbnRGb3J3YXJkID0gdHJ1ZTtcbiAgICAgIH1cblxuICAgICAgLy8gQ2hlY2sgaWYgdHJ5aW5nIHRvIGZpdCBiZWZvcmUgdGV4dCBiZWdpbm5pbmcsIGFuZCBpZiBub3QsIGNoZWNrIGl0IGZpdHNcbiAgICAgIC8vIGJlZm9yZSBvZmZzZXQgbG9jYXRpb25cbiAgICAgIGlmIChtaW5MaW5lIDw9IHN0YXJ0IC0gbG9jYWxPZmZzZXQpIHtcbiAgICAgICAgcmV0dXJuIC1sb2NhbE9mZnNldCsrO1xuICAgICAgfVxuXG4gICAgICBiYWNrd2FyZEV4aGF1c3RlZCA9IHRydWU7XG4gICAgICByZXR1cm4gaXRlcmF0b3IoKTtcbiAgICB9XG5cbiAgICAvLyBXZSB0cmllZCB0byBmaXQgaHVuayBiZWZvcmUgdGV4dCBiZWdpbm5pbmcgYW5kIGJleW9uZCB0ZXh0IGxlbmd0aCwgdGhlblxuICAgIC8vIGh1bmsgY2FuJ3QgZml0IG9uIHRoZSB0ZXh0LiBSZXR1cm4gdW5kZWZpbmVkXG4gIH07XG59XG4iXX0=
diff --git a/node_modules/diff/lib/util/params.js b/node_modules/diff/lib/util/params.js
new file mode 100644
index 0000000..6ff0483
--- /dev/null
+++ b/node_modules/diff/lib/util/params.js
@@ -0,0 +1,18 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports. /*istanbul ignore end*/generateOptions = generateOptions;
+function generateOptions(options, defaults) {
+  if (typeof options === 'function') {
+    defaults.callback = options;
+  } else if (options) {
+    for (var name in options) {
+      /* istanbul ignore else */
+      if (options.hasOwnProperty(name)) {
+        defaults[name] = options[name];
+      }
+    }
+  }
+  return defaults;
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy91dGlsL3BhcmFtcy5qcyJdLCJuYW1lcyI6WyJnZW5lcmF0ZU9wdGlvbnMiLCJvcHRpb25zIiwiZGVmYXVsdHMiLCJjYWxsYmFjayIsIm5hbWUiLCJoYXNPd25Qcm9wZXJ0eSJdLCJtYXBwaW5ncyI6Ijs7O2dDQUFnQkEsZSxHQUFBQSxlO0FBQVQsU0FBU0EsZUFBVCxDQUF5QkMsT0FBekIsRUFBa0NDLFFBQWxDLEVBQTRDO0FBQ2pELE1BQUksT0FBT0QsT0FBUCxLQUFtQixVQUF2QixFQUFtQztBQUNqQ0MsYUFBU0MsUUFBVCxHQUFvQkYsT0FBcEI7QUFDRCxHQUZELE1BRU8sSUFBSUEsT0FBSixFQUFhO0FBQ2xCLFNBQUssSUFBSUcsSUFBVCxJQUFpQkgsT0FBakIsRUFBMEI7QUFDeEI7QUFDQSxVQUFJQSxRQUFRSSxjQUFSLENBQXVCRCxJQUF2QixDQUFKLEVBQWtDO0FBQ2hDRixpQkFBU0UsSUFBVCxJQUFpQkgsUUFBUUcsSUFBUixDQUFqQjtBQUNEO0FBQ0Y7QUFDRjtBQUNELFNBQU9GLFFBQVA7QUFDRCIsImZpbGUiOiJwYXJhbXMuanMiLCJzb3VyY2VzQ29udGVudCI6WyJleHBvcnQgZnVuY3Rpb24gZ2VuZXJhdGVPcHRpb25zKG9wdGlvbnMsIGRlZmF1bHRzKSB7XG4gIGlmICh0eXBlb2Ygb3B0aW9ucyA9PT0gJ2Z1bmN0aW9uJykge1xuICAgIGRlZmF1bHRzLmNhbGxiYWNrID0gb3B0aW9ucztcbiAgfSBlbHNlIGlmIChvcHRpb25zKSB7XG4gICAgZm9yIChsZXQgbmFtZSBpbiBvcHRpb25zKSB7XG4gICAgICAvKiBpc3RhbmJ1bCBpZ25vcmUgZWxzZSAqL1xuICAgICAgaWYgKG9wdGlvbnMuaGFzT3duUHJvcGVydHkobmFtZSkpIHtcbiAgICAgICAgZGVmYXVsdHNbbmFtZV0gPSBvcHRpb25zW25hbWVdO1xuICAgICAgfVxuICAgIH1cbiAgfVxuICByZXR1cm4gZGVmYXVsdHM7XG59XG4iXX0=
diff --git a/node_modules/diff/package.json b/node_modules/diff/package.json
new file mode 100644
index 0000000..ec89bfc
--- /dev/null
+++ b/node_modules/diff/package.json
@@ -0,0 +1,120 @@
+{
+  "_args": [
+    [
+      "diff@3.5.0",
+      "/home/licence/helayelq/Integration/my-test-project/node_modules/mocha"
+    ]
+  ],
+  "_from": "diff@3.5.0",
+  "_hasShrinkwrap": false,
+  "_id": "diff@3.5.0",
+  "_inCache": true,
+  "_installable": true,
+  "_location": "/diff",
+  "_nodeVersion": "8.9.3",
+  "_npmOperationalInternal": {
+    "host": "s3://npm-registry-packages",
+    "tmp": "tmp/diff_3.5.0_1520223774069_0.3506252394193625"
+  },
+  "_npmUser": {
+    "email": "kpdecker@gmail.com",
+    "name": "kpdecker"
+  },
+  "_npmVersion": "5.5.1",
+  "_phantomChildren": {},
+  "_requested": {
+    "name": "diff",
+    "raw": "diff@3.5.0",
+    "rawSpec": "3.5.0",
+    "scope": null,
+    "spec": "3.5.0",
+    "type": "version"
+  },
+  "_requiredBy": [
+    "/mocha"
+  ],
+  "_resolved": "https://registry.npmjs.org/diff/-/diff-3.5.0.tgz",
+  "_shasum": "800c0dd1e0a8bfbc95835c202ad220fe317e5a12",
+  "_shrinkwrap": null,
+  "_spec": "diff@3.5.0",
+  "_where": "/home/licence/helayelq/Integration/my-test-project/node_modules/mocha",
+  "browser": "./dist/diff.js",
+  "bugs": {
+    "email": "kpdecker@gmail.com",
+    "url": "http://github.com/kpdecker/jsdiff/issues"
+  },
+  "dependencies": {},
+  "description": "A javascript text diff implementation.",
+  "devDependencies": {
+    "async": "^1.4.2",
+    "babel-core": "^6.0.0",
+    "babel-loader": "^6.0.0",
+    "babel-preset-es2015-mod": "^6.3.13",
+    "babel-preset-es3": "^1.0.1",
+    "chai": "^3.3.0",
+    "colors": "^1.1.2",
+    "eslint": "^1.6.0",
+    "grunt": "^0.4.5",
+    "grunt-babel": "^6.0.0",
+    "grunt-clean": "^0.4.0",
+    "grunt-cli": "^0.1.13",
+    "grunt-contrib-clean": "^1.0.0",
+    "grunt-contrib-copy": "^1.0.0",
+    "grunt-contrib-uglify": "^1.0.0",
+    "grunt-contrib-watch": "^1.0.0",
+    "grunt-eslint": "^17.3.1",
+    "grunt-karma": "^0.12.1",
+    "grunt-mocha-istanbul": "^3.0.1",
+    "grunt-mocha-test": "^0.12.7",
+    "grunt-webpack": "^1.0.11",
+    "istanbul": "github:kpdecker/istanbul",
+    "karma": "^0.13.11",
+    "karma-mocha": "^0.2.0",
+    "karma-mocha-reporter": "^2.0.0",
+    "karma-phantomjs-launcher": "^1.0.0",
+    "karma-sauce-launcher": "^0.3.0",
+    "karma-sourcemap-loader": "^0.3.6",
+    "karma-webpack": "^1.7.0",
+    "mocha": "^2.3.3",
+    "phantomjs-prebuilt": "^2.1.5",
+    "semver": "^5.0.3",
+    "webpack": "^1.12.2",
+    "webpack-dev-server": "^1.12.0"
+  },
+  "directories": {},
+  "dist": {
+    "fileCount": 27,
+    "integrity": "sha512-A46qtFgd+g7pDZinpnwiRJtxbC1hpgf0uzP3iG89scHk0AUC7A1TGxf5OiiOUv/JMZR8GOt8hL900hV0bOy5xA==",
+    "shasum": "800c0dd1e0a8bfbc95835c202ad220fe317e5a12",
+    "tarball": "https://registry.npmjs.org/diff/-/diff-3.5.0.tgz",
+    "unpackedSize": 622126
+  },
+  "engines": {
+    "node": ">=0.3.1"
+  },
+  "gitHead": "e9ab94893a77f1f7d7ea8483b873083e6c6a390a",
+  "homepage": "https://github.com/kpdecker/jsdiff#readme",
+  "keywords": [
+    "diff",
+    "javascript"
+  ],
+  "license": "BSD-3-Clause",
+  "main": "./lib",
+  "maintainers": [
+    {
+      "name": "kpdecker",
+      "email": "kpdecker@gmail.com"
+    }
+  ],
+  "name": "diff",
+  "optionalDependencies": {},
+  "readme": "ERROR: No README data found!",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/kpdecker/jsdiff.git"
+  },
+  "scripts": {
+    "test": "grunt"
+  },
+  "version": "3.5.0"
+}
diff --git a/node_modules/diff/release-notes.md b/node_modules/diff/release-notes.md
new file mode 100644
index 0000000..0116a2b
--- /dev/null
+++ b/node_modules/diff/release-notes.md
@@ -0,0 +1,247 @@
+# Release Notes
+
+## Development
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v3.5.0...master)
+
+## v3.5.0 - March 4th, 2018
+- Omit redundant slice in join method of diffArrays - 1023590
+- Support patches with empty lines - fb0f208
+- Accept a custom JSON replacer function for JSON diffing - 69c7f0a
+- Optimize parch header parser - 2aec429
+- Fix typos - e89c832
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v3.5.0...v3.5.0)
+
+## v3.5.0 - March 4th, 2018
+- Omit redundant slice in join method of diffArrays - 1023590
+- Support patches with empty lines - fb0f208
+- Accept a custom JSON replacer function for JSON diffing - 69c7f0a
+- Optimize parch header parser - 2aec429
+- Fix typos - e89c832
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v3.4.0...v3.5.0)
+
+## v3.4.0 - October 7th, 2017
+- [#183](https://github.com/kpdecker/jsdiff/issues/183) - Feature request: ability to specify a custom equality checker for `diffArrays`
+- [#173](https://github.com/kpdecker/jsdiff/issues/173) - Bug: diffArrays gives wrong result on array of booleans
+- [#158](https://github.com/kpdecker/jsdiff/issues/158) - diffArrays will not compare the empty string in array?
+- comparator for custom equality checks - 30e141e
+- count oldLines and newLines when there are conflicts - 53bf384
+- Fix: diffArrays can compare falsey items - 9e24284
+- Docs: Replace grunt with npm test - 00e2f94
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v3.3.1...v3.4.0)
+
+## v3.3.1 - September 3rd, 2017
+- [#141](https://github.com/kpdecker/jsdiff/issues/141) - Cannot apply patch because my file delimiter is "/r/n" instead of "/n"
+- [#192](https://github.com/kpdecker/jsdiff/pull/192) - Fix: Bad merge when adding new files (#189)
+- correct spelling mistake - 21fa478
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v3.3.0...v3.3.1)
+
+## v3.3.0 - July 5th, 2017
+- [#114](https://github.com/kpdecker/jsdiff/issues/114) - /patch/merge not exported
+- Gracefully accept invalid newStart in hunks, same as patch(1) does. - d8a3635
+- Use regex rather than starts/ends with for parsePatch - 6cab62c
+- Add browser flag - e64f674
+- refactor: simplified code a bit more - 8f8e0f2
+- refactor: simplified code a bit - b094a6f
+- fix: some corrections re ignoreCase option - 3c78fd0
+- ignoreCase option - 3cbfbb5
+- Sanitize filename while parsing patches - 2fe8129
+- Added better installation methods - aced50b
+- Simple export of functionality - 8690f31
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v3.2.0...v3.3.0)
+
+## v3.2.0 - December 26th, 2016
+- [#156](https://github.com/kpdecker/jsdiff/pull/156) - Add `undefinedReplacement` option to `diffJson` ([@ewnd9](https://api.github.com/users/ewnd9))
+- [#154](https://github.com/kpdecker/jsdiff/pull/154) - Add `examples` and `images` to `.npmignore`. ([@wtgtybhertgeghgtwtg](https://api.github.com/users/wtgtybhertgeghgtwtg))
+- [#153](https://github.com/kpdecker/jsdiff/pull/153) - feat(structuredPatch): Pass options to diffLines ([@Kiougar](https://api.github.com/users/Kiougar))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v3.1.0...v3.2.0)
+
+## v3.1.0 - November 27th, 2016
+- [#146](https://github.com/kpdecker/jsdiff/pull/146) - JsDiff.diffArrays to compare arrays ([@wvanderdeijl](https://api.github.com/users/wvanderdeijl))
+- [#144](https://github.com/kpdecker/jsdiff/pull/144) - Split file using all possible line delimiter instead of hard-coded "/n" and join lines back using the original delimiters ([@soulbeing](https://api.github.com/users/soulbeing))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v3.0.1...v3.1.0)
+
+## v3.0.1 - October 9th, 2016
+- [#139](https://github.com/kpdecker/jsdiff/pull/139) - Make README.md look nicer in npmjs.com ([@takenspc](https://api.github.com/users/takenspc))
+- [#135](https://github.com/kpdecker/jsdiff/issues/135) - parsePatch combines patches from multiple files into a single IUniDiff when there is no "Index" line ([@ramya-rao-a](https://api.github.com/users/ramya-rao-a))
+- [#124](https://github.com/kpdecker/jsdiff/issues/124) - IE7/IE8 failure since 2.0.0 ([@boneskull](https://api.github.com/users/boneskull))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v3.0.0...v3.0.1)
+
+## v3.0.0 - August 23rd, 2016
+- [#130](https://github.com/kpdecker/jsdiff/pull/130) - Add callback argument to applyPatches `patched` option ([@piranna](https://api.github.com/users/piranna))
+- [#120](https://github.com/kpdecker/jsdiff/pull/120) - Correctly handle file names containing spaces ([@adius](https://api.github.com/users/adius))
+- [#119](https://github.com/kpdecker/jsdiff/pull/119) - Do single reflow ([@wifiextender](https://api.github.com/users/wifiextender))
+- [#117](https://github.com/kpdecker/jsdiff/pull/117) - Make more usable with long strings. ([@abnbgist](https://api.github.com/users/abnbgist))
+
+Compatibility notes:
+- applyPatches patch callback now is async and requires the callback be called to continue operation
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.2.3...v3.0.0)
+
+## v2.2.3 - May 31st, 2016
+- [#118](https://github.com/kpdecker/jsdiff/pull/118) - Add a fix for applying 0-length destination patches ([@chaaz](https://api.github.com/users/chaaz))
+- [#115](https://github.com/kpdecker/jsdiff/pull/115) - Fixed grammar in README ([@krizalys](https://api.github.com/users/krizalys))
+- [#113](https://github.com/kpdecker/jsdiff/pull/113) - fix typo ([@vmazare](https://api.github.com/users/vmazare))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.2.2...v2.2.3)
+
+## v2.2.2 - March 13th, 2016
+- [#102](https://github.com/kpdecker/jsdiff/issues/102) - diffJson with dates, returns empty curly braces  ([@dr-dimitru](https://api.github.com/users/dr-dimitru))
+- [#97](https://github.com/kpdecker/jsdiff/issues/97) - Whitespaces & diffWords ([@faiwer](https://api.github.com/users/faiwer))
+- [#92](https://github.com/kpdecker/jsdiff/pull/92) - Fixes typo in the readme ([@bg451](https://api.github.com/users/bg451))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.2.1...v2.2.2)
+
+## v2.2.1 - November 12th, 2015
+- [#89](https://github.com/kpdecker/jsdiff/pull/89) - add in display selector to readme ([@FranDias](https://api.github.com/users/FranDias))
+- [#88](https://github.com/kpdecker/jsdiff/pull/88) - Split diffs based on file headers instead of 'Index:' metadata ([@piranna](https://api.github.com/users/piranna))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.2.0...v2.2.1)
+
+## v2.2.0 - October 29th, 2015
+- [#80](https://github.com/kpdecker/jsdiff/pull/80) - Fix a typo: applyPath ->  applyPatch ([@fluxxu](https://api.github.com/users/fluxxu))
+- [#83](https://github.com/kpdecker/jsdiff/pull/83) - Add basic fuzzy matching to applyPatch ([@piranna](https://github.com/piranna))
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.2.0...v2.2.0)
+
+## v2.2.0 - October 29th, 2015
+- [#80](https://github.com/kpdecker/jsdiff/pull/80) - Fix a typo: applyPath ->  applyPatch ([@fluxxu](https://api.github.com/users/fluxxu))
+- [#83](https://github.com/kpdecker/jsdiff/pull/83) - Add basic fuzzy matching to applyPatch ([@piranna](https://github.com/piranna))
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.1.3...v2.2.0)
+
+## v2.1.3 - September 30th, 2015
+- [#78](https://github.com/kpdecker/jsdiff/pull/78) - fix: error throwing when apply patch to empty string ([@21paradox](https://api.github.com/users/21paradox))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.1.2...v2.1.3)
+
+## v2.1.2 - September 23rd, 2015
+- [#76](https://github.com/kpdecker/jsdiff/issues/76) - diff headers give error ([@piranna](https://api.github.com/users/piranna))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.1.1...v2.1.2)
+
+## v2.1.1 - September 9th, 2015
+- [#73](https://github.com/kpdecker/jsdiff/issues/73) - Is applyPatches() exposed in the API? ([@davidparsson](https://api.github.com/users/davidparsson))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.1.0...v2.1.1)
+
+## v2.1.0 - August 27th, 2015
+- [#72](https://github.com/kpdecker/jsdiff/issues/72) - Consider using options object API for flag permutations ([@kpdecker](https://api.github.com/users/kpdecker))
+- [#70](https://github.com/kpdecker/jsdiff/issues/70) - diffWords treats \n at the end as significant whitespace ([@nesQuick](https://api.github.com/users/nesQuick))
+- [#69](https://github.com/kpdecker/jsdiff/issues/69) - Missing count ([@wfalkwallace](https://api.github.com/users/wfalkwallace))
+- [#68](https://github.com/kpdecker/jsdiff/issues/68) - diffLines seems broken ([@wfalkwallace](https://api.github.com/users/wfalkwallace))
+- [#60](https://github.com/kpdecker/jsdiff/issues/60) - Support multiple diff hunks ([@piranna](https://api.github.com/users/piranna))
+- [#54](https://github.com/kpdecker/jsdiff/issues/54) - Feature Request: 3-way merge ([@mog422](https://api.github.com/users/mog422))
+- [#42](https://github.com/kpdecker/jsdiff/issues/42) - Fuzz factor for applyPatch ([@stuartpb](https://api.github.com/users/stuartpb))
+- Move whitespace ignore out of equals method - 542063c
+- Include source maps in babel output - 7f7ab21
+- Merge diff/line and diff/patch implementations - 1597705
+- Drop map utility method - 1ddc939
+- Documentation for parsePatch and applyPatches - 27c4b77
+
+Compatibility notes:
+- The undocumented ignoreWhitespace flag has been removed from the Diff equality check directly. This implementation may be copied to diff utilities if dependencies existed on this functionality.
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.0.2...v2.1.0)
+
+## v2.0.2 - August 8th, 2015
+- [#67](https://github.com/kpdecker/jsdiff/issues/67) - cannot require from npm module in node ([@commenthol](https://api.github.com/users/commenthol))
+- Convert to chai since we don’t support IE8 - a96bbad
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.0.1...v2.0.2)
+
+## v2.0.1 - August 7th, 2015
+- Add release build at proper step - 57542fd
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.0.0...v2.0.1)
+
+## v2.0.0 - August 7th, 2015
+- [#66](https://github.com/kpdecker/jsdiff/issues/66) - Add karma and sauce tests ([@kpdecker](https://api.github.com/users/kpdecker))
+- [#65](https://github.com/kpdecker/jsdiff/issues/65) - Create component repository for bower ([@kpdecker](https://api.github.com/users/kpdecker))
+- [#64](https://github.com/kpdecker/jsdiff/issues/64) - Automatically call removeEmpty for all tokenizer calls ([@kpdecker](https://api.github.com/users/kpdecker))
+- [#62](https://github.com/kpdecker/jsdiff/pull/62) - Allow access to structured object representation of patch data ([@bittrance](https://api.github.com/users/bittrance))
+- [#61](https://github.com/kpdecker/jsdiff/pull/61) - Use svg instead of png to get better image quality ([@PeterDaveHello](https://api.github.com/users/PeterDaveHello))
+- [#29](https://github.com/kpdecker/jsdiff/issues/29) - word tokenizer works only for 7 bit ascii ([@plasmagunman](https://api.github.com/users/plasmagunman))
+
+Compatibility notes:
+- `this.removeEmpty` is now called automatically for all instances. If this is not desired, this may be overridden on a per instance basis.
+- The library has been refactored to use some ES6 features. The external APIs should remain the same, but bower projects that directly referenced the repository will now have to point to the [components/jsdiff](https://github.com/components/jsdiff) repository.
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.4.0...v2.0.0)
+
+## v1.4.0 - May 6th, 2015
+- [#57](https://github.com/kpdecker/jsdiff/issues/57) - createPatch -> applyPatch failed. ([@mog422](https://api.github.com/users/mog422))
+- [#56](https://github.com/kpdecker/jsdiff/pull/56) - Two files patch ([@rgeissert](https://api.github.com/users/rgeissert))
+- [#14](https://github.com/kpdecker/jsdiff/issues/14) - Flip added and removed order? ([@jakesandlund](https://api.github.com/users/jakesandlund))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.3.2...v1.4.0)
+
+## v1.3.2 - March 30th, 2015
+- [#53](https://github.com/kpdecker/jsdiff/pull/53) - Updated README.MD with Bower installation instructions ([@ofbriggs](https://api.github.com/users/ofbriggs))
+- [#49](https://github.com/kpdecker/jsdiff/issues/49) - Cannot read property 'oldlines' of undefined ([@nwtn](https://api.github.com/users/nwtn))
+- [#44](https://github.com/kpdecker/jsdiff/issues/44) - invalid-meta jsdiff is missing "main" entry in bower.json
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.3.1...v1.3.2)
+
+## v1.3.1 - March 13th, 2015
+- [#52](https://github.com/kpdecker/jsdiff/pull/52) - Fix for #51 Wrong result of JsDiff.diffLines ([@felicienfrancois](https://api.github.com/users/felicienfrancois))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.3.0...v1.3.1)
+
+## v1.3.0 - March 2nd, 2015
+- [#47](https://github.com/kpdecker/jsdiff/pull/47) - Adding Diff Trimmed Lines ([@JamesGould123](https://api.github.com/users/JamesGould123))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.2.2...v1.3.0)
+
+## v1.2.2 - January 26th, 2015
+- [#45](https://github.com/kpdecker/jsdiff/pull/45) - Fix AMD module loading ([@pedrocarrico](https://api.github.com/users/pedrocarrico))
+- [#43](https://github.com/kpdecker/jsdiff/pull/43) - added a bower file ([@nbrustein](https://api.github.com/users/nbrustein))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.2.1...v1.2.2)
+
+## v1.2.1 - December 26th, 2014
+- [#41](https://github.com/kpdecker/jsdiff/pull/41) - change condition of using node export system. ([@ironhee](https://api.github.com/users/ironhee))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.2.0...v1.2.1)
+
+## v1.2.0 - November 29th, 2014
+- [#37](https://github.com/kpdecker/jsdiff/pull/37) - Add support for sentences. ([@vmariano](https://api.github.com/users/vmariano))
+- [#28](https://github.com/kpdecker/jsdiff/pull/28) - Implemented diffJson ([@papandreou](https://api.github.com/users/papandreou))
+- [#27](https://github.com/kpdecker/jsdiff/issues/27) - Slow to execute over diffs with a large number of changes ([@termi](https://api.github.com/users/termi))
+- Allow for optional async diffing - 19385b9
+- Fix diffChars implementation - eaa44ed
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.1.0...v1.2.0)
+
+## v1.1.0 - November 25th, 2014
+- [#33](https://github.com/kpdecker/jsdiff/pull/33) - AMD and global exports ([@ovcharik](https://api.github.com/users/ovcharik))
+- [#32](https://github.com/kpdecker/jsdiff/pull/32) - Add support for component ([@vmariano](https://api.github.com/users/vmariano))
+- [#31](https://github.com/kpdecker/jsdiff/pull/31) - Don't rely on Array.prototype.map ([@papandreou](https://api.github.com/users/papandreou))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.0.8...v1.1.0)
+
+## v1.0.8 - December 22nd, 2013
+- [#24](https://github.com/kpdecker/jsdiff/pull/24) - Handle windows newlines on non windows machines. ([@benogle](https://api.github.com/users/benogle))
+- [#23](https://github.com/kpdecker/jsdiff/pull/23) - Prettied up the API formatting a little, and added basic node and web examples ([@airportyh](https://api.github.com/users/airportyh))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.0.7...v1.0.8)
+
+## v1.0.7 - September 11th, 2013
+
+- [#22](https://github.com/kpdecker/jsdiff/pull/22) - Added variant of WordDiff that doesn't ignore whitespace differences ([@papandreou](https://api.github.com/users/papandreou)
+
+- Add 0.10 to travis tests - 243a526
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.0.6...v1.0.7)
+
+## v1.0.6 - August 30th, 2013
+
+- [#19](https://github.com/kpdecker/jsdiff/pull/19) - Explicitly define contents of npm package ([@sindresorhus](https://api.github.com/users/sindresorhus)
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.0.5...v1.0.6)
diff --git a/node_modules/diff/runtime.js b/node_modules/diff/runtime.js
new file mode 100644
index 0000000..fd8ca6e
--- /dev/null
+++ b/node_modules/diff/runtime.js
@@ -0,0 +1,3 @@
+require('babel-core/register')({
+  ignore: /\/lib\/|\/node_modules\//
+});
diff --git a/node_modules/diff/yarn.lock b/node_modules/diff/yarn.lock
new file mode 100644
index 0000000..29e3ab3
--- /dev/null
+++ b/node_modules/diff/yarn.lock
@@ -0,0 +1,5729 @@
+# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY.
