diff --git a/.devcontainer/devcontainer.json b/.devcontainer/devcontainer.json
new file mode 100644
index 0000000..3c71b3b
--- /dev/null
+++ b/.devcontainer/devcontainer.json
@@ -0,0 +1,13 @@
+{
+    "image": "ghcr.io/near/near-devcontainer:latest",
+    "customizations": {
+        "vscode": {
+            "extensions": [
+                "dtsvet.vscode-wasm",
+                "rust-lang.rust-analyzer",
+                "github.vscode-github-actions"
+            ]
+        }
+    },
+    "postCreateCommand": "./.devcontainer/post-create.sh"
+}
diff --git a/.devcontainer/post-create.sh b/.devcontainer/post-create.sh
new file mode 100755
index 0000000..e9d1ebb
--- /dev/null
+++ b/.devcontainer/post-create.sh
@@ -0,0 +1,6 @@
+#!/bin/bash
+
+(cd discussions && cargo near build)
+(cd community && cargo near build)
+(cd community-factory && cargo near build)
+cargo near build
diff --git a/.gitattributes b/.gitattributes
new file mode 100644
index 0000000..d0f1e0d
--- /dev/null
+++ b/.gitattributes
@@ -0,0 +1 @@
+res/near_ideas.wasm binary
\ No newline at end of file
diff --git a/.github/workflows/main.yml b/.github/workflows/main.yml
new file mode 100644
index 0000000..2706a0f
--- /dev/null
+++ b/.github/workflows/main.yml
@@ -0,0 +1,26 @@
+name: CI
+on:
+  push:
+    branches: [ main ]
+  pull_request:
+    branches: [ main ]
+jobs:
+  rununittest:
+    name: Unit tests
+    runs-on: ubuntu-latest
+    steps:
+      - name: Checkout repository
+        uses: actions/checkout@v4
+      - uses: Swatinem/rust-cache@v1
+      - name: Install cargo-near
+        run: curl --proto '=https' --tlsv1.2 -LsSf https://github.com/near/cargo-near/releases/latest/download/cargo-near-installer.sh | sh
+      - name: Build discussions contract
+        run: cd discussions && cargo near build
+      - name: Build community contract
+        run: cd community && cargo near build
+      - name: Build community factory contract
+        run: cd community-factory && cargo near build
+      - name: Build devhub contract
+        run: cargo near build
+      - name: Unit tests
+        run: cargo test
diff --git a/.gitignore b/.gitignore
new file mode 100644
index 0000000..3db7b0d
--- /dev/null
+++ b/.gitignore
@@ -0,0 +1,5 @@
+.idea
+neardev/
+target/
+res/*.wasm
+.DS_Store
\ No newline at end of file
diff --git a/Cargo.lock b/Cargo.lock
new file mode 100644
index 0000000..9082446
--- /dev/null
+++ b/Cargo.lock
@@ -0,0 +1,4709 @@
+# This file is automatically @generated by Cargo.
+# It is not intended for manual editing.
+version = 3
+
+[[package]]
+name = "Inflector"
+version = "0.11.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "fe438c63458706e03479442743baae6c88256498e6431708f6dfc520a26515d3"
+
+[[package]]
+name = "actix"
+version = "0.13.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "cba56612922b907719d4a01cf11c8d5b458e7d3dba946d0435f20f58d6795ed2"
+dependencies = [
+ "actix-macros",
+ "actix-rt",
+ "actix_derive",
+ "bitflags 2.4.1",
+ "bytes",
+ "crossbeam-channel",
+ "futures-core",
+ "futures-sink",
+ "futures-task",
+ "futures-util",
+ "log",
+ "once_cell",
+ "parking_lot",
+ "pin-project-lite",
+ "smallvec",
+ "tokio",
+ "tokio-util 0.7.8",
+]
+
+[[package]]
+name = "actix-macros"
+version = "0.2.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e01ed3140b2f8d422c68afa1ed2e85d996ea619c988ac834d255db32138655cb"
+dependencies = [
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "actix-rt"
+version = "2.9.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "28f32d40287d3f402ae0028a9d54bef51af15c8769492826a69d28f81893151d"
+dependencies = [
+ "futures-core",
+ "tokio",
+]
+
+[[package]]
+name = "actix_derive"
+version = "0.6.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7c7db3d5a9718568e4cf4a537cfd7070e6e6ff7481510d0237fb529ac850f6d3"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "adler"
+version = "1.0.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f26201604c87b1e01bd3d98f8d5d9a8fcbb815e8cedb41ffccbeb4bf593a35fe"
+
+[[package]]
+name = "aes"
+version = "0.8.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ac1f845298e95f983ff1944b728ae08b8cebab80d684f0a832ed0fc74dfa27e2"
+dependencies = [
+ "cfg-if 1.0.0",
+ "cipher 0.4.4",
+ "cpufeatures",
+]
+
+[[package]]
+name = "ahash"
+version = "0.7.6"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "fcb51a0695d8f838b1ee009b3fbf66bda078cd64590202a864a8f3e8c4315c47"
+dependencies = [
+ "getrandom 0.2.10",
+ "once_cell",
+ "version_check",
+]
+
+[[package]]
+name = "aho-corasick"
+version = "1.0.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "43f6cb1bf222025340178f382c426f13757b2960e89779dfcb319c32542a5a41"
+dependencies = [
+ "memchr",
+]
+
+[[package]]
+name = "android-tzdata"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e999941b234f3131b00bc13c22d06e8c5ff726d1b6318ac7eb276997bbb4fef0"
+
+[[package]]
+name = "android_system_properties"
+version = "0.1.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "819e7219dbd41043ac279b19830f2efc897156490d7fd6ea916720117ee66311"
+dependencies = [
+ "libc",
+]
+
+[[package]]
+name = "anstream"
+version = "0.2.6"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "342258dd14006105c2b75ab1bd7543a03bdf0cfc94383303ac212a04939dff6f"
+dependencies = [
+ "anstyle",
+ "anstyle-parse",
+ "anstyle-wincon",
+ "concolor-override",
+ "concolor-query",
+ "is-terminal",
+ "utf8parse",
+]
+
+[[package]]
+name = "anstyle"
+version = "0.3.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "23ea9e81bd02e310c216d080f6223c179012256e5151c41db88d12c88a1684d2"
+
+[[package]]
+name = "anstyle-parse"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a7d1bb534e9efed14f3e5f44e7dd1a4f709384023a4165199a4241e18dff0116"
+dependencies = [
+ "utf8parse",
+]
+
+[[package]]
+name = "anstyle-wincon"
+version = "0.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c3127af6145b149f3287bb9a0d10ad9c5692dba8c53ad48285e5bec4063834fa"
+dependencies = [
+ "anstyle",
+ "windows-sys 0.45.0",
+]
+
+[[package]]
+name = "anyhow"
+version = "1.0.72"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3b13c32d80ecc7ab747b80c3784bce54ee8a7a0cc4fbda9bf4cda2cf6fe90854"
+
+[[package]]
+name = "arbitrary"
+version = "1.3.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7d5a26814d8dcb93b0e5a0ff3c6d80a8843bafb21b39e8e18a6f05471870e110"
+dependencies = [
+ "derive_arbitrary",
+]
+
+[[package]]
+name = "arrayvec"
+version = "0.7.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "96d30a06541fbafbc7f82ed10c06164cfbd2c401138f6addd8404629c4b16711"
+
+[[package]]
+name = "assert_matches"
+version = "1.5.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "9b34d609dfbaf33d6889b2b7106d3ca345eacad44200913df5ba02bfd31d2ba9"
+
+[[package]]
+name = "async-stream"
+version = "0.3.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "cd56dd203fef61ac097dd65721a419ddccb106b2d2b70ba60a6b529f03961a51"
+dependencies = [
+ "async-stream-impl",
+ "futures-core",
+ "pin-project-lite",
+]
+
+[[package]]
+name = "async-stream-impl"
+version = "0.3.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "16e62a023e7c117e27523144c5d2459f4397fcc3cab0085af8e2224f643a0193"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "async-trait"
+version = "0.1.72"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "cc6dde6e4ed435a4c1ee4e73592f5ba9da2151af10076cc04858746af9352d09"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "atty"
+version = "0.2.14"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d9b39be18770d11421cdb1b9947a45dd3f37e93092cbf377614828a319d5fee8"
+dependencies = [
+ "hermit-abi 0.1.19",
+ "libc",
+ "winapi",
+]
+
+[[package]]
+name = "autocfg"
+version = "1.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d468802bab17cbc0cc575e9b053f41e72aa36bfa6b7f55e3529ffa43161b97fa"
+
+[[package]]
+name = "base64"
+version = "0.13.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "9e1b586273c5702936fe7b7d6896644d8be71e6314cfe09d3167c95f712589e8"
+
+[[package]]
+name = "base64"
+version = "0.21.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "604178f6c5c21f02dc555784810edfb88d34ac2c73b2eae109655649ee73ce3d"
+
+[[package]]
+name = "base64ct"
+version = "1.6.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8c3c1a368f70d6cf7302d78f8f7093da241fb8e8807c05cc9e51a125895a6d5b"
+
+[[package]]
+name = "binary-install"
+version = "0.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "93bff426ff93f3610dd2b946f3eb8cb2d1285ca8682834d43be531a3f93db2ff"
+dependencies = [
+ "anyhow",
+ "dirs-next",
+ "flate2",
+ "fs2",
+ "hex",
+ "is_executable",
+ "siphasher",
+ "tar",
+ "ureq",
+ "zip 0.6.6",
+]
+
+[[package]]
+name = "bitflags"
+version = "1.3.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "bef38d45163c2f1dde094a7dfd33ccf595c92905c8f8f4fdc18d06fb1037718a"
+
+[[package]]
+name = "bitflags"
+version = "2.4.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "327762f6e5a765692301e5bb513e0d9fef63be86bbc14528052b1cd3e6f03e07"
+
+[[package]]
+name = "bitvec"
+version = "1.0.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1bc2832c24239b0141d5674bb9174f9d68a8b5b3f2753311927c172ca46f7e9c"
+dependencies = [
+ "funty",
+ "radium",
+ "tap",
+ "wyz",
+]
+
+[[package]]
+name = "blake2"
+version = "0.9.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "0a4e37d16930f5459780f5621038b6382b9bb37c19016f39fb6b5808d831f174"
+dependencies = [
+ "crypto-mac",
+ "digest 0.9.0",
+ "opaque-debug",
+]
+
+[[package]]
+name = "block-buffer"
+version = "0.10.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3078c7629b62d3f0439517fa394996acacc5cbc91c5a20d8c658e77abd503a71"
+dependencies = [
+ "generic-array",
+]
+
+[[package]]
+name = "borsh"
+version = "0.9.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "15bf3650200d8bffa99015595e10f1fbd17de07abbc25bb067da79e769939bfa"
+dependencies = [
+ "borsh-derive 0.9.3",
+ "hashbrown 0.11.2",
+]
+
+[[package]]
+name = "borsh"
+version = "1.3.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f58b559fd6448c6e2fd0adb5720cd98a2506594cafa4737ff98c396f3e82f667"
+dependencies = [
+ "borsh-derive 1.3.1",
+ "cfg_aliases",
+]
+
+[[package]]
+name = "borsh-derive"
+version = "0.9.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6441c552f230375d18e3cc377677914d2ca2b0d36e52129fe15450a2dce46775"
+dependencies = [
+ "borsh-derive-internal",
+ "borsh-schema-derive-internal",
+ "proc-macro-crate 0.1.5",
+ "proc-macro2",
+ "syn 1.0.109",
+]
+
+[[package]]
+name = "borsh-derive"
+version = "1.3.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7aadb5b6ccbd078890f6d7003694e33816e6b784358f18e15e7e6d9f065a57cd"
+dependencies = [
+ "once_cell",
+ "proc-macro-crate 3.1.0",
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+ "syn_derive",
+]
+
+[[package]]
+name = "borsh-derive-internal"
+version = "0.9.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5449c28a7b352f2d1e592a8a28bf139bc71afb0764a14f3c02500935d8c44065"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 1.0.109",
+]
+
+[[package]]
+name = "borsh-schema-derive-internal"
+version = "0.9.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "cdbd5696d8bfa21d53d9fe39a714a18538bad11492a42d066dbbc395fb1951c0"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 1.0.109",
+]
+
+[[package]]
+name = "brownstone"
+version = "1.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "030ea61398f34f1395ccbeb046fb68c87b631d1f34567fed0f0f11fa35d18d8d"
+dependencies = [
+ "arrayvec",
+]
+
+[[package]]
+name = "bs58"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "771fe0050b883fcc3ea2359b1a96bcfbc090b7116eae7c3c512c7a083fdf23d3"
+
+[[package]]
+name = "bs58"
+version = "0.5.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f5353f36341f7451062466f0b755b96ac3a9547e4d7f6b70d603fc721a7d7896"
+dependencies = [
+ "tinyvec",
+]
+
+[[package]]
+name = "bumpalo"
+version = "3.13.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a3e2c3daef883ecc1b5d58c15adae93470a91d425f3532ba1695849656af3fc1"
+
+[[package]]
+name = "byteorder"
+version = "1.4.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "14c189c53d098945499cdfa7ecc63567cf3886b3332b312a5b4585d8d3a6a610"
+
+[[package]]
+name = "bytes"
+version = "1.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "89b2fd2a0dcf38d7971e2194b6b6eebab45ae01067456a7fd93d5547a61b70be"
+
+[[package]]
+name = "bytesize"
+version = "1.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "38fcc2979eff34a4b84e1cf9a1e3da42a7d44b3b690a40cdcb23e3d556cfb2e5"
+dependencies = [
+ "serde",
+]
+
+[[package]]
+name = "bzip2"
+version = "0.4.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "bdb116a6ef3f6c3698828873ad02c3014b3c85cadb88496095628e3ef1e347f8"
+dependencies = [
+ "bzip2-sys",
+ "libc",
+]
+
+[[package]]
+name = "bzip2-sys"
+version = "0.1.11+1.0.8"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "736a955f3fa7875102d57c82b8cac37ec45224a07fd32d58f9f7a186b6cd4cdc"
+dependencies = [
+ "cc",
+ "libc",
+ "pkg-config",
+]
+
+[[package]]
+name = "c2-chacha"
+version = "0.3.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d27dae93fe7b1e0424dc57179ac396908c26b035a87234809f5c4dfd1b47dc80"
+dependencies = [
+ "cipher 0.2.5",
+ "ppv-lite86",
+]
+
+[[package]]
+name = "camino"
+version = "1.1.6"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c59e92b5a388f549b863a7bea62612c09f24c8393560709a54558a9abdfb3b9c"
+dependencies = [
+ "serde",
+]
+
+[[package]]
+name = "cargo-near"
+version = "0.3.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7f73eb01da3b6737778d2006645533e75563d1080c64bf714bfb88d3fb0ac09b"
+dependencies = [
+ "anyhow",
+ "atty",
+ "bs58 0.4.0",
+ "camino",
+ "cargo_metadata 0.14.2",
+ "clap 3.2.25",
+ "colored",
+ "env_logger",
+ "libloading",
+ "log",
+ "near-abi",
+ "rustc_version",
+ "schemars",
+ "serde_json",
+ "sha2",
+ "symbolic-debuginfo",
+ "zstd",
+]
+
+[[package]]
+name = "cargo-platform"
+version = "0.1.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "2cfa25e60aea747ec7e1124f238816749faa93759c6ff5b31f1ccdda137f4479"
+dependencies = [
+ "serde",
+]
+
+[[package]]
+name = "cargo_metadata"
+version = "0.14.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "4acbb09d9ee8e23699b9634375c72795d095bf268439da88562cf9b501f181fa"
+dependencies = [
+ "camino",
+ "cargo-platform",
+ "semver",
+ "serde",
+ "serde_json",
+]
+
+[[package]]
+name = "cargo_metadata"
+version = "0.18.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "2d886547e41f740c616ae73108f6eb70afe6d940c7bc697cb30f13daec073037"
+dependencies = [
+ "camino",
+ "cargo-platform",
+ "semver",
+ "serde",
+ "serde_json",
+ "thiserror",
+]
+
+[[package]]
+name = "cc"
+version = "1.0.83"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f1174fb0b6ec23863f8b971027804a42614e347eafb0a95bf0b12cdae21fc4d0"
+dependencies = [
+ "jobserver",
+ "libc",
+]
+
+[[package]]
+name = "cfg-if"
+version = "0.1.10"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "4785bdd1c96b2a846b2bd7cc02e86b6b3dbf14e7e53446c4f54c92a361040822"
+
+[[package]]
+name = "cfg-if"
+version = "1.0.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "baf1de4339761588bc0619e3cbc0120ee582ebb74b53b4efbf79117bd2da40fd"
+
+[[package]]
+name = "cfg_aliases"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "fd16c4719339c4530435d38e511904438d07cce7950afa3718a84ac36c10e89e"
+
+[[package]]
+name = "chrono"
+version = "0.4.31"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7f2c685bad3eb3d45a01354cedb7d5faa66194d1d58ba6e267a8de788f79db38"
+dependencies = [
+ "android-tzdata",
+ "iana-time-zone",
+ "js-sys",
+ "num-traits",
+ "serde",
+ "wasm-bindgen",
+ "windows-targets 0.48.1",
+]
+
+[[package]]
+name = "cipher"
+version = "0.2.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "12f8e7987cbd042a63249497f41aed09f8e65add917ea6566effbc56578d6801"
+dependencies = [
+ "generic-array",
+]
+
+[[package]]
+name = "cipher"
+version = "0.4.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "773f3b9af64447d2ce9850330c473515014aa235e6a783b02db81ff39e4a3dad"
+dependencies = [
+ "crypto-common",
+ "inout",
+]
+
+[[package]]
+name = "clap"
+version = "3.2.25"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "4ea181bf566f71cb9a5d17a59e1871af638180a18fb0035c92ae62b705207123"
+dependencies = [
+ "atty",
+ "bitflags 1.3.2",
+ "clap_derive 3.2.25",
+ "clap_lex 0.2.4",
+ "indexmap 1.9.3",
+ "once_cell",
+ "strsim",
+ "termcolor",
+ "textwrap",
+]
+
+[[package]]
+name = "clap"
+version = "4.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6efb5f0a41b5ef5b50c5da28c07609c20091df0c1fc33d418fa2a7e693c2b624"
+dependencies = [
+ "clap_builder",
+ "clap_derive 4.2.0",
+ "once_cell",
+]
+
+[[package]]
+name = "clap_builder"
+version = "4.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "671fcaa5debda4b9a84aa7fde49c907c8986c0e6ab927e04217c9cb74e7c8bc9"
+dependencies = [
+ "anstream",
+ "anstyle",
+ "bitflags 1.3.2",
+ "clap_lex 0.4.1",
+ "strsim",
+]
+
+[[package]]
+name = "clap_derive"
+version = "3.2.25"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ae6371b8bdc8b7d3959e9cf7b22d4435ef3e79e138688421ec654acf8c81b008"
+dependencies = [
+ "heck 0.4.1",
+ "proc-macro-error",
+ "proc-macro2",
+ "quote",
+ "syn 1.0.109",
+]
+
+[[package]]
+name = "clap_derive"
+version = "4.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3f9644cd56d6b87dbe899ef8b053e331c0637664e9e21a33dfcdc36093f5c5c4"
+dependencies = [
+ "heck 0.4.1",
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "clap_lex"
+version = "0.2.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "2850f2f5a82cbf437dd5af4d49848fbdfc27c157c3d010345776f952765261c5"
+dependencies = [
+ "os_str_bytes",
+]
+
+[[package]]
+name = "clap_lex"
+version = "0.4.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8a2dd5a6fe8c6e3502f568a6353e5273bbb15193ad9a89e457b9970798efbea1"
+
+[[package]]
+name = "colorchoice"
+version = "1.0.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "acbf1af155f9b9ef647e42cdc158db4b64a1b61f743629225fde6f3e0be2a7c7"
+
+[[package]]
+name = "colored"
+version = "2.0.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "2674ec482fbc38012cf31e6c42ba0177b431a0cb6f15fe40efa5aab1bda516f6"
+dependencies = [
+ "is-terminal",
+ "lazy_static",
+ "windows-sys 0.48.0",
+]
+
+[[package]]
+name = "concolor-override"
+version = "1.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "40a4925288e39d5923e024781971aab940995fa31bab3ffceebbadfc87591e90"
+dependencies = [
+ "colorchoice",
+]
+
+[[package]]
+name = "concolor-query"
+version = "0.3.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "88d11d52c3d7ca2e6d0040212be9e4dbbcd78b6447f535b6b561f449427944cf"
+dependencies = [
+ "windows-sys 0.45.0",
+]
+
+[[package]]
+name = "console"
+version = "0.15.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c926e00cc70edefdc64d3a5ff31cc65bb97a3460097762bd23afb4d8145fccf8"
+dependencies = [
+ "encode_unicode",
+ "lazy_static",
+ "libc",
+ "windows-sys 0.45.0",
+]
+
+[[package]]
+name = "constant_time_eq"
+version = "0.1.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "245097e9a4535ee1e3e3931fcfcd55a796a44c643e8596ff6566d68f09b87bbc"
+
+[[package]]
+name = "convert_case"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6245d59a3e82a7fc217c5828a6692dbc6dfb63a0c8c90495621f7b9d79704a0e"
+
+[[package]]
+name = "core-foundation"
+version = "0.9.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "194a7a9e6de53fa55116934067c844d9d749312f75c6f6d0980e8c252f8c2146"
+dependencies = [
+ "core-foundation-sys",
+ "libc",
+]
+
+[[package]]
+name = "core-foundation-sys"
+version = "0.8.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e496a50fda8aacccc86d7529e2c1e0892dbd0f898a6b5645b5561b89c3210efa"
+
+[[package]]
+name = "cpufeatures"
+version = "0.2.9"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a17b76ff3a4162b0b27f354a0c87015ddad39d35f9c0c36607a3bdd175dde1f1"
+dependencies = [
+ "libc",
+]
+
+[[package]]
+name = "crc32fast"
+version = "1.3.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b540bd8bc810d3885c6ea91e2018302f68baba2129ab3e88f32389ee9370880d"
+dependencies = [
+ "cfg-if 1.0.0",
+]
+
+[[package]]
+name = "crossbeam-channel"
+version = "0.5.9"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "14c3242926edf34aec4ac3a77108ad4854bffaa2e4ddc1824124ce59231302d5"
+dependencies = [
+ "cfg-if 1.0.0",
+ "crossbeam-utils",
+]
+
+[[package]]
+name = "crossbeam-utils"
+version = "0.8.17"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c06d96137f14f244c37f989d9fff8f95e6c18b918e71f36638f8c49112e4c78f"
+dependencies = [
+ "cfg-if 1.0.0",
+]
+
+[[package]]
+name = "crunchy"
+version = "0.2.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7a81dae078cea95a014a339291cec439d2f232ebe854a9d672b796c6afafa9b7"
+
+[[package]]
+name = "crypto-common"
+version = "0.1.6"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1bfb12502f3fc46cca1bb51ac28df9d618d813cdc3d2f25b9fe775a34af26bb3"
+dependencies = [
+ "generic-array",
+ "typenum",
+]
+
+[[package]]
+name = "crypto-mac"
+version = "0.8.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b584a330336237c1eecd3e94266efb216c56ed91225d634cb2991c5f3fd1aeab"
+dependencies = [
+ "generic-array",
+ "subtle",
+]
+
+[[package]]
+name = "curve25519-dalek"
+version = "4.1.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "0a677b8922c94e01bdbb12126b0bc852f00447528dee1782229af9c720c3f348"
+dependencies = [
+ "cfg-if 1.0.0",
+ "cpufeatures",
+ "curve25519-dalek-derive",
+ "digest 0.10.7",
+ "fiat-crypto",
+ "platforms",
+ "rand_core 0.6.4",
+ "rustc_version",
+ "subtle",
+ "zeroize",
+]
+
+[[package]]
+name = "curve25519-dalek-derive"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f46882e17999c6cc590af592290432be3bce0428cb0d5f8b6715e4dc7b383eb3"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "darling"
+version = "0.20.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "0209d94da627ab5605dcccf08bb18afa5009cfbef48d8a8b7d7bdbc79be25c5e"
+dependencies = [
+ "darling_core",
+ "darling_macro",
+]
+
+[[package]]
+name = "darling_core"
+version = "0.20.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "177e3443818124b357d8e76f53be906d60937f0d3a90773a664fa63fa253e621"
+dependencies = [
+ "fnv",
+ "ident_case",
+ "proc-macro2",
+ "quote",
+ "strsim",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "darling_macro"
+version = "0.20.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "836a9bbc7ad63342d6d6e7b815ccab164bc77a2d95d84bc3117a8c0d5c98e2d5"
+dependencies = [
+ "darling_core",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "debugid"
+version = "0.7.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d6ee87af31d84ef885378aebca32be3d682b0e0dc119d5b4860a2c5bb5046730"
+dependencies = [
+ "uuid",
+]
+
+[[package]]
+name = "deranged"
+version = "0.3.10"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8eb30d70a07a3b04884d2677f06bec33509dc67ca60d92949e5535352d3191dc"
+dependencies = [
+ "powerfmt",
+ "serde",
+]
+
+[[package]]
+name = "derive_arbitrary"
+version = "1.3.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "67e77553c4162a157adbf834ebae5b415acbecbeafc7a74b0e886657506a7611"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "derive_more"
+version = "0.99.17"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "4fb810d30a7c1953f91334de7244731fc3f3c10d7fe163338a35b9f640960321"
+dependencies = [
+ "convert_case",
+ "proc-macro2",
+ "quote",
+ "rustc_version",
+ "syn 1.0.109",
+]
+
+[[package]]
+name = "devhub"
+version = "0.2.0"
+dependencies = [
+ "anyhow",
+ "devhub_common",
+ "html-escape",
+ "insta",
+ "near-contract-standards",
+ "near-sdk",
+ "near-workspaces",
+ "regex",
+ "serde_json",
+ "tokio",
+]
+
+[[package]]
+name = "devhub_common"
+version = "0.1.0"
+dependencies = [
+ "near-sdk",
+]
+
+[[package]]
+name = "digest"
+version = "0.9.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d3dd60d1080a57a05ab032377049e0591415d2b31afd7028356dbf3cc6dcb066"
+dependencies = [
+ "generic-array",
+]
+
+[[package]]
+name = "digest"
+version = "0.10.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "9ed9a281f7bc9b7576e61468ba615a66a5c8cfdff42420a70aa82701a3b1e292"
+dependencies = [
+ "block-buffer",
+ "crypto-common",
+ "subtle",
+]
+
+[[package]]
+name = "dirs-next"
+version = "2.0.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b98cf8ebf19c3d1b223e151f99a4f9f0690dca41414773390fc824184ac833e1"
+dependencies = [
+ "cfg-if 1.0.0",
+ "dirs-sys-next",
+]
+
+[[package]]
+name = "dirs-sys-next"
+version = "0.1.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "4ebda144c4fe02d1f7ea1a7d9641b6fc6b580adcfa024ae48797ecdeb6825b4d"
+dependencies = [
+ "libc",
+ "redox_users",
+ "winapi",
+]
+
+[[package]]
+name = "dmsort"
+version = "1.0.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f0bc8fbe9441c17c9f46f75dfe27fa1ddb6c68a461ccaed0481419219d4f10d3"
+
+[[package]]
+name = "dyn-clone"
+version = "1.0.14"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "23d2f3407d9a573d666de4b5bdf10569d73ca9478087346697dcbae6244bfbcd"
+
+[[package]]
+name = "easy-ext"
+version = "0.2.9"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "53aff6fdc1b181225acdcb5b14c47106726fd8e486707315b1b138baed68ee31"
+
+[[package]]
+name = "ed25519"
+version = "2.2.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "115531babc129696a58c64a4fef0a8bf9e9698629fb97e9e40767d235cfbcd53"
+dependencies = [
+ "signature",
+]
+
+[[package]]
+name = "ed25519-dalek"
+version = "2.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "4a3daa8e81a3963a60642bcc1f90a670680bd4a77535faa384e9d1c79d620871"
+dependencies = [
+ "curve25519-dalek",
+ "ed25519",
+ "rand_core 0.6.4",
+ "sha2",
+ "subtle",
+]
+
+[[package]]
+name = "either"
+version = "1.9.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a26ae43d7bcc3b814de94796a5e736d4029efb0ee900c12e2d54c993ad1a1e07"
+
+[[package]]
+name = "elementtree"
+version = "0.7.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5f6319c9433cf1e95c60c8533978bccf0614f27f03bb4e514253468eeeaa7fe3"
+dependencies = [
+ "string_cache",
+ "xml-rs",
+]
+
+[[package]]
+name = "encode_unicode"
+version = "0.3.6"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a357d28ed41a50f9c765dbfe56cbc04a64e53e5fc58ba79fbc34c10ef3df831f"
+
+[[package]]
+name = "encoding_rs"
+version = "0.8.32"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "071a31f4ee85403370b58aca746f01041ede6f0da2730960ad001edc2b71b394"
+dependencies = [
+ "cfg-if 1.0.0",
+]
+
+[[package]]
+name = "enum-map"
+version = "2.7.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6866f3bfdf8207509a033af1a75a7b08abda06bbaaeae6669323fd5a097df2e9"
+dependencies = [
+ "enum-map-derive",
+]
+
+[[package]]
+name = "enum-map-derive"
+version = "0.17.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f282cfdfe92516eb26c2af8589c274c7c17681f5ecc03c18255fe741c6aa64eb"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "env_logger"
+version = "0.9.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a12e6657c4c97ebab115a42dcee77225f7f482cdd841cf7088c657a42e9e00e7"
+dependencies = [
+ "atty",
+ "humantime",
+ "log",
+ "regex",
+ "termcolor",
+]
+
+[[package]]
+name = "equivalent"
+version = "1.0.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5443807d6dff69373d433ab9ef5378ad8df50ca6298caf15de6e52e24aaf54d5"
+
+[[package]]
+name = "errno"
+version = "0.3.8"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a258e46cdc063eb8519c00b9fc845fc47bcfca4130e2f08e88665ceda8474245"
+dependencies = [
+ "libc",
+ "windows-sys 0.52.0",
+]
+
+[[package]]
+name = "fallible-iterator"
+version = "0.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "4443176a9f2c162692bd3d352d745ef9413eec5782a80d8fd6f8a1ac692a07f7"
+
+[[package]]
+name = "fastrand"
+version = "2.0.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6999dc1837253364c2ebb0704ba97994bd874e8f195d665c50b7548f6ea92764"
+
+[[package]]
+name = "fiat-crypto"
+version = "0.2.6"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1676f435fc1dadde4d03e43f5d62b259e1ce5f40bd4ffb21db2b42ebe59c1382"
+
+[[package]]
+name = "filetime"
+version = "0.2.21"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5cbc844cecaee9d4443931972e1289c8ff485cb4cc2767cb03ca139ed6885153"
+dependencies = [
+ "cfg-if 1.0.0",
+ "libc",
+ "redox_syscall 0.2.16",
+ "windows-sys 0.48.0",
+]
+
+[[package]]
+name = "fixed-hash"
+version = "0.7.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "cfcf0ed7fe52a17a03854ec54a9f76d6d84508d1c0e66bc1793301c73fc8493c"
+dependencies = [
+ "static_assertions",
+]
+
+[[package]]
+name = "fixedbitset"
+version = "0.4.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "0ce7134b9999ecaf8bcd65542e436736ef32ddca1b3e06094cb6ec5755203b80"
+
+[[package]]
+name = "flate2"
+version = "1.0.26"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3b9429470923de8e8cbd4d2dc513535400b4b3fef0319fb5c4e1f520a7bef743"
+dependencies = [
+ "crc32fast",
+ "miniz_oxide",
+]
+
+[[package]]
+name = "fnv"
+version = "1.0.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3f9eec918d3f24069decb9af1554cad7c880e2da24a9afd88aca000531ab82c1"
+
+[[package]]
+name = "foreign-types"
+version = "0.3.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f6f339eb8adc052cd2ca78910fda869aefa38d22d5cb648e6485e4d3fc06f3b1"
+dependencies = [
+ "foreign-types-shared",
+]
+
+[[package]]
+name = "foreign-types-shared"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "00b0228411908ca8685dba7fc2cdd70ec9990a6e753e89b6ac91a84c40fbaf4b"
+
+[[package]]
+name = "form_urlencoded"
+version = "1.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a62bc1cf6f830c2ec14a513a9fb124d0a213a629668a4186f329db21fe045652"
+dependencies = [
+ "percent-encoding",
+]
+
+[[package]]
+name = "fs2"
+version = "0.4.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "9564fc758e15025b46aa6643b1b77d047d1a56a1aea6e01002ac0c7026876213"
+dependencies = [
+ "libc",
+ "winapi",
+]
+
+[[package]]
+name = "funty"
+version = "2.0.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e6d5a32815ae3f33302d95fdcb2ce17862f8c65363dcfd29360480ba1001fc9c"
+
+[[package]]
+name = "futures"
+version = "0.3.28"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "23342abe12aba583913b2e62f22225ff9c950774065e4bfb61a19cd9770fec40"
+dependencies = [
+ "futures-channel",
+ "futures-core",
+ "futures-io",
+ "futures-sink",
+ "futures-task",
+ "futures-util",
+]
+
+[[package]]
+name = "futures-channel"
+version = "0.3.28"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "955518d47e09b25bbebc7a18df10b81f0c766eaf4c4f1cccef2fca5f2a4fb5f2"
+dependencies = [
+ "futures-core",
+ "futures-sink",
+]
+
+[[package]]
+name = "futures-core"
+version = "0.3.28"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "4bca583b7e26f571124fe5b7561d49cb2868d79116cfa0eefce955557c6fee8c"
+
+[[package]]
+name = "futures-executor"
+version = "0.3.28"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ccecee823288125bd88b4d7f565c9e58e41858e47ab72e8ea2d64e93624386e0"
+dependencies = [
+ "futures-core",
+ "futures-task",
+ "futures-util",
+]
+
+[[package]]
+name = "futures-io"
+version = "0.3.28"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "4fff74096e71ed47f8e023204cfd0aa1289cd54ae5430a9523be060cdb849964"
+
+[[package]]
+name = "futures-sink"
+version = "0.3.28"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f43be4fe21a13b9781a69afa4985b0f6ee0e1afab2c6f454a8cf30e2b2237b6e"
+
+[[package]]
+name = "futures-task"
+version = "0.3.28"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "76d3d132be6c0e6aa1534069c705a74a5997a356c0dc2f86a47765e5617c5b65"
+
+[[package]]
+name = "futures-util"
+version = "0.3.28"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "26b01e40b772d54cf6c6d721c1d1abd0647a0106a12ecaa1c186273392a69533"
+dependencies = [
+ "futures-channel",
+ "futures-core",
+ "futures-io",
+ "futures-sink",
+ "futures-task",
+ "memchr",
+ "pin-project-lite",
+ "pin-utils",
+ "slab",
+]
+
+[[package]]
+name = "generic-array"
+version = "0.14.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "85649ca51fd72272d7821adaf274ad91c288277713d9c18820d8499a7ff69e9a"
+dependencies = [
+ "typenum",
+ "version_check",
+]
+
+[[package]]
+name = "getrandom"
+version = "0.1.16"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8fc3cb4d91f53b50155bdcfd23f6a4c39ae1969c2ae85982b135750cccaf5fce"
+dependencies = [
+ "cfg-if 1.0.0",
+ "libc",
+ "wasi 0.9.0+wasi-snapshot-preview1",
+]
+
+[[package]]
+name = "getrandom"
+version = "0.2.10"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "be4136b2a15dd319360be1c07d9933517ccf0be8f16bf62a3bee4f0d618df427"
+dependencies = [
+ "cfg-if 1.0.0",
+ "libc",
+ "wasi 0.11.0+wasi-snapshot-preview1",
+]
+
+[[package]]
+name = "gimli"
+version = "0.26.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "22030e2c5a68ec659fde1e949a745124b48e6fa8b045b7ed5bd1fe4ccc5c4e5d"
+dependencies = [
+ "fallible-iterator",
+ "stable_deref_trait",
+]
+
+[[package]]
+name = "goblin"
+version = "0.5.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a7666983ed0dd8d21a6f6576ee00053ca0926fb281a5522577a4dbd0f1b54143"
+dependencies = [
+ "log",
+ "plain",
+ "scroll 0.11.0",
+]
+
+[[package]]
+name = "h2"
+version = "0.3.20"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "97ec8491ebaf99c8eaa73058b045fe58073cd6be7f596ac993ced0b0a0c01049"
+dependencies = [
+ "bytes",
+ "fnv",
+ "futures-core",
+ "futures-sink",
+ "futures-util",
+ "http",
+ "indexmap 1.9.3",
+ "slab",
+ "tokio",
+ "tokio-util 0.7.8",
+ "tracing",
+]
+
+[[package]]
+name = "hashbrown"
+version = "0.11.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ab5ef0d4909ef3724cc8cce6ccc8572c5c817592e9285f5464f8e86f8bd3726e"
+dependencies = [
+ "ahash",
+]
+
+[[package]]
+name = "hashbrown"
+version = "0.12.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8a9ee70c43aaf417c914396645a0fa852624801b24ebb7ae78fe8272889ac888"
+
+[[package]]
+name = "hashbrown"
+version = "0.14.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "2c6201b9ff9fd90a5a3bac2e56a830d0caa509576f0e503818ee82c181b3437a"
+
+[[package]]
+name = "heck"
+version = "0.3.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6d621efb26863f0e9924c6ac577e8275e5e6b77455db64ffa6c65c904e9e132c"
+dependencies = [
+ "unicode-segmentation",
+]
+
+[[package]]
+name = "heck"
+version = "0.4.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "95505c38b4572b2d910cecb0281560f54b440a19336cbbcb27bf6ce6adc6f5a8"
+
+[[package]]
+name = "hermit-abi"
+version = "0.1.19"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "62b467343b94ba476dcb2500d242dadbb39557df889310ac77c5d99100aaac33"
+dependencies = [
+ "libc",
+]
+
+[[package]]
+name = "hermit-abi"
+version = "0.3.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "443144c8cdadd93ebf52ddb4056d257f5b52c04d3c804e657d19eb73fc33668b"
+
+[[package]]
+name = "hex"
+version = "0.4.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7f24254aa9a54b5c858eaee2f5bccdb46aaf0e486a595ed5fd8f86ba55232a70"
+dependencies = [
+ "serde",
+]
+
+[[package]]
+name = "hmac"
+version = "0.12.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6c49c37c09c17a53d937dfbb742eb3a961d65a994e6bcdcf37e7399d0cc8ab5e"
+dependencies = [
+ "digest 0.10.7",
+]
+
+[[package]]
+name = "home"
+version = "0.5.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5444c27eef6923071f7ebcc33e3444508466a76f7a2b93da00ed6e19f30c1ddb"
+dependencies = [
+ "windows-sys 0.48.0",
+]
+
+[[package]]
+name = "html-escape"
+version = "0.2.13"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6d1ad449764d627e22bfd7cd5e8868264fc9236e07c752972b4080cd351cb476"
+dependencies = [
+ "utf8-width",
+]
+
+[[package]]
+name = "http"
+version = "0.2.9"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "bd6effc99afb63425aff9b05836f029929e345a6148a14b7ecd5ab67af944482"
+dependencies = [
+ "bytes",
+ "fnv",
+ "itoa",
+]
+
+[[package]]
+name = "http-body"
+version = "0.4.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d5f38f16d184e36f2408a55281cd658ecbd3ca05cce6d6510a176eca393e26d1"
+dependencies = [
+ "bytes",
+ "http",
+ "pin-project-lite",
+]
+
+[[package]]
+name = "httparse"
+version = "1.8.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d897f394bad6a705d5f4104762e116a75639e470d80901eed05a860a95cb1904"
+
+[[package]]
+name = "httpdate"
+version = "1.0.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c4a1e36c821dbe04574f602848a19f742f4fb3c98d40449f11bcad18d6b17421"
+
+[[package]]
+name = "humantime"
+version = "2.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "9a3a5bfb195931eeb336b2a7b4d761daec841b97f947d34394601737a7bba5e4"
+
+[[package]]
+name = "hyper"
+version = "0.14.27"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ffb1cfd654a8219eaef89881fdb3bb3b1cdc5fa75ded05d6933b2b382e395468"
+dependencies = [
+ "bytes",
+ "futures-channel",
+ "futures-core",
+ "futures-util",
+ "h2",
+ "http",
+ "http-body",
+ "httparse",
+ "httpdate",
+ "itoa",
+ "pin-project-lite",
+ "socket2",
+ "tokio",
+ "tower-service",
+ "tracing",
+ "want",
+]
+
+[[package]]
+name = "hyper-timeout"
+version = "0.4.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "bbb958482e8c7be4bc3cf272a766a2b0bf1a6755e7a6ae777f017a31d11b13b1"
+dependencies = [
+ "hyper",
+ "pin-project-lite",
+ "tokio",
+ "tokio-io-timeout",