+# yarn lockfile v1
+
+
+abbrev@1:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/abbrev/-/abbrev-1.1.1.tgz#f8f2c887ad10bf67f634f005b6987fed3179aac8"
+
+abbrev@1.0.x:
+  version "1.0.9"
+  resolved "https://registry.yarnpkg.com/abbrev/-/abbrev-1.0.9.tgz#91b4792588a7738c25f35dd6f63752a2f8776135"
+
+accepts@1.3.3:
+  version "1.3.3"
+  resolved "https://registry.yarnpkg.com/accepts/-/accepts-1.3.3.tgz#c3ca7434938648c3e0d9c1e328dd68b622c284ca"
+  dependencies:
+    mime-types "~2.1.11"
+    negotiator "0.6.1"
+
+accepts@~1.3.4:
+  version "1.3.5"
+  resolved "https://registry.yarnpkg.com/accepts/-/accepts-1.3.5.tgz#eb777df6011723a3b14e8a72c0805c8e86746bd2"
+  dependencies:
+    mime-types "~2.1.18"
+    negotiator "0.6.1"
+
+acorn@^3.0.0:
+  version "3.3.0"
+  resolved "https://registry.yarnpkg.com/acorn/-/acorn-3.3.0.tgz#45e37fb39e8da3f25baee3ff5369e2bb5f22017a"
+
+adm-zip@~0.4.3:
+  version "0.4.7"
+  resolved "https://registry.yarnpkg.com/adm-zip/-/adm-zip-0.4.7.tgz#8606c2cbf1c426ce8c8ec00174447fd49b6eafc1"
+
+after@0.8.2:
+  version "0.8.2"
+  resolved "https://registry.yarnpkg.com/after/-/after-0.8.2.tgz#fedb394f9f0e02aa9768e702bda23b505fae7e1f"
+
+agent-base@2:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/agent-base/-/agent-base-2.1.1.tgz#d6de10d5af6132d5bd692427d46fc538539094c7"
+  dependencies:
+    extend "~3.0.0"
+    semver "~5.0.1"
+
+ajv@^4.9.1:
+  version "4.11.8"
+  resolved "https://registry.yarnpkg.com/ajv/-/ajv-4.11.8.tgz#82ffb02b29e662ae53bdc20af15947706739c536"
+  dependencies:
+    co "^4.6.0"
+    json-stable-stringify "^1.0.1"
+
+ajv@^5.1.0:
+  version "5.5.2"
+  resolved "https://registry.yarnpkg.com/ajv/-/ajv-5.5.2.tgz#73b5eeca3fab653e3d3f9422b341ad42205dc965"
+  dependencies:
+    co "^4.6.0"
+    fast-deep-equal "^1.0.0"
+    fast-json-stable-stringify "^2.0.0"
+    json-schema-traverse "^0.3.0"
+
+align-text@^0.1.1, align-text@^0.1.3:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/align-text/-/align-text-0.1.4.tgz#0cd90a561093f35d0a99256c22b7069433fad117"
+  dependencies:
+    kind-of "^3.0.2"
+    longest "^1.0.1"
+    repeat-string "^1.5.2"
+
+amdefine@>=0.0.4:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/amdefine/-/amdefine-1.0.1.tgz#4a5282ac164729e93619bcfd3ad151f817ce91f5"
+
+ansi-escapes@^1.1.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/ansi-escapes/-/ansi-escapes-1.4.0.tgz#d3a8a83b319aa67793662b13e761c7911422306e"
+
+ansi-regex@^2.0.0:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-2.1.1.tgz#c3b33ab5ee360d86e0e628f0468ae7ef27d654df"
+
+ansi-regex@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-3.0.0.tgz#ed0317c322064f79466c02966bddb605ab37d998"
+
+ansi-styles@^2.2.1:
+  version "2.2.1"
+  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-2.2.1.tgz#b432dd3358b634cf75e1e4664368240533c1ddbe"
+
+ansi-styles@^3.2.1:
+  version "3.2.1"
+  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.2.1.tgz#41fbb20243e50b12be0f04b8dedbf07520ce841d"
+  dependencies:
+    color-convert "^1.9.0"
+
+anymatch@^1.3.0:
+  version "1.3.2"
+  resolved "https://registry.yarnpkg.com/anymatch/-/anymatch-1.3.2.tgz#553dcb8f91e3c889845dfdba34c77721b90b9d7a"
+  dependencies:
+    micromatch "^2.1.5"
+    normalize-path "^2.0.0"
+
+append-transform@^0.4.0:
+  version "0.4.0"
+  resolved "https://registry.yarnpkg.com/append-transform/-/append-transform-0.4.0.tgz#d76ebf8ca94d276e247a36bad44a4b74ab611991"
+  dependencies:
+    default-require-extensions "^1.0.0"
+
+aproba@^1.0.3:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/aproba/-/aproba-1.2.0.tgz#6802e6264efd18c790a1b0d517f0f2627bf2c94a"
+
+archiver@~0.14.0:
+  version "0.14.4"
+  resolved "https://registry.yarnpkg.com/archiver/-/archiver-0.14.4.tgz#5b9ddb9f5ee1ceef21cb8f3b020e6240ecb4315c"
+  dependencies:
+    async "~0.9.0"
+    buffer-crc32 "~0.2.1"
+    glob "~4.3.0"
+    lazystream "~0.1.0"
+    lodash "~3.2.0"
+    readable-stream "~1.0.26"
+    tar-stream "~1.1.0"
+    zip-stream "~0.5.0"
+
+archy@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/archy/-/archy-1.0.0.tgz#f9c8c13757cc1dd7bc379ac77b2c62a5c2868c40"
+
+are-we-there-yet@~1.1.2:
+  version "1.1.4"
+  resolved "https://registry.yarnpkg.com/are-we-there-yet/-/are-we-there-yet-1.1.4.tgz#bb5dca382bb94f05e15194373d16fd3ba1ca110d"
+  dependencies:
+    delegates "^1.0.0"
+    readable-stream "^2.0.6"
+
+argparse@^1.0.2, argparse@^1.0.7:
+  version "1.0.10"
+  resolved "https://registry.yarnpkg.com/argparse/-/argparse-1.0.10.tgz#bcd6791ea5ae09725e17e5ad988134cd40b3d911"
+  dependencies:
+    sprintf-js "~1.0.2"
+
+"argparse@~ 0.1.11":
+  version "0.1.16"
+  resolved "https://registry.yarnpkg.com/argparse/-/argparse-0.1.16.tgz#cfd01e0fbba3d6caed049fbd758d40f65196f57c"
+  dependencies:
+    underscore "~1.7.0"
+    underscore.string "~2.4.0"
+
+arr-diff@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/arr-diff/-/arr-diff-2.0.0.tgz#8f3b827f955a8bd669697e4a4256ac3ceae356cf"
+  dependencies:
+    arr-flatten "^1.0.1"
+
+arr-flatten@^1.0.1:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/arr-flatten/-/arr-flatten-1.1.0.tgz#36048bbff4e7b47e136644316c99669ea5ae91f1"
+
+array-find-index@^1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/array-find-index/-/array-find-index-1.0.2.tgz#df010aa1287e164bbda6f9723b0a96a1ec4187a1"
+
+array-flatten@1.1.1:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/array-flatten/-/array-flatten-1.1.1.tgz#9a5f699051b1e7073328f2a008968b64ea2955d2"
+
+array-slice@^0.2.3:
+  version "0.2.3"
+  resolved "https://registry.yarnpkg.com/array-slice/-/array-slice-0.2.3.tgz#dd3cfb80ed7973a75117cdac69b0b99ec86186f5"
+
+array-union@^1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/array-union/-/array-union-1.0.2.tgz#9a34410e4f4e3da23dea375be5be70f24778ec39"
+  dependencies:
+    array-uniq "^1.0.1"
+
+array-uniq@^1.0.1:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/array-uniq/-/array-uniq-1.0.3.tgz#af6ac877a25cc7f74e058894753858dfdb24fdb6"
+
+array-unique@^0.2.1:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/array-unique/-/array-unique-0.2.1.tgz#a1d97ccafcbc2625cc70fadceb36a50c58b01a53"
+
+arraybuffer.slice@0.0.6:
+  version "0.0.6"
+  resolved "https://registry.yarnpkg.com/arraybuffer.slice/-/arraybuffer.slice-0.0.6.tgz#f33b2159f0532a3f3107a272c0ccfbd1ad2979ca"
+
+arrify@^1.0.0, arrify@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/arrify/-/arrify-1.0.1.tgz#898508da2226f380df904728456849c1501a4b0d"
+
+asn1@0.1.11:
+  version "0.1.11"
+  resolved "https://registry.yarnpkg.com/asn1/-/asn1-0.1.11.tgz#559be18376d08a4ec4dbe80877d27818639b2df7"
+
+asn1@~0.2.3:
+  version "0.2.3"
+  resolved "https://registry.yarnpkg.com/asn1/-/asn1-0.2.3.tgz#dac8787713c9966849fc8180777ebe9c1ddf3b86"
+
+assert-plus@1.0.0, assert-plus@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/assert-plus/-/assert-plus-1.0.0.tgz#f12e0f3c5d77b0b1cdd9146942e4e96c1e4dd525"
+
+assert-plus@^0.1.5:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/assert-plus/-/assert-plus-0.1.5.tgz#ee74009413002d84cec7219c6ac811812e723160"
+
+assert-plus@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/assert-plus/-/assert-plus-0.2.0.tgz#d74e1b87e7affc0db8aadb7021f3fe48101ab234"
+
+assert@^1.1.1:
+  version "1.4.1"
+  resolved "https://registry.yarnpkg.com/assert/-/assert-1.4.1.tgz#99912d591836b5a6f5b345c0f07eefc08fc65d91"
+  dependencies:
+    util "0.10.3"
+
+assertion-error@^1.0.1:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/assertion-error/-/assertion-error-1.1.0.tgz#e60b6b0e8f301bd97e5375215bda406c85118c0b"
+
+async-each@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/async-each/-/async-each-1.0.1.tgz#19d386a1d9edc6e7c1c85d388aedbcc56d33602d"
+
+async@0.1.x, async@~0.1.18, async@~0.1.22:
+  version "0.1.22"
+  resolved "https://registry.yarnpkg.com/async/-/async-0.1.22.tgz#0fc1aaa088a0e3ef0ebe2d8831bab0dcf8845061"
+
+async@1.4.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/async/-/async-1.4.0.tgz#35f86f83c59e0421d099cd9a91d8278fb578c00d"
+
+async@1.x, async@^1.3.0, async@^1.4.0, async@^1.4.2, async@^1.5.0, async@^1.5.2:
+  version "1.5.2"
+  resolved "https://registry.yarnpkg.com/async/-/async-1.5.2.tgz#ec6a61ae56480c0c3cb241c95618e20892f9672a"
+
+async@^0.9.0, async@~0.9.0:
+  version "0.9.2"
+  resolved "https://registry.yarnpkg.com/async/-/async-0.9.2.tgz#aea74d5e61c1f899613bf64bda66d4c78f2fd17d"
+
+async@~0.2.6:
+  version "0.2.10"
+  resolved "https://registry.yarnpkg.com/async/-/async-0.2.10.tgz#b6bbe0b0674b9d719708ca38de8c237cb526c3d1"
+
+async@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/async/-/async-1.0.0.tgz#f8fc04ca3a13784ade9e1641af98578cfbd647a9"
+
+asynckit@^0.4.0:
+  version "0.4.0"
+  resolved "https://registry.yarnpkg.com/asynckit/-/asynckit-0.4.0.tgz#c79ed97f7f34cb8f2ba1bc9790bcc366474b4b79"
+
+aws-sign2@~0.5.0:
+  version "0.5.0"
+  resolved "https://registry.yarnpkg.com/aws-sign2/-/aws-sign2-0.5.0.tgz#c57103f7a17fc037f02d7c2e64b602ea223f7d63"
+
+aws-sign2@~0.6.0:
+  version "0.6.0"
+  resolved "https://registry.yarnpkg.com/aws-sign2/-/aws-sign2-0.6.0.tgz#14342dd38dbcc94d0e5b87d763cd63612c0e794f"
+
+aws-sign2@~0.7.0:
+  version "0.7.0"
+  resolved "https://registry.yarnpkg.com/aws-sign2/-/aws-sign2-0.7.0.tgz#b46e890934a9591f2d2f6f86d7e6a9f1b3fe76a8"
+
+aws4@^1.2.1, aws4@^1.6.0:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/aws4/-/aws4-1.6.0.tgz#83ef5ca860b2b32e4a0deedee8c771b9db57471e"
+
+babel-code-frame@^6.26.0:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-code-frame/-/babel-code-frame-6.26.0.tgz#63fd43f7dc1e3bb7ce35947db8fe369a3f58c74b"
+  dependencies:
+    chalk "^1.1.3"
+    esutils "^2.0.2"
+    js-tokens "^3.0.2"
+
+babel-core@^6.0.0, babel-core@^6.0.12, babel-core@^6.26.0, babel-core@^6.6.5:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-core/-/babel-core-6.26.0.tgz#af32f78b31a6fcef119c87b0fd8d9753f03a0bb8"
+  dependencies:
+    babel-code-frame "^6.26.0"
+    babel-generator "^6.26.0"
+    babel-helpers "^6.24.1"
+    babel-messages "^6.23.0"
+    babel-register "^6.26.0"
+    babel-runtime "^6.26.0"
+    babel-template "^6.26.0"
+    babel-traverse "^6.26.0"
+    babel-types "^6.26.0"
+    babylon "^6.18.0"
+    convert-source-map "^1.5.0"
+    debug "^2.6.8"
+    json5 "^0.5.1"
+    lodash "^4.17.4"
+    minimatch "^3.0.4"
+    path-is-absolute "^1.0.1"
+    private "^0.1.7"
+    slash "^1.0.0"
+    source-map "^0.5.6"
+
+babel-generator@^6.18.0, babel-generator@^6.26.0:
+  version "6.26.1"
+  resolved "https://registry.yarnpkg.com/babel-generator/-/babel-generator-6.26.1.tgz#1844408d3b8f0d35a404ea7ac180f087a601bd90"
+  dependencies:
+    babel-messages "^6.23.0"
+    babel-runtime "^6.26.0"
+    babel-types "^6.26.0"
+    detect-indent "^4.0.0"
+    jsesc "^1.3.0"
+    lodash "^4.17.4"
+    source-map "^0.5.7"
+    trim-right "^1.0.1"
+
+babel-helper-call-delegate@^6.24.1:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-helper-call-delegate/-/babel-helper-call-delegate-6.24.1.tgz#ece6aacddc76e41c3461f88bfc575bd0daa2df8d"
+  dependencies:
+    babel-helper-hoist-variables "^6.24.1"
+    babel-runtime "^6.22.0"
+    babel-traverse "^6.24.1"
+    babel-types "^6.24.1"
+
+babel-helper-define-map@^6.24.1:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-helper-define-map/-/babel-helper-define-map-6.26.0.tgz#a5f56dab41a25f97ecb498c7ebaca9819f95be5f"
+  dependencies:
+    babel-helper-function-name "^6.24.1"
+    babel-runtime "^6.26.0"
+    babel-types "^6.26.0"
+    lodash "^4.17.4"
+
+babel-helper-function-name@^6.24.1:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-helper-function-name/-/babel-helper-function-name-6.24.1.tgz#d3475b8c03ed98242a25b48351ab18399d3580a9"
+  dependencies:
+    babel-helper-get-function-arity "^6.24.1"
+    babel-runtime "^6.22.0"
+    babel-template "^6.24.1"
+    babel-traverse "^6.24.1"
+    babel-types "^6.24.1"
+
+babel-helper-get-function-arity@^6.24.1:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-helper-get-function-arity/-/babel-helper-get-function-arity-6.24.1.tgz#8f7782aa93407c41d3aa50908f89b031b1b6853d"
+  dependencies:
+    babel-runtime "^6.22.0"
+    babel-types "^6.24.1"
+
+babel-helper-hoist-variables@^6.24.1:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-helper-hoist-variables/-/babel-helper-hoist-variables-6.24.1.tgz#1ecb27689c9d25513eadbc9914a73f5408be7a76"
+  dependencies:
+    babel-runtime "^6.22.0"
+    babel-types "^6.24.1"
+
+babel-helper-optimise-call-expression@^6.24.1:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-helper-optimise-call-expression/-/babel-helper-optimise-call-expression-6.24.1.tgz#f7a13427ba9f73f8f4fa993c54a97882d1244257"
+  dependencies:
+    babel-runtime "^6.22.0"
+    babel-types "^6.24.1"
+
+babel-helper-regex@^6.24.1:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-helper-regex/-/babel-helper-regex-6.26.0.tgz#325c59f902f82f24b74faceed0363954f6495e72"
+  dependencies:
+    babel-runtime "^6.26.0"
+    babel-types "^6.26.0"
+    lodash "^4.17.4"
+
+babel-helper-replace-supers@^6.24.1:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-helper-replace-supers/-/babel-helper-replace-supers-6.24.1.tgz#bf6dbfe43938d17369a213ca8a8bf74b6a90ab1a"
+  dependencies:
+    babel-helper-optimise-call-expression "^6.24.1"
+    babel-messages "^6.23.0"
+    babel-runtime "^6.22.0"
+    babel-template "^6.24.1"
+    babel-traverse "^6.24.1"
+    babel-types "^6.24.1"
+
+babel-helpers@^6.24.1:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-helpers/-/babel-helpers-6.24.1.tgz#3471de9caec388e5c850e597e58a26ddf37602b2"
+  dependencies:
+    babel-runtime "^6.22.0"
+    babel-template "^6.24.1"
+
+babel-loader@^6.0.0:
+  version "6.4.1"
+  resolved "https://registry.yarnpkg.com/babel-loader/-/babel-loader-6.4.1.tgz#0b34112d5b0748a8dcdbf51acf6f9bd42d50b8ca"
+  dependencies:
+    find-cache-dir "^0.1.1"
+    loader-utils "^0.2.16"
+    mkdirp "^0.5.1"
+    object-assign "^4.0.1"
+
+babel-messages@^6.23.0:
+  version "6.23.0"
+  resolved "https://registry.yarnpkg.com/babel-messages/-/babel-messages-6.23.0.tgz#f3cdf4703858035b2a2951c6ec5edf6c62f2630e"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-check-es2015-constants@^6.3.13:
+  version "6.22.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-check-es2015-constants/-/babel-plugin-check-es2015-constants-6.22.0.tgz#35157b101426fd2ffd3da3f75c7d1e91835bbf8a"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-syntax-async-functions@^6.3.13:
+  version "6.13.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-syntax-async-functions/-/babel-plugin-syntax-async-functions-6.13.0.tgz#cad9cad1191b5ad634bf30ae0872391e0647be95"
+
+babel-plugin-transform-es2015-arrow-functions@^6.3.13:
+  version "6.22.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-arrow-functions/-/babel-plugin-transform-es2015-arrow-functions-6.22.0.tgz#452692cb711d5f79dc7f85e440ce41b9f244d221"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es2015-block-scoped-functions@^6.3.13:
+  version "6.22.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-block-scoped-functions/-/babel-plugin-transform-es2015-block-scoped-functions-6.22.0.tgz#bbc51b49f964d70cb8d8e0b94e820246ce3a6141"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es2015-block-scoping@^6.6.0, babel-plugin-transform-es2015-block-scoping@^6.6.5:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-block-scoping/-/babel-plugin-transform-es2015-block-scoping-6.26.0.tgz#d70f5299c1308d05c12f463813b0a09e73b1895f"
+  dependencies:
+    babel-runtime "^6.26.0"
+    babel-template "^6.26.0"
+    babel-traverse "^6.26.0"
+    babel-types "^6.26.0"
+    lodash "^4.17.4"
+
+babel-plugin-transform-es2015-classes@^6.6.0:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-classes/-/babel-plugin-transform-es2015-classes-6.24.1.tgz#5a4c58a50c9c9461e564b4b2a3bfabc97a2584db"
+  dependencies:
+    babel-helper-define-map "^6.24.1"
+    babel-helper-function-name "^6.24.1"
+    babel-helper-optimise-call-expression "^6.24.1"
+    babel-helper-replace-supers "^6.24.1"
+    babel-messages "^6.23.0"
+    babel-runtime "^6.22.0"
+    babel-template "^6.24.1"
+    babel-traverse "^6.24.1"
+    babel-types "^6.24.1"
+
+babel-plugin-transform-es2015-computed-properties@^6.3.13:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-computed-properties/-/babel-plugin-transform-es2015-computed-properties-6.24.1.tgz#6fe2a8d16895d5634f4cd999b6d3480a308159b3"
+  dependencies:
+    babel-runtime "^6.22.0"
+    babel-template "^6.24.1"
+
+babel-plugin-transform-es2015-destructuring@^6.6.0:
+  version "6.23.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-destructuring/-/babel-plugin-transform-es2015-destructuring-6.23.0.tgz#997bb1f1ab967f682d2b0876fe358d60e765c56d"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es2015-duplicate-keys@^6.6.0:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-duplicate-keys/-/babel-plugin-transform-es2015-duplicate-keys-6.24.1.tgz#73eb3d310ca969e3ef9ec91c53741a6f1576423e"
+  dependencies:
+    babel-runtime "^6.22.0"
+    babel-types "^6.24.1"
+
+babel-plugin-transform-es2015-for-of@^6.6.0:
+  version "6.23.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-for-of/-/babel-plugin-transform-es2015-for-of-6.23.0.tgz#f47c95b2b613df1d3ecc2fdb7573623c75248691"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es2015-function-name@^6.3.13:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-function-name/-/babel-plugin-transform-es2015-function-name-6.24.1.tgz#834c89853bc36b1af0f3a4c5dbaa94fd8eacaa8b"
+  dependencies:
+    babel-helper-function-name "^6.24.1"
+    babel-runtime "^6.22.0"
+    babel-types "^6.24.1"
+
+babel-plugin-transform-es2015-literals@^6.3.13:
+  version "6.22.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-literals/-/babel-plugin-transform-es2015-literals-6.22.0.tgz#4f54a02d6cd66cf915280019a31d31925377ca2e"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es2015-modules-commonjs@6.7.7:
+  version "6.7.7"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-modules-commonjs/-/babel-plugin-transform-es2015-modules-commonjs-6.7.7.tgz#fa5ca2016617c4d712123d8cfc15787fcaa83f33"
+  dependencies:
+    babel-plugin-transform-strict-mode "^6.6.5"
+    babel-runtime "^5.0.0"
+    babel-template "^6.7.0"
+    babel-types "^6.7.7"
+
+babel-plugin-transform-es2015-modules-commonjs@^6.6.0:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-modules-commonjs/-/babel-plugin-transform-es2015-modules-commonjs-6.26.0.tgz#0d8394029b7dc6abe1a97ef181e00758dd2e5d8a"
+  dependencies:
+    babel-plugin-transform-strict-mode "^6.24.1"
+    babel-runtime "^6.26.0"
+    babel-template "^6.26.0"
+    babel-types "^6.26.0"
+
+babel-plugin-transform-es2015-object-super@^6.3.13:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-object-super/-/babel-plugin-transform-es2015-object-super-6.24.1.tgz#24cef69ae21cb83a7f8603dad021f572eb278f8d"
+  dependencies:
+    babel-helper-replace-supers "^6.24.1"
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es2015-parameters@^6.6.0:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-parameters/-/babel-plugin-transform-es2015-parameters-6.24.1.tgz#57ac351ab49caf14a97cd13b09f66fdf0a625f2b"
+  dependencies:
+    babel-helper-call-delegate "^6.24.1"
+    babel-helper-get-function-arity "^6.24.1"
+    babel-runtime "^6.22.0"
+    babel-template "^6.24.1"
+    babel-traverse "^6.24.1"
+    babel-types "^6.24.1"
+
+babel-plugin-transform-es2015-shorthand-properties@^6.3.13:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-shorthand-properties/-/babel-plugin-transform-es2015-shorthand-properties-6.24.1.tgz#24f875d6721c87661bbd99a4622e51f14de38aa0"
+  dependencies:
+    babel-runtime "^6.22.0"
+    babel-types "^6.24.1"
+
+babel-plugin-transform-es2015-spread@^6.3.13:
+  version "6.22.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-spread/-/babel-plugin-transform-es2015-spread-6.22.0.tgz#d6d68a99f89aedc4536c81a542e8dd9f1746f8d1"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es2015-sticky-regex@^6.3.13:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-sticky-regex/-/babel-plugin-transform-es2015-sticky-regex-6.24.1.tgz#00c1cdb1aca71112cdf0cf6126c2ed6b457ccdbc"
+  dependencies:
+    babel-helper-regex "^6.24.1"
+    babel-runtime "^6.22.0"
+    babel-types "^6.24.1"
+
+babel-plugin-transform-es2015-template-literals@^6.6.0:
+  version "6.22.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-template-literals/-/babel-plugin-transform-es2015-template-literals-6.22.0.tgz#a84b3450f7e9f8f1f6839d6d687da84bb1236d8d"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es2015-typeof-symbol@^6.6.0:
+  version "6.23.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-typeof-symbol/-/babel-plugin-transform-es2015-typeof-symbol-6.23.0.tgz#dec09f1cddff94b52ac73d505c84df59dcceb372"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es2015-unicode-regex@^6.3.13:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-unicode-regex/-/babel-plugin-transform-es2015-unicode-regex-6.24.1.tgz#d38b12f42ea7323f729387f18a7c5ae1faeb35e9"
+  dependencies:
+    babel-helper-regex "^6.24.1"
+    babel-runtime "^6.22.0"
+    regexpu-core "^2.0.0"
+
+babel-plugin-transform-es3-member-expression-literals@^6.8.0:
+  version "6.22.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es3-member-expression-literals/-/babel-plugin-transform-es3-member-expression-literals-6.22.0.tgz#733d3444f3ecc41bef8ed1a6a4e09657b8969ebb"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es3-property-literals@^6.8.0:
+  version "6.22.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es3-property-literals/-/babel-plugin-transform-es3-property-literals-6.22.0.tgz#b2078d5842e22abf40f73e8cde9cd3711abd5758"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-regenerator@6.6.5:
+  version "6.6.5"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-regenerator/-/babel-plugin-transform-regenerator-6.6.5.tgz#079a982bd56e2235e31ee3b17ad54aeba898d4e7"
+  dependencies:
+    babel-core "^6.6.5"
+    babel-plugin-syntax-async-functions "^6.3.13"
+    babel-plugin-transform-es2015-block-scoping "^6.6.5"
+    babel-plugin-transform-es2015-for-of "^6.6.0"
+    babel-runtime "^5.0.0"
+    babel-traverse "^6.6.5"
+    babel-types "^6.6.5"
+    babylon "^6.6.5"
+    private "~0.1.5"
+
+babel-plugin-transform-regenerator@^6.6.0:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-regenerator/-/babel-plugin-transform-regenerator-6.26.0.tgz#e0703696fbde27f0a3efcacf8b4dca2f7b3a8f2f"
+  dependencies:
+    regenerator-transform "^0.10.0"
+
+babel-plugin-transform-strict-mode@^6.24.1, babel-plugin-transform-strict-mode@^6.6.5:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-strict-mode/-/babel-plugin-transform-strict-mode-6.24.1.tgz#d5faf7aa578a65bbe591cf5edae04a0c67020758"
+  dependencies:
+    babel-runtime "^6.22.0"
+    babel-types "^6.24.1"
+
+babel-preset-es2015-mod@^6.3.13:
+  version "6.6.0"
+  resolved "https://registry.yarnpkg.com/babel-preset-es2015-mod/-/babel-preset-es2015-mod-6.6.0.tgz#e105b62eb7c1001090ab86225298904cf90c1e8e"
+  dependencies:
+    babel-plugin-transform-es2015-modules-commonjs "6.7.7"
+    babel-plugin-transform-regenerator "6.6.5"
+    babel-preset-es2015 "6.6.0"
+    modify-babel-preset "2.0.2"
+
+babel-preset-es2015@6.6.0:
+  version "6.6.0"
+  resolved "https://registry.yarnpkg.com/babel-preset-es2015/-/babel-preset-es2015-6.6.0.tgz#88b33e58fec94c6ebde58dc65ece5d14e0ec2568"
+  dependencies:
+    babel-plugin-check-es2015-constants "^6.3.13"
+    babel-plugin-transform-es2015-arrow-functions "^6.3.13"
+    babel-plugin-transform-es2015-block-scoped-functions "^6.3.13"
+    babel-plugin-transform-es2015-block-scoping "^6.6.0"
+    babel-plugin-transform-es2015-classes "^6.6.0"
+    babel-plugin-transform-es2015-computed-properties "^6.3.13"
+    babel-plugin-transform-es2015-destructuring "^6.6.0"
+    babel-plugin-transform-es2015-duplicate-keys "^6.6.0"
+    babel-plugin-transform-es2015-for-of "^6.6.0"
+    babel-plugin-transform-es2015-function-name "^6.3.13"
+    babel-plugin-transform-es2015-literals "^6.3.13"
+    babel-plugin-transform-es2015-modules-commonjs "^6.6.0"
+    babel-plugin-transform-es2015-object-super "^6.3.13"
+    babel-plugin-transform-es2015-parameters "^6.6.0"
+    babel-plugin-transform-es2015-shorthand-properties "^6.3.13"
+    babel-plugin-transform-es2015-spread "^6.3.13"
+    babel-plugin-transform-es2015-sticky-regex "^6.3.13"
+    babel-plugin-transform-es2015-template-literals "^6.6.0"
+    babel-plugin-transform-es2015-typeof-symbol "^6.6.0"
+    babel-plugin-transform-es2015-unicode-regex "^6.3.13"
+    babel-plugin-transform-regenerator "^6.6.0"
+
+babel-preset-es3@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/babel-preset-es3/-/babel-preset-es3-1.0.1.tgz#e08dd950a1670dab8b50abceaa9b93d3d9accd1e"
+  dependencies:
+    babel-plugin-transform-es3-member-expression-literals "^6.8.0"
+    babel-plugin-transform-es3-property-literals "^6.8.0"
+
+babel-register@^6.26.0:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-register/-/babel-register-6.26.0.tgz#6ed021173e2fcb486d7acb45c6009a856f647071"
+  dependencies:
+    babel-core "^6.26.0"
+    babel-runtime "^6.26.0"
+    core-js "^2.5.0"
+    home-or-tmp "^2.0.0"
+    lodash "^4.17.4"
+    mkdirp "^0.5.1"
+    source-map-support "^0.4.15"
+
+babel-runtime@^5.0.0:
+  version "5.8.38"
+  resolved "https://registry.yarnpkg.com/babel-runtime/-/babel-runtime-5.8.38.tgz#1c0b02eb63312f5f087ff20450827b425c9d4c19"
+  dependencies:
+    core-js "^1.0.0"
+
+babel-runtime@^6.18.0, babel-runtime@^6.22.0, babel-runtime@^6.26.0:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-runtime/-/babel-runtime-6.26.0.tgz#965c7058668e82b55d7bfe04ff2337bc8b5647fe"
+  dependencies:
+    core-js "^2.4.0"
+    regenerator-runtime "^0.11.0"
+
+babel-template@^6.16.0, babel-template@^6.24.1, babel-template@^6.26.0, babel-template@^6.7.0:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-template/-/babel-template-6.26.0.tgz#de03e2d16396b069f46dd9fff8521fb1a0e35e02"
+  dependencies:
+    babel-runtime "^6.26.0"
+    babel-traverse "^6.26.0"
+    babel-types "^6.26.0"
+    babylon "^6.18.0"
+    lodash "^4.17.4"
+
+babel-traverse@^6.18.0, babel-traverse@^6.24.1, babel-traverse@^6.26.0, babel-traverse@^6.6.5:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-traverse/-/babel-traverse-6.26.0.tgz#46a9cbd7edcc62c8e5c064e2d2d8d0f4035766ee"
+  dependencies:
+    babel-code-frame "^6.26.0"
+    babel-messages "^6.23.0"
+    babel-runtime "^6.26.0"
+    babel-types "^6.26.0"
+    babylon "^6.18.0"
+    debug "^2.6.8"
+    globals "^9.18.0"
+    invariant "^2.2.2"
+    lodash "^4.17.4"
+
+babel-types@^6.18.0, babel-types@^6.19.0, babel-types@^6.24.1, babel-types@^6.26.0, babel-types@^6.6.5, babel-types@^6.7.7:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-types/-/babel-types-6.26.0.tgz#a3b073f94ab49eb6fa55cd65227a334380632497"
+  dependencies:
+    babel-runtime "^6.26.0"
+    esutils "^2.0.2"
+    lodash "^4.17.4"
+    to-fast-properties "^1.0.3"
+
+babylon@^6.18.0, babylon@^6.6.5:
+  version "6.18.0"
+  resolved "https://registry.yarnpkg.com/babylon/-/babylon-6.18.0.tgz#af2f3b88fa6f5c1e4c634d1a0f8eac4f55b395e3"
+
+backo2@1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/backo2/-/backo2-1.0.2.tgz#31ab1ac8b129363463e35b3ebb69f4dfcfba7947"
+
+balanced-match@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.0.tgz#89b4d199ab2bee49de164ea02b89ce462d71b767"
+
+base64-arraybuffer@0.1.5:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/base64-arraybuffer/-/base64-arraybuffer-0.1.5.tgz#73926771923b5a19747ad666aa5cd4bf9c6e9ce8"
+
+base64-js@^1.0.2:
+  version "1.2.3"
+  resolved "https://registry.yarnpkg.com/base64-js/-/base64-js-1.2.3.tgz#fb13668233d9614cf5fb4bce95a9ba4096cdf801"
+
+base64id@1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/base64id/-/base64id-1.0.0.tgz#47688cb99bb6804f0e06d3e763b1c32e57d8e6b6"
+
+batch@0.6.1:
+  version "0.6.1"
+  resolved "https://registry.yarnpkg.com/batch/-/batch-0.6.1.tgz#dc34314f4e679318093fc760272525f94bf25c16"
+
+batch@^0.5.3:
+  version "0.5.3"
+  resolved "https://registry.yarnpkg.com/batch/-/batch-0.5.3.tgz#3f3414f380321743bfc1042f9a83ff1d5824d464"
+
+bcrypt-pbkdf@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/bcrypt-pbkdf/-/bcrypt-pbkdf-1.0.1.tgz#63bc5dcb61331b92bc05fd528953c33462a06f8d"
+  dependencies:
+    tweetnacl "^0.14.3"
+
+better-assert@~1.0.0:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/better-assert/-/better-assert-1.0.2.tgz#40866b9e1b9e0b55b481894311e68faffaebc522"
+  dependencies:
+    callsite "1.0.0"
+
+big.js@^3.1.3:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/big.js/-/big.js-3.2.0.tgz#a5fc298b81b9e0dca2e458824784b65c52ba588e"
+
+binary-extensions@^1.0.0:
+  version "1.11.0"
+  resolved "https://registry.yarnpkg.com/binary-extensions/-/binary-extensions-1.11.0.tgz#46aa1751fb6a2f93ee5e689bb1087d4b14c6c205"
+
+bind-obj-methods@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/bind-obj-methods/-/bind-obj-methods-1.0.0.tgz#4f5979cac15793adf70e488161e463e209ca509c"
+
+bl@^0.9.0, bl@~0.9.0:
+  version "0.9.5"
+  resolved "https://registry.yarnpkg.com/bl/-/bl-0.9.5.tgz#c06b797af085ea00bc527afc8efcf11de2232054"
+  dependencies:
+    readable-stream "~1.0.26"
+
+blob@0.0.4:
+  version "0.0.4"
+  resolved "https://registry.yarnpkg.com/blob/-/blob-0.0.4.tgz#bcf13052ca54463f30f9fc7e95b9a47630a94921"
+
+block-stream@*:
+  version "0.0.9"
+  resolved "https://registry.yarnpkg.com/block-stream/-/block-stream-0.0.9.tgz#13ebfe778a03205cfe03751481ebb4b3300c126a"
+  dependencies:
+    inherits "~2.0.0"
+
+bluebird@^2.9.27, bluebird@^2.9.30:
+  version "2.11.0"
+  resolved "https://registry.yarnpkg.com/bluebird/-/bluebird-2.11.0.tgz#534b9033c022c9579c56ba3b3e5a5caafbb650e1"
+
+bluebird@^3.5.1:
+  version "3.5.1"
+  resolved "https://registry.yarnpkg.com/bluebird/-/bluebird-3.5.1.tgz#d9551f9de98f1fcda1e683d17ee91a0602ee2eb9"
+
+body-parser@1.18.2, body-parser@^1.12.4:
+  version "1.18.2"
+  resolved "https://registry.yarnpkg.com/body-parser/-/body-parser-1.18.2.tgz#87678a19d84b47d859b83199bd59bce222b10454"
+  dependencies:
+    bytes "3.0.0"
+    content-type "~1.0.4"
+    debug "2.6.9"
+    depd "~1.1.1"
+    http-errors "~1.6.2"
+    iconv-lite "0.4.19"
+    on-finished "~2.3.0"
+    qs "6.5.1"
+    raw-body "2.3.2"
+    type-is "~1.6.15"
+
+body-parser@~1.14.0:
+  version "1.14.2"
+  resolved "https://registry.yarnpkg.com/body-parser/-/body-parser-1.14.2.tgz#1015cb1fe2c443858259581db53332f8d0cf50f9"
+  dependencies:
+    bytes "2.2.0"
+    content-type "~1.0.1"
+    debug "~2.2.0"
+    depd "~1.1.0"
+    http-errors "~1.3.1"
+    iconv-lite "0.4.13"
+    on-finished "~2.3.0"
+    qs "5.2.0"
+    raw-body "~2.1.5"
+    type-is "~1.6.10"
+
+boom@2.x.x:
+  version "2.10.1"
+  resolved "https://registry.yarnpkg.com/boom/-/boom-2.10.1.tgz#39c8918ceff5799f83f9492a848f625add0c766f"
+  dependencies:
+    hoek "2.x.x"
+
+boom@4.x.x:
+  version "4.3.1"
+  resolved "https://registry.yarnpkg.com/boom/-/boom-4.3.1.tgz#4f8a3005cb4a7e3889f749030fd25b96e01d2e31"
+  dependencies:
+    hoek "4.x.x"
+
+boom@5.x.x:
+  version "5.2.0"
+  resolved "https://registry.yarnpkg.com/boom/-/boom-5.2.0.tgz#5dd9da6ee3a5f302077436290cb717d3f4a54e02"
+  dependencies:
+    hoek "4.x.x"
+
+brace-expansion@^1.0.0, brace-expansion@^1.1.7:
+  version "1.1.11"
+  resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd"
+  dependencies:
+    balanced-match "^1.0.0"
+    concat-map "0.0.1"
+
+braces@^0.1.2:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/braces/-/braces-0.1.5.tgz#c085711085291d8b75fdd74eab0f8597280711e6"
+  dependencies:
+    expand-range "^0.1.0"
+
+braces@^1.8.2:
+  version "1.8.5"
+  resolved "https://registry.yarnpkg.com/braces/-/braces-1.8.5.tgz#ba77962e12dff969d6b76711e914b737857bf6a7"
+  dependencies:
+    expand-range "^1.8.1"
+    preserve "^0.2.0"
+    repeat-element "^1.1.2"
+
+browserify-aes@0.4.0:
+  version "0.4.0"
+  resolved "https://registry.yarnpkg.com/browserify-aes/-/browserify-aes-0.4.0.tgz#067149b668df31c4b58533e02d01e806d8608e2c"
+  dependencies:
+    inherits "^2.0.1"
+
+browserify-zlib@^0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/browserify-zlib/-/browserify-zlib-0.1.4.tgz#bb35f8a519f600e0fa6b8485241c979d0141fb2d"
+  dependencies:
+    pako "~0.2.0"
+
+buffer-crc32@~0.2.1:
+  version "0.2.13"
+  resolved "https://registry.yarnpkg.com/buffer-crc32/-/buffer-crc32-0.2.13.tgz#0d333e3f00eac50aa1454abd30ef8c2a5d9a7242"
+
+buffer@^4.9.0:
+  version "4.9.1"
+  resolved "https://registry.yarnpkg.com/buffer/-/buffer-4.9.1.tgz#6d1bb601b07a4efced97094132093027c95bc298"
+  dependencies:
+    base64-js "^1.0.2"
+    ieee754 "^1.1.4"
+    isarray "^1.0.0"
+
+builtin-modules@^1.0.0:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/builtin-modules/-/builtin-modules-1.1.1.tgz#270f076c5a72c02f5b65a47df94c5fe3a278892f"
+
+builtin-status-codes@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/builtin-status-codes/-/builtin-status-codes-3.0.0.tgz#85982878e21b98e1c66425e03d0174788f569ee8"
+
+bytes@0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/bytes/-/bytes-0.1.0.tgz#c574812228126d6369d1576925a8579db3f8e5a2"
+
+bytes@2.2.0:
+  version "2.2.0"
+  resolved "https://registry.yarnpkg.com/bytes/-/bytes-2.2.0.tgz#fd35464a403f6f9117c2de3609ecff9cae000588"
+
+bytes@2.4.0:
+  version "2.4.0"
+  resolved "https://registry.yarnpkg.com/bytes/-/bytes-2.4.0.tgz#7d97196f9d5baf7f6935e25985549edd2a6c2339"
+
+bytes@3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/bytes/-/bytes-3.0.0.tgz#d32815404d689699f85a4ea4fa8755dd13a96048"
+
+caching-transform@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/caching-transform/-/caching-transform-1.0.1.tgz#6dbdb2f20f8d8fbce79f3e94e9d1742dcdf5c0a1"
+  dependencies:
+    md5-hex "^1.2.0"
+    mkdirp "^0.5.1"
+    write-file-atomic "^1.1.4"
+
+callsite@1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/callsite/-/callsite-1.0.0.tgz#280398e5d664bd74038b6f0905153e6e8af1bc20"
+
+camelcase-keys@^2.0.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/camelcase-keys/-/camelcase-keys-2.1.0.tgz#308beeaffdf28119051efa1d932213c91b8f92e7"
+  dependencies:
+    camelcase "^2.0.0"
+    map-obj "^1.0.0"
+
+camelcase@^1.0.2:
+  version "1.2.1"
+  resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-1.2.1.tgz#9bb5304d2e0b56698b2c758b08a3eaa9daa58a39"
+
+camelcase@^2.0.0:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-2.1.1.tgz#7c1d16d679a1bbe59ca02cacecfb011e201f5a1f"
+
+camelcase@^4.1.0:
+  version "4.1.0"
+  resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-4.1.0.tgz#d545635be1e33c542649c69173e5de6acfae34dd"
+
+caseless@~0.11.0:
+  version "0.11.0"
+  resolved "https://registry.yarnpkg.com/caseless/-/caseless-0.11.0.tgz#715b96ea9841593cc33067923f5ec60ebda4f7d7"
+
+caseless@~0.12.0:
+  version "0.12.0"
+  resolved "https://registry.yarnpkg.com/caseless/-/caseless-0.12.0.tgz#1b681c21ff84033c826543090689420d187151dc"
+
+caseless@~0.9.0:
+  version "0.9.0"
+  resolved "https://registry.yarnpkg.com/caseless/-/caseless-0.9.0.tgz#b7b65ce6bf1413886539cfd533f0b30effa9cf88"
+
+center-align@^0.1.1:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/center-align/-/center-align-0.1.3.tgz#aa0d32629b6ee972200411cbd4461c907bc2b7ad"
+  dependencies:
+    align-text "^0.1.3"
+    lazy-cache "^1.0.3"
+
+chai@^3.3.0:
+  version "3.5.0"
+  resolved "https://registry.yarnpkg.com/chai/-/chai-3.5.0.tgz#4d02637b067fe958bdbfdd3a40ec56fef7373247"
+  dependencies:
+    assertion-error "^1.0.1"
+    deep-eql "^0.1.3"
+    type-detect "^1.0.0"
+
+chalk@^1.0.0, chalk@^1.1.1, chalk@^1.1.3:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-1.1.3.tgz#a8115c55e4a702fe4d150abd3872822a7e09fc98"
+  dependencies:
+    ansi-styles "^2.2.1"
+    escape-string-regexp "^1.0.2"
+    has-ansi "^2.0.0"
+    strip-ansi "^3.0.0"
+    supports-color "^2.0.0"
+
+chalk@^2.0.1, chalk@^2.1.0:
+  version "2.3.2"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.3.2.tgz#250dc96b07491bfd601e648d66ddf5f60c7a5c65"
+  dependencies:
+    ansi-styles "^3.2.1"
+    escape-string-regexp "^1.0.5"
+    supports-color "^5.3.0"
+
+chokidar@^1.0.0, chokidar@^1.4.1:
+  version "1.7.0"
+  resolved "https://registry.yarnpkg.com/chokidar/-/chokidar-1.7.0.tgz#798e689778151c8076b4b360e5edd28cda2bb468"
+  dependencies:
+    anymatch "^1.3.0"
+    async-each "^1.0.0"
+    glob-parent "^2.0.0"
+    inherits "^2.0.1"
+    is-binary-path "^1.0.0"
+    is-glob "^2.0.0"
+    path-is-absolute "^1.0.0"
+    readdirp "^2.0.0"
+  optionalDependencies:
+    fsevents "^1.0.0"
+
+circular-json@^0.3.1:
+  version "0.3.3"
+  resolved "https://registry.yarnpkg.com/circular-json/-/circular-json-0.3.3.tgz#815c99ea84f6809529d2f45791bdf82711352d66"
+
+clean-yaml-object@^0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/clean-yaml-object/-/clean-yaml-object-0.1.0.tgz#63fb110dc2ce1a84dc21f6d9334876d010ae8b68"
+
+cli-cursor@^1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/cli-cursor/-/cli-cursor-1.0.2.tgz#64da3f7d56a54412e59794bd62dc35295e8f2987"
+  dependencies:
+    restore-cursor "^1.0.1"
+
+cli-width@^1.0.1:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/cli-width/-/cli-width-1.1.1.tgz#a4d293ef67ebb7b88d4a4d42c0ccf00c4d1e366d"
+
+cli@0.4.3:
+  version "0.4.3"
+  resolved "https://registry.yarnpkg.com/cli/-/cli-0.4.3.tgz#e6819c8d5faa957f64f98f66a8506268c1d1f17d"
+  dependencies:
+    glob ">= 3.1.4"
+
+cliui@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/cliui/-/cliui-2.1.0.tgz#4b475760ff80264c762c3a1719032e91c7fea0d1"
+  dependencies:
+    center-align "^0.1.1"
+    right-align "^0.1.1"
+    wordwrap "0.0.2"
+
+cliui@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/cliui/-/cliui-4.0.0.tgz#743d4650e05f36d1ed2575b59638d87322bfbbcc"
+  dependencies:
+    string-width "^2.1.1"
+    strip-ansi "^4.0.0"
+    wrap-ansi "^2.0.0"
+
+clone@^1.0.2:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/clone/-/clone-1.0.3.tgz#298d7e2231660f40c003c2ed3140decf3f53085f"
+
+co@^4.6.0:
+  version "4.6.0"
+  resolved "https://registry.yarnpkg.com/co/-/co-4.6.0.tgz#6ea6bdf3d853ae54ccb8e47bfa0bf3f9031fb184"
+
+code-point-at@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/code-point-at/-/code-point-at-1.1.0.tgz#0d070b4d043a5bea33a2f1a40e2edb3d9a4ccf77"
+
+coffee-script@~1.3.3:
+  version "1.3.3"
+  resolved "https://registry.yarnpkg.com/coffee-script/-/coffee-script-1.3.3.tgz#150d6b4cb522894369efed6a2101c20bc7f4a4f4"
+
+color-convert@^1.9.0:
+  version "1.9.1"
+  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.1.tgz#c1261107aeb2f294ebffec9ed9ecad529a6097ed"
+  dependencies:
+    color-name "^1.1.1"
+
+color-name@^1.1.1:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.3.tgz#a7d0558bd89c42f795dd42328f740831ca53bc25"
+
+color-support@^1.1.0:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/color-support/-/color-support-1.1.3.tgz#93834379a1cc9a0c61f82f52f0d04322251bd5a2"
+
+colors@0.x.x, colors@~0.6.0, colors@~0.6.2:
+  version "0.6.2"
+  resolved "https://registry.yarnpkg.com/colors/-/colors-0.6.2.tgz#2423fe6678ac0c5dae8852e5d0e5be08c997abcc"
+
+colors@^1.1.0, colors@^1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/colors/-/colors-1.1.2.tgz#168a4701756b6a7f51a12ce0c97bfa28c084ed63"
+
+combined-stream@1.0.6, combined-stream@^1.0.5, combined-stream@~1.0.5:
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/combined-stream/-/combined-stream-1.0.6.tgz#723e7df6e801ac5613113a7e445a9b69cb632818"
+  dependencies:
+    delayed-stream "~1.0.0"
+
+combined-stream@~0.0.4, combined-stream@~0.0.5:
+  version "0.0.7"
+  resolved "https://registry.yarnpkg.com/combined-stream/-/combined-stream-0.0.7.tgz#0137e657baa5a7541c57ac37ac5fc07d73b4dc1f"
+  dependencies:
+    delayed-stream "0.0.5"
+
+commander@0.6.1:
+  version "0.6.1"
+  resolved "https://registry.yarnpkg.com/commander/-/commander-0.6.1.tgz#fa68a14f6a945d54dbbe50d8cdb3320e9e3b1a06"
+
+commander@2.3.0:
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/commander/-/commander-2.3.0.tgz#fd430e889832ec353b9acd1de217c11cb3eef873"
+
+commander@^2.8.1, commander@^2.9.0:
+  version "2.14.1"
+  resolved "https://registry.yarnpkg.com/commander/-/commander-2.14.1.tgz#2235123e37af8ca3c65df45b026dbd357b01b9aa"
+
+commondir@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/commondir/-/commondir-1.0.1.tgz#ddd800da0c66127393cca5950ea968a3aaf1253b"
+
+component-bind@1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/component-bind/-/component-bind-1.0.0.tgz#00c608ab7dcd93897c0009651b1d3a8e1e73bbd1"
+
+component-emitter@1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/component-emitter/-/component-emitter-1.1.2.tgz#296594f2753daa63996d2af08d15a95116c9aec3"
+
+component-emitter@1.2.1:
+  version "1.2.1"
+  resolved "https://registry.yarnpkg.com/component-emitter/-/component-emitter-1.2.1.tgz#137918d6d78283f7df7a6b7c5a63e140e69425e6"
+
+component-inherit@0.0.3:
+  version "0.0.3"
+  resolved "https://registry.yarnpkg.com/component-inherit/-/component-inherit-0.0.3.tgz#645fc4adf58b72b649d5cae65135619db26ff143"
+
+compress-commons@~0.2.0:
+  version "0.2.9"
+  resolved "https://registry.yarnpkg.com/compress-commons/-/compress-commons-0.2.9.tgz#422d927430c01abd06cd455b6dfc04cb4cf8003c"
+  dependencies:
+    buffer-crc32 "~0.2.1"
+    crc32-stream "~0.3.1"
+    node-int64 "~0.3.0"
+    readable-stream "~1.0.26"
+
+compressible@~2.0.13:
+  version "2.0.13"
+  resolved "https://registry.yarnpkg.com/compressible/-/compressible-2.0.13.tgz#0d1020ab924b2fdb4d6279875c7d6daba6baa7a9"
+  dependencies:
+    mime-db ">= 1.33.0 < 2"
+
+compression@^1.5.2:
+  version "1.7.2"
+  resolved "https://registry.yarnpkg.com/compression/-/compression-1.7.2.tgz#aaffbcd6aaf854b44ebb280353d5ad1651f59a69"
+  dependencies:
+    accepts "~1.3.4"
+    bytes "3.0.0"
+    compressible "~2.0.13"
+    debug "2.6.9"
+    on-headers "~1.0.1"
+    safe-buffer "5.1.1"
+    vary "~1.1.2"
+
+concat-map@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b"
+
+concat-stream@1.6.0:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/concat-stream/-/concat-stream-1.6.0.tgz#0aac662fd52be78964d5532f694784e70110acf7"
+  dependencies:
+    inherits "^2.0.3"
+    readable-stream "^2.2.2"
+    typedarray "^0.0.6"
+
+concat-stream@^1.4.1, concat-stream@^1.4.6:
+  version "1.6.1"
+  resolved "https://registry.yarnpkg.com/concat-stream/-/concat-stream-1.6.1.tgz#261b8f518301f1d834e36342b9fea095d2620a26"
+  dependencies:
+    inherits "^2.0.3"
+    readable-stream "^2.2.2"
+    typedarray "^0.0.6"
+
+connect-history-api-fallback@^1.3.0:
+  version "1.5.0"
+  resolved "https://registry.yarnpkg.com/connect-history-api-fallback/-/connect-history-api-fallback-1.5.0.tgz#b06873934bc5e344fef611a196a6faae0aee015a"
+
+connect@^3.3.5:
+  version "3.6.6"
+  resolved "https://registry.yarnpkg.com/connect/-/connect-3.6.6.tgz#09eff6c55af7236e137135a72574858b6786f524"
+  dependencies:
+    debug "2.6.9"
+    finalhandler "1.1.0"
+    parseurl "~1.3.2"
+    utils-merge "1.0.1"
+
+connect@~2.4.4:
+  version "2.4.6"
+  resolved "https://registry.yarnpkg.com/connect/-/connect-2.4.6.tgz#012c2fe05018504ed2028668a16903199e6e7ace"
+  dependencies:
+    bytes "0.1.0"
+    cookie "0.0.4"
+    crc "0.2.0"
+    debug "*"
+    formidable "1.0.11"
+    fresh "0.1.0"
+    pause "0.0.1"
+    qs "0.5.1"
+    send "0.0.4"
+
+console-browserify@^1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/console-browserify/-/console-browserify-1.1.0.tgz#f0241c45730a9fc6323b206dbf38edc741d0bb10"
+  dependencies:
+    date-now "^0.1.4"
+
+console-control-strings@^1.0.0, console-control-strings@~1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/console-control-strings/-/console-control-strings-1.1.0.tgz#3d7cf4464db6446ea644bf4b39507f9851008e8e"
+
+constants-browserify@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/constants-browserify/-/constants-browserify-1.0.0.tgz#c20b96d8c617748aaf1c16021760cd27fcb8cb75"
+
+content-disposition@0.5.2:
+  version "0.5.2"
+  resolved "https://registry.yarnpkg.com/content-disposition/-/content-disposition-0.5.2.tgz#0cf68bb9ddf5f2be7961c3a85178cb85dba78cb4"
+
+content-type@~1.0.1, content-type@~1.0.4:
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/content-type/-/content-type-1.0.4.tgz#e138cc75e040c727b1966fe5e5f8c9aee256fe3b"
+
+convert-source-map@^1.1.1, convert-source-map@^1.3.0, convert-source-map@^1.5.0:
+  version "1.5.1"
+  resolved "https://registry.yarnpkg.com/convert-source-map/-/convert-source-map-1.5.1.tgz#b8278097b9bc229365de5c62cf5fcaed8b5599e5"
+
+cookie-signature@1.0.6:
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/cookie-signature/-/cookie-signature-1.0.6.tgz#e303a882b342cc3ee8ca513a79999734dab3ae2c"
+
+cookie@0.0.4:
+  version "0.0.4"
+  resolved "https://registry.yarnpkg.com/cookie/-/cookie-0.0.4.tgz#5456bd47aee2666eac976ea80a6105940483fe98"
+
+cookie@0.3.1:
+  version "0.3.1"
+  resolved "https://registry.yarnpkg.com/cookie/-/cookie-0.3.1.tgz#e7e0a1f9ef43b4c8ba925c5c5a96e806d16873bb"
+
+core-js@^1.0.0:
+  version "1.2.7"
+  resolved "https://registry.yarnpkg.com/core-js/-/core-js-1.2.7.tgz#652294c14651db28fa93bd2d5ff2983a4f08c636"
+
+core-js@^2.1.0, core-js@^2.4.0, core-js@^2.5.0:
+  version "2.5.3"
+  resolved "https://registry.yarnpkg.com/core-js/-/core-js-2.5.3.tgz#8acc38345824f16d8365b7c9b4259168e8ed603e"
+
+core-util-is@1.0.2, core-util-is@~1.0.0:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/core-util-is/-/core-util-is-1.0.2.tgz#b5fd54220aa2bc5ab57aab7140c940754503c1a7"
+
+coveralls@^2.13.3:
+  version "2.13.3"
+  resolved "https://registry.yarnpkg.com/coveralls/-/coveralls-2.13.3.tgz#9ad7c2ae527417f361e8b626483f48ee92dd2bc7"
+  dependencies:
+    js-yaml "3.6.1"
+    lcov-parse "0.0.10"
+    log-driver "1.2.5"
+    minimist "1.2.0"
+    request "2.79.0"
+
+crc32-stream@~0.3.1:
+  version "0.3.4"
+  resolved "https://registry.yarnpkg.com/crc32-stream/-/crc32-stream-0.3.4.tgz#73bc25b45fac1db6632231a7bfce8927e9f06552"
+  dependencies:
+    buffer-crc32 "~0.2.1"
+    readable-stream "~1.0.24"
+
+"crc32@>= 0.2.2":
+  version "0.2.2"
+  resolved "https://registry.yarnpkg.com/crc32/-/crc32-0.2.2.tgz#7ad220d6ffdcd119f9fc127a7772cacea390a4ba"
+
+crc@0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/crc/-/crc-0.2.0.tgz#f4486b9bf0a12df83c3fca14e31e030fdabd9454"
+
+cross-spawn@^4:
+  version "4.0.2"
+  resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-4.0.2.tgz#7b9247621c23adfdd3856004a823cbe397424d41"
+  dependencies:
+    lru-cache "^4.0.1"
+    which "^1.2.9"
+
+cross-spawn@^5.0.1:
+  version "5.1.0"
+  resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-5.1.0.tgz#e8bd0efee58fcff6f8f94510a0a554bbfa235449"
+  dependencies:
+    lru-cache "^4.0.1"
+    shebang-command "^1.2.0"
+    which "^1.2.9"
+
+cryptiles@2.x.x:
+  version "2.0.5"
+  resolved "https://registry.yarnpkg.com/cryptiles/-/cryptiles-2.0.5.tgz#3bdfecdc608147c1c67202fa291e7dca59eaa3b8"
+  dependencies:
+    boom "2.x.x"
+
+cryptiles@3.x.x:
+  version "3.1.2"
+  resolved "https://registry.yarnpkg.com/cryptiles/-/cryptiles-3.1.2.tgz#a89fbb220f5ce25ec56e8c4aa8a4fd7b5b0d29fe"
+  dependencies:
+    boom "5.x.x"
+
+crypto-browserify@3.3.0:
+  version "3.3.0"
+  resolved "https://registry.yarnpkg.com/crypto-browserify/-/crypto-browserify-3.3.0.tgz#b9fc75bb4a0ed61dcf1cd5dae96eb30c9c3e506c"
+  dependencies:
+    browserify-aes "0.4.0"
+    pbkdf2-compat "2.0.1"
+    ripemd160 "0.2.0"
+    sha.js "2.2.6"
+
+ctype@0.5.3:
+  version "0.5.3"
+  resolved "https://registry.yarnpkg.com/ctype/-/ctype-0.5.3.tgz#82c18c2461f74114ef16c135224ad0b9144ca12f"
+
+currently-unhandled@^0.4.1:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/currently-unhandled/-/currently-unhandled-0.4.1.tgz#988df33feab191ef799a61369dd76c17adf957ea"
+  dependencies:
+    array-find-index "^1.0.1"
+
+custom-event@~1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/custom-event/-/custom-event-1.0.1.tgz#5d02a46850adf1b4a317946a3928fccb5bfd0425"
+
+d@1:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/d/-/d-1.0.0.tgz#754bb5bfe55451da69a58b94d45f4c5b0462d58f"
+  dependencies:
+    es5-ext "^0.10.9"
+
+dashdash@^1.12.0:
+  version "1.14.1"
+  resolved "https://registry.yarnpkg.com/dashdash/-/dashdash-1.14.1.tgz#853cfa0f7cbe2fed5de20326b8dd581035f6e2f0"
+  dependencies:
+    assert-plus "^1.0.0"
+
+date-now@^0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/date-now/-/date-now-0.1.4.tgz#eaf439fd4d4848ad74e5cc7dbef200672b9e345b"
+
+dateformat@1.0.2-1.2.3:
+  version "1.0.2-1.2.3"
+  resolved "https://registry.yarnpkg.com/dateformat/-/dateformat-1.0.2-1.2.3.tgz#b0220c02de98617433b72851cf47de3df2cdbee9"
+
+debug-log@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/debug-log/-/debug-log-1.0.1.tgz#2307632d4c04382b8df8a32f70b895046d52745f"
+
+debug@*, debug@^3.1.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-3.1.0.tgz#5bb5a0672628b64149566ba16819e61518c67261"
+  dependencies:
+    ms "2.0.0"
+
+debug@2, debug@2.6.9, debug@^2.1.1, debug@^2.1.3, debug@^2.2.0, debug@^2.6.6, debug@^2.6.8:
+  version "2.6.9"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.9.tgz#5d128515df134ff327e90a4c93f4e077a536341f"
+  dependencies:
+    ms "2.0.0"
+
+debug@2.2.0, debug@~2.2.0:
+  version "2.2.0"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-2.2.0.tgz#f87057e995b1a1f6ae6a4960664137bc56f039da"
+  dependencies:
+    ms "0.7.1"
+
+debug@2.3.3:
+  version "2.3.3"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-2.3.3.tgz#40c453e67e6e13c901ddec317af8986cda9eff8c"
+  dependencies:
+    ms "0.7.2"
+
+decamelize@^1.0.0, decamelize@^1.1.1, decamelize@^1.1.2:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/decamelize/-/decamelize-1.2.0.tgz#f6534d15148269b20352e7bee26f501f9a191290"
+
+deep-eql@^0.1.3:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/deep-eql/-/deep-eql-0.1.3.tgz#ef558acab8de25206cd713906d74e56930eb69f2"
+  dependencies:
+    type-detect "0.1.1"
+
+deep-extend@~0.4.0:
+  version "0.4.2"
+  resolved "https://registry.yarnpkg.com/deep-extend/-/deep-extend-0.4.2.tgz#48b699c27e334bf89f10892be432f6e4c7d34a7f"
+
+deep-is@~0.1.2, deep-is@~0.1.3:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/deep-is/-/deep-is-0.1.3.tgz#b369d6fb5dbc13eecf524f91b070feedc357cf34"
+
+default-require-extensions@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/default-require-extensions/-/default-require-extensions-1.0.0.tgz#f37ea15d3e13ffd9b437d33e1a75b5fb97874cb8"
+  dependencies:
+    strip-bom "^2.0.0"
+
+"deflate-js@>= 0.2.2":
+  version "0.2.3"
+  resolved "https://registry.yarnpkg.com/deflate-js/-/deflate-js-0.2.3.tgz#f85abb58ebc5151a306147473d57c3e4f7e4426b"
+
+del@^2.0.2:
+  version "2.2.2"
+  resolved "https://registry.yarnpkg.com/del/-/del-2.2.2.tgz#c12c981d067846c84bcaf862cff930d907ffd1a8"
+  dependencies:
+    globby "^5.0.0"
+    is-path-cwd "^1.0.0"
+    is-path-in-cwd "^1.0.0"
+    object-assign "^4.0.1"
+    pify "^2.0.0"
+    pinkie-promise "^2.0.0"
+    rimraf "^2.2.8"
+
+delayed-stream@0.0.5:
+  version "0.0.5"
+  resolved "https://registry.yarnpkg.com/delayed-stream/-/delayed-stream-0.0.5.tgz#d4b1f43a93e8296dfe02694f4680bc37a313c73f"
+
+delayed-stream@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/delayed-stream/-/delayed-stream-1.0.0.tgz#df3ae199acadfb7d440aaae0b29e2272b24ec619"
+
+delegates@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/delegates/-/delegates-1.0.0.tgz#84c6e159b81904fdca59a0ef44cd870d31250f9a"
+
+depd@1.1.1:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/depd/-/depd-1.1.1.tgz#5783b4e1c459f06fa5ca27f991f3d06e7a310359"
+
+depd@~1.1.0, depd@~1.1.1:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/depd/-/depd-1.1.2.tgz#9bcd52e14c097763e749b274c4346ed2e560b5a9"
+
+destroy@~1.0.4:
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/destroy/-/destroy-1.0.4.tgz#978857442c44749e4206613e37946205826abd80"
+
+detect-indent@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/detect-indent/-/detect-indent-4.0.0.tgz#f76d064352cdf43a1cb6ce619c4ee3a9475de208"
+  dependencies:
+    repeating "^2.0.0"
+
+detect-libc@^1.0.2:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/detect-libc/-/detect-libc-1.0.3.tgz#fa137c4bd698edf55cd5cd02ac559f91a4c4ba9b"
+
+di@^0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/di/-/di-0.0.1.tgz#806649326ceaa7caa3306d75d985ea2748ba913c"
+
+diff@1.4.0, diff@^1.3.2:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/diff/-/diff-1.4.0.tgz#7f28d2eb9ee7b15a97efd89ce63dcfdaa3ccbabf"
+
+doctrine@^0.7.1:
+  version "0.7.2"
+  resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-0.7.2.tgz#7cb860359ba3be90e040b26b729ce4bfa654c523"
+  dependencies:
+    esutils "^1.1.6"
+    isarray "0.0.1"
+
+dom-serialize@^2.2.0:
+  version "2.2.1"
+  resolved "https://registry.yarnpkg.com/dom-serialize/-/dom-serialize-2.2.1.tgz#562ae8999f44be5ea3076f5419dcd59eb43ac95b"
+  dependencies:
+    custom-event "~1.0.0"
+    ent "~2.2.0"
+    extend "^3.0.0"
+    void-elements "^2.0.0"
+
+domain-browser@^1.1.1:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/domain-browser/-/domain-browser-1.2.0.tgz#3d31f50191a6749dd1375a7f522e823d42e54eda"
+
+ecc-jsbn@~0.1.1:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/ecc-jsbn/-/ecc-jsbn-0.1.1.tgz#0fc73a9ed5f0d53c38193398523ef7e543777505"
+  dependencies:
+    jsbn "~0.1.0"
+
+ee-first@1.1.1:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/ee-first/-/ee-first-1.1.1.tgz#590c61156b0ae2f4f0255732a158b266bc56b21d"
+
+emojis-list@^2.0.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/emojis-list/-/emojis-list-2.1.0.tgz#4daa4d9db00f9819880c79fa457ae5b09a1fd389"
+
+encodeurl@~1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/encodeurl/-/encodeurl-1.0.2.tgz#ad3ff4c86ec2d029322f5a02c3a9a606c95b3f59"
+
+end-of-stream@^1.0.0:
+  version "1.4.1"
+  resolved "https://registry.yarnpkg.com/end-of-stream/-/end-of-stream-1.4.1.tgz#ed29634d19baba463b6ce6b80a37213eab71ec43"
+  dependencies:
+    once "^1.4.0"
+
+engine.io-client@~1.8.4:
+  version "1.8.5"
+  resolved "https://registry.yarnpkg.com/engine.io-client/-/engine.io-client-1.8.5.tgz#fe7fb60cb0dcf2fa2859489329cb5968dedeb11f"
+  dependencies:
+    component-emitter "1.2.1"
+    component-inherit "0.0.3"
+    debug "2.3.3"
+    engine.io-parser "1.3.2"
+    has-cors "1.1.0"
+    indexof "0.0.1"
+    parsejson "0.0.3"
+    parseqs "0.0.5"
+    parseuri "0.0.5"
+    ws "~1.1.5"
+    xmlhttprequest-ssl "1.5.3"
+    yeast "0.1.2"
+
+engine.io-parser@1.3.2:
+  version "1.3.2"
+  resolved "https://registry.yarnpkg.com/engine.io-parser/-/engine.io-parser-1.3.2.tgz#937b079f0007d0893ec56d46cb220b8cb435220a"
+  dependencies:
+    after "0.8.2"
+    arraybuffer.slice "0.0.6"
+    base64-arraybuffer "0.1.5"
+    blob "0.0.4"
+    has-binary "0.1.7"
+    wtf-8 "1.0.0"
+
+engine.io@~1.8.4:
+  version "1.8.5"
+  resolved "https://registry.yarnpkg.com/engine.io/-/engine.io-1.8.5.tgz#4ebe5e75c6dc123dee4afdce6e5fdced21eb93f6"
+  dependencies:
+    accepts "1.3.3"
+    base64id "1.0.0"
+    cookie "0.3.1"
+    debug "2.3.3"
+    engine.io-parser "1.3.2"
+    ws "~1.1.5"
+
+enhanced-resolve@~0.9.0:
+  version "0.9.1"
+  resolved "https://registry.yarnpkg.com/enhanced-resolve/-/enhanced-resolve-0.9.1.tgz#4d6e689b3725f86090927ccc86cd9f1635b89e2e"
+  dependencies:
+    graceful-fs "^4.1.2"
+    memory-fs "^0.2.0"
+    tapable "^0.1.8"
+
+ent@~2.2.0:
+  version "2.2.0"
+  resolved "https://registry.yarnpkg.com/ent/-/ent-2.2.0.tgz#e964219325a21d05f44466a2f686ed6ce5f5dd1d"
+
+errno@^0.1.3:
+  version "0.1.7"
+  resolved "https://registry.yarnpkg.com/errno/-/errno-0.1.7.tgz#4684d71779ad39af177e3f007996f7c67c852618"
+  dependencies:
+    prr "~1.0.1"
+
+error-ex@^1.2.0:
+  version "1.3.1"
+  resolved "https://registry.yarnpkg.com/error-ex/-/error-ex-1.3.1.tgz#f855a86ce61adc4e8621c3cda21e7a7612c3a8dc"
+  dependencies:
+    is-arrayish "^0.2.1"
+
+es5-ext@^0.10.14, es5-ext@^0.10.35, es5-ext@^0.10.9, es5-ext@~0.10.14:
+  version "0.10.39"
+  resolved "https://registry.yarnpkg.com/es5-ext/-/es5-ext-0.10.39.tgz#fca21b67559277ca4ac1a1ed7048b107b6f76d87"
+  dependencies:
+    es6-iterator "~2.0.3"
+    es6-symbol "~3.1.1"
+
+es6-iterator@^2.0.1, es6-iterator@~2.0.1, es6-iterator@~2.0.3:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/es6-iterator/-/es6-iterator-2.0.3.tgz#a7de889141a05a94b0854403b2d0a0fbfa98f3b7"
+  dependencies:
+    d "1"
+    es5-ext "^0.10.35"
+    es6-symbol "^3.1.1"
+
+es6-map@^0.1.3:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/es6-map/-/es6-map-0.1.5.tgz#9136e0503dcc06a301690f0bb14ff4e364e949f0"
+  dependencies:
+    d "1"
+    es5-ext "~0.10.14"
+    es6-iterator "~2.0.1"
+    es6-set "~0.1.5"
+    es6-symbol "~3.1.1"
+    event-emitter "~0.3.5"
+
+es6-promise@^4.0.3:
+  version "4.2.4"
+  resolved "https://registry.yarnpkg.com/es6-promise/-/es6-promise-4.2.4.tgz#dc4221c2b16518760bd8c39a52d8f356fc00ed29"
+
+es6-set@~0.1.5:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/es6-set/-/es6-set-0.1.5.tgz#d2b3ec5d4d800ced818db538d28974db0a73ccb1"
+  dependencies:
+    d "1"
+    es5-ext "~0.10.14"
+    es6-iterator "~2.0.1"
+    es6-symbol "3.1.1"
+    event-emitter "~0.3.5"
+
+es6-symbol@3.1.1, es6-symbol@^3.1.1, es6-symbol@~3.1.1:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/es6-symbol/-/es6-symbol-3.1.1.tgz#bf00ef4fdab6ba1b46ecb7b629b4c7ed5715cc77"
+  dependencies:
+    d "1"
+    es5-ext "~0.10.14"
+
+es6-weak-map@^2.0.1:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/es6-weak-map/-/es6-weak-map-2.0.2.tgz#5e3ab32251ffd1538a1f8e5ffa1357772f92d96f"
+  dependencies:
+    d "1"
+    es5-ext "^0.10.14"
+    es6-iterator "^2.0.1"
+    es6-symbol "^3.1.1"
+
+escape-html@~1.0.3:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/escape-html/-/escape-html-1.0.3.tgz#0258eae4d3d0c0974de1c169188ef0051d1d1988"
+
+escape-string-regexp@1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.2.tgz#4dbc2fe674e71949caf3fb2695ce7f2dc1d9a8d1"
+
+escape-string-regexp@^1.0.2, escape-string-regexp@^1.0.3, escape-string-regexp@^1.0.5:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz#1b61c0562190a8dff6ae3bb2cf0200ca130b86d4"
+
+escodegen@1.7.x:
+  version "1.7.1"
+  resolved "https://registry.yarnpkg.com/escodegen/-/escodegen-1.7.1.tgz#30ecfcf66ca98dc67cd2fd162abeb6eafa8ce6fc"
+  dependencies:
+    esprima "^1.2.2"
+    estraverse "^1.9.1"
+    esutils "^2.0.2"
+    optionator "^0.5.0"
+  optionalDependencies:
+    source-map "~0.2.0"
+
+escope@^3.3.0:
+  version "3.6.0"
+  resolved "https://registry.yarnpkg.com/escope/-/escope-3.6.0.tgz#e01975e812781a163a6dadfdd80398dc64c889c3"
+  dependencies:
+    es6-map "^0.1.3"
+    es6-weak-map "^2.0.1"
+    esrecurse "^4.1.0"
+    estraverse "^4.1.1"
+
+eslint@^1.5.1, eslint@^1.6.0:
+  version "1.10.3"
+  resolved "https://registry.yarnpkg.com/eslint/-/eslint-1.10.3.tgz#fb19a91b13c158082bbca294b17d979bc8353a0a"
+  dependencies:
+    chalk "^1.0.0"
+    concat-stream "^1.4.6"
+    debug "^2.1.1"
+    doctrine "^0.7.1"
+    escape-string-regexp "^1.0.2"
+    escope "^3.3.0"
+    espree "^2.2.4"
+    estraverse "^4.1.1"
+    estraverse-fb "^1.3.1"
+    esutils "^2.0.2"
+    file-entry-cache "^1.1.1"
+    glob "^5.0.14"
+    globals "^8.11.0"
+    handlebars "^4.0.0"
+    inquirer "^0.11.0"
+    is-my-json-valid "^2.10.0"
+    is-resolvable "^1.0.0"
+    js-yaml "3.4.5"
+    json-stable-stringify "^1.0.0"
+    lodash.clonedeep "^3.0.1"
+    lodash.merge "^3.3.2"
+    lodash.omit "^3.1.0"
+    minimatch "^3.0.0"
+    mkdirp "^0.5.0"
+    object-assign "^4.0.1"
+    optionator "^0.6.0"
+    path-is-absolute "^1.0.0"
+    path-is-inside "^1.0.1"
+    shelljs "^0.5.3"
+    strip-json-comments "~1.0.1"
+    text-table "~0.2.0"
+    user-home "^2.0.0"
+    xml-escape "~1.0.0"
+
+espree@^2.2.4:
+  version "2.2.5"
+  resolved "https://registry.yarnpkg.com/espree/-/espree-2.2.5.tgz#df691b9310889402aeb29cc066708c56690b854b"
+
+esprima@2.5.x:
+  version "2.5.0"
+  resolved "https://registry.yarnpkg.com/esprima/-/esprima-2.5.0.tgz#f387a46fd344c1b1a39baf8c20bfb43b6d0058cc"
+
+esprima@^1.2.2:
+  version "1.2.5"
+  resolved "https://registry.yarnpkg.com/esprima/-/esprima-1.2.5.tgz#0993502feaf668138325756f30f9a51feeec11e9"
+
+esprima@^2.6.0:
+  version "2.7.3"