+]
+
+[[package]]
+name = "hyper-tls"
+version = "0.5.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d6183ddfa99b85da61a140bea0efc93fdf56ceaa041b37d553518030827f9905"
+dependencies = [
+ "bytes",
+ "hyper",
+ "native-tls",
+ "tokio",
+ "tokio-native-tls",
+]
+
+[[package]]
+name = "iana-time-zone"
+version = "0.1.57"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "2fad5b825842d2b38bd206f3e81d6957625fd7f0a361e345c30e01a0ae2dd613"
+dependencies = [
+ "android_system_properties",
+ "core-foundation-sys",
+ "iana-time-zone-haiku",
+ "js-sys",
+ "wasm-bindgen",
+ "windows",
+]
+
+[[package]]
+name = "iana-time-zone-haiku"
+version = "0.1.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f31827a206f56af32e590ba56d5d2d085f558508192593743f16b2306495269f"
+dependencies = [
+ "cc",
+]
+
+[[package]]
+name = "ident_case"
+version = "1.0.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b9e0384b61958566e926dc50660321d12159025e767c18e043daf26b70104c39"
+
+[[package]]
+name = "idna"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7d20d6b07bfbc108882d88ed8e37d39636dcc260e15e30c45e6ba089610b917c"
+dependencies = [
+ "unicode-bidi",
+ "unicode-normalization",
+]
+
+[[package]]
+name = "indent_write"
+version = "2.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "0cfe9645a18782869361d9c8732246be7b410ad4e919d3609ebabdac00ba12c3"
+
+[[package]]
+name = "indexmap"
+version = "1.9.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "bd070e393353796e801d209ad339e89596eb4c8d430d18ede6a1cced8fafbd99"
+dependencies = [
+ "autocfg",
+ "hashbrown 0.12.3",
+ "serde",
+]
+
+[[package]]
+name = "indexmap"
+version = "2.0.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d5477fe2230a79769d8dc68e0eabf5437907c0457a5614a9e8dddb67f65eb65d"
+dependencies = [
+ "equivalent",
+ "hashbrown 0.14.0",
+ "serde",
+]
+
+[[package]]
+name = "inout"
+version = "0.1.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a0c10553d664a4d0bcff9f4215d0aac67a639cc68ef660840afe309b807bc9f5"
+dependencies = [
+ "generic-array",
+]
+
+[[package]]
+name = "insta"
+version = "1.31.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a0770b0a3d4c70567f0d58331f3088b0e4c4f56c9b8d764efe654b4a5d46de3a"
+dependencies = [
+ "console",
+ "lazy_static",
+ "linked-hash-map",
+ "pest",
+ "pest_derive",
+ "serde",
+ "similar",
+ "yaml-rust",
+]
+
+[[package]]
+name = "ipnet"
+version = "2.8.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "28b29a3cd74f0f4598934efe3aeba42bae0eb4680554128851ebbecb02af14e6"
+
+[[package]]
+name = "is-terminal"
+version = "0.4.9"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "cb0889898416213fab133e1d33a0e5858a48177452750691bde3666d0fdbaf8b"
+dependencies = [
+ "hermit-abi 0.3.2",
+ "rustix",
+ "windows-sys 0.48.0",
+]
+
+[[package]]
+name = "is_executable"
+version = "0.1.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "302d553b8abc8187beb7d663e34c065ac4570b273bc9511a50e940e99409c577"
+dependencies = [
+ "winapi",
+]
+
+[[package]]
+name = "itertools"
+version = "0.10.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b0fd2260e829bddf4cb6ea802289de2f86d6a7a690192fbe91b3f46e0f2c8473"
+dependencies = [
+ "either",
+]
+
+[[package]]
+name = "itoa"
+version = "1.0.9"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "af150ab688ff2122fcef229be89cb50dd66af9e01a4ff320cc137eecc9bacc38"
+
+[[package]]
+name = "jobserver"
+version = "0.1.27"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8c37f63953c4c63420ed5fd3d6d398c719489b9f872b9fa683262f8edd363c7d"
+dependencies = [
+ "libc",
+]
+
+[[package]]
+name = "joinery"
+version = "2.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "72167d68f5fce3b8655487b8038691a3c9984ee769590f93f2a631f4ad64e4f5"
+
+[[package]]
+name = "js-sys"
+version = "0.3.64"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c5f195fe497f702db0f318b07fdd68edb16955aed830df8363d837542f8f935a"
+dependencies = [
+ "wasm-bindgen",
+]
+
+[[package]]
+name = "json-patch"
+version = "1.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "55ff1e1486799e3f64129f8ccad108b38290df9cd7015cd31bed17239f0789d6"
+dependencies = [
+ "serde",
+ "serde_json",
+ "thiserror",
+ "treediff",
+]
+
+[[package]]
+name = "json_comments"
+version = "0.2.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "9dbbfed4e59ba9750e15ba154fdfd9329cee16ff3df539c2666b70f58cc32105"
+
+[[package]]
+name = "keccak"
+version = "0.1.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ecc2af9a1119c51f12a14607e783cb977bde58bc069ff0c3da1095e635d70654"
+dependencies = [
+ "cpufeatures",
+]
+
+[[package]]
+name = "lazy_static"
+version = "1.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e2abad23fbc42b3700f2f279844dc832adb2b2eb069b2df918f455c4e18cc646"
+dependencies = [
+ "spin 0.5.2",
+]
+
+[[package]]
+name = "lazycell"
+version = "1.3.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "830d08ce1d1d941e6b30645f1a0eb5643013d835ce3779a5fc208261dbe10f55"
+
+[[package]]
+name = "libc"
+version = "0.2.151"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "302d7ab3130588088d277783b1e2d2e10c9e9e4a16dd9050e6ec93fb3e7048f4"
+
+[[package]]
+name = "libloading"
+version = "0.7.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b67380fd3b2fbe7527a606e18729d21c6f3951633d0500574c4dc22d2d638b9f"
+dependencies = [
+ "cfg-if 1.0.0",
+ "winapi",
+]
+
+[[package]]
+name = "linked-hash-map"
+version = "0.5.6"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "0717cef1bc8b636c6e1c1bbdefc09e6322da8a9321966e8928ef80d20f7f770f"
+
+[[package]]
+name = "linux-raw-sys"
+version = "0.4.12"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c4cd1a83af159aa67994778be9070f0ae1bd732942279cabb14f86f986a21456"
+
+[[package]]
+name = "lock_api"
+version = "0.4.10"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c1cc9717a20b1bb222f333e6a92fd32f7d8a18ddc5a3191a11af45dcbf4dcd16"
+dependencies = [
+ "autocfg",
+ "scopeguard",
+]
+
+[[package]]
+name = "log"
+version = "0.4.19"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b06a4cde4c0f271a446782e3eff8de789548ce57dbc8eca9292c27f4a42004b4"
+
+[[package]]
+name = "matchers"
+version = "0.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8263075bb86c5a1b1427b5ae862e8889656f126e9f77c484496e8b47cf5c5558"
+dependencies = [
+ "regex-automata 0.1.10",
+]
+
+[[package]]
+name = "memchr"
+version = "2.5.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "2dffe52ecf27772e601905b7522cb4ef790d2cc203488bbd0e2fe85fcb74566d"
+
+[[package]]
+name = "memmap2"
+version = "0.5.10"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "83faa42c0a078c393f6b29d5db232d8be22776a891f8f56e5284faee4a20b327"
+dependencies = [
+ "libc",
+]
+
+[[package]]
+name = "memoffset"
+version = "0.8.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d61c719bcfbcf5d62b3a09efa6088de8c54bc0bfcd3ea7ae39fcc186108b8de1"
+dependencies = [
+ "autocfg",
+]
+
+[[package]]
+name = "memory_units"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8452105ba047068f40ff7093dd1d9da90898e63dd61736462e9cdda6a90ad3c3"
+
+[[package]]
+name = "mime"
+version = "0.3.17"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6877bb514081ee2a7ff5ef9de3281f14a4dd4bceac4c09388074a6b5df8a139a"
+
+[[package]]
+name = "minimal-lexical"
+version = "0.2.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "68354c5c6bd36d73ff3feceb05efa59b6acb7626617f4962be322a825e61f79a"
+
+[[package]]
+name = "miniz_oxide"
+version = "0.7.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e7810e0be55b428ada41041c41f32c9f1a42817901b4ccf45fa3d4b6561e74c7"
+dependencies = [
+ "adler",
+]
+
+[[package]]
+name = "mio"
+version = "0.8.8"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "927a765cd3fc26206e66b296465fa9d3e5ab003e651c1b3c060e7956d96b19d2"
+dependencies = [
+ "libc",
+ "wasi 0.11.0+wasi-snapshot-preview1",
+ "windows-sys 0.48.0",
+]
+
+[[package]]
+name = "multimap"
+version = "0.8.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e5ce46fe64a9d73be07dcbe690a38ce1b293be448fd8ce1e6c1b8062c9f72c6a"
+
+[[package]]
+name = "native-tls"
+version = "0.2.11"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "07226173c32f2926027b63cce4bcd8076c3552846cbe7925f3aaffeac0a3b92e"
+dependencies = [
+ "lazy_static",
+ "libc",
+ "log",
+ "openssl",
+ "openssl-probe",
+ "openssl-sys",
+ "schannel",
+ "security-framework",
+ "security-framework-sys",
+ "tempfile",
+]
+
+[[package]]
+name = "near-abi"
+version = "0.3.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "885db39b08518fa700b73fa2214e8adbbfba316ba82dd510f50519173eadaf73"
+dependencies = [
+ "borsh 0.9.3",
+ "schemars",
+ "semver",
+ "serde",
+]
+
+[[package]]
+name = "near-account-id"
+version = "1.0.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "35cbb989542587b47205e608324ddd391f0cee1c22b4b64ae49f458334b95907"
+dependencies = [
+ "borsh 1.3.1",
+ "serde",
+]
+
+[[package]]
+name = "near-chain-configs"
+version = "0.20.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d05e5a8ace81c09d7eb165dffc1742358a021b2fa761f2160943305f83216003"
+dependencies = [
+ "anyhow",
+ "bytesize",
+ "chrono",
+ "derive_more",
+ "near-config-utils",
+ "near-crypto",
+ "near-parameters",
+ "near-primitives",
+ "num-rational",
+ "once_cell",
+ "serde",
+ "serde_json",
+ "sha2",
+ "smart-default",
+ "tracing",
+]
+
+[[package]]
+name = "near-config-utils"
+version = "0.20.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "2ae1eaab1d545a9be7a55b6ef09f365c2017f93a03063547591d12c0c6d27e58"
+dependencies = [
+ "anyhow",
+ "json_comments",
+ "thiserror",
+ "tracing",
+]
+
+[[package]]
+name = "near-contract-standards"
+version = "5.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a0e78fe14d389ae76f792735a2108a6b8332a2bed61197310bf5ad718fb1e424"
+dependencies = [
+ "near-sdk",
+]
+
+[[package]]
+name = "near-crypto"
+version = "0.20.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "2991d2912218a80ec0733ac87f84fa803accea105611eea209d4419271957667"
+dependencies = [
+ "blake2",
+ "borsh 1.3.1",
+ "bs58 0.4.0",
+ "c2-chacha",
+ "curve25519-dalek",
+ "derive_more",
+ "ed25519-dalek",
+ "hex",
+ "near-account-id",
+ "near-config-utils",
+ "near-stdx",
+ "once_cell",
+ "primitive-types",
+ "rand 0.7.3",
+ "secp256k1",
+ "serde",
+ "serde_json",
+ "subtle",
+ "thiserror",
+]
+
+[[package]]
+name = "near-fmt"
+version = "0.20.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b7d998dfc1e04001608899b2498ad5a782c7d036b73769d510de21964db99286"
+dependencies = [
+ "near-primitives-core",
+]
+
+[[package]]
+name = "near-gas"
+version = "0.2.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "14e75c875026229902d065e4435804497337b631ec69ba746b102954273e9ad1"
+dependencies = [
+ "borsh 1.3.1",
+ "schemars",
+ "serde",
+]
+
+[[package]]
+name = "near-jsonrpc-client"
+version = "0.8.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "18ad81e015f7aced8925d5b9ba3f369b36da9575c15812cfd0786bc1213284ca"
+dependencies = [
+ "borsh 1.3.1",
+ "lazy_static",
+ "log",
+ "near-chain-configs",
+ "near-crypto",
+ "near-jsonrpc-primitives",
+ "near-primitives",
+ "reqwest",
+ "serde",
+ "serde_json",
+ "thiserror",
+]
+
+[[package]]
+name = "near-jsonrpc-primitives"
+version = "0.20.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b0ce745e954ae776eef05957602e638ee9581106a3675946fb43c2fe7e38ef03"
+dependencies = [
+ "arbitrary",
+ "near-chain-configs",
+ "near-crypto",
+ "near-primitives",
+ "near-rpc-error-macro",
+ "serde",
+ "serde_json",
+ "thiserror",
+]
+
+[[package]]
+name = "near-o11y"
+version = "0.20.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d20762631bc8253030013bbae9b5f0542691edc1aa6722f1e8141cc9b928ae5b"
+dependencies = [
+ "actix",
+ "base64 0.21.2",
+ "clap 4.2.0",
+ "near-crypto",
+ "near-fmt",
+ "near-primitives-core",
+ "once_cell",
+ "opentelemetry",
+ "opentelemetry-otlp",
+ "opentelemetry-semantic-conventions",
+ "prometheus",
+ "serde",
+ "serde_json",
+ "strum 0.24.1",
+ "thiserror",
+ "tokio",
+ "tracing",
+ "tracing-appender",
+ "tracing-opentelemetry",
+ "tracing-subscriber",
+]
+
+[[package]]
+name = "near-parameters"
+version = "0.20.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e9f16a59b6c3e69b0585be951af6fe42a0ba86c0e207cb8c63badd19efd16680"
+dependencies = [
+ "assert_matches",
+ "borsh 1.3.1",
+ "enum-map",
+ "near-account-id",
+ "near-primitives-core",
+ "num-rational",
+ "serde",
+ "serde_repr",
+ "serde_yaml",
+ "strum 0.24.1",
+ "thiserror",
+]
+
+[[package]]
+name = "near-primitives"
+version = "0.20.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "0462b067732132babcc89d5577db3bfcb0a1bcfbaaed3f2db4c11cd033666314"
+dependencies = [
+ "arbitrary",
+ "base64 0.21.2",
+ "borsh 1.3.1",
+ "bytesize",
+ "cfg-if 1.0.0",
+ "chrono",
+ "derive_more",
+ "easy-ext",
+ "enum-map",
+ "hex",
+ "near-crypto",
+ "near-fmt",
+ "near-o11y",
+ "near-parameters",
+ "near-primitives-core",
+ "near-rpc-error-macro",
+ "near-stdx",
+ "near-vm-runner",
+ "num-rational",
+ "once_cell",
+ "primitive-types",
+ "rand 0.8.5",
+ "rand_chacha 0.3.1",
+ "reed-solomon-erasure",
+ "serde",
+ "serde_json",
+ "serde_with",
+ "serde_yaml",
+ "sha3",
+ "smart-default",
+ "strum 0.24.1",
+ "thiserror",
+ "time",
+ "tracing",
+]
+
+[[package]]
+name = "near-primitives-core"
+version = "0.20.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8443eb718606f572c438be6321a097a8ebd69f8e48d953885b4f16601af88225"
+dependencies = [
+ "arbitrary",
+ "base64 0.21.2",
+ "borsh 1.3.1",
+ "bs58 0.4.0",
+ "derive_more",
+ "enum-map",
+ "near-account-id",
+ "num-rational",
+ "serde",
+ "serde_repr",
+ "serde_with",
+ "sha2",
+ "strum 0.24.1",
+ "thiserror",
+]
+
+[[package]]
+name = "near-rpc-error-core"
+version = "0.20.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "80fca203c51edd9595ec14db1d13359fb9ede32314990bf296b6c5c4502f6ab7"
+dependencies = [
+ "quote",
+ "serde",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "near-rpc-error-macro"
+version = "0.20.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "897a445de2102f6732c8a185d922f5e3bf7fd0a41243ce40854df2197237f799"
+dependencies = [
+ "fs2",
+ "near-rpc-error-core",
+ "serde",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "near-sandbox-utils"
+version = "0.7.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "2de216bb0152bfb64f59016d9e6a5b1ac56dd85f729e5fde08461571e2182c8f"
+dependencies = [
+ "anyhow",
+ "binary-install",
+ "chrono",
+ "fs2",
+ "home",
+ "tokio",
+]
+
+[[package]]
+name = "near-sdk"
+version = "5.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "520234cfdf04a805ac2f04715889d096eb83fdd5b99ca7d0f8027ae473f891a8"
+dependencies = [
+ "base64 0.21.2",
+ "borsh 1.3.1",
+ "bs58 0.5.0",
+ "near-account-id",
+ "near-crypto",
+ "near-gas",
+ "near-parameters",
+ "near-primitives",
+ "near-primitives-core",
+ "near-sdk-macros",
+ "near-sys",
+ "near-token",
+ "near-vm-runner",
+ "once_cell",
+ "serde",
+ "serde_json",
+ "wee_alloc",
+]
+
+[[package]]
+name = "near-sdk-macros"
+version = "5.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ee2fe3fc30068c5f20e89b0985d6104c5cc1c6742dbc6efbf352be4189b9bbf7"
+dependencies = [
+ "Inflector",
+ "darling",
+ "proc-macro2",
+ "quote",
+ "serde",
+ "serde_json",
+ "strum 0.26.1",
+ "strum_macros 0.26.1",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "near-stdx"
+version = "0.20.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "855fd5540e3b4ff6fedf12aba2db1ee4b371b36f465da1363a6d022b27cb43b8"
+
+[[package]]
+name = "near-sys"
+version = "0.2.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "397688591acf8d3ebf2c2485ba32d4b24fc10aad5334e3ad8ec0b7179bfdf06b"
+
+[[package]]
+name = "near-token"
+version = "0.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7b68f3f8a2409f72b43efdbeff8e820b81e70824c49fee8572979d789d1683fb"
+dependencies = [
+ "borsh 1.3.1",
+ "serde",
+]
+
+[[package]]
+name = "near-vm-runner"
+version = "0.20.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c56c80bdb1954808f59bd36a9112377197b38d424991383bf05f52d0fe2e0da5"
+dependencies = [
+ "base64 0.21.2",
+ "borsh 1.3.1",
+ "ed25519-dalek",
+ "enum-map",
+ "memoffset",
+ "near-crypto",
+ "near-parameters",
+ "near-primitives-core",
+ "near-stdx",
+ "num-rational",
+ "once_cell",
+ "prefix-sum-vec",
+ "ripemd",
+ "serde",
+ "serde_repr",
+ "serde_with",
+ "sha2",
+ "sha3",
+ "strum 0.24.1",
+ "thiserror",
+ "tracing",
+ "zeropool-bn",
+]
+
+[[package]]
+name = "near-workspaces"
+version = "0.10.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a3e597da87d0c1a722e23efb8c24ae42a0ad99a15f37101dad45c15defb051c1"
+dependencies = [
+ "async-trait",
+ "base64 0.21.2",
+ "bs58 0.5.0",
+ "cargo-near",
+ "cargo_metadata 0.18.1",
+ "chrono",
+ "fs2",
+ "json-patch",
+ "libc",
+ "near-account-id",
+ "near-crypto",
+ "near-gas",
+ "near-jsonrpc-client",
+ "near-jsonrpc-primitives",
+ "near-primitives",
+ "near-sandbox-utils",
+ "near-token",
+ "rand 0.8.5",
+ "reqwest",
+ "serde",
+ "serde_json",
+ "sha2",
+ "tempfile",
+ "thiserror",
+ "tokio",
+ "tokio-retry",
+ "tracing",
+ "url",
+]
+
+[[package]]
+name = "new_debug_unreachable"
+version = "1.0.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e4a24736216ec316047a1fc4252e27dabb04218aa4a3f37c6e7ddbf1f9782b54"
+
+[[package]]
+name = "nom"
+version = "7.1.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d273983c5a657a70a3e8f2a01329822f3b8c8172b73826411a55751e404a0a4a"
+dependencies = [
+ "memchr",
+ "minimal-lexical",
+]
+
+[[package]]
+name = "nom-supreme"
+version = "0.6.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "aadc66631948f6b65da03be4c4cd8bd104d481697ecbb9bbd65719b1ec60bc9f"
+dependencies = [
+ "brownstone",
+ "indent_write",
+ "joinery",
+ "memchr",
+ "nom",
+]
+
+[[package]]
+name = "nu-ansi-term"
+version = "0.46.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "77a8165726e8236064dbb45459242600304b42a5ea24ee2948e18e023bf7ba84"
+dependencies = [
+ "overload",
+ "winapi",
+]
+
+[[package]]
+name = "num-bigint"
+version = "0.3.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5f6f7833f2cbf2360a6cfd58cd41a53aa7a90bd4c202f5b1c7dd2ed73c57b2c3"
+dependencies = [
+ "autocfg",
+ "num-integer",
+ "num-traits",
+]
+
+[[package]]
+name = "num-integer"
+version = "0.1.45"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "225d3389fb3509a24c93f5c29eb6bde2586b98d9f016636dff58d7c6f7569cd9"
+dependencies = [
+ "autocfg",
+ "num-traits",
+]
+
+[[package]]
+name = "num-rational"
+version = "0.3.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "12ac428b1cb17fce6f731001d307d351ec70a6d202fc2e60f7d4c5e42d8f4f07"
+dependencies = [
+ "autocfg",
+ "num-bigint",
+ "num-integer",
+ "num-traits",
+ "serde",
+]
+
+[[package]]
+name = "num-traits"
+version = "0.2.16"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f30b0abd723be7e2ffca1272140fac1a2f084c77ec3e123c192b66af1ee9e6c2"
+dependencies = [
+ "autocfg",
+]
+
+[[package]]
+name = "num_cpus"
+version = "1.16.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "4161fcb6d602d4d2081af7c3a45852d875a03dd337a6bfdd6e06407b61342a43"
+dependencies = [
+ "hermit-abi 0.3.2",
+ "libc",
+]
+
+[[package]]
+name = "once_cell"
+version = "1.18.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "dd8b5dd2ae5ed71462c540258bedcb51965123ad7e7ccf4b9a8cafaa4a63576d"
+
+[[package]]
+name = "opaque-debug"
+version = "0.3.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "624a8340c38c1b80fd549087862da4ba43e08858af025b236e509b6649fc13d5"
+
+[[package]]
+name = "openssl"
+version = "0.10.55"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "345df152bc43501c5eb9e4654ff05f794effb78d4efe3d53abc158baddc0703d"
+dependencies = [
+ "bitflags 1.3.2",
+ "cfg-if 1.0.0",
+ "foreign-types",
+ "libc",
+ "once_cell",
+ "openssl-macros",
+ "openssl-sys",
+]
+
+[[package]]
+name = "openssl-macros"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a948666b637a0f465e8564c73e89d4dde00d72d4d473cc972f390fc3dcee7d9c"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "openssl-probe"
+version = "0.1.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ff011a302c396a5197692431fc1948019154afc178baf7d8e37367442a4601cf"
+
+[[package]]
+name = "openssl-sys"
+version = "0.9.90"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "374533b0e45f3a7ced10fcaeccca020e66656bc03dac384f852e4e5a7a8104a6"
+dependencies = [
+ "cc",
+ "libc",
+ "pkg-config",
+ "vcpkg",
+]
+
+[[package]]
+name = "opentelemetry"
+version = "0.17.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6105e89802af13fdf48c49d7646d3b533a70e536d818aae7e78ba0433d01acb8"
+dependencies = [
+ "async-trait",
+ "crossbeam-channel",
+ "futures-channel",
+ "futures-executor",
+ "futures-util",
+ "js-sys",
+ "lazy_static",
+ "percent-encoding",
+ "pin-project",
+ "rand 0.8.5",
+ "thiserror",
+ "tokio",
+ "tokio-stream",
+]
+
+[[package]]
+name = "opentelemetry-otlp"
+version = "0.10.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "9d1a6ca9de4c8b00aa7f1a153bd76cb263287155cec642680d79d98706f3d28a"
+dependencies = [
+ "async-trait",
+ "futures",
+ "futures-util",
+ "http",
+ "opentelemetry",
+ "prost",
+ "thiserror",
+ "tokio",
+ "tonic",
+ "tonic-build",
+]
+
+[[package]]
+name = "opentelemetry-semantic-conventions"
+version = "0.9.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "985cc35d832d412224b2cffe2f9194b1b89b6aa5d0bef76d080dce09d90e62bd"
+dependencies = [
+ "opentelemetry",
+]
+
+[[package]]
+name = "os_str_bytes"
+version = "6.6.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e2355d85b9a3786f481747ced0e0ff2ba35213a1f9bd406ed906554d7af805a1"
+
+[[package]]
+name = "overload"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b15813163c1d831bf4a13c3610c05c0d03b39feb07f7e09fa234dac9b15aaf39"
+
+[[package]]
+name = "parking_lot"
+version = "0.12.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3742b2c103b9f06bc9fff0a37ff4912935851bee6d36f3c02bcc755bcfec228f"
+dependencies = [
+ "lock_api",
+ "parking_lot_core",
+]
+
+[[package]]
+name = "parking_lot_core"
+version = "0.9.8"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "93f00c865fe7cabf650081affecd3871070f26767e7b2070a3ffae14c654b447"
+dependencies = [
+ "cfg-if 1.0.0",
+ "libc",
+ "redox_syscall 0.3.5",
+ "smallvec",
+ "windows-targets 0.48.1",
+]
+
+[[package]]
+name = "password-hash"
+version = "0.4.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7676374caaee8a325c9e7a2ae557f216c5563a171d6997b0ef8a65af35147700"
+dependencies = [
+ "base64ct",
+ "rand_core 0.6.4",
+ "subtle",
+]
+
+[[package]]
+name = "pbkdf2"
+version = "0.11.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "83a0692ec44e4cf1ef28ca317f14f8f07da2d95ec3fa01f86e4467b725e60917"
+dependencies = [
+ "digest 0.10.7",
+ "hmac",
+ "password-hash",
+ "sha2",
+]
+
+[[package]]
+name = "pdb"
+version = "0.7.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "13f4d162ecaaa1467de5afbe62d597757b674b51da8bb4e587430c5fdb2af7aa"
+dependencies = [
+ "fallible-iterator",
+ "scroll 0.10.2",
+ "uuid",
+]
+
+[[package]]
+name = "percent-encoding"
+version = "2.3.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "9b2a4787296e9989611394c33f193f676704af1686e70b8f8033ab5ba9a35a94"
+
+[[package]]
+name = "pest"
+version = "2.7.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d7a4d085fd991ac8d5b05a147b437791b4260b76326baf0fc60cf7c9c27ecd33"
+dependencies = [
+ "memchr",
+ "thiserror",
+ "ucd-trie",
+]
+
+[[package]]
+name = "pest_derive"
+version = "2.7.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a2bee7be22ce7918f641a33f08e3f43388c7656772244e2bbb2477f44cc9021a"
+dependencies = [
+ "pest",
+ "pest_generator",
+]
+
+[[package]]
+name = "pest_generator"
+version = "2.7.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d1511785c5e98d79a05e8a6bc34b4ac2168a0e3e92161862030ad84daa223141"
+dependencies = [
+ "pest",
+ "pest_meta",
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "pest_meta"
+version = "2.7.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b42f0394d3123e33353ca5e1e89092e533d2cc490389f2bd6131c43c634ebc5f"
+dependencies = [
+ "once_cell",
+ "pest",
+ "sha2",
+]
+
+[[package]]
+name = "petgraph"
+version = "0.6.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e1d3afd2628e69da2be385eb6f2fd57c8ac7977ceeff6dc166ff1657b0e386a9"
+dependencies = [
+ "fixedbitset",
+ "indexmap 2.0.0",
+]
+
+[[package]]
+name = "phf_shared"
+version = "0.10.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b6796ad771acdc0123d2a88dc428b5e38ef24456743ddb1744ed628f9815c096"
+dependencies = [
+ "siphasher",
+]
+
+[[package]]
+name = "pin-project"
+version = "1.1.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "030ad2bc4db10a8944cb0d837f158bdfec4d4a4873ab701a95046770d11f8842"
+dependencies = [
+ "pin-project-internal",
+]
+
+[[package]]
+name = "pin-project-internal"
+version = "1.1.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ec2e072ecce94ec471b13398d5402c188e76ac03cf74dd1a975161b23a3f6d9c"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "pin-project-lite"
+version = "0.2.13"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8afb450f006bf6385ca15ef45d71d2288452bc3683ce2e2cacc0d18e4be60b58"
+
+[[package]]
+name = "pin-utils"
+version = "0.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184"
+
+[[package]]
+name = "pkg-config"
+version = "0.3.27"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "26072860ba924cbfa98ea39c8c19b4dd6a4a25423dbdf219c1eca91aa0cf6964"
+
+[[package]]
+name = "plain"
+version = "0.2.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b4596b6d070b27117e987119b4dac604f3c58cfb0b191112e24771b2faeac1a6"
+
+[[package]]
+name = "platforms"
+version = "3.3.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "626dec3cac7cc0e1577a2ec3fc496277ec2baa084bebad95bb6fdbfae235f84c"
+
+[[package]]
+name = "powerfmt"
+version = "0.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "439ee305def115ba05938db6eb1644ff94165c5ab5e9420d1c1bcedbba909391"
+
+[[package]]
+name = "ppv-lite86"
+version = "0.2.17"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5b40af805b3121feab8a3c29f04d8ad262fa8e0561883e7653e024ae4479e6de"
+
+[[package]]
+name = "precomputed-hash"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "925383efa346730478fb4838dbe9137d2a47675ad789c546d150a6e1dd4ab31c"
+
+[[package]]
+name = "prefix-sum-vec"
+version = "0.1.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "aa06bd51638b6e76ac9ba9b6afb4164fa647bd2916d722f2623fbb6d1ed8bdba"
+
+[[package]]
+name = "primitive-types"
+version = "0.10.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "05e4722c697a58a99d5d06a08c30821d7c082a4632198de1eaa5a6c22ef42373"
+dependencies = [
+ "fixed-hash",
+ "uint",
+]
+
+[[package]]
+name = "proc-macro-crate"
+version = "0.1.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1d6ea3c4595b96363c13943497db34af4460fb474a95c43f4446ad341b8c9785"
+dependencies = [
+ "toml",
+]
+
+[[package]]
+name = "proc-macro-crate"
+version = "3.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6d37c51ca738a55da99dc0c4a34860fd675453b8b36209178c2249bb13651284"
+dependencies = [
+ "toml_edit",
+]
+
+[[package]]
+name = "proc-macro-error"
+version = "1.0.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "da25490ff9892aab3fcf7c36f08cfb902dd3e71ca0f9f9517bea02a73a5ce38c"
+dependencies = [
+ "proc-macro-error-attr",
+ "proc-macro2",
+ "quote",
+ "syn 1.0.109",
+ "version_check",
+]
+
+[[package]]
+name = "proc-macro-error-attr"
+version = "1.0.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a1be40180e52ecc98ad80b184934baf3d0d29f979574e439af5a55274b35f869"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "version_check",
+]
+
+[[package]]
+name = "proc-macro2"
+version = "1.0.66"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "18fb31db3f9bddb2ea821cde30a9f70117e3f119938b5ee630b7403aa6e2ead9"
+dependencies = [
+ "unicode-ident",
+]
+
+[[package]]
+name = "prometheus"
+version = "0.13.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "449811d15fbdf5ceb5c1144416066429cf82316e2ec8ce0c1f6f8a02e7bbcf8c"
+dependencies = [
+ "cfg-if 1.0.0",
+ "fnv",
+ "lazy_static",
+ "memchr",
+ "parking_lot",
+ "protobuf",
+ "thiserror",
+]
+
+[[package]]
+name = "prost"
+version = "0.9.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "444879275cb4fd84958b1a1d5420d15e6fcf7c235fe47f053c9c2a80aceb6001"
+dependencies = [
+ "bytes",
+ "prost-derive",
+]
+
+[[package]]
+name = "prost-build"
+version = "0.9.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "62941722fb675d463659e49c4f3fe1fe792ff24fe5bbaa9c08cd3b98a1c354f5"
+dependencies = [
+ "bytes",
+ "heck 0.3.3",
+ "itertools",
+ "lazy_static",
+ "log",
+ "multimap",
+ "petgraph",
+ "prost",
+ "prost-types",
+ "regex",
+ "tempfile",
+ "which",
+]
+
+[[package]]
+name = "prost-derive"
+version = "0.9.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f9cc1a3263e07e0bf68e96268f37665207b49560d98739662cdfaae215c720fe"
+dependencies = [
+ "anyhow",
+ "itertools",
+ "proc-macro2",
+ "quote",
+ "syn 1.0.109",
+]
+
+[[package]]
+name = "prost-types"
+version = "0.9.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "534b7a0e836e3c482d2693070f982e39e7611da9695d4d1f5a4b186b51faef0a"
+dependencies = [
+ "bytes",
+ "prost",
+]
+
+[[package]]
+name = "protobuf"
+version = "2.28.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "106dd99e98437432fed6519dedecfade6a06a73bb7b2a1e019fdd2bee5778d94"
+
+[[package]]
+name = "quote"
+version = "1.0.32"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "50f3b39ccfb720540debaa0164757101c08ecb8d326b15358ce76a62c7e85965"
+dependencies = [
+ "proc-macro2",
+]
+
+[[package]]
+name = "radium"
+version = "0.7.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "dc33ff2d4973d518d823d61aa239014831e521c75da58e3df4840d3f47749d09"
+
+[[package]]
+name = "rand"
+version = "0.7.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6a6b1679d49b24bbfe0c803429aa1874472f50d9b363131f0e89fc356b544d03"
+dependencies = [
+ "getrandom 0.1.16",
+ "libc",
+ "rand_chacha 0.2.2",
+ "rand_core 0.5.1",
+ "rand_hc",
+]
+
+[[package]]
+name = "rand"
+version = "0.8.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "34af8d1a0e25924bc5b7c43c079c942339d8f0a8b57c39049bef581b46327404"
+dependencies = [
+ "libc",
+ "rand_chacha 0.3.1",
+ "rand_core 0.6.4",
+]
+
+[[package]]
+name = "rand_chacha"
+version = "0.2.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f4c8ed856279c9737206bf725bf36935d8666ead7aa69b52be55af369d193402"
+dependencies = [
+ "ppv-lite86",
+ "rand_core 0.5.1",
+]
+
+[[package]]
+name = "rand_chacha"
+version = "0.3.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e6c10a63a0fa32252be49d21e7709d4d4baf8d231c2dbce1eaa8141b9b127d88"
+dependencies = [
+ "ppv-lite86",
+ "rand_core 0.6.4",
+]
+
+[[package]]
+name = "rand_core"
+version = "0.5.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "90bde5296fc891b0cef12a6d03ddccc162ce7b2aff54160af9338f8d40df6d19"
+dependencies = [
+ "getrandom 0.1.16",
+]
+
+[[package]]
+name = "rand_core"
+version = "0.6.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ec0be4795e2f6a28069bec0b5ff3e2ac9bafc99e6a9a7dc3547996c5c816922c"
+dependencies = [
+ "getrandom 0.2.10",
+]
+
+[[package]]
+name = "rand_hc"
+version = "0.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ca3129af7b92a17112d59ad498c6f81eaf463253766b90396d39ea7a39d6613c"
+dependencies = [
+ "rand_core 0.5.1",
+]
+
+[[package]]
+name = "redox_syscall"
+version = "0.2.16"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "fb5a58c1855b4b6819d59012155603f0b22ad30cad752600aadfcb695265519a"
+dependencies = [
+ "bitflags 1.3.2",
+]
+
+[[package]]
+name = "redox_syscall"
+version = "0.3.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "567664f262709473930a4bf9e51bf2ebf3348f2e748ccc50dea20646858f8f29"
+dependencies = [
+ "bitflags 1.3.2",
+]
+
+[[package]]
+name = "redox_users"
+version = "0.4.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b033d837a7cf162d7993aded9304e30a83213c648b6e389db233191f891e5c2b"
+dependencies = [
+ "getrandom 0.2.10",
+ "redox_syscall 0.2.16",
+ "thiserror",
+]
+
+[[package]]
+name = "reed-solomon-erasure"
+version = "4.0.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a415a013dd7c5d4221382329a5a3482566da675737494935cbbbcdec04662f9d"
+dependencies = [
+ "smallvec",
+]
+
+[[package]]
+name = "regex"
+version = "1.9.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b2eae68fc220f7cf2532e4494aded17545fce192d59cd996e0fe7887f4ceb575"
+dependencies = [
+ "aho-corasick",
+ "memchr",
+ "regex-automata 0.3.4",
+ "regex-syntax 0.7.4",
+]
+
+[[package]]
+name = "regex-automata"
+version = "0.1.10"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6c230d73fb8d8c1b9c0b3135c5142a8acee3a0558fb8db5cf1cb65f8d7862132"
+dependencies = [
+ "regex-syntax 0.6.29",
+]
+
+[[package]]
+name = "regex-automata"
+version = "0.3.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b7b6d6190b7594385f61bd3911cd1be99dfddcfc365a4160cc2ab5bff4aed294"
+dependencies = [
+ "aho-corasick",
+ "memchr",
+ "regex-syntax 0.7.4",
+]
+
+[[package]]
+name = "regex-syntax"
+version = "0.6.29"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f162c6dd7b008981e4d40210aca20b4bd0f9b60ca9271061b07f78537722f2e1"
+
+[[package]]
+name = "regex-syntax"
+version = "0.7.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e5ea92a5b6195c6ef2a0295ea818b312502c6fc94dde986c5553242e18fd4ce2"
+
+[[package]]
+name = "reqwest"
+version = "0.11.18"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "cde824a14b7c14f85caff81225f411faacc04a2013f41670f41443742b1c1c55"
+dependencies = [
+ "base64 0.21.2",
+ "bytes",
+ "encoding_rs",
+ "futures-core",
+ "futures-util",
+ "h2",
+ "http",
+ "http-body",
+ "hyper",
+ "hyper-tls",
+ "ipnet",
+ "js-sys",
+ "log",
+ "mime",
+ "native-tls",
+ "once_cell",
+ "percent-encoding",
+ "pin-project-lite",
+ "serde",
+ "serde_json",
+ "serde_urlencoded",
+ "tokio",
+ "tokio-native-tls",
+ "tower-service",
+ "url",
+ "wasm-bindgen",
+ "wasm-bindgen-futures",
+ "web-sys",
+ "winreg",
+]
+
+[[package]]
+name = "ring"
+version = "0.17.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "688c63d65483050968b2a8937f7995f443e27041a0f7700aa59b0822aedebb74"
+dependencies = [
+ "cc",
+ "getrandom 0.2.10",
+ "libc",
+ "spin 0.9.8",
+ "untrusted",
+ "windows-sys 0.48.0",
+]
+
+[[package]]
+name = "ripemd"
+version = "0.1.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "bd124222d17ad93a644ed9d011a40f4fb64aa54275c08cc216524a9ea82fb09f"
+dependencies = [
+ "digest 0.10.7",
+]
+
+[[package]]
+name = "rustc-hex"
+version = "2.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3e75f6a532d0fd9f7f13144f392b6ad56a32696bfcd9c78f797f16bbb6f072d6"
+
+[[package]]
+name = "rustc_version"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "bfa0f585226d2e68097d4f95d113b15b83a82e819ab25717ec0590d9584ef366"
+dependencies = [
+ "semver",
+]
+
+[[package]]
+name = "rustix"
+version = "0.38.28"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "72e572a5e8ca657d7366229cdde4bd14c4eb5499a9573d4d366fe1b599daa316"
+dependencies = [
+ "bitflags 2.4.1",
+ "errno",
+ "libc",
+ "linux-raw-sys",
+ "windows-sys 0.52.0",
+]
+
+[[package]]
+name = "rustls"
+version = "0.21.10"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f9d5a6813c0759e4609cd494e8e725babae6a2ca7b62a5536a13daaec6fcb7ba"
+dependencies = [
+ "log",
+ "ring",
+ "rustls-webpki",
+ "sct",
+]
+
+[[package]]
+name = "rustls-webpki"
+version = "0.101.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8b6275d1ee7a1cd780b64aca7726599a1dbc893b1e64144529e55c3c2f745765"
+dependencies = [
+ "ring",
+ "untrusted",
+]
+
+[[package]]
+name = "rustversion"
+version = "1.0.14"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7ffc183a10b4478d04cbbbfc96d0873219d962dd5accaff2ffbd4ceb7df837f4"
+
+[[package]]
+name = "ryu"
+version = "1.0.15"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1ad4cc8da4ef723ed60bced201181d83791ad433213d8c24efffda1eec85d741"
+
+[[package]]
+name = "schannel"
+version = "0.1.22"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "0c3733bf4cf7ea0880754e19cb5a462007c4a8c1914bff372ccc95b464f1df88"
+dependencies = [
+ "windows-sys 0.48.0",
+]
+
+[[package]]
+name = "schemars"
+version = "0.8.15"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1f7b0ce13155372a76ee2e1c5ffba1fe61ede73fbea5630d61eee6fac4929c0c"
+dependencies = [
+ "dyn-clone",
+ "schemars_derive",
+ "serde",
+ "serde_json",
+]
+
+[[package]]
+name = "schemars_derive"
+version = "0.8.15"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e85e2a16b12bdb763244c69ab79363d71db2b4b918a2def53f80b02e0574b13c"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "serde_derive_internals",
+ "syn 1.0.109",
+]
+
+[[package]]
+name = "scopeguard"
+version = "1.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "94143f37725109f92c262ed2cf5e59bce7498c01bcc1502d7b9afe439a4e9f49"
+
+[[package]]
+name = "scroll"
+version = "0.10.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "fda28d4b4830b807a8b43f7b0e6b5df875311b3e7621d84577188c175b6ec1ec"
+
+[[package]]
+name = "scroll"
+version = "0.11.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "04c565b551bafbef4157586fa379538366e4385d42082f255bfd96e4fe8519da"
+dependencies = [
+ "scroll_derive",
+]
+
+[[package]]
+name = "scroll_derive"