+  resolved "https://registry.yarnpkg.com/esprima/-/esprima-2.7.3.tgz#96e3b70d5779f6ad49cd032673d1c312767ba581"
+
+esprima@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/esprima/-/esprima-4.0.0.tgz#4499eddcd1110e0b218bacf2fa7f7f59f55ca804"
+
+"esprima@~ 1.0.2":
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/esprima/-/esprima-1.0.4.tgz#9f557e08fc3b4d26ece9dd34f8fbf476b62585ad"
+
+esrecurse@^4.1.0:
+  version "4.2.1"
+  resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.2.1.tgz#007a3b9fdbc2b3bb87e4879ea19c92fdbd3942cf"
+  dependencies:
+    estraverse "^4.1.0"
+
+estraverse-fb@^1.3.1:
+  version "1.3.2"
+  resolved "https://registry.yarnpkg.com/estraverse-fb/-/estraverse-fb-1.3.2.tgz#d323a4cb5e5ac331cea033413a9253e1643e07c4"
+
+estraverse@^1.9.1:
+  version "1.9.3"
+  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-1.9.3.tgz#af67f2dc922582415950926091a4005d29c9bb44"
+
+estraverse@^4.1.0, estraverse@^4.1.1:
+  version "4.2.0"
+  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-4.2.0.tgz#0dee3fed31fcd469618ce7342099fc1afa0bdb13"
+
+esutils@^1.1.6:
+  version "1.1.6"
+  resolved "https://registry.yarnpkg.com/esutils/-/esutils-1.1.6.tgz#c01ccaa9ae4b897c6d0c3e210ae52f3c7a844375"
+
+esutils@^2.0.2:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/esutils/-/esutils-2.0.2.tgz#0abf4f1caa5bcb1f7a9d8acc6dea4faaa04bac9b"
+
+etag@~1.8.1:
+  version "1.8.1"
+  resolved "https://registry.yarnpkg.com/etag/-/etag-1.8.1.tgz#41ae2eeb65efa62268aebfea83ac7d79299b0887"
+
+event-emitter@~0.3.5:
+  version "0.3.5"
+  resolved "https://registry.yarnpkg.com/event-emitter/-/event-emitter-0.3.5.tgz#df8c69eef1647923c7157b9ce83840610b02cc39"
+  dependencies:
+    d "1"
+    es5-ext "~0.10.14"
+
+eventemitter2@~0.4.13:
+  version "0.4.14"
+  resolved "https://registry.yarnpkg.com/eventemitter2/-/eventemitter2-0.4.14.tgz#8f61b75cde012b2e9eb284d4545583b5643b61ab"
+
+eventemitter3@1.x.x:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/eventemitter3/-/eventemitter3-1.2.0.tgz#1c86991d816ad1e504750e73874224ecf3bec508"
+
+events-to-array@^1.0.1:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/events-to-array/-/events-to-array-1.1.2.tgz#2d41f563e1fe400ed4962fe1a4d5c6a7539df7f6"
+
+events@^1.0.0:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/events/-/events-1.1.1.tgz#9ebdb7635ad099c70dcc4c2a1f5004288e8bd924"
+
+eventsource@0.1.6:
+  version "0.1.6"
+  resolved "https://registry.yarnpkg.com/eventsource/-/eventsource-0.1.6.tgz#0acede849ed7dd1ccc32c811bb11b944d4f29232"
+  dependencies:
+    original ">=0.0.5"
+
+execa@^0.7.0:
+  version "0.7.0"
+  resolved "https://registry.yarnpkg.com/execa/-/execa-0.7.0.tgz#944becd34cc41ee32a63a9faf27ad5a65fc59777"
+  dependencies:
+    cross-spawn "^5.0.1"
+    get-stream "^3.0.0"
+    is-stream "^1.1.0"
+    npm-run-path "^2.0.0"
+    p-finally "^1.0.0"
+    signal-exit "^3.0.0"
+    strip-eof "^1.0.0"
+
+exit-hook@^1.0.0:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/exit-hook/-/exit-hook-1.1.1.tgz#f05ca233b48c05d54fff07765df8507e95c02ff8"
+
+exit@~0.1.1:
+  version "0.1.2"
+  resolved "https://registry.yarnpkg.com/exit/-/exit-0.1.2.tgz#0632638f8d877cc82107d30a0fff1a17cba1cd0c"
+
+expand-braces@^0.1.1:
+  version "0.1.2"
+  resolved "https://registry.yarnpkg.com/expand-braces/-/expand-braces-0.1.2.tgz#488b1d1d2451cb3d3a6b192cfc030f44c5855fea"
+  dependencies:
+    array-slice "^0.2.3"
+    array-unique "^0.2.1"
+    braces "^0.1.2"
+
+expand-brackets@^0.1.4:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/expand-brackets/-/expand-brackets-0.1.5.tgz#df07284e342a807cd733ac5af72411e581d1177b"
+  dependencies:
+    is-posix-bracket "^0.1.0"
+
+expand-range@^0.1.0:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/expand-range/-/expand-range-0.1.1.tgz#4cb8eda0993ca56fa4f41fc42f3cbb4ccadff044"
+  dependencies:
+    is-number "^0.1.1"
+    repeat-string "^0.2.2"
+
+expand-range@^1.8.1:
+  version "1.8.2"
+  resolved "https://registry.yarnpkg.com/expand-range/-/expand-range-1.8.2.tgz#a299effd335fe2721ebae8e257ec79644fc85337"
+  dependencies:
+    fill-range "^2.1.0"
+
+express@^4.13.3:
+  version "4.16.2"
+  resolved "https://registry.yarnpkg.com/express/-/express-4.16.2.tgz#e35c6dfe2d64b7dca0a5cd4f21781be3299e076c"
+  dependencies:
+    accepts "~1.3.4"
+    array-flatten "1.1.1"
+    body-parser "1.18.2"
+    content-disposition "0.5.2"
+    content-type "~1.0.4"
+    cookie "0.3.1"
+    cookie-signature "1.0.6"
+    debug "2.6.9"
+    depd "~1.1.1"
+    encodeurl "~1.0.1"
+    escape-html "~1.0.3"
+    etag "~1.8.1"
+    finalhandler "1.1.0"
+    fresh "0.5.2"
+    merge-descriptors "1.0.1"
+    methods "~1.1.2"
+    on-finished "~2.3.0"
+    parseurl "~1.3.2"
+    path-to-regexp "0.1.7"
+    proxy-addr "~2.0.2"
+    qs "6.5.1"
+    range-parser "~1.2.0"
+    safe-buffer "5.1.1"
+    send "0.16.1"
+    serve-static "1.13.1"
+    setprototypeof "1.1.0"
+    statuses "~1.3.1"
+    type-is "~1.6.15"
+    utils-merge "1.0.1"
+    vary "~1.1.2"
+
+extend@3, extend@^3.0.0, extend@~3.0.0, extend@~3.0.1:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/extend/-/extend-3.0.1.tgz#a755ea7bc1adfcc5a31ce7e762dbaadc5e636444"
+
+extglob@^0.3.1:
+  version "0.3.2"
+  resolved "https://registry.yarnpkg.com/extglob/-/extglob-0.3.2.tgz#2e18ff3d2f49ab2765cec9023f011daa8d8349a1"
+  dependencies:
+    is-extglob "^1.0.0"
+
+extract-zip@^1.6.5:
+  version "1.6.6"
+  resolved "https://registry.yarnpkg.com/extract-zip/-/extract-zip-1.6.6.tgz#1290ede8d20d0872b429fd3f351ca128ec5ef85c"
+  dependencies:
+    concat-stream "1.6.0"
+    debug "2.6.9"
+    mkdirp "0.5.0"
+    yauzl "2.4.1"
+
+extsprintf@1.3.0:
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/extsprintf/-/extsprintf-1.3.0.tgz#96918440e3041a7a414f8c52e3c574eb3c3e1e05"
+
+extsprintf@^1.2.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/extsprintf/-/extsprintf-1.4.0.tgz#e2689f8f356fad62cca65a3a91c5df5f9551692f"
+
+eyes@0.1.x:
+  version "0.1.8"
+  resolved "https://registry.yarnpkg.com/eyes/-/eyes-0.1.8.tgz#62cf120234c683785d902348a800ef3e0cc20bc0"
+
+fast-deep-equal@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/fast-deep-equal/-/fast-deep-equal-1.1.0.tgz#c053477817c86b51daa853c81e059b733d023614"
+
+fast-json-stable-stringify@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz#d5142c0caee6b1189f87d3a76111064f86c8bbf2"
+
+fast-levenshtein@~1.0.0, fast-levenshtein@~1.0.6:
+  version "1.0.7"
+  resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-1.0.7.tgz#0178dcdee023b92905193af0959e8a7639cfdcb9"
+
+faye-websocket@^0.10.0, faye-websocket@~0.10.0:
+  version "0.10.0"
+  resolved "https://registry.yarnpkg.com/faye-websocket/-/faye-websocket-0.10.0.tgz#4e492f8d04dfb6f89003507f6edbf2d501e7c6f4"
+  dependencies:
+    websocket-driver ">=0.5.1"
+
+faye-websocket@~0.11.0:
+  version "0.11.1"
+  resolved "https://registry.yarnpkg.com/faye-websocket/-/faye-websocket-0.11.1.tgz#f0efe18c4f56e4f40afc7e06c719fd5ee6188f38"
+  dependencies:
+    websocket-driver ">=0.5.1"
+
+fd-slicer@~1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/fd-slicer/-/fd-slicer-1.0.1.tgz#8b5bcbd9ec327c5041bf9ab023fd6750f1177e65"
+  dependencies:
+    pend "~1.2.0"
+
+figures@^1.0.1, figures@^1.3.5:
+  version "1.7.0"
+  resolved "https://registry.yarnpkg.com/figures/-/figures-1.7.0.tgz#cbe1e3affcf1cd44b80cadfed28dc793a9701d2e"
+  dependencies:
+    escape-string-regexp "^1.0.5"
+    object-assign "^4.1.0"
+
+file-entry-cache@^1.1.1:
+  version "1.3.1"
+  resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-1.3.1.tgz#44c61ea607ae4be9c1402f41f44270cbfe334ff8"
+  dependencies:
+    flat-cache "^1.2.1"
+    object-assign "^4.0.1"
+
+file-sync-cmp@^0.1.0:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/file-sync-cmp/-/file-sync-cmp-0.1.1.tgz#a5e7a8ffbfa493b43b923bbd4ca89a53b63b612b"
+
+filename-regex@^2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/filename-regex/-/filename-regex-2.0.1.tgz#c1c4b9bee3e09725ddb106b75c1e301fe2f18b26"
+
+fileset@0.2.x:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/fileset/-/fileset-0.2.1.tgz#588ef8973c6623b2a76df465105696b96aac8067"
+  dependencies:
+    glob "5.x"
+    minimatch "2.x"
+
+fill-range@^2.1.0:
+  version "2.2.3"
+  resolved "https://registry.yarnpkg.com/fill-range/-/fill-range-2.2.3.tgz#50b77dfd7e469bc7492470963699fe7a8485a723"
+  dependencies:
+    is-number "^2.1.0"
+    isobject "^2.0.0"
+    randomatic "^1.1.3"
+    repeat-element "^1.1.2"
+    repeat-string "^1.5.2"
+
+finalhandler@1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/finalhandler/-/finalhandler-1.1.0.tgz#ce0b6855b45853e791b2fcc680046d88253dd7f5"
+  dependencies:
+    debug "2.6.9"
+    encodeurl "~1.0.1"
+    escape-html "~1.0.3"
+    on-finished "~2.3.0"
+    parseurl "~1.3.2"
+    statuses "~1.3.1"
+    unpipe "~1.0.0"
+
+find-cache-dir@^0.1.1:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/find-cache-dir/-/find-cache-dir-0.1.1.tgz#c8defae57c8a52a8a784f9e31c57c742e993a0b9"
+  dependencies:
+    commondir "^1.0.1"
+    mkdirp "^0.5.1"
+    pkg-dir "^1.0.0"
+
+find-up@^1.0.0:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/find-up/-/find-up-1.1.2.tgz#6b2e9822b1a2ce0a60ab64d610eccad53cb24d0f"
+  dependencies:
+    path-exists "^2.0.0"
+    pinkie-promise "^2.0.0"
+
+find-up@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/find-up/-/find-up-2.1.0.tgz#45d1b7e506c717ddd482775a2b77920a3c0c57a7"
+  dependencies:
+    locate-path "^2.0.0"
+
+findup-sync@~0.1.0, findup-sync@~0.1.2:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/findup-sync/-/findup-sync-0.1.3.tgz#7f3e7a97b82392c653bf06589bd85190e93c3683"
+  dependencies:
+    glob "~3.2.9"
+    lodash "~2.4.1"
+
+flat-cache@^1.2.1:
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-1.3.0.tgz#d3030b32b38154f4e3b7e9c709f490f7ef97c481"
+  dependencies:
+    circular-json "^0.3.1"
+    del "^2.0.2"
+    graceful-fs "^4.1.2"
+    write "^0.2.1"
+
+for-in@^1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/for-in/-/for-in-1.0.2.tgz#81068d295a8142ec0ac726c6e2200c30fb6d5e80"
+
+for-own@^0.1.4:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/for-own/-/for-own-0.1.5.tgz#5265c681a4f294dabbf17c9509b6763aa84510ce"
+  dependencies:
+    for-in "^1.0.1"
+
+foreground-child@^1.3.3, foreground-child@^1.5.3, foreground-child@^1.5.6:
+  version "1.5.6"
+  resolved "https://registry.yarnpkg.com/foreground-child/-/foreground-child-1.5.6.tgz#4fd71ad2dfde96789b980a5c0a295937cb2f5ce9"
+  dependencies:
+    cross-spawn "^4"
+    signal-exit "^3.0.0"
+
+forever-agent@~0.6.0, forever-agent@~0.6.1:
+  version "0.6.1"
+  resolved "https://registry.yarnpkg.com/forever-agent/-/forever-agent-0.6.1.tgz#fbc71f0c41adeb37f96c577ad1ed42d8fdacca91"
+
+form-data@~0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/form-data/-/form-data-0.2.0.tgz#26f8bc26da6440e299cbdcfb69035c4f77a6e466"
+  dependencies:
+    async "~0.9.0"
+    combined-stream "~0.0.4"
+    mime-types "~2.0.3"
+
+form-data@~2.1.1:
+  version "2.1.4"
+  resolved "https://registry.yarnpkg.com/form-data/-/form-data-2.1.4.tgz#33c183acf193276ecaa98143a69e94bfee1750d1"
+  dependencies:
+    asynckit "^0.4.0"
+    combined-stream "^1.0.5"
+    mime-types "^2.1.12"
+
+form-data@~2.3.1:
+  version "2.3.2"
+  resolved "https://registry.yarnpkg.com/form-data/-/form-data-2.3.2.tgz#4970498be604c20c005d4f5c23aecd21d6b49099"
+  dependencies:
+    asynckit "^0.4.0"
+    combined-stream "1.0.6"
+    mime-types "^2.1.12"
+
+formidable@1.0.11:
+  version "1.0.11"
+  resolved "https://registry.yarnpkg.com/formidable/-/formidable-1.0.11.tgz#68f63325a035e644b6f7bb3d11243b9761de1b30"
+
+forwarded@~0.1.2:
+  version "0.1.2"
+  resolved "https://registry.yarnpkg.com/forwarded/-/forwarded-0.1.2.tgz#98c23dab1175657b8c0573e8ceccd91b0ff18c84"
+
+fresh@0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/fresh/-/fresh-0.1.0.tgz#03e4b0178424e4c2d5d19a54d8814cdc97934850"
+
+fresh@0.5.2:
+  version "0.5.2"
+  resolved "https://registry.yarnpkg.com/fresh/-/fresh-0.5.2.tgz#3d8cadd90d976569fa835ab1f8e4b23a105605a7"
+
+fs-exists-cached@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/fs-exists-cached/-/fs-exists-cached-1.0.0.tgz#cf25554ca050dc49ae6656b41de42258989dcbce"
+
+fs-extra@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-1.0.0.tgz#cd3ce5f7e7cb6145883fcae3191e9877f8587950"
+  dependencies:
+    graceful-fs "^4.1.2"
+    jsonfile "^2.1.0"
+    klaw "^1.0.0"
+
+fs.realpath@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f"
+
+fsevents@^1.0.0:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/fsevents/-/fsevents-1.1.3.tgz#11f82318f5fe7bb2cd22965a108e9306208216d8"
+  dependencies:
+    nan "^2.3.0"
+    node-pre-gyp "^0.6.39"
+
+fstream-ignore@^1.0.5:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/fstream-ignore/-/fstream-ignore-1.0.5.tgz#9c31dae34767018fe1d249b24dada67d092da105"
+  dependencies:
+    fstream "^1.0.0"
+    inherits "2"
+    minimatch "^3.0.0"
+
+fstream@^1.0.0, fstream@^1.0.10, fstream@^1.0.2:
+  version "1.0.11"
+  resolved "https://registry.yarnpkg.com/fstream/-/fstream-1.0.11.tgz#5c1fb1f117477114f0632a0eb4b71b3cb0fd3171"
+  dependencies:
+    graceful-fs "^4.1.2"
+    inherits "~2.0.0"
+    mkdirp ">=0.5 0"
+    rimraf "2"
+
+function-loop@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/function-loop/-/function-loop-1.0.1.tgz#8076bb305e8e6a3cceee2920765f330d190f340c"
+
+gauge@~2.7.3:
+  version "2.7.4"
+  resolved "https://registry.yarnpkg.com/gauge/-/gauge-2.7.4.tgz#2c03405c7538c39d7eb37b317022e325fb018bf7"
+  dependencies:
+    aproba "^1.0.3"
+    console-control-strings "^1.0.0"
+    has-unicode "^2.0.0"
+    object-assign "^4.1.0"
+    signal-exit "^3.0.0"
+    string-width "^1.0.1"
+    strip-ansi "^3.0.1"
+    wide-align "^1.1.0"
+
+gaze@^1.0.0:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/gaze/-/gaze-1.1.2.tgz#847224677adb8870d679257ed3388fdb61e40105"
+  dependencies:
+    globule "^1.0.0"
+
+generate-function@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/generate-function/-/generate-function-2.0.0.tgz#6858fe7c0969b7d4e9093337647ac79f60dfbe74"
+
+generate-object-property@^1.1.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/generate-object-property/-/generate-object-property-1.2.0.tgz#9c0e1c40308ce804f4783618b937fa88f99d50d0"
+  dependencies:
+    is-property "^1.0.0"
+
+get-caller-file@^1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/get-caller-file/-/get-caller-file-1.0.2.tgz#f702e63127e7e231c160a80c1554acb70d5047e5"
+
+get-stdin@^4.0.1:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/get-stdin/-/get-stdin-4.0.1.tgz#b968c6b0a04384324902e8bf1a5df32579a450fe"
+
+get-stream@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/get-stream/-/get-stream-3.0.0.tgz#8e943d1358dc37555054ecbe2edb05aa174ede14"
+
+getobject@~0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/getobject/-/getobject-0.1.0.tgz#047a449789fa160d018f5486ed91320b6ec7885c"
+
+getpass@^0.1.1:
+  version "0.1.7"
+  resolved "https://registry.yarnpkg.com/getpass/-/getpass-0.1.7.tgz#5eff8e3e684d569ae4cb2b1282604e8ba62149fa"
+  dependencies:
+    assert-plus "^1.0.0"
+
+glob-base@^0.3.0:
+  version "0.3.0"
+  resolved "https://registry.yarnpkg.com/glob-base/-/glob-base-0.3.0.tgz#dbb164f6221b1c0b1ccf82aea328b497df0ea3c4"
+  dependencies:
+    glob-parent "^2.0.0"
+    is-glob "^2.0.0"
+
+glob-parent@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-2.0.0.tgz#81383d72db054fcccf5336daa902f182f6edbb28"
+  dependencies:
+    is-glob "^2.0.0"
+
+glob-whatev@~0.1.4:
+  version "0.1.8"
+  resolved "https://registry.yarnpkg.com/glob-whatev/-/glob-whatev-0.1.8.tgz#a33a763262e501e851bc84fd22b5736cff3826fd"
+  dependencies:
+    minimatch "~0.2.5"
+
+glob@3.2.11, glob@~3.2.9:
+  version "3.2.11"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-3.2.11.tgz#4a973f635b9190f715d10987d5c00fd2815ebe3d"
+  dependencies:
+    inherits "2"
+    minimatch "0.3"
+
+glob@5.x, glob@^5.0.14:
+  version "5.0.15"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-5.0.15.tgz#1bc936b9e02f4a603fcc222ecf7633d30b8b93b1"
+  dependencies:
+    inflight "^1.0.4"
+    inherits "2"
+    minimatch "2 || 3"
+    once "^1.3.0"
+    path-is-absolute "^1.0.0"
+
+"glob@>= 3.1.4", glob@^7.0.0, glob@^7.0.3, glob@^7.0.5, glob@^7.0.6, glob@~7.1.1:
+  version "7.1.2"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.2.tgz#c19c9df9a028702d678612384a6552404c636d15"
+  dependencies:
+    fs.realpath "^1.0.0"
+    inflight "^1.0.4"
+    inherits "2"
+    minimatch "^3.0.4"
+    once "^1.3.0"
+    path-is-absolute "^1.0.0"
+
+glob@~3.1.21:
+  version "3.1.21"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-3.1.21.tgz#d29e0a055dea5138f4d07ed40e8982e83c2066cd"
+  dependencies:
+    graceful-fs "~1.2.0"
+    inherits "1"
+    minimatch "~0.2.11"
+
+glob@~4.3.0:
+  version "4.3.5"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-4.3.5.tgz#80fbb08ca540f238acce5d11d1e9bc41e75173d3"
+  dependencies:
+    inflight "^1.0.4"
+    inherits "2"
+    minimatch "^2.0.1"
+    once "^1.3.0"
+
+globals@^8.11.0:
+  version "8.18.0"
+  resolved "https://registry.yarnpkg.com/globals/-/globals-8.18.0.tgz#93d4a62bdcac38cfafafc47d6b034768cb0ffcb4"
+
+globals@^9.18.0:
+  version "9.18.0"
+  resolved "https://registry.yarnpkg.com/globals/-/globals-9.18.0.tgz#aa3896b3e69b487f17e31ed2143d69a8e30c2d8a"
+
+globby@^5.0.0:
+  version "5.0.0"
+  resolved "https://registry.yarnpkg.com/globby/-/globby-5.0.0.tgz#ebd84667ca0dbb330b99bcfc68eac2bc54370e0d"
+  dependencies:
+    array-union "^1.0.1"
+    arrify "^1.0.0"
+    glob "^7.0.3"
+    object-assign "^4.0.1"
+    pify "^2.0.0"
+    pinkie-promise "^2.0.0"
+
+globule@^1.0.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/globule/-/globule-1.2.0.tgz#1dc49c6822dd9e8a2fa00ba2a295006e8664bd09"
+  dependencies:
+    glob "~7.1.1"
+    lodash "~4.17.4"
+    minimatch "~3.0.2"
+
+graceful-fs@^4.1.11, graceful-fs@^4.1.2, graceful-fs@^4.1.6, graceful-fs@^4.1.9:
+  version "4.1.11"
+  resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-4.1.11.tgz#0e8bdfe4d1ddb8854d64e04ea7c00e2a026e5658"
+
+graceful-fs@~1.2.0:
+  version "1.2.3"
+  resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-1.2.3.tgz#15a4806a57547cb2d2dbf27f42e89a8c3451b364"
+
+growl@1.9.2:
+  version "1.9.2"
+  resolved "https://registry.yarnpkg.com/growl/-/growl-1.9.2.tgz#0ea7743715db8d8de2c5ede1775e1b45ac85c02f"
+
+grunt-babel@^6.0.0:
+  version "6.0.0"
+  resolved "https://registry.yarnpkg.com/grunt-babel/-/grunt-babel-6.0.0.tgz#378189b487de1168c4c4a9fc88dd6005b35df960"
+  dependencies:
+    babel-core "^6.0.12"
+
+grunt-clean@^0.4.0:
+  version "0.4.0"
+  resolved "https://registry.yarnpkg.com/grunt-clean/-/grunt-clean-0.4.0.tgz#a7b4e188d7e94ca6c93bb88ec64096534931c40b"
+  dependencies:
+    grunt "~0.3.9"
+
+grunt-cli@^0.1.13:
+  version "0.1.13"
+  resolved "https://registry.yarnpkg.com/grunt-cli/-/grunt-cli-0.1.13.tgz#e9ebc4047631f5012d922770c39378133cad10f4"
+  dependencies:
+    findup-sync "~0.1.0"
+    nopt "~1.0.10"
+    resolve "~0.3.1"
+
+grunt-contrib-clean@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/grunt-contrib-clean/-/grunt-contrib-clean-1.1.0.tgz#564abf2d0378a983a15b9e3f30ee75b738c40638"
+  dependencies:
+    async "^1.5.2"
+    rimraf "^2.5.1"
+
+grunt-contrib-copy@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/grunt-contrib-copy/-/grunt-contrib-copy-1.0.0.tgz#7060c6581e904b8ab0d00f076e0a8f6e3e7c3573"
+  dependencies:
+    chalk "^1.1.1"
+    file-sync-cmp "^0.1.0"
+
+grunt-contrib-uglify@^1.0.0:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/grunt-contrib-uglify/-/grunt-contrib-uglify-1.0.2.tgz#ae67a46f9153edd4cb11813a55eb69c70d7db2fb"
+  dependencies:
+    chalk "^1.0.0"
+    lodash "^4.0.1"
+    maxmin "^1.1.0"
+    uglify-js "~2.6.2"
+    uri-path "^1.0.0"
+
+grunt-contrib-watch@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/grunt-contrib-watch/-/grunt-contrib-watch-1.0.0.tgz#84a1a7a1d6abd26ed568413496c73133e990018f"
+  dependencies:
+    async "^1.5.0"
+    gaze "^1.0.0"
+    lodash "^3.10.1"
+    tiny-lr "^0.2.1"
+
+grunt-eslint@^17.3.1:
+  version "17.3.2"
+  resolved "https://registry.yarnpkg.com/grunt-eslint/-/grunt-eslint-17.3.2.tgz#36a8b3be6ccde88c8b58f909745d75db19e5d4b0"
+  dependencies:
+    chalk "^1.0.0"
+    eslint "^1.5.1"
+
+grunt-karma@^0.12.1:
+  version "0.12.2"
+  resolved "https://registry.yarnpkg.com/grunt-karma/-/grunt-karma-0.12.2.tgz#d52676ab94779e4b20052b5f3519eb32653dc566"
+  dependencies:
+    lodash "^3.10.1"
+
+grunt-legacy-log-utils@~0.1.1:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/grunt-legacy-log-utils/-/grunt-legacy-log-utils-0.1.1.tgz#c0706b9dd9064e116f36f23fe4e6b048672c0f7e"
+  dependencies:
+    colors "~0.6.2"
+    lodash "~2.4.1"
+    underscore.string "~2.3.3"
+
+grunt-legacy-log@~0.1.0:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/grunt-legacy-log/-/grunt-legacy-log-0.1.3.tgz#ec29426e803021af59029f87d2f9cd7335a05531"
+  dependencies:
+    colors "~0.6.2"
+    grunt-legacy-log-utils "~0.1.1"
+    hooker "~0.2.3"
+    lodash "~2.4.1"
+    underscore.string "~2.3.3"
+
+grunt-legacy-util@~0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/grunt-legacy-util/-/grunt-legacy-util-0.2.0.tgz#93324884dbf7e37a9ff7c026dff451d94a9e554b"
+  dependencies:
+    async "~0.1.22"
+    exit "~0.1.1"
+    getobject "~0.1.0"
+    hooker "~0.2.3"
+    lodash "~0.9.2"
+    underscore.string "~2.2.1"
+    which "~1.0.5"
+
+grunt-mocha-istanbul@^3.0.1:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/grunt-mocha-istanbul/-/grunt-mocha-istanbul-3.0.1.tgz#a33525707b2fa82eb2f7fb3230513f7ca279bf60"
+
+grunt-mocha-test@^0.12.7:
+  version "0.12.7"
+  resolved "https://registry.yarnpkg.com/grunt-mocha-test/-/grunt-mocha-test-0.12.7.tgz#c61cdf32a6762954115fe712b983e3dd8e0c9554"
+  dependencies:
+    hooker "~0.2.3"
+    mkdirp "^0.5.0"
+
+grunt-webpack@^1.0.11:
+  version "1.0.18"
+  resolved "https://registry.yarnpkg.com/grunt-webpack/-/grunt-webpack-1.0.18.tgz#ff26c43ff35bae6cca707a93c4bcdd950a3ecbb7"
+  dependencies:
+    lodash "^4.7.0"
+
+grunt@^0.4.5:
+  version "0.4.5"
+  resolved "https://registry.yarnpkg.com/grunt/-/grunt-0.4.5.tgz#56937cd5194324adff6d207631832a9d6ba4e7f0"
+  dependencies:
+    async "~0.1.22"
+    coffee-script "~1.3.3"
+    colors "~0.6.2"
+    dateformat "1.0.2-1.2.3"
+    eventemitter2 "~0.4.13"
+    exit "~0.1.1"
+    findup-sync "~0.1.2"
+    getobject "~0.1.0"
+    glob "~3.1.21"
+    grunt-legacy-log "~0.1.0"
+    grunt-legacy-util "~0.2.0"
+    hooker "~0.2.3"
+    iconv-lite "~0.2.11"
+    js-yaml "~2.0.5"
+    lodash "~0.9.2"
+    minimatch "~0.2.12"
+    nopt "~1.0.10"
+    rimraf "~2.2.8"
+    underscore.string "~2.2.1"
+    which "~1.0.5"
+
+grunt@~0.3.9:
+  version "0.3.17"
+  resolved "https://registry.yarnpkg.com/grunt/-/grunt-0.3.17.tgz#f2e034d200befd5eeb38ba5c41d4ccd7235fd64d"
+  dependencies:
+    async "~0.1.18"
+    colors "~0.6.0"
+    connect "~2.4.4"
+    dateformat "1.0.2-1.2.3"
+    glob-whatev "~0.1.4"
+    gzip-js "~0.3.1"
+    hooker "~0.2.3"
+    jshint "~0.9.1"
+    nodeunit "~0.7.4"
+    nopt "~1.0.10"
+    prompt "~0.1.12"
+    semver "~1.0.13"
+    temporary "~0.0.4"
+    uglify-js "~1.3.3"
+    underscore "~1.2.4"
+    underscore.string "~2.1.1"
+
+gzip-js@~0.3.1:
+  version "0.3.2"
+  resolved "https://registry.yarnpkg.com/gzip-js/-/gzip-js-0.3.2.tgz#23117efeeb28cf385248deff0dffad894836d96b"
+  dependencies:
+    crc32 ">= 0.2.2"
+    deflate-js ">= 0.2.2"
+
+gzip-size@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/gzip-size/-/gzip-size-1.0.0.tgz#66cf8b101047227b95bace6ea1da0c177ed5c22f"
+  dependencies:
+    browserify-zlib "^0.1.4"
+    concat-stream "^1.4.1"
+
+handlebars@^4.0.0, handlebars@^4.0.1, handlebars@^4.0.3:
+  version "4.0.11"
+  resolved "https://registry.yarnpkg.com/handlebars/-/handlebars-4.0.11.tgz#630a35dfe0294bc281edae6ffc5d329fc7982dcc"
+  dependencies:
+    async "^1.4.0"
+    optimist "^0.6.1"
+    source-map "^0.4.4"
+  optionalDependencies:
+    uglify-js "^2.6"
+
+har-schema@^1.0.5:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/har-schema/-/har-schema-1.0.5.tgz#d263135f43307c02c602afc8fe95970c0151369e"
+
+har-schema@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/har-schema/-/har-schema-2.0.0.tgz#a94c2224ebcac04782a0d9035521f24735b7ec92"
+
+har-validator@^1.4.0:
+  version "1.8.0"
+  resolved "https://registry.yarnpkg.com/har-validator/-/har-validator-1.8.0.tgz#d83842b0eb4c435960aeb108a067a3aa94c0eeb2"
+  dependencies:
+    bluebird "^2.9.30"
+    chalk "^1.0.0"
+    commander "^2.8.1"
+    is-my-json-valid "^2.12.0"
+
+har-validator@~2.0.6:
+  version "2.0.6"
+  resolved "https://registry.yarnpkg.com/har-validator/-/har-validator-2.0.6.tgz#cdcbc08188265ad119b6a5a7c8ab70eecfb5d27d"
+  dependencies:
+    chalk "^1.1.1"
+    commander "^2.9.0"
+    is-my-json-valid "^2.12.4"
+    pinkie-promise "^2.0.0"
+
+har-validator@~4.2.1:
+  version "4.2.1"
+  resolved "https://registry.yarnpkg.com/har-validator/-/har-validator-4.2.1.tgz#33481d0f1bbff600dd203d75812a6a5fba002e2a"
+  dependencies:
+    ajv "^4.9.1"
+    har-schema "^1.0.5"
+
+har-validator@~5.0.3:
+  version "5.0.3"
+  resolved "https://registry.yarnpkg.com/har-validator/-/har-validator-5.0.3.tgz#ba402c266194f15956ef15e0fcf242993f6a7dfd"
+  dependencies:
+    ajv "^5.1.0"
+    har-schema "^2.0.0"
+
+has-ansi@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/has-ansi/-/has-ansi-2.0.0.tgz#34f5049ce1ecdf2b0649af3ef24e45ed35416d91"
+  dependencies:
+    ansi-regex "^2.0.0"
+
+has-binary@0.1.7:
+  version "0.1.7"
+  resolved "https://registry.yarnpkg.com/has-binary/-/has-binary-0.1.7.tgz#68e61eb16210c9545a0a5cce06a873912fe1e68c"
+  dependencies:
+    isarray "0.0.1"
+
+has-cors@1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/has-cors/-/has-cors-1.1.0.tgz#5e474793f7ea9843d1bb99c23eef49ff126fff39"
+
+has-flag@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-1.0.0.tgz#9d9e793165ce017a00f00418c43f942a7b1d11fa"
+
+has-flag@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-3.0.0.tgz#b5d454dc2199ae225699f3467e5a07f3b955bafd"
+
+has-unicode@^2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/has-unicode/-/has-unicode-2.0.1.tgz#e0e6fe6a28cf51138855e086d1691e771de2a8b9"
+
+hasha@^2.2.0:
+  version "2.2.0"
+  resolved "https://registry.yarnpkg.com/hasha/-/hasha-2.2.0.tgz#78d7cbfc1e6d66303fe79837365984517b2f6ee1"
+  dependencies:
+    is-stream "^1.0.1"
+    pinkie-promise "^2.0.0"
+
+hawk@3.1.3, hawk@~3.1.3:
+  version "3.1.3"
+  resolved "https://registry.yarnpkg.com/hawk/-/hawk-3.1.3.tgz#078444bd7c1640b0fe540d2c9b73d59678e8e1c4"
+  dependencies:
+    boom "2.x.x"
+    cryptiles "2.x.x"
+    hoek "2.x.x"
+    sntp "1.x.x"
+
+hawk@~2.3.0:
+  version "2.3.1"
+  resolved "https://registry.yarnpkg.com/hawk/-/hawk-2.3.1.tgz#1e731ce39447fa1d0f6d707f7bceebec0fd1ec1f"
+  dependencies:
+    boom "2.x.x"
+    cryptiles "2.x.x"
+    hoek "2.x.x"
+    sntp "1.x.x"
+
+hawk@~6.0.2:
+  version "6.0.2"
+  resolved "https://registry.yarnpkg.com/hawk/-/hawk-6.0.2.tgz#af4d914eb065f9b5ce4d9d11c1cb2126eecc3038"
+  dependencies:
+    boom "4.x.x"
+    cryptiles "3.x.x"
+    hoek "4.x.x"
+    sntp "2.x.x"
+
+hoek@2.x.x:
+  version "2.16.3"
+  resolved "https://registry.yarnpkg.com/hoek/-/hoek-2.16.3.tgz#20bb7403d3cea398e91dc4710a8ff1b8274a25ed"
+
+hoek@4.x.x:
+  version "4.2.1"
+  resolved "https://registry.yarnpkg.com/hoek/-/hoek-4.2.1.tgz#9634502aa12c445dd5a7c5734b572bb8738aacbb"
+
+home-or-tmp@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/home-or-tmp/-/home-or-tmp-2.0.0.tgz#e36c3f2d2cae7d746a857e38d18d5f32a7882db8"
+  dependencies:
+    os-homedir "^1.0.0"
+    os-tmpdir "^1.0.1"
+
+hooker@~0.2.3:
+  version "0.2.3"
+  resolved "https://registry.yarnpkg.com/hooker/-/hooker-0.2.3.tgz#b834f723cc4a242aa65963459df6d984c5d3d959"
+
+hosted-git-info@^2.1.4:
+  version "2.5.0"
+  resolved "https://registry.yarnpkg.com/hosted-git-info/-/hosted-git-info-2.5.0.tgz#6d60e34b3abbc8313062c3b798ef8d901a07af3c"
+
+http-errors@1.6.2, http-errors@~1.6.2:
+  version "1.6.2"
+  resolved "https://registry.yarnpkg.com/http-errors/-/http-errors-1.6.2.tgz#0a002cc85707192a7e7946ceedc11155f60ec736"
+  dependencies:
+    depd "1.1.1"
+    inherits "2.0.3"
+    setprototypeof "1.0.3"
+    statuses ">= 1.3.1 < 2"
+
+http-errors@~1.3.1:
+  version "1.3.1"
+  resolved "https://registry.yarnpkg.com/http-errors/-/http-errors-1.3.1.tgz#197e22cdebd4198585e8694ef6786197b91ed942"
+  dependencies:
+    inherits "~2.0.1"
+    statuses "1"
+
+http-parser-js@>=0.4.0:
+  version "0.4.10"
+  resolved "https://registry.yarnpkg.com/http-parser-js/-/http-parser-js-0.4.10.tgz#92c9c1374c35085f75db359ec56cc257cbb93fa4"
+
+http-proxy-middleware@~0.17.1:
+  version "0.17.4"
+  resolved "https://registry.yarnpkg.com/http-proxy-middleware/-/http-proxy-middleware-0.17.4.tgz#642e8848851d66f09d4f124912846dbaeb41b833"
+  dependencies:
+    http-proxy "^1.16.2"
+    is-glob "^3.1.0"
+    lodash "^4.17.2"
+    micromatch "^2.3.11"
+
+http-proxy@^1.13.0, http-proxy@^1.16.2:
+  version "1.16.2"
+  resolved "https://registry.yarnpkg.com/http-proxy/-/http-proxy-1.16.2.tgz#06dff292952bf64dbe8471fa9df73066d4f37742"
+  dependencies:
+    eventemitter3 "1.x.x"
+    requires-port "1.x.x"
+
+http-signature@~0.10.0:
+  version "0.10.1"
+  resolved "https://registry.yarnpkg.com/http-signature/-/http-signature-0.10.1.tgz#4fbdac132559aa8323121e540779c0a012b27e66"
+  dependencies:
+    asn1 "0.1.11"
+    assert-plus "^0.1.5"
+    ctype "0.5.3"
+
+http-signature@~1.1.0:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/http-signature/-/http-signature-1.1.1.tgz#df72e267066cd0ac67fb76adf8e134a8fbcf91bf"
+  dependencies:
+    assert-plus "^0.2.0"
+    jsprim "^1.2.2"
+    sshpk "^1.7.0"
+
+http-signature@~1.2.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/http-signature/-/http-signature-1.2.0.tgz#9aecd925114772f3d95b65a60abb8f7c18fbace1"
+  dependencies:
+    assert-plus "^1.0.0"
+    jsprim "^1.2.2"
+    sshpk "^1.7.0"
+
+https-browserify@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/https-browserify/-/https-browserify-0.0.1.tgz#3f91365cabe60b77ed0ebba24b454e3e09d95a82"
+
+https-proxy-agent@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/https-proxy-agent/-/https-proxy-agent-1.0.0.tgz#35f7da6c48ce4ddbfa264891ac593ee5ff8671e6"
+  dependencies:
+    agent-base "2"
+    debug "2"
+    extend "3"
+
+iconv-lite@0.4.13:
+  version "0.4.13"
+  resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.13.tgz#1f88aba4ab0b1508e8312acc39345f36e992e2f2"
+
+iconv-lite@0.4.19:
+  version "0.4.19"
+  resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.19.tgz#f7468f60135f5e5dad3399c0a81be9a1603a082b"
+
+iconv-lite@~0.2.11:
+  version "0.2.11"
+  resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.2.11.tgz#1ce60a3a57864a292d1321ff4609ca4bb965adc8"
+
+ieee754@^1.1.4:
+  version "1.1.8"
+  resolved "https://registry.yarnpkg.com/ieee754/-/ieee754-1.1.8.tgz#be33d40ac10ef1926701f6f08a2d86fbfd1ad3e4"
+
+imurmurhash@^0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea"
+
+indent-string@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/indent-string/-/indent-string-2.1.0.tgz#8e2d48348742121b4a8218b7a137e9a52049dc80"
+  dependencies:
+    repeating "^2.0.0"
+
+indexof@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/indexof/-/indexof-0.0.1.tgz#82dc336d232b9062179d05ab3293a66059fd435d"
+
+inflight@^1.0.4:
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/inflight/-/inflight-1.0.6.tgz#49bd6331d7d02d0c09bc910a1075ba8165b56df9"
+  dependencies:
+    once "^1.3.0"
+    wrappy "1"
+
+inherits@1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/inherits/-/inherits-1.0.2.tgz#ca4309dadee6b54cc0b8d247e8d7c7a0975bdc9b"
+
+inherits@2, inherits@2.0.3, inherits@^2.0.1, inherits@^2.0.3, inherits@~2.0.0, inherits@~2.0.1, inherits@~2.0.3:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de"
+
+inherits@2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.1.tgz#b17d08d326b4423e568eff719f91b0b1cbdf69f1"
+
+ini@~1.3.0:
+  version "1.3.5"
+  resolved "https://registry.yarnpkg.com/ini/-/ini-1.3.5.tgz#eee25f56db1c9ec6085e0c22778083f596abf927"
+
+inquirer@^0.11.0:
+  version "0.11.4"
+  resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-0.11.4.tgz#81e3374e8361beaff2d97016206d359d0b32fa4d"
+  dependencies:
+    ansi-escapes "^1.1.0"
+    ansi-regex "^2.0.0"
+    chalk "^1.0.0"
+    cli-cursor "^1.0.1"
+    cli-width "^1.0.1"
+    figures "^1.3.5"
+    lodash "^3.3.1"
+    readline2 "^1.0.1"
+    run-async "^0.1.0"
+    rx-lite "^3.1.2"
+    string-width "^1.0.1"
+    strip-ansi "^3.0.0"
+    through "^2.3.6"
+
+interpret@^0.6.4:
+  version "0.6.6"
+  resolved "https://registry.yarnpkg.com/interpret/-/interpret-0.6.6.tgz#fecd7a18e7ce5ca6abfb953e1f86213a49f1625b"
+
+invariant@^2.2.2:
+  version "2.2.3"
+  resolved "https://registry.yarnpkg.com/invariant/-/invariant-2.2.3.tgz#1a827dfde7dcbd7c323f0ca826be8fa7c5e9d688"
+  dependencies:
+    loose-envify "^1.0.0"
+
+invert-kv@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/invert-kv/-/invert-kv-1.0.0.tgz#104a8e4aaca6d3d8cd157a8ef8bfab2d7a3ffdb6"
+
+ipaddr.js@1.6.0:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/ipaddr.js/-/ipaddr.js-1.6.0.tgz#e3fa357b773da619f26e95f049d055c72796f86b"
+
+is-arrayish@^0.2.1:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/is-arrayish/-/is-arrayish-0.2.1.tgz#77c99840527aa8ecb1a8ba697b80645a7a926a9d"
+
+is-binary-path@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/is-binary-path/-/is-binary-path-1.0.1.tgz#75f16642b480f187a711c814161fd3a4a7655898"
+  dependencies:
+    binary-extensions "^1.0.0"
+
+is-buffer@^1.1.5:
+  version "1.1.6"
+  resolved "https://registry.yarnpkg.com/is-buffer/-/is-buffer-1.1.6.tgz#efaa2ea9daa0d7ab2ea13a97b2b8ad51fefbe8be"
+
+is-builtin-module@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/is-builtin-module/-/is-builtin-module-1.0.0.tgz#540572d34f7ac3119f8f76c30cbc1b1e037affbe"
+  dependencies:
+    builtin-modules "^1.0.0"
+
+is-dotfile@^1.0.0:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/is-dotfile/-/is-dotfile-1.0.3.tgz#a6a2f32ffd2dfb04f5ca25ecd0f6b83cf798a1e1"
+
+is-equal-shallow@^0.1.3:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/is-equal-shallow/-/is-equal-shallow-0.1.3.tgz#2238098fc221de0bcfa5d9eac4c45d638aa1c534"
+  dependencies:
+    is-primitive "^2.0.0"
+
+is-extendable@^0.1.1:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/is-extendable/-/is-extendable-0.1.1.tgz#62b110e289a471418e3ec36a617d472e301dfc89"
+
+is-extglob@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-1.0.0.tgz#ac468177c4943405a092fc8f29760c6ffc6206c0"
+
+is-extglob@^2.1.0:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2"
+
+is-finite@^1.0.0:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/is-finite/-/is-finite-1.0.2.tgz#cc6677695602be550ef11e8b4aa6305342b6d0aa"
+  dependencies:
+    number-is-nan "^1.0.0"
+
+is-fullwidth-code-point@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz#ef9e31386f031a7f0d643af82fde50c457ef00cb"
+  dependencies:
+    number-is-nan "^1.0.0"
+
+is-fullwidth-code-point@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz#a3b30a5c4f199183167aaab93beefae3ddfb654f"
+
+is-glob@^2.0.0, is-glob@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-2.0.1.tgz#d096f926a3ded5600f3fdfd91198cb0888c2d863"
+  dependencies:
+    is-extglob "^1.0.0"
+
+is-glob@^3.1.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-3.1.0.tgz#7ba5ae24217804ac70707b96922567486cc3e84a"
+  dependencies:
+    is-extglob "^2.1.0"
+
+is-my-ip-valid@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/is-my-ip-valid/-/is-my-ip-valid-1.0.0.tgz#7b351b8e8edd4d3995d4d066680e664d94696824"
+
+is-my-json-valid@^2.10.0, is-my-json-valid@^2.12.0, is-my-json-valid@^2.12.4:
+  version "2.17.2"
+  resolved "https://registry.yarnpkg.com/is-my-json-valid/-/is-my-json-valid-2.17.2.tgz#6b2103a288e94ef3de5cf15d29dd85fc4b78d65c"
+  dependencies:
+    generate-function "^2.0.0"
+    generate-object-property "^1.1.0"
+    is-my-ip-valid "^1.0.0"
+    jsonpointer "^4.0.0"
+    xtend "^4.0.0"
+
+is-number@^0.1.1:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/is-number/-/is-number-0.1.1.tgz#69a7af116963d47206ec9bd9b48a14216f1e3806"
+
+is-number@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/is-number/-/is-number-2.1.0.tgz#01fcbbb393463a548f2f466cce16dece49db908f"
+  dependencies:
+    kind-of "^3.0.2"
+
+is-number@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/is-number/-/is-number-3.0.0.tgz#24fd6201a4782cf50561c810276afc7d12d71195"
+  dependencies:
+    kind-of "^3.0.2"
+
+is-path-cwd@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/is-path-cwd/-/is-path-cwd-1.0.0.tgz#d225ec23132e89edd38fda767472e62e65f1106d"
+
+is-path-in-cwd@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/is-path-in-cwd/-/is-path-in-cwd-1.0.0.tgz#6477582b8214d602346094567003be8a9eac04dc"
+  dependencies:
+    is-path-inside "^1.0.0"
+
+is-path-inside@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/is-path-inside/-/is-path-inside-1.0.1.tgz#8ef5b7de50437a3fdca6b4e865ef7aa55cb48036"
+  dependencies:
+    path-is-inside "^1.0.1"
+
+is-posix-bracket@^0.1.0:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/is-posix-bracket/-/is-posix-bracket-0.1.1.tgz#3334dc79774368e92f016e6fbc0a88f5cd6e6bc4"
+
+is-primitive@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/is-primitive/-/is-primitive-2.0.0.tgz#207bab91638499c07b2adf240a41a87210034575"
+
+is-property@^1.0.0:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/is-property/-/is-property-1.0.2.tgz#57fe1c4e48474edd65b09911f26b1cd4095dda84"
+
+is-resolvable@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/is-resolvable/-/is-resolvable-1.1.0.tgz#fb18f87ce1feb925169c9a407c19318a3206ed88"
+
+is-stream@^1.0.1, is-stream@^1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/is-stream/-/is-stream-1.1.0.tgz#12d4a3dd4e68e0b79ceb8dbc84173ae80d91ca44"
+
+is-typedarray@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/is-typedarray/-/is-typedarray-1.0.0.tgz#e479c80858df0c1b11ddda6940f96011fcda4a9a"
+
+is-utf8@^0.2.0:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/is-utf8/-/is-utf8-0.2.1.tgz#4b0da1442104d1b336340e80797e865cf39f7d72"
+
+isarray@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/isarray/-/isarray-0.0.1.tgz#8a18acfca9a8f4177e09abfc6038939b05d1eedf"
+
+isarray@1.0.0, isarray@^1.0.0, isarray@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/isarray/-/isarray-1.0.0.tgz#bb935d48582cba168c06834957a54a3e07124f11"
+
+isbinaryfile@^3.0.0:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/isbinaryfile/-/isbinaryfile-3.0.2.tgz#4a3e974ec0cba9004d3fc6cde7209ea69368a621"
+
+isexe@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/isexe/-/isexe-2.0.0.tgz#e8fbf374dc556ff8947a10dcb0572d633f2cfa10"
+
+isobject@^2.0.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/isobject/-/isobject-2.1.0.tgz#f065561096a3f1da2ef46272f815c840d87e0c89"
+  dependencies:
+    isarray "1.0.0"
+
+isstream@~0.1.1, isstream@~0.1.2:
+  version "0.1.2"
+  resolved "https://registry.yarnpkg.com/isstream/-/isstream-0.1.2.tgz#47e63f7af55afa6f92e1500e690eb8b8529c099a"
+
+istanbul-lib-coverage@^1.1.1, istanbul-lib-coverage@^1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/istanbul-lib-coverage/-/istanbul-lib-coverage-1.1.2.tgz#4113c8ff6b7a40a1ef7350b01016331f63afde14"
+
+istanbul-lib-hook@^1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/istanbul-lib-hook/-/istanbul-lib-hook-1.1.0.tgz#8538d970372cb3716d53e55523dd54b557a8d89b"
+  dependencies:
+    append-transform "^0.4.0"
+
+istanbul-lib-instrument@^1.9.1:
+  version "1.9.2"
+  resolved "https://registry.yarnpkg.com/istanbul-lib-instrument/-/istanbul-lib-instrument-1.9.2.tgz#84905bf47f7e0b401d6b840da7bad67086b4aab6"
+  dependencies:
+    babel-generator "^6.18.0"
+    babel-template "^6.16.0"
+    babel-traverse "^6.18.0"
+    babel-types "^6.18.0"
+    babylon "^6.18.0"
+    istanbul-lib-coverage "^1.1.2"
+    semver "^5.3.0"
+
+istanbul-lib-report@^1.1.2:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/istanbul-lib-report/-/istanbul-lib-report-1.1.3.tgz#2df12188c0fa77990c0d2176d2d0ba3394188259"
+  dependencies:
+    istanbul-lib-coverage "^1.1.2"
+    mkdirp "^0.5.1"
+    path-parse "^1.0.5"
+    supports-color "^3.1.2"
+
+istanbul-lib-source-maps@^1.2.2:
+  version "1.2.3"
+  resolved "https://registry.yarnpkg.com/istanbul-lib-source-maps/-/istanbul-lib-source-maps-1.2.3.tgz#20fb54b14e14b3fb6edb6aca3571fd2143db44e6"
+  dependencies:
+    debug "^3.1.0"
+    istanbul-lib-coverage "^1.1.2"
+    mkdirp "^0.5.1"
+    rimraf "^2.6.1"
+    source-map "^0.5.3"
+
+istanbul-reports@^1.1.3:
+  version "1.1.4"
+  resolved "https://registry.yarnpkg.com/istanbul-reports/-/istanbul-reports-1.1.4.tgz#5ccba5e22b7b5a5d91d5e0a830f89be334bf97bd"
+  dependencies:
+    handlebars "^4.0.3"
+
+"istanbul@github:kpdecker/istanbul":
+  version "0.4.0"
+  resolved "https://codeload.github.com/kpdecker/istanbul/tar.gz/dd1228d2f0a6e8506cbb5dba398a8297b1dbaf22"
+  dependencies:
+    abbrev "1.0.x"
+    async "1.x"
+    convert-source-map "^1.1.1"
+    escodegen "1.7.x"
+    esprima "2.5.x"
+    fileset "0.2.x"
+    handlebars "^4.0.1"
+    js-yaml "3.x"
+    mkdirp "0.5.x"
+    nopt "3.x"
+    once "1.x"
+    resolve "1.1.x"
+    source-map "^0.4.4"
+    source-map-support "^0.3.2"
+    supports-color "^3.1.0"
+    which "^1.1.1"
+    wordwrap "^1.0.0"
+
+jade@0.26.3:
+  version "0.26.3"
+  resolved "https://registry.yarnpkg.com/jade/-/jade-0.26.3.tgz#8f10d7977d8d79f2f6ff862a81b0513ccb25686c"
+  dependencies:
+    commander "0.6.1"
+    mkdirp "0.3.0"
+
+js-tokens@^3.0.0, js-tokens@^3.0.2:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/js-tokens/-/js-tokens-3.0.2.tgz#9866df395102130e38f7f996bceb65443209c25b"
+
+js-yaml@3.4.5:
+  version "3.4.5"
+  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.4.5.tgz#c3403797df12b91866574f2de23646fe8cafb44d"
+  dependencies:
+    argparse "^1.0.2"
+    esprima "^2.6.0"
+
+js-yaml@3.6.1:
+  version "3.6.1"
+  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.6.1.tgz#6e5fe67d8b205ce4d22fad05b7781e8dadcc4b30"
+  dependencies:
+    argparse "^1.0.7"
+    esprima "^2.6.0"
+
+js-yaml@3.x, js-yaml@^3.10.0, js-yaml@^3.2.7, js-yaml@^3.3.1:
+  version "3.10.0"
+  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.10.0.tgz#2e78441646bd4682e963f22b6e92823c309c62dc"
+  dependencies:
+    argparse "^1.0.7"
+    esprima "^4.0.0"
+
+js-yaml@~2.0.5:
+  version "2.0.5"
+  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-2.0.5.tgz#a25ae6509999e97df278c6719da11bd0687743a8"
+  dependencies:
+    argparse "~ 0.1.11"
+    esprima "~ 1.0.2"
+
+jsbn@~0.1.0:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/jsbn/-/jsbn-0.1.1.tgz#a5e654c2e5a2deb5f201d96cefbca80c0ef2f513"
+
+jsesc@^1.3.0:
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-1.3.0.tgz#46c3fec8c1892b12b0833db9bc7622176dbab34b"
+
+jsesc@~0.5.0:
+  version "0.5.0"
+  resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-0.5.0.tgz#e7dee66e35d6fc16f710fe91d5cf69f70f08911d"
+
+jshint@~0.9.1:
+  version "0.9.1"
+  resolved "https://registry.yarnpkg.com/jshint/-/jshint-0.9.1.tgz#ff32ec7f09f84001f7498eeafd63c9e4fbb2dc0e"
+  dependencies:
+    cli "0.4.3"
+    minimatch "0.0.x"
+
+json-schema-traverse@^0.3.0:
+  version "0.3.1"
+  resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-0.3.1.tgz#349a6d44c53a51de89b40805c5d5e59b417d3340"
+
+json-schema@0.2.3:
+  version "0.2.3"
+  resolved "https://registry.yarnpkg.com/json-schema/-/json-schema-0.2.3.tgz#b480c892e59a2f05954ce727bd3f2a4e882f9e13"
+
+json-stable-stringify@^1.0.0, json-stable-stringify@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/json-stable-stringify/-/json-stable-stringify-1.0.1.tgz#9a759d39c5f2ff503fd5300646ed445f88c4f9af"
+  dependencies:
+    jsonify "~0.0.0"
+
+json-stringify-safe@~5.0.0, json-stringify-safe@~5.0.1:
+  version "5.0.1"
+  resolved "https://registry.yarnpkg.com/json-stringify-safe/-/json-stringify-safe-5.0.1.tgz#1296a2d58fd45f19a0f6ce01d65701e2c735b6eb"
+
+json3@3.3.2, json3@^3.3.2:
+  version "3.3.2"
+  resolved "https://registry.yarnpkg.com/json3/-/json3-3.3.2.tgz#3c0434743df93e2f5c42aee7b19bcb483575f4e1"
+
+json5@^0.5.0, json5@^0.5.1:
+  version "0.5.1"
+  resolved "https://registry.yarnpkg.com/json5/-/json5-0.5.1.tgz#1eade7acc012034ad84e2396767ead9fa5495821"
+
+jsonfile@^2.1.0:
+  version "2.4.0"
+  resolved "https://registry.yarnpkg.com/jsonfile/-/jsonfile-2.4.0.tgz#3736a2b428b87bbda0cc83b53fa3d633a35c2ae8"
+  optionalDependencies:
+    graceful-fs "^4.1.6"
+
+jsonify@~0.0.0:
+  version "0.0.0"
+  resolved "https://registry.yarnpkg.com/jsonify/-/jsonify-0.0.0.tgz#2c74b6ee41d93ca51b7b5aaee8f503631d252a73"
+
+jsonpointer@^4.0.0:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/jsonpointer/-/jsonpointer-4.0.1.tgz#4fd92cb34e0e9db3c89c8622ecf51f9b978c6cb9"
+
+jsprim@^1.2.2:
+  version "1.4.1"
+  resolved "https://registry.yarnpkg.com/jsprim/-/jsprim-1.4.1.tgz#313e66bc1e5cc06e438bc1b7499c2e5c56acb6a2"
+  dependencies:
+    assert-plus "1.0.0"
+    extsprintf "1.3.0"
+    json-schema "0.2.3"
+    verror "1.10.0"
+
+karma-mocha-reporter@^2.0.0:
+  version "2.2.5"
+  resolved "https://registry.yarnpkg.com/karma-mocha-reporter/-/karma-mocha-reporter-2.2.5.tgz#15120095e8ed819186e47a0b012f3cd741895560"
+  dependencies:
+    chalk "^2.1.0"
+    log-symbols "^2.1.0"
+    strip-ansi "^4.0.0"
+
+karma-mocha@^0.2.0:
+  version "0.2.2"
+  resolved "https://registry.yarnpkg.com/karma-mocha/-/karma-mocha-0.2.2.tgz#388ed917da15dcb196d1b915c1934ef803193f8e"
+
+karma-phantomjs-launcher@^1.0.0:
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/karma-phantomjs-launcher/-/karma-phantomjs-launcher-1.0.4.tgz#d23ca34801bda9863ad318e3bb4bd4062b13acd2"
+  dependencies:
+    lodash "^4.0.1"
+    phantomjs-prebuilt "^2.1.7"
+
+karma-sauce-launcher@^0.3.0:
+  version "0.3.1"
+  resolved "https://registry.yarnpkg.com/karma-sauce-launcher/-/karma-sauce-launcher-0.3.1.tgz#fa41f6afd1ad6cb7610885da83cbc9921a4d334c"
+  dependencies:
+    q "^1.4.1"
+    sauce-connect-launcher "^0.13.0"
+    saucelabs "^1.0.1"
+    wd "^0.3.4"
+
+karma-sourcemap-loader@^0.3.6:
+  version "0.3.7"
+  resolved "https://registry.yarnpkg.com/karma-sourcemap-loader/-/karma-sourcemap-loader-0.3.7.tgz#91322c77f8f13d46fed062b042e1009d4c4505d8"
+  dependencies:
+    graceful-fs "^4.1.2"
+
+karma-webpack@^1.7.0:
+  version "1.8.1"
+  resolved "https://registry.yarnpkg.com/karma-webpack/-/karma-webpack-1.8.1.tgz#39d5fd2edeea3cc3ef5b405989b37d5b0e6a3b4e"
+  dependencies:
+    async "~0.9.0"
+    loader-utils "^0.2.5"
+    lodash "^3.8.0"
+    source-map "^0.1.41"
+    webpack-dev-middleware "^1.0.11"
+
+karma@^0.13.11:
+  version "0.13.22"
+  resolved "https://registry.yarnpkg.com/karma/-/karma-0.13.22.tgz#07750b1bd063d7e7e7b91bcd2e6354d8f2aa8744"
+  dependencies:
+    batch "^0.5.3"
+    bluebird "^2.9.27"
+    body-parser "^1.12.4"
+    chokidar "^1.4.1"
+    colors "^1.1.0"
+    connect "^3.3.5"
+    core-js "^2.1.0"
+    di "^0.0.1"
+    dom-serialize "^2.2.0"
+    expand-braces "^0.1.1"
+    glob "^7.0.0"
+    graceful-fs "^4.1.2"
+    http-proxy "^1.13.0"
+    isbinaryfile "^3.0.0"
+    lodash "^3.8.0"
+    log4js "^0.6.31"
+    mime "^1.3.4"
+    minimatch "^3.0.0"
+    optimist "^0.6.1"
+    rimraf "^2.3.3"
+    socket.io "^1.4.5"
+    source-map "^0.5.3"
+    useragent "^2.1.6"
+
+kew@^0.7.0:
+  version "0.7.0"
+  resolved "https://registry.yarnpkg.com/kew/-/kew-0.7.0.tgz#79d93d2d33363d6fdd2970b335d9141ad591d79b"
+
+kind-of@^3.0.2:
+  version "3.2.2"
+  resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-3.2.2.tgz#31ea21a734bab9bbb0f32466d893aea51e4a3c64"
+  dependencies:
+    is-buffer "^1.1.5"
+
+kind-of@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-4.0.0.tgz#20813df3d712928b207378691a45066fae72dd57"
+  dependencies:
+    is-buffer "^1.1.5"
+
+klaw@^1.0.0:
+  version "1.3.1"
+  resolved "https://registry.yarnpkg.com/klaw/-/klaw-1.3.1.tgz#4088433b46b3b1ba259d78785d8e96f73ba02439"
+  optionalDependencies:
+    graceful-fs "^4.1.9"
+
+lazy-cache@^1.0.3:
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/lazy-cache/-/lazy-cache-1.0.4.tgz#a1d78fc3a50474cb80845d3b3b6e1da49a446e8e"
+
+lazystream@~0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/lazystream/-/lazystream-0.1.0.tgz#1b25d63c772a4c20f0a5ed0a9d77f484b6e16920"
+  dependencies:
+    readable-stream "~1.0.2"
+
+lcid@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/lcid/-/lcid-1.0.0.tgz#308accafa0bc483a3867b4b6f2b9506251d1b835"
+  dependencies:
+    invert-kv "^1.0.0"
+
+lcov-parse@0.0.10:
+  version "0.0.10"
+  resolved "https://registry.yarnpkg.com/lcov-parse/-/lcov-parse-0.0.10.tgz#1b0b8ff9ac9c7889250582b70b71315d9da6d9a3"
+
+levn@~0.2.5:
+  version "0.2.5"
+  resolved "https://registry.yarnpkg.com/levn/-/levn-0.2.5.tgz#ba8d339d0ca4a610e3a3f145b9caf48807155054"
+  dependencies:
+    prelude-ls "~1.1.0"
+    type-check "~0.3.1"
+
+livereload-js@^2.2.0:
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/livereload-js/-/livereload-js-2.3.0.tgz#c3ab22e8aaf5bf3505d80d098cbad67726548c9a"
+
+load-json-file@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/load-json-file/-/load-json-file-1.1.0.tgz#956905708d58b4bab4c2261b04f59f31c99374c0"
+  dependencies:
+    graceful-fs "^4.1.2"
+    parse-json "^2.2.0"
+    pify "^2.0.0"
+    pinkie-promise "^2.0.0"
+    strip-bom "^2.0.0"
+
+loader-utils@^0.2.11, loader-utils@^0.2.16, loader-utils@^0.2.5:
+  version "0.2.17"
+  resolved "https://registry.yarnpkg.com/loader-utils/-/loader-utils-0.2.17.tgz#f86e6374d43205a6e6c60e9196f17c0299bfb348"
+  dependencies:
+    big.js "^3.1.3"
+    emojis-list "^2.0.0"
+    json5 "^0.5.0"
+    object-assign "^4.0.1"
+
+locate-path@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/locate-path/-/locate-path-2.0.0.tgz#2b568b265eec944c6d9c0de9c3dbbbca0354cd8e"
+  dependencies:
+    p-locate "^2.0.0"
+    path-exists "^3.0.0"
+
+lodash._arraycopy@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/lodash._arraycopy/-/lodash._arraycopy-3.0.0.tgz#76e7b7c1f1fb92547374878a562ed06a3e50f6e1"
+
+lodash._arrayeach@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/lodash._arrayeach/-/lodash._arrayeach-3.0.0.tgz#bab156b2a90d3f1bbd5c653403349e5e5933ef9e"
+
+lodash._arraymap@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/lodash._arraymap/-/lodash._arraymap-3.0.0.tgz#1a8fd0f4c0df4b61dea076d717cdc97f0a3c3e66"
+
+lodash._baseassign@^3.0.0:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/lodash._baseassign/-/lodash._baseassign-3.2.0.tgz#8c38a099500f215ad09e59f1722fd0c52bfe0a4e"
+  dependencies:
+    lodash._basecopy "^3.0.0"
+    lodash.keys "^3.0.0"
+
+lodash._baseclone@^3.0.0:
+  version "3.3.0"
+  resolved "https://registry.yarnpkg.com/lodash._baseclone/-/lodash._baseclone-3.3.0.tgz#303519bf6393fe7e42f34d8b630ef7794e3542b7"
+  dependencies:
+    lodash._arraycopy "^3.0.0"
+    lodash._arrayeach "^3.0.0"
+    lodash._baseassign "^3.0.0"
+    lodash._basefor "^3.0.0"
+    lodash.isarray "^3.0.0"
+    lodash.keys "^3.0.0"
+
+lodash._basecopy@^3.0.0:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/lodash._basecopy/-/lodash._basecopy-3.0.1.tgz#8da0e6a876cf344c0ad8a54882111dd3c5c7ca36"
+
+lodash._basedifference@^3.0.0:
+  version "3.0.3"
+  resolved "https://registry.yarnpkg.com/lodash._basedifference/-/lodash._basedifference-3.0.3.tgz#f2c204296c2a78e02b389081b6edcac933cf629c"
+  dependencies:
+    lodash._baseindexof "^3.0.0"
+    lodash._cacheindexof "^3.0.0"
+    lodash._createcache "^3.0.0"
+
+lodash._baseflatten@^3.0.0:
+  version "3.1.4"
+  resolved "https://registry.yarnpkg.com/lodash._baseflatten/-/lodash._baseflatten-3.1.4.tgz#0770ff80131af6e34f3b511796a7ba5214e65ff7"
+  dependencies:
+    lodash.isarguments "^3.0.0"
+    lodash.isarray "^3.0.0"
+
+lodash._basefor@^3.0.0:
+  version "3.0.3"
+  resolved "https://registry.yarnpkg.com/lodash._basefor/-/lodash._basefor-3.0.3.tgz#7550b4e9218ef09fad24343b612021c79b4c20c2"
+
+lodash._baseindexof@^3.0.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/lodash._baseindexof/-/lodash._baseindexof-3.1.0.tgz#fe52b53a1c6761e42618d654e4a25789ed61822c"
+
+lodash._bindcallback@^3.0.0:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/lodash._bindcallback/-/lodash._bindcallback-3.0.1.tgz#e531c27644cf8b57a99e17ed95b35c748789392e"
+
+lodash._cacheindexof@^3.0.0:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/lodash._cacheindexof/-/lodash._cacheindexof-3.0.2.tgz#3dc69ac82498d2ee5e3ce56091bafd2adc7bde92"
+
+lodash._createassigner@^3.0.0:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/lodash._createassigner/-/lodash._createassigner-3.1.1.tgz#838a5bae2fdaca63ac22dee8e19fa4e6d6970b11"
+  dependencies:
+    lodash._bindcallback "^3.0.0"
+    lodash._isiterateecall "^3.0.0"
+    lodash.restparam "^3.0.0"
+
+lodash._createcache@^3.0.0:
+  version "3.1.2"
+  resolved "https://registry.yarnpkg.com/lodash._createcache/-/lodash._createcache-3.1.2.tgz#56d6a064017625e79ebca6b8018e17440bdcf093"
+  dependencies:
+    lodash._getnative "^3.0.0"
+
+lodash._getnative@^3.0.0:
+  version "3.9.1"
+  resolved "https://registry.yarnpkg.com/lodash._getnative/-/lodash._getnative-3.9.1.tgz#570bc7dede46d61cdcde687d65d3eecbaa3aaff5"
+
+lodash._isiterateecall@^3.0.0:
+  version "3.0.9"
+  resolved "https://registry.yarnpkg.com/lodash._isiterateecall/-/lodash._isiterateecall-3.0.9.tgz#5203ad7ba425fae842460e696db9cf3e6aac057c"
+
+lodash._pickbyarray@^3.0.0:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/lodash._pickbyarray/-/lodash._pickbyarray-3.0.2.tgz#1f898d9607eb560b0e167384b77c7c6d108aa4c5"
+
+lodash._pickbycallback@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/lodash._pickbycallback/-/lodash._pickbycallback-3.0.0.tgz#ff61b9a017a7b3af7d30e6c53de28afa19b8750a"
+  dependencies:
+    lodash._basefor "^3.0.0"
+    lodash.keysin "^3.0.0"
+
+lodash.clonedeep@^3.0.1:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/lodash.clonedeep/-/lodash.clonedeep-3.0.2.tgz#a0a1e40d82a5ea89ff5b147b8444ed63d92827db"
+  dependencies:
+    lodash._baseclone "^3.0.0"
+    lodash._bindcallback "^3.0.0"
+
+lodash.isarguments@^3.0.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/lodash.isarguments/-/lodash.isarguments-3.1.0.tgz#2f573d85c6a24289ff00663b491c1d338ff3458a"
+
+lodash.isarray@^3.0.0:
+  version "3.0.4"
+  resolved "https://registry.yarnpkg.com/lodash.isarray/-/lodash.isarray-3.0.4.tgz#79e4eb88c36a8122af86f844aa9bcd851b5fbb55"
+
+lodash.isplainobject@^3.0.0:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/lodash.isplainobject/-/lodash.isplainobject-3.2.0.tgz#9a8238ae16b200432960cd7346512d0123fbf4c5"
+  dependencies:
+    lodash._basefor "^3.0.0"
+    lodash.isarguments "^3.0.0"
+    lodash.keysin "^3.0.0"
+
+lodash.istypedarray@^3.0.0:
+  version "3.0.6"
+  resolved "https://registry.yarnpkg.com/lodash.istypedarray/-/lodash.istypedarray-3.0.6.tgz#c9a477498607501d8e8494d283b87c39281cef62"
+
+lodash.keys@^3.0.0:
+  version "3.1.2"
+  resolved "https://registry.yarnpkg.com/lodash.keys/-/lodash.keys-3.1.2.tgz#4dbc0472b156be50a0b286855d1bd0b0c656098a"
+  dependencies:
+    lodash._getnative "^3.0.0"
+    lodash.isarguments "^3.0.0"
+    lodash.isarray "^3.0.0"
+
+lodash.keysin@^3.0.0:
+  version "3.0.8"
+  resolved "https://registry.yarnpkg.com/lodash.keysin/-/lodash.keysin-3.0.8.tgz#22c4493ebbedb1427962a54b445b2c8a767fb47f"
+  dependencies:
+    lodash.isarguments "^3.0.0"
+    lodash.isarray "^3.0.0"
+
+lodash.merge@^3.3.2:
+  version "3.3.2"
+  resolved "https://registry.yarnpkg.com/lodash.merge/-/lodash.merge-3.3.2.tgz#0d90d93ed637b1878437bb3e21601260d7afe994"
+  dependencies:
+    lodash._arraycopy "^3.0.0"
+    lodash._arrayeach "^3.0.0"
+    lodash._createassigner "^3.0.0"
+    lodash._getnative "^3.0.0"
+    lodash.isarguments "^3.0.0"
+    lodash.isarray "^3.0.0"
+    lodash.isplainobject "^3.0.0"
+    lodash.istypedarray "^3.0.0"
+    lodash.keys "^3.0.0"
+    lodash.keysin "^3.0.0"
+    lodash.toplainobject "^3.0.0"
+
+lodash.omit@^3.1.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/lodash.omit/-/lodash.omit-3.1.0.tgz#897fe382e6413d9ac97c61f78ed1e057a00af9f3"
+  dependencies:
+    lodash._arraymap "^3.0.0"
+    lodash._basedifference "^3.0.0"
+    lodash._baseflatten "^3.0.0"
+    lodash._bindcallback "^3.0.0"
+    lodash._pickbyarray "^3.0.0"
+    lodash._pickbycallback "^3.0.0"
+    lodash.keysin "^3.0.0"
+    lodash.restparam "^3.0.0"
+
+lodash.restparam@^3.0.0:
+  version "3.6.1"
+  resolved "https://registry.yarnpkg.com/lodash.restparam/-/lodash.restparam-3.6.1.tgz#936a4e309ef330a7645ed4145986c85ae5b20805"
+
+lodash.toplainobject@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/lodash.toplainobject/-/lodash.toplainobject-3.0.0.tgz#28790ad942d293d78aa663a07ecf7f52ca04198d"
+  dependencies:
+    lodash._basecopy "^3.0.0"
+    lodash.keysin "^3.0.0"
+
+lodash@3.10.1, lodash@^3.10.1, lodash@^3.3.1, lodash@^3.8.0:
+  version "3.10.1"
+  resolved "https://registry.yarnpkg.com/lodash/-/lodash-3.10.1.tgz#5bf45e8e49ba4189e17d482789dfd15bd140b7b6"
+
+lodash@^4.0.1, lodash@^4.17.2, lodash@^4.17.4, lodash@^4.7.0, lodash@~4.17.4:
+  version "4.17.5"
+  resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.5.tgz#99a92d65c0272debe8c96b6057bc8fbfa3bed511"
+
+lodash@~0.9.2:
+  version "0.9.2"
+  resolved "https://registry.yarnpkg.com/lodash/-/lodash-0.9.2.tgz#8f3499c5245d346d682e5b0d3b40767e09f1a92c"
+
+lodash@~2.4.1:
+  version "2.4.2"
+  resolved "https://registry.yarnpkg.com/lodash/-/lodash-2.4.2.tgz#fadd834b9683073da179b3eae6d9c0d15053f73e"
+
+lodash@~3.2.0:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/lodash/-/lodash-3.2.0.tgz#4bf50a3243f9aeb0bac41a55d3d5990675a462fb"
+
+lodash@~3.9.3:
+  version "3.9.3"
+  resolved "https://registry.yarnpkg.com/lodash/-/lodash-3.9.3.tgz#0159e86832feffc6d61d852b12a953b99496bd32"
+
+log-driver@1.2.5:
+  version "1.2.5"
+  resolved "https://registry.yarnpkg.com/log-driver/-/log-driver-1.2.5.tgz#7ae4ec257302fd790d557cb10c97100d857b0056"
+
+log-symbols@^2.1.0:
+  version "2.2.0"
+  resolved "https://registry.yarnpkg.com/log-symbols/-/log-symbols-2.2.0.tgz#5740e1c5d6f0dfda4ad9323b5332107ef6b4c40a"
+  dependencies:
+    chalk "^2.0.1"
+
+log4js@^0.6.31:
+  version "0.6.38"
+  resolved "https://registry.yarnpkg.com/log4js/-/log4js-0.6.38.tgz#2c494116695d6fb25480943d3fc872e662a522fd"
+  dependencies:
+    readable-stream "~1.0.2"
+    semver "~4.3.3"
+
+"loggly@0.3.x >=0.3.7":
+  version "0.3.11"
+  resolved "https://registry.yarnpkg.com/loggly/-/loggly-0.3.11.tgz#62c1ec3436772f0954598f26b957d2ad2986b611"
+  dependencies:
+    request "2.9.x"
+    timespan "2.x.x"
+
+longest@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/longest/-/longest-1.0.1.tgz#30a0b2da38f73770e8294a0d22e6625ed77d0097"
+
+loose-envify@^1.0.0:
+  version "1.3.1"
+  resolved "https://registry.yarnpkg.com/loose-envify/-/loose-envify-1.3.1.tgz#d1a8ad33fa9ce0e713d65fdd0ac8b748d478c848"
+  dependencies:
+    js-tokens "^3.0.0"
+
+loud-rejection@^1.0.0:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/loud-rejection/-/loud-rejection-1.6.0.tgz#5b46f80147edee578870f086d04821cf998e551f"
+  dependencies:
+    currently-unhandled "^0.4.1"
+    signal-exit "^3.0.0"
+
+lru-cache@2:
+  version "2.7.3"
+  resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-2.7.3.tgz#6d4524e8b955f95d4f5b58851ce21dd72fb4e952"
+
+lru-cache@4.1.x, lru-cache@^4.0.1:
+  version "4.1.1"
+  resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-4.1.1.tgz#622e32e82488b49279114a4f9ecf45e7cd6bba55"
+  dependencies:
+    pseudomap "^1.0.2"
+    yallist "^2.1.2"
+
+lru-cache@~1.0.2:
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-1.0.6.tgz#aa50f97047422ac72543bda177a9c9d018d98452"
+
+map-obj@^1.0.0, map-obj@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/map-obj/-/map-obj-1.0.1.tgz#d933ceb9205d82bdcf4886f6742bdc2b4dea146d"
+
+maxmin@^1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/maxmin/-/maxmin-1.1.0.tgz#71365e84a99dd8f8b3f7d5fde2f00d1e7f73be61"
+  dependencies:
+    chalk "^1.0.0"
+    figures "^1.0.1"
+    gzip-size "^1.0.0"
+    pretty-bytes "^1.0.0"
+
+md5-hex@^1.2.0:
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/md5-hex/-/md5-hex-1.3.0.tgz#d2c4afe983c4370662179b8cad145219135046c4"