+version = "0.11.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1db149f81d46d2deba7cd3c50772474707729550221e69588478ebf9ada425ae"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "sct"
+version = "0.7.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "da046153aa2352493d6cb7da4b6e5c0c057d8a1d0a9aa8560baffdd945acd414"
+dependencies = [
+ "ring",
+ "untrusted",
+]
+
+[[package]]
+name = "secp256k1"
+version = "0.27.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "25996b82292a7a57ed3508f052cfff8640d38d32018784acd714758b43da9c8f"
+dependencies = [
+ "rand 0.8.5",
+ "secp256k1-sys",
+]
+
+[[package]]
+name = "secp256k1-sys"
+version = "0.8.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "70a129b9e9efbfb223753b9163c4ab3b13cff7fd9c7f010fbac25ab4099fa07e"
+dependencies = [
+ "cc",
+]
+
+[[package]]
+name = "security-framework"
+version = "2.9.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "05b64fb303737d99b81884b2c63433e9ae28abebe5eb5045dcdd175dc2ecf4de"
+dependencies = [
+ "bitflags 1.3.2",
+ "core-foundation",
+ "core-foundation-sys",
+ "libc",
+ "security-framework-sys",
+]
+
+[[package]]
+name = "security-framework-sys"
+version = "2.9.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e932934257d3b408ed8f30db49d85ea163bfe74961f017f405b025af298f0c7a"
+dependencies = [
+ "core-foundation-sys",
+ "libc",
+]
+
+[[package]]
+name = "semver"
+version = "1.0.18"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b0293b4b29daaf487284529cc2f5675b8e57c61f70167ba415a463651fd6a918"
+dependencies = [
+ "serde",
+]
+
+[[package]]
+name = "serde"
+version = "1.0.193"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "25dd9975e68d0cb5aa1120c288333fc98731bd1dd12f561e468ea4728c042b89"
+dependencies = [
+ "serde_derive",
+]
+
+[[package]]
+name = "serde_derive"
+version = "1.0.193"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "43576ca501357b9b071ac53cdc7da8ef0cbd9493d8df094cd821777ea6e894d3"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "serde_derive_internals"
+version = "0.26.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "85bf8229e7920a9f636479437026331ce11aa132b4dde37d121944a44d6e5f3c"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 1.0.109",
+]
+
+[[package]]
+name = "serde_json"
+version = "1.0.104"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "076066c5f1078eac5b722a31827a8832fe108bed65dfa75e233c89f8206e976c"
+dependencies = [
+ "indexmap 2.0.0",
+ "itoa",
+ "ryu",
+ "serde",
+]
+
+[[package]]
+name = "serde_repr"
+version = "0.1.16"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8725e1dfadb3a50f7e5ce0b1a540466f6ed3fe7a0fca2ac2b8b831d31316bd00"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "serde_urlencoded"
+version = "0.7.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d3491c14715ca2294c4d6a88f15e84739788c1d030eed8c110436aafdaa2f3fd"
+dependencies = [
+ "form_urlencoded",
+ "itoa",
+ "ryu",
+ "serde",
+]
+
+[[package]]
+name = "serde_with"
+version = "3.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "64cd236ccc1b7a29e7e2739f27c0b2dd199804abc4290e32f59f3b68d6405c23"
+dependencies = [
+ "base64 0.21.2",
+ "chrono",
+ "hex",
+ "indexmap 1.9.3",
+ "indexmap 2.0.0",
+ "serde",
+ "serde_json",
+ "serde_with_macros",
+ "time",
+]
+
+[[package]]
+name = "serde_with_macros"
+version = "3.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "93634eb5f75a2323b16de4748022ac4297f9e76b6dced2be287a099f41b5e788"
+dependencies = [
+ "darling",
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "serde_yaml"
+version = "0.9.27"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3cc7a1570e38322cfe4154732e5110f887ea57e22b76f4bfd32b5bdd3368666c"
+dependencies = [
+ "indexmap 2.0.0",
+ "itoa",
+ "ryu",
+ "serde",
+ "unsafe-libyaml",
+]
+
+[[package]]
+name = "sha1"
+version = "0.10.6"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e3bf829a2d51ab4a5ddf1352d8470c140cadc8301b2ae1789db023f01cedd6ba"
+dependencies = [
+ "cfg-if 1.0.0",
+ "cpufeatures",
+ "digest 0.10.7",
+]
+
+[[package]]
+name = "sha2"
+version = "0.10.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "479fb9d862239e610720565ca91403019f2f00410f1864c5aa7479b950a76ed8"
+dependencies = [
+ "cfg-if 1.0.0",
+ "cpufeatures",
+ "digest 0.10.7",
+]
+
+[[package]]
+name = "sha3"
+version = "0.10.8"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "75872d278a8f37ef87fa0ddbda7802605cb18344497949862c0d4dcb291eba60"
+dependencies = [
+ "digest 0.10.7",
+ "keccak",
+]
+
+[[package]]
+name = "sharded-slab"
+version = "0.1.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f40ca3c46823713e0d4209592e8d6e826aa57e928f09752619fc696c499637f6"
+dependencies = [
+ "lazy_static",
+]
+
+[[package]]
+name = "signal-hook-registry"
+version = "1.4.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d8229b473baa5980ac72ef434c4415e70c4b5e71b423043adb4ba059f89c99a1"
+dependencies = [
+ "libc",
+]
+
+[[package]]
+name = "signature"
+version = "2.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "77549399552de45a898a580c1b41d445bf730df867cc44e6c0233bbc4b8329de"
+
+[[package]]
+name = "similar"
+version = "2.2.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "420acb44afdae038210c99e69aae24109f32f15500aa708e81d46c9f29d55fcf"
+
+[[package]]
+name = "siphasher"
+version = "0.3.11"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "38b58827f4464d87d377d175e90bf58eb00fd8716ff0a62f80356b5e61555d0d"
+
+[[package]]
+name = "slab"
+version = "0.4.8"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6528351c9bc8ab22353f9d776db39a20288e8d6c37ef8cfe3317cf875eecfc2d"
+dependencies = [
+ "autocfg",
+]
+
+[[package]]
+name = "smallvec"
+version = "1.11.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "62bb4feee49fdd9f707ef802e22365a35de4b7b299de4763d44bfea899442ff9"
+
+[[package]]
+name = "smart-default"
+version = "0.6.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "133659a15339456eeeb07572eb02a91c91e9815e9cbc89566944d2c8d3efdbf6"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 1.0.109",
+]
+
+[[package]]
+name = "socket2"
+version = "0.4.9"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "64a4a911eed85daf18834cfaa86a79b7d266ff93ff5ba14005426219480ed662"
+dependencies = [
+ "libc",
+ "winapi",
+]
+
+[[package]]
+name = "spin"
+version = "0.5.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6e63cff320ae2c57904679ba7cb63280a3dc4613885beafb148ee7bf9aa9042d"
+
+[[package]]
+name = "spin"
+version = "0.9.8"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6980e8d7511241f8acf4aebddbb1ff938df5eebe98691418c4468d0b72a96a67"
+
+[[package]]
+name = "stable_deref_trait"
+version = "1.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a8f112729512f8e442d81f95a8a7ddf2b7c6b8a1a6f509a95864142b30cab2d3"
+
+[[package]]
+name = "static_assertions"
+version = "1.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a2eb9349b6444b326872e140eb1cf5e7c522154d69e7a0ffb0fb81c06b37543f"
+
+[[package]]
+name = "string_cache"
+version = "0.8.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f91138e76242f575eb1d3b38b4f1362f10d3a43f47d182a5b359af488a02293b"
+dependencies = [
+ "new_debug_unreachable",
+ "once_cell",
+ "parking_lot",
+ "phf_shared",
+ "precomputed-hash",
+ "serde",
+]
+
+[[package]]
+name = "strsim"
+version = "0.10.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "73473c0e59e6d5812c5dfe2a064a6444949f089e20eec9a2e5506596494e4623"
+
+[[package]]
+name = "strum"
+version = "0.24.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "063e6045c0e62079840579a7e47a355ae92f60eb74daaf156fb1e84ba164e63f"
+dependencies = [
+ "strum_macros 0.24.3",
+]
+
+[[package]]
+name = "strum"
+version = "0.26.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "723b93e8addf9aa965ebe2d11da6d7540fa2283fcea14b3371ff055f7ba13f5f"
+
+[[package]]
+name = "strum_macros"
+version = "0.24.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1e385be0d24f186b4ce2f9982191e7101bb737312ad61c1f2f984f34bcf85d59"
+dependencies = [
+ "heck 0.4.1",
+ "proc-macro2",
+ "quote",
+ "rustversion",
+ "syn 1.0.109",
+]
+
+[[package]]
+name = "strum_macros"
+version = "0.26.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7a3417fc93d76740d974a01654a09777cb500428cc874ca9f45edfe0c4d4cd18"
+dependencies = [
+ "heck 0.4.1",
+ "proc-macro2",
+ "quote",
+ "rustversion",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "subtle"
+version = "2.5.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "81cdd64d312baedb58e21336b31bc043b77e01cc99033ce76ef539f78e965ebc"
+
+[[package]]
+name = "symbolic-common"
+version = "8.8.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f551f902d5642e58039aee6a9021a61037926af96e071816361644983966f540"
+dependencies = [
+ "debugid",
+ "memmap2",
+ "stable_deref_trait",
+ "uuid",
+]
+
+[[package]]
+name = "symbolic-debuginfo"
+version = "8.8.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1165dabf9fc1d6bb6819c2c0e27c8dd0e3068d2c53cf186d319788e96517f0d6"
+dependencies = [
+ "bitvec",
+ "dmsort",
+ "elementtree",
+ "fallible-iterator",
+ "flate2",
+ "gimli",
+ "goblin",
+ "lazy_static",
+ "lazycell",
+ "nom",
+ "nom-supreme",
+ "parking_lot",
+ "pdb",
+ "regex",
+ "scroll 0.11.0",
+ "serde",
+ "serde_json",
+ "smallvec",
+ "symbolic-common",
+ "thiserror",
+ "wasmparser",
+ "zip 0.5.13",
+]
+
+[[package]]
+name = "syn"
+version = "1.0.109"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "72b64191b275b66ffe2469e8af2c1cfe3bafa67b529ead792a6d0160888b4237"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "unicode-ident",
+]
+
+[[package]]
+name = "syn"
+version = "2.0.28"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "04361975b3f5e348b2189d8dc55bc942f278b2d482a6a0365de5bdd62d351567"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "unicode-ident",
+]
+
+[[package]]
+name = "syn_derive"
+version = "0.1.8"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1329189c02ff984e9736652b1631330da25eaa6bc639089ed4915d25446cbe7b"
+dependencies = [
+ "proc-macro-error",
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "tap"
+version = "1.0.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "55937e1799185b12863d447f42597ed69d9928686b8d88a1df17376a097d8369"
+
+[[package]]
+name = "tar"
+version = "0.4.39"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ec96d2ffad078296368d46ff1cb309be1c23c513b4ab0e22a45de0185275ac96"
+dependencies = [
+ "filetime",
+ "libc",
+ "xattr",
+]
+
+[[package]]
+name = "tempfile"
+version = "3.7.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5486094ee78b2e5038a6382ed7645bc084dc2ec433426ca4c3cb61e2007b8998"
+dependencies = [
+ "cfg-if 1.0.0",
+ "fastrand",
+ "redox_syscall 0.3.5",
+ "rustix",
+ "windows-sys 0.48.0",
+]
+
+[[package]]
+name = "termcolor"
+version = "1.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ff1bc3d3f05aff0403e8ac0d92ced918ec05b666a43f83297ccef5bea8a3d449"
+dependencies = [
+ "winapi-util",
+]
+
+[[package]]
+name = "textwrap"
+version = "0.16.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "222a222a5bfe1bba4a77b45ec488a741b3cb8872e5e499451fd7d0129c9c7c3d"
+
+[[package]]
+name = "thiserror"
+version = "1.0.44"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "611040a08a0439f8248d1990b111c95baa9c704c805fa1f62104b39655fd7f90"
+dependencies = [
+ "thiserror-impl",
+]
+
+[[package]]
+name = "thiserror-impl"
+version = "1.0.44"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "090198534930841fab3a5d1bb637cde49e339654e606195f8d9c76eeb081dc96"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "thread_local"
+version = "1.1.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3fdd6f064ccff2d6567adcb3873ca630700f00b5ad3f060c25b5dcfd9a4ce152"
+dependencies = [
+ "cfg-if 1.0.0",
+ "once_cell",
+]
+
+[[package]]
+name = "time"
+version = "0.3.30"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c4a34ab300f2dee6e562c10a046fc05e358b29f9bf92277f30c3c8d82275f6f5"
+dependencies = [
+ "deranged",
+ "itoa",
+ "powerfmt",
+ "serde",
+ "time-core",
+ "time-macros",
+]
+
+[[package]]
+name = "time-core"
+version = "0.1.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ef927ca75afb808a4d64dd374f00a2adf8d0fcff8e7b184af886c3c87ec4a3f3"
+
+[[package]]
+name = "time-macros"
+version = "0.2.15"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "4ad70d68dba9e1f8aceda7aa6711965dfec1cac869f311a51bd08b3a2ccbce20"
+dependencies = [
+ "time-core",
+]
+
+[[package]]
+name = "tinyvec"
+version = "1.6.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "87cc5ceb3875bb20c2890005a4e226a4651264a5c75edb2421b52861a0a0cb50"
+dependencies = [
+ "tinyvec_macros",
+]
+
+[[package]]
+name = "tinyvec_macros"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1f3ccbac311fea05f86f61904b462b55fb3df8837a366dfc601a0161d0532f20"
+
+[[package]]
+name = "tokio"
+version = "1.28.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "94d7b1cfd2aa4011f2de74c2c4c63665e27a71006b0a192dcd2710272e73dfa2"
+dependencies = [
+ "autocfg",
+ "bytes",
+ "libc",
+ "mio",
+ "num_cpus",
+ "parking_lot",
+ "pin-project-lite",
+ "signal-hook-registry",
+ "socket2",
+ "tokio-macros",
+ "windows-sys 0.48.0",
+]
+
+[[package]]
+name = "tokio-io-timeout"
+version = "1.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "30b74022ada614a1b4834de765f9bb43877f910cc8ce4be40e89042c9223a8bf"
+dependencies = [
+ "pin-project-lite",
+ "tokio",
+]
+
+[[package]]
+name = "tokio-macros"
+version = "2.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "630bdcf245f78637c13ec01ffae6187cca34625e8c63150d424b59e55af2675e"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "tokio-native-tls"
+version = "0.3.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "bbae76ab933c85776efabc971569dd6119c580d8f5d448769dec1764bf796ef2"
+dependencies = [
+ "native-tls",
+ "tokio",
+]
+
+[[package]]
+name = "tokio-retry"
+version = "0.3.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7f57eb36ecbe0fc510036adff84824dd3c24bb781e21bfa67b69d556aa85214f"
+dependencies = [
+ "pin-project",
+ "rand 0.8.5",
+ "tokio",
+]
+
+[[package]]
+name = "tokio-stream"
+version = "0.1.14"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "397c988d37662c7dda6d2208364a706264bf3d6138b11d436cbac0ad38832842"
+dependencies = [
+ "futures-core",
+ "pin-project-lite",
+ "tokio",
+]
+
+[[package]]
+name = "tokio-util"
+version = "0.6.10"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "36943ee01a6d67977dd3f84a5a1d2efeb4ada3a1ae771cadfaa535d9d9fc6507"
+dependencies = [
+ "bytes",
+ "futures-core",
+ "futures-sink",
+ "log",
+ "pin-project-lite",
+ "tokio",
+]
+
+[[package]]
+name = "tokio-util"
+version = "0.7.8"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "806fe8c2c87eccc8b3267cbae29ed3ab2d0bd37fca70ab622e46aaa9375ddb7d"
+dependencies = [
+ "bytes",
+ "futures-core",
+ "futures-sink",
+ "pin-project-lite",
+ "tokio",
+ "tracing",
+]
+
+[[package]]
+name = "toml"
+version = "0.5.11"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f4f7f0dd8d50a853a531c426359045b1998f04219d88799810762cd4ad314234"
+dependencies = [
+ "serde",
+]
+
+[[package]]
+name = "toml_datetime"
+version = "0.6.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3550f4e9685620ac18a50ed434eb3aec30db8ba93b0287467bca5826ea25baf1"
+
+[[package]]
+name = "toml_edit"
+version = "0.21.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6a8534fd7f78b5405e860340ad6575217ce99f38d4d5c8f2442cb5ecb50090e1"
+dependencies = [
+ "indexmap 2.0.0",
+ "toml_datetime",
+ "winnow",
+]
+
+[[package]]
+name = "tonic"
+version = "0.6.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ff08f4649d10a70ffa3522ca559031285d8e421d727ac85c60825761818f5d0a"
+dependencies = [
+ "async-stream",
+ "async-trait",
+ "base64 0.13.1",
+ "bytes",
+ "futures-core",
+ "futures-util",
+ "h2",
+ "http",
+ "http-body",
+ "hyper",
+ "hyper-timeout",
+ "percent-encoding",
+ "pin-project",
+ "prost",
+ "prost-derive",
+ "tokio",
+ "tokio-stream",
+ "tokio-util 0.6.10",
+ "tower",
+ "tower-layer",
+ "tower-service",
+ "tracing",
+ "tracing-futures",
+]
+
+[[package]]
+name = "tonic-build"
+version = "0.6.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "9403f1bafde247186684b230dc6f38b5cd514584e8bec1dd32514be4745fa757"
+dependencies = [
+ "proc-macro2",
+ "prost-build",
+ "quote",
+ "syn 1.0.109",
+]
+
+[[package]]
+name = "tower"
+version = "0.4.13"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b8fa9be0de6cf49e536ce1851f987bd21a43b771b09473c3549a6c853db37c1c"
+dependencies = [
+ "futures-core",
+ "futures-util",
+ "indexmap 1.9.3",
+ "pin-project",
+ "pin-project-lite",
+ "rand 0.8.5",
+ "slab",
+ "tokio",
+ "tokio-util 0.7.8",
+ "tower-layer",
+ "tower-service",
+ "tracing",
+]
+
+[[package]]
+name = "tower-layer"
+version = "0.3.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c20c8dbed6283a09604c3e69b4b7eeb54e298b8a600d4d5ecb5ad39de609f1d0"
+
+[[package]]
+name = "tower-service"
+version = "0.3.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b6bc1c9ce2b5135ac7f93c72918fc37feb872bdc6a5533a8b85eb4b86bfdae52"
+
+[[package]]
+name = "tracing"
+version = "0.1.37"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8ce8c33a8d48bd45d624a6e523445fd21ec13d3653cd51f681abf67418f54eb8"
+dependencies = [
+ "cfg-if 1.0.0",
+ "log",
+ "pin-project-lite",
+ "tracing-attributes",
+ "tracing-core",
+]
+
+[[package]]
+name = "tracing-appender"
+version = "0.2.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3566e8ce28cc0a3fe42519fc80e6b4c943cc4c8cef275620eb8dac2d3d4e06cf"
+dependencies = [
+ "crossbeam-channel",
+ "thiserror",
+ "time",
+ "tracing-subscriber",
+]
+
+[[package]]
+name = "tracing-attributes"
+version = "0.1.26"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5f4f31f56159e98206da9efd823404b79b6ef3143b4a7ab76e67b1751b25a4ab"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+]
+
+[[package]]
+name = "tracing-core"
+version = "0.1.31"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "0955b8137a1df6f1a2e9a37d8a6656291ff0297c1a97c24e0d8425fe2312f79a"
+dependencies = [
+ "once_cell",
+ "valuable",
+]
+
+[[package]]
+name = "tracing-futures"
+version = "0.2.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "97d095ae15e245a057c8e8451bab9b3ee1e1f68e9ba2b4fbc18d0ac5237835f2"
+dependencies = [
+ "pin-project",
+ "tracing",
+]
+
+[[package]]
+name = "tracing-log"
+version = "0.1.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f751112709b4e791d8ce53e32c4ed2d353565a795ce84da2285393f41557bdf2"
+dependencies = [
+ "log",
+ "once_cell",
+ "tracing-core",
+]
+
+[[package]]
+name = "tracing-log"
+version = "0.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ee855f1f400bd0e5c02d150ae5de3840039a3f54b025156404e34c23c03f47c3"
+dependencies = [
+ "log",
+ "once_cell",
+ "tracing-core",
+]
+
+[[package]]
+name = "tracing-opentelemetry"
+version = "0.17.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "fbbe89715c1dbbb790059e2565353978564924ee85017b5fff365c872ff6721f"
+dependencies = [
+ "once_cell",
+ "opentelemetry",
+ "tracing",
+ "tracing-core",
+ "tracing-log 0.1.4",
+ "tracing-subscriber",
+]
+
+[[package]]
+name = "tracing-subscriber"
+version = "0.3.18"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ad0f048c97dbd9faa9b7df56362b8ebcaa52adb06b498c050d2f4e32f90a7a8b"
+dependencies = [
+ "matchers",
+ "nu-ansi-term",
+ "once_cell",
+ "regex",
+ "sharded-slab",
+ "smallvec",
+ "thread_local",
+ "tracing",
+ "tracing-core",
+ "tracing-log 0.2.0",
+]
+
+[[package]]
+name = "treediff"
+version = "4.0.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "52984d277bdf2a751072b5df30ec0377febdb02f7696d64c2d7d54630bac4303"
+dependencies = [
+ "serde_json",
+]
+
+[[package]]
+name = "try-lock"
+version = "0.2.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3528ecfd12c466c6f163363caf2d02a71161dd5e1cc6ae7b34207ea2d42d81ed"
+
+[[package]]
+name = "typenum"
+version = "1.16.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "497961ef93d974e23eb6f433eb5fe1b7930b659f06d12dec6fc44a8f554c0bba"
+
+[[package]]
+name = "ucd-trie"
+version = "0.1.6"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ed646292ffc8188ef8ea4d1e0e0150fb15a5c2e12ad9b8fc191ae7a8a7f3c4b9"
+
+[[package]]
+name = "uint"
+version = "0.9.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "76f64bba2c53b04fcab63c01a7d7427eadc821e3bc48c34dc9ba29c501164b52"
+dependencies = [
+ "byteorder",
+ "crunchy",
+ "hex",
+ "static_assertions",
+]
+
+[[package]]
+name = "unicode-bidi"
+version = "0.3.13"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "92888ba5573ff080736b3648696b70cafad7d250551175acbaa4e0385b3e1460"
+
+[[package]]
+name = "unicode-ident"
+version = "1.0.11"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "301abaae475aa91687eb82514b328ab47a211a533026cb25fc3e519b86adfc3c"
+
+[[package]]
+name = "unicode-normalization"
+version = "0.1.22"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5c5713f0fc4b5db668a2ac63cdb7bb4469d8c9fed047b1d0292cc7b0ce2ba921"
+dependencies = [
+ "tinyvec",
+]
+
+[[package]]
+name = "unicode-segmentation"
+version = "1.10.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1dd624098567895118886609431a7c3b8f516e41d30e0643f03d94592a147e36"
+
+[[package]]
+name = "unsafe-libyaml"
+version = "0.2.10"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ab4c90930b95a82d00dc9e9ac071b4991924390d46cbd0dfe566148667605e4b"
+
+[[package]]
+name = "untrusted"
+version = "0.9.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8ecb6da28b8a351d773b68d5825ac39017e680750f980f3a1a85cd8dd28a47c1"
+
+[[package]]
+name = "ureq"
+version = "2.9.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f8cdd25c339e200129fe4de81451814e5228c9b771d57378817d6117cc2b3f97"
+dependencies = [
+ "base64 0.21.2",
+ "flate2",
+ "log",
+ "once_cell",
+ "rustls",
+ "rustls-webpki",
+ "url",
+ "webpki-roots",
+]
+
+[[package]]
+name = "url"
+version = "2.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "50bff7831e19200a85b17131d085c25d7811bc4e186efdaf54bbd132994a88cb"
+dependencies = [
+ "form_urlencoded",
+ "idna",
+ "percent-encoding",
+ "serde",
+]
+
+[[package]]
+name = "utf8-width"
+version = "0.1.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "86bd8d4e895da8537e5315b8254664e6b769c4ff3db18321b297a1e7004392e3"
+
+[[package]]
+name = "utf8parse"
+version = "0.2.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "711b9620af191e0cdc7468a8d14e709c3dcdb115b36f838e601583af800a370a"
+
+[[package]]
+name = "uuid"
+version = "0.8.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "bc5cf98d8186244414c848017f0e2676b3fcb46807f6668a97dfe67359a3c4b7"
+
+[[package]]
+name = "valuable"
+version = "0.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "830b7e5d4d90034032940e4ace0d9a9a057e7a45cd94e6c007832e39edb82f6d"
+
+[[package]]
+name = "vcpkg"
+version = "0.2.15"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "accd4ea62f7bb7a82fe23066fb0957d48ef677f6eeb8215f372f52e48bb32426"
+
+[[package]]
+name = "version_check"
+version = "0.9.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "49874b5167b65d7193b8aba1567f5c7d93d001cafc34600cee003eda787e483f"
+
+[[package]]
+name = "want"
+version = "0.3.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "bfa7760aed19e106de2c7c0b581b509f2f25d3dacaf737cb82ac61bc6d760b0e"
+dependencies = [
+ "try-lock",
+]
+
+[[package]]
+name = "wasi"
+version = "0.9.0+wasi-snapshot-preview1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "cccddf32554fecc6acb585f82a32a72e28b48f8c4c1883ddfeeeaa96f7d8e519"
+
+[[package]]
+name = "wasi"
+version = "0.11.0+wasi-snapshot-preview1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "9c8d87e72b64a3b4db28d11ce29237c246188f4f51057d65a7eab63b7987e423"
+
+[[package]]
+name = "wasm-bindgen"
+version = "0.2.87"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7706a72ab36d8cb1f80ffbf0e071533974a60d0a308d01a5d0375bf60499a342"
+dependencies = [
+ "cfg-if 1.0.0",
+ "wasm-bindgen-macro",
+]
+
+[[package]]
+name = "wasm-bindgen-backend"
+version = "0.2.87"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5ef2b6d3c510e9625e5fe6f509ab07d66a760f0885d858736483c32ed7809abd"
+dependencies = [
+ "bumpalo",
+ "log",
+ "once_cell",
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+ "wasm-bindgen-shared",
+]
+
+[[package]]
+name = "wasm-bindgen-futures"
+version = "0.4.37"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c02dbc21516f9f1f04f187958890d7e6026df8d16540b7ad9492bc34a67cea03"
+dependencies = [
+ "cfg-if 1.0.0",
+ "js-sys",
+ "wasm-bindgen",
+ "web-sys",
+]
+
+[[package]]
+name = "wasm-bindgen-macro"
+version = "0.2.87"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "dee495e55982a3bd48105a7b947fd2a9b4a8ae3010041b9e0faab3f9cd028f1d"
+dependencies = [
+ "quote",
+ "wasm-bindgen-macro-support",
+]
+
+[[package]]
+name = "wasm-bindgen-macro-support"
+version = "0.2.87"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "54681b18a46765f095758388f2d0cf16eb8d4169b639ab575a8f5693af210c7b"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 2.0.28",
+ "wasm-bindgen-backend",
+ "wasm-bindgen-shared",
+]
+
+[[package]]
+name = "wasm-bindgen-shared"
+version = "0.2.87"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ca6ad05a4870b2bf5fe995117d3728437bd27d7cd5f06f13c17443ef369775a1"
+
+[[package]]
+name = "wasmparser"
+version = "0.83.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "718ed7c55c2add6548cca3ddd6383d738cd73b892df400e96b9aa876f0141d7a"
+
+[[package]]
+name = "web-sys"
+version = "0.3.64"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "9b85cbef8c220a6abc02aefd892dfc0fc23afb1c6a426316ec33253a3877249b"
+dependencies = [
+ "js-sys",
+ "wasm-bindgen",
+]
+
+[[package]]
+name = "webpki-roots"
+version = "0.25.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1778a42e8b3b90bff8d0f5032bf22250792889a5cdc752aa0020c84abe3aaf10"
+
+[[package]]
+name = "wee_alloc"
+version = "0.4.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "dbb3b5a6b2bb17cb6ad44a2e68a43e8d2722c997da10e928665c72ec6c0a0b8e"
+dependencies = [
+ "cfg-if 0.1.10",
+ "libc",
+ "memory_units",
+ "winapi",
+]
+
+[[package]]
+name = "which"
+version = "4.4.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "87ba24419a2078cd2b0f2ede2691b6c66d8e47836da3b6db8265ebad47afbfc7"
+dependencies = [
+ "either",
+ "home",
+ "once_cell",
+ "rustix",
+]
+
+[[package]]
+name = "winapi"
+version = "0.3.9"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5c839a674fcd7a98952e593242ea400abe93992746761e38641405d28b00f419"
+dependencies = [
+ "winapi-i686-pc-windows-gnu",
+ "winapi-x86_64-pc-windows-gnu",
+]
+
+[[package]]
+name = "winapi-i686-pc-windows-gnu"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ac3b87c63620426dd9b991e5ce0329eff545bccbbb34f3be09ff6fb6ab51b7b6"
+
+[[package]]
+name = "winapi-util"
+version = "0.1.6"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f29e6f9198ba0d26b4c9f07dbe6f9ed633e1f3d5b8b414090084349e46a52596"
+dependencies = [
+ "winapi",
+]
+
+[[package]]
+name = "winapi-x86_64-pc-windows-gnu"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "712e227841d057c1ee1cd2fb22fa7e5a5461ae8e48fa2ca79ec42cfc1931183f"
+
+[[package]]
+name = "windows"
+version = "0.48.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e686886bc078bc1b0b600cac0147aadb815089b6e4da64016cbd754b6342700f"
+dependencies = [
+ "windows-targets 0.48.1",
+]
+
+[[package]]
+name = "windows-sys"
+version = "0.45.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "75283be5efb2831d37ea142365f009c02ec203cd29a3ebecbc093d52315b66d0"
+dependencies = [
+ "windows-targets 0.42.2",
+]
+
+[[package]]
+name = "windows-sys"
+version = "0.48.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "677d2418bec65e3338edb076e806bc1ec15693c5d0104683f2efe857f61056a9"
+dependencies = [
+ "windows-targets 0.48.1",
+]
+
+[[package]]
+name = "windows-sys"
+version = "0.52.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "282be5f36a8ce781fad8c8ae18fa3f9beff57ec1b52cb3de0789201425d9a33d"
+dependencies = [
+ "windows-targets 0.52.0",
+]
+
+[[package]]
+name = "windows-targets"
+version = "0.42.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8e5180c00cd44c9b1c88adb3693291f1cd93605ded80c250a75d472756b4d071"
+dependencies = [
+ "windows_aarch64_gnullvm 0.42.2",
+ "windows_aarch64_msvc 0.42.2",
+ "windows_i686_gnu 0.42.2",
+ "windows_i686_msvc 0.42.2",
+ "windows_x86_64_gnu 0.42.2",
+ "windows_x86_64_gnullvm 0.42.2",
+ "windows_x86_64_msvc 0.42.2",
+]
+
+[[package]]
+name = "windows-targets"
+version = "0.48.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "05d4b17490f70499f20b9e791dcf6a299785ce8af4d709018206dc5b4953e95f"
+dependencies = [
+ "windows_aarch64_gnullvm 0.48.0",
+ "windows_aarch64_msvc 0.48.0",
+ "windows_i686_gnu 0.48.0",
+ "windows_i686_msvc 0.48.0",
+ "windows_x86_64_gnu 0.48.0",
+ "windows_x86_64_gnullvm 0.48.0",
+ "windows_x86_64_msvc 0.48.0",
+]
+
+[[package]]
+name = "windows-targets"
+version = "0.52.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8a18201040b24831fbb9e4eb208f8892e1f50a37feb53cc7ff887feb8f50e7cd"
+dependencies = [
+ "windows_aarch64_gnullvm 0.52.0",
+ "windows_aarch64_msvc 0.52.0",
+ "windows_i686_gnu 0.52.0",
+ "windows_i686_msvc 0.52.0",
+ "windows_x86_64_gnu 0.52.0",
+ "windows_x86_64_gnullvm 0.52.0",
+ "windows_x86_64_msvc 0.52.0",
+]
+
+[[package]]
+name = "windows_aarch64_gnullvm"
+version = "0.42.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "597a5118570b68bc08d8d59125332c54f1ba9d9adeedeef5b99b02ba2b0698f8"
+
+[[package]]
+name = "windows_aarch64_gnullvm"
+version = "0.48.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "91ae572e1b79dba883e0d315474df7305d12f569b400fcf90581b06062f7e1bc"
+
+[[package]]
+name = "windows_aarch64_gnullvm"
+version = "0.52.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "cb7764e35d4db8a7921e09562a0304bf2f93e0a51bfccee0bd0bb0b666b015ea"
+
+[[package]]
+name = "windows_aarch64_msvc"
+version = "0.42.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e08e8864a60f06ef0d0ff4ba04124db8b0fb3be5776a5cd47641e942e58c4d43"
+
+[[package]]
+name = "windows_aarch64_msvc"
+version = "0.48.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b2ef27e0d7bdfcfc7b868b317c1d32c641a6fe4629c171b8928c7b08d98d7cf3"
+
+[[package]]
+name = "windows_aarch64_msvc"
+version = "0.52.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "bbaa0368d4f1d2aaefc55b6fcfee13f41544ddf36801e793edbbfd7d7df075ef"
+
+[[package]]
+name = "windows_i686_gnu"
+version = "0.42.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c61d927d8da41da96a81f029489353e68739737d3beca43145c8afec9a31a84f"
+
+[[package]]
+name = "windows_i686_gnu"
+version = "0.48.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "622a1962a7db830d6fd0a69683c80a18fda201879f0f447f065a3b7467daa241"
+
+[[package]]
+name = "windows_i686_gnu"
+version = "0.52.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a28637cb1fa3560a16915793afb20081aba2c92ee8af57b4d5f28e4b3e7df313"
+
+[[package]]
+name = "windows_i686_msvc"
+version = "0.42.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "44d840b6ec649f480a41c8d80f9c65108b92d89345dd94027bfe06ac444d1060"
+
+[[package]]
+name = "windows_i686_msvc"
+version = "0.48.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "4542c6e364ce21bf45d69fdd2a8e455fa38d316158cfd43b3ac1c5b1b19f8e00"
+
+[[package]]
+name = "windows_i686_msvc"
+version = "0.52.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ffe5e8e31046ce6230cc7215707b816e339ff4d4d67c65dffa206fd0f7aa7b9a"
+
+[[package]]
+name = "windows_x86_64_gnu"
+version = "0.42.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8de912b8b8feb55c064867cf047dda097f92d51efad5b491dfb98f6bbb70cb36"
+
+[[package]]
+name = "windows_x86_64_gnu"
+version = "0.48.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ca2b8a661f7628cbd23440e50b05d705db3686f894fc9580820623656af974b1"
+
+[[package]]
+name = "windows_x86_64_gnu"
+version = "0.52.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3d6fa32db2bc4a2f5abeacf2b69f7992cd09dca97498da74a151a3132c26befd"
+
+[[package]]
+name = "windows_x86_64_gnullvm"
+version = "0.42.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "26d41b46a36d453748aedef1486d5c7a85db22e56aff34643984ea85514e94a3"
+
+[[package]]
+name = "windows_x86_64_gnullvm"
+version = "0.48.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7896dbc1f41e08872e9d5e8f8baa8fdd2677f29468c4e156210174edc7f7b953"
+
+[[package]]
+name = "windows_x86_64_gnullvm"
+version = "0.52.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1a657e1e9d3f514745a572a6846d3c7aa7dbe1658c056ed9c3344c4109a6949e"
+
+[[package]]
+name = "windows_x86_64_msvc"
+version = "0.42.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "9aec5da331524158c6d1a4ac0ab1541149c0b9505fde06423b02f5ef0106b9f0"
+
+[[package]]
+name = "windows_x86_64_msvc"
+version = "0.48.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1a515f5799fe4961cb532f983ce2b23082366b898e52ffbce459c86f67c8378a"
+
+[[package]]
+name = "windows_x86_64_msvc"
+version = "0.52.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "dff9641d1cd4be8d1a070daf9e3773c5f67e78b4d9d42263020c057706765c04"
+
+[[package]]
+name = "winnow"
+version = "0.5.15"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7c2e3184b9c4e92ad5167ca73039d0c42476302ab603e2fec4487511f38ccefc"
+dependencies = [
+ "memchr",
+]
+
+[[package]]
+name = "winreg"
+version = "0.10.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "80d0f4e272c85def139476380b12f9ac60926689dd2e01d4923222f40580869d"
+dependencies = [
+ "winapi",
+]
+
+[[package]]
+name = "wyz"
+version = "0.5.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "05f360fc0b24296329c78fda852a1e9ae82de9cf7b27dae4b7f62f118f77b9ed"
+dependencies = [
+ "tap",
+]
+
+[[package]]
+name = "xattr"
+version = "0.2.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6d1526bbe5aaeb5eb06885f4d987bcdfa5e23187055de9b83fe00156a821fabc"
+dependencies = [
+ "libc",
+]
+
+[[package]]
+name = "xml-rs"
+version = "0.8.19"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "0fcb9cbac069e033553e8bb871be2fbdffcab578eb25bd0f7c508cedc6dcd75a"
+
+[[package]]
+name = "yaml-rust"
+version = "0.4.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "56c1936c4cc7a1c9ab21a1ebb602eb942ba868cbd44a99cb7cdc5892335e1c85"
+dependencies = [
+ "linked-hash-map",
+]
+
+[[package]]
+name = "zeroize"
+version = "1.3.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "4756f7db3f7b5574938c3eb1c117038b8e07f95ee6718c0efad4ac21508f1efd"
+
+[[package]]
+name = "zeropool-bn"
+version = "0.5.11"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "71e61de68ede9ffdd69c01664f65a178c5188b73f78faa21f0936016a888ff7c"
+dependencies = [
+ "byteorder",
+ "crunchy",
+ "lazy_static",
+ "rand 0.8.5",
+ "rustc-hex",
+]
+
+[[package]]
+name = "zip"
+version = "0.5.13"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "93ab48844d61251bb3835145c521d88aa4031d7139e8485990f60ca911fa0815"
+dependencies = [
+ "byteorder",
+ "crc32fast",
+ "flate2",
+ "thiserror",
+]
+
+[[package]]
+name = "zip"
+version = "0.6.6"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "760394e246e4c28189f19d488c058bf16f564016aefac5d32bb1f3b51d5e9261"
+dependencies = [
+ "aes",
+ "byteorder",
+ "bzip2",
+ "constant_time_eq",
+ "crc32fast",
+ "crossbeam-utils",
+ "flate2",
+ "hmac",
+ "pbkdf2",
+ "sha1",
+ "time",
+ "zstd",
+]
+
+[[package]]
+name = "zstd"
+version = "0.11.2+zstd.1.5.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "20cc960326ece64f010d2d2107537f26dc589a6573a316bd5b1dba685fa5fde4"
+dependencies = [
+ "zstd-safe",
+]
+
+[[package]]
+name = "zstd-safe"
+version = "5.0.2+zstd.1.5.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1d2a5585e04f9eea4b2a3d1eca508c4dee9592a89ef6f450c11719da0726f4db"
+dependencies = [
+ "libc",
+ "zstd-sys",
+]
+
+[[package]]
+name = "zstd-sys"
+version = "2.0.9+zstd.1.5.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "9e16efa8a874a0481a574084d34cc26fdb3b99627480f785888deb6386506656"
+dependencies = [
+ "cc",
+ "pkg-config",
+]
diff --git a/Cargo.toml b/Cargo.toml
new file mode 100644
index 0000000..bb0518e
--- /dev/null
+++ b/Cargo.toml
@@ -0,0 +1,32 @@
+[package]
+name = "devhub"
+version = "0.2.0"
+authors = ["NEAR DevHub <neardevhub.org>"]
+edition = "2021"
+
+[lib]
+crate-type = ["cdylib"]
+
+[dependencies]
+near-sdk = { version = "5.1.0", features = ["unstable"] }
+near-contract-standards = "5.1.0"
+serde_json = { version = "1.0", features = ["preserve_order"] }
+devhub_common = { path = "./devhub_common" }
+html-escape = "0.2.13"
+
+[dev-dependencies]
+near-sdk = { version = "5.1.0", features = ["unit-testing"] }
+insta = { version = "1.31.0", features = ["json", "redactions"] }
+regex = "1"
+near-workspaces = { version = "0.10.0", features = ["unstable"], default-features = false  }
+tokio = { version = "1.10.0", features = ["full"] }
+anyhow = "1.0"
+
+[profile.release]
+codegen-units = 1
+# Tell `rustc` to optimize for small code size.
+opt-level = "s"
+lto = true
+debug = false
+panic = "abort"
+overflow-checks = true
diff --git a/community-factory/Cargo.lock b/community-factory/Cargo.lock
new file mode 100644
index 0000000..99e77e1
--- /dev/null
+++ b/community-factory/Cargo.lock
@@ -0,0 +1,475 @@
+# This file is automatically @generated by Cargo.
+# It is not intended for manual editing.