+  dependencies:
+    md5-o-matic "^0.1.1"
+
+md5-o-matic@^0.1.1:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/md5-o-matic/-/md5-o-matic-0.1.1.tgz#822bccd65e117c514fab176b25945d54100a03c3"
+
+media-typer@0.3.0:
+  version "0.3.0"
+  resolved "https://registry.yarnpkg.com/media-typer/-/media-typer-0.3.0.tgz#8710d7af0aa626f8fffa1ce00168545263255748"
+
+mem@^1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/mem/-/mem-1.1.0.tgz#5edd52b485ca1d900fe64895505399a0dfa45f76"
+  dependencies:
+    mimic-fn "^1.0.0"
+
+memory-fs@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/memory-fs/-/memory-fs-0.2.0.tgz#f2bb25368bc121e391c2520de92969caee0a0290"
+
+memory-fs@~0.3.0:
+  version "0.3.0"
+  resolved "https://registry.yarnpkg.com/memory-fs/-/memory-fs-0.3.0.tgz#7bcc6b629e3a43e871d7e29aca6ae8a7f15cbb20"
+  dependencies:
+    errno "^0.1.3"
+    readable-stream "^2.0.1"
+
+memory-fs@~0.4.1:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/memory-fs/-/memory-fs-0.4.1.tgz#3a9a20b8462523e447cfbc7e8bb80ed667bfc552"
+  dependencies:
+    errno "^0.1.3"
+    readable-stream "^2.0.1"
+
+meow@^3.1.0:
+  version "3.7.0"
+  resolved "https://registry.yarnpkg.com/meow/-/meow-3.7.0.tgz#72cb668b425228290abbfa856892587308a801fb"
+  dependencies:
+    camelcase-keys "^2.0.0"
+    decamelize "^1.1.2"
+    loud-rejection "^1.0.0"
+    map-obj "^1.0.1"
+    minimist "^1.1.3"
+    normalize-package-data "^2.3.4"
+    object-assign "^4.0.1"
+    read-pkg-up "^1.0.1"
+    redent "^1.0.0"
+    trim-newlines "^1.0.0"
+
+merge-descriptors@1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/merge-descriptors/-/merge-descriptors-1.0.1.tgz#b00aaa556dd8b44568150ec9d1b953f3f90cbb61"
+
+merge-source-map@^1.0.2:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/merge-source-map/-/merge-source-map-1.1.0.tgz#2fdde7e6020939f70906a68f2d7ae685e4c8c646"
+  dependencies:
+    source-map "^0.6.1"
+
+methods@~1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/methods/-/methods-1.1.2.tgz#5529a4d67654134edcc5266656835b0f851afcee"
+
+micromatch@^2.1.5, micromatch@^2.3.11:
+  version "2.3.11"
+  resolved "https://registry.yarnpkg.com/micromatch/-/micromatch-2.3.11.tgz#86677c97d1720b363431d04d0d15293bd38c1565"
+  dependencies:
+    arr-diff "^2.0.0"
+    array-unique "^0.2.1"
+    braces "^1.8.2"
+    expand-brackets "^0.1.4"
+    extglob "^0.3.1"
+    filename-regex "^2.0.0"
+    is-extglob "^1.0.0"
+    is-glob "^2.0.1"
+    kind-of "^3.0.2"
+    normalize-path "^2.0.1"
+    object.omit "^2.0.0"
+    parse-glob "^3.0.4"
+    regex-cache "^0.4.2"
+
+"mime-db@>= 1.33.0 < 2", mime-db@~1.33.0:
+  version "1.33.0"
+  resolved "https://registry.yarnpkg.com/mime-db/-/mime-db-1.33.0.tgz#a3492050a5cb9b63450541e39d9788d2272783db"
+
+mime-db@~1.12.0:
+  version "1.12.0"
+  resolved "https://registry.yarnpkg.com/mime-db/-/mime-db-1.12.0.tgz#3d0c63180f458eb10d325aaa37d7c58ae312e9d7"
+
+mime-types@^2.1.12, mime-types@~2.1.11, mime-types@~2.1.17, mime-types@~2.1.18, mime-types@~2.1.7:
+  version "2.1.18"
+  resolved "https://registry.yarnpkg.com/mime-types/-/mime-types-2.1.18.tgz#6f323f60a83d11146f831ff11fd66e2fe5503bb8"
+  dependencies:
+    mime-db "~1.33.0"
+
+mime-types@~2.0.1, mime-types@~2.0.3:
+  version "2.0.14"
+  resolved "https://registry.yarnpkg.com/mime-types/-/mime-types-2.0.14.tgz#310e159db23e077f8bb22b748dabfa4957140aa6"
+  dependencies:
+    mime-db "~1.12.0"
+
+mime@1.2.6:
+  version "1.2.6"
+  resolved "https://registry.yarnpkg.com/mime/-/mime-1.2.6.tgz#b1f86c768c025fa87b48075f1709f28aeaf20365"
+
+mime@1.4.1:
+  version "1.4.1"
+  resolved "https://registry.yarnpkg.com/mime/-/mime-1.4.1.tgz#121f9ebc49e3766f311a76e1fa1c8003c4b03aa6"
+
+mime@^1.3.4, mime@^1.5.0:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/mime/-/mime-1.6.0.tgz#32cd9e5c64553bd58d19a568af452acff04981b1"
+
+mimic-fn@^1.0.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/mimic-fn/-/mimic-fn-1.2.0.tgz#820c86a39334640e99516928bd03fca88057d022"
+
+minimatch@0.0.x:
+  version "0.0.5"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-0.0.5.tgz#96bb490bbd3ba6836bbfac111adf75301b1584de"
+  dependencies:
+    lru-cache "~1.0.2"
+
+minimatch@0.3:
+  version "0.3.0"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-0.3.0.tgz#275d8edaac4f1bb3326472089e7949c8394699dd"
+  dependencies:
+    lru-cache "2"
+    sigmund "~1.0.0"
+
+"minimatch@2 || 3", minimatch@^3.0.0, minimatch@^3.0.2, minimatch@^3.0.4, minimatch@~3.0.2:
+  version "3.0.4"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083"
+  dependencies:
+    brace-expansion "^1.1.7"
+
+minimatch@2.x, minimatch@^2.0.1:
+  version "2.0.10"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-2.0.10.tgz#8d087c39c6b38c001b97fca7ce6d0e1e80afbac7"
+  dependencies:
+    brace-expansion "^1.0.0"
+
+minimatch@~0.2.11, minimatch@~0.2.12, minimatch@~0.2.5:
+  version "0.2.14"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-0.2.14.tgz#c74e780574f63c6f9a090e90efbe6ef53a6a756a"
+  dependencies:
+    lru-cache "2"
+    sigmund "~1.0.0"
+
+minimist@0.0.8:
+  version "0.0.8"
+  resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.8.tgz#857fcabfc3397d2625b8228262e86aa7a011b05d"
+
+minimist@1.2.0, minimist@^1.1.3, minimist@^1.2.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/minimist/-/minimist-1.2.0.tgz#a35008b20f41383eec1fb914f4cd5df79a264284"
+
+minimist@~0.0.1:
+  version "0.0.10"
+  resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.10.tgz#de3f98543dbf96082be48ad1a0c7cda836301dcf"
+
+minipass@^2.2.0, minipass@^2.2.1:
+  version "2.2.1"
+  resolved "https://registry.yarnpkg.com/minipass/-/minipass-2.2.1.tgz#5ada97538b1027b4cf7213432428578cb564011f"
+  dependencies:
+    yallist "^3.0.0"
+
+mkdirp@0.3.0:
+  version "0.3.0"
+  resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.3.0.tgz#1bbf5ab1ba827af23575143490426455f481fe1e"
+
+mkdirp@0.5.0:
+  version "0.5.0"
+  resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.0.tgz#1d73076a6df986cd9344e15e71fcc05a4c9abf12"
+  dependencies:
+    minimist "0.0.8"
+
+mkdirp@0.5.1, mkdirp@0.5.x, "mkdirp@>=0.5 0", mkdirp@^0.5.0, mkdirp@^0.5.1, mkdirp@~0.5.0:
+  version "0.5.1"
+  resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.1.tgz#30057438eac6cf7f8c4767f38648d6697d75c903"
+  dependencies:
+    minimist "0.0.8"
+
+mocha@^2.3.3:
+  version "2.5.3"
+  resolved "https://registry.yarnpkg.com/mocha/-/mocha-2.5.3.tgz#161be5bdeb496771eb9b35745050b622b5aefc58"
+  dependencies:
+    commander "2.3.0"
+    debug "2.2.0"
+    diff "1.4.0"
+    escape-string-regexp "1.0.2"
+    glob "3.2.11"
+    growl "1.9.2"
+    jade "0.26.3"
+    mkdirp "0.5.1"
+    supports-color "1.2.0"
+    to-iso-string "0.0.2"
+
+modify-babel-preset@2.0.2:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/modify-babel-preset/-/modify-babel-preset-2.0.2.tgz#bfa509669fe49f4222c0ce171ba44ed0e81551e7"
+  dependencies:
+    require-relative "^0.8.7"
+
+ms@0.7.1:
+  version "0.7.1"
+  resolved "https://registry.yarnpkg.com/ms/-/ms-0.7.1.tgz#9cd13c03adbff25b65effde7ce864ee952017098"
+
+ms@0.7.2:
+  version "0.7.2"
+  resolved "https://registry.yarnpkg.com/ms/-/ms-0.7.2.tgz#ae25cf2512b3885a1d95d7f037868d8431124765"
+
+ms@2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8"
+
+mute-stream@0.0.5:
+  version "0.0.5"
+  resolved "https://registry.yarnpkg.com/mute-stream/-/mute-stream-0.0.5.tgz#8fbfabb0a98a253d3184331f9e8deb7372fac6c0"
+
+nan@^2.3.0:
+  version "2.9.2"
+  resolved "https://registry.yarnpkg.com/nan/-/nan-2.9.2.tgz#f564d75f5f8f36a6d9456cca7a6c4fe488ab7866"
+
+negotiator@0.6.1:
+  version "0.6.1"
+  resolved "https://registry.yarnpkg.com/negotiator/-/negotiator-0.6.1.tgz#2b327184e8992101177b28563fb5e7102acd0ca9"
+
+node-int64@~0.3.0:
+  version "0.3.3"
+  resolved "https://registry.yarnpkg.com/node-int64/-/node-int64-0.3.3.tgz#2d6e6b2ece5de8588b43d88d1bc41b26cd1fa84d"
+
+node-libs-browser@^0.7.0:
+  version "0.7.0"
+  resolved "https://registry.yarnpkg.com/node-libs-browser/-/node-libs-browser-0.7.0.tgz#3e272c0819e308935e26674408d7af0e1491b83b"
+  dependencies:
+    assert "^1.1.1"
+    browserify-zlib "^0.1.4"
+    buffer "^4.9.0"
+    console-browserify "^1.1.0"
+    constants-browserify "^1.0.0"
+    crypto-browserify "3.3.0"
+    domain-browser "^1.1.1"
+    events "^1.0.0"
+    https-browserify "0.0.1"
+    os-browserify "^0.2.0"
+    path-browserify "0.0.0"
+    process "^0.11.0"
+    punycode "^1.2.4"
+    querystring-es3 "^0.2.0"
+    readable-stream "^2.0.5"
+    stream-browserify "^2.0.1"
+    stream-http "^2.3.1"
+    string_decoder "^0.10.25"
+    timers-browserify "^2.0.2"
+    tty-browserify "0.0.0"
+    url "^0.11.0"
+    util "^0.10.3"
+    vm-browserify "0.0.4"
+
+node-pre-gyp@^0.6.39:
+  version "0.6.39"
+  resolved "https://registry.yarnpkg.com/node-pre-gyp/-/node-pre-gyp-0.6.39.tgz#c00e96860b23c0e1420ac7befc5044e1d78d8649"
+  dependencies:
+    detect-libc "^1.0.2"
+    hawk "3.1.3"
+    mkdirp "^0.5.1"
+    nopt "^4.0.1"
+    npmlog "^4.0.2"
+    rc "^1.1.7"
+    request "2.81.0"
+    rimraf "^2.6.1"
+    semver "^5.3.0"
+    tar "^2.2.1"
+    tar-pack "^3.4.0"
+
+node-uuid@~1.4.0:
+  version "1.4.8"
+  resolved "https://registry.yarnpkg.com/node-uuid/-/node-uuid-1.4.8.tgz#b040eb0923968afabf8d32fb1f17f1167fdab907"
+
+nodeunit@~0.7.4:
+  version "0.7.4"
+  resolved "https://registry.yarnpkg.com/nodeunit/-/nodeunit-0.7.4.tgz#c908def7f299fbe65ff7ac888782955c46aae9f8"
+  dependencies:
+    tap ">=0.2.3"
+
+nopt@3.x:
+  version "3.0.6"
+  resolved "https://registry.yarnpkg.com/nopt/-/nopt-3.0.6.tgz#c6465dbf08abcd4db359317f79ac68a646b28ff9"
+  dependencies:
+    abbrev "1"
+
+nopt@^4.0.1:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/nopt/-/nopt-4.0.1.tgz#d0d4685afd5415193c8c7505602d0d17cd64474d"
+  dependencies:
+    abbrev "1"
+    osenv "^0.1.4"
+
+nopt@~1.0.10:
+  version "1.0.10"
+  resolved "https://registry.yarnpkg.com/nopt/-/nopt-1.0.10.tgz#6ddd21bd2a31417b92727dd585f8a6f37608ebee"
+  dependencies:
+    abbrev "1"
+
+normalize-package-data@^2.3.2, normalize-package-data@^2.3.4:
+  version "2.4.0"
+  resolved "https://registry.yarnpkg.com/normalize-package-data/-/normalize-package-data-2.4.0.tgz#12f95a307d58352075a04907b84ac8be98ac012f"
+  dependencies:
+    hosted-git-info "^2.1.4"
+    is-builtin-module "^1.0.0"
+    semver "2 || 3 || 4 || 5"
+    validate-npm-package-license "^3.0.1"
+
+normalize-path@^2.0.0, normalize-path@^2.0.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/normalize-path/-/normalize-path-2.1.1.tgz#1ab28b556e198363a8c1a6f7e6fa20137fe6aed9"
+  dependencies:
+    remove-trailing-separator "^1.0.1"
+
+npm-run-path@^2.0.0:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/npm-run-path/-/npm-run-path-2.0.2.tgz#35a9232dfa35d7067b4cb2ddf2357b1871536c5f"
+  dependencies:
+    path-key "^2.0.0"
+
+npmlog@^4.0.2:
+  version "4.1.2"
+  resolved "https://registry.yarnpkg.com/npmlog/-/npmlog-4.1.2.tgz#08a7f2a8bf734604779a9efa4ad5cc717abb954b"
+  dependencies:
+    are-we-there-yet "~1.1.2"
+    console-control-strings "~1.1.0"
+    gauge "~2.7.3"
+    set-blocking "~2.0.0"
+
+number-is-nan@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/number-is-nan/-/number-is-nan-1.0.1.tgz#097b602b53422a522c1afb8790318336941a011d"
+
+nyc@^11.3.0:
+  version "11.4.1"
+  resolved "https://registry.yarnpkg.com/nyc/-/nyc-11.4.1.tgz#13fdf7e7ef22d027c61d174758f6978a68f4f5e5"
+  dependencies:
+    archy "^1.0.0"
+    arrify "^1.0.1"
+    caching-transform "^1.0.0"
+    convert-source-map "^1.3.0"
+    debug-log "^1.0.1"
+    default-require-extensions "^1.0.0"
+    find-cache-dir "^0.1.1"
+    find-up "^2.1.0"
+    foreground-child "^1.5.3"
+    glob "^7.0.6"
+    istanbul-lib-coverage "^1.1.1"
+    istanbul-lib-hook "^1.1.0"
+    istanbul-lib-instrument "^1.9.1"
+    istanbul-lib-report "^1.1.2"
+    istanbul-lib-source-maps "^1.2.2"
+    istanbul-reports "^1.1.3"
+    md5-hex "^1.2.0"
+    merge-source-map "^1.0.2"
+    micromatch "^2.3.11"
+    mkdirp "^0.5.0"
+    resolve-from "^2.0.0"
+    rimraf "^2.5.4"
+    signal-exit "^3.0.1"
+    spawn-wrap "^1.4.2"
+    test-exclude "^4.1.1"
+    yargs "^10.0.3"
+    yargs-parser "^8.0.0"
+
+oauth-sign@~0.6.0:
+  version "0.6.0"
+  resolved "https://registry.yarnpkg.com/oauth-sign/-/oauth-sign-0.6.0.tgz#7dbeae44f6ca454e1f168451d630746735813ce3"
+
+oauth-sign@~0.8.1, oauth-sign@~0.8.2:
+  version "0.8.2"
+  resolved "https://registry.yarnpkg.com/oauth-sign/-/oauth-sign-0.8.2.tgz#46a6ab7f0aead8deae9ec0565780b7d4efeb9d43"
+
+object-assign@4.1.0:
+  version "4.1.0"
+  resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.0.tgz#7a3b3d0e98063d43f4c03f2e8ae6cd51a86883a0"
+
+object-assign@^4.0.1, object-assign@^4.1.0:
+  version "4.1.1"
+  resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.1.tgz#2109adc7965887cfc05cbbd442cac8bfbb360863"
+
+object-component@0.0.3:
+  version "0.0.3"
+  resolved "https://registry.yarnpkg.com/object-component/-/object-component-0.0.3.tgz#f0c69aa50efc95b866c186f400a33769cb2f1291"
+
+object.omit@^2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/object.omit/-/object.omit-2.0.1.tgz#1a9c744829f39dbb858c76ca3579ae2a54ebd1fa"
+  dependencies:
+    for-own "^0.1.4"
+    is-extendable "^0.1.1"
+
+on-finished@~2.3.0:
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/on-finished/-/on-finished-2.3.0.tgz#20f1336481b083cd75337992a16971aa2d906947"
+  dependencies:
+    ee-first "1.1.1"
+
+on-headers@~1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/on-headers/-/on-headers-1.0.1.tgz#928f5d0f470d49342651ea6794b0857c100693f7"
+
+once@1.x, once@^1.3.0, once@^1.3.3, once@^1.4.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1"
+  dependencies:
+    wrappy "1"
+
+onetime@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/onetime/-/onetime-1.1.0.tgz#a1f7838f8314c516f05ecefcbc4ccfe04b4ed789"
+
+open@0.0.5:
+  version "0.0.5"
+  resolved "https://registry.yarnpkg.com/open/-/open-0.0.5.tgz#42c3e18ec95466b6bf0dc42f3a2945c3f0cad8fc"
+
+opener@^1.4.1:
+  version "1.4.3"
+  resolved "https://registry.yarnpkg.com/opener/-/opener-1.4.3.tgz#5c6da2c5d7e5831e8ffa3964950f8d6674ac90b8"
+
+optimist@^0.6.1, optimist@~0.6.0, optimist@~0.6.1:
+  version "0.6.1"
+  resolved "https://registry.yarnpkg.com/optimist/-/optimist-0.6.1.tgz#da3ea74686fa21a19a111c326e90eb15a0196686"
+  dependencies:
+    minimist "~0.0.1"
+    wordwrap "~0.0.2"
+
+optionator@^0.5.0:
+  version "0.5.0"
+  resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.5.0.tgz#b75a8995a2d417df25b6e4e3862f50aa88651368"
+  dependencies:
+    deep-is "~0.1.2"
+    fast-levenshtein "~1.0.0"
+    levn "~0.2.5"
+    prelude-ls "~1.1.1"
+    type-check "~0.3.1"
+    wordwrap "~0.0.2"
+
+optionator@^0.6.0:
+  version "0.6.0"
+  resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.6.0.tgz#b63ecbbf0e315fad4bc9827b45dc7ba45284fcb6"
+  dependencies:
+    deep-is "~0.1.3"
+    fast-levenshtein "~1.0.6"
+    levn "~0.2.5"
+    prelude-ls "~1.1.1"
+    type-check "~0.3.1"
+    wordwrap "~0.0.2"
+
+options@>=0.0.5:
+  version "0.0.6"
+  resolved "https://registry.yarnpkg.com/options/-/options-0.0.6.tgz#ec22d312806bb53e731773e7cdaefcf1c643128f"
+
+original@>=0.0.5:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/original/-/original-1.0.0.tgz#9147f93fa1696d04be61e01bd50baeaca656bd3b"
+  dependencies:
+    url-parse "1.0.x"
+
+os-browserify@^0.2.0:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/os-browserify/-/os-browserify-0.2.1.tgz#63fc4ccee5d2d7763d26bbf8601078e6c2e0044f"
+
+os-homedir@^1.0.0, os-homedir@^1.0.1, os-homedir@^1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/os-homedir/-/os-homedir-1.0.2.tgz#ffbc4988336e0e833de0c168c7ef152121aa7fb3"
+
+os-locale@^2.0.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/os-locale/-/os-locale-2.1.0.tgz#42bc2900a6b5b8bd17376c8e882b65afccf24bf2"
+  dependencies:
+    execa "^0.7.0"
+    lcid "^1.0.0"
+    mem "^1.1.0"
+
+os-tmpdir@^1.0.0, os-tmpdir@^1.0.1, os-tmpdir@~1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/os-tmpdir/-/os-tmpdir-1.0.2.tgz#bbe67406c79aa85c5cfec766fe5734555dfa1274"
+
+osenv@^0.1.4:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/osenv/-/osenv-0.1.5.tgz#85cdfafaeb28e8677f416e287592b5f3f49ea410"
+  dependencies:
+    os-homedir "^1.0.0"
+    os-tmpdir "^1.0.0"
+
+own-or-env@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/own-or-env/-/own-or-env-1.0.1.tgz#54ce601d3bf78236c5c65633aa1c8ec03f8007e4"
+  dependencies:
+    own-or "^1.0.0"
+
+own-or@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/own-or/-/own-or-1.0.0.tgz#4e877fbeda9a2ec8000fbc0bcae39645ee8bf8dc"
+
+p-finally@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/p-finally/-/p-finally-1.0.0.tgz#3fbcfb15b899a44123b34b6dcc18b724336a2cae"
+
+p-limit@^1.1.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/p-limit/-/p-limit-1.2.0.tgz#0e92b6bedcb59f022c13d0f1949dc82d15909f1c"
+  dependencies:
+    p-try "^1.0.0"
+
+p-locate@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/p-locate/-/p-locate-2.0.0.tgz#20a0103b222a70c8fd39cc2e580680f3dde5ec43"
+  dependencies:
+    p-limit "^1.1.0"
+
+p-try@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/p-try/-/p-try-1.0.0.tgz#cbc79cdbaf8fd4228e13f621f2b1a237c1b207b3"
+
+"package@>= 1.0.0 < 1.2.0":
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/package/-/package-1.0.1.tgz#d25a1f99e2506dcb27d6704b83dca8a312e4edcc"
+
+pako@~0.2.0:
+  version "0.2.9"
+  resolved "https://registry.yarnpkg.com/pako/-/pako-0.2.9.tgz#f3f7522f4ef782348da8161bad9ecfd51bf83a75"
+
+parse-glob@^3.0.4:
+  version "3.0.4"
+  resolved "https://registry.yarnpkg.com/parse-glob/-/parse-glob-3.0.4.tgz#b2c376cfb11f35513badd173ef0bb6e3a388391c"
+  dependencies:
+    glob-base "^0.3.0"
+    is-dotfile "^1.0.0"
+    is-extglob "^1.0.0"
+    is-glob "^2.0.0"
+
+parse-json@^2.2.0:
+  version "2.2.0"
+  resolved "https://registry.yarnpkg.com/parse-json/-/parse-json-2.2.0.tgz#f480f40434ef80741f8469099f8dea18f55a4dc9"
+  dependencies:
+    error-ex "^1.2.0"
+
+parsejson@0.0.3:
+  version "0.0.3"
+  resolved "https://registry.yarnpkg.com/parsejson/-/parsejson-0.0.3.tgz#ab7e3759f209ece99437973f7d0f1f64ae0e64ab"
+  dependencies:
+    better-assert "~1.0.0"
+
+parseqs@0.0.5:
+  version "0.0.5"
+  resolved "https://registry.yarnpkg.com/parseqs/-/parseqs-0.0.5.tgz#d5208a3738e46766e291ba2ea173684921a8b89d"
+  dependencies:
+    better-assert "~1.0.0"
+
+parseuri@0.0.5:
+  version "0.0.5"
+  resolved "https://registry.yarnpkg.com/parseuri/-/parseuri-0.0.5.tgz#80204a50d4dbb779bfdc6ebe2778d90e4bce320a"
+  dependencies:
+    better-assert "~1.0.0"
+
+parseurl@~1.3.0, parseurl@~1.3.2:
+  version "1.3.2"
+  resolved "https://registry.yarnpkg.com/parseurl/-/parseurl-1.3.2.tgz#fc289d4ed8993119460c156253262cdc8de65bf3"
+
+path-browserify@0.0.0:
+  version "0.0.0"
+  resolved "https://registry.yarnpkg.com/path-browserify/-/path-browserify-0.0.0.tgz#a0b870729aae214005b7d5032ec2cbbb0fb4451a"
+
+path-exists@^2.0.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/path-exists/-/path-exists-2.1.0.tgz#0feb6c64f0fc518d9a754dd5efb62c7022761f4b"
+  dependencies:
+    pinkie-promise "^2.0.0"
+
+path-exists@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/path-exists/-/path-exists-3.0.0.tgz#ce0ebeaa5f78cb18925ea7d810d7b59b010fd515"
+
+path-is-absolute@^1.0.0, path-is-absolute@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f"
+
+path-is-inside@^1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/path-is-inside/-/path-is-inside-1.0.2.tgz#365417dede44430d1c11af61027facf074bdfc53"
+
+path-key@^2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/path-key/-/path-key-2.0.1.tgz#411cadb574c5a140d3a4b1910d40d80cc9f40b40"
+
+path-parse@^1.0.5:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/path-parse/-/path-parse-1.0.5.tgz#3c1adf871ea9cd6c9431b6ea2bd74a0ff055c4c1"
+
+path-to-regexp@0.1.7:
+  version "0.1.7"
+  resolved "https://registry.yarnpkg.com/path-to-regexp/-/path-to-regexp-0.1.7.tgz#df604178005f522f15eb4490e7247a1bfaa67f8c"
+
+path-type@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/path-type/-/path-type-1.1.0.tgz#59c44f7ee491da704da415da5a4070ba4f8fe441"
+  dependencies:
+    graceful-fs "^4.1.2"
+    pify "^2.0.0"
+    pinkie-promise "^2.0.0"
+
+pause@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/pause/-/pause-0.0.1.tgz#1d408b3fdb76923b9543d96fb4c9dfd535d9cb5d"
+
+pbkdf2-compat@2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/pbkdf2-compat/-/pbkdf2-compat-2.0.1.tgz#b6e0c8fa99494d94e0511575802a59a5c142f288"
+
+pend@~1.2.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/pend/-/pend-1.2.0.tgz#7a57eb550a6783f9115331fcf4663d5c8e007a50"
+
+performance-now@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/performance-now/-/performance-now-0.2.0.tgz#33ef30c5c77d4ea21c5a53869d91b56d8f2555e5"
+
+performance-now@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/performance-now/-/performance-now-2.1.0.tgz#6309f4e0e5fa913ec1c69307ae364b4b377c9e7b"
+
+phantomjs-prebuilt@^2.1.5, phantomjs-prebuilt@^2.1.7:
+  version "2.1.16"
+  resolved "https://registry.yarnpkg.com/phantomjs-prebuilt/-/phantomjs-prebuilt-2.1.16.tgz#efd212a4a3966d3647684ea8ba788549be2aefef"
+  dependencies:
+    es6-promise "^4.0.3"
+    extract-zip "^1.6.5"
+    fs-extra "^1.0.0"
+    hasha "^2.2.0"
+    kew "^0.7.0"
+    progress "^1.1.8"
+    request "^2.81.0"
+    request-progress "^2.0.1"
+    which "^1.2.10"
+
+pify@^2.0.0:
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/pify/-/pify-2.3.0.tgz#ed141a6ac043a849ea588498e7dca8b15330e90c"
+
+pinkie-promise@^2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/pinkie-promise/-/pinkie-promise-2.0.1.tgz#2135d6dfa7a358c069ac9b178776288228450ffa"
+  dependencies:
+    pinkie "^2.0.0"
+
+pinkie@^2.0.0:
+  version "2.0.4"
+  resolved "https://registry.yarnpkg.com/pinkie/-/pinkie-2.0.4.tgz#72556b80cfa0d48a974e80e77248e80ed4f7f870"
+
+pkg-dir@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/pkg-dir/-/pkg-dir-1.0.0.tgz#7a4b508a8d5bb2d629d447056ff4e9c9314cf3d4"
+  dependencies:
+    find-up "^1.0.0"
+
+pkginfo@0.2.x:
+  version "0.2.3"
+  resolved "https://registry.yarnpkg.com/pkginfo/-/pkginfo-0.2.3.tgz#7239c42a5ef6c30b8f328439d9b9ff71042490f8"
+
+pkginfo@0.x.x:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/pkginfo/-/pkginfo-0.4.1.tgz#b5418ef0439de5425fc4995042dced14fb2a84ff"
+
+prelude-ls@~1.1.0, prelude-ls@~1.1.1, prelude-ls@~1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/prelude-ls/-/prelude-ls-1.1.2.tgz#21932a549f5e52ffd9a827f570e04be62a97da54"
+
+preserve@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/preserve/-/preserve-0.2.0.tgz#815ed1f6ebc65926f865b310c0713bcb3315ce4b"
+
+pretty-bytes@^1.0.0:
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/pretty-bytes/-/pretty-bytes-1.0.4.tgz#0a22e8210609ad35542f8c8d5d2159aff0751c84"
+  dependencies:
+    get-stdin "^4.0.1"
+    meow "^3.1.0"
+
+private@^0.1.6, private@^0.1.7, private@~0.1.5:
+  version "0.1.8"
+  resolved "https://registry.yarnpkg.com/private/-/private-0.1.8.tgz#2381edb3689f7a53d653190060fcf822d2f368ff"
+
+process-nextick-args@~2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/process-nextick-args/-/process-nextick-args-2.0.0.tgz#a37d732f4271b4ab1ad070d35508e8290788ffaa"
+
+process@^0.11.0:
+  version "0.11.10"
+  resolved "https://registry.yarnpkg.com/process/-/process-0.11.10.tgz#7332300e840161bda3e69a1d1d91a7d4bc16f182"
+
+progress@^1.1.8:
+  version "1.1.8"
+  resolved "https://registry.yarnpkg.com/progress/-/progress-1.1.8.tgz#e260c78f6161cdd9b0e56cc3e0a85de17c7a57be"
+
+prompt@~0.1.12:
+  version "0.1.12"
+  resolved "https://registry.yarnpkg.com/prompt/-/prompt-0.1.12.tgz#d3114e4fb985ac66eaa35586dcb7b3fb3b27bfc6"
+  dependencies:
+    async "0.1.x"
+    colors "0.x.x"
+    pkginfo "0.x.x"
+    winston "0.5.x"
+
+proxy-addr@~2.0.2:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/proxy-addr/-/proxy-addr-2.0.3.tgz#355f262505a621646b3130a728eb647e22055341"
+  dependencies:
+    forwarded "~0.1.2"
+    ipaddr.js "1.6.0"
+
+prr@~1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/prr/-/prr-1.0.1.tgz#d3fc114ba06995a45ec6893f484ceb1d78f5f476"
+
+pseudomap@^1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/pseudomap/-/pseudomap-1.0.2.tgz#f052a28da70e618917ef0a8ac34c1ae5a68286b3"
+
+punycode@1.3.2:
+  version "1.3.2"
+  resolved "https://registry.yarnpkg.com/punycode/-/punycode-1.3.2.tgz#9653a036fb7c1ee42342f2325cceefea3926c48d"
+
+punycode@^1.2.4, punycode@^1.3.2, punycode@^1.4.1:
+  version "1.4.1"
+  resolved "https://registry.yarnpkg.com/punycode/-/punycode-1.4.1.tgz#c0d5a63b2718800ad8e1eb0fa5269c84dd41845e"
+
+q@^1.4.1:
+  version "1.5.1"
+  resolved "https://registry.yarnpkg.com/q/-/q-1.5.1.tgz#7e32f75b41381291d04611f1bf14109ac00651d7"
+
+q@~1.4.1:
+  version "1.4.1"
+  resolved "https://registry.yarnpkg.com/q/-/q-1.4.1.tgz#55705bcd93c5f3673530c2c2cbc0c2b3addc286e"
+
+qs@0.5.1:
+  version "0.5.1"
+  resolved "https://registry.yarnpkg.com/qs/-/qs-0.5.1.tgz#9f6bf5d9ac6c76384e95d36d15b48980e5e4add0"
+
+qs@5.2.0:
+  version "5.2.0"
+  resolved "https://registry.yarnpkg.com/qs/-/qs-5.2.0.tgz#a9f31142af468cb72b25b30136ba2456834916be"
+
+qs@6.5.1, qs@~6.5.1:
+  version "6.5.1"
+  resolved "https://registry.yarnpkg.com/qs/-/qs-6.5.1.tgz#349cdf6eef89ec45c12d7d5eb3fc0c870343a6d8"
+
+qs@~2.4.0:
+  version "2.4.2"
+  resolved "https://registry.yarnpkg.com/qs/-/qs-2.4.2.tgz#f7ce788e5777df0b5010da7f7c4e73ba32470f5a"
+
+qs@~5.1.0:
+  version "5.1.0"
+  resolved "https://registry.yarnpkg.com/qs/-/qs-5.1.0.tgz#4d932e5c7ea411cca76a312d39a606200fd50cd9"
+
+qs@~6.3.0:
+  version "6.3.2"
+  resolved "https://registry.yarnpkg.com/qs/-/qs-6.3.2.tgz#e75bd5f6e268122a2a0e0bda630b2550c166502c"
+
+qs@~6.4.0:
+  version "6.4.0"
+  resolved "https://registry.yarnpkg.com/qs/-/qs-6.4.0.tgz#13e26d28ad6b0ffaa91312cd3bf708ed351e7233"
+
+querystring-es3@^0.2.0:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/querystring-es3/-/querystring-es3-0.2.1.tgz#9ec61f79049875707d69414596fd907a4d711e73"
+
+querystring@0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/querystring/-/querystring-0.2.0.tgz#b209849203bb25df820da756e747005878521620"
+
+querystringify@0.0.x:
+  version "0.0.4"
+  resolved "https://registry.yarnpkg.com/querystringify/-/querystringify-0.0.4.tgz#0cf7f84f9463ff0ae51c4c4b142d95be37724d9c"
+
+querystringify@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/querystringify/-/querystringify-1.0.0.tgz#6286242112c5b712fa654e526652bf6a13ff05cb"
+
+randomatic@^1.1.3:
+  version "1.1.7"
+  resolved "https://registry.yarnpkg.com/randomatic/-/randomatic-1.1.7.tgz#c7abe9cc8b87c0baa876b19fde83fd464797e38c"
+  dependencies:
+    is-number "^3.0.0"
+    kind-of "^4.0.0"
+
+range-parser@0.0.4:
+  version "0.0.4"
+  resolved "https://registry.yarnpkg.com/range-parser/-/range-parser-0.0.4.tgz#c0427ffef51c10acba0782a46c9602e744ff620b"
+
+range-parser@^1.0.3, range-parser@~1.2.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/range-parser/-/range-parser-1.2.0.tgz#f49be6b487894ddc40dcc94a322f611092e00d5e"
+
+raw-body@2.3.2:
+  version "2.3.2"
+  resolved "https://registry.yarnpkg.com/raw-body/-/raw-body-2.3.2.tgz#bcd60c77d3eb93cde0050295c3f379389bc88f89"
+  dependencies:
+    bytes "3.0.0"
+    http-errors "1.6.2"
+    iconv-lite "0.4.19"
+    unpipe "1.0.0"
+
+raw-body@~2.1.5:
+  version "2.1.7"
+  resolved "https://registry.yarnpkg.com/raw-body/-/raw-body-2.1.7.tgz#adfeace2e4fb3098058014d08c072dcc59758774"
+  dependencies:
+    bytes "2.4.0"
+    iconv-lite "0.4.13"
+    unpipe "1.0.0"
+
+rc@^1.1.7:
+  version "1.2.5"
+  resolved "https://registry.yarnpkg.com/rc/-/rc-1.2.5.tgz#275cd687f6e3b36cc756baa26dfee80a790301fd"
+  dependencies:
+    deep-extend "~0.4.0"
+    ini "~1.3.0"
+    minimist "^1.2.0"
+    strip-json-comments "~2.0.1"
+
+read-pkg-up@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/read-pkg-up/-/read-pkg-up-1.0.1.tgz#9d63c13276c065918d57f002a57f40a1b643fb02"
+  dependencies:
+    find-up "^1.0.0"
+    read-pkg "^1.0.0"
+
+read-pkg@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/read-pkg/-/read-pkg-1.1.0.tgz#f5ffaa5ecd29cb31c0474bca7d756b6bb29e3f28"
+  dependencies:
+    load-json-file "^1.0.0"
+    normalize-package-data "^2.3.2"
+    path-type "^1.0.0"
+
+readable-stream@^2, readable-stream@^2.0.1, readable-stream@^2.0.2, readable-stream@^2.0.5, readable-stream@^2.0.6, readable-stream@^2.1.4, readable-stream@^2.1.5, readable-stream@^2.2.2, readable-stream@^2.3.3:
+  version "2.3.5"
+  resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-2.3.5.tgz#b4f85003a938cbb6ecbce2a124fb1012bd1a838d"
+  dependencies:
+    core-util-is "~1.0.0"
+    inherits "~2.0.3"
+    isarray "~1.0.0"
+    process-nextick-args "~2.0.0"
+    safe-buffer "~5.1.1"
+    string_decoder "~1.0.3"
+    util-deprecate "~1.0.1"
+
+readable-stream@~1.0.2, readable-stream@~1.0.24, readable-stream@~1.0.26, readable-stream@~1.0.33:
+  version "1.0.34"
+  resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-1.0.34.tgz#125820e34bc842d2f2aaafafe4c2916ee32c157c"
+  dependencies:
+    core-util-is "~1.0.0"
+    inherits "~2.0.1"
+    isarray "0.0.1"
+    string_decoder "~0.10.x"
+
+readdirp@^2.0.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-2.1.0.tgz#4ed0ad060df3073300c48440373f72d1cc642d78"
+  dependencies:
+    graceful-fs "^4.1.2"
+    minimatch "^3.0.2"
+    readable-stream "^2.0.2"
+    set-immediate-shim "^1.0.1"
+
+readline2@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/readline2/-/readline2-1.0.1.tgz#41059608ffc154757b715d9989d199ffbf372e35"
+  dependencies:
+    code-point-at "^1.0.0"
+    is-fullwidth-code-point "^1.0.0"
+    mute-stream "0.0.5"
+
+redent@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/redent/-/redent-1.0.0.tgz#cf916ab1fd5f1f16dfb20822dd6ec7f730c2afde"
+  dependencies:
+    indent-string "^2.1.0"
+    strip-indent "^1.0.1"
+
+regenerate@^1.2.1:
+  version "1.3.3"
+  resolved "https://registry.yarnpkg.com/regenerate/-/regenerate-1.3.3.tgz#0c336d3980553d755c39b586ae3b20aa49c82b7f"
+
+regenerator-runtime@^0.11.0:
+  version "0.11.1"
+  resolved "https://registry.yarnpkg.com/regenerator-runtime/-/regenerator-runtime-0.11.1.tgz#be05ad7f9bf7d22e056f9726cee5017fbf19e2e9"