+version = 3
+
+[[package]]
+name = "Inflector"
+version = "0.11.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "fe438c63458706e03479442743baae6c88256498e6431708f6dfc520a26515d3"
+
+[[package]]
+name = "base64"
+version = "0.21.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "35636a1494ede3b646cc98f74f8e62c773a38a659ebc777a2cf26b9b74171df9"
+
+[[package]]
+name = "borsh"
+version = "1.1.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "18a744ac76a433734df0902926ed12edd997391a8da3add87f6d706afc2dcbea"
+dependencies = [
+ "borsh-derive",
+ "cfg_aliases",
+]
+
+[[package]]
+name = "borsh-derive"
+version = "1.1.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b22bf794b9f8c87b51ea4d9e2710907ce13aa81dd2b8ac18a78fcca68ac738ef"
+dependencies = [
+ "once_cell",
+ "proc-macro-crate",
+ "proc-macro2",
+ "quote",
+ "syn",
+ "syn_derive",
+]
+
+[[package]]
+name = "bs58"
+version = "0.5.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f5353f36341f7451062466f0b755b96ac3a9547e4d7f6b70d603fc721a7d7896"
+dependencies = [
+ "tinyvec",
+]
+
+[[package]]
+name = "cfg-if"
+version = "0.1.10"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "4785bdd1c96b2a846b2bd7cc02e86b6b3dbf14e7e53446c4f54c92a361040822"
+
+[[package]]
+name = "cfg_aliases"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "fd16c4719339c4530435d38e511904438d07cce7950afa3718a84ac36c10e89e"
+
+[[package]]
+name = "darling"
+version = "0.20.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "0209d94da627ab5605dcccf08bb18afa5009cfbef48d8a8b7d7bdbc79be25c5e"
+dependencies = [
+ "darling_core",
+ "darling_macro",
+]
+
+[[package]]
+name = "darling_core"
+version = "0.20.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "177e3443818124b357d8e76f53be906d60937f0d3a90773a664fa63fa253e621"
+dependencies = [
+ "fnv",
+ "ident_case",
+ "proc-macro2",
+ "quote",
+ "syn",
+]
+
+[[package]]
+name = "darling_macro"
+version = "0.20.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "836a9bbc7ad63342d6d6e7b815ccab164bc77a2d95d84bc3117a8c0d5c98e2d5"
+dependencies = [
+ "darling_core",
+ "quote",
+ "syn",
+]
+
+[[package]]
+name = "devhub-community-factory"
+version = "0.1.0"
+dependencies = [
+ "devhub_common",
+ "near-sdk",
+]
+
+[[package]]
+name = "devhub_common"
+version = "0.1.0"
+dependencies = [
+ "near-sdk",
+]
+
+[[package]]
+name = "equivalent"
+version = "1.0.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5443807d6dff69373d433ab9ef5378ad8df50ca6298caf15de6e52e24aaf54d5"
+
+[[package]]
+name = "fnv"
+version = "1.0.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3f9eec918d3f24069decb9af1554cad7c880e2da24a9afd88aca000531ab82c1"
+
+[[package]]
+name = "hashbrown"
+version = "0.14.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "290f1a1d9242c78d09ce40a5e87e7554ee637af1351968159f4952f028f75604"
+
+[[package]]
+name = "heck"
+version = "0.4.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "95505c38b4572b2d910cecb0281560f54b440a19336cbbcb27bf6ce6adc6f5a8"
+
+[[package]]
+name = "ident_case"
+version = "1.0.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b9e0384b61958566e926dc50660321d12159025e767c18e043daf26b70104c39"
+
+[[package]]
+name = "indexmap"
+version = "2.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d530e1a18b1cb4c484e6e34556a0d948706958449fca0cab753d649f2bce3d1f"
+dependencies = [
+ "equivalent",
+ "hashbrown",
+]
+
+[[package]]
+name = "itoa"
+version = "1.0.10"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b1a46d1a171d865aa5f83f92695765caa047a9b4cbae2cbf37dbd613a793fd4c"
+
+[[package]]
+name = "libc"
+version = "0.2.151"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "302d7ab3130588088d277783b1e2d2e10c9e9e4a16dd9050e6ec93fb3e7048f4"
+
+[[package]]
+name = "memchr"
+version = "2.6.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f665ee40bc4a3c5590afb1e9677db74a508659dfd71e126420da8274909a0167"
+
+[[package]]
+name = "memory_units"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8452105ba047068f40ff7093dd1d9da90898e63dd61736462e9cdda6a90ad3c3"
+
+[[package]]
+name = "near-account-id"
+version = "1.0.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "35cbb989542587b47205e608324ddd391f0cee1c22b4b64ae49f458334b95907"
+dependencies = [
+ "borsh",
+ "serde",
+]
+
+[[package]]
+name = "near-gas"
+version = "0.2.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "14e75c875026229902d065e4435804497337b631ec69ba746b102954273e9ad1"
+dependencies = [
+ "borsh",
+ "serde",
+]
+
+[[package]]
+name = "near-sdk"
+version = "5.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "520234cfdf04a805ac2f04715889d096eb83fdd5b99ca7d0f8027ae473f891a8"
+dependencies = [
+ "base64",
+ "borsh",
+ "bs58",
+ "near-account-id",
+ "near-gas",
+ "near-sdk-macros",
+ "near-sys",
+ "near-token",
+ "once_cell",
+ "serde",
+ "serde_json",
+ "wee_alloc",
+]
+
+[[package]]
+name = "near-sdk-macros"
+version = "5.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ee2fe3fc30068c5f20e89b0985d6104c5cc1c6742dbc6efbf352be4189b9bbf7"
+dependencies = [
+ "Inflector",
+ "darling",
+ "proc-macro2",
+ "quote",
+ "serde",
+ "serde_json",
+ "strum",
+ "strum_macros",
+ "syn",
+]
+
+[[package]]
+name = "near-sys"
+version = "0.2.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "397688591acf8d3ebf2c2485ba32d4b24fc10aad5334e3ad8ec0b7179bfdf06b"
+
+[[package]]
+name = "near-token"
+version = "0.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7b68f3f8a2409f72b43efdbeff8e820b81e70824c49fee8572979d789d1683fb"
+dependencies = [
+ "borsh",
+ "serde",
+]
+
+[[package]]
+name = "once_cell"
+version = "1.19.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3fdb12b2476b595f9358c5161aa467c2438859caa136dec86c26fdd2efe17b92"
+
+[[package]]
+name = "proc-macro-crate"
+version = "2.0.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "97dc5fea232fc28d2f597b37c4876b348a40e33f3b02cc975c8d006d78d94b1a"
+dependencies = [
+ "toml_datetime",
+ "toml_edit",
+]
+
+[[package]]
+name = "proc-macro-error"
+version = "1.0.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "da25490ff9892aab3fcf7c36f08cfb902dd3e71ca0f9f9517bea02a73a5ce38c"
+dependencies = [
+ "proc-macro-error-attr",
+ "proc-macro2",
+ "quote",
+ "version_check",
+]
+
+[[package]]
+name = "proc-macro-error-attr"
+version = "1.0.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a1be40180e52ecc98ad80b184934baf3d0d29f979574e439af5a55274b35f869"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "version_check",
+]
+
+[[package]]
+name = "proc-macro2"
+version = "1.0.70"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "39278fbbf5fb4f646ce651690877f89d1c5811a3d4acb27700c1cb3cdb78fd3b"
+dependencies = [
+ "unicode-ident",
+]
+
+[[package]]
+name = "quote"
+version = "1.0.33"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5267fca4496028628a95160fc423a33e8b2e6af8a5302579e322e4b520293cae"
+dependencies = [
+ "proc-macro2",
+]
+
+[[package]]
+name = "rustversion"
+version = "1.0.14"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7ffc183a10b4478d04cbbbfc96d0873219d962dd5accaff2ffbd4ceb7df837f4"
+
+[[package]]
+name = "ryu"
+version = "1.0.16"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f98d2aa92eebf49b69786be48e4477826b256916e84a57ff2a4f21923b48eb4c"
+
+[[package]]
+name = "serde"
+version = "1.0.193"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "25dd9975e68d0cb5aa1120c288333fc98731bd1dd12f561e468ea4728c042b89"
+dependencies = [
+ "serde_derive",
+]
+
+[[package]]
+name = "serde_derive"
+version = "1.0.193"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "43576ca501357b9b071ac53cdc7da8ef0cbd9493d8df094cd821777ea6e894d3"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn",
+]
+
+[[package]]
+name = "serde_json"
+version = "1.0.108"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3d1c7e3eac408d115102c4c24ad393e0821bb3a5df4d506a80f85f7a742a526b"
+dependencies = [
+ "itoa",
+ "ryu",
+ "serde",
+]
+
+[[package]]
+name = "strum"
+version = "0.26.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "723b93e8addf9aa965ebe2d11da6d7540fa2283fcea14b3371ff055f7ba13f5f"
+
+[[package]]
+name = "strum_macros"
+version = "0.26.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7a3417fc93d76740d974a01654a09777cb500428cc874ca9f45edfe0c4d4cd18"
+dependencies = [
+ "heck",
+ "proc-macro2",
+ "quote",
+ "rustversion",
+ "syn",
+]
+
+[[package]]
+name = "syn"
+version = "2.0.41"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "44c8b28c477cc3bf0e7966561e3460130e1255f7a1cf71931075f1c5e7a7e269"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "unicode-ident",
+]
+
+[[package]]
+name = "syn_derive"
+version = "0.1.8"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1329189c02ff984e9736652b1631330da25eaa6bc639089ed4915d25446cbe7b"
+dependencies = [
+ "proc-macro-error",
+ "proc-macro2",
+ "quote",
+ "syn",
+]
+
+[[package]]
+name = "tinyvec"
+version = "1.6.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "87cc5ceb3875bb20c2890005a4e226a4651264a5c75edb2421b52861a0a0cb50"
+dependencies = [
+ "tinyvec_macros",
+]
+
+[[package]]
+name = "tinyvec_macros"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1f3ccbac311fea05f86f61904b462b55fb3df8837a366dfc601a0161d0532f20"
+
+[[package]]
+name = "toml_datetime"
+version = "0.6.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7cda73e2f1397b1262d6dfdcef8aafae14d1de7748d66822d3bfeeb6d03e5e4b"
+
+[[package]]
+name = "toml_edit"
+version = "0.20.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "396e4d48bbb2b7554c944bde63101b5ae446cff6ec4a24227428f15eb72ef338"
+dependencies = [
+ "indexmap",
+ "toml_datetime",
+ "winnow",
+]
+
+[[package]]
+name = "unicode-ident"
+version = "1.0.12"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3354b9ac3fae1ff6755cb6db53683adb661634f67557942dea4facebec0fee4b"
+
+[[package]]
+name = "version_check"
+version = "0.9.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "49874b5167b65d7193b8aba1567f5c7d93d001cafc34600cee003eda787e483f"
+
+[[package]]
+name = "wee_alloc"
+version = "0.4.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "dbb3b5a6b2bb17cb6ad44a2e68a43e8d2722c997da10e928665c72ec6c0a0b8e"
+dependencies = [
+ "cfg-if",
+ "libc",
+ "memory_units",
+ "winapi",
+]
+
+[[package]]
+name = "winapi"
+version = "0.3.9"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5c839a674fcd7a98952e593242ea400abe93992746761e38641405d28b00f419"
+dependencies = [
+ "winapi-i686-pc-windows-gnu",
+ "winapi-x86_64-pc-windows-gnu",
+]
+
+[[package]]
+name = "winapi-i686-pc-windows-gnu"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ac3b87c63620426dd9b991e5ce0329eff545bccbbb34f3be09ff6fb6ab51b7b6"
+
+[[package]]
+name = "winapi-x86_64-pc-windows-gnu"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "712e227841d057c1ee1cd2fb22fa7e5a5461ae8e48fa2ca79ec42cfc1931183f"
+
+[[package]]
+name = "winnow"
+version = "0.5.28"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6c830786f7720c2fd27a1a0e27a709dbd3c4d009b56d098fc742d4f4eab91fe2"
+dependencies = [
+ "memchr",
+]
diff --git a/community-factory/Cargo.toml b/community-factory/Cargo.toml
new file mode 100644
index 0000000..221fd26
--- /dev/null
+++ b/community-factory/Cargo.toml
@@ -0,0 +1,21 @@
+[package]
+name = "devhub-community-factory"
+version = "0.1.0"
+authors = ["NEAR DevHub <neardevhub.org>"]
+edition = "2021"
+
+[lib]
+crate-type = ["cdylib"]
+
+[dependencies]
+near-sdk = "5.1.0"
+devhub_common = { path = "../devhub_common" }
+
+[profile.release]
+codegen-units = 1
+# Tell `rustc` to optimize for small code size.
+opt-level = "s"
+lto = true
+debug = false
+panic = "abort"
+overflow-checks = true
diff --git a/community-factory/src/lib.rs b/community-factory/src/lib.rs
new file mode 100644
index 0000000..7e87d1f
--- /dev/null
+++ b/community-factory/src/lib.rs
@@ -0,0 +1,88 @@
+use near_sdk::{env, near, require, AccountId, Gas, NearToken, Promise};
+use near_sdk::serde_json::json;
+
+use devhub_common::social_db_contract;
+
+const CODE: &[u8] = include_bytes!("../../community/target/near/devhub_community.wasm");
+const INITIAL_BALANCE: NearToken = NearToken::from_near(4);
+const PUBKEY_STR: &str = "ed25519:4deBAvg1S4MF7qe9GBDJwDCGLyyXtJa73JnMXwyG9vsB";
+
+#[near(contract_state)]
+#[derive(Default)]
+pub struct Contract {}
+
+#[near]
+impl Contract {
+    #[payable]
+    pub fn create_community_account(&mut self, community: String) -> Promise {
+        let parent_account: AccountId = env::current_account_id()
+            .get_parent_account_id()
+            .expect("Community factory should be deployed on a child account")
+            .into();
+        require!(
+            env::predecessor_account_id() == parent_account,
+            "Can only be called from parent contract"
+        );
+        require!(
+            env::attached_deposit() >= INITIAL_BALANCE,
+            "Require 4 NEAR to create community account"
+        );
+
+        let community_account_id: AccountId =
+            format!("{}.{}", community, env::current_account_id()).parse().unwrap();
+
+        let pubkey = PUBKEY_STR.parse().unwrap();
+        Promise::new(community_account_id.clone())
+            .create_account()
+            .add_full_access_key(pubkey)
+            .transfer(INITIAL_BALANCE)
+            .deploy_contract(CODE.to_vec())
+            .function_call(
+                "new".to_string(),
+                b"{}".to_vec(),
+                NearToken::from_near(0),
+                Gas::from_tgas(50),
+            )
+            .then(
+                self.subscribe_to_community_accounts(community_account_id)
+            )
+    }
+
+    pub fn subscribe_to_community_accounts(&mut self, community_account_id: AccountId) -> Promise {
+        let community_factory_account = env::current_account_id();
+        let discussions_account_id: AccountId =
+            format!("discussions.{}", community_account_id.clone()).parse().unwrap();
+
+        social_db_contract()
+            .with_static_gas(env::prepaid_gas().saturating_div(3))
+            .with_attached_deposit(env::attached_deposit())
+            .set(json!({
+                community_factory_account: {
+                    "graph": {
+                        "follow": {
+                            community_account_id.clone(): "",
+                            discussions_account_id.clone(): "",
+                        }
+                    },
+                    "index": {
+                        "graph": json!([
+                            {
+                                "key": "follow",
+                                "value": {
+                                    "type": "follow",
+                                    "accountId": community_account_id
+                                }
+                            },
+                            {
+                                "key": "follow",
+                                "value": {
+                                    "type": "follow",
+                                    "accountId": discussions_account_id
+                                }
+                            }
+                        ]).to_string()
+                    }                  
+                },
+            }))
+    }
+}
diff --git a/community/Cargo.lock b/community/Cargo.lock
new file mode 100644
index 0000000..ca29f82
--- /dev/null
+++ b/community/Cargo.lock
@@ -0,0 +1,475 @@
+# This file is automatically @generated by Cargo.
+# It is not intended for manual editing.
+version = 3
+
+[[package]]
+name = "Inflector"
+version = "0.11.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "fe438c63458706e03479442743baae6c88256498e6431708f6dfc520a26515d3"
+
+[[package]]
+name = "base64"
+version = "0.21.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "35636a1494ede3b646cc98f74f8e62c773a38a659ebc777a2cf26b9b74171df9"
+
+[[package]]
+name = "borsh"
+version = "1.1.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "18a744ac76a433734df0902926ed12edd997391a8da3add87f6d706afc2dcbea"
+dependencies = [
+ "borsh-derive",
+ "cfg_aliases",
+]
+
+[[package]]
+name = "borsh-derive"
+version = "1.1.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b22bf794b9f8c87b51ea4d9e2710907ce13aa81dd2b8ac18a78fcca68ac738ef"
+dependencies = [
+ "once_cell",
+ "proc-macro-crate",
+ "proc-macro2",
+ "quote",
+ "syn",
+ "syn_derive",
+]
+
+[[package]]
+name = "bs58"
+version = "0.5.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f5353f36341f7451062466f0b755b96ac3a9547e4d7f6b70d603fc721a7d7896"
+dependencies = [
+ "tinyvec",
+]
+
+[[package]]
+name = "cfg-if"
+version = "0.1.10"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "4785bdd1c96b2a846b2bd7cc02e86b6b3dbf14e7e53446c4f54c92a361040822"
+
+[[package]]
+name = "cfg_aliases"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "fd16c4719339c4530435d38e511904438d07cce7950afa3718a84ac36c10e89e"
+
+[[package]]
+name = "darling"
+version = "0.20.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "0209d94da627ab5605dcccf08bb18afa5009cfbef48d8a8b7d7bdbc79be25c5e"
+dependencies = [
+ "darling_core",
+ "darling_macro",
+]
+
+[[package]]
+name = "darling_core"
+version = "0.20.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "177e3443818124b357d8e76f53be906d60937f0d3a90773a664fa63fa253e621"
+dependencies = [
+ "fnv",
+ "ident_case",
+ "proc-macro2",
+ "quote",
+ "syn",
+]
+
+[[package]]
+name = "darling_macro"
+version = "0.20.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "836a9bbc7ad63342d6d6e7b815ccab164bc77a2d95d84bc3117a8c0d5c98e2d5"
+dependencies = [
+ "darling_core",
+ "quote",
+ "syn",
+]
+
+[[package]]
+name = "devhub-community"
+version = "0.1.0"
+dependencies = [
+ "devhub_common",
+ "near-sdk",
+]
+
+[[package]]
+name = "devhub_common"
+version = "0.1.0"
+dependencies = [
+ "near-sdk",
+]
+
+[[package]]
+name = "equivalent"
+version = "1.0.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5443807d6dff69373d433ab9ef5378ad8df50ca6298caf15de6e52e24aaf54d5"
+
+[[package]]
+name = "fnv"
+version = "1.0.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3f9eec918d3f24069decb9af1554cad7c880e2da24a9afd88aca000531ab82c1"
+
+[[package]]
+name = "hashbrown"
+version = "0.14.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "290f1a1d9242c78d09ce40a5e87e7554ee637af1351968159f4952f028f75604"
+
+[[package]]
+name = "heck"
+version = "0.4.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "95505c38b4572b2d910cecb0281560f54b440a19336cbbcb27bf6ce6adc6f5a8"
+
+[[package]]
+name = "ident_case"
+version = "1.0.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b9e0384b61958566e926dc50660321d12159025e767c18e043daf26b70104c39"
+
+[[package]]
+name = "indexmap"
+version = "2.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d530e1a18b1cb4c484e6e34556a0d948706958449fca0cab753d649f2bce3d1f"
+dependencies = [
+ "equivalent",
+ "hashbrown",
+]
+
+[[package]]
+name = "itoa"
+version = "1.0.10"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b1a46d1a171d865aa5f83f92695765caa047a9b4cbae2cbf37dbd613a793fd4c"
+
+[[package]]
+name = "libc"
+version = "0.2.151"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "302d7ab3130588088d277783b1e2d2e10c9e9e4a16dd9050e6ec93fb3e7048f4"
+
+[[package]]
+name = "memchr"
+version = "2.6.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f665ee40bc4a3c5590afb1e9677db74a508659dfd71e126420da8274909a0167"
+
+[[package]]
+name = "memory_units"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8452105ba047068f40ff7093dd1d9da90898e63dd61736462e9cdda6a90ad3c3"
+
+[[package]]
+name = "near-account-id"
+version = "1.0.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "35cbb989542587b47205e608324ddd391f0cee1c22b4b64ae49f458334b95907"
+dependencies = [
+ "borsh",
+ "serde",
+]
+
+[[package]]
+name = "near-gas"
+version = "0.2.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "14e75c875026229902d065e4435804497337b631ec69ba746b102954273e9ad1"
+dependencies = [
+ "borsh",
+ "serde",
+]
+
+[[package]]
+name = "near-sdk"
+version = "5.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "520234cfdf04a805ac2f04715889d096eb83fdd5b99ca7d0f8027ae473f891a8"
+dependencies = [
+ "base64",
+ "borsh",
+ "bs58",
+ "near-account-id",
+ "near-gas",
+ "near-sdk-macros",
+ "near-sys",
+ "near-token",
+ "once_cell",
+ "serde",
+ "serde_json",
+ "wee_alloc",
+]
+
+[[package]]
+name = "near-sdk-macros"
+version = "5.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ee2fe3fc30068c5f20e89b0985d6104c5cc1c6742dbc6efbf352be4189b9bbf7"
+dependencies = [
+ "Inflector",
+ "darling",
+ "proc-macro2",
+ "quote",
+ "serde",
+ "serde_json",
+ "strum",
+ "strum_macros",
+ "syn",
+]
+
+[[package]]
+name = "near-sys"
+version = "0.2.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "397688591acf8d3ebf2c2485ba32d4b24fc10aad5334e3ad8ec0b7179bfdf06b"
+
+[[package]]
+name = "near-token"
+version = "0.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7b68f3f8a2409f72b43efdbeff8e820b81e70824c49fee8572979d789d1683fb"
+dependencies = [
+ "borsh",
+ "serde",
+]
+
+[[package]]
+name = "once_cell"
+version = "1.19.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3fdb12b2476b595f9358c5161aa467c2438859caa136dec86c26fdd2efe17b92"
+
+[[package]]
+name = "proc-macro-crate"
+version = "2.0.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "97dc5fea232fc28d2f597b37c4876b348a40e33f3b02cc975c8d006d78d94b1a"
+dependencies = [
+ "toml_datetime",
+ "toml_edit",
+]
+
+[[package]]
+name = "proc-macro-error"
+version = "1.0.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "da25490ff9892aab3fcf7c36f08cfb902dd3e71ca0f9f9517bea02a73a5ce38c"
+dependencies = [
+ "proc-macro-error-attr",
+ "proc-macro2",
+ "quote",
+ "version_check",
+]
+
+[[package]]
+name = "proc-macro-error-attr"
+version = "1.0.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a1be40180e52ecc98ad80b184934baf3d0d29f979574e439af5a55274b35f869"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "version_check",
+]
+
+[[package]]
+name = "proc-macro2"
+version = "1.0.70"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "39278fbbf5fb4f646ce651690877f89d1c5811a3d4acb27700c1cb3cdb78fd3b"
+dependencies = [
+ "unicode-ident",
+]
+
+[[package]]
+name = "quote"
+version = "1.0.33"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5267fca4496028628a95160fc423a33e8b2e6af8a5302579e322e4b520293cae"
+dependencies = [
+ "proc-macro2",
+]
+
+[[package]]
+name = "rustversion"
+version = "1.0.14"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7ffc183a10b4478d04cbbbfc96d0873219d962dd5accaff2ffbd4ceb7df837f4"
+
+[[package]]
+name = "ryu"
+version = "1.0.16"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f98d2aa92eebf49b69786be48e4477826b256916e84a57ff2a4f21923b48eb4c"
+
+[[package]]
+name = "serde"
+version = "1.0.193"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "25dd9975e68d0cb5aa1120c288333fc98731bd1dd12f561e468ea4728c042b89"
+dependencies = [
+ "serde_derive",
+]
+
+[[package]]
+name = "serde_derive"
+version = "1.0.193"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "43576ca501357b9b071ac53cdc7da8ef0cbd9493d8df094cd821777ea6e894d3"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn",
+]
+
+[[package]]
+name = "serde_json"
+version = "1.0.108"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3d1c7e3eac408d115102c4c24ad393e0821bb3a5df4d506a80f85f7a742a526b"
+dependencies = [
+ "itoa",
+ "ryu",
+ "serde",
+]
+
+[[package]]
+name = "strum"
+version = "0.26.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "723b93e8addf9aa965ebe2d11da6d7540fa2283fcea14b3371ff055f7ba13f5f"
+
+[[package]]
+name = "strum_macros"
+version = "0.26.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7a3417fc93d76740d974a01654a09777cb500428cc874ca9f45edfe0c4d4cd18"
+dependencies = [
+ "heck",
+ "proc-macro2",
+ "quote",
+ "rustversion",
+ "syn",
+]
+
+[[package]]
+name = "syn"
+version = "2.0.41"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "44c8b28c477cc3bf0e7966561e3460130e1255f7a1cf71931075f1c5e7a7e269"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "unicode-ident",
+]
+
+[[package]]
+name = "syn_derive"
+version = "0.1.8"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1329189c02ff984e9736652b1631330da25eaa6bc639089ed4915d25446cbe7b"
+dependencies = [
+ "proc-macro-error",
+ "proc-macro2",
+ "quote",
+ "syn",
+]
+
+[[package]]
+name = "tinyvec"
+version = "1.6.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "87cc5ceb3875bb20c2890005a4e226a4651264a5c75edb2421b52861a0a0cb50"
+dependencies = [
+ "tinyvec_macros",
+]
+
+[[package]]
+name = "tinyvec_macros"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1f3ccbac311fea05f86f61904b462b55fb3df8837a366dfc601a0161d0532f20"
+
+[[package]]
+name = "toml_datetime"
+version = "0.6.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7cda73e2f1397b1262d6dfdcef8aafae14d1de7748d66822d3bfeeb6d03e5e4b"
+
+[[package]]
+name = "toml_edit"
+version = "0.20.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "396e4d48bbb2b7554c944bde63101b5ae446cff6ec4a24227428f15eb72ef338"
+dependencies = [
+ "indexmap",
+ "toml_datetime",
+ "winnow",
+]
+
+[[package]]
+name = "unicode-ident"
+version = "1.0.12"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3354b9ac3fae1ff6755cb6db53683adb661634f67557942dea4facebec0fee4b"
+
+[[package]]
+name = "version_check"
+version = "0.9.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "49874b5167b65d7193b8aba1567f5c7d93d001cafc34600cee003eda787e483f"
+
+[[package]]
+name = "wee_alloc"
+version = "0.4.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "dbb3b5a6b2bb17cb6ad44a2e68a43e8d2722c997da10e928665c72ec6c0a0b8e"
+dependencies = [
+ "cfg-if",
+ "libc",
+ "memory_units",
+ "winapi",
+]
+
+[[package]]
+name = "winapi"
+version = "0.3.9"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5c839a674fcd7a98952e593242ea400abe93992746761e38641405d28b00f419"
+dependencies = [
+ "winapi-i686-pc-windows-gnu",
+ "winapi-x86_64-pc-windows-gnu",
+]
+
+[[package]]
+name = "winapi-i686-pc-windows-gnu"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ac3b87c63620426dd9b991e5ce0329eff545bccbbb34f3be09ff6fb6ab51b7b6"
+
+[[package]]
+name = "winapi-x86_64-pc-windows-gnu"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "712e227841d057c1ee1cd2fb22fa7e5a5461ae8e48fa2ca79ec42cfc1931183f"
+
+[[package]]
+name = "winnow"
+version = "0.5.28"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6c830786f7720c2fd27a1a0e27a709dbd3c4d009b56d098fc742d4f4eab91fe2"
+dependencies = [
+ "memchr",
+]
diff --git a/community/Cargo.toml b/community/Cargo.toml
new file mode 100644
index 0000000..c560d97
--- /dev/null
+++ b/community/Cargo.toml
@@ -0,0 +1,21 @@
+[package]
+name = "devhub-community"
+version = "0.1.0"
+authors = ["NEAR DevHub <neardevhub.org>"]
+edition = "2021"
+
+[lib]
+crate-type = ["cdylib"]
+
+[dependencies]
+near-sdk = "5.1.0"
+devhub_common = { path = "../devhub_common" }
+
+[profile.release]
+codegen-units = 1
+# Tell `rustc` to optimize for small code size.
+opt-level = "s"
+lto = true
+debug = false
+panic = "abort"
+overflow-checks = true
diff --git a/community/src/lib.rs b/community/src/lib.rs
new file mode 100644
index 0000000..d928a30
--- /dev/null
+++ b/community/src/lib.rs
@@ -0,0 +1,63 @@
+use devhub_common::social_db_contract;
+use near_sdk;
+use near_sdk::Gas;
+use near_sdk::{env, near, require, AccountId, NearToken, Promise};
+
+const CODE: &[u8] = include_bytes!("../../discussions/target/near/devhub_discussions.wasm");
+const PUBKEY_STR: &str = "ed25519:4deBAvg1S4MF7qe9GBDJwDCGLyyXtJa73JnMXwyG9vsB";
+
+#[near(contract_state)]
+#[derive(Default)]
+pub struct Contract {}
+
+#[near]
+impl Contract {
+    #[payable]
+    pub fn new(&mut self) -> Promise {
+        social_db_contract()
+            .with_unused_gas_weight(1)
+            .with_attached_deposit(NearToken::from_near(1))
+            .grant_write_permission(
+                Some(Contract::get_devhub_account()),
+                None,
+                vec![env::current_account_id().to_string()],
+            )
+            .then(self.create_discussions_account())
+    }
+
+    pub fn destroy(&mut self) -> Promise {
+        let devhub_account = Contract::get_devhub_account();
+        require!(
+            env::predecessor_account_id() == devhub_account,
+            "Can only destroy community account from DevHub contract"
+        );
+        Promise::new(env::current_account_id()).delete_account(devhub_account)
+    }
+
+    fn get_devhub_account() -> AccountId {
+        env::current_account_id()
+            .get_parent_account_id()
+            .expect("Community contract should be deployed on a child account")
+            .get_parent_account_id()
+            .expect("Community factory should be deployed on a child account")
+            .into()
+    }
+
+    pub fn create_discussions_account(&mut self) -> Promise {
+        let account_id: AccountId =
+            format!("discussions.{}", env::current_account_id()).parse().unwrap();
+
+        let pubkey = PUBKEY_STR.parse().unwrap();
+        Promise::new(account_id)
+            .create_account()
+            .add_full_access_key(pubkey)
+            .transfer(NearToken::from_near(2))
+            .deploy_contract(CODE.to_vec())
+            .function_call(
+                "new".to_string(),
+                b"{}".to_vec(),
+                NearToken::from_near(0),
+                Gas::from_tgas(20),
+            )
+    }
+}
diff --git a/devhub_common/Cargo.lock b/devhub_common/Cargo.lock
new file mode 100644
index 0000000..6f3fb95
--- /dev/null
+++ b/devhub_common/Cargo.lock
@@ -0,0 +1,466 @@
+# This file is automatically @generated by Cargo.
+# It is not intended for manual editing.
+version = 3
+
+[[package]]
+name = "Inflector"
+version = "0.11.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "fe438c63458706e03479442743baae6c88256498e6431708f6dfc520a26515d3"
+
+[[package]]
+name = "base64"
+version = "0.21.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "9d297deb1925b89f2ccc13d7635fa0714f12c87adce1c75356b39ca9b7178567"
+
+[[package]]
+name = "borsh"
+version = "1.3.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f58b559fd6448c6e2fd0adb5720cd98a2506594cafa4737ff98c396f3e82f667"
+dependencies = [
+ "borsh-derive",
+ "cfg_aliases",
+]
+
+[[package]]
+name = "borsh-derive"
+version = "1.3.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7aadb5b6ccbd078890f6d7003694e33816e6b784358f18e15e7e6d9f065a57cd"
+dependencies = [
+ "once_cell",
+ "proc-macro-crate",
+ "proc-macro2",
+ "quote",
+ "syn",
+ "syn_derive",
+]
+
+[[package]]
+name = "bs58"
+version = "0.5.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "bf88ba1141d185c399bee5288d850d63b8369520c1eafc32a0430b5b6c287bf4"
+dependencies = [
+ "tinyvec",
+]
+
+[[package]]
+name = "cfg-if"
+version = "0.1.10"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "4785bdd1c96b2a846b2bd7cc02e86b6b3dbf14e7e53446c4f54c92a361040822"
+
+[[package]]
+name = "cfg_aliases"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "fd16c4719339c4530435d38e511904438d07cce7950afa3718a84ac36c10e89e"
+
+[[package]]
+name = "darling"
+version = "0.20.8"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "54e36fcd13ed84ffdfda6f5be89b31287cbb80c439841fe69e04841435464391"
+dependencies = [
+ "darling_core",
+ "darling_macro",
+]
+
+[[package]]
+name = "darling_core"
+version = "0.20.8"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "9c2cf1c23a687a1feeb728783b993c4e1ad83d99f351801977dd809b48d0a70f"
+dependencies = [
+ "fnv",
+ "ident_case",
+ "proc-macro2",
+ "quote",
+ "syn",
+]
+
+[[package]]
+name = "darling_macro"
+version = "0.20.8"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a668eda54683121533a393014d8692171709ff57a7d61f187b6e782719f8933f"
+dependencies = [
+ "darling_core",
+ "quote",
+ "syn",
+]
+
+[[package]]
+name = "devhub_common"
+version = "0.1.0"
+dependencies = [
+ "near-sdk",
+]
+
+[[package]]
+name = "equivalent"
+version = "1.0.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5443807d6dff69373d433ab9ef5378ad8df50ca6298caf15de6e52e24aaf54d5"
+
+[[package]]
+name = "fnv"
+version = "1.0.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3f9eec918d3f24069decb9af1554cad7c880e2da24a9afd88aca000531ab82c1"
+
+[[package]]
+name = "hashbrown"
+version = "0.14.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "290f1a1d9242c78d09ce40a5e87e7554ee637af1351968159f4952f028f75604"
+
+[[package]]
+name = "heck"
+version = "0.4.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "95505c38b4572b2d910cecb0281560f54b440a19336cbbcb27bf6ce6adc6f5a8"
+
+[[package]]
+name = "ident_case"
+version = "1.0.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b9e0384b61958566e926dc50660321d12159025e767c18e043daf26b70104c39"
+
+[[package]]
+name = "indexmap"
+version = "2.2.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7b0b929d511467233429c45a44ac1dcaa21ba0f5ba11e4879e6ed28ddb4f9df4"
+dependencies = [
+ "equivalent",
+ "hashbrown",
+]
+
+[[package]]
+name = "itoa"
+version = "1.0.10"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b1a46d1a171d865aa5f83f92695765caa047a9b4cbae2cbf37dbd613a793fd4c"
+
+[[package]]
+name = "libc"
+version = "0.2.153"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "9c198f91728a82281a64e1f4f9eeb25d82cb32a5de251c6bd1b5154d63a8e7bd"
+
+[[package]]
+name = "memchr"
+version = "2.7.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "523dc4f511e55ab87b694dc30d0f820d60906ef06413f93d4d7a1385599cc149"
+
+[[package]]
+name = "memory_units"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8452105ba047068f40ff7093dd1d9da90898e63dd61736462e9cdda6a90ad3c3"
+
+[[package]]
+name = "near-account-id"
+version = "1.0.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "35cbb989542587b47205e608324ddd391f0cee1c22b4b64ae49f458334b95907"
+dependencies = [
+ "borsh",
+ "serde",
+]
+
+[[package]]
+name = "near-gas"
+version = "0.2.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "14e75c875026229902d065e4435804497337b631ec69ba746b102954273e9ad1"
+dependencies = [
+ "borsh",
+ "serde",
+]
+
+[[package]]
+name = "near-sdk"
+version = "5.0.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b5c2e7c9524308b1b301cca05d875de13b3b20dc8b92e71f3890b380372e4c88"
+dependencies = [
+ "base64",
+ "borsh",
+ "bs58",
+ "near-account-id",
+ "near-gas",
+ "near-sdk-macros",
+ "near-sys",
+ "near-token",
+ "once_cell",
+ "serde",
+ "serde_json",
+ "wee_alloc",
+]
+
+[[package]]
+name = "near-sdk-macros"
+version = "5.0.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e1e9b23d9d7757ade258921c9cbc7923542e64d9d3b52a6cd91f746c77cb0a0f"
+dependencies = [
+ "Inflector",
+ "darling",
+ "proc-macro2",
+ "quote",
+ "serde",
+ "serde_json",
+ "strum",
+ "strum_macros",
+ "syn",
+]
+
+[[package]]
+name = "near-sys"
+version = "0.2.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "397688591acf8d3ebf2c2485ba32d4b24fc10aad5334e3ad8ec0b7179bfdf06b"
+
+[[package]]
+name = "near-token"
+version = "0.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7b68f3f8a2409f72b43efdbeff8e820b81e70824c49fee8572979d789d1683fb"
+dependencies = [
+ "borsh",
+ "serde",
+]
+
+[[package]]
+name = "once_cell"
+version = "1.19.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3fdb12b2476b595f9358c5161aa467c2438859caa136dec86c26fdd2efe17b92"
+
+[[package]]
+name = "proc-macro-crate"
+version = "3.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6d37c51ca738a55da99dc0c4a34860fd675453b8b36209178c2249bb13651284"
+dependencies = [
+ "toml_edit",
+]
+
+[[package]]
+name = "proc-macro-error"
+version = "1.0.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "da25490ff9892aab3fcf7c36f08cfb902dd3e71ca0f9f9517bea02a73a5ce38c"
+dependencies = [
+ "proc-macro-error-attr",
+ "proc-macro2",
+ "quote",
+ "version_check",
+]
+
+[[package]]
+name = "proc-macro-error-attr"
+version = "1.0.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a1be40180e52ecc98ad80b184934baf3d0d29f979574e439af5a55274b35f869"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "version_check",
+]
+
+[[package]]
+name = "proc-macro2"
+version = "1.0.79"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e835ff2298f5721608eb1a980ecaee1aef2c132bf95ecc026a11b7bf3c01c02e"
+dependencies = [
+ "unicode-ident",
+]
+
+[[package]]
+name = "quote"
+version = "1.0.35"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "291ec9ab5efd934aaf503a6466c5d5251535d108ee747472c3977cc5acc868ef"
+dependencies = [
+ "proc-macro2",
+]
+
+[[package]]
+name = "rustversion"
+version = "1.0.14"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7ffc183a10b4478d04cbbbfc96d0873219d962dd5accaff2ffbd4ceb7df837f4"
+
+[[package]]
+name = "ryu"
+version = "1.0.17"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e86697c916019a8588c99b5fac3cead74ec0b4b819707a682fd4d23fa0ce1ba1"
+
+[[package]]
+name = "serde"
+version = "1.0.197"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3fb1c873e1b9b056a4dc4c0c198b24c3ffa059243875552b2bd0933b1aee4ce2"
+dependencies = [
+ "serde_derive",
+]
+
+[[package]]
+name = "serde_derive"
+version = "1.0.197"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7eb0b34b42edc17f6b7cac84a52a1c5f0e1bb2227e997ca9011ea3dd34e8610b"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn",
+]
+
+[[package]]
+name = "serde_json"
+version = "1.0.114"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c5f09b1bd632ef549eaa9f60a1f8de742bdbc698e6cee2095fc84dde5f549ae0"
+dependencies = [
+ "itoa",
+ "ryu",
+ "serde",
+]
+
+[[package]]
+name = "strum"
+version = "0.26.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5d8cec3501a5194c432b2b7976db6b7d10ec95c253208b45f83f7136aa985e29"
+
+[[package]]
+name = "strum_macros"
+version = "0.26.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c6cf59daf282c0a494ba14fd21610a0325f9f90ec9d1231dea26bcb1d696c946"
+dependencies = [
+ "heck",
+ "proc-macro2",
+ "quote",
+ "rustversion",
+ "syn",
+]
+
+[[package]]
+name = "syn"
+version = "2.0.53"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7383cd0e49fff4b6b90ca5670bfd3e9d6a733b3f90c686605aa7eec8c4996032"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "unicode-ident",
+]
+
+[[package]]
+name = "syn_derive"
+version = "0.1.8"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1329189c02ff984e9736652b1631330da25eaa6bc639089ed4915d25446cbe7b"
+dependencies = [
+ "proc-macro-error",
+ "proc-macro2",
+ "quote",
+ "syn",
+]
+
+[[package]]
+name = "tinyvec"
+version = "1.6.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "87cc5ceb3875bb20c2890005a4e226a4651264a5c75edb2421b52861a0a0cb50"
+dependencies = [
+ "tinyvec_macros",
+]
+
+[[package]]
+name = "tinyvec_macros"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1f3ccbac311fea05f86f61904b462b55fb3df8837a366dfc601a0161d0532f20"
+
+[[package]]
+name = "toml_datetime"
+version = "0.6.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3550f4e9685620ac18a50ed434eb3aec30db8ba93b0287467bca5826ea25baf1"
+
+[[package]]
+name = "toml_edit"
+version = "0.21.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6a8534fd7f78b5405e860340ad6575217ce99f38d4d5c8f2442cb5ecb50090e1"
+dependencies = [
+ "indexmap",
+ "toml_datetime",
+ "winnow",
+]
+
+[[package]]
+name = "unicode-ident"
+version = "1.0.12"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3354b9ac3fae1ff6755cb6db53683adb661634f67557942dea4facebec0fee4b"
+
+[[package]]
+name = "version_check"
+version = "0.9.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "49874b5167b65d7193b8aba1567f5c7d93d001cafc34600cee003eda787e483f"
+
+[[package]]
+name = "wee_alloc"
+version = "0.4.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "dbb3b5a6b2bb17cb6ad44a2e68a43e8d2722c997da10e928665c72ec6c0a0b8e"
+dependencies = [
+ "cfg-if",
+ "libc",
+ "memory_units",
+ "winapi",
+]
+
+[[package]]
+name = "winapi"
+version = "0.3.9"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5c839a674fcd7a98952e593242ea400abe93992746761e38641405d28b00f419"
+dependencies = [
+ "winapi-i686-pc-windows-gnu",
+ "winapi-x86_64-pc-windows-gnu",
+]
+
+[[package]]
+name = "winapi-i686-pc-windows-gnu"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ac3b87c63620426dd9b991e5ce0329eff545bccbbb34f3be09ff6fb6ab51b7b6"
+
+[[package]]
+name = "winapi-x86_64-pc-windows-gnu"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "712e227841d057c1ee1cd2fb22fa7e5a5461ae8e48fa2ca79ec42cfc1931183f"
+
+[[package]]
+name = "winnow"
+version = "0.5.40"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f593a95398737aeed53e489c785df13f3618e41dbcd6718c6addbf1395aa6876"
+dependencies = [
+ "memchr",
+]
diff --git a/devhub_common/Cargo.toml b/devhub_common/Cargo.toml
new file mode 100644
index 0000000..ae388bc
--- /dev/null
+++ b/devhub_common/Cargo.toml
@@ -0,0 +1,16 @@
+[package]
+name = "devhub_common"
+version = "0.1.0"
+edition = "2021"
+
+[dependencies]
+near-sdk = "5.1.0"
+
+[profile.release]
+codegen-units = 1
+# Tell `rustc` to optimize for small code size.
+opt-level = "s"
+lto = true
+debug = false
+panic = "abort"
+overflow-checks = true
\ No newline at end of file
diff --git a/devhub_common/src/lib.rs b/devhub_common/src/lib.rs
new file mode 100644
index 0000000..c21889d
--- /dev/null
+++ b/devhub_common/src/lib.rs
@@ -0,0 +1,31 @@
+use near_sdk::serde::{Deserialize, Serialize};
+use near_sdk::serde_json::Value;
+use near_sdk::{env, ext_contract, AccountId, PublicKey, NearSchema};
+
+#[derive(Copy, Clone, Serialize, Deserialize, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+pub struct SetReturnType {
+    pub block_height: near_sdk::json_types::U64,
+}
+
+#[ext_contract(ext_social_db)]
+pub trait SocialDB {
+    fn set(&mut self, data: Value) -> SetReturnType;
+    fn grant_write_permission(
+        &mut self,
+        predecessor_id: Option<AccountId>,
+        public_key: Option<PublicKey>,
+        keys: Vec<String>,
+    );
+}
+
+pub fn social_db_contract() -> ext_social_db::SocialDBExt {
+    let social_db: AccountId = if env::current_account_id().to_string().ends_with("testnet") {
+        "v1.social08.testnet"
+    } else {
+        "social.near"
+    }
+    .parse()
+    .unwrap();
+    ext_social_db::ext(social_db)
+}
diff --git a/discussions/Cargo.lock b/discussions/Cargo.lock
new file mode 100644
index 0000000..089de0f
--- /dev/null
+++ b/discussions/Cargo.lock
@@ -0,0 +1,475 @@
+# This file is automatically @generated by Cargo.
+# It is not intended for manual editing.
+version = 3
+
+[[package]]
+name = "Inflector"
+version = "0.11.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "fe438c63458706e03479442743baae6c88256498e6431708f6dfc520a26515d3"
+
+[[package]]
+name = "base64"
+version = "0.21.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "35636a1494ede3b646cc98f74f8e62c773a38a659ebc777a2cf26b9b74171df9"
+
+[[package]]
+name = "borsh"
+version = "1.1.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "18a744ac76a433734df0902926ed12edd997391a8da3add87f6d706afc2dcbea"
+dependencies = [
+ "borsh-derive",
+ "cfg_aliases",
+]
+
+[[package]]
+name = "borsh-derive"
+version = "1.1.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b22bf794b9f8c87b51ea4d9e2710907ce13aa81dd2b8ac18a78fcca68ac738ef"
+dependencies = [
+ "once_cell",
+ "proc-macro-crate",
+ "proc-macro2",
+ "quote",
+ "syn",
+ "syn_derive",
+]
+
+[[package]]
+name = "bs58"
+version = "0.5.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f5353f36341f7451062466f0b755b96ac3a9547e4d7f6b70d603fc721a7d7896"
+dependencies = [
+ "tinyvec",
+]
+
+[[package]]
+name = "cfg-if"
+version = "0.1.10"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "4785bdd1c96b2a846b2bd7cc02e86b6b3dbf14e7e53446c4f54c92a361040822"
+
+[[package]]
+name = "cfg_aliases"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "fd16c4719339c4530435d38e511904438d07cce7950afa3718a84ac36c10e89e"
+
+[[package]]
+name = "darling"
+version = "0.20.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "0209d94da627ab5605dcccf08bb18afa5009cfbef48d8a8b7d7bdbc79be25c5e"
+dependencies = [
+ "darling_core",
+ "darling_macro",
+]
+
+[[package]]
+name = "darling_core"
+version = "0.20.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "177e3443818124b357d8e76f53be906d60937f0d3a90773a664fa63fa253e621"
+dependencies = [
+ "fnv",
+ "ident_case",
+ "proc-macro2",
+ "quote",
+ "syn",
+]
+
+[[package]]
+name = "darling_macro"
+version = "0.20.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "836a9bbc7ad63342d6d6e7b815ccab164bc77a2d95d84bc3117a8c0d5c98e2d5"
+dependencies = [
+ "darling_core",
+ "quote",
+ "syn",
+]
+
+[[package]]
+name = "devhub-discussions"
+version = "0.1.0"
+dependencies = [
+ "devhub_common",
+ "near-sdk",
+]
+
+[[package]]
+name = "devhub_common"
+version = "0.1.0"
+dependencies = [
+ "near-sdk",
+]
+
+[[package]]
+name = "equivalent"
+version = "1.0.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5443807d6dff69373d433ab9ef5378ad8df50ca6298caf15de6e52e24aaf54d5"
+
+[[package]]
+name = "fnv"
+version = "1.0.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3f9eec918d3f24069decb9af1554cad7c880e2da24a9afd88aca000531ab82c1"
+
+[[package]]
+name = "hashbrown"
+version = "0.14.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "290f1a1d9242c78d09ce40a5e87e7554ee637af1351968159f4952f028f75604"
+
+[[package]]
+name = "heck"
+version = "0.4.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "95505c38b4572b2d910cecb0281560f54b440a19336cbbcb27bf6ce6adc6f5a8"
+
+[[package]]
+name = "ident_case"
+version = "1.0.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b9e0384b61958566e926dc50660321d12159025e767c18e043daf26b70104c39"
+
+[[package]]
+name = "indexmap"
+version = "2.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d530e1a18b1cb4c484e6e34556a0d948706958449fca0cab753d649f2bce3d1f"
+dependencies = [
+ "equivalent",
+ "hashbrown",
+]
+
+[[package]]
+name = "itoa"
+version = "1.0.10"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b1a46d1a171d865aa5f83f92695765caa047a9b4cbae2cbf37dbd613a793fd4c"
+
+[[package]]
+name = "libc"
+version = "0.2.151"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "302d7ab3130588088d277783b1e2d2e10c9e9e4a16dd9050e6ec93fb3e7048f4"
+
+[[package]]
+name = "memchr"
+version = "2.6.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f665ee40bc4a3c5590afb1e9677db74a508659dfd71e126420da8274909a0167"
+
+[[package]]
+name = "memory_units"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8452105ba047068f40ff7093dd1d9da90898e63dd61736462e9cdda6a90ad3c3"
+
+[[package]]
+name = "near-account-id"
+version = "1.0.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "35cbb989542587b47205e608324ddd391f0cee1c22b4b64ae49f458334b95907"
+dependencies = [
+ "borsh",
+ "serde",
+]
+
+[[package]]
+name = "near-gas"
+version = "0.2.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "14e75c875026229902d065e4435804497337b631ec69ba746b102954273e9ad1"
+dependencies = [
+ "borsh",
+ "serde",
+]
+
+[[package]]
+name = "near-sdk"
+version = "5.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "520234cfdf04a805ac2f04715889d096eb83fdd5b99ca7d0f8027ae473f891a8"
+dependencies = [
+ "base64",
+ "borsh",
+ "bs58",
+ "near-account-id",
+ "near-gas",
+ "near-sdk-macros",
+ "near-sys",
+ "near-token",
+ "once_cell",
+ "serde",
+ "serde_json",
+ "wee_alloc",
+]
+
+[[package]]
+name = "near-sdk-macros"
+version = "5.1.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ee2fe3fc30068c5f20e89b0985d6104c5cc1c6742dbc6efbf352be4189b9bbf7"
+dependencies = [
+ "Inflector",
+ "darling",
+ "proc-macro2",
+ "quote",
+ "serde",
+ "serde_json",
+ "strum",
+ "strum_macros",
+ "syn",
+]
+
+[[package]]
+name = "near-sys"
+version = "0.2.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "397688591acf8d3ebf2c2485ba32d4b24fc10aad5334e3ad8ec0b7179bfdf06b"
+
+[[package]]
+name = "near-token"
+version = "0.2.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7b68f3f8a2409f72b43efdbeff8e820b81e70824c49fee8572979d789d1683fb"
+dependencies = [
+ "borsh",
+ "serde",
+]
+
+[[package]]
+name = "once_cell"
+version = "1.19.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3fdb12b2476b595f9358c5161aa467c2438859caa136dec86c26fdd2efe17b92"
+
+[[package]]
+name = "proc-macro-crate"
+version = "2.0.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "97dc5fea232fc28d2f597b37c4876b348a40e33f3b02cc975c8d006d78d94b1a"
+dependencies = [
+ "toml_datetime",
+ "toml_edit",
+]
+
+[[package]]
+name = "proc-macro-error"
+version = "1.0.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "da25490ff9892aab3fcf7c36f08cfb902dd3e71ca0f9f9517bea02a73a5ce38c"
+dependencies = [
+ "proc-macro-error-attr",
+ "proc-macro2",
+ "quote",
+ "version_check",
+]
+
+[[package]]
+name = "proc-macro-error-attr"
+version = "1.0.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a1be40180e52ecc98ad80b184934baf3d0d29f979574e439af5a55274b35f869"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "version_check",
+]
+
+[[package]]
+name = "proc-macro2"
+version = "1.0.70"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "39278fbbf5fb4f646ce651690877f89d1c5811a3d4acb27700c1cb3cdb78fd3b"
+dependencies = [
+ "unicode-ident",
+]
+
+[[package]]
+name = "quote"
+version = "1.0.33"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5267fca4496028628a95160fc423a33e8b2e6af8a5302579e322e4b520293cae"
+dependencies = [
+ "proc-macro2",
+]
+
+[[package]]
+name = "rustversion"
+version = "1.0.14"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7ffc183a10b4478d04cbbbfc96d0873219d962dd5accaff2ffbd4ceb7df837f4"
+
+[[package]]
+name = "ryu"
+version = "1.0.16"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f98d2aa92eebf49b69786be48e4477826b256916e84a57ff2a4f21923b48eb4c"
+
+[[package]]
+name = "serde"
+version = "1.0.193"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "25dd9975e68d0cb5aa1120c288333fc98731bd1dd12f561e468ea4728c042b89"
+dependencies = [
+ "serde_derive",
+]
+
+[[package]]
+name = "serde_derive"
+version = "1.0.193"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "43576ca501357b9b071ac53cdc7da8ef0cbd9493d8df094cd821777ea6e894d3"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn",
+]
+
+[[package]]
+name = "serde_json"
+version = "1.0.108"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3d1c7e3eac408d115102c4c24ad393e0821bb3a5df4d506a80f85f7a742a526b"
+dependencies = [
+ "itoa",
+ "ryu",
+ "serde",
+]
+
+[[package]]
+name = "strum"
+version = "0.26.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "723b93e8addf9aa965ebe2d11da6d7540fa2283fcea14b3371ff055f7ba13f5f"
+
+[[package]]
+name = "strum_macros"
+version = "0.26.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7a3417fc93d76740d974a01654a09777cb500428cc874ca9f45edfe0c4d4cd18"
+dependencies = [
+ "heck",
+ "proc-macro2",
+ "quote",
+ "rustversion",
+ "syn",
+]
+
+[[package]]
+name = "syn"
+version = "2.0.41"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "44c8b28c477cc3bf0e7966561e3460130e1255f7a1cf71931075f1c5e7a7e269"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "unicode-ident",
+]
+
+[[package]]
+name = "syn_derive"
+version = "0.1.8"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1329189c02ff984e9736652b1631330da25eaa6bc639089ed4915d25446cbe7b"
+dependencies = [
+ "proc-macro-error",
+ "proc-macro2",
+ "quote",
+ "syn",
+]
+
+[[package]]
+name = "tinyvec"
+version = "1.6.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "87cc5ceb3875bb20c2890005a4e226a4651264a5c75edb2421b52861a0a0cb50"
+dependencies = [
+ "tinyvec_macros",
+]
+
+[[package]]
+name = "tinyvec_macros"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1f3ccbac311fea05f86f61904b462b55fb3df8837a366dfc601a0161d0532f20"
+
+[[package]]
+name = "toml_datetime"
+version = "0.6.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "7cda73e2f1397b1262d6dfdcef8aafae14d1de7748d66822d3bfeeb6d03e5e4b"
+
+[[package]]
+name = "toml_edit"
+version = "0.20.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "396e4d48bbb2b7554c944bde63101b5ae446cff6ec4a24227428f15eb72ef338"
+dependencies = [
+ "indexmap",
+ "toml_datetime",
+ "winnow",
+]
+
+[[package]]
+name = "unicode-ident"
+version = "1.0.12"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3354b9ac3fae1ff6755cb6db53683adb661634f67557942dea4facebec0fee4b"
+
+[[package]]
+name = "version_check"
+version = "0.9.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "49874b5167b65d7193b8aba1567f5c7d93d001cafc34600cee003eda787e483f"
+
+[[package]]
+name = "wee_alloc"
+version = "0.4.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "dbb3b5a6b2bb17cb6ad44a2e68a43e8d2722c997da10e928665c72ec6c0a0b8e"
+dependencies = [
+ "cfg-if",
+ "libc",
+ "memory_units",
+ "winapi",
+]
+
+[[package]]
+name = "winapi"
+version = "0.3.9"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5c839a674fcd7a98952e593242ea400abe93992746761e38641405d28b00f419"
+dependencies = [
+ "winapi-i686-pc-windows-gnu",
+ "winapi-x86_64-pc-windows-gnu",
+]
+
+[[package]]
+name = "winapi-i686-pc-windows-gnu"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ac3b87c63620426dd9b991e5ce0329eff545bccbbb34f3be09ff6fb6ab51b7b6"
+
+[[package]]
+name = "winapi-x86_64-pc-windows-gnu"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "712e227841d057c1ee1cd2fb22fa7e5a5461ae8e48fa2ca79ec42cfc1931183f"
+
+[[package]]
+name = "winnow"
+version = "0.5.28"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6c830786f7720c2fd27a1a0e27a709dbd3c4d009b56d098fc742d4f4eab91fe2"
+dependencies = [
+ "memchr",
+]
diff --git a/discussions/Cargo.toml b/discussions/Cargo.toml
new file mode 100644
index 0000000..5af8ed7
--- /dev/null
+++ b/discussions/Cargo.toml
@@ -0,0 +1,21 @@
+[package]
+name = "devhub-discussions"
+version = "0.1.0"
+authors = ["NEAR DevHub <neardevhub.org>"]
+edition = "2021"
+
+[lib]
+crate-type = ["cdylib"]
+
+[dependencies]
+near-sdk = "5.1.0"
+devhub_common = { path = "../devhub_common" }
+
+[profile.release]
+codegen-units = 1
+# Tell `rustc` to optimize for small code size.
+opt-level = "s"
+lto = true
+debug = false
+panic = "abort"
+overflow-checks = true
diff --git a/discussions/src/lib.rs b/discussions/src/lib.rs
new file mode 100644
index 0000000..5307215
--- /dev/null
+++ b/discussions/src/lib.rs
@@ -0,0 +1,47 @@
+use devhub_common::social_db_contract;
+use near_sdk::{env, require, near, AccountId, NearToken, Promise};
+
+#[near(contract_state)]
+#[derive(Default)]
+pub struct Contract {}
+
+#[near]
+impl Contract {
+    #[init]
+    pub fn new() -> Self {
+        social_db_contract()
+            .with_unused_gas_weight(1)
+            .with_attached_deposit(NearToken::from_near(1))
+            .grant_write_permission(
+                Some(Contract::get_devhub_account()),
+                None,
+                vec![env::current_account_id().to_string()],
+            )
+            .as_return();
+        Contract {}
+    }
+
+    pub fn destroy(&mut self) -> Promise {
+        let devhub_account = Contract::get_devhub_account();
+        require!(
+            env::predecessor_account_id() == devhub_account,
+            "Can only destroy community account from DevHub contract"
+        );
+        Promise::new(env::current_account_id()).delete_account(devhub_account)
+    }
+
+    /**
+     * current_account_id = discussions.{{community}}.community.devhub.near
+     * returns devhub.near
+     */
+    fn get_devhub_account() -> AccountId {
+        env::current_account_id()
+            .get_parent_account_id()
+            .expect("Discussions contract should be deployed on a child account")
+            .get_parent_account_id()
+            .expect("Community contract should be deployed on a child account")
+            .get_parent_account_id()
+            .expect("Community factory should be deployed on a child account")
+            .into()
+    }
+}
diff --git a/res/.gitkeep b/res/.gitkeep
new file mode 100644
index 0000000..e69de29
diff --git a/rust-toolchain.toml b/rust-toolchain.toml
new file mode 100644
index 0000000..9ccbc7a
--- /dev/null
+++ b/rust-toolchain.toml
@@ -0,0 +1,4 @@
+[toolchain]
+channel = "1.75.0"
+components = ["rustfmt"]
+targets = ["wasm32-unknown-unknown"]
diff --git a/rustfmt.toml b/rustfmt.toml
new file mode 100644
index 0000000..53efc17
--- /dev/null
+++ b/rustfmt.toml
@@ -0,0 +1,3 @@
+use_small_heuristics = "Max"
+reorder_imports = true
+edition = "2021"
diff --git a/src/access_control/members.rs b/src/access_control/members.rs
new file mode 100644
index 0000000..b934656
--- /dev/null
+++ b/src/access_control/members.rs
@@ -0,0 +1,409 @@
+use crate::access_control::rules::Rule;
+use near_sdk::{near, AccountId};
+use std::collections::hash_map::Entry;
+use std::collections::{HashMap, HashSet};
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone, Debug, PartialOrd, PartialEq, Ord, Eq, Hash)]
+#[serde(from = "String")]
+#[serde(into = "String")]
+pub enum Member {
+    /// NEAR account names do not allow `:` character so this structure cannot be abused.
+    Account(AccountId),
+    Team(String),
+}
+
+/// JSON string representation prefix of `Member::Team` variant.
+const TEAM: &str = "team:";
+
+impl From<String> for Member {
+    fn from(full_str: String) -> Self {
+        if let Some(s) = full_str.strip_prefix(TEAM) {
+            Member::Team(s.to_string())
+        } else {
+            Member::Account(full_str.parse().unwrap())
+        }
+    }
+}
+
+impl Into<String> for Member {
+    fn into(self) -> String {
+        match self {
+            Member::Account(s) => s.to_string(),
+            Member::Team(s) => format!("{}{}", TEAM, s).to_string(),
+        }
+    }
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone, Default, Debug, Eq, PartialEq)]
+pub struct MemberMetadata {
+    pub description: String,
+    pub permissions: HashMap<Rule, HashSet<ActionType>>,
+    pub children: HashSet<Member>,
+    pub parents: HashSet<Member>,
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone, PartialOrd, PartialEq, Ord, Eq, Hash, Debug)]
+#[serde(rename_all = "kebab-case")]
+pub enum ActionType {
+    /// Can edit posts that have these labels.
+    EditPost,
+    /// Can add/remove labels that fall under these rules.
+    UseLabels,
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone, Debug, Eq, PartialEq)]
+#[serde(tag = "member_metadata_version")]
+pub enum VersionedMemberMetadata {
+    V0(MemberMetadata),
+}
+
+impl VersionedMemberMetadata {
+    pub fn last_version(&self) -> MemberMetadata {
+        match self {
+            VersionedMemberMetadata::V0(v0) => v0.clone(),
+        }
+    }
+}
+
+impl From<MemberMetadata> for VersionedMemberMetadata {
+    fn from(m: MemberMetadata) -> Self {
+        VersionedMemberMetadata::V0(m)
+    }
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone, Debug, Eq, PartialEq, Default)]
+pub struct MembersList {
+    #[serde(flatten)]
+    pub members: HashMap<Member, VersionedMemberMetadata>,
+}
+
+impl MembersList {
+    /// Get members that do not belong to any team.
+    pub fn get_root_members(&self) -> HashMap<Member, VersionedMemberMetadata> {
+        self.members
+            .iter()
+            .filter(|(_, v)| v.last_version().parents.is_empty())
+            .map(|(k, v)| (k.clone(), v.clone()))
+            .collect()
+    }
+
+    /// Whether given account has special permissions for a post with the given labels.
+    /// Labels are restricted labels.
+    pub fn check_permissions(
+        &self,
+        account: AccountId,
+        labels: Vec<String>,
+    ) -> HashSet<ActionType> {
+        let member_account = Member::Account(account);
+        if !self.members.contains_key(&member_account) {
+            return HashSet::new();
+        }
+
+        let mut stack = HashSet::new();
+        stack.insert(member_account);
+
+        let mut permissions = HashSet::new();
+        while let Some(member) = stack.iter().next().cloned() {
+            stack.remove(&member);
+
+            let metadata = self
+                .members
+                .get(&member)
+                .unwrap_or_else(|| panic!("Metadata not found for {:#?}", member))
+                .last_version();
+
+            for (member_rule, member_permissions) in metadata.permissions {
+                if member_rule.applies_to_any(&labels) {
+                    permissions.extend(member_permissions);
+                }
+            }
+
+            stack.extend(metadata.parents);
+        }
+        permissions
+    }
+
+    pub fn add_member(&mut self, member: Member, metadata: VersionedMemberMetadata) {
+        assert!(
+            self.members.insert(member.clone(), metadata.clone()).is_none(),
+            "Member already exists"
+        );
+
+        // Update child members that this member is a parent of.
+        for child in &metadata.last_version().children {
+            match self.members.entry(child.clone()) {
+                Entry::Occupied(mut occ) => {
+                    let MemberMetadata { description, children, mut parents, permissions } =
+                        occ.get().last_version();
+                    assert!(parents.insert(member.clone()), "Child already had this parent");
+                    let new_child = MemberMetadata { description, children, parents, permissions };
+                    occ.insert(new_child.into());
+                }
+                Entry::Vacant(_) => {
+                    panic!("Member declares a child {:#?} that does not exist", child)
+                }
+            }
+        }
+
+        // Update parent members that this member is now a child of.
+        for parent in &metadata.last_version().parents {
+            match self.members.entry(parent.clone()) {
+                Entry::Occupied(mut occ) => {
+                    let MemberMetadata { description, mut children, parents, permissions } =
+                        occ.get().last_version();
+                    assert!(children.insert(member.clone()), "Parent already had this child");
+                    let new_parent = MemberMetadata { description, children, parents, permissions };
+                    occ.insert(new_parent.into());
+                }
+                Entry::Vacant(_) => {
+                    panic!("Member declares a parent {:#?} that does not exist", parent)
+                }
+            }
+        }
+    }
+
+    pub fn remove_member(&mut self, member: &Member) {
+        let metadata = self.members.remove(member).expect("Member does not exist");
+
+        // Update child members that this member is not a parent of anymore.
+        for child in &metadata.last_version().children {
+            match self.members.entry(child.clone()) {
+                Entry::Occupied(mut occ) => {
+                    let MemberMetadata { description, children, mut parents, permissions } =
+                        occ.get().last_version();
+                    assert!(parents.remove(member), "Child did not have this parent.");
+                    let new_child = MemberMetadata { description, children, parents, permissions };
+                    occ.insert(new_child.into());
+                }
+                Entry::Vacant(_) => {
+                    panic!("Member declares a child {:#?} that does not exist", child)
+                }
+            }
+        }
+
+        // Update parent members that this member is not a child of anymore.
+        for parent in &metadata.last_version().parents {
+            match self.members.entry(parent.clone()) {
+                Entry::Occupied(mut occ) => {
+                    let MemberMetadata { description, mut children, parents, permissions } =
+                        occ.get().last_version();
+                    assert!(children.remove(member), "Parent did not have this child.");
+                    let new_parent = MemberMetadata { description, children, parents, permissions };
+                    occ.insert(new_parent.into());
+                }
+                Entry::Vacant(_) => {
+                    panic!("Member declares a parent {:#?} that does not exist", parent)
+                }
+            }
+        }
+    }
+
+    pub fn edit_member(&mut self, member: Member, metadata: VersionedMemberMetadata) {
+        self.remove_member(&member);
+        self.add_member(member, metadata);
+    }
+
+    pub fn get_moderators(&self) -> HashSet<Member> {
+        self.members
+            .get(&Member::Team("moderators".to_string()))
+            .map(|team| team.last_version().children)
+            .unwrap_or(HashSet::new())
+    }
+}
+
+#[cfg(test)]
+mod tests {
+    use crate::access_control::members::{
+        ActionType, Member, MemberMetadata, MembersList, VersionedMemberMetadata,
+    };
+    use crate::access_control::rules::Rule;
+    use near_sdk::serde_json;
+    use std::collections::{HashMap, HashSet};
+
+    #[test]
+    fn member_serialization() {
+        let member = Member::Account("alice.near".parse().unwrap());
+        assert_eq!(serde_json::to_value(&member).unwrap(), serde_json::json!("alice.near"));
+
+        let member = Member::Team("funding".to_string());
+        assert_eq!(serde_json::to_value(&member).unwrap(), serde_json::json!("team:funding"));
+    }
+
+    #[test]
+    fn member_deserialization() {
+        let member: Member = serde_json::from_str(r#""alice.near""#).unwrap();
+        assert_eq!(member, Member::Account("alice.near".parse().unwrap()));
+
+        let member: Member = serde_json::from_str(r#""team:funding""#).unwrap();
+        assert_eq!(member, Member::Team("funding".to_string()));
+    }
+
+    fn root_member() -> (Member, VersionedMemberMetadata) {
+        (
+            Member::Account("devgovgigs.near".parse().unwrap()),
+            MemberMetadata {
+                description: "Main account can do anything".to_string(),
+                permissions: HashMap::from([
+                    (
+                        Rule::StartsWith("wg-".to_string()),
+                        HashSet::from([ActionType::EditPost, ActionType::UseLabels]),
+                    ),
+                    (
+                        Rule::StartsWith("funding".to_string()),
+                        HashSet::from([ActionType::EditPost, ActionType::UseLabels]),
+                    ),
+                    (
+                        Rule::StartsWith("mnw".to_string()),
+                        HashSet::from([ActionType::EditPost, ActionType::UseLabels]),
+                    ),
+                ]),
+                ..Default::default()
+            }
+            .into(),
+        )
+    }
+
+    fn moderator_member(name: &str) -> (Member, VersionedMemberMetadata) {
+        (
+            Member::Account(name.parse().unwrap()),
+            MemberMetadata {
+                description: format!("{} inherits everything from moderator group.", name)
+                    .to_string(),
+                parents: HashSet::from([Member::Team("moderators".to_string())]),
+                ..Default::default()
+            }
+            .into(),
+        )
+    }
+
+    fn moderators() -> (Member, VersionedMemberMetadata) {
+        (
+            Member::Team("moderators".to_string()),
+            MemberMetadata {
+                description: "Moderators can do anything except funding posts.".to_string(),
+                permissions: HashMap::from([
+                    (
+                        Rule::StartsWith("wg-".to_string()),
+                        HashSet::from([ActionType::EditPost, ActionType::UseLabels]),
+                    ),
+                    (
+                        Rule::StartsWith("mnw".to_string()),
+                        HashSet::from([ActionType::EditPost, ActionType::UseLabels]),
+                    ),
+                ]),
+                children: HashSet::from([
+                    Member::Account("ori.near".parse().unwrap()),
+                    Member::Account("max.near".parse().unwrap()),
+                    Member::Account("vlad.near".parse().unwrap()),
+                ]),
+                ..Default::default()
+            }
+            .into(),
+        )
+    }
+
+    fn create_list() -> MembersList {
+        MembersList {
+            members: HashMap::from([
+                moderators(),
+                root_member(),
+                moderator_member("ori.near"),
+                moderator_member("max.near"),
+                moderator_member("vlad.near"),
+            ]),
+        }
+    }
+
+    #[test]
+    fn get_root_members() {
+        let list = create_list();
+        let root_members: HashSet<_> = list.get_root_members().keys().cloned().collect();
+        assert_eq!(
+            root_members,
+            HashSet::from([
+                Member::Team("moderators".to_string()),
+                Member::Account("devgovgigs.near".parse().unwrap())
+            ])
+        );
+    }
+
+    #[test]
+    fn check_permissions() {
+        let list = create_list();
+        let actual = list.check_permissions(
+            "max.near".parse().unwrap(),
+            vec!["wg-protocol".to_string(), "funding-requested".to_string()],
+        );
+        assert_eq!(
+            actual,
+            serde_json::from_value::<HashSet<ActionType>>(serde_json::json!([
+                "edit-post",
+                "use-labels"
+            ]))
+            .unwrap()
+        );
+
+        let actual = list
+            .check_permissions("max.near".parse().unwrap(), vec!["funding-requested".to_string()]);
+        assert!(actual.is_empty());
+    }
+
+    #[test]
+    fn check_permissions_rules_any() {
+        let mut list = create_list();
+        let given_permissions = HashSet::from([ActionType::EditPost, ActionType::UseLabels]);
+        list.add_member(
+            Member::Account("thomasguntenaar.near".parse().unwrap()),
+            MemberMetadata {
+                description: "Account has `Any` rules without labels".to_string(),
+                permissions: HashMap::from([(Rule::Any(), given_permissions.clone())]),
+                ..Default::default()
+            }
+            .into(),
+        );
+        // Without labels
+        assert_eq!(
+            list.check_permissions("thomasguntenaar.near".parse().unwrap(), vec![]),
+            given_permissions,
+        );
+
+        // With labels
+        assert_eq!(
+            list.check_permissions(
+                "thomasguntenaar.near".parse().unwrap(),
+                vec!["funding-requested".to_string()]
+            ),
+            given_permissions,
+        )
+    }
+
+    #[test]
+    fn check_permissions_of_not_member() {
+        let list = create_list();
+        let actual: HashSet<ActionType> = list.check_permissions(
+            "random.near".parse().unwrap(),
+            vec!["wg-protocol".to_string(), "funding-requested".to_string()],
+        );
+        assert!(actual.is_empty());
+    }
+
+    #[test]
+    fn add_remove_member() {
+        let mut list = create_list();
+        list.add_member(
+            Member::Account("bob.near".parse().unwrap()),
+            MemberMetadata {
+                parents: HashSet::from([Member::Team("moderators".to_string())]),
+                ..Default::default()
+            }
+            .into(),
+        );
+        list.remove_member(&Member::Account("bob.near".parse().unwrap()));
+        assert_eq!(list, create_list());
+    }
+}
diff --git a/src/access_control/mod.rs b/src/access_control/mod.rs
new file mode 100644
index 0000000..783108d
--- /dev/null
+++ b/src/access_control/mod.rs
@@ -0,0 +1,79 @@
+use crate::access_control::members::{Member, MembersList, VersionedMemberMetadata};
+use crate::access_control::rules::{Rule, RulesList};
+use crate::*;
+use near_sdk::near;
+use std::collections::{HashMap, HashSet};
+
+pub mod members;
+pub mod rules;
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone, Default)]
+pub struct AccessControl {
+    pub rules_list: RulesList,
+    pub members_list: MembersList,
+}
+
+#[near]
+impl Contract {
+    pub fn get_access_control_info(&self) -> &AccessControl {
+        &self.access_control
+    }
+
+    pub fn is_restricted_label(&self, label: String) -> bool {
+        self.access_control.rules_list.is_restricted(&label)
+    }
+
+    pub fn find_restricted_labels(&self, labels: Vec<String>) -> HashSet<String> {
+        self.access_control.rules_list.find_restricted(&labels)
+    }
+
+    pub fn set_restricted_rules(&mut self, rules: RulesList) {
+        require!(
+            self.has_moderator(env::predecessor_account_id())
+                || env::predecessor_account_id() == env::current_account_id(),
+            "Only the admin and moderators can set restricted rules"
+        );
+        self.access_control.rules_list.set_restricted(rules)
+    }
+
+    pub fn unset_restricted_rules(&mut self, rules: Vec<Rule>) {
+        require!(
+            self.has_moderator(env::predecessor_account_id())
+                || env::predecessor_account_id() == env::current_account_id(),
+            "Only the admin and moderators can unset restricted rules"
+        );
+        self.access_control.rules_list.unset_restricted(rules)
+    }
+
+    pub fn get_root_members(&self) -> HashMap<Member, VersionedMemberMetadata> {
+        self.access_control.members_list.get_root_members()
+    }
+
+    pub fn add_member(&mut self, member: Member, metadata: VersionedMemberMetadata) {
+        require!(
+            self.has_moderator(env::predecessor_account_id())
+                || env::predecessor_account_id() == env::current_account_id(),
+            "Only the admin and moderators can add members"
+        );
+        self.access_control.members_list.add_member(member, metadata)
+    }
+
+    pub fn remove_member(&mut self, member: &Member) {
+        require!(
+            self.has_moderator(env::predecessor_account_id())
+                || env::predecessor_account_id() == env::current_account_id(),
+            "Only the admin and moderators can remove members"
+        );
+        self.access_control.members_list.remove_member(member)
+    }
+
+    pub fn edit_member(&mut self, member: Member, metadata: VersionedMemberMetadata) {
+        require!(
+            self.has_moderator(env::predecessor_account_id())
+                || env::predecessor_account_id() == env::current_account_id(),
+            "Only the admin and moderators can edit members"
+        );
+        self.access_control.members_list.edit_member(member, metadata)
+    }
+}
diff --git a/src/access_control/rules.rs b/src/access_control/rules.rs
new file mode 100644
index 0000000..a9331d0
--- /dev/null
+++ b/src/access_control/rules.rs
@@ -0,0 +1,237 @@
+use near_sdk::near;
+use std::collections::{HashMap, HashSet};
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone, Debug, Eq, PartialEq, Default)]
+pub struct RulesList {
+    #[serde(flatten)]
+    pub rules: HashMap<Rule, VersionedRuleMetadata>,
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone, Debug, Eq, PartialEq)]
+pub struct RuleMetadata {
+    pub description: String,
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone, Debug, Eq, PartialEq)]
+#[serde(tag = "rule_metadata_version")]
+pub enum VersionedRuleMetadata {
+    V0(RuleMetadata),
+}
+
+impl From<RuleMetadata> for VersionedRuleMetadata {
+    fn from(rm: RuleMetadata) -> Self {
+        VersionedRuleMetadata::V0(rm)
+    }
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone, PartialOrd, PartialEq, Ord, Eq, Hash, Debug)]
+#[serde(from = "String", into = "String")]
+pub enum Rule {
+    /// Labels can be any string, but rules are created by the NEAR account owner of this contract,
+    /// or small circle of moderators. So this code cannot be abused. Likely creating a label that
+    /// mimics a rule makes this label only more restrictive, so there might be nothing to exploit.
+    /// TODO: Add extra logic to prevent malicious rules creation by creating labels that mimic rules.
+    ExactMatch(String),
+    StartsWith(String),
+    Any(),
+}
+
+/// JSON string representation prefix of Rule::StartsWith variant.
+const STARTS_WITH: &str = "starts-with:";
+const ANY: &str = "*";
+
+impl From<String> for Rule {
+    fn from(full_str: String) -> Self {
+        if full_str == ANY {
+            Rule::Any()
+        } else if let Some(s) = full_str.strip_prefix(STARTS_WITH) {
+            Rule::StartsWith(s.to_string())
+        } else {
+            Rule::ExactMatch(full_str)
+        }
+    }
+}
+
+impl Into<String> for Rule {
+    fn into(self) -> String {
+        match self {
+            Rule::ExactMatch(s) => s.to_string(),
+            Rule::StartsWith(s) => format!("{}{}", STARTS_WITH, s).to_string(),
+            Rule::Any() => ANY.to_string(),
+        }
+    }
+}
+
+impl Rule {
+    /// Check if this rule applies to a label.
+    pub fn applies(&self, label: &str) -> bool {
+        match self {
+            Rule::ExactMatch(rule) => label == rule,
+            Rule::StartsWith(rule) => label.starts_with(rule),
+            Rule::Any() => true,
+        }
+    }
+
+    /// Check if this rule applies to any of the labels.
+    pub fn applies_to_any(&self, labels: &[String]) -> bool {
+        match self {
+            Rule::ExactMatch(rule) => labels.iter().any(|label| label == rule),
+            Rule::StartsWith(rule) => labels.iter().any(|label| label.starts_with(rule.as_str())),
+            Rule::Any() => true,
+        }
+    }
+}
+
+impl RulesList {
+    /// Is this a restricted label.
+    pub fn is_restricted(&self, label: &str) -> bool {
+        self.rules.keys().any(|rule| rule.applies(label))
+    }
+
+    /// Get restricted labels out of this list.
+    pub fn find_restricted(&self, labels: &[String]) -> HashSet<String> {
+        self.rules
+            .keys()
+            .map(|key| match key {
+                Rule::ExactMatch(rule) => {
+                    labels.iter().filter(|label| label == &rule).collect::<Vec<_>>()
+                }
+                Rule::StartsWith(rule) => {
+                    labels.iter().filter(|label| label.starts_with(rule)).collect::<Vec<_>>()
+                }
+                Rule::Any() => {
+                    vec![]
+                }
+            })
+            .flatten()
+            .cloned()
+            .collect()
+    }
+
+    /// Set rules as restricted. Can be also used to override metadata on existing rules.
+    pub fn set_restricted(&mut self, rules: Self) {
+        for (rule, metadata) in rules.rules {
+            self.rules.insert(rule, metadata);
+        }
+    }
+
+    /// Unset rules as restricted.