+
+regenerator-transform@^0.10.0:
+  version "0.10.1"
+  resolved "https://registry.yarnpkg.com/regenerator-transform/-/regenerator-transform-0.10.1.tgz#1e4996837231da8b7f3cf4114d71b5691a0680dd"
+  dependencies:
+    babel-runtime "^6.18.0"
+    babel-types "^6.19.0"
+    private "^0.1.6"
+
+regex-cache@^0.4.2:
+  version "0.4.4"
+  resolved "https://registry.yarnpkg.com/regex-cache/-/regex-cache-0.4.4.tgz#75bdc58a2a1496cec48a12835bc54c8d562336dd"
+  dependencies:
+    is-equal-shallow "^0.1.3"
+
+regexpu-core@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/regexpu-core/-/regexpu-core-2.0.0.tgz#49d038837b8dcf8bfa5b9a42139938e6ea2ae240"
+  dependencies:
+    regenerate "^1.2.1"
+    regjsgen "^0.2.0"
+    regjsparser "^0.1.4"
+
+regjsgen@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/regjsgen/-/regjsgen-0.2.0.tgz#6c016adeac554f75823fe37ac05b92d5a4edb1f7"
+
+regjsparser@^0.1.4:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/regjsparser/-/regjsparser-0.1.5.tgz#7ee8f84dc6fa792d3fd0ae228d24bd949ead205c"
+  dependencies:
+    jsesc "~0.5.0"
+
+remove-trailing-separator@^1.0.1:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/remove-trailing-separator/-/remove-trailing-separator-1.1.0.tgz#c24bce2a283adad5bc3f58e0d48249b92379d8ef"
+
+repeat-element@^1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/repeat-element/-/repeat-element-1.1.2.tgz#ef089a178d1483baae4d93eb98b4f9e4e11d990a"
+
+repeat-string@^0.2.2:
+  version "0.2.2"
+  resolved "https://registry.yarnpkg.com/repeat-string/-/repeat-string-0.2.2.tgz#c7a8d3236068362059a7e4651fc6884e8b1fb4ae"
+
+repeat-string@^1.5.2:
+  version "1.6.1"
+  resolved "https://registry.yarnpkg.com/repeat-string/-/repeat-string-1.6.1.tgz#8dcae470e1c88abc2d600fff4a776286da75e637"
+
+repeating@^2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/repeating/-/repeating-2.0.1.tgz#5214c53a926d3552707527fbab415dbc08d06dda"
+  dependencies:
+    is-finite "^1.0.0"
+
+request-progress@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/request-progress/-/request-progress-2.0.1.tgz#5d36bb57961c673aa5b788dbc8141fdf23b44e08"
+  dependencies:
+    throttleit "^1.0.0"
+
+request@2.79.0:
+  version "2.79.0"
+  resolved "https://registry.yarnpkg.com/request/-/request-2.79.0.tgz#4dfe5bf6be8b8cdc37fcf93e04b65577722710de"
+  dependencies:
+    aws-sign2 "~0.6.0"
+    aws4 "^1.2.1"
+    caseless "~0.11.0"
+    combined-stream "~1.0.5"
+    extend "~3.0.0"
+    forever-agent "~0.6.1"
+    form-data "~2.1.1"
+    har-validator "~2.0.6"
+    hawk "~3.1.3"
+    http-signature "~1.1.0"
+    is-typedarray "~1.0.0"
+    isstream "~0.1.2"
+    json-stringify-safe "~5.0.1"
+    mime-types "~2.1.7"
+    oauth-sign "~0.8.1"
+    qs "~6.3.0"
+    stringstream "~0.0.4"
+    tough-cookie "~2.3.0"
+    tunnel-agent "~0.4.1"
+    uuid "^3.0.0"
+
+request@2.81.0:
+  version "2.81.0"
+  resolved "https://registry.yarnpkg.com/request/-/request-2.81.0.tgz#c6928946a0e06c5f8d6f8a9333469ffda46298a0"
+  dependencies:
+    aws-sign2 "~0.6.0"
+    aws4 "^1.2.1"
+    caseless "~0.12.0"
+    combined-stream "~1.0.5"
+    extend "~3.0.0"
+    forever-agent "~0.6.1"
+    form-data "~2.1.1"
+    har-validator "~4.2.1"
+    hawk "~3.1.3"
+    http-signature "~1.1.0"
+    is-typedarray "~1.0.0"
+    isstream "~0.1.2"
+    json-stringify-safe "~5.0.1"
+    mime-types "~2.1.7"
+    oauth-sign "~0.8.1"
+    performance-now "^0.2.0"
+    qs "~6.4.0"
+    safe-buffer "^5.0.1"
+    stringstream "~0.0.4"
+    tough-cookie "~2.3.0"
+    tunnel-agent "^0.6.0"
+    uuid "^3.0.0"
+
+request@2.9.x:
+  version "2.9.203"
+  resolved "https://registry.yarnpkg.com/request/-/request-2.9.203.tgz#6c1711a5407fb94a114219563e44145bcbf4723a"
+
+request@^2.81.0:
+  version "2.83.0"
+  resolved "https://registry.yarnpkg.com/request/-/request-2.83.0.tgz#ca0b65da02ed62935887808e6f510381034e3356"
+  dependencies:
+    aws-sign2 "~0.7.0"
+    aws4 "^1.6.0"
+    caseless "~0.12.0"
+    combined-stream "~1.0.5"
+    extend "~3.0.1"
+    forever-agent "~0.6.1"
+    form-data "~2.3.1"
+    har-validator "~5.0.3"
+    hawk "~6.0.2"
+    http-signature "~1.2.0"
+    is-typedarray "~1.0.0"
+    isstream "~0.1.2"
+    json-stringify-safe "~5.0.1"
+    mime-types "~2.1.17"
+    oauth-sign "~0.8.2"
+    performance-now "^2.1.0"
+    qs "~6.5.1"
+    safe-buffer "^5.1.1"
+    stringstream "~0.0.5"
+    tough-cookie "~2.3.3"
+    tunnel-agent "^0.6.0"
+    uuid "^3.1.0"
+
+request@~2.55.0:
+  version "2.55.0"
+  resolved "https://registry.yarnpkg.com/request/-/request-2.55.0.tgz#d75c1cdf679d76bb100f9bffe1fe551b5c24e93d"
+  dependencies:
+    aws-sign2 "~0.5.0"
+    bl "~0.9.0"
+    caseless "~0.9.0"
+    combined-stream "~0.0.5"
+    forever-agent "~0.6.0"
+    form-data "~0.2.0"
+    har-validator "^1.4.0"
+    hawk "~2.3.0"
+    http-signature "~0.10.0"
+    isstream "~0.1.1"
+    json-stringify-safe "~5.0.0"
+    mime-types "~2.0.1"
+    node-uuid "~1.4.0"
+    oauth-sign "~0.6.0"
+    qs "~2.4.0"
+    stringstream "~0.0.4"
+    tough-cookie ">=0.12.0"
+    tunnel-agent "~0.4.0"
+
+require-directory@^2.1.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/require-directory/-/require-directory-2.1.1.tgz#8c64ad5fd30dab1c976e2344ffe7f792a6a6df42"
+
+require-main-filename@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/require-main-filename/-/require-main-filename-1.0.1.tgz#97f717b69d48784f5f526a6c5aa8ffdda055a4d1"
+
+require-relative@^0.8.7:
+  version "0.8.7"
+  resolved "https://registry.yarnpkg.com/require-relative/-/require-relative-0.8.7.tgz#7999539fc9e047a37928fa196f8e1563dabd36de"
+
+requires-port@1.0.x, requires-port@1.x.x, requires-port@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/requires-port/-/requires-port-1.0.0.tgz#925d2601d39ac485e091cf0da5c6e694dc3dcaff"
+
+resolve-from@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-2.0.0.tgz#9480ab20e94ffa1d9e80a804c7ea147611966b57"
+
+resolve@1.1.x:
+  version "1.1.7"
+  resolved "https://registry.yarnpkg.com/resolve/-/resolve-1.1.7.tgz#203114d82ad2c5ed9e8e0411b3932875e889e97b"
+
+resolve@~0.3.1:
+  version "0.3.1"
+  resolved "https://registry.yarnpkg.com/resolve/-/resolve-0.3.1.tgz#34c63447c664c70598d1c9b126fc43b2a24310a4"
+
+restore-cursor@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/restore-cursor/-/restore-cursor-1.0.1.tgz#34661f46886327fed2991479152252df92daa541"
+  dependencies:
+    exit-hook "^1.0.0"
+    onetime "^1.0.0"
+
+right-align@^0.1.1:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/right-align/-/right-align-0.1.3.tgz#61339b722fe6a3515689210d24e14c96148613ef"
+  dependencies:
+    align-text "^0.1.1"
+
+rimraf@2, rimraf@^2.2.8, rimraf@^2.3.3, rimraf@^2.5.1, rimraf@^2.5.4, rimraf@^2.6.1, rimraf@^2.6.2:
+  version "2.6.2"
+  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.6.2.tgz#2ed8150d24a16ea8651e6d6ef0f47c4158ce7a36"
+  dependencies:
+    glob "^7.0.5"
+
+rimraf@2.4.3:
+  version "2.4.3"
+  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.4.3.tgz#e5b51c9437a4c582adb955e9f28cf8d945e272af"
+  dependencies:
+    glob "^5.0.14"
+
+rimraf@~2.2.8:
+  version "2.2.8"
+  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.2.8.tgz#e439be2aaee327321952730f99a8929e4fc50582"
+
+ripemd160@0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/ripemd160/-/ripemd160-0.2.0.tgz#2bf198bde167cacfa51c0a928e84b68bbe171fce"
+
+run-async@^0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/run-async/-/run-async-0.1.0.tgz#c8ad4a5e110661e402a7d21b530e009f25f8e389"
+  dependencies:
+    once "^1.3.0"
+
+rx-lite@^3.1.2:
+  version "3.1.2"
+  resolved "https://registry.yarnpkg.com/rx-lite/-/rx-lite-3.1.2.tgz#19ce502ca572665f3b647b10939f97fd1615f102"
+
+safe-buffer@5.1.1, safe-buffer@^5.0.1, safe-buffer@^5.1.1, safe-buffer@~5.1.0, safe-buffer@~5.1.1:
+  version "5.1.1"
+  resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.1.1.tgz#893312af69b2123def71f57889001671eeb2c853"
+
+sauce-connect-launcher@^0.13.0:
+  version "0.13.0"
+  resolved "https://registry.yarnpkg.com/sauce-connect-launcher/-/sauce-connect-launcher-0.13.0.tgz#25d7df9da16a5ed1caa13df424cb57cb0b6d5a22"
+  dependencies:
+    adm-zip "~0.4.3"
+    async "1.4.0"
+    lodash "3.10.1"
+    rimraf "2.4.3"
+
+saucelabs@^1.0.1:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/saucelabs/-/saucelabs-1.4.0.tgz#b934a9af9da2874b3f40aae1fcde50a4466f5f38"
+  dependencies:
+    https-proxy-agent "^1.0.0"
+
+"semver@2 || 3 || 4 || 5", semver@^5.0.3, semver@^5.3.0:
+  version "5.5.0"
+  resolved "https://registry.yarnpkg.com/semver/-/semver-5.5.0.tgz#dc4bbc7a6ca9d916dee5d43516f0092b58f7b8ab"
+
+semver@~1.0.13:
+  version "1.0.14"
+  resolved "https://registry.yarnpkg.com/semver/-/semver-1.0.14.tgz#cac5e2d55a6fbf958cb220ae844045071c78f676"
+
+semver@~4.3.3:
+  version "4.3.6"
+  resolved "https://registry.yarnpkg.com/semver/-/semver-4.3.6.tgz#300bc6e0e86374f7ba61068b5b1ecd57fc6532da"
+
+semver@~5.0.1:
+  version "5.0.3"
+  resolved "https://registry.yarnpkg.com/semver/-/semver-5.0.3.tgz#77466de589cd5d3c95f138aa78bc569a3cb5d27a"
+
+send@0.0.4:
+  version "0.0.4"
+  resolved "https://registry.yarnpkg.com/send/-/send-0.0.4.tgz#2d4cf79b189fcd09610e1302510ac9b0e4dde800"
+  dependencies:
+    debug "*"
+    fresh "0.1.0"
+    mime "1.2.6"
+    range-parser "0.0.4"
+
+send@0.16.1:
+  version "0.16.1"
+  resolved "https://registry.yarnpkg.com/send/-/send-0.16.1.tgz#a70e1ca21d1382c11d0d9f6231deb281080d7ab3"
+  dependencies:
+    debug "2.6.9"
+    depd "~1.1.1"
+    destroy "~1.0.4"
+    encodeurl "~1.0.1"
+    escape-html "~1.0.3"
+    etag "~1.8.1"
+    fresh "0.5.2"
+    http-errors "~1.6.2"
+    mime "1.4.1"
+    ms "2.0.0"
+    on-finished "~2.3.0"
+    range-parser "~1.2.0"
+    statuses "~1.3.1"
+
+serve-index@^1.7.2:
+  version "1.9.1"
+  resolved "https://registry.yarnpkg.com/serve-index/-/serve-index-1.9.1.tgz#d3768d69b1e7d82e5ce050fff5b453bea12a9239"
+  dependencies:
+    accepts "~1.3.4"
+    batch "0.6.1"
+    debug "2.6.9"
+    escape-html "~1.0.3"
+    http-errors "~1.6.2"
+    mime-types "~2.1.17"
+    parseurl "~1.3.2"
+
+serve-static@1.13.1:
+  version "1.13.1"
+  resolved "https://registry.yarnpkg.com/serve-static/-/serve-static-1.13.1.tgz#4c57d53404a761d8f2e7c1e8a18a47dbf278a719"
+  dependencies:
+    encodeurl "~1.0.1"
+    escape-html "~1.0.3"
+    parseurl "~1.3.2"
+    send "0.16.1"
+
+set-blocking@^2.0.0, set-blocking@~2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/set-blocking/-/set-blocking-2.0.0.tgz#045f9782d011ae9a6803ddd382b24392b3d890f7"
+
+set-immediate-shim@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/set-immediate-shim/-/set-immediate-shim-1.0.1.tgz#4b2b1b27eb808a9f8dcc481a58e5e56f599f3f61"
+
+setimmediate@^1.0.4:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/setimmediate/-/setimmediate-1.0.5.tgz#290cbb232e306942d7d7ea9b83732ab7856f8285"
+
+setprototypeof@1.0.3:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/setprototypeof/-/setprototypeof-1.0.3.tgz#66567e37043eeb4f04d91bd658c0cbefb55b8e04"
+
+setprototypeof@1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/setprototypeof/-/setprototypeof-1.1.0.tgz#d0bd85536887b6fe7c0d818cb962d9d91c54e656"
+
+sha.js@2.2.6:
+  version "2.2.6"
+  resolved "https://registry.yarnpkg.com/sha.js/-/sha.js-2.2.6.tgz#17ddeddc5f722fb66501658895461977867315ba"
+
+shebang-command@^1.2.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/shebang-command/-/shebang-command-1.2.0.tgz#44aac65b695b03398968c39f363fee5deafdf1ea"
+  dependencies:
+    shebang-regex "^1.0.0"
+
+shebang-regex@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/shebang-regex/-/shebang-regex-1.0.0.tgz#da42f49740c0b42db2ca9728571cb190c98efea3"
+
+shelljs@^0.5.3:
+  version "0.5.3"
+  resolved "https://registry.yarnpkg.com/shelljs/-/shelljs-0.5.3.tgz#c54982b996c76ef0c1e6b59fbdc5825f5b713113"
+
+sigmund@~1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/sigmund/-/sigmund-1.0.1.tgz#3ff21f198cad2175f9f3b781853fd94d0d19b590"
+
+signal-exit@^3.0.0, signal-exit@^3.0.1, signal-exit@^3.0.2:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/signal-exit/-/signal-exit-3.0.2.tgz#b5fdc08f1287ea1178628e415e25132b73646c6d"
+
+slash@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/slash/-/slash-1.0.0.tgz#c41f2f6c39fc16d1cd17ad4b5d896114ae470d55"
+
+slide@^1.1.5:
+  version "1.1.6"
+  resolved "https://registry.yarnpkg.com/slide/-/slide-1.1.6.tgz#56eb027d65b4d2dce6cb2e2d32c4d4afc9e1d707"
+
+sntp@1.x.x:
+  version "1.0.9"
+  resolved "https://registry.yarnpkg.com/sntp/-/sntp-1.0.9.tgz#6541184cc90aeea6c6e7b35e2659082443c66198"
+  dependencies:
+    hoek "2.x.x"
+
+sntp@2.x.x:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/sntp/-/sntp-2.1.0.tgz#2c6cec14fedc2222739caf9b5c3d85d1cc5a2cc8"
+  dependencies:
+    hoek "4.x.x"
+
+socket.io-adapter@0.5.0:
+  version "0.5.0"
+  resolved "https://registry.yarnpkg.com/socket.io-adapter/-/socket.io-adapter-0.5.0.tgz#cb6d4bb8bec81e1078b99677f9ced0046066bb8b"
+  dependencies:
+    debug "2.3.3"
+    socket.io-parser "2.3.1"
+
+socket.io-client@1.7.4:
+  version "1.7.4"
+  resolved "https://registry.yarnpkg.com/socket.io-client/-/socket.io-client-1.7.4.tgz#ec9f820356ed99ef6d357f0756d648717bdd4281"
+  dependencies:
+    backo2 "1.0.2"
+    component-bind "1.0.0"
+    component-emitter "1.2.1"
+    debug "2.3.3"
+    engine.io-client "~1.8.4"
+    has-binary "0.1.7"
+    indexof "0.0.1"
+    object-component "0.0.3"
+    parseuri "0.0.5"
+    socket.io-parser "2.3.1"
+    to-array "0.1.4"
+
+socket.io-parser@2.3.1:
+  version "2.3.1"
+  resolved "https://registry.yarnpkg.com/socket.io-parser/-/socket.io-parser-2.3.1.tgz#dd532025103ce429697326befd64005fcfe5b4a0"
+  dependencies:
+    component-emitter "1.1.2"
+    debug "2.2.0"
+    isarray "0.0.1"
+    json3 "3.3.2"
+
+socket.io@^1.4.5:
+  version "1.7.4"
+  resolved "https://registry.yarnpkg.com/socket.io/-/socket.io-1.7.4.tgz#2f7ecedc3391bf2d5c73e291fe233e6e34d4dd00"
+  dependencies:
+    debug "2.3.3"
+    engine.io "~1.8.4"
+    has-binary "0.1.7"
+    object-assign "4.1.0"
+    socket.io-adapter "0.5.0"
+    socket.io-client "1.7.4"
+    socket.io-parser "2.3.1"
+
+sockjs-client@^1.0.3:
+  version "1.1.4"
+  resolved "https://registry.yarnpkg.com/sockjs-client/-/sockjs-client-1.1.4.tgz#5babe386b775e4cf14e7520911452654016c8b12"
+  dependencies:
+    debug "^2.6.6"
+    eventsource "0.1.6"
+    faye-websocket "~0.11.0"
+    inherits "^2.0.1"
+    json3 "^3.3.2"
+    url-parse "^1.1.8"
+
+sockjs@^0.3.15:
+  version "0.3.19"
+  resolved "https://registry.yarnpkg.com/sockjs/-/sockjs-0.3.19.tgz#d976bbe800af7bd20ae08598d582393508993c0d"
+  dependencies:
+    faye-websocket "^0.10.0"
+    uuid "^3.0.1"
+
+source-list-map@~0.1.7:
+  version "0.1.8"
+  resolved "https://registry.yarnpkg.com/source-list-map/-/source-list-map-0.1.8.tgz#c550b2ab5427f6b3f21f5afead88c4f5587b2106"
+
+source-map-support@^0.3.2:
+  version "0.3.3"
+  resolved "https://registry.yarnpkg.com/source-map-support/-/source-map-support-0.3.3.tgz#34900977d5ba3f07c7757ee72e73bb1a9b53754f"
+  dependencies:
+    source-map "0.1.32"
+
+source-map-support@^0.4.15, source-map-support@^0.4.18:
+  version "0.4.18"
+  resolved "https://registry.yarnpkg.com/source-map-support/-/source-map-support-0.4.18.tgz#0286a6de8be42641338594e97ccea75f0a2c585f"
+  dependencies:
+    source-map "^0.5.6"
+
+source-map@0.1.32:
+  version "0.1.32"
+  resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.1.32.tgz#c8b6c167797ba4740a8ea33252162ff08591b266"
+  dependencies:
+    amdefine ">=0.0.4"
+
+source-map@^0.1.41:
+  version "0.1.43"
+  resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.1.43.tgz#c24bc146ca517c1471f5dacbe2571b2b7f9e3346"
+  dependencies:
+    amdefine ">=0.0.4"
+
+source-map@^0.4.4, source-map@~0.4.1:
+  version "0.4.4"
+  resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.4.4.tgz#eba4f5da9c0dc999de68032d8b4f76173652036b"
+  dependencies:
+    amdefine ">=0.0.4"
+
+source-map@^0.5.3, source-map@^0.5.6, source-map@^0.5.7, source-map@~0.5.1:
+  version "0.5.7"
+  resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.5.7.tgz#8a039d2d1021d22d1ea14c80d8ea468ba2ef3fcc"
+
+source-map@^0.6.1:
+  version "0.6.1"
+  resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.6.1.tgz#74722af32e9614e9c287a8d0bbde48b5e2f1a263"
+
+source-map@~0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.2.0.tgz#dab73fbcfc2ba819b4de03bd6f6eaa48164b3f9d"
+  dependencies:
+    amdefine ">=0.0.4"
+
+spawn-wrap@^1.4.2:
+  version "1.4.2"
+  resolved "https://registry.yarnpkg.com/spawn-wrap/-/spawn-wrap-1.4.2.tgz#cff58e73a8224617b6561abdc32586ea0c82248c"
+  dependencies:
+    foreground-child "^1.5.6"
+    mkdirp "^0.5.0"
+    os-homedir "^1.0.1"
+    rimraf "^2.6.2"
+    signal-exit "^3.0.2"
+    which "^1.3.0"
+
+spdx-correct@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/spdx-correct/-/spdx-correct-3.0.0.tgz#05a5b4d7153a195bc92c3c425b69f3b2a9524c82"
+  dependencies:
+    spdx-expression-parse "^3.0.0"
+    spdx-license-ids "^3.0.0"
+
+spdx-exceptions@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/spdx-exceptions/-/spdx-exceptions-2.1.0.tgz#2c7ae61056c714a5b9b9b2b2af7d311ef5c78fe9"
+
+spdx-expression-parse@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/spdx-expression-parse/-/spdx-expression-parse-3.0.0.tgz#99e119b7a5da00e05491c9fa338b7904823b41d0"
+  dependencies:
+    spdx-exceptions "^2.1.0"
+    spdx-license-ids "^3.0.0"
+
+spdx-license-ids@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/spdx-license-ids/-/spdx-license-ids-3.0.0.tgz#7a7cd28470cc6d3a1cfe6d66886f6bc430d3ac87"
+
+sprintf-js@~1.0.2:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/sprintf-js/-/sprintf-js-1.0.3.tgz#04e6926f662895354f3dd015203633b857297e2c"
+
+sshpk@^1.7.0:
+  version "1.13.1"
+  resolved "https://registry.yarnpkg.com/sshpk/-/sshpk-1.13.1.tgz#512df6da6287144316dc4c18fe1cf1d940739be3"
+  dependencies:
+    asn1 "~0.2.3"
+    assert-plus "^1.0.0"
+    dashdash "^1.12.0"
+    getpass "^0.1.1"
+  optionalDependencies:
+    bcrypt-pbkdf "^1.0.0"
+    ecc-jsbn "~0.1.1"
+    jsbn "~0.1.0"
+    tweetnacl "~0.14.0"
+
+stack-trace@0.0.x:
+  version "0.0.10"
+  resolved "https://registry.yarnpkg.com/stack-trace/-/stack-trace-0.0.10.tgz#547c70b347e8d32b4e108ea1a2a159e5fdde19c0"
+
+stack-utils@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/stack-utils/-/stack-utils-1.0.1.tgz#d4f33ab54e8e38778b0ca5cfd3b3afb12db68620"
+
+statuses@1, "statuses@>= 1.3.1 < 2":
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/statuses/-/statuses-1.4.0.tgz#bb73d446da2796106efcc1b601a253d6c46bd087"
+
+statuses@~1.3.1:
+  version "1.3.1"
+  resolved "https://registry.yarnpkg.com/statuses/-/statuses-1.3.1.tgz#faf51b9eb74aaef3b3acf4ad5f61abf24cb7b93e"
+
+stream-browserify@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/stream-browserify/-/stream-browserify-2.0.1.tgz#66266ee5f9bdb9940a4e4514cafb43bb71e5c9db"
+  dependencies:
+    inherits "~2.0.1"
+    readable-stream "^2.0.2"
+
+stream-cache@~0.0.1:
+  version "0.0.2"
+  resolved "https://registry.yarnpkg.com/stream-cache/-/stream-cache-0.0.2.tgz#1ac5ad6832428ca55667dbdee395dad4e6db118f"
+
+stream-http@^2.3.1:
+  version "2.8.0"
+  resolved "https://registry.yarnpkg.com/stream-http/-/stream-http-2.8.0.tgz#fd86546dac9b1c91aff8fc5d287b98fafb41bc10"
+  dependencies:
+    builtin-status-codes "^3.0.0"
+    inherits "^2.0.1"
+    readable-stream "^2.3.3"
+    to-arraybuffer "^1.0.0"
+    xtend "^4.0.0"
+
+string-width@^1.0.1, string-width@^1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/string-width/-/string-width-1.0.2.tgz#118bdf5b8cdc51a2a7e70d211e07e2b0b9b107d3"
+  dependencies:
+    code-point-at "^1.0.0"
+    is-fullwidth-code-point "^1.0.0"
+    strip-ansi "^3.0.0"
+
+string-width@^2.0.0, string-width@^2.1.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/string-width/-/string-width-2.1.1.tgz#ab93f27a8dc13d28cac815c462143a6d9012ae9e"
+  dependencies:
+    is-fullwidth-code-point "^2.0.0"
+    strip-ansi "^4.0.0"
+
+string_decoder@^0.10.25, string_decoder@~0.10.x:
+  version "0.10.31"
+  resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-0.10.31.tgz#62e203bc41766c6c28c9fc84301dab1c5310fa94"
+
+string_decoder@~1.0.3:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.0.3.tgz#0fc67d7c141825de94282dd536bec6b9bce860ab"
+  dependencies:
+    safe-buffer "~5.1.0"
+
+stringstream@~0.0.4, stringstream@~0.0.5:
+  version "0.0.5"
+  resolved "https://registry.yarnpkg.com/stringstream/-/stringstream-0.0.5.tgz#4e484cd4de5a0bbbee18e46307710a8a81621878"
+
+strip-ansi@^3.0.0, strip-ansi@^3.0.1:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-3.0.1.tgz#6a385fb8853d952d5ff05d0e8aaf94278dc63dcf"
+  dependencies:
+    ansi-regex "^2.0.0"
+
+strip-ansi@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-4.0.0.tgz#a8479022eb1ac368a871389b635262c505ee368f"
+  dependencies:
+    ansi-regex "^3.0.0"
+
+strip-bom@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/strip-bom/-/strip-bom-2.0.0.tgz#6219a85616520491f35788bdbf1447a99c7e6b0e"
+  dependencies:
+    is-utf8 "^0.2.0"
+
+strip-eof@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/strip-eof/-/strip-eof-1.0.0.tgz#bb43ff5598a6eb05d89b59fcd129c983313606bf"
+
+strip-indent@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/strip-indent/-/strip-indent-1.0.1.tgz#0c7962a6adefa7bbd4ac366460a638552ae1a0a2"
+  dependencies:
+    get-stdin "^4.0.1"
+
+strip-json-comments@~1.0.1:
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-1.0.4.tgz#1e15fbcac97d3ee99bf2d73b4c656b082bbafb91"
+
+strip-json-comments@~2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-2.0.1.tgz#3c531942e908c2697c0ec344858c286c7ca0a60a"
+
+supports-color@1.2.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-1.2.0.tgz#ff1ed1e61169d06b3cf2d588e188b18d8847e17e"
+
+supports-color@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-2.0.0.tgz#535d045ce6b6363fa40117084629995e9df324c7"
+
+supports-color@^3.1.0, supports-color@^3.1.1, supports-color@^3.1.2:
+  version "3.2.3"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-3.2.3.tgz#65ac0504b3954171d8a64946b2ae3cbb8a5f54f6"
+  dependencies:
+    has-flag "^1.0.0"
+
+supports-color@^5.3.0:
+  version "5.3.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.3.0.tgz#5b24ac15db80fa927cf5227a4a33fd3c4c7676c0"
+  dependencies:
+    has-flag "^3.0.0"
+
+tap-mocha-reporter@^3.0.6:
+  version "3.0.6"
+  resolved "https://registry.yarnpkg.com/tap-mocha-reporter/-/tap-mocha-reporter-3.0.6.tgz#12abe97ff409a5a6ecc3d70b6dba34d82184a770"
+  dependencies:
+    color-support "^1.1.0"
+    debug "^2.1.3"
+    diff "^1.3.2"
+    escape-string-regexp "^1.0.3"
+    glob "^7.0.5"
+    js-yaml "^3.3.1"
+    tap-parser "^5.1.0"
+    unicode-length "^1.0.0"
+  optionalDependencies:
+    readable-stream "^2.1.5"
+
+tap-parser@^5.1.0:
+  version "5.4.0"
+  resolved "https://registry.yarnpkg.com/tap-parser/-/tap-parser-5.4.0.tgz#6907e89725d7b7fa6ae41ee2c464c3db43188aec"
+  dependencies:
+    events-to-array "^1.0.1"
+    js-yaml "^3.2.7"
+  optionalDependencies:
+    readable-stream "^2"
+
+tap-parser@^7.0.0:
+  version "7.0.0"
+  resolved "https://registry.yarnpkg.com/tap-parser/-/tap-parser-7.0.0.tgz#54db35302fda2c2ccc21954ad3be22b2cba42721"
+  dependencies:
+    events-to-array "^1.0.1"
+    js-yaml "^3.2.7"
+    minipass "^2.2.0"
+
+tap@>=0.2.3:
+  version "11.1.1"
+  resolved "https://registry.yarnpkg.com/tap/-/tap-11.1.1.tgz#6dbd23c487127f621a95c793f7a247fa7e2c053a"
+  dependencies:
+    bind-obj-methods "^1.0.0"
+    bluebird "^3.5.1"
+    clean-yaml-object "^0.1.0"
+    color-support "^1.1.0"
+    coveralls "^2.13.3"
+    foreground-child "^1.3.3"
+    fs-exists-cached "^1.0.0"
+    function-loop "^1.0.1"
+    glob "^7.0.0"
+    isexe "^2.0.0"
+    js-yaml "^3.10.0"
+    minipass "^2.2.1"
+    mkdirp "^0.5.1"
+    nyc "^11.3.0"
+    opener "^1.4.1"
+    os-homedir "^1.0.2"
+    own-or "^1.0.0"
+    own-or-env "^1.0.0"
+    rimraf "^2.6.2"
+    signal-exit "^3.0.0"
+    source-map-support "^0.4.18"
+    stack-utils "^1.0.0"
+    tap-mocha-reporter "^3.0.6"
+    tap-parser "^7.0.0"
+    tmatch "^3.1.0"
+    trivial-deferred "^1.0.1"
+    tsame "^1.1.2"
+    write-file-atomic "^2.3.0"
+    yapool "^1.0.0"
+
+tapable@^0.1.8, tapable@~0.1.8:
+  version "0.1.10"
+  resolved "https://registry.yarnpkg.com/tapable/-/tapable-0.1.10.tgz#29c35707c2b70e50d07482b5d202e8ed446dafd4"
+
+tar-pack@^3.4.0:
+  version "3.4.1"
+  resolved "https://registry.yarnpkg.com/tar-pack/-/tar-pack-3.4.1.tgz#e1dbc03a9b9d3ba07e896ad027317eb679a10a1f"
+  dependencies:
+    debug "^2.2.0"
+    fstream "^1.0.10"
+    fstream-ignore "^1.0.5"
+    once "^1.3.3"
+    readable-stream "^2.1.4"
+    rimraf "^2.5.1"
+    tar "^2.2.1"
+    uid-number "^0.0.6"
+
+tar-stream@~1.1.0:
+  version "1.1.5"
+  resolved "https://registry.yarnpkg.com/tar-stream/-/tar-stream-1.1.5.tgz#be9218c130c20029e107b0f967fb23de0579d13c"
+  dependencies:
+    bl "^0.9.0"
+    end-of-stream "^1.0.0"
+    readable-stream "~1.0.33"
+    xtend "^4.0.0"
+
+tar@^2.2.1:
+  version "2.2.1"
+  resolved "https://registry.yarnpkg.com/tar/-/tar-2.2.1.tgz#8e4d2a256c0e2185c6b18ad694aec968b83cb1d1"
+  dependencies:
+    block-stream "*"
+    fstream "^1.0.2"
+    inherits "2"
+
+temporary@~0.0.4:
+  version "0.0.8"
+  resolved "https://registry.yarnpkg.com/temporary/-/temporary-0.0.8.tgz#a18a981d28ba8ca36027fb3c30538c3ecb740ac0"
+  dependencies:
+    package ">= 1.0.0 < 1.2.0"
+
+test-exclude@^4.1.1:
+  version "4.2.0"
+  resolved "https://registry.yarnpkg.com/test-exclude/-/test-exclude-4.2.0.tgz#07e3613609a362c74516a717515e13322ab45b3c"
+  dependencies:
+    arrify "^1.0.1"
+    micromatch "^2.3.11"
+    object-assign "^4.1.0"
+    read-pkg-up "^1.0.1"
+    require-main-filename "^1.0.1"
+
+text-table@~0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/text-table/-/text-table-0.2.0.tgz#7f5ee823ae805207c00af2df4a84ec3fcfa570b4"
+
+throttleit@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/throttleit/-/throttleit-1.0.0.tgz#9e785836daf46743145a5984b6268d828528ac6c"
+
+through@^2.3.6:
+  version "2.3.8"
+  resolved "https://registry.yarnpkg.com/through/-/through-2.3.8.tgz#0dd4c9ffaabc357960b1b724115d7e0e86a2e1f5"
+
+time-stamp@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/time-stamp/-/time-stamp-2.0.0.tgz#95c6a44530e15ba8d6f4a3ecb8c3a3fac46da357"
+
+timers-browserify@^2.0.2:
+  version "2.0.6"
+  resolved "https://registry.yarnpkg.com/timers-browserify/-/timers-browserify-2.0.6.tgz#241e76927d9ca05f4d959819022f5b3664b64bae"
+  dependencies:
+    setimmediate "^1.0.4"
+
+timespan@2.x.x:
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/timespan/-/timespan-2.3.0.tgz#4902ce040bd13d845c8f59b27e9d59bad6f39929"
+
+tiny-lr@^0.2.1:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/tiny-lr/-/tiny-lr-0.2.1.tgz#b3fdba802e5d56a33c2f6f10794b32e477ac729d"
+  dependencies:
+    body-parser "~1.14.0"
+    debug "~2.2.0"
+    faye-websocket "~0.10.0"
+    livereload-js "^2.2.0"
+    parseurl "~1.3.0"
+    qs "~5.1.0"
+
+tmatch@^3.1.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/tmatch/-/tmatch-3.1.0.tgz#701264fd7582d0144a80c85af3358cca269c71e3"
+
+tmp@0.0.x:
+  version "0.0.33"
+  resolved "https://registry.yarnpkg.com/tmp/-/tmp-0.0.33.tgz#6d34335889768d21b2bcda0aa277ced3b1bfadf9"
+  dependencies:
+    os-tmpdir "~1.0.2"
+
+to-array@0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/to-array/-/to-array-0.1.4.tgz#17e6c11f73dd4f3d74cda7a4ff3238e9ad9bf890"
+
+to-arraybuffer@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/to-arraybuffer/-/to-arraybuffer-1.0.1.tgz#7d229b1fcc637e466ca081180836a7aabff83f43"
+
+to-fast-properties@^1.0.3:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/to-fast-properties/-/to-fast-properties-1.0.3.tgz#b83571fa4d8c25b82e231b06e3a3055de4ca1a47"
+
+to-iso-string@0.0.2:
+  version "0.0.2"
+  resolved "https://registry.yarnpkg.com/to-iso-string/-/to-iso-string-0.0.2.tgz#4dc19e664dfccbe25bd8db508b00c6da158255d1"
+
+tough-cookie@>=0.12.0, tough-cookie@~2.3.0, tough-cookie@~2.3.3:
+  version "2.3.4"
+  resolved "https://registry.yarnpkg.com/tough-cookie/-/tough-cookie-2.3.4.tgz#ec60cee38ac675063ffc97a5c18970578ee83655"
+  dependencies:
+    punycode "^1.4.1"
+
+trim-newlines@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/trim-newlines/-/trim-newlines-1.0.0.tgz#5887966bb582a4503a41eb524f7d35011815a613"
+
+trim-right@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/trim-right/-/trim-right-1.0.1.tgz#cb2e1203067e0c8de1f614094b9fe45704ea6003"
+
+trivial-deferred@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/trivial-deferred/-/trivial-deferred-1.0.1.tgz#376d4d29d951d6368a6f7a0ae85c2f4d5e0658f3"
+
+tsame@^1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/tsame/-/tsame-1.1.2.tgz#5ce0002acf685942789c63018797a2aa5e6b03c5"
+
+tty-browserify@0.0.0:
+  version "0.0.0"
+  resolved "https://registry.yarnpkg.com/tty-browserify/-/tty-browserify-0.0.0.tgz#a157ba402da24e9bf957f9aa69d524eed42901a6"
+
+tunnel-agent@^0.6.0:
+  version "0.6.0"
+  resolved "https://registry.yarnpkg.com/tunnel-agent/-/tunnel-agent-0.6.0.tgz#27a5dea06b36b04a0a9966774b290868f0fc40fd"
+  dependencies:
+    safe-buffer "^5.0.1"
+
+tunnel-agent@~0.4.0, tunnel-agent@~0.4.1:
+  version "0.4.3"
+  resolved "https://registry.yarnpkg.com/tunnel-agent/-/tunnel-agent-0.4.3.tgz#6373db76909fe570e08d73583365ed828a74eeeb"
+
+tweetnacl@^0.14.3, tweetnacl@~0.14.0:
+  version "0.14.5"
+  resolved "https://registry.yarnpkg.com/tweetnacl/-/tweetnacl-0.14.5.tgz#5ae68177f192d4456269d108afa93ff8743f4f64"
+
+type-check@~0.3.1:
+  version "0.3.2"
+  resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.3.2.tgz#5884cab512cf1d355e3fb784f30804b2b520db72"
+  dependencies:
+    prelude-ls "~1.1.2"
+
+type-detect@0.1.1:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/type-detect/-/type-detect-0.1.1.tgz#0ba5ec2a885640e470ea4e8505971900dac58822"
+
+type-detect@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/type-detect/-/type-detect-1.0.0.tgz#762217cc06db258ec48908a1298e8b95121e8ea2"
+
+type-is@~1.6.10, type-is@~1.6.15:
+  version "1.6.16"