+    pub fn unset_restricted(&mut self, rules: Vec<Rule>) {
+        for rule in rules {
+            self.rules.remove(&rule);
+        }
+    }
+}
+
+#[cfg(test)]
+mod tests {
+    use crate::access_control::rules::{Rule, RuleMetadata, RulesList};
+    use near_sdk::serde_json;
+    use std::collections::{HashMap, HashSet};
+
+    #[test]
+    fn rule_serialization() {
+        let rule = Rule::ExactMatch("wg-protocol".to_string());
+        assert_eq!(serde_json::to_value(&rule).unwrap(), serde_json::json!("wg-protocol"));
+
+        let rule = Rule::StartsWith("funding".to_string());
+        assert_eq!(serde_json::to_value(&rule).unwrap(), serde_json::json!("starts-with:funding"));
+    }
+
+    #[test]
+    fn rule_deserialization() {
+        let rule: Rule = serde_json::from_str(r#""wg-protocol""#).unwrap();
+        assert_eq!(rule, Rule::ExactMatch("wg-protocol".to_string()));
+
+        let rule: Rule = serde_json::from_str(r#""starts-with:funding""#).unwrap();
+        assert_eq!(rule, Rule::StartsWith("funding".to_string()));
+    }
+
+    fn create_list() -> RulesList {
+        RulesList {
+            rules: HashMap::from([
+                (
+                    Rule::ExactMatch("wg-protocol".to_string()),
+                    RuleMetadata { description: "For Protocol WG only".to_string() }.into(),
+                ),
+                (
+                    Rule::ExactMatch("wg-tools".to_string()),
+                    RuleMetadata { description: "For Tools WG only".to_string() }.into(),
+                ),
+                (
+                    Rule::StartsWith("funding".to_string()),
+                    RuleMetadata { description: "For funding team only".to_string() }.into(),
+                ),
+                (
+                    Rule::StartsWith("mnw".to_string()),
+                    RuleMetadata { description: "For Wallet WG only".to_string() }.into(),
+                ),
+            ]),
+        }
+    }
+
+    #[test]
+    fn rule_list_serialization_deserialization() {
+        let list = create_list();
+
+        let list_json = serde_json::json!(
+            {
+                "wg-protocol": { "description": "For Protocol WG only", "rule_metadata_version": "V0"},
+                "wg-tools": {"description": "For Tools WG only", "rule_metadata_version": "V0" },
+                "starts-with:funding": {"description": "For funding team only", "rule_metadata_version": "V0" },
+                "starts-with:mnw": {"description": "For Wallet WG only", "rule_metadata_version": "V0" }
+            }
+        );
+        assert_eq!(serde_json::to_value(list.clone()).unwrap(), list_json);
+        assert_eq!(serde_json::from_value::<RulesList>(list_json).unwrap(), list);
+    }
+
+    #[test]
+    fn is_restricted() {
+        let list = create_list();
+        assert!(list.is_restricted(&"wg-protocol".to_string()));
+        assert!(list.is_restricted(&"wg-tools".to_string()));
+        assert!(!list.is_restricted(&"wg-wallet".to_string()));
+        assert!(list.is_restricted(&"funding".to_string()));
+        assert!(list.is_restricted(&"fundingfoobar".to_string()));
+        assert!(list.is_restricted(&"funding-requested".to_string()));
+        assert!(!list.is_restricted(&"nofunding".to_string()));
+        assert!(list.is_restricted(&"mnw".to_string()));
+        assert!(list.is_restricted(&"mnw-approved".to_string()));
+        assert!(!list.is_restricted(&"nomnw".to_string()));
+    }
+
+    #[test]
+    fn find_restricted() {
+        let list = create_list();
+        let actual = list.find_restricted(&[
+            "wg-protocol".to_string(),
+            "wg-tools".to_string(),
+            "wg-wallet".to_string(),
+            "funding".to_string(),
+            "funding".to_string(),
+            "fundingfoobar".to_string(),
+            "fundingfoobar".to_string(),
+            "funding-requested".to_string(),
+            "nofunding".to_string(),
+            "nofunding".to_string(),
+            "mnw".to_string(),
+            "mnw-approved".to_string(),
+            "nomnw".to_string(),
+        ]);
+        let expected = HashSet::from([
+            "wg-protocol".to_string(),
+            "wg-tools".to_string(),
+            "funding".to_string(),
+            "fundingfoobar".to_string(),
+            "funding-requested".to_string(),
+            "mnw".to_string(),
+            "mnw-approved".to_string(),
+        ]);
+        assert_eq!(actual, expected);
+    }
+}
diff --git a/src/community/mod.rs b/src/community/mod.rs
new file mode 100644
index 0000000..1959202
--- /dev/null
+++ b/src/community/mod.rs
@@ -0,0 +1,211 @@
+use near_sdk::{env, ext_contract, near, require, AccountId, Gas, NearToken};
+
+pub type CommunityHandle = String;
+
+pub type AddOnId = String;
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+pub struct CommunityInputs {
+    pub handle: CommunityHandle,
+    pub name: String,
+    pub tag: String,
+    pub description: String,
+    pub logo_url: String,
+    pub banner_url: String,
+    pub bio_markdown: Option<String>,
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+pub struct CommunityMetadata {
+    pub admins: Vec<AccountId>,
+    pub handle: CommunityHandle,
+    pub name: String,
+    pub tag: String,
+    pub description: String,
+    pub logo_url: String,
+    pub banner_url: String,
+    pub bio_markdown: Option<String>,
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+pub struct CommunityFeatureFlags {
+    pub telegram: bool,
+    pub github: bool,
+    pub board: bool,
+    pub wiki: bool,
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+pub struct WikiPage {
+    name: String,
+    content_markdown: String,
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone, PartialEq, Debug)]
+pub struct CommunityAddOn {
+    pub id: String,
+    pub addon_id: AddOnId,
+    pub display_name: String,
+    pub enabled: bool,
+    pub parameters: String,
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone, PartialEq, Debug)]
+pub struct AddOn {
+    pub id: AddOnId,
+    pub title: String,
+    pub description: String,
+    pub icon: String,
+    // The path to the view on the community page
+    pub view_widget: String,
+    // The path to the view on the community configuration page
+    pub configurator_widget: String,
+}
+
+impl AddOn {
+    pub fn validate(&self) {
+        if !matches!(self.id.chars().count(), 3..=120) {
+            panic!("Add-on id must contain 3 to 120 characters");
+        }
+
+        if !matches!(self.title.chars().count(), 3..=120) {
+            panic!("Add-on title must contain 3 to 120 characters");
+        }
+
+        if !matches!(self.description.chars().count(), 3..=120) {
+            panic!("Add-on description must contain 3 to 120 characters");
+        }
+        if !matches!(self.view_widget.chars().count(), 6..=240) {
+            panic!("Add-on viewer must contain 6 to 240 characters");
+        }
+        if !matches!(self.configurator_widget.chars().count(), 0..=240) {
+            panic!("Add-on configurator must contain 0 to 240 characters");
+        }
+        if !matches!(self.icon.chars().count(), 6..=60) {
+            panic!("Add-on icon must contain 6 to 60 characters");
+        }
+    }
+}
+
+#[near(serializers=[borsh, json])]
+pub struct Community {
+    pub admins: Vec<AccountId>,
+    pub handle: CommunityHandle,
+    pub name: String,
+    pub tag: String,
+    pub description: String,
+    pub logo_url: String,
+    pub banner_url: String,
+    pub bio_markdown: Option<String>,
+    pub github_handle: Option<String>,
+    pub telegram_handle: Option<String>,
+    pub twitter_handle: Option<String>,
+    pub website_url: Option<String>,
+    pub addons: Vec<CommunityAddOn>,
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+pub struct FeaturedCommunity {
+    pub handle: CommunityHandle,
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+pub struct CommunityPermissions {
+    pub can_configure: bool,
+    pub can_delete: bool,
+}
+
+impl Community {
+    pub fn validate(&self) {
+        require!(
+            matches!(self.handle.chars().count(), 3..=40),
+            "Community handle must contain 3 to 40 characters"
+        );
+        require!(
+            self.handle.parse::<AccountId>().is_ok() && !self.handle.contains('.'),
+            "Community handle should be lowercase alphanumeric symbols separated either by `_` or `-`, separators are not permitted to immediately follow each other, start or end with separators"
+        );
+        require!(
+            matches!(self.name.chars().count(), 3..=30),
+            "Community name must contain 3 to 30 characters"
+        );
+        require!(
+            matches!(self.tag.chars().count(), 3..=30),
+            "Community tag must contain 3 to 30 characters"
+        );
+        require!(
+            matches!(self.description.chars().count(), 6..=60),
+            "Community description must contain 6 to 60 characters"
+        );
+        require!(
+            self.bio_markdown.is_none()
+                || matches!(
+                    self.bio_markdown.to_owned().map_or(0, |text| text.chars().count()),
+                    3..=200
+                ),
+            "Community bio must contain 3 to 200 characters"
+        );
+    }
+
+    pub fn add_addon(&mut self, addon_config: CommunityAddOn) {
+        self.addons.push(addon_config);
+    }
+
+    pub fn remove_addon(&mut self, addon_to_remove: CommunityAddOn) {
+        self.addons.retain(|addon| addon != &addon_to_remove);
+    }
+
+    pub fn set_addons(&mut self, addons: Vec<CommunityAddOn>) {
+        self.addons = addons;
+    }
+
+    pub fn set_default_admin(&mut self) {
+        if self.admins.is_empty() {
+            self.admins = vec![env::predecessor_account_id()];
+        }
+    }
+}
+
+pub fn get_devhub_community_factory() -> AccountId {
+    format!("community.{}", env::current_account_id()).parse().unwrap()
+}
+
+pub fn get_devhub_discussions_factory(handle: &CommunityHandle) -> AccountId {
+    get_devhub_community_account(handle).parse().unwrap()
+}
+
+pub fn get_devhub_community_account(handle: &CommunityHandle) -> String {
+    format!("{}.{}", handle, get_devhub_community_factory())
+}
+
+pub fn get_devhub_discussions_account(handle: &CommunityHandle) -> String {
+    format!("discussions.{}", get_devhub_community_account(handle))
+}
+
+#[ext_contract(ext_devhub_community_factory)]
+pub trait DevhubCommunityFactory {
+    fn create_community_account(&mut self, community: String);
+}
+
+#[ext_contract(ext_devhub_community)]
+pub trait DevhubCommunity {
+    fn destroy(&mut self);
+
+    fn create_discussions_account(&mut self);
+}
+
+pub const CREATE_COMMUNITY_BALANCE: NearToken = NearToken::from_near(4);
+pub const CREATE_DISCUSSION_BALANCE: NearToken = NearToken::from_near(2);
+pub const CREATE_COMMUNITY_GAS: Gas = Gas::from_tgas(200);
+pub const UPDATE_COMMUNITY_GAS: Gas = Gas::from_tgas(30);
+pub const DELETE_COMMUNITY_GAS: Gas = Gas::from_tgas(30);
+pub const SET_COMMUNITY_SOCIALDB_GAS: Gas = Gas::from_tgas(30);
+pub const CREATE_DISCUSSION_GAS: Gas = Gas::from_tgas(30);
diff --git a/src/debug.rs b/src/debug.rs
new file mode 100644
index 0000000..2e52a19
--- /dev/null
+++ b/src/debug.rs
@@ -0,0 +1,32 @@
+use crate::*;
+use near_sdk::near;
+use near_sdk::serde::{Deserialize, Serialize};
+
+#[derive(Serialize, Deserialize)]
+#[serde(crate = "near_sdk::serde")]
+pub struct Stats {
+    pub num_posts: u64,
+}
+
+#[near]
+impl Contract {
+    pub fn get_post_to_parent(&self) -> Vec<(PostId, PostId)> {
+        let mut res = vec![];
+        for child_id in 0..self.posts.len() {
+            if let Some(parent_id) = self.post_to_parent.get(&child_id) {
+                res.push((child_id, parent_id));
+            }
+        }
+        res
+    }
+
+    pub fn get_parent_to_children(&self) -> Vec<(PostId, Vec<PostId>)> {
+        let mut res = vec![];
+        for parent_id in 0..self.posts.len() {
+            if let Some(children_ids) = self.post_to_children.get(&parent_id) {
+                res.push((parent_id, children_ids));
+            }
+        }
+        res
+    }
+}
diff --git a/src/lib.rs b/src/lib.rs
new file mode 100644
index 0000000..687aacf
--- /dev/null
+++ b/src/lib.rs
@@ -0,0 +1,1301 @@
+pub mod access_control;
+pub mod community;
+pub mod debug;
+pub mod migrations;
+mod notify;
+pub mod post;
+pub mod proposal;
+mod repost;
+pub mod rfp;
+pub mod stats;
+pub mod str_serializers;
+pub mod web4;
+
+use crate::access_control::members::ActionType;
+use crate::access_control::members::Member;
+use crate::access_control::AccessControl;
+use community::*;
+use post::*;
+use proposal::timeline::TimelineStatus;
+use proposal::*;
+use rfp::{
+    RFPId, RFPSnapshot, TimelineStatus as RFPTimelineStatus, VersionedRFP, VersionedRFPBody, RFP,
+};
+
+use devhub_common::{social_db_contract, SetReturnType};
+
+use near_sdk::borsh::BorshDeserialize;
+use near_sdk::collections::{LookupMap, UnorderedMap, Vector};
+use near_sdk::serde::{Deserialize, Serialize};
+use near_sdk::serde_json::{json, Number, Value};
+use near_sdk::store::Lazy;
+use near_sdk::{env, near, require, AccountId, NearSchema, PanicOnDefault, Promise};
+use web4::types::{Web4Request, Web4Response};
+
+use std::collections::{HashMap, HashSet};
+use std::convert::TryInto;
+
+type PostId = u64;
+type IdeaId = u64;
+type AttestationId = u64;
+type SolutionId = u64;
+type SponsorshipId = u64;
+type CommentId = u64;
+
+/// An imaginary top post representing the landing page.
+const ROOT_POST_ID: u64 = u64::MAX;
+
+#[near(contract_state)]
+#[derive(PanicOnDefault)]
+pub struct Contract {
+    pub posts: Vector<VersionedPost>,
+    pub post_to_parent: LookupMap<PostId, PostId>,
+    pub post_to_children: LookupMap<PostId, Vec<PostId>>,
+    pub label_to_posts: UnorderedMap<String, HashSet<PostId>>,
+    pub access_control: AccessControl,
+    pub authors: UnorderedMap<AccountId, HashSet<PostId>>,
+    pub proposals: Vector<VersionedProposal>,
+    pub label_to_proposals: UnorderedMap<String, HashSet<ProposalId>>,
+    pub author_proposals: UnorderedMap<AccountId, HashSet<ProposalId>>,
+    pub proposal_categories: Vec<String>,
+    pub rfps: Vector<VersionedRFP>,
+    pub label_to_rfps: UnorderedMap<String, HashSet<RFPId>>,
+    pub global_labels_info: Lazy<HashMap<String, LabelInfo>>,
+    pub communities: UnorderedMap<CommunityHandle, Community>,
+    pub featured_communities: Vec<FeaturedCommunity>,
+    pub available_addons: UnorderedMap<AddOnId, AddOn>,
+}
+
+#[near]
+impl Contract {
+    #[init]
+    pub fn new() -> Self {
+        migrations::state_version_write(&migrations::StateVersion::V11);
+
+        let mut contract = Self {
+            posts: Vector::new(StorageKey::Posts),
+            post_to_parent: LookupMap::new(StorageKey::PostToParent),
+            post_to_children: LookupMap::new(StorageKey::PostToChildren),
+            label_to_posts: UnorderedMap::new(StorageKey::LabelToPostsV2),
+            access_control: AccessControl::default(),
+            authors: UnorderedMap::new(StorageKey::AuthorToAuthorPosts),
+            proposals: Vector::new(StorageKey::Proposals),
+            label_to_proposals: UnorderedMap::new(StorageKey::LabelToProposals),
+            author_proposals: UnorderedMap::new(StorageKey::AuthorProposals),
+            proposal_categories: default_categories(),
+            rfps: Vector::new(StorageKey::RFPs),
+            label_to_rfps: UnorderedMap::new(StorageKey::LabelToRFPs),
+            global_labels_info: Lazy::new(StorageKey::LabelInfo, HashMap::new()),
+            communities: UnorderedMap::new(StorageKey::Communities),
+            featured_communities: Vec::new(),
+            available_addons: UnorderedMap::new(StorageKey::AddOns),
+        };
+
+        contract.post_to_children.insert(&ROOT_POST_ID, &Vec::new());
+        contract
+    }
+
+    /// If `parent_id` is not provided get all landing page posts. Otherwise, get all posts under
+    /// `parent_id` post.
+    pub fn get_posts(&self, parent_id: Option<PostId>) -> Vec<VersionedPost> {
+        let parent_id = parent_id.unwrap_or(ROOT_POST_ID);
+        let children_ids = self
+            .post_to_children
+            .get(&parent_id)
+            .unwrap_or_else(|| panic!("Parent id {} not found", parent_id));
+        children_ids
+            .into_iter()
+            .map(|id| {
+                self.posts
+                    .get(id)
+                    .unwrap_or_else(|| panic!("Post id {} not found. Broken state invariant", id))
+            })
+            .collect()
+    }
+
+    pub fn get_post(&self, post_id: PostId) -> VersionedPost {
+        self.posts.get(post_id).unwrap_or_else(|| panic!("Post id {} not found", post_id))
+    }
+
+    pub fn get_all_post_ids(&self) -> Vec<PostId> {
+        (0..self.posts.len()).collect()
+    }
+
+    pub fn get_children_ids(&self, post_id: Option<PostId>) -> Vec<PostId> {
+        let post_id = post_id.unwrap_or(ROOT_POST_ID);
+        self.post_to_children
+            .get(&post_id)
+            .unwrap_or_else(|| panic!("Parent id {} not found", post_id))
+    }
+
+    pub fn get_parent_id(&self, post_id: PostId) -> Option<PostId> {
+        let res = self
+            .post_to_parent
+            .get(&post_id)
+            .unwrap_or_else(|| panic!("Parent id {} not found", post_id));
+        if res == ROOT_POST_ID {
+            Option::None
+        } else {
+            Option::Some(res)
+        }
+    }
+
+    pub fn get_proposals(&self, ids: Option<Vec<ProposalId>>) -> Vec<VersionedProposal> {
+        if let Some(ids) = ids {
+            ids.into_iter().filter_map(|id| self.proposals.get(id.into())).collect()
+        } else {
+            self.proposals.to_vec()
+        }
+    }
+
+    pub fn get_proposal(&self, proposal_id: ProposalId) -> VersionedProposal {
+        self.proposals
+            .get(proposal_id.into())
+            .unwrap_or_else(|| panic!("Proposal id {} not found", proposal_id))
+    }
+
+    pub fn get_all_proposal_ids(&self) -> Vec<ProposalId> {
+        (0..self.proposals.len().try_into().unwrap()).collect()
+    }
+
+    pub fn get_rfps(&self) -> Vec<VersionedRFP> {
+        self.rfps.to_vec()
+    }
+
+    pub fn get_rfp(&self, rfp_id: RFPId) -> VersionedRFP {
+        self.rfps.get(rfp_id.into()).unwrap_or_else(|| panic!("RFP id {} not found", rfp_id))
+    }
+
+    pub fn get_all_rfp_ids(&self) -> Vec<RFPId> {
+        (0..self.rfps.len().try_into().unwrap()).collect()
+    }
+
+    #[payable]
+    pub fn add_like(&mut self, post_id: PostId) -> Promise {
+        let mut post: Post = self
+            .posts
+            .get(post_id)
+            .unwrap_or_else(|| panic!("Post id {} not found", post_id))
+            .into();
+        let post_author = post.author_id.clone();
+        let like =
+            Like { author_id: env::predecessor_account_id(), timestamp: env::block_timestamp() };
+        post.likes.insert(like);
+        self.posts.replace(post_id, &post.into());
+        notify::notify_like(post_id, post_author)
+    }
+
+    #[payable]
+    pub fn add_post(
+        &mut self,
+        parent_id: Option<PostId>,
+        body: PostBody,
+        labels: HashSet<String>,
+    ) -> Promise {
+        let parent_id = parent_id.unwrap_or(ROOT_POST_ID);
+        let id = self.posts.len();
+        let author_id = env::predecessor_account_id();
+        let editor_id = author_id.clone();
+        require!(
+            self.is_allowed_to_use_labels(
+                Some(editor_id.clone()),
+                labels.iter().cloned().collect()
+            ),
+            "Cannot use these labels"
+        );
+
+        for label in &labels {
+            let mut other_posts = self.label_to_posts.get(label).unwrap_or_default();
+            other_posts.insert(id);
+            self.label_to_posts.insert(label, &other_posts);
+        }
+        let post = Post {
+            id,
+            author_id: author_id.clone(),
+            likes: Default::default(),
+            snapshot: PostSnapshot { editor_id, timestamp: env::block_timestamp(), labels, body },
+            snapshot_history: vec![],
+        };
+        self.posts.push(&post.clone().into());
+        self.post_to_parent.insert(&id, &parent_id);
+
+        let mut siblings = self
+            .post_to_children
+            .get(&parent_id)
+            .unwrap_or_else(|| panic!("Parent id {} not found", parent_id));
+        siblings.push(id);
+        self.post_to_children.insert(&parent_id, &siblings);
+
+        // Don't forget to add an empty list of your own children.
+        self.post_to_children.insert(&id, &vec![]);
+
+        let mut author_posts = self.authors.get(&author_id).unwrap_or_default();
+        author_posts.insert(post.id);
+        self.authors.insert(&post.author_id, &author_posts);
+
+        let desc = get_post_description(post.clone());
+
+        if parent_id != ROOT_POST_ID {
+            let parent_post: Post = self
+                .posts
+                .get(parent_id)
+                .unwrap_or_else(|| panic!("Parent post with id {} not found", parent_id))
+                .into();
+            let parent_author = parent_post.author_id;
+            notify::notify_reply(parent_id, parent_author);
+        } else {
+            repost::repost(post);
+        }
+        notify::notify_mentions(desc.as_str(), id)
+    }
+
+    #[payable]
+    pub fn add_proposal(
+        &mut self,
+        body: VersionedProposalBody,
+        labels: HashSet<String>,
+    ) -> Promise {
+        let id: ProposalId = self.proposals.len().try_into().unwrap();
+        let author_id = env::predecessor_account_id();
+        let editor_id = author_id.clone();
+
+        let proposal_body = body.clone().latest_version();
+
+        if proposal_body.linked_rfp.is_some() {
+            require!(labels.is_empty(), "Cannot add custom labels to this proposal. It inherits labels from the linked RFP. You should not add any labels to this proposal manually");
+        }
+
+        let labels = self.update_and_check_rfp_link(id, body.clone(), None, labels);
+
+        require!(
+            self.is_allowed_to_use_labels(
+                Some(editor_id.clone()),
+                labels.iter().cloned().collect()
+            ),
+            "Cannot use these labels"
+        );
+
+        require!(self.proposal_categories.contains(&proposal_body.category), "Unknown category");
+
+        require!(
+            proposal_body.timeline.is_draft() || proposal_body.timeline.is_empty_review(),
+            "Cannot create proposal which is not in a draft or a review state"
+        );
+
+        for label in &labels {
+            let mut other_proposals = self.label_to_proposals.get(label).unwrap_or_default();
+            other_proposals.insert(id);
+            self.label_to_proposals.insert(label, &other_proposals);
+        }
+
+        let mut author_proposals = self.author_proposals.get(&author_id).unwrap_or_default();
+        author_proposals.insert(id);
+        self.author_proposals.insert(&author_id, &author_proposals);
+
+        let proposal = Proposal {
+            id: id,
+            author_id: author_id.clone(),
+            social_db_post_block_height: 0u64,
+            snapshot: ProposalSnapshot {
+                editor_id,
+                timestamp: env::block_timestamp(),
+                labels,
+                body: body.clone(),
+            },
+            snapshot_history: vec![],
+        };
+
+        proposal::repost::publish_to_socialdb_feed(
+            Self::ext(env::current_account_id())
+                .with_static_gas(env::prepaid_gas().saturating_div(4))
+                .set_block_height_callback(proposal.clone()),
+            proposal::repost::proposal_repost_text(proposal.clone()),
+        )
+        .then(notify::notify_proposal_subscribers(&proposal))
+    }
+
+    #[payable]
+    pub fn add_rfp(&mut self, body: VersionedRFPBody, labels: HashSet<String>) -> Promise {
+        let id: RFPId = self.rfps.len().try_into().unwrap();
+        let author_id = env::predecessor_account_id();
+        let editor_id = author_id.clone();
+
+        let rfp_body = body.clone().latest_version();
+
+        require!(
+            self.is_allowed_to_write_rfps(editor_id.clone()),
+            "The account is not allowed to create RFPs"
+        );
+
+        require!(
+            rfp_body.timeline.is_accepting_submissions(),
+            "Cannot create proposal which is not in a Accepting Submissions state"
+        );
+
+        for label in &labels {
+            require!(
+                self.global_labels_info.get().get(label).is_some(),
+                format!("Label {} is not registered", label)
+            );
+
+            let mut other_rfps = self.label_to_rfps.get(label).unwrap_or_default();
+            other_rfps.insert(id);
+            self.label_to_rfps.insert(label, &other_rfps);
+        }
+
+        let rfp = RFP {
+            id: id,
+            author_id: env::predecessor_account_id(),
+            social_db_post_block_height: 0u64,
+            snapshot: RFPSnapshot {
+                editor_id: env::predecessor_account_id(),
+                timestamp: env::block_timestamp(),
+                block_height: env::block_height(),
+                labels,
+                body: body.clone(),
+                linked_proposals: HashSet::new(),
+            },
+            snapshot_history: vec![],
+        };
+
+        proposal::repost::publish_to_socialdb_feed(
+            Self::ext(env::current_account_id())
+                .with_static_gas(env::prepaid_gas().saturating_div(4))
+                .set_rfp_block_height_callback(rfp.clone()),
+            rfp::repost::rfp_repost_text(rfp.clone()),
+        )
+        .then(notify::notify_rfp_subscribers(&rfp, self.get_moderators()))
+    }
+
+    #[private]
+    pub fn set_block_height_callback(
+        &mut self,
+        #[allow(unused_mut)] mut proposal: Proposal,
+        #[callback_unwrap] set_result: SetReturnType,
+    ) -> BlockHeightCallbackRetValue {
+        proposal.social_db_post_block_height = set_result.block_height.into();
+        self.proposals.push(&proposal.clone().into());
+        BlockHeightCallbackRetValue { proposal_id: proposal.id }
+    }
+
+    pub fn set_rfp_block_height_callback(
+        &mut self,
+        #[allow(unused_mut)] mut rfp: RFP,
+        #[callback_unwrap] set_result: SetReturnType,
+    ) -> BlockHeightCallbackRetValue {
+        let ret_value = BlockHeightCallbackRetValue { proposal_id: rfp.id };
+        rfp.social_db_post_block_height = set_result.block_height.into();
+        self.rfps.push(&rfp.into());
+        ret_value
+    }
+
+    pub fn get_posts_by_author(&self, author: AccountId) -> Vec<PostId> {
+        self.authors.get(&author).map(|posts| posts.into_iter().collect()).unwrap_or_default()
+    }
+
+    pub fn get_posts_by_label(&self, label: String) -> Vec<PostId> {
+        let mut res: Vec<_> =
+            self.label_to_posts.get(&label).unwrap_or_default().into_iter().collect();
+        res.sort();
+        res
+    }
+
+    pub fn get_proposals_by_author(&self, author: AccountId) -> Vec<ProposalId> {
+        self.author_proposals
+            .get(&author)
+            .map(|proposals| proposals.into_iter().collect())
+            .unwrap_or_default()
+    }
+
+    pub fn get_proposals_by_label(&self, label: String) -> Vec<ProposalId> {
+        let mut res: Vec<_> =
+            self.label_to_proposals.get(&label).unwrap_or_default().into_iter().collect();
+        res.sort();
+        res
+    }
+
+    pub fn get_rfps_by_label(&self, label: String) -> Vec<RFPId> {
+        let mut res: Vec<_> =
+            self.label_to_rfps.get(&label).unwrap_or_default().into_iter().collect();
+        res.sort();
+        res
+    }
+
+    pub fn get_all_labels(&self) -> Vec<String> {
+        let mut res: Vec<_> = self.label_to_posts.keys().collect();
+        res.sort();
+        res
+    }
+
+    pub fn get_all_proposal_labels(&self) -> Vec<String> {
+        let mut res: Vec<_> = self.label_to_proposals.keys().collect();
+        res.sort();
+        res
+    }
+
+    pub fn get_all_authors(&self) -> Vec<AccountId> {
+        let mut res: Vec<_> = self.authors.keys().collect();
+        res.sort();
+        res
+    }
+
+    pub fn get_all_proposal_authors(&self) -> Vec<AccountId> {
+        let mut res: Vec<_> = self.author_proposals.keys().collect();
+        res.sort();
+        res
+    }
+
+    pub fn is_allowed_to_edit_proposal(
+        &self,
+        proposal_id: ProposalId,
+        editor: Option<AccountId>,
+    ) -> bool {
+        let proposal: Proposal = self
+            .proposals
+            .get(proposal_id.try_into().unwrap())
+            .unwrap_or_else(|| panic!("Proposal id {} not found", proposal_id))
+            .into();
+        let editor = editor.unwrap_or_else(env::predecessor_account_id);
+        // First check for simple cases.
+        if editor == env::current_account_id() || editor == proposal.author_id {
+            return true;
+        }
+
+        // Then check for complex case.
+        self.access_control
+            .members_list
+            .check_permissions(editor, proposal.snapshot.labels.into_iter().collect::<Vec<_>>())
+            .contains(&ActionType::EditPost)
+    }
+
+    pub fn is_allowed_to_write_rfps(&self, editor: AccountId) -> bool {
+        editor == env::current_account_id() || self.has_moderator(editor)
+    }
+
+    pub fn is_allowed_to_edit(&self, post_id: PostId, editor: Option<AccountId>) -> bool {
+        let post: Post = self
+            .posts
+            .get(post_id)
+            .unwrap_or_else(|| panic!("Post id {} not found", post_id))
+            .into();
+        let editor = editor.unwrap_or_else(env::predecessor_account_id);
+        // First check for simple cases.
+        if editor == env::current_account_id() || editor == post.author_id {
+            return true;
+        }
+
+        // Then check for complex case.
+        self.access_control
+            .members_list
+            .check_permissions(editor, post.snapshot.labels.into_iter().collect::<Vec<_>>())
+            .contains(&ActionType::EditPost)
+    }
+
+    pub fn is_allowed_to_use_labels(&self, editor: Option<AccountId>, labels: Vec<String>) -> bool {
+        let editor = editor.unwrap_or_else(env::predecessor_account_id);
+        // First check for simple cases.
+        if editor == env::current_account_id() {
+            return true;
+        }
+        let restricted_labels = self.access_control.rules_list.find_restricted(&labels);
+        if restricted_labels.is_empty() {
+            return true;
+        }
+        self.access_control
+            .members_list
+            .check_permissions(editor, labels)
+            .contains(&ActionType::UseLabels)
+    }
+
+    fn filtered_labels<T>(
+        &self,
+        labels_to_t: &UnorderedMap<String, T>,
+        editor: &AccountId,
+    ) -> Vec<String>
+    where
+        T: near_sdk::borsh::BorshSerialize + near_sdk::borsh::BorshDeserialize,
+    {
+        let filtered: HashSet<String> = labels_to_t
+            .keys()
+            .filter(|label| {
+                self.is_allowed_to_use_labels(Some(editor.clone()), vec![label.clone()])
+            })
+            .collect();
+        let mut res: Vec<_> = filtered.into_iter().collect();
+        res.sort();
+        res
+    }
+
+    pub fn get_all_allowed_labels(&self, editor: AccountId) -> Vec<String> {
+        self.filtered_labels(&self.label_to_posts, &editor)
+    }
+
+    pub fn get_all_allowed_proposal_labels(&self, editor: AccountId) -> Vec<String> {
+        self.filtered_labels(&self.label_to_proposals, &editor)
+    }
+
+    #[payable]
+    pub fn edit_post(&mut self, id: PostId, body: PostBody, labels: HashSet<String>) -> Promise {
+        require!(
+            self.is_allowed_to_edit(id, Option::None),
+            "The account is not allowed to edit this post"
+        );
+        let editor_id = env::predecessor_account_id();
+        let mut post: Post =
+            self.posts.get(id).unwrap_or_else(|| panic!("Post id {} not found", id)).into();
+
+        let old_snapshot = post.snapshot.clone();
+        let old_labels_set = old_snapshot.labels.clone();
+        let new_labels = labels;
+        let new_snapshot = PostSnapshot {
+            editor_id: editor_id.clone(),
+            timestamp: env::block_timestamp(),
+            labels: new_labels.clone(),
+            body,
+        };
+        post.snapshot = new_snapshot;
+        post.snapshot_history.push(old_snapshot);
+        let post_author = post.author_id.clone();
+        self.posts.replace(id, &post.into());
+
+        // Update labels index.
+        let new_labels_set = new_labels;
+        let labels_to_remove = &old_labels_set - &new_labels_set;
+        let labels_to_add = &new_labels_set - &old_labels_set;
+        require!(
+            self.is_allowed_to_use_labels(
+                Some(editor_id.clone()),
+                labels_to_remove.iter().cloned().collect()
+            ),
+            "Not allowed to remove these labels"
+        );
+        require!(
+            self.is_allowed_to_use_labels(
+                Some(editor_id.clone()),
+                labels_to_add.iter().cloned().collect()
+            ),
+            "Not allowed to add these labels"
+        );
+
+        for label_to_remove in labels_to_remove {
+            let mut posts = self.label_to_posts.get(&label_to_remove).unwrap();
+            posts.remove(&id);
+            self.label_to_posts.insert(&label_to_remove, &posts);
+        }
+
+        for label_to_add in labels_to_add {
+            let mut posts = self.label_to_posts.get(&label_to_add).unwrap_or_default();
+            posts.insert(id);
+            self.label_to_posts.insert(&label_to_add, &posts);
+        }
+
+        notify::notify_edit(id, post_author)
+    }
+
+    #[payable]
+    pub fn create_community(
+        &mut self,
+        #[allow(unused_mut)] mut inputs: CommunityInputs,
+    ) -> Promise {
+        require!(
+            self.get_community(inputs.handle.to_owned()).is_none(),
+            "Community already exists"
+        );
+
+        require!(
+            env::attached_deposit() >= CREATE_COMMUNITY_BALANCE,
+            "Require 4 NEAR to create community"
+        );
+
+        require!(env::prepaid_gas() >= CREATE_COMMUNITY_GAS, "Require at least 200 Tgas");
+
+        let mut new_community = Community {
+            admins: vec![],
+            handle: inputs.handle.clone(),
+            name: inputs.name,
+            tag: inputs.tag,
+            description: inputs.description,
+            logo_url: inputs.logo_url,
+            banner_url: inputs.banner_url,
+            bio_markdown: inputs.bio_markdown,
+            github_handle: None,
+            telegram_handle: None,
+            twitter_handle: None,
+            website_url: None,
+            addons: vec![
+                CommunityAddOn {
+                    id: "announcements".to_string(),
+                    addon_id: "announcements".to_string(),
+                    display_name: "Announcements".to_string(),
+                    enabled: true,
+                    parameters: "".to_string(),
+                },
+                CommunityAddOn {
+                    id: "discussions".to_string(),
+                    addon_id: "discussions".to_string(),
+                    display_name: "Discussions".to_string(),
+                    enabled: true,
+                    parameters: "".to_string(),
+                },
+            ],
+        };
+
+        new_community.validate();
+        new_community.set_default_admin();
+        self.communities.insert(&new_community.handle, &new_community);
+
+        ext_devhub_community_factory::ext(get_devhub_community_factory())
+            .with_unused_gas_weight(1)
+            .with_attached_deposit(CREATE_COMMUNITY_BALANCE)
+            .create_community_account(new_community.handle.clone())
+    }
+
+    #[payable]
+    pub fn edit_proposal(
+        &mut self,
+        id: ProposalId,
+        body: VersionedProposalBody,
+        labels: HashSet<String>,
+    ) -> ProposalId {
+        let proposal_body = body.clone().latest_version();
+        if proposal_body.linked_rfp.is_some() {
+            require!(labels.len() == 0, "Cannot edit labels of a proposal linked to RFP. It inherits labels from the linked RFP.");
+        }
+        self.edit_proposal_internal(id, body.clone(), labels)
+    }
+
+    #[payable]
+    pub fn edit_proposal_timeline(
+        &mut self,
+        id: ProposalId,
+        timeline: TimelineStatus,
+    ) -> ProposalId {
+        let proposal: Proposal = self
+            .proposals
+            .get(id.into())
+            .unwrap_or_else(|| panic!("Proposal id {} not found", id))
+            .into();
+        let mut body = proposal.snapshot.body.latest_version();
+        body.timeline = timeline;
+
+        self.edit_proposal_internal(id, body.into(), proposal.snapshot.labels)
+    }
+
+    #[payable]
+    pub fn edit_proposal_linked_rfp(
+        &mut self,
+        id: ProposalId,
+        rfp_id: Option<RFPId>,
+    ) -> ProposalId {
+        let proposal: Proposal = self
+            .proposals
+            .get(id.into())
+            .unwrap_or_else(|| panic!("Proposal id {} not found", id))
+            .into();
+        let mut body = proposal.snapshot.body.latest_version();
+        body.linked_rfp = rfp_id;
+
+        self.edit_proposal_internal(id, body.into(), proposal.snapshot.labels)
+    }
+
+    #[payable]
+    pub fn edit_rfp(
+        &mut self,
+        id: RFPId,
+        body: VersionedRFPBody,
+        labels: HashSet<String>,
+    ) -> RFPId {
+        self.edit_rfp_internal(id, body.clone(), labels)
+    }
+
+    #[payable]
+    pub fn cancel_rfp(
+        &mut self,
+        id: RFPId,
+        proposals_to_cancel: Vec<ProposalId>,
+        proposals_to_unlink: Vec<ProposalId>,
+    ) -> RFPId {
+        for proposal_id in proposals_to_cancel {
+            let proposal: Proposal = self.get_proposal(proposal_id).into();
+            let proposal_timeline = proposal.snapshot.body.latest_version().timeline;
+            let review_status = proposal_timeline.get_review_status().clone();
+            self.edit_proposal_timeline(proposal_id, TimelineStatus::Cancelled(review_status));
+        }
+
+        for proposal_id in proposals_to_unlink {
+            self.edit_proposal_linked_rfp(proposal_id, None);
+        }
+
+        self.edit_rfp_timeline(id, RFPTimelineStatus::Cancelled)
+    }
+
+    #[payable]
+    pub fn edit_rfp_timeline(&mut self, id: RFPId, timeline: RFPTimelineStatus) -> ProposalId {
+        let rfp: RFP = self.get_rfp(id).into();
+        let mut body = rfp.snapshot.body.latest_version();
+        body.timeline = timeline;
+
+        self.edit_rfp_internal(id, body.into(), rfp.snapshot.labels)
+    }
+
+    pub fn get_allowed_categories(&self) -> Vec<String> {
+        self.proposal_categories.clone()
+    }
+
+    pub fn get_global_labels(&self) -> Vec<LabelInfoExtended> {
+        let mut result: Vec<LabelInfoExtended> = self
+            .global_labels_info
+            .iter()
+            .map(|(label, label_info)| LabelInfoExtended {
+                value: label.clone(),
+                title: label_info.title.clone(),
+                color: label_info.color.clone(),
+            })
+            .collect();
+        result.sort_by(|a, b| a.value.cmp(&b.value));
+        result
+    }
+
+    pub fn get_rfp_linked_proposals(&self, rfp_id: RFPId) -> Vec<ProposalId> {
+        self.get_linked_proposals_in_rfp(rfp_id).into_iter().collect()
+    }
+
+    #[payable]
+    pub fn set_global_labels(&mut self, labels: Vec<LabelInfoExtended>) {
+        let editor_id = env::predecessor_account_id();
+        require!(
+            self.has_moderator(editor_id.clone()) || editor_id.clone() == env::current_account_id(),
+            "Only the admin and moderators can set labels"
+        );
+
+        self.global_labels_info.clear();
+
+        for label in labels {
+            let label_info = LabelInfo { title: label.title, color: label.color };
+            (*self.global_labels_info).insert(label.value, label_info);
+        }
+    }
+
+    #[payable]
+    pub fn set_allowed_categories(&mut self, new_categories: Vec<String>) {
+        let editor_id = env::predecessor_account_id();
+        require!(
+            self.has_moderator(editor_id.clone()) || editor_id.clone() == env::current_account_id(),
+            "Only the admin and moderators can set categories"
+        );
+        self.proposal_categories = new_categories;
+    }
+
+    pub fn get_community(&self, handle: CommunityHandle) -> Option<Community> {
+        self.communities.get(&handle)
+    }
+
+    pub fn get_community_metadata(&self, handle: CommunityHandle) -> Option<CommunityMetadata> {
+        self.communities.get(&handle).map(|community| CommunityMetadata {
+            admins: community.admins,
+            handle: community.handle,
+            name: community.name,
+            tag: community.tag,
+            description: community.description,
+            logo_url: community.logo_url,
+            banner_url: community.banner_url,
+            bio_markdown: community.bio_markdown,
+        })
+    }
+
+    pub fn get_account_community_permissions(
+        &self,
+        account_id: AccountId,
+        community_handle: CommunityHandle,
+    ) -> CommunityPermissions {
+        let community = self.get_community(community_handle.to_owned()).expect(
+            format!("Community with handle `{}` does not exist", community_handle).as_str(),
+        );
+
+        CommunityPermissions {
+            can_configure: community.admins.contains(&account_id)
+                || self.has_moderator(account_id.to_owned()),
+
+            can_delete: self.has_moderator(account_id),
+        }
+    }
+
+    pub fn get_all_communities_metadata(&self) -> Vec<CommunityMetadata> {
+        self.communities
+            .iter()
+            .map(|(handle, community)| CommunityMetadata {
+                admins: community.admins,
+                handle,
+                name: community.name,
+                tag: community.tag,
+                description: community.description,
+                logo_url: community.logo_url,
+                banner_url: community.banner_url,
+                bio_markdown: community.bio_markdown,
+            })
+            .collect()
+    }
+
+    pub fn get_addon(&self, id: AddOnId) -> Option<AddOn> {
+        self.available_addons.get(&id)
+    }
+
+    pub fn get_all_addons(&self) -> Vec<AddOn> {
+        self.available_addons.iter().map(|(_id, add_on)| add_on).collect()
+    }
+
+    // Only the contract admin and DevHub moderators
+    pub fn create_addon(&mut self, addon: AddOn) {
+        if !self.has_moderator(env::predecessor_account_id())
+            && env::predecessor_account_id() != env::current_account_id()
+        {
+            panic!("Only the admin and moderators can create new add-ons");
+        }
+        if self.get_addon(addon.id.to_owned()).is_some() {
+            panic!("Add-on with this id already exists");
+        }
+        addon.validate();
+        self.available_addons.insert(&addon.id.clone(), &addon);
+    }
+
+    // ONLY FOR TESTING
+    pub fn delete_addon(&mut self, id: AddOnId) {
+        // Also delete from communities
+        if !self.has_moderator(env::predecessor_account_id())
+            && env::predecessor_account_id() != env::current_account_id()
+        {
+            panic!("Only the admin and moderators can delete add-ons");
+        }
+        let addon = self
+            .get_addon(id.clone())
+            .expect(&format!("Add-on with id `{}` does not exist", id))
+            .clone();
+
+        self.available_addons.remove(&addon.id);
+    }
+
+    pub fn update_addon(&mut self, addon: AddOn) {
+        if !self.has_moderator(env::predecessor_account_id())
+            && env::predecessor_account_id() != env::current_account_id()
+        {
+            panic!("Only the admin and moderators can edit add-ons");
+        }
+        self.available_addons.insert(&addon.id.clone(), &addon);
+    }
+
+    pub fn get_community_addons(&self, handle: CommunityHandle) -> Vec<CommunityAddOn> {
+        let community = self
+            .get_community(handle.clone())
+            .expect(format!("Community not found with handle `{}`", handle).as_str());
+        return community.addons;
+    }
+
+    pub fn set_community_addons(
+        &mut self,
+        handle: CommunityHandle,
+        addons: Vec<CommunityAddOn>,
+    ) -> Promise {
+        let mut community = self
+            .get_community(handle.clone())
+            .expect(format!("Community not found with handle `{}`", handle).as_str());
+        community.addons = addons;
+        self.update_community(handle, community)
+    }
+
+    // To add or update parameters set by the configurator widget
+    pub fn set_community_addon(
+        &mut self,
+        handle: CommunityHandle,
+        community_addon: CommunityAddOn,
+    ) -> Promise {
+        let mut community = self
+            .get_community(handle.clone())
+            .expect(format!("Community not found with handle `{}`", handle).as_str());
+        if let Some(existing_addon) =
+            community.addons.iter_mut().find(|current| current.id == community_addon.id)
+        {
+            *existing_addon = community_addon;
+        } else {
+            community.addons.push(community_addon);
+        }
+        self.update_community(handle, community)
+    }
+
+    fn get_editable_community(&self, handle: &CommunityHandle) -> Option<Community> {
+        if self
+            .get_account_community_permissions(env::predecessor_account_id(), handle.to_owned())
+            .can_configure
+        {
+            return self.get_community(handle.to_owned());
+        } else {
+            return None;
+        };
+    }
+
+    pub fn update_community(
+        &mut self,
+        handle: CommunityHandle,
+        #[allow(unused_mut)] mut community: Community,
+    ) -> Promise {
+        let _ = self
+            .get_editable_community(&handle)
+            .expect("Only community admins and hub moderators can configure communities");
+
+        community.validate();
+        community.set_default_admin();
+
+        require!(community.handle == handle, "Community handle cannot be changed");
+        require!(env::prepaid_gas() >= UPDATE_COMMUNITY_GAS, "Require at least 30 Tgas");
+        self.communities.insert(&handle, &community);
+        let community_page_link =
+            format!("/devhub.near/widget/app?page=community&handle={}", community.handle);
+        social_db_contract().with_unused_gas_weight(1).set(json!({
+            get_devhub_community_account(&community.handle): {
+                "profile": {
+                    "name": community.name,
+                    "image": {
+                        "url": community.logo_url,
+                    },
+                    "linktree": {
+                        "twitter": community.twitter_handle,
+                        "github": community.github_handle,
+                        "telegram": community.telegram_handle,
+                        "website": format!("near.social{community_page_link}"),
+                    },
+                    "description": format!(
+                        "{}\n\nLearn more about our community [on DevHub]({}).",
+                        community.bio_markdown.as_ref().unwrap_or(&community.description),
+                        community_page_link
+                    ),
+                    "backgroundImage": {
+                        "url": community.banner_url,
+                    },
+                    "tags": {
+                        "community": "",
+                        "announcements": "",
+                        &community.handle: "",
+                    }
+                }
+            },
+            get_devhub_discussions_account(&community.handle):  {
+                "profile": {
+                    "name": format!("{} (Community Discussions)", community.name),
+                    "image": {
+                        "url": community.logo_url,
+                    },
+                    "linktree": {
+                        "twitter": community.twitter_handle,
+                        "github": community.github_handle,
+                        "telegram": community.telegram_handle,
+                        "website": format!("near.social{community_page_link}"),
+                    },
+                    "description": format!("{}\n\nLearn more about our community [on DevHub]({}).", community.description, community_page_link),
+                    "backgroundImage": {
+                        "url": community.banner_url,
+                    },
+                    "tags": {
+                        "community": "",
+                        "discussions": "",
+                        &community.handle: "",
+                    }
+                }
+            }
+        }))
+    }
+
+    pub fn set_community_socialdb(&mut self, handle: CommunityHandle, data: Value) -> Promise {
+        let _ = self
+            .get_editable_community(&handle)
+            .expect("Only community admins and hub moderators can set community Social DB");
+
+        require!(env::prepaid_gas() >= SET_COMMUNITY_SOCIALDB_GAS, "Require at least 30 Tgas");
+        social_db_contract()
+            .with_unused_gas_weight(1)
+            .set(json!({ get_devhub_community_account(&handle): data }))
+    }
+
+    pub fn create_discussion(&mut self, handle: CommunityHandle, block_height: Number) -> Promise {
+        require!(env::prepaid_gas() >= CREATE_DISCUSSION_GAS, "Require at least 30 Tgas");
+
+        let post_initiator = env::predecessor_account_id();
+        let repost = format!("[{{\"key\":\"main\",\"value\":{{\"type\":\"repost\",\"item\":{{\"type\":\"social\",\"path\":\"{}/post/main\",\"blockHeight\":{}}}}}}},{{\"key\":{{\"type\":\"social\",\"path\":\"{}/post/main\",\"blockHeight\":{}}},\"value\":{{\"type\":\"repost\"}}}}]", post_initiator, block_height, post_initiator, block_height);
+        let notify = format!("{{\"key\":\"{}\",\"value\":{{\"type\":\"repost\",\"item\":{{\"type\":\"social\",\"path\":\"{}/post/main\",\"blockHeight\":{}}}}}}}", post_initiator, post_initiator, block_height);
+        social_db_contract().with_unused_gas_weight(1).set(
+            json!({ get_devhub_discussions_account(&handle): {
+              "index": {
+                "repost": repost,
+                "notify": notify
+              }
+            } }),
+        )
+    }
+
+    pub fn delete_community(&mut self, handle: CommunityHandle) -> Promise {
+        require!(
+            self.has_moderator(env::predecessor_account_id()),
+            "Only moderators can delete community"
+        );
+
+        let community = self
+            .get_community(handle.clone())
+            .expect(&format!("Community with handle `{}` does not exist", handle));
+
+        self.communities.remove(&community.handle);
+
+        require!(env::prepaid_gas() >= DELETE_COMMUNITY_GAS, "Require at least 30 Tgas");
+        ext_devhub_community::ext(get_devhub_community_account(&community.handle).parse().unwrap())
+            .with_unused_gas_weight(1)
+            .destroy()
+    }
+
+    pub fn set_featured_communities(&mut self, handles: Vec<CommunityHandle>) {
+        require!(
+            self.has_moderator(env::predecessor_account_id()),
+            "Only moderators can add featured communities"
+        );
+
+        // Check if every handle corresponds to an existing community
+        for handle in &handles {
+            require!(self.communities.get(&handle).is_some(), "Community does not exist.");
+        }
+
+        // Replace the existing featured communities with the new ones
+        self.featured_communities =
+            handles.into_iter().map(|handle| FeaturedCommunity { handle }).collect();
+    }
+
+    pub fn get_featured_communities(&self) -> Vec<Community> {
+        self.featured_communities
+            .iter()
+            .filter_map(|fc| self.get_community(fc.handle.clone()))
+            .collect()
+    }
+
+    fn get_moderators(&self) -> HashSet<AccountId> {
+        let mut moderators: HashSet<AccountId> = HashSet::new();
+        for m in self.access_control.members_list.get_moderators() {
+            if let Member::Account(account_id) = m {
+                moderators.insert(account_id.clone());
+            }
+        }
+        moderators.insert(env::current_account_id());
+        moderators
+    }
+
+    pub fn has_moderator(&self, account_id: AccountId) -> bool {
+        let moderators = self.access_control.members_list.get_moderators();
+        moderators.contains(&Member::Account(account_id))
+    }
+
+    pub fn web4_get(&self, request: Web4Request) -> Web4Response {
+        web4::handler::web4_get(self, request)
+    }
+
+    pub fn set_social_db_profile_announcement(&self, announcement: String) -> Promise {
+        let editor = env::predecessor_account_id();
+        require!(
+            editor == env::current_account_id() || self.has_moderator(editor),
+            "Permission denied"
+        );
+        social_db_contract()
+            .with_static_gas(env::prepaid_gas().saturating_div(3))
+            .with_attached_deposit(env::attached_deposit())
+            .set(json!({
+                env::current_account_id(): {
+                    "profile": {
+                        "announcement": announcement
+                    }
+                }
+            }))
+    }
+}
+
+#[near]
+pub struct LabelInfo {
+    title: Option<String>,
+    color: Option<(u8, u8, u8)>,
+}
+
+#[near(serializers=[borsh, json])]
+pub struct LabelInfoExtended {
+    value: String,
+    title: Option<String>,
+    color: Option<(u8, u8, u8)>,
+}
+
+#[derive(Copy, Clone, Serialize, Deserialize, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+pub struct BlockHeightCallbackRetValue {
+    proposal_id: ProposalId,
+}
+
+#[cfg(all(test, not(target_arch = "wasm32")))]
+mod tests {
+    use crate::community::AddOn;
+
+    use crate::{PostBody, ProposalBodyV0, VersionedProposalBody};
+
+    use near_sdk::test_utils::{get_created_receipts, VMContextBuilder};
+    use near_sdk::{testing_env, VMContext};
+    use serde_json::json;
+    use std::collections::HashSet;
+    use std::convert::TryInto;
+
+    use super::Contract;
+
+    fn get_context(is_view: bool) -> VMContext {
+        get_context_with_signer(is_view, "bob.near".to_string())
+    }
+
+    fn get_context_with_signer(is_view: bool, signer: String) -> VMContext {
+        VMContextBuilder::new()
+            .signer_account_id(signer.clone().try_into().unwrap())
+            .current_account_id(signer.try_into().unwrap())
+            .is_view(is_view)
+            .build()
+    }
+
+    fn get_context_with_current(is_view: bool, signer: String) -> VMContext {
+        VMContextBuilder::new()
+            .current_account_id(signer.try_into().unwrap())
+            .is_view(is_view)
+            .build()
+    }
+
+    #[allow(dead_code)]
+    fn get_context_with_predecessor(is_view: bool, signer: String) -> VMContext {
+        VMContextBuilder::new()
+            .predecessor_account_id(signer.try_into().unwrap())
+            .is_view(is_view)
+            .build()
+    }
+
+    #[test]
+    pub fn test_add_proposal() {
+        let context = get_context(false);
+        testing_env!(context);
+        let mut contract = Contract::new();
+
+        let body: ProposalBodyV0 = near_sdk::serde_json::from_value(json!({
+            "proposal_body_version": "V0",
+            "name": "another post",
+            "description": "Hello to @petersalomonsen.near and @psalomo.near. This is an idea with mentions.",            "category": "Marketing",
+            "summary": "sum",
+            "linked_proposals": [1, 3],
+            "requested_sponsorship_usd_amount": "1000000000",
+            "requested_sponsorship_paid_in_currency": "USDT",
+            "receiver_account": "polyprogrammist.near",
+            "supervisor": "frol.near",
+            "requested_sponsor": "neardevdao.near",
+            "payouts": [],
+            "timeline": {"status": "DRAFT"}
+        })).unwrap();
+        contract.add_proposal(VersionedProposalBody::V0(body), HashSet::new());
+        let receipts = get_created_receipts();
+        assert_eq!(3, receipts.len());
+
+        if let near_sdk::mock::MockAction::FunctionCallWeight { method_name, args, .. } =
+            &receipts[2].actions[0]
+        {
+            assert_eq!(method_name, b"set");
+            assert_eq!(args, b"{\"data\":{\"bob.near\":{\"index\":{\"notify\":\"[{\\\"key\\\":\\\"petersalomonsen.near\\\",\\\"value\\\":{\\\"type\\\":\\\"proposal/mention\\\",\\\"proposal\\\":0,\\\"widgetAccountId\\\":\\\"bob.near\\\",\\\"notifier\\\":\\\"bob.near\\\"}},{\\\"key\\\":\\\"psalomo.near.\\\",\\\"value\\\":{\\\"type\\\":\\\"proposal/mention\\\",\\\"proposal\\\":0,\\\"widgetAccountId\\\":\\\"bob.near\\\",\\\"notifier\\\":\\\"bob.near\\\"}},{\\\"key\\\":\\\"frol.near\\\",\\\"value\\\":{\\\"type\\\":\\\"proposal/mention\\\",\\\"proposal\\\":0,\\\"widgetAccountId\\\":\\\"bob.near\\\",\\\"notifier\\\":\\\"bob.near\\\"}},{\\\"key\\\":\\\"neardevdao.near\\\",\\\"value\\\":{\\\"type\\\":\\\"proposal/mention\\\",\\\"proposal\\\":0,\\\"widgetAccountId\\\":\\\"bob.near\\\",\\\"notifier\\\":\\\"bob.near\\\"}}]\"}}}}");
+        } else {
+            assert!(false, "Expected a function call ...")
+        }
+    }
+
+    #[test]
+    pub fn test_add_post_with_mention() {
+        let context = get_context(false);
+        testing_env!(context);
+        let mut contract = Contract::new();
+
+        let body: PostBody = near_sdk::serde_json::from_str(r#"
+        {
+            "name": "another post",
+            "description": "Hello to @petersalomonsen.near and @psalomo.near. This is an idea with mentions.",
+            "post_type": "Idea",
+            "idea_version": "V1"
+        }"#).unwrap();
+        contract.add_post(None, body, HashSet::new());
+        let receipts = get_created_receipts();
+        assert_eq!(2, receipts.len());
+
+        // Extract the method_name and args values
+        if let near_sdk::mock::MockAction::FunctionCallWeight { method_name, args, .. } =
+            &receipts[1].actions[0]
+        {
+            assert_eq!(method_name, b"set");
+            assert_eq!(args, b"{\"data\":{\"bob.near\":{\"index\":{\"notify\":\"[{\\\"key\\\":\\\"petersalomonsen.near\\\",\\\"value\\\":{\\\"type\\\":\\\"devgovgigs/mention\\\",\\\"post\\\":0}},{\\\"key\\\":\\\"psalomo.near.\\\",\\\"value\\\":{\\\"type\\\":\\\"devgovgigs/mention\\\",\\\"post\\\":0}}]\"}}}}");
+        } else {
+            assert!(false, "Expected a function call ...")
+        }
+    }
+
+    #[test]
+    pub fn test_create_addon() {
+        let context = get_context_with_current(false, "bob.near".to_string());
+        testing_env!(context);
+
+        let mut contract = Contract::new();
+        let input = fake_addon("CommunityAddOnId".to_string());
+        contract.create_addon(input.to_owned());
+
+        let addon = contract.get_addon("CommunityAddOnId".to_owned());
+
+        assert_eq!(addon, Some(input))
+    }
+
+    pub fn fake_addon(id: String) -> AddOn {
+        let input = AddOn {
+            id: id.to_owned(),
+            title: "GitHub AddOn".to_owned(),
+            description: "Current status of NEARCORE repo".to_owned(),
+            view_widget: "custom-viewer-widget".to_owned(),
+            configurator_widget: "github-configurator".to_owned(),
+            icon: "bi bi-github".to_owned(),
+        };
+        return input;
+    }
+
+    #[test]
+    pub fn test_get_all_addons() {
+        let context = get_context_with_current(false, "bob.near".to_string());
+        testing_env!(context);
+        let mut contract = Contract::new();
+        let input = fake_addon("CommunityAddOnId".to_string());
+        contract.create_addon(input.to_owned());
+
+        let addons = contract.get_all_addons();
+
+        assert_eq!(addons[0], input)
+    }
+
+    #[test]
+    pub fn test_get_addon() {
+        let context = get_context_with_current(false, "bob.near".to_string());
+        testing_env!(context);
+        let mut contract = Contract::new();
+        let input = fake_addon("CommunityAddOnId".to_string());
+        contract.create_addon(input.to_owned());
+
+        let addon = contract.get_addon("CommunityAddOnId".to_owned());
+
+        assert_eq!(addon, Some(input))
+    }
+
+    #[test]
+    pub fn test_update_addon() {
+        let context = get_context(false);
+        testing_env!(context);
+        let mut contract = Contract::new();
+        let input = fake_addon("test".to_owned());
+        contract.create_addon(input.to_owned());
+
+        contract.update_addon(AddOn { title: "Telegram AddOn".to_owned(), ..input });
+
+        let addons = contract.get_all_addons();
+
+        assert_eq!(addons[0].title, "Telegram AddOn".to_owned());
+    }
+}
diff --git a/src/migrations.rs b/src/migrations.rs
new file mode 100644
index 0000000..1281d60
--- /dev/null
+++ b/src/migrations.rs
@@ -0,0 +1,826 @@
+//! Public methods of data model/state migrations between the versions.
+//! Should be invocable only by the owner and in most cases should be called only once though the
+//! latter is not asserted.
+
+use crate::*;
+use near_sdk::{borsh::to_vec, env, near, NearToken, Promise};
+use near_sdk::store::Lazy;
+use std::cmp::min;
+use std::collections::{HashSet, HashMap};
+
+#[near]
+#[derive(PanicOnDefault)]
+pub struct ContractV1 {
+    pub posts: Vector<VersionedPost>,
+    pub post_to_parent: LookupMap<PostId, PostId>,
+    pub post_to_children: LookupMap<PostId, Vec<PostId>>,
+    pub label_to_posts: UnorderedMap<String, HashSet<PostId>>,
+}
+
+// From ContractV1 to ContractV2
+impl Contract {
+    fn unsafe_add_acl() {
+        let ContractV1 { posts, post_to_parent, post_to_children, label_to_posts } =
+            env::state_read().unwrap();
+        env::state_write(&ContractV2 {
+            posts,
+            post_to_parent,
+            post_to_children,
+            label_to_posts,
+            access_control: Default::default(),
+        });
+    }
+}
+
+// // Fake vector purely for the sake of overriding initialization.
+// #[derive(BorshSerialize, BorshDeserialize)]
+// pub struct FakeVector {
+//     len: u64,
+//     prefix: Vec<u8>,
+// }
+//
+// impl FakeVector {
+//     pub fn new<S>(len: u64, prefix: S) -> Self
+//     where
+//         S: IntoStorageKey,
+//     {
+//         Self { len, prefix: prefix.into_storage_key() }
+//     }
+// }
+
+#[near]
+#[derive(PanicOnDefault)]
+pub struct ContractV2 {
+    pub posts: Vector<VersionedPost>,
+    pub post_to_parent: LookupMap<PostId, PostId>,
+    pub post_to_children: LookupMap<PostId, Vec<PostId>>,
+    pub label_to_posts: UnorderedMap<String, HashSet<PostId>>,
+    pub access_control: AccessControl,
+}
+
+// From ContractV2 to ContractV3
+impl Contract {
+    fn unsafe_add_post_authors() {
+        let ContractV2 { posts, post_to_parent, post_to_children, label_to_posts, access_control } =
+            env::state_read().unwrap();
+        let authors = UnorderedMap::new(StorageKey::AuthorToAuthorPosts);
+
+        env::state_write(&ContractV3 {
+            posts,
+            post_to_parent,
+            post_to_children,
+            label_to_posts,
+            access_control,
+            authors,
+        });
+    }
+
+    fn unsafe_insert_old_post_authors(start: u64, end: u64) -> StateVersion {
+        let mut contract: ContractV3 = env::state_read().unwrap();
+        let total = contract.posts.len();
+        let end = min(total, end);
+        for i in start..end {
+            let versioned_post = contract.posts.get(i);
+            if let Some(versioned_post) = versioned_post {
+                let post: Post = versioned_post.into();
+                let mut author_posts =
+                    contract.authors.get(&post.author_id).unwrap_or_else(|| HashSet::new());
+                author_posts.insert(post.id);
+                contract.authors.insert(&post.author_id, &author_posts);
+            }
+        }
+        env::state_write(&contract);
+        StateVersion::V3 { done: end == total, migrated_count: end }
+    }
+}
+
+#[near]
+#[derive(PanicOnDefault)]
+pub struct ContractV3 {
+    pub posts: Vector<VersionedPost>,
+    pub post_to_parent: LookupMap<PostId, PostId>,
+    pub post_to_children: LookupMap<PostId, Vec<PostId>>,
+    pub label_to_posts: UnorderedMap<String, HashSet<PostId>>,
+    pub access_control: AccessControl,
+    pub authors: UnorderedMap<AccountId, HashSet<PostId>>,
+}
+
+// From ContractV3 to ContractV4
+impl Contract {
+    fn unsafe_add_communities() {
+        let ContractV3 {
+            posts,
+            post_to_parent,
+            post_to_children,
+            label_to_posts,
+            access_control,
+            authors,
+        } = env::state_read().unwrap();
+        env::state_write(&ContractV4 {
+            posts,
+            post_to_parent,
+            post_to_children,
+            label_to_posts,
+            access_control,
+            authors,
+            communities: UnorderedMap::new(StorageKey::Communities),
+        });
+    }
+}
+
+#[near]
+#[derive(PanicOnDefault)]
+pub struct ContractV4 {
+    pub posts: Vector<VersionedPost>,
+    pub post_to_parent: LookupMap<PostId, PostId>,
+    pub post_to_children: LookupMap<PostId, Vec<PostId>>,
+    pub label_to_posts: UnorderedMap<String, HashSet<PostId>>,
+    pub access_control: AccessControl,
+    pub authors: UnorderedMap<AccountId, HashSet<PostId>>,
+    pub communities: UnorderedMap<String, CommunityV1>,
+}
+
+// From ContractV4 to ContractV5
+impl Contract {
+    fn unsafe_add_featured_communities() {
+        let ContractV4 {
+            posts,
+            post_to_parent,
+            post_to_children,
+            label_to_posts,
+            access_control,
+            authors,
+            communities,
+        } = env::state_read().unwrap();
+        env::state_write(&ContractV5 {
+            posts,
+            post_to_parent,
+            post_to_children,
+            label_to_posts,
+            access_control,
+            authors,
+            communities,
+            featured_communities: Vec::new(),
+        });
+    }
+}
+
+#[near]
+#[derive(Clone)]
+pub struct CommunityV1 {
+    pub handle: CommunityHandle,
+    pub admins: Vec<AccountId>,
+    pub name: String,
+    pub description: String,
+    pub bio_markdown: Option<String>,
+    pub logo_url: String,
+    pub banner_url: String,
+    pub tag: String,
+    pub github_handle: Option<String>,
+    pub telegram_handle: Option<String>,
+    pub twitter_handle: Option<String>,
+    pub website_url: Option<String>,
+    /// JSON string of github board configuration
+    pub github: Option<String>,
+    pub sponsorship: Option<bool>,
+    pub wiki1: Option<WikiPage>,
+    pub wiki2: Option<WikiPage>,
+}
+
+#[near]
+#[derive(PanicOnDefault)]
+pub struct ContractV5 {
+    pub posts: Vector<VersionedPost>,
+    pub post_to_parent: LookupMap<PostId, PostId>,
+    pub post_to_children: LookupMap<PostId, Vec<PostId>>,
+    pub label_to_posts: UnorderedMap<String, HashSet<PostId>>,
+    pub access_control: AccessControl,
+    pub authors: UnorderedMap<AccountId, HashSet<PostId>>,
+    pub communities: UnorderedMap<String, CommunityV1>,
+    pub featured_communities: Vec<FeaturedCommunity>,
+}
+
+// From ContractV5 to ContractV6
+impl Contract {
+    fn unsafe_multiple_telegrams() {
+        let ContractV5 {
+            posts,
+            post_to_parent,
+            post_to_children,
+            label_to_posts,
+            access_control,
+            authors,
+            mut communities,
+            featured_communities,
+        } = env::state_read().unwrap();
+
+        let migrated_communities: Vec<(String, CommunityV2)> = communities
+            .iter()
+            .map(|(community_handle, community)| {
+                (
+                    community_handle,
+                    CommunityV2 {
+                        handle: community.handle,
+                        admins: community.admins,
+                        name: community.name,
+                        description: community.description,
+                        bio_markdown: community.bio_markdown,
+                        logo_url: community.logo_url,
+                        banner_url: community.banner_url,
+                        tag: community.tag,
+                        github_handle: community.github_handle,
+                        telegram_handle: community.telegram_handle.iter().cloned().collect(),
+                        twitter_handle: community.twitter_handle,
+                        website_url: community.website_url,
+                        github: community.github,
+                        sponsorship: community.sponsorship,
+                        wiki1: community.wiki1,
+                        wiki2: community.wiki2,
+                    },
+                )
+            })
+            .collect();
+
+        communities.clear();
+
+        let mut communities_new = UnorderedMap::new(StorageKey::Communities);
+
+        for (k, v) in migrated_communities {
+            communities_new.insert(&k, &v);
+        }
+
+        env::state_write(&ContractV6 {
+            posts,
+            post_to_parent,
+            post_to_children,
+            label_to_posts,
+            access_control,
+            authors,
+            communities: communities_new,
+            featured_communities,
+        });
+    }
+}
+
+#[near]
+#[derive(Clone)]
+pub struct CommunityV2 {
+    pub handle: CommunityHandle,
+    pub admins: Vec<AccountId>,
+    pub name: String,
+    pub description: String,
+    pub bio_markdown: Option<String>,
+    pub logo_url: String,
+    pub banner_url: String,
+    pub tag: String,
+    pub github_handle: Option<String>,
+    pub telegram_handle: Vec<String>,
+    pub twitter_handle: Option<String>,
+    pub website_url: Option<String>,
+    /// JSON string of github board configuration
+    pub github: Option<String>,
+    pub sponsorship: Option<bool>,
+    pub wiki1: Option<WikiPage>,
+    pub wiki2: Option<WikiPage>,
+}
+
+#[near]
+#[derive(PanicOnDefault)]
+pub struct ContractV6 {
+    pub posts: Vector<VersionedPost>,
+    pub post_to_parent: LookupMap<PostId, PostId>,
+    pub post_to_children: LookupMap<PostId, Vec<PostId>>,
+    pub label_to_posts: UnorderedMap<String, HashSet<PostId>>,
+    pub access_control: AccessControl,
+    pub authors: UnorderedMap<AccountId, HashSet<PostId>>,
+    pub communities: UnorderedMap<String, CommunityV2>,
+    pub featured_communities: Vec<FeaturedCommunity>,
+}
+
+// From ContractV6 to ContractV7
+impl Contract {
+    fn unsafe_add_board_and_feature_flags() {
+        let ContractV6 {
+            posts,
+            post_to_parent,
+            post_to_children,
+            label_to_posts,
+            access_control,
+            authors,
+            mut communities,
+            featured_communities,
+        } = env::state_read().unwrap();
+
+        let migrated_communities: Vec<(String, CommunityV3)> = communities
+            .iter()
+            .map(|(community_handle, community)| {
+                (
+                    community_handle,
+                    CommunityV3 {
+                        admins: community.admins,
+                        handle: community.handle,
+                        name: community.name,
+                        tag: community.tag,
+                        description: community.description,
+                        logo_url: community.logo_url,
+                        banner_url: community.banner_url,
+                        bio_markdown: community.bio_markdown,
+                        github_handle: community.github_handle,
+                        telegram_handle: community.telegram_handle,
+                        twitter_handle: community.twitter_handle,
+                        website_url: community.website_url,
+                        github: community.github,
+                        board: None,
+                        wiki1: community.wiki1,
+                        wiki2: community.wiki2,
+
+                        features: CommunityFeatureFlags {
+                            telegram: true,
+                            github: true,
+                            board: true,
+                            wiki: true,
+                        },
+                    },
+                )
+            })
+            .collect();
+
+        communities.clear();
+
+        let mut communities_new = UnorderedMap::new(StorageKey::Communities);
+
+        for (k, v) in migrated_communities {
+            communities_new.insert(&k, &v);
+        }
+
+        env::state_write(&ContractV7 {
+            posts,
+            post_to_parent,
+            post_to_children,
+            label_to_posts,
+            access_control,
+            authors,
+            communities: communities_new,
+            featured_communities,
+        });
+    }
+}
+
+#[near]
+#[derive(Clone)]
+pub struct CommunityV3 {
+    pub admins: Vec<AccountId>,
+    pub handle: CommunityHandle,
+    pub name: String,
+    pub tag: String,
+    pub description: String,
+    pub logo_url: String,
+    pub banner_url: String,
+    pub bio_markdown: Option<String>,
+    pub github_handle: Option<String>,
+    pub telegram_handle: Vec<String>,
+    pub twitter_handle: Option<String>,
+    pub website_url: Option<String>,
+    /// JSON string of github board configuration
+    pub github: Option<String>,
+    /// JSON string of kanban board configuration
+    pub board: Option<String>,
+    pub wiki1: Option<WikiPage>,
+    pub wiki2: Option<WikiPage>,
+    pub features: CommunityFeatureFlags,
+}
+
+#[near]
+#[derive(PanicOnDefault)]
+pub struct ContractV7 {
+    pub posts: Vector<VersionedPost>,
+    pub post_to_parent: LookupMap<PostId, PostId>,
+    pub post_to_children: LookupMap<PostId, Vec<PostId>>,
+    pub label_to_posts: UnorderedMap<String, HashSet<PostId>>,
+    pub access_control: AccessControl,
+    pub authors: UnorderedMap<AccountId, HashSet<PostId>>,
+    pub communities: UnorderedMap<String, CommunityV3>,
+    pub featured_communities: Vec<FeaturedCommunity>,
+}
+
+// From ContractV7 to ContractV8
+impl Contract {
+    fn unsafe_add_community_addons() {
+        let ContractV7 {
+            posts,
+            post_to_parent,
+            post_to_children,
+            label_to_posts,
+            access_control,
+            authors,
+            mut communities,
+            featured_communities,
+        } = env::state_read().unwrap();
+
+        let migrated_communities: Vec<(String, CommunityV4)> = communities
+            .iter()
+            .map(|(community_handle, community)| {
+                (
+                    community_handle,
+                    CommunityV4 {
+                        admins: community.admins,
+                        handle: community.handle,
+                        name: community.name,
+                        tag: community.tag,
+                        description: community.description,
+                        logo_url: community.logo_url,
+                        banner_url: community.banner_url,
+                        bio_markdown: community.bio_markdown,
+                        github_handle: community.github_handle,
+                        telegram_handle: community.telegram_handle,
+                        twitter_handle: community.twitter_handle,
+                        website_url: community.website_url,
+                        github: community.github,
+                        board: None,
+                        wiki1: community.wiki1,
+                        wiki2: community.wiki2,
+                        features: community.features,
+                        addons: Vec::new(),
+                    },
+                )
+            })
+            .collect();
+
+        communities.clear();
+
+        let mut communities_new = UnorderedMap::new(StorageKey::Communities);
+
+        for (k, v) in migrated_communities {
+            communities_new.insert(&k, &v);
+        }
+
+        env::state_write(&ContractV8 {
+            posts,
+            post_to_parent,
+            post_to_children,
+            label_to_posts,
+            access_control,
+            authors,
+            communities: communities_new,
+            featured_communities,
+            available_addons: UnorderedMap::new(StorageKey::AddOns),
+        });
+    }
+}
+
+#[near]
+pub struct CommunityV4 {
+    pub admins: Vec<AccountId>,
+    pub handle: CommunityHandle,
+    pub name: String,
+    pub tag: String,
+    pub description: String,
+    pub logo_url: String,
+    pub banner_url: String,
+    pub bio_markdown: Option<String>,
+    pub github_handle: Option<String>,
+    pub telegram_handle: Vec<String>,
+    pub twitter_handle: Option<String>,
+    pub website_url: Option<String>,
+    /// JSON string of github board configuration
+    pub github: Option<String>,
+    /// JSON string of kanban board configuration
+    pub board: Option<String>,
+    pub wiki1: Option<WikiPage>,
+    pub wiki2: Option<WikiPage>,
+    pub features: CommunityFeatureFlags,
+    pub addons: Vec<CommunityAddOn>,
+}
+
+#[near]
+#[derive(PanicOnDefault)]
+pub struct ContractV8 {
+    pub posts: Vector<VersionedPost>,
+    pub post_to_parent: LookupMap<PostId, PostId>,
+    pub post_to_children: LookupMap<PostId, Vec<PostId>>,
+    pub label_to_posts: UnorderedMap<String, HashSet<PostId>>,
+    pub access_control: AccessControl,
+    pub authors: UnorderedMap<AccountId, HashSet<PostId>>,
+    pub communities: UnorderedMap<String, CommunityV4>,
+    pub featured_communities: Vec<FeaturedCommunity>,
+    pub available_addons: UnorderedMap<AddOnId, AddOn>,
+}
+
+// From ContractV8 to ContractV9
+impl Contract {
+    fn unsafe_clean_up_community() {
+        let ContractV8 {
+            posts,
+            post_to_parent,
+            post_to_children,
+            label_to_posts,
+            access_control,
+            authors,
+            mut communities,
+            featured_communities,
+            available_addons,
+        } = env::state_read().unwrap();
+        let migrated_communities: Vec<(String, CommunityV5)> = communities
+            .iter()
+            .map(|(community_handle, community)| {
+                (
+                    community_handle,
+                    CommunityV5 {
+                        admins: community.admins,
+                        handle: community.handle,
+                        name: community.name,
+                        tag: community.tag,
+                        description: community.description,
+                        logo_url: community.logo_url,
+                        banner_url: community.banner_url,
+                        bio_markdown: community.bio_markdown,
+                        github_handle: community.github_handle,
+                        telegram_handle: community.telegram_handle.first().cloned(),
+                        twitter_handle: community.twitter_handle,
+                        website_url: community.website_url,
+                        addons: community.addons,
+                    },
+                )
+            })
+            .collect();
+
+        communities.clear();
+
+        let mut communities_new = UnorderedMap::new(StorageKey::Communities);
+
+        for (k, v) in migrated_communities {
+            communities_new.insert(&k, &v);
+        }
+
+        env::state_write(&ContractV9 {
+            posts,
+            post_to_parent,
+            post_to_children,
+            label_to_posts,
+            access_control,
+            authors,
+            communities: communities_new,
+            featured_communities,
+            available_addons,
+        });
+    }
+}
+
+#[near]
+pub struct CommunityV5 {
+    pub admins: Vec<AccountId>,
+    pub handle: CommunityHandle,
+    pub name: String,
+    pub tag: String,
+    pub description: String,
+    pub logo_url: String,
+    pub banner_url: String,
+    pub bio_markdown: Option<String>,
+    pub github_handle: Option<String>,
+    pub telegram_handle: Option<String>,
+    pub twitter_handle: Option<String>,
+    pub website_url: Option<String>,
+    pub addons: Vec<CommunityAddOn>,
+}
+
+#[near]
+#[derive(PanicOnDefault)]
+pub struct ContractV9 {
+    pub posts: Vector<VersionedPost>,
+    pub post_to_parent: LookupMap<PostId, PostId>,
+    pub post_to_children: LookupMap<PostId, Vec<PostId>>,
+    pub label_to_posts: UnorderedMap<String, HashSet<PostId>>,
+    pub access_control: AccessControl,
+    pub authors: UnorderedMap<AccountId, HashSet<PostId>>,
+    pub communities: UnorderedMap<String, CommunityV5>,
+    pub featured_communities: Vec<FeaturedCommunity>,
+    pub available_addons: UnorderedMap<AddOnId, AddOn>,
+}
+
+// From ContractV9 to ContractV10
+impl Contract {
+    fn unsafe_add_proposals() {
+        let ContractV9 {
+            posts,
+            post_to_parent,
+            post_to_children,
+            label_to_posts,
+            access_control,
+            authors,
+            communities,
+            featured_communities,
+            available_addons,
+        } = env::state_read().unwrap();
+
+        env::state_write(&ContractV10 {
+            posts,
+            post_to_parent,
+            post_to_children,
+            label_to_posts,
+            access_control,
+            authors,
+            proposals: Vector::new(StorageKey::Proposals),
+            label_to_proposals: UnorderedMap::new(StorageKey::LabelToProposals),
+            author_proposals: UnorderedMap::new(StorageKey::AuthorProposals),
+            proposal_categories: default_categories(),
+            communities,
+            featured_communities,
+            available_addons,
+        });
+    }
+}
+
+#[near]
+#[derive(PanicOnDefault)]
+pub struct ContractV10 {
+    pub posts: Vector<VersionedPost>,
+    pub post_to_parent: LookupMap<PostId, PostId>,
+    pub post_to_children: LookupMap<PostId, Vec<PostId>>,
+    pub label_to_posts: UnorderedMap<String, HashSet<PostId>>,
+    pub access_control: AccessControl,
+    pub authors: UnorderedMap<AccountId, HashSet<PostId>>,
+    pub proposals: Vector<VersionedProposal>,
+    pub label_to_proposals: UnorderedMap<String, HashSet<ProposalId>>,
+    pub author_proposals: UnorderedMap<AccountId, HashSet<ProposalId>>,
+    pub proposal_categories: Vec<String>,
+    pub communities: UnorderedMap<CommunityHandle, CommunityV5>,
+    pub featured_communities: Vec<FeaturedCommunity>,
+    pub available_addons: UnorderedMap<AddOnId, AddOn>,
+}
+
+// From ContractV10 to ContractV11
+impl Contract {
+    fn unsafe_add_rfp() {
+        let ContractV10 {
+            posts,
+            post_to_parent,
+            post_to_children,
+            label_to_posts,
+            access_control,
+            authors,
+            proposals,
+            label_to_proposals,
+            author_proposals,
+            proposal_categories,
+            communities,
+            featured_communities,
+            available_addons,
+        } = env::state_read().unwrap();
+
+        env::state_write(&ContractV11 {
+            posts,
+            post_to_parent,
+            post_to_children,
+            label_to_posts,
+            access_control,
+            authors,
+            proposals,
+            label_to_proposals,
+            author_proposals,
+            proposal_categories,
+            rfps: Vector::new(StorageKey::RFPs),
+            label_to_rfps: UnorderedMap::new(StorageKey::LabelToRFPs),
+            global_labels_info: Lazy::new(StorageKey::LabelInfo, HashMap::new()),
+            communities,
+            featured_communities,
+            available_addons,
+        });
+    }
+}
+
+#[near]
+#[derive(PanicOnDefault)]
+pub struct ContractV11 {
+    pub posts: Vector<VersionedPost>,
+    pub post_to_parent: LookupMap<PostId, PostId>,
+    pub post_to_children: LookupMap<PostId, Vec<PostId>>,
+    pub label_to_posts: UnorderedMap<String, HashSet<PostId>>,
+    pub access_control: AccessControl,
+    pub authors: UnorderedMap<AccountId, HashSet<PostId>>,
+    pub proposals: Vector<VersionedProposal>,
+    pub label_to_proposals: UnorderedMap<String, HashSet<ProposalId>>,
+    pub author_proposals: UnorderedMap<AccountId, HashSet<ProposalId>>,
+    pub proposal_categories: Vec<String>,
+    pub rfps: Vector<VersionedRFP>,
+    pub label_to_rfps: UnorderedMap<String, HashSet<RFPId>>,
+    pub global_labels_info: Lazy<HashMap<String, LabelInfo>>,
+    pub communities: UnorderedMap<CommunityHandle, CommunityV5>,
+    pub featured_communities: Vec<FeaturedCommunity>,
+    pub available_addons: UnorderedMap<AddOnId, AddOn>,
+}
+
+#[near]
+#[derive(Debug)]
+pub(crate) enum StateVersion {
+    V1,
+    V2,
+    V3 { done: bool, migrated_count: u64 },
+    V4,
+    V5,
+    V6,
+    V7,
+    V8,
+    V9,
+    V10,
+    V11,
+}
+
+const VERSION_KEY: &[u8] = b"VERSION";
+
+fn state_version_read() -> StateVersion {
+    env::storage_read(VERSION_KEY)
+        .map(|data| {
+            StateVersion::try_from_slice(&data).expect("Cannot deserialize the contract state.")
+        })
+        .unwrap_or(StateVersion::V2) // StateVersion is introduced in production contract with V2 State.
+}
+
+pub(crate) fn state_version_write(version: &StateVersion) {
+    let data = to_vec(&version).expect("Cannot serialize the contract state.");
+    env::storage_write(VERSION_KEY, &data);
+    near_sdk::log!("Migrated to version: {:?}", version);
+}
+
+#[near]
+impl Contract {
+    pub fn unsafe_self_upgrade() {
+        near_sdk::assert_self();
+
+        let contract = env::input().expect("No contract code is attached in input");
+        Promise::new(env::current_account_id())
+            .deploy_contract(contract)
+            .then(Promise::new(env::current_account_id()).function_call(
+                "unsafe_migrate".to_string(),
+                Vec::new(),
+                NearToken::from_near(0),
+                env::prepaid_gas().saturating_sub(near_sdk::Gas::from_tgas(100)),
+            ))
+            .as_return();
+    }
+
+    fn migration_done() {
+        near_sdk::log!("Migration done.");
+        env::value_return(b"\"done\"");
+    }
+
+    fn needs_migration() {
+        env::value_return(b"\"needs-migration\"");
+    }
+
+    pub fn unsafe_migrate() {
+        near_sdk::assert_self();
+        let current_version = state_version_read();
+        near_sdk::log!("Migrating from version: {:?}", current_version);
+        match current_version {
+            StateVersion::V1 => {
+                Contract::unsafe_add_acl();
+                state_version_write(&StateVersion::V2);
+            }
+            StateVersion::V2 => {
+                Contract::unsafe_add_post_authors();
+                state_version_write(&StateVersion::V3 { done: false, migrated_count: 0 })
+            }
+            StateVersion::V3 { done: false, migrated_count } => {
+                let new_version =
+                    Contract::unsafe_insert_old_post_authors(migrated_count, migrated_count + 100);
+                state_version_write(&new_version);
+            }
+            StateVersion::V3 { done: true, migrated_count: _ } => {
+                Contract::unsafe_add_communities();
+                state_version_write(&StateVersion::V4);
+            }
+            StateVersion::V4 => {
+                Contract::unsafe_add_featured_communities();
+                state_version_write(&StateVersion::V5);
+            }
+            StateVersion::V5 => {
+                Contract::unsafe_multiple_telegrams();
+                state_version_write(&StateVersion::V6);
+            }
+            StateVersion::V6 => {
+                Contract::unsafe_add_board_and_feature_flags();
+                state_version_write(&StateVersion::V7);
+            }
+            StateVersion::V7 => {
+                Contract::unsafe_add_community_addons();
+                state_version_write(&StateVersion::V8);
+            }
+            StateVersion::V8 => {
+                Contract::unsafe_clean_up_community();
+                state_version_write(&StateVersion::V9);
+            }
+            StateVersion::V9 => {
+                Contract::unsafe_add_proposals();
+                state_version_write(&StateVersion::V10);
+            }
+            StateVersion::V10 => {
+                Contract::unsafe_add_rfp();
+                state_version_write(&StateVersion::V11);
+            }
+            _ => {
+                return Contract::migration_done();
+            }
+        }
+        Contract::needs_migration();
+    }
+}
diff --git a/src/notify.rs b/src/notify.rs
new file mode 100644
index 0000000..8d86d80
--- /dev/null
+++ b/src/notify.rs
@@ -0,0 +1,208 @@
+use std::collections::HashSet;
+
+use crate::{
+    get_subscribers, rfp::get_subscribers as get_rfp_subscribers, PostId, Proposal, ProposalId, RFP,
+};
+use devhub_common::social_db_contract;
+use near_sdk::serde_json::json;
+use near_sdk::{env, AccountId, Promise};
+
+pub fn get_text_mentions(text: &str) -> Vec<String> {
+    let mut mentions = Vec::new();
+    let mut mention = String::new();
+    let mut recording = false;
+
+    for ch in text.chars() {
+        if recording {
+            if ch.is_alphanumeric() || ch == '.' {
+                mention.push(ch);
+            } else {
+                if !mention.is_empty() {
+                    mentions.push(mention.clone());
+                    mention.clear();
+                }
+                recording = false;
+            }
+        }
+
+        if ch == '@' {
+            recording = true;
+        }
+    }
+
+    // Push the last mention if it wasn't pushed yet
+    if recording && !mention.is_empty() {
+        mentions.push(mention);
+    }
+
+    mentions
+}
+
+pub fn notify_accounts(
+    notifier: AccountId,
+    accounts: Vec<String>,
+    notify_value: serde_json::Value,
+) -> Promise {
+    if !accounts.is_empty() {
+        let mut notify_values = Vec::new();
+
+        for account in accounts {
+            notify_values.push(json!({
+                "key": account,
+                "value": notify_value,
+            }));
+        }
+
+        social_db_contract()
+            .with_static_gas(env::prepaid_gas().saturating_div(4))
+            .with_attached_deposit(env::attached_deposit())
+            .set(json!({
+                notifier : {
+                    "index": {
+                        "notify": json!(notify_values).to_string()
+                    }
+                }
+            }))
+    } else {
+        Promise::new(env::current_account_id())
+    }
+}
+
+pub fn notify_proposal_subscribers(proposal: &Proposal) -> Promise {
+    let accounts = get_subscribers(&proposal.snapshot.body.clone().latest_version());
+
+    notify_accounts(
+        env::current_account_id(),
+        accounts,
+        json!({
+            "type": "proposal/mention",
+            "proposal": proposal.id,
+            "widgetAccountId": env::current_account_id(),
+            "notifier": env::predecessor_account_id(),
+        }),
+    )
+}
+
+pub fn notify_rfp_subscribers(rfp: &RFP, additional_accounts: HashSet<AccountId>) -> Promise {
+    let accounts = [
+        get_rfp_subscribers(&rfp.snapshot.body.clone().latest_version()),
+        additional_accounts.iter().map(|x| x.to_string()).collect::<Vec<_>>(),
+    ]
+    .concat();
+
+    notify_accounts(
+        env::current_account_id(),
+        accounts,
+        json!({
+            "type": "rfp/mention",
+            "rfp": rfp.id,
+            "widgetAccountId": env::current_account_id(),
+            "notifier": env::current_account_id(),
+        }),
+    )
+}
+
+pub fn notify_mentions(text: &str, post_id: PostId) -> Promise {
+    let mentions = get_text_mentions(text);
+
+    notify_accounts(
+        env::predecessor_account_id(),
+        mentions,
+        json!({
+            "type": "devgovgigs/mention",
+            "post": post_id,
+        }),
+    )
+}
+
+pub fn notify_like(post_id: PostId, post_author: AccountId) -> Promise {
+    notify(env::predecessor_account_id(), post_author, notify_value(post_id, "like"))
+}
+
+pub fn notify_reply(post_id: PostId, post_author: AccountId) -> Promise {
+    notify(env::predecessor_account_id(), post_author, notify_value(post_id, "reply"))
+}
+
+pub fn notify_edit(post_id: PostId, post_author: AccountId) -> Promise {
+    notify(env::predecessor_account_id(), post_author, notify_value(post_id, "edit"))
+}
+
+pub fn notify_edit_proposal(proposal_id: ProposalId, post_author: AccountId) -> Promise {
+    notify(
+        env::current_account_id(),
+        post_author,
+        json!({
+            "type": "proposal/edit",
+            "proposal": proposal_id,
+            "widgetAccountId": env::current_account_id(),
+            "notifier": env::predecessor_account_id(),
+        }),
+    )
+}
+
+fn notify_value(post_id: PostId, action: &str) -> serde_json::Value {
+    json!({
+        "type": format!("devgovgigs/{}", action),
+        "post": post_id,
+    })
+}
+
+fn notify(notifier: AccountId, post_author: AccountId, notify_value: serde_json::Value) -> Promise {
+    social_db_contract()
+        .with_static_gas(env::prepaid_gas().saturating_div(4))
+        .with_attached_deposit(env::attached_deposit())
+        .set(json!({
+            notifier : {
+                "index": {
+                    "notify": json!({
+                        "key": post_author,
+                        "value": notify_value,
+                    }).to_string()
+                }
+            }
+        }))
+}
+
+#[cfg(all(test, not(target_arch = "wasm32")))]
+mod tests {
+    use super::notify_mentions;
+
+    use near_sdk::test_utils::{get_created_receipts, VMContextBuilder};
+    use near_sdk::{testing_env, VMContext};
+
+    fn get_context(is_view: bool) -> VMContext {
+        VMContextBuilder::new()
+            .signer_account_id("bob.near".parse().unwrap())
+            .is_view(is_view)
+            .build()
+    }
+
+    #[test]
+    pub fn test_notify_mentions() {
+        let context = get_context(false);
+        testing_env!(context);
+        let text = "Mentioning @a.near and @bcdefg.near";
+        notify_mentions(text, 2);
+        let receipts = get_created_receipts();
+        assert_eq!(1, receipts.len());
+
+        if let near_sdk::mock::MockAction::FunctionCallWeight { method_name, args, .. } =
+            &receipts[0].actions[0]
+        {
+            assert_eq!(method_name, b"set");
+            assert_eq!(args, b"{\"data\":{\"bob.near\":{\"index\":{\"notify\":\"[{\\\"key\\\":\\\"a.near\\\",\\\"value\\\":{\\\"type\\\":\\\"devgovgigs/mention\\\",\\\"post\\\":2}},{\\\"key\\\":\\\"bcdefg.near\\\",\\\"value\\\":{\\\"type\\\":\\\"devgovgigs/mention\\\",\\\"post\\\":2}}]\"}}}}");
+        } else {
+            assert!(false, "Expected a function call ...")