+  resolved "https://registry.yarnpkg.com/type-is/-/type-is-1.6.16.tgz#f89ce341541c672b25ee7ae3c73dee3b2be50194"
+  dependencies:
+    media-typer "0.3.0"
+    mime-types "~2.1.18"
+
+typedarray@^0.0.6:
+  version "0.0.6"
+  resolved "https://registry.yarnpkg.com/typedarray/-/typedarray-0.0.6.tgz#867ac74e3864187b1d3d47d996a78ec5c8830777"
+
+uglify-js@^2.6:
+  version "2.8.29"
+  resolved "https://registry.yarnpkg.com/uglify-js/-/uglify-js-2.8.29.tgz#29c5733148057bb4e1f75df35b7a9cb72e6a59dd"
+  dependencies:
+    source-map "~0.5.1"
+    yargs "~3.10.0"
+  optionalDependencies:
+    uglify-to-browserify "~1.0.0"
+
+uglify-js@~1.3.3:
+  version "1.3.5"
+  resolved "https://registry.yarnpkg.com/uglify-js/-/uglify-js-1.3.5.tgz#4b5bfff9186effbaa888e4c9e94bd9fc4c94929d"
+
+uglify-js@~2.6.2:
+  version "2.6.4"
+  resolved "https://registry.yarnpkg.com/uglify-js/-/uglify-js-2.6.4.tgz#65ea2fb3059c9394692f15fed87c2b36c16b9adf"
+  dependencies:
+    async "~0.2.6"
+    source-map "~0.5.1"
+    uglify-to-browserify "~1.0.0"
+    yargs "~3.10.0"
+
+uglify-js@~2.7.3:
+  version "2.7.5"
+  resolved "https://registry.yarnpkg.com/uglify-js/-/uglify-js-2.7.5.tgz#4612c0c7baaee2ba7c487de4904ae122079f2ca8"
+  dependencies:
+    async "~0.2.6"
+    source-map "~0.5.1"
+    uglify-to-browserify "~1.0.0"
+    yargs "~3.10.0"
+
+uglify-to-browserify@~1.0.0:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/uglify-to-browserify/-/uglify-to-browserify-1.0.2.tgz#6e0924d6bda6b5afe349e39a6d632850a0f882b7"
+
+uid-number@^0.0.6:
+  version "0.0.6"
+  resolved "https://registry.yarnpkg.com/uid-number/-/uid-number-0.0.6.tgz#0ea10e8035e8eb5b8e4449f06da1c730663baa81"
+
+ultron@1.0.x:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/ultron/-/ultron-1.0.2.tgz#ace116ab557cd197386a4e88f4685378c8b2e4fa"
+
+underscore.string@~2.1.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/underscore.string/-/underscore.string-2.1.1.tgz#458397799114b9b67f6030bb527b0afae689c061"
+
+underscore.string@~2.2.1:
+  version "2.2.1"
+  resolved "https://registry.yarnpkg.com/underscore.string/-/underscore.string-2.2.1.tgz#d7c0fa2af5d5a1a67f4253daee98132e733f0f19"
+
+underscore.string@~2.3.3:
+  version "2.3.3"
+  resolved "https://registry.yarnpkg.com/underscore.string/-/underscore.string-2.3.3.tgz#71c08bf6b428b1133f37e78fa3a21c82f7329b0d"
+
+underscore.string@~2.4.0:
+  version "2.4.0"
+  resolved "https://registry.yarnpkg.com/underscore.string/-/underscore.string-2.4.0.tgz#8cdd8fbac4e2d2ea1e7e2e8097c42f442280f85b"
+
+underscore.string@~3.0.3:
+  version "3.0.3"
+  resolved "https://registry.yarnpkg.com/underscore.string/-/underscore.string-3.0.3.tgz#4617b8c1a250cf6e5064fbbb363d0fa96cf14552"
+
+underscore@~1.2.4:
+  version "1.2.4"
+  resolved "https://registry.yarnpkg.com/underscore/-/underscore-1.2.4.tgz#e8da6241aa06f64df2473bb2590b8c17c84c3c7e"
+
+underscore@~1.7.0:
+  version "1.7.0"
+  resolved "https://registry.yarnpkg.com/underscore/-/underscore-1.7.0.tgz#6bbaf0877500d36be34ecaa584e0db9fef035209"
+
+unicode-length@^1.0.0:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/unicode-length/-/unicode-length-1.0.3.tgz#5ada7a7fed51841a418a328cf149478ac8358abb"
+  dependencies:
+    punycode "^1.3.2"
+    strip-ansi "^3.0.1"
+
+unpipe@1.0.0, unpipe@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/unpipe/-/unpipe-1.0.0.tgz#b2bf4ee8514aae6165b4817829d21b2ef49904ec"
+
+uri-path@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/uri-path/-/uri-path-1.0.0.tgz#9747f018358933c31de0fccfd82d138e67262e32"
+
+url-parse@1.0.x:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/url-parse/-/url-parse-1.0.5.tgz#0854860422afdcfefeb6c965c662d4800169927b"
+  dependencies:
+    querystringify "0.0.x"
+    requires-port "1.0.x"
+
+url-parse@^1.1.8:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/url-parse/-/url-parse-1.2.0.tgz#3a19e8aaa6d023ddd27dcc44cb4fc8f7fec23986"
+  dependencies:
+    querystringify "~1.0.0"
+    requires-port "~1.0.0"
+
+url@^0.11.0:
+  version "0.11.0"
+  resolved "https://registry.yarnpkg.com/url/-/url-0.11.0.tgz#3838e97cfc60521eb73c525a8e55bfdd9e2e28f1"
+  dependencies:
+    punycode "1.3.2"
+    querystring "0.2.0"
+
+user-home@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/user-home/-/user-home-2.0.0.tgz#9c70bfd8169bc1dcbf48604e0f04b8b49cde9e9f"
+  dependencies:
+    os-homedir "^1.0.0"
+
+useragent@^2.1.6:
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/useragent/-/useragent-2.3.0.tgz#217f943ad540cb2128658ab23fc960f6a88c9972"
+  dependencies:
+    lru-cache "4.1.x"
+    tmp "0.0.x"
+
+util-deprecate@~1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/util-deprecate/-/util-deprecate-1.0.2.tgz#450d4dc9fa70de732762fbd2d4a28981419a0ccf"
+
+util@0.10.3, util@^0.10.3:
+  version "0.10.3"
+  resolved "https://registry.yarnpkg.com/util/-/util-0.10.3.tgz#7afb1afe50805246489e3db7fe0ed379336ac0f9"
+  dependencies:
+    inherits "2.0.1"
+
+utils-merge@1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/utils-merge/-/utils-merge-1.0.1.tgz#9f95710f50a267947b2ccc124741c1028427e713"
+
+uuid@^3.0.0, uuid@^3.0.1, uuid@^3.1.0:
+  version "3.2.1"
+  resolved "https://registry.yarnpkg.com/uuid/-/uuid-3.2.1.tgz#12c528bb9d58d0b9265d9a2f6f0fe8be17ff1f14"
+
+validate-npm-package-license@^3.0.1:
+  version "3.0.3"
+  resolved "https://registry.yarnpkg.com/validate-npm-package-license/-/validate-npm-package-license-3.0.3.tgz#81643bcbef1bdfecd4623793dc4648948ba98338"
+  dependencies:
+    spdx-correct "^3.0.0"
+    spdx-expression-parse "^3.0.0"
+
+vargs@~0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/vargs/-/vargs-0.1.0.tgz#6b6184da6520cc3204ce1b407cac26d92609ebff"
+
+vary@~1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/vary/-/vary-1.1.2.tgz#2299f02c6ded30d4a5961b0b9f74524a18f634fc"
+
+verror@1.10.0:
+  version "1.10.0"
+  resolved "https://registry.yarnpkg.com/verror/-/verror-1.10.0.tgz#3a105ca17053af55d6e270c1f8288682e18da400"
+  dependencies:
+    assert-plus "^1.0.0"
+    core-util-is "1.0.2"
+    extsprintf "^1.2.0"
+
+vm-browserify@0.0.4:
+  version "0.0.4"
+  resolved "https://registry.yarnpkg.com/vm-browserify/-/vm-browserify-0.0.4.tgz#5d7ea45bbef9e4a6ff65f95438e0a87c357d5a73"
+  dependencies:
+    indexof "0.0.1"
+
+void-elements@^2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/void-elements/-/void-elements-2.0.1.tgz#c066afb582bb1cb4128d60ea92392e94d5e9dbec"
+
+watchpack@^0.2.1:
+  version "0.2.9"
+  resolved "https://registry.yarnpkg.com/watchpack/-/watchpack-0.2.9.tgz#62eaa4ab5e5ba35fdfc018275626e3c0f5e3fb0b"
+  dependencies:
+    async "^0.9.0"
+    chokidar "^1.0.0"
+    graceful-fs "^4.1.2"
+
+wd@^0.3.4:
+  version "0.3.12"
+  resolved "https://registry.yarnpkg.com/wd/-/wd-0.3.12.tgz#3fb4f1d759f8c85dde5393d17334ffe03e9bb329"
+  dependencies:
+    archiver "~0.14.0"
+    async "~1.0.0"
+    lodash "~3.9.3"
+    q "~1.4.1"
+    request "~2.55.0"
+    underscore.string "~3.0.3"
+    vargs "~0.1.0"
+
+webpack-core@~0.6.9:
+  version "0.6.9"
+  resolved "https://registry.yarnpkg.com/webpack-core/-/webpack-core-0.6.9.tgz#fc571588c8558da77be9efb6debdc5a3b172bdc2"
+  dependencies:
+    source-list-map "~0.1.7"
+    source-map "~0.4.1"
+
+webpack-dev-middleware@^1.0.11, webpack-dev-middleware@^1.10.2:
+  version "1.12.2"
+  resolved "https://registry.yarnpkg.com/webpack-dev-middleware/-/webpack-dev-middleware-1.12.2.tgz#f8fc1120ce3b4fc5680ceecb43d777966b21105e"
+  dependencies:
+    memory-fs "~0.4.1"
+    mime "^1.5.0"
+    path-is-absolute "^1.0.0"
+    range-parser "^1.0.3"
+    time-stamp "^2.0.0"
+
+webpack-dev-server@^1.12.0:
+  version "1.16.5"
+  resolved "https://registry.yarnpkg.com/webpack-dev-server/-/webpack-dev-server-1.16.5.tgz#0cbd5f2d2ac8d4e593aacd5c9702e7bbd5e59892"
+  dependencies:
+    compression "^1.5.2"
+    connect-history-api-fallback "^1.3.0"
+    express "^4.13.3"
+    http-proxy-middleware "~0.17.1"
+    open "0.0.5"
+    optimist "~0.6.1"
+    serve-index "^1.7.2"
+    sockjs "^0.3.15"
+    sockjs-client "^1.0.3"
+    stream-cache "~0.0.1"
+    strip-ansi "^3.0.0"
+    supports-color "^3.1.1"
+    webpack-dev-middleware "^1.10.2"
+
+webpack@^1.12.2:
+  version "1.15.0"
+  resolved "https://registry.yarnpkg.com/webpack/-/webpack-1.15.0.tgz#4ff31f53db03339e55164a9d468ee0324968fe98"
+  dependencies:
+    acorn "^3.0.0"
+    async "^1.3.0"
+    clone "^1.0.2"
+    enhanced-resolve "~0.9.0"
+    interpret "^0.6.4"
+    loader-utils "^0.2.11"
+    memory-fs "~0.3.0"
+    mkdirp "~0.5.0"
+    node-libs-browser "^0.7.0"
+    optimist "~0.6.0"
+    supports-color "^3.1.0"
+    tapable "~0.1.8"
+    uglify-js "~2.7.3"
+    watchpack "^0.2.1"
+    webpack-core "~0.6.9"
+
+websocket-driver@>=0.5.1:
+  version "0.7.0"
+  resolved "https://registry.yarnpkg.com/websocket-driver/-/websocket-driver-0.7.0.tgz#0caf9d2d755d93aee049d4bdd0d3fe2cca2a24eb"
+  dependencies:
+    http-parser-js ">=0.4.0"
+    websocket-extensions ">=0.1.1"
+
+websocket-extensions@>=0.1.1:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/websocket-extensions/-/websocket-extensions-0.1.3.tgz#5d2ff22977003ec687a4b87073dfbbac146ccf29"
+
+which-module@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/which-module/-/which-module-2.0.0.tgz#d9ef07dce77b9902b8a3a8fa4b31c3e3f7e6e87a"
+
+which@^1.1.1, which@^1.2.10, which@^1.2.9, which@^1.3.0:
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/which/-/which-1.3.0.tgz#ff04bdfc010ee547d780bec38e1ac1c2777d253a"
+  dependencies:
+    isexe "^2.0.0"
+
+which@~1.0.5:
+  version "1.0.9"
+  resolved "https://registry.yarnpkg.com/which/-/which-1.0.9.tgz#460c1da0f810103d0321a9b633af9e575e64486f"
+
+wide-align@^1.1.0:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/wide-align/-/wide-align-1.1.2.tgz#571e0f1b0604636ebc0dfc21b0339bbe31341710"
+  dependencies:
+    string-width "^1.0.2"
+
+window-size@0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/window-size/-/window-size-0.1.0.tgz#5438cd2ea93b202efa3a19fe8887aee7c94f9c9d"
+
+winston@0.5.x:
+  version "0.5.11"
+  resolved "https://registry.yarnpkg.com/winston/-/winston-0.5.11.tgz#9d84ead981a497a92ddf76616137abef661c414f"
+  dependencies:
+    async "0.1.x"
+    colors "0.x.x"
+    eyes "0.1.x"
+    loggly "0.3.x >=0.3.7"
+    pkginfo "0.2.x"
+    stack-trace "0.0.x"
+
+wordwrap@0.0.2:
+  version "0.0.2"
+  resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-0.0.2.tgz#b79669bb42ecb409f83d583cad52ca17eaa1643f"
+
+wordwrap@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-1.0.0.tgz#27584810891456a4171c8d0226441ade90cbcaeb"
+
+wordwrap@~0.0.2:
+  version "0.0.3"
+  resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-0.0.3.tgz#a3d5da6cd5c0bc0008d37234bbaf1bed63059107"
+
+wrap-ansi@^2.0.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/wrap-ansi/-/wrap-ansi-2.1.0.tgz#d8fc3d284dd05794fe84973caecdd1cf824fdd85"
+  dependencies:
+    string-width "^1.0.1"
+    strip-ansi "^3.0.1"
+
+wrappy@1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f"
+
+write-file-atomic@^1.1.4:
+  version "1.3.4"
+  resolved "https://registry.yarnpkg.com/write-file-atomic/-/write-file-atomic-1.3.4.tgz#f807a4f0b1d9e913ae7a48112e6cc3af1991b45f"
+  dependencies:
+    graceful-fs "^4.1.11"
+    imurmurhash "^0.1.4"
+    slide "^1.1.5"
+
+write-file-atomic@^2.3.0:
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/write-file-atomic/-/write-file-atomic-2.3.0.tgz#1ff61575c2e2a4e8e510d6fa4e243cce183999ab"
+  dependencies:
+    graceful-fs "^4.1.11"
+    imurmurhash "^0.1.4"
+    signal-exit "^3.0.2"
+
+write@^0.2.1:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/write/-/write-0.2.1.tgz#5fc03828e264cea3fe91455476f7a3c566cb0757"
+  dependencies:
+    mkdirp "^0.5.1"
+
+ws@~1.1.5:
+  version "1.1.5"
+  resolved "https://registry.yarnpkg.com/ws/-/ws-1.1.5.tgz#cbd9e6e75e09fc5d2c90015f21f0c40875e0dd51"
+  dependencies:
+    options ">=0.0.5"
+    ultron "1.0.x"
+
+wtf-8@1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/wtf-8/-/wtf-8-1.0.0.tgz#392d8ba2d0f1c34d1ee2d630f15d0efb68e1048a"
+
+xml-escape@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/xml-escape/-/xml-escape-1.0.0.tgz#00963d697b2adf0c185c4e04e73174ba9b288eb2"
+
+xmlhttprequest-ssl@1.5.3:
+  version "1.5.3"
+  resolved "https://registry.yarnpkg.com/xmlhttprequest-ssl/-/xmlhttprequest-ssl-1.5.3.tgz#185a888c04eca46c3e4070d99f7b49de3528992d"
+
+xtend@^4.0.0:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/xtend/-/xtend-4.0.1.tgz#a5c6d532be656e23db820efb943a1f04998d63af"
+
+y18n@^3.2.1:
+  version "3.2.1"
+  resolved "https://registry.yarnpkg.com/y18n/-/y18n-3.2.1.tgz#6d15fba884c08679c0d77e88e7759e811e07fa41"
+
+yallist@^2.1.2:
+  version "2.1.2"
+  resolved "https://registry.yarnpkg.com/yallist/-/yallist-2.1.2.tgz#1c11f9218f076089a47dd512f93c6699a6a81d52"
+
+yallist@^3.0.0:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/yallist/-/yallist-3.0.2.tgz#8452b4bb7e83c7c188d8041c1a837c773d6d8bb9"
+
+yapool@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/yapool/-/yapool-1.0.0.tgz#f693f29a315b50d9a9da2646a7a6645c96985b6a"
+
+yargs-parser@^8.0.0, yargs-parser@^8.1.0:
+  version "8.1.0"
+  resolved "https://registry.yarnpkg.com/yargs-parser/-/yargs-parser-8.1.0.tgz#f1376a33b6629a5d063782944da732631e966950"
+  dependencies:
+    camelcase "^4.1.0"
+
+yargs@^10.0.3:
+  version "10.1.2"
+  resolved "https://registry.yarnpkg.com/yargs/-/yargs-10.1.2.tgz#454d074c2b16a51a43e2fb7807e4f9de69ccb5c5"
+  dependencies:
+    cliui "^4.0.0"
+    decamelize "^1.1.1"
+    find-up "^2.1.0"
+    get-caller-file "^1.0.1"
+    os-locale "^2.0.0"
+    require-directory "^2.1.1"
+    require-main-filename "^1.0.1"
+    set-blocking "^2.0.0"
+    string-width "^2.0.0"
+    which-module "^2.0.0"
+    y18n "^3.2.1"
+    yargs-parser "^8.1.0"
+
+yargs@~3.10.0:
+  version "3.10.0"
+  resolved "https://registry.yarnpkg.com/yargs/-/yargs-3.10.0.tgz#f7ee7bd857dd7c1d2d38c0e74efbd681d1431fd1"
+  dependencies:
+    camelcase "^1.0.2"
+    cliui "^2.1.0"
+    decamelize "^1.0.0"
+    window-size "0.1.0"
+
+yauzl@2.4.1:
+  version "2.4.1"
+  resolved "https://registry.yarnpkg.com/yauzl/-/yauzl-2.4.1.tgz#9528f442dab1b2284e58b4379bb194e22e0c4005"
+  dependencies:
+    fd-slicer "~1.0.1"
+
+yeast@0.1.2:
+  version "0.1.2"
+  resolved "https://registry.yarnpkg.com/yeast/-/yeast-0.1.2.tgz#008e06d8094320c372dbc2f8ed76a0ca6c8ac419"
+
+zip-stream@~0.5.0:
+  version "0.5.2"
+  resolved "https://registry.yarnpkg.com/zip-stream/-/zip-stream-0.5.2.tgz#32dcbc506d0dab4d21372625bd7ebaac3c2fff56"
+  dependencies:
+    compress-commons "~0.2.0"
+    lodash "~3.2.0"
+    readable-stream "~1.0.26"
diff --git a/node_modules/dom-serializer/LICENSE b/node_modules/dom-serializer/LICENSE
new file mode 100644
index 0000000..3d241a8
--- /dev/null
+++ b/node_modules/dom-serializer/LICENSE
@@ -0,0 +1,11 @@
+License
+
+(The MIT License)
+
+Copyright (c) 2014 The cheeriojs contributors
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the 'Software'), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/dom-serializer/README.md b/node_modules/dom-serializer/README.md
new file mode 100644
index 0000000..45fde0c
--- /dev/null
+++ b/node_modules/dom-serializer/README.md
@@ -0,0 +1 @@
+Renders a DOM node or an array of DOM nodes to a string.
diff --git a/node_modules/dom-serializer/foreignNames.json b/node_modules/dom-serializer/foreignNames.json
new file mode 100644
index 0000000..aada7c7
--- /dev/null
+++ b/node_modules/dom-serializer/foreignNames.json
@@ -0,0 +1,102 @@
+{
+  "elementNames" : {
+"altglyph" : "altGlyph",
+"altglyphdef" : "altGlyphDef",
+"altglyphitem" : "altGlyphItem",
+"animatecolor" : "animateColor",
+"animatemotion" : "animateMotion",
+"animatetransform" : "animateTransform",
+"clippath" : "clipPath",
+"feblend" : "feBlend",
+"fecolormatrix" : "feColorMatrix",
+"fecomponenttransfer" : "feComponentTransfer",
+"fecomposite" : "feComposite",
+"feconvolvematrix" : "feConvolveMatrix",
+"fediffuselighting" : "feDiffuseLighting",
+"fedisplacementmap" : "feDisplacementMap",
+"fedistantlight" : "feDistantLight",
+"fedropshadow" : "feDropShadow",
+"feflood" : "feFlood",
+"fefunca" : "feFuncA",
+"fefuncb" : "feFuncB",
+"fefuncg" : "feFuncG",
+"fefuncr" : "feFuncR",
+"fegaussianblur" : "feGaussianBlur",
+"feimage" : "feImage",
+"femerge" : "feMerge",
+"femergenode" : "feMergeNode",
+"femorphology" : "feMorphology",
+"feoffset" : "feOffset",
+"fepointlight" : "fePointLight",
+"fespecularlighting" : "feSpecularLighting",
+"fespotlight" : "feSpotLight",
+"fetile" : "feTile",
+"feturbulence" : "feTurbulence",
+"foreignobject" : "foreignObject",
+"glyphref" : "glyphRef",
+"lineargradient" : "linearGradient",
+"radialgradient" : "radialGradient",
+"textpath" : "textPath"
+  },
+  "attributeNames" : {
+"definitionurl" : "definitionURL",
+"attributename" : "attributeName",
+"attributetype" : "attributeType",
+"basefrequency" : "baseFrequency",
+"baseprofile" : "baseProfile",
+"calcmode" : "calcMode",
+"clippathunits" : "clipPathUnits",
+"diffuseconstant" : "diffuseConstant",
+"edgemode" : "edgeMode",
+"filterunits" : "filterUnits",
+"glyphref" : "glyphRef",
+"gradienttransform" : "gradientTransform",
+"gradientunits" : "gradientUnits",
+"kernelmatrix" : "kernelMatrix",
+"kernelunitlength" : "kernelUnitLength",
+"keypoints" : "keyPoints",
+"keysplines" : "keySplines",
+"keytimes" : "keyTimes",
+"lengthadjust" : "lengthAdjust",
+"limitingconeangle" : "limitingConeAngle",
+"markerheight" : "markerHeight",
+"markerunits" : "markerUnits",
+"markerwidth" : "markerWidth",
+"maskcontentunits" : "maskContentUnits",
+"maskunits" : "maskUnits",
+"numoctaves" : "numOctaves",
+"pathlength" : "pathLength",
+"patterncontentunits" : "patternContentUnits",
+"patterntransform" : "patternTransform",
+"patternunits" : "patternUnits",
+"pointsatx" : "pointsAtX",
+"pointsaty" : "pointsAtY",
+"pointsatz" : "pointsAtZ",
+"preservealpha" : "preserveAlpha",
+"preserveaspectratio" : "preserveAspectRatio",
+"primitiveunits" : "primitiveUnits",
+"refx" : "refX",
+"refy" : "refY",
+"repeatcount" : "repeatCount",
+"repeatdur" : "repeatDur",
+"requiredextensions" : "requiredExtensions",
+"requiredfeatures" : "requiredFeatures",
+"specularconstant" : "specularConstant",
+"specularexponent" : "specularExponent",
+"spreadmethod" : "spreadMethod",
+"startoffset" : "startOffset",
+"stddeviation" : "stdDeviation",
+"stitchtiles" : "stitchTiles",
+"surfacescale" : "surfaceScale",
+"systemlanguage" : "systemLanguage",
+"tablevalues" : "tableValues",
+"targetx" : "targetX",
+"targety" : "targetY",
+"textlength" : "textLength",
+"viewbox" : "viewBox",
+"viewtarget" : "viewTarget",
+"xchannelselector" : "xChannelSelector",
+"ychannelselector" : "yChannelSelector",
+"zoomandpan" : "zoomAndPan"
+  }
+}
diff --git a/node_modules/dom-serializer/index.d.ts b/node_modules/dom-serializer/index.d.ts
new file mode 100644
index 0000000..4499daf
--- /dev/null
+++ b/node_modules/dom-serializer/index.d.ts
@@ -0,0 +1,17 @@
+export interface DomSerializerOptions {
+  xmlMode?: boolean | 'foreign';
+  decodeEntities?: boolean;
+}
+
+/**
+ * Renders a DOM node or an array of DOM nodes to a string.
+ *
+ * Can be thought of as the equivalent of the `outerHTML` of the passed node(s).
+ *
+ * @param nodes Nodes to be rendered.
+ * @param options Changes serialization behavior
+ */
+export default function render(
+  nodes: {} | {}[],
+  options?: DomSerializerOptions
+): string;
diff --git a/node_modules/dom-serializer/index.js b/node_modules/dom-serializer/index.js
new file mode 100644
index 0000000..53e999c
--- /dev/null
+++ b/node_modules/dom-serializer/index.js
@@ -0,0 +1,183 @@
+/*
+  Module dependencies
+*/
+var ElementType = require('domelementtype');
+var entities = require('entities');
+
+/* mixed-case SVG and MathML tags & attributes
+   recognized by the HTML parser, see
+   https://html.spec.whatwg.org/multipage/parsing.html#parsing-main-inforeign
+*/
+var foreignNames = require('./foreignNames.json');
+foreignNames.elementNames.__proto__ = null; /* use as a simple dictionary */
+foreignNames.attributeNames.__proto__ = null;
+
+var unencodedElements = {
+  __proto__: null,
+  style: true,
+  script: true,
+  xmp: true,
+  iframe: true,
+  noembed: true,
+  noframes: true,
+  plaintext: true,
+  noscript: true
+};
+
+/*
+  Format attributes
+*/
+function formatAttrs(attributes, opts) {
+  if (!attributes) return;
+
+  var output = '';
+  var value;
+
+  // Loop through the attributes
+  for (var key in attributes) {
+    value = attributes[key];
+    if (output) {
+      output += ' ';
+    }
+
+    if (opts.xmlMode === 'foreign') {
+      /* fix up mixed-case attribute names */
+      key = foreignNames.attributeNames[key] || key;
+    }
+    output += key;
+    if ((value !== null && value !== '') || opts.xmlMode) {
+      output +=
+        '="' +
+        (opts.decodeEntities
+          ? entities.encodeXML(value)
+          : value.replace(/\"/g, '"')) +
+        '"';
+    }
+  }
+
+  return output;
+}
+
+/*
+  Self-enclosing tags (stolen from node-htmlparser)
+*/
+var singleTag = {
+  __proto__: null,
+  area: true,
+  base: true,
+  basefont: true,
+  br: true,
+  col: true,
+  command: true,
+  embed: true,
+  frame: true,
+  hr: true,
+  img: true,
+  input: true,
+  isindex: true,
+  keygen: true,
+  link: true,
+  meta: true,
+  param: true,
+  source: true,
+  track: true,
+  wbr: true
+};
+
+var render = (module.exports = function(dom, opts) {
+  if (!Array.isArray(dom) && !dom.cheerio) dom = [dom];
+  opts = opts || {};
+
+  var output = '';
+
+  for (var i = 0; i < dom.length; i++) {
+    var elem = dom[i];
+
+    if (elem.type === 'root') output += render(elem.children, opts);
+    else if (ElementType.isTag(elem)) output += renderTag(elem, opts);
+    else if (elem.type === ElementType.Directive)
+      output += renderDirective(elem);
+    else if (elem.type === ElementType.Comment) output += renderComment(elem);
+    else if (elem.type === ElementType.CDATA) output += renderCdata(elem);
+    else output += renderText(elem, opts);
+  }
+
+  return output;
+});
+
+const foreignModeIntegrationPoints = [
+  'mi',
+  'mo',
+  'mn',
+  'ms',
+  'mtext',
+  'annotation-xml',
+  'foreignObject',
+  'desc',
+  'title'
+];
+
+function renderTag(elem, opts) {
+  // Handle SVG / MathML in HTML
+  if (opts.xmlMode === 'foreign') {
+    /* fix up mixed-case element names */
+    elem.name = foreignNames.elementNames[elem.name] || elem.name;
+    /* exit foreign mode at integration points */
+    if (
+      elem.parent &&
+      foreignModeIntegrationPoints.indexOf(elem.parent.name) >= 0
+    )
+      opts = Object.assign({}, opts, { xmlMode: false });
+  }
+  if (!opts.xmlMode && ['svg', 'math'].indexOf(elem.name) >= 0) {
+    opts = Object.assign({}, opts, { xmlMode: 'foreign' });
+  }
+
+  var tag = '<' + elem.name;
+  var attribs = formatAttrs(elem.attribs, opts);
+
+  if (attribs) {
+    tag += ' ' + attribs;
+  }
+
+  if (opts.xmlMode && (!elem.children || elem.children.length === 0)) {
+    tag += '/>';
+  } else {
+    tag += '>';
+    if (elem.children) {
+      tag += render(elem.children, opts);
+    }
+
+    if (!singleTag[elem.name] || opts.xmlMode) {
+      tag += '';
+    }
+  }
+
+  return tag;
+}
+
+function renderDirective(elem) {
+  return '<' + elem.data + '>';
+}
+
+function renderText(elem, opts) {
+  var data = elem.data || '';
+
+  // if entities weren't decoded, no need to encode them back
+  if (
+    opts.decodeEntities &&
+    !(elem.parent && elem.parent.name in unencodedElements)
+  ) {
+    data = entities.encodeXML(data);
+  }
+
+  return data;
+}
+
+function renderCdata(elem) {
+  return '';
+}
+
+function renderComment(elem) {
+  return '';
+}
diff --git a/node_modules/dom-serializer/node_modules/domelementtype/LICENSE b/node_modules/dom-serializer/node_modules/domelementtype/LICENSE
new file mode 100644
index 0000000..c464f86
--- /dev/null
+++ b/node_modules/dom-serializer/node_modules/domelementtype/LICENSE
@@ -0,0 +1,11 @@
+Copyright (c) Felix Böhm
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met:
+
+Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer.
+
+Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution.
+
+THIS IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS,
+EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
diff --git a/node_modules/dom-serializer/node_modules/domelementtype/README.md b/node_modules/dom-serializer/node_modules/domelementtype/README.md
new file mode 100644
index 0000000..4eadc07
--- /dev/null
+++ b/node_modules/dom-serializer/node_modules/domelementtype/README.md
@@ -0,0 +1 @@
+All the types of nodes in htmlparser2's DOM.
diff --git a/node_modules/dom-serializer/node_modules/domelementtype/lib/index.d.ts b/node_modules/dom-serializer/node_modules/domelementtype/lib/index.d.ts
new file mode 100644
index 0000000..a61d346
--- /dev/null
+++ b/node_modules/dom-serializer/node_modules/domelementtype/lib/index.d.ts
@@ -0,0 +1,28 @@
+/** Types of elements found in the DOM */
+export declare const enum ElementType {
+    Text = "text",
+    Directive = "directive",
+    Comment = "comment",
+    Script = "script",
+    Style = "style",
+    Tag = "tag",
+    CDATA = "cdata",
+    Doctype = "doctype"
+}
+/**
+ * Tests whether an element is a tag or not.
+ *
+ * @param elem Element to test
+ */
+export declare function isTag(elem: {
+    type: ElementType;
+}): boolean;
+export declare const Text = ElementType.Text;
+export declare const Directive = ElementType.Directive;
+export declare const Comment = ElementType.Comment;
+export declare const Script = ElementType.Script;
+export declare const Style = ElementType.Style;
+export declare const Tag = ElementType.Tag;
+export declare const CDATA = ElementType.CDATA;
+export declare const Doctype = ElementType.Doctype;
+//# sourceMappingURL=index.d.ts.map
\ No newline at end of file
diff --git a/node_modules/dom-serializer/node_modules/domelementtype/lib/index.d.ts.map b/node_modules/dom-serializer/node_modules/domelementtype/lib/index.d.ts.map
new file mode 100644
index 0000000..d9398e3
--- /dev/null
+++ b/node_modules/dom-serializer/node_modules/domelementtype/lib/index.d.ts.map
@@ -0,0 +1 @@
+{"version":3,"file":"index.d.ts","sourceRoot":"","sources":["../src/index.ts"],"names":[],"mappings":"AAAA,yCAAyC;AACzC,0BAAkB,WAAW;IACzB,IAAI,SAAS;IACb,SAAS,cAAc;IACvB,OAAO,YAAY;IACnB,MAAM,WAAW;IACjB,KAAK,UAAU;IACf,GAAG,QAAQ;IACX,KAAK,UAAU;IACf,OAAO,YAAY;CACtB;AAED;;;;GAIG;AACH,wBAAgB,KAAK,CAAC,IAAI,EAAE;IAAE,IAAI,EAAE,WAAW,CAAA;CAAE,GAAG,OAAO,CAM1D;AAGD,eAAO,MAAM,IAAI,mBAAmB,CAAC;AACrC,eAAO,MAAM,SAAS,wBAAwB,CAAC;AAC/C,eAAO,MAAM,OAAO,sBAAsB,CAAC;AAC3C,eAAO,MAAM,MAAM,qBAAqB,CAAC;AACzC,eAAO,MAAM,KAAK,oBAAoB,CAAC;AACvC,eAAO,MAAM,GAAG,kBAAkB,CAAC;AACnC,eAAO,MAAM,KAAK,oBAAoB,CAAC;AACvC,eAAO,MAAM,OAAO,sBAAsB,CAAC"}
\ No newline at end of file
diff --git a/node_modules/dom-serializer/node_modules/domelementtype/lib/index.js b/node_modules/dom-serializer/node_modules/domelementtype/lib/index.js
new file mode 100644
index 0000000..1908ef7
--- /dev/null
+++ b/node_modules/dom-serializer/node_modules/domelementtype/lib/index.js
@@ -0,0 +1,22 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+/**
+ * Tests whether an element is a tag or not.
+ *
+ * @param elem Element to test
+ */
+function isTag(elem) {
+    return (elem.type === "tag" /* Tag */ ||
+        elem.type === "script" /* Script */ ||
+        elem.type === "style" /* Style */);
+}
+exports.isTag = isTag;
+// Exports for backwards compatibility
+exports.Text = "text" /* Text */; //Text
+exports.Directive = "directive" /* Directive */; //
+exports.Comment = "comment" /* Comment */; //
+exports.Script = "script" /* Script */; //",
+  "expected": [
+    {
+      "type": "script",
+      "name": "script",
+      "attribs": {},
+      "children": [
+        {
+          "data": "",
+          "type": "text"
+        }
+      ]
+    }
+  ]
+}
\ No newline at end of file
diff --git a/node_modules/domhandler/test/cases/07-unescaped_in_style.json b/node_modules/domhandler/test/cases/07-unescaped_in_style.json
new file mode 100644
index 0000000..77438fd
--- /dev/null
+++ b/node_modules/domhandler/test/cases/07-unescaped_in_style.json
@@ -0,0 +1,20 @@
+{
+  "name": "Unescaped chars in style",
+  "options": {},
+  "html": "",
+  "expected": [
+    {
+      "type": "style",
+      "name": "style",
+      "attribs": {
+        "type": "text/css"
+      },
+      "children": [
+        {
+          "data": "\n body > p\n\t{ font-weight: bold; }",
+          "type": "text"
+        }
+      ]
+    }
+  ]
+}
\ No newline at end of file
diff --git a/node_modules/domhandler/test/cases/08-extra_spaces_in_tag.json b/node_modules/domhandler/test/cases/08-extra_spaces_in_tag.json
new file mode 100644
index 0000000..5c2492e
--- /dev/null
+++ b/node_modules/domhandler/test/cases/08-extra_spaces_in_tag.json
@@ -0,0 +1,20 @@
+{
+  "name": "Extra spaces in tag",
+  "options": {},
+  "html": "the text",
+  "expected": [
+    {
+      "type": "tag",
+      "name": "font",
+      "attribs": {
+        "size": "14"
+      },
+      "children": [
+        {
+          "data": "the text",
+          "type": "text"
+        }
+      ]
+    }
+  ]
+}
\ No newline at end of file
diff --git a/node_modules/domhandler/test/cases/09-unquoted_attrib.json b/node_modules/domhandler/test/cases/09-unquoted_attrib.json
new file mode 100644
index 0000000..543ccee
--- /dev/null
+++ b/node_modules/domhandler/test/cases/09-unquoted_attrib.json
@@ -0,0 +1,20 @@
+{
+  "name": "Unquoted attributes",
+  "options": {},
+  "html": "the text",
+  "expected": [
+    {
+      "type": "tag",
+      "name": "font",
+      "attribs": {
+        "size": "14"
+      },
+      "children": [
+        {
+          "data": "the text",
+          "type": "text"
+        }
+      ]
+    }
+  ]
+}
\ No newline at end of file
diff --git a/node_modules/domhandler/test/cases/10-singular_attribute.json b/node_modules/domhandler/test/cases/10-singular_attribute.json
new file mode 100644
index 0000000..544636e
--- /dev/null
+++ b/node_modules/domhandler/test/cases/10-singular_attribute.json
@@ -0,0 +1,15 @@
+{
+  "name": "Singular attribute",
+  "options": {},
+  "html": "