+        }
+    }
+
+    #[test]
+    pub fn test_no_mentions() {
+        let context = get_context(false);
+        testing_env!(context);
+        let text = "Not mentioning anyone";
+        notify_mentions(text, 2);
+        assert_eq!(1, get_created_receipts().len());
+        assert_eq!(0, get_created_receipts()[0].actions.len());
+    }
+}
diff --git a/src/post/attestation.rs b/src/post/attestation.rs
new file mode 100644
index 0000000..3f37803
--- /dev/null
+++ b/src/post/attestation.rs
@@ -0,0 +1,80 @@
+use super::{Like, PostStatus};
+use crate::str_serializers::*;
+use crate::{AttestationId, CommentId, SolutionId};
+use near_sdk::borsh::{BorshDeserialize, BorshSerialize};
+use near_sdk::serde::{Deserialize, Serialize};
+use near_sdk::{AccountId, NearSchema, Timestamp};
+use std::collections::HashSet;
+
+#[derive(BorshSerialize, BorshDeserialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub struct Attestation {
+    // Common fields
+    pub id: AttestationId,
+    pub name: String,
+    pub description: String,
+    pub author_id: AccountId,
+    #[serde(
+        serialize_with = "u64_dec_format::serialize",
+        deserialize_with = "u64_dec_format::deserialize"
+    )]
+    pub timestamp: Timestamp,
+    pub status: PostStatus,
+    pub likes: HashSet<Like>,
+    pub comments: Vec<CommentId>,
+
+    //Specific fields
+    #[serde(
+        serialize_with = "u64_dec_format::serialize",
+        deserialize_with = "u64_dec_format::deserialize"
+    )]
+    pub submission_id: SolutionId,
+}
+
+#[derive(BorshSerialize, BorshDeserialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub struct AttestationV1 {
+    pub name: String,
+    pub description: String,
+}
+
+#[derive(BorshDeserialize, BorshSerialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[serde(tag = "attestation_version")]
+#[borsh(crate = "near_sdk::borsh")]
+pub enum VersionedAttestation {
+    V0(Attestation),
+    V1(AttestationV1),
+}
+
+impl VersionedAttestation {
+    pub fn latest_version(self) -> AttestationV1 {
+        self.into()
+    }
+}
+
+impl From<VersionedAttestation> for Attestation {
+    fn from(va: VersionedAttestation) -> Self {
+        match va {
+            VersionedAttestation::V0(v0) => v0,
+            VersionedAttestation::V1(_) => unimplemented!(),
+        }
+    }
+}
+
+impl From<VersionedAttestation> for AttestationV1 {
+    fn from(va: VersionedAttestation) -> Self {
+        match va {
+            VersionedAttestation::V0(_) => unimplemented!(),
+            VersionedAttestation::V1(v1) => v1,
+        }
+    }
+}
+
+impl From<Attestation> for VersionedAttestation {
+    fn from(a: Attestation) -> Self {
+        VersionedAttestation::V0(a)
+    }
+}
diff --git a/src/post/comment.rs b/src/post/comment.rs
new file mode 100644
index 0000000..071288c
--- /dev/null
+++ b/src/post/comment.rs
@@ -0,0 +1,93 @@
+use super::Like;
+use crate::str_serializers::*;
+use crate::CommentId;
+use near_sdk::borsh::{BorshDeserialize, BorshSerialize};
+use near_sdk::serde::{Deserialize, Serialize};
+use near_sdk::{AccountId, NearSchema, Timestamp};
+use std::collections::HashSet;
+
+#[derive(BorshSerialize, BorshDeserialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub struct CommentV0 {
+    pub author_id: AccountId,
+    #[serde(
+        serialize_with = "u64_dec_format::serialize",
+        deserialize_with = "u64_dec_format::deserialize"
+    )]
+    pub timestamp: Timestamp,
+    pub description: String,
+    pub likes: HashSet<Like>,
+    pub comments: Vec<CommentId>,
+}
+
+#[derive(BorshSerialize, BorshDeserialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub struct Comment {
+    pub id: CommentId,
+    pub author_id: AccountId,
+    #[serde(
+        serialize_with = "u64_dec_format::serialize",
+        deserialize_with = "u64_dec_format::deserialize"
+    )]
+    pub timestamp: Timestamp,
+    pub description: String,
+    pub likes: HashSet<Like>,
+    pub comments: Vec<CommentId>,
+}
+
+#[derive(BorshSerialize, BorshDeserialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub struct CommentV2 {
+    pub description: String,
+}
+
+#[derive(BorshSerialize, BorshDeserialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[serde(tag = "comment_version")]
+#[borsh(crate = "near_sdk::borsh")]
+pub enum VersionedComment {
+    V0(CommentV0),
+    V1(Comment),
+    V2(CommentV2),
+}
+
+impl VersionedComment {
+    pub fn latest_version(self) -> CommentV2 {
+        self.into()
+    }
+}
+
+impl From<VersionedComment> for Comment {
+    fn from(vc: VersionedComment) -> Self {
+        match vc {
+            VersionedComment::V0(v0) => Comment {
+                id: 0,
+                author_id: v0.author_id,
+                timestamp: v0.timestamp,
+                description: v0.description,
+                likes: v0.likes,
+                comments: v0.comments,
+            },
+            VersionedComment::V1(v1) => v1,
+            VersionedComment::V2(_) => unimplemented!(),
+        }
+    }
+}
+
+impl From<VersionedComment> for CommentV2 {
+    fn from(vc: VersionedComment) -> Self {
+        match vc {
+            VersionedComment::V2(v2) => v2,
+            _ => unimplemented!(),
+        }
+    }
+}
+
+impl From<Comment> for VersionedComment {
+    fn from(c: Comment) -> Self {
+        VersionedComment::V1(c)
+    }
+}
diff --git a/src/post/github.rs b/src/post/github.rs
new file mode 100644
index 0000000..f3f91b3
--- /dev/null
+++ b/src/post/github.rs
@@ -0,0 +1,33 @@
+use near_sdk::borsh::{BorshDeserialize, BorshSerialize};
+use near_sdk::serde::{Deserialize, Serialize};
+
+#[derive(BorshDeserialize, BorshSerialize, Serialize, Deserialize, Clone)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub struct GithubV0 {
+    pub github_link: String,
+    pub name: String,
+    pub description: String,
+}
+
+#[derive(BorshDeserialize, BorshSerialize, Serialize, Deserialize, Clone)]
+#[serde(crate = "near_sdk::serde")]
+#[serde(tag = "github_version")]
+#[borsh(crate = "near_sdk::borsh")]
+pub enum VersionedGithub {
+    V0(GithubV0),
+}
+
+impl From<GithubV0> for VersionedGithub {
+    fn from(v0: GithubV0) -> Self {
+        VersionedGithub::V0(v0)
+    }
+}
+
+impl From<VersionedGithub> for GithubV0 {
+    fn from(vg: VersionedGithub) -> Self {
+        match vg {
+            VersionedGithub::V0(v0) => v0,
+        }
+    }
+}
diff --git a/src/post/idea.rs b/src/post/idea.rs
new file mode 100644
index 0000000..39c23de
--- /dev/null
+++ b/src/post/idea.rs
@@ -0,0 +1,71 @@
+use super::{Like, PostStatus};
+use crate::{CommentId, IdeaId, SolutionId};
+use near_sdk::borsh::{BorshDeserialize, BorshSerialize};
+use near_sdk::serde::{Deserialize, Serialize};
+use near_sdk::{AccountId, NearSchema, Timestamp};
+use std::collections::HashSet;
+
+#[derive(BorshDeserialize, BorshSerialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub struct Idea {
+    // Common Fields
+    pub id: IdeaId,
+    pub name: String,
+    pub description: String,
+    pub author_id: AccountId,
+    pub timestamp: Timestamp,
+    pub status: PostStatus,
+    pub likes: HashSet<Like>,
+    pub comments: Vec<CommentId>,
+
+    // Specific fields
+    pub solutions: Vec<SolutionId>,
+}
+
+#[derive(BorshDeserialize, BorshSerialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub struct IdeaV1 {
+    pub name: String,
+    pub description: String,
+}
+
+#[derive(BorshDeserialize, BorshSerialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[serde(tag = "idea_version")]
+#[borsh(crate = "near_sdk::borsh")]
+pub enum VersionedIdea {
+    V0(Idea),
+    V1(IdeaV1),
+}
+
+impl VersionedIdea {
+    pub fn latest_version(self) -> IdeaV1 {
+        self.into()
+    }
+}
+
+impl From<VersionedIdea> for Idea {
+    fn from(vi: VersionedIdea) -> Self {
+        match vi {
+            VersionedIdea::V0(v0) => v0,
+            VersionedIdea::V1(_) => unimplemented!(),
+        }
+    }
+}
+
+impl From<VersionedIdea> for IdeaV1 {
+    fn from(vi: VersionedIdea) -> Self {
+        match vi {
+            VersionedIdea::V1(v1) => v1,
+            _ => unimplemented!(),
+        }
+    }
+}
+
+impl From<Idea> for VersionedIdea {
+    fn from(idea: Idea) -> Self {
+        VersionedIdea::V0(idea)
+    }
+}
diff --git a/src/post/like.rs b/src/post/like.rs
new file mode 100644
index 0000000..73b2d82
--- /dev/null
+++ b/src/post/like.rs
@@ -0,0 +1,38 @@
+use crate::str_serializers::*;
+use near_sdk::borsh::{BorshDeserialize, BorshSerialize};
+use near_sdk::serde::{Deserialize, Serialize};
+use near_sdk::{AccountId, NearSchema, Timestamp};
+use std::cmp::Ordering;
+use std::hash::{Hash, Hasher};
+
+#[derive(BorshSerialize, BorshDeserialize, Serialize, Deserialize, Clone, Ord, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub struct Like {
+    pub author_id: AccountId,
+    #[serde(
+        serialize_with = "u64_dec_format::serialize",
+        deserialize_with = "u64_dec_format::deserialize"
+    )]
+    pub timestamp: Timestamp,
+}
+
+impl Hash for Like {
+    fn hash<H: Hasher>(&self, state: &mut H) {
+        self.author_id.hash(state)
+    }
+}
+
+impl PartialEq for Like {
+    fn eq(&self, other: &Self) -> bool {
+        self.author_id.eq(&other.author_id)
+    }
+}
+
+impl PartialOrd for Like {
+    fn partial_cmp(&self, other: &Self) -> Option<Ordering> {
+        self.author_id.partial_cmp(&other.author_id)
+    }
+}
+
+impl Eq for Like {}
diff --git a/src/post/mod.rs b/src/post/mod.rs
new file mode 100644
index 0000000..bbbfa0e
--- /dev/null
+++ b/src/post/mod.rs
@@ -0,0 +1,142 @@
+mod attestation;
+mod comment;
+mod github;
+mod idea;
+mod like;
+mod solution;
+mod sponsorship;
+
+use crate::str_serializers::*;
+pub use attestation::*;
+pub use comment::*;
+pub use idea::*;
+pub use like::*;
+use near_sdk::borsh::{BorshDeserialize, BorshSerialize};
+use near_sdk::serde::{Deserialize, Serialize};
+use near_sdk::{AccountId, BorshStorageKey, CryptoHash, NearSchema, Timestamp};
+pub use solution::*;
+pub use sponsorship::*;
+use std::collections::HashSet;
+
+pub type Balance = u128;
+pub type PostId = u64;
+
+#[derive(BorshSerialize, BorshDeserialize, Serialize, Deserialize, Clone)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub enum PostType {
+    Comment,
+    Idea,
+    Solution,
+    Attestation,
+    Sponsorship,
+    Github,
+}
+
+#[derive(BorshSerialize, BorshDeserialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub enum PostStatus {
+    Open,
+    Closed { reason: String },
+}
+
+#[derive(BorshSerialize, BorshStorageKey)]
+#[borsh(crate = "near_sdk::borsh")]
+pub enum StorageKey {
+    Ideas,
+    Solutions,
+    Attestations,
+    Sponsorships,
+    Comments,
+    Posts,
+    PostToParent,
+    PostToChildren,
+    /// Deprecated due to damaged storage state.
+    LabelToPosts,
+    LabelToPostsV2,
+    AuthorToAuthorPosts,
+    AuthorPosts(CryptoHash),
+    Communities,
+    AddOns,
+    Proposals,
+    LabelToProposals,
+    AuthorProposals,
+    RFPs,
+    LabelToRFPs,
+    RFPLinkedProposals,
+    LabelInfo,
+}
+
+#[derive(BorshSerialize, BorshDeserialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[serde(tag = "post_version")]
+#[borsh(crate = "near_sdk::borsh")]
+pub enum VersionedPost {
+    V0(Post),
+}
+
+#[derive(BorshSerialize, BorshDeserialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub struct Post {
+    pub id: PostId,
+    pub author_id: AccountId,
+    pub likes: HashSet<Like>,
+    pub snapshot: PostSnapshot,
+    // Excludes the current snapshot itself.
+    pub snapshot_history: Vec<PostSnapshot>,
+}
+
+type PostTag = String;
+
+impl From<VersionedPost> for Post {
+    fn from(vp: VersionedPost) -> Self {
+        match vp {
+            VersionedPost::V0(v0) => v0,
+        }
+    }
+}
+
+impl From<Post> for VersionedPost {
+    fn from(p: Post) -> Self {
+        VersionedPost::V0(p)
+    }
+}
+
+#[derive(BorshSerialize, BorshDeserialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub struct PostSnapshot {
+    pub editor_id: AccountId,
+    #[serde(
+        serialize_with = "u64_dec_format::serialize",
+        deserialize_with = "u64_dec_format::deserialize"
+    )]
+    pub timestamp: Timestamp,
+    pub labels: HashSet<PostTag>,
+    #[serde(flatten)]
+    pub body: PostBody,
+}
+
+#[derive(BorshSerialize, BorshDeserialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[serde(tag = "post_type")]
+#[borsh(crate = "near_sdk::borsh")]
+pub enum PostBody {
+    Comment(VersionedComment),
+    Idea(VersionedIdea),
+    Solution(VersionedSolution),
+    Attestation(VersionedAttestation),
+    Sponsorship(VersionedSponsorship),
+}
+
+pub fn get_post_description(post: Post) -> String {
+    return match post.snapshot.body.clone() {
+        PostBody::Comment(comment) => comment.latest_version().description,
+        PostBody::Idea(idea) => idea.latest_version().description,
+        PostBody::Solution(solution) => solution.latest_version().description,
+        PostBody::Attestation(attestation) => attestation.latest_version().description,
+        PostBody::Sponsorship(sponsorship) => sponsorship.latest_version().description,
+    };
+}
diff --git a/src/post/solution.rs b/src/post/solution.rs
new file mode 100644
index 0000000..c335071
--- /dev/null
+++ b/src/post/solution.rs
@@ -0,0 +1,133 @@
+use super::{Like, PostStatus, SponsorshipToken};
+use crate::str_serializers::*;
+use crate::{AttestationId, Balance, CommentId, SolutionId, SponsorshipId};
+use near_sdk::borsh::{BorshDeserialize, BorshSerialize};
+use near_sdk::serde::{Deserialize, Serialize};
+use near_sdk::{AccountId, NearSchema, Timestamp};
+use std::collections::HashSet;
+
+#[derive(BorshDeserialize, BorshSerialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub struct SolutionV0 {
+    // Common fields
+    pub id: SolutionId,
+    pub name: String,
+    pub description: String,
+    pub author_id: AccountId,
+    #[serde(
+        serialize_with = "u64_dec_format::serialize",
+        deserialize_with = "u64_dec_format::deserialize"
+    )]
+    pub timestamp: Timestamp,
+    pub status: PostStatus,
+    pub likes: HashSet<Like>,
+    pub comments: Vec<CommentId>,
+
+    // Specific fields
+    #[serde(
+        serialize_with = "u64_dec_format::serialize",
+        deserialize_with = "u64_dec_format::deserialize"
+    )]
+    pub idea_id: u64,
+    pub attestations: Vec<AttestationId>,
+    pub sponsorships: Vec<SponsorshipId>,
+}
+
+#[derive(BorshDeserialize, BorshSerialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub struct SolutionV1 {
+    pub name: String,
+    pub description: String,
+}
+
+#[derive(BorshDeserialize, BorshSerialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub struct SolutionV2 {
+    pub name: String,
+    pub description: String,
+    pub requested_sponsor: Option<AccountId>,
+    #[serde(
+        serialize_with = "u128_dec_format::serialize",
+        deserialize_with = "u128_dec_format::deserialize"
+    )]
+    pub requested_sponsorship_amount: Balance,
+    pub requested_sponsorship_token: Option<SponsorshipToken>,
+}
+
+#[derive(BorshDeserialize, BorshSerialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[serde(tag = "solution_version")]
+#[borsh(crate = "near_sdk::borsh")]
+pub enum VersionedSolution {
+    V0(SolutionV0),
+    V1(SolutionV1),
+    V2(SolutionV2),
+}
+
+impl VersionedSolution {
+    pub fn latest_version(self) -> SolutionV2 {
+        self.into()
+    }
+
+    pub fn validate(&self) {
+        match self {
+            VersionedSolution::V2(solution) => {
+                if solution.requested_sponsorship_amount > 0
+                    && (solution.requested_sponsorship_token.is_none()
+                        || solution.requested_sponsor.is_none())
+                {
+                    panic!(
+                        "Solution that requires funding must specify sponsorship token and sponsor"
+                    )
+                }
+            }
+
+            _ => unimplemented!(),
+        }
+    }
+}
+
+impl From<VersionedSolution> for SolutionV0 {
+    fn from(solution: VersionedSolution) -> Self {
+        match solution {
+            VersionedSolution::V0(v0) => v0,
+            _ => unimplemented!(),
+        }
+    }
+}
+
+impl From<VersionedSolution> for SolutionV1 {
+    fn from(solution: VersionedSolution) -> Self {
+        match solution {
+            VersionedSolution::V1(v1) => v1,
+            _ => unimplemented!(),
+        }
+    }
+}
+
+impl From<SolutionV0> for VersionedSolution {
+    fn from(solution: SolutionV0) -> Self {
+        VersionedSolution::V0(solution)
+    }
+}
+
+impl From<VersionedSolution> for SolutionV2 {
+    fn from(solution: VersionedSolution) -> Self {
+        match solution {
+            VersionedSolution::V2(v2) => v2,
+
+            VersionedSolution::V1(v1) => SolutionV2 {
+                name: v1.name,
+                description: v1.description,
+                requested_sponsor: None,
+                requested_sponsorship_amount: 0,
+                requested_sponsorship_token: None,
+            },
+
+            _ => unimplemented!(),
+        }
+    }
+}
diff --git a/src/post/sponsorship.rs b/src/post/sponsorship.rs
new file mode 100644
index 0000000..d9e2408
--- /dev/null
+++ b/src/post/sponsorship.rs
@@ -0,0 +1,102 @@
+use super::{Like, PostStatus};
+use crate::{str_serializers::*, Balance, CommentId, SolutionId, SponsorshipId};
+use near_sdk::borsh::{BorshDeserialize, BorshSerialize};
+use near_sdk::serde::{Deserialize, Serialize};
+use near_sdk::{AccountId, NearSchema, Timestamp};
+use std::collections::HashSet;
+
+#[derive(BorshSerialize, BorshDeserialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub enum SponsorshipToken {
+    NEAR,
+    NEP141 { address: AccountId },
+    USD,
+}
+
+#[derive(BorshSerialize, BorshDeserialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub struct Sponsorship {
+    // Common fields
+    pub id: SponsorshipId,
+    pub name: String,
+    pub description: String,
+    pub author_id: AccountId,
+    #[serde(
+        serialize_with = "u64_dec_format::serialize",
+        deserialize_with = "u64_dec_format::deserialize"
+    )]
+    pub timestamp: Timestamp,
+    pub status: PostStatus,
+    pub likes: HashSet<Like>,
+    pub comments: Vec<CommentId>,
+
+    // Specific fields
+    #[serde(
+        serialize_with = "u64_dec_format::serialize",
+        deserialize_with = "u64_dec_format::deserialize"
+    )]
+    pub submission_id: SolutionId,
+    pub sponsorship_token: SponsorshipToken,
+    #[serde(
+        serialize_with = "u128_dec_format::serialize",
+        deserialize_with = "u128_dec_format::deserialize"
+    )]
+    pub amount: Balance,
+    pub supervisor: AccountId,
+}
+
+#[derive(BorshSerialize, BorshDeserialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[borsh(crate = "near_sdk::borsh")]
+pub struct SponsorshipV1 {
+    pub name: String,
+    pub description: String,
+    pub sponsorship_token: SponsorshipToken,
+    #[serde(
+        serialize_with = "u128_dec_format::serialize",
+        deserialize_with = "u128_dec_format::deserialize"
+    )]
+    pub amount: Balance,
+    pub supervisor: AccountId,
+}
+
+#[derive(BorshSerialize, BorshDeserialize, Serialize, Deserialize, Clone, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+#[serde(tag = "sponsorship_version")]
+#[borsh(crate = "near_sdk::borsh")]
+pub enum VersionedSponsorship {
+    V0(Sponsorship),
+    V1(SponsorshipV1),
+}
+
+impl VersionedSponsorship {
+    pub fn latest_version(self) -> SponsorshipV1 {
+        self.into()
+    }
+}
+
+impl From<VersionedSponsorship> for Sponsorship {
+    fn from(vs: VersionedSponsorship) -> Self {
+        match vs {
+            VersionedSponsorship::V0(v0) => v0,
+            VersionedSponsorship::V1(_) => unimplemented!(),
+        }
+    }
+}
+
+impl From<VersionedSponsorship> for SponsorshipV1 {
+    fn from(vs: VersionedSponsorship) -> Self {
+        match vs {
+            VersionedSponsorship::V1(v1) => v1,
+            _ => unimplemented!(),
+        }
+    }
+}
+
+impl From<Sponsorship> for VersionedSponsorship {
+    fn from(s: Sponsorship) -> Self {
+        VersionedSponsorship::V0(s)
+    }
+}
diff --git a/src/proposal/mod.rs b/src/proposal/mod.rs
new file mode 100644
index 0000000..9ab218a
--- /dev/null
+++ b/src/proposal/mod.rs
@@ -0,0 +1,306 @@
+pub mod repost;
+pub mod timeline;
+
+use std::collections::HashSet;
+
+use self::timeline::TimelineStatus;
+
+use crate::Contract;
+use crate::str_serializers::*;
+use crate::{notify::get_text_mentions, rfp::RFPId};
+
+use near_sdk::{env, near, require, AccountId, BlockHeight, Timestamp};
+
+pub type ProposalId = u32;
+
+type PostTag = String;
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+#[serde(tag = "proposal_version")]
+pub enum VersionedProposal {
+    V0(Proposal),
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+pub struct Proposal {
+    pub id: ProposalId,
+    pub author_id: AccountId,
+    #[serde(
+        serialize_with = "u64_dec_format::serialize",
+        deserialize_with = "u64_dec_format::deserialize"
+    )]
+    pub social_db_post_block_height: BlockHeight,
+    pub snapshot: ProposalSnapshot,
+    // // Excludes the current snapshot itself.
+    pub snapshot_history: Vec<ProposalSnapshot>,
+}
+
+impl From<VersionedProposal> for Proposal {
+    fn from(vp: VersionedProposal) -> Self {
+        match vp {
+            VersionedProposal::V0(v0) => v0,
+        }
+    }
+}
+
+impl From<Proposal> for VersionedProposal {
+    fn from(p: Proposal) -> Self {
+        VersionedProposal::V0(p)
+    }
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+pub struct ProposalSnapshot {
+    pub editor_id: AccountId,
+    #[serde(
+        serialize_with = "u64_dec_format::serialize",
+        deserialize_with = "u64_dec_format::deserialize"
+    )]
+    pub timestamp: Timestamp,
+    pub labels: HashSet<PostTag>,
+    #[serde(flatten)]
+    pub body: VersionedProposalBody,
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+pub struct ProposalBodyV0 {
+    pub name: String,
+    pub category: String,
+    pub summary: String,
+    pub description: String,
+    pub linked_proposals: Vec<ProposalId>,
+    #[serde(
+        serialize_with = "u32_dec_format::serialize",
+        deserialize_with = "u32_dec_format::deserialize"
+    )]
+    pub requested_sponsorship_usd_amount: u32,
+    pub requested_sponsorship_paid_in_currency: ProposalFundingCurrency,
+    pub receiver_account: AccountId,
+    pub requested_sponsor: AccountId,
+    pub supervisor: Option<AccountId>,
+    pub timeline: TimelineStatus,
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+pub struct ProposalBodyV1 {
+    pub name: String,
+    pub category: String,
+    pub summary: String,
+    pub description: String,
+    pub linked_proposals: Vec<ProposalId>,
+    #[serde(
+        serialize_with = "u32_dec_format::serialize",
+        deserialize_with = "u32_dec_format::deserialize"
+    )]
+    pub requested_sponsorship_usd_amount: u32,
+    pub requested_sponsorship_paid_in_currency: ProposalFundingCurrency,
+    pub receiver_account: AccountId,
+    pub requested_sponsor: AccountId,
+    pub supervisor: Option<AccountId>,
+    pub timeline: TimelineStatus,
+    pub linked_rfp: Option<RFPId>,
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+#[serde(tag = "proposal_body_version")]
+pub enum VersionedProposalBody {
+    V0(ProposalBodyV0),
+    V1(ProposalBodyV1),
+}
+
+impl From<ProposalBodyV0> for ProposalBodyV1 {
+    fn from(v0: ProposalBodyV0) -> Self {
+        ProposalBodyV1 {
+            name: v0.name,
+            category: v0.category,
+            summary: v0.summary,
+            description: v0.description,
+            linked_proposals: v0.linked_proposals,
+            requested_sponsorship_usd_amount: v0.requested_sponsorship_usd_amount,
+            requested_sponsorship_paid_in_currency: v0.requested_sponsorship_paid_in_currency,
+            receiver_account: v0.receiver_account,
+            requested_sponsor: v0.requested_sponsor,
+            supervisor: v0.supervisor,
+            timeline: v0.timeline,
+            linked_rfp: None,
+        }
+    }
+}
+
+impl From<VersionedProposalBody> for ProposalBodyV0 {
+    fn from(solution: VersionedProposalBody) -> Self {
+        match solution {
+            VersionedProposalBody::V0(v0) => v0,
+            _ => unimplemented!(),
+        }
+    }
+}
+
+impl From<VersionedProposalBody> for ProposalBodyV1 {
+    fn from(solution: VersionedProposalBody) -> Self {
+        match solution {
+            VersionedProposalBody::V0(v0) => v0.into(),
+            VersionedProposalBody::V1(v1) => v1,
+        }
+    }
+}
+
+impl From<ProposalBodyV0> for VersionedProposalBody {
+    fn from(p: ProposalBodyV0) -> Self {
+        VersionedProposalBody::V0(p)
+    }
+}
+
+impl From<ProposalBodyV1> for VersionedProposalBody {
+    fn from(p: ProposalBodyV1) -> Self {
+        VersionedProposalBody::V1(p)
+    }
+}
+
+impl VersionedProposalBody {
+    pub fn latest_version(self) -> ProposalBodyV1 {
+        self.into()
+    }
+}
+
+pub fn get_subscribers(proposal_body: &ProposalBodyV1) -> Vec<String> {
+    let mut result = [
+        get_text_mentions(proposal_body.description.as_str()),
+        get_text_mentions(proposal_body.summary.as_str()),
+    ]
+    .concat();
+    if let Some(supervisor) = proposal_body.supervisor.clone() {
+        result.push(supervisor.to_string());
+    }
+    result.push(proposal_body.requested_sponsor.to_string());
+    result
+}
+
+pub fn default_categories() -> Vec<String> {
+    vec![
+        String::from("DevDAO Operations"),
+        String::from("Decentralized DevRel"),
+        String::from("NEAR Campus"),
+        String::from("Marketing"),
+        String::from("Events"),
+        String::from("Tooling & Infrastructures"),
+        String::from("Other"),
+    ]
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+pub enum ProposalFundingCurrency {
+    NEAR,
+    USDT,
+    USDC,
+    OTHER,
+}
+
+impl Contract {
+    pub(crate) fn update_proposal_labels(&mut self, proposal_id: ProposalId, new_labels: HashSet<String>) -> ProposalId {
+        let proposal: Proposal = self
+            .proposals
+            .get(proposal_id.into())
+            .unwrap_or_else(|| panic!("Proposal id {} not found", proposal_id))
+            .into();
+
+        self.edit_proposal_internal(proposal_id, proposal.snapshot.body, new_labels)
+    }
+
+    pub(crate) fn edit_proposal_internal(
+        &mut self,
+        id: ProposalId,
+        body: VersionedProposalBody,
+        labels: HashSet<String>,
+    ) -> ProposalId {
+        require!(
+            self.is_allowed_to_edit_proposal(id, Option::None),
+            "The account is not allowed to edit this proposal"
+        );
+        let editor_id = env::predecessor_account_id();
+        let mut proposal: Proposal = self
+            .proposals
+            .get(id.into())
+            .unwrap_or_else(|| panic!("Proposal id {} not found", id))
+            .into();
+
+        let proposal_body = body.clone().latest_version();
+
+        let old_body = proposal.snapshot.body.clone();
+        let labels = self.update_and_check_rfp_link(id, body.clone(), Some(old_body.clone()), labels);
+
+        let current_timeline = old_body.latest_version().timeline;
+
+        require!(
+            self.has_moderator(editor_id.clone())
+                || editor_id.clone() == env::current_account_id()
+                || current_timeline.is_draft()
+                    && (proposal_body.timeline.is_empty_review()
+                        || proposal_body.timeline.is_draft())
+                || current_timeline.can_be_cancelled() && proposal_body.timeline.is_cancelled(),
+            "This account is only allowed to change proposal status from DRAFT to REVIEW"
+        );
+
+        require!(
+            proposal_body.timeline.is_draft() ||  proposal_body.timeline.is_review() || proposal_body.timeline.is_cancelled() || proposal_body.supervisor.is_some(),
+            "You can't change the timeline of the proposal to this status without adding a supervisor"
+        );
+
+        require!(self.proposal_categories.contains(&proposal_body.category), "Unknown category");
+
+        let old_snapshot = proposal.snapshot.clone();
+        let old_labels_set = old_snapshot.labels.clone();
+        let new_labels = labels;
+        let new_snapshot = ProposalSnapshot {
+            editor_id: editor_id.clone(),
+            timestamp: env::block_timestamp(),
+            labels: new_labels.clone(),
+            body: body,
+        };
+        proposal.snapshot = new_snapshot;
+        proposal.snapshot_history.push(old_snapshot);
+        let proposal_author = proposal.author_id.clone();
+        self.proposals.replace(id.try_into().unwrap(), &proposal.into());
+
+        // Update labels index.
+        let new_labels_set = new_labels;
+        let labels_to_remove = &old_labels_set - &new_labels_set;
+        let labels_to_add = &new_labels_set - &old_labels_set;
+        require!(
+            self.is_allowed_to_use_labels(
+                Some(editor_id.clone()),
+                labels_to_remove.iter().cloned().collect()
+            ),
+            "Not allowed to remove these labels"
+        );
+        require!(
+            self.is_allowed_to_use_labels(
+                Some(editor_id.clone()),
+                labels_to_add.iter().cloned().collect()
+            ),
+            "Not allowed to add these labels"
+        );
+
+        for label_to_remove in labels_to_remove {
+            let mut proposals = self.label_to_proposals.get(&label_to_remove).unwrap();
+            proposals.remove(&id);
+            self.label_to_proposals.insert(&label_to_remove, &proposals);
+        }
+
+        for label_to_add in labels_to_add {
+            let mut proposals = self.label_to_proposals.get(&label_to_add).unwrap_or_default();
+            proposals.insert(id);
+            self.label_to_proposals.insert(&label_to_add, &proposals);
+        }
+
+        crate::notify::notify_edit_proposal(id, proposal_author);
+        id
+    }
+}
\ No newline at end of file
diff --git a/src/proposal/repost.rs b/src/proposal/repost.rs
new file mode 100644
index 0000000..480a59b
--- /dev/null
+++ b/src/proposal/repost.rs
@@ -0,0 +1,52 @@
+use near_sdk::serde_json::json;
+use near_sdk::{env, AccountId, Promise};
+
+use devhub_common::social_db_contract;
+
+use crate::Proposal;
+
+pub fn proposal_repost_text(proposal: Proposal) -> String {
+    let proposal_link =
+        format!("/bos.forum.potlock.near/widget/app?page=proposal&id={}", proposal.id);
+
+    let title = proposal.snapshot.body.clone().latest_version().name;
+    let summary = proposal.snapshot.body.clone().latest_version().summary;
+    let category = proposal.snapshot.body.clone().latest_version().category;
+
+    let text = format!(
+        "We have just received a new *{category}* proposal.\n\n———\n\n**By**: @{author}\n\n**Title**: “{title}“\n\n**Summary**:\n\n{summary}\n\n———\n\nRead the full proposal and share your feedback on [AI PGF]({proposal_link})",
+        author = proposal.author_id,
+        proposal_link = proposal_link,
+        title = title,
+        summary = summary,
+        category = category
+    );
+
+    text
+}
+
+fn repost_internal(text: String, contract_address: AccountId) -> near_sdk::serde_json::Value {
+    let main_value = json!({
+        "type": "md",
+        "text": text
+    });
+
+    json!({
+        contract_address: {
+            "post": {
+                "main": main_value.to_string(),
+            },
+            "index": {
+                "post": "{\"key\":\"main\",\"value\":{\"type\":\"md\"}}",
+            }
+        }
+    })
+}
+
+pub fn publish_to_socialdb_feed(callback: Promise, text: String) -> Promise {
+    social_db_contract()
+        .with_static_gas(env::prepaid_gas().saturating_div(3))
+        .with_attached_deposit(env::attached_deposit())
+        .set(repost_internal(text, env::current_account_id()))
+        .then(callback)
+}
diff --git a/src/proposal/timeline.rs b/src/proposal/timeline.rs
new file mode 100644
index 0000000..a677a05
--- /dev/null
+++ b/src/proposal/timeline.rs
@@ -0,0 +1,104 @@
+use near_sdk::near;
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+#[serde(tag = "status", rename_all = "SCREAMING_SNAKE_CASE")]
+pub enum TimelineStatus {
+    Draft,
+    Review(ReviewStatus),
+    Approved(ReviewStatus),
+    Rejected(ReviewStatus),
+    ApprovedConditionally(ReviewStatus),
+    PaymentProcessing(PaymentProcessingStatus),
+    Funded(FundedStatus),
+    Cancelled(ReviewStatus),
+}
+
+impl TimelineStatus {
+    pub fn is_draft(&self) -> bool {
+        matches!(self, TimelineStatus::Draft)
+    }
+
+    pub fn is_empty_review(&self) -> bool {
+        match self {
+            TimelineStatus::Review(review_status) => {
+                !review_status.sponsor_requested_review
+                    && !review_status.reviewer_completed_attestation
+            }
+            _ => false,
+        }
+    }
+
+    pub fn is_review(&self) -> bool {
+        matches!(self, TimelineStatus::Review(..))
+    }
+
+    pub fn is_cancelled(&self) -> bool {
+        matches!(self, TimelineStatus::Cancelled(..))
+    }
+
+    pub fn can_be_cancelled(&self) -> bool {
+        match self {
+            TimelineStatus::Draft => true,
+            TimelineStatus::Review(..) => true,
+            _ => false,
+        }
+    }
+
+    pub fn was_approved(&self) -> bool {
+        match self {
+            TimelineStatus::Approved(..) => true,
+            TimelineStatus::ApprovedConditionally(..) => true,
+            TimelineStatus::PaymentProcessing(..) => true,
+            TimelineStatus::Funded(..) => true,
+            _ => false,
+            
+        }
+    }
+
+    pub fn get_review_status(&self) -> &ReviewStatus {
+        match self {
+            TimelineStatus::Review(review_status)
+            | TimelineStatus::Approved(review_status)
+            | TimelineStatus::Rejected(review_status)
+            | TimelineStatus::ApprovedConditionally(review_status)
+            | TimelineStatus::Cancelled(review_status) => review_status,
+            TimelineStatus::PaymentProcessing(payment_processing_status) => {
+                &payment_processing_status.review_status
+            },
+            TimelineStatus::Funded(funded_status) => {
+                &funded_status.payment_processing_status.review_status
+            },
+            TimelineStatus::Draft => &ReviewStatus {
+                sponsor_requested_review: false,
+                reviewer_completed_attestation: false,
+            },
+        }
+    }
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+pub struct ReviewStatus {
+    sponsor_requested_review: bool,
+    reviewer_completed_attestation: bool,
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+pub struct PaymentProcessingStatus {
+    #[serde(flatten)]
+    review_status: ReviewStatus,
+    kyc_verified: bool,
+    test_transaction_sent: bool,
+    request_for_trustees_created: bool,
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+pub struct FundedStatus {
+    #[serde(flatten)]
+    payment_processing_status: PaymentProcessingStatus,
+    trustees_released_payment: bool,
+    payouts: Vec<String>,
+}
diff --git a/src/repost.rs b/src/repost.rs
new file mode 100644
index 0000000..31d6d85
--- /dev/null
+++ b/src/repost.rs
@@ -0,0 +1,90 @@
+use crate::post::{get_post_description, Post, PostBody};
+use devhub_common::social_db_contract;
+use near_sdk::serde_json::json;
+use near_sdk::{env, AccountId, Promise};
+
+fn repost_internal(post: Post, contract_address: AccountId) -> near_sdk::serde_json::Value {
+    let post_link = format!("/devhub.near/widget/app?page=post&id={}", post.id);
+    let title = match post.snapshot.body.clone() {
+        PostBody::Idea(idea) => format!("## Idea: {}\n", idea.latest_version().name),
+        PostBody::Solution(solution) => {
+            format!("## Solution: {}\n", solution.latest_version().name)
+        }
+        PostBody::Attestation(attestation) => {
+            format!("## Attestation: {}\n", attestation.latest_version().name)
+        }
+        PostBody::Sponsorship(sponsorship) => {
+            format!("## Sponsorship: {}\n", sponsorship.latest_version().name)
+        }
+        _ => Default::default(),
+    };
+
+    let desc = get_post_description(post.clone());
+
+    let text = format!(
+        "@{author} [Posted on DevHub]({post_link})\n{title}{desc}",
+        author = post.author_id,
+        post_link = post_link,
+        title = title,
+        desc = desc
+    );
+
+    let main_value = json!({
+        "type": "md",
+        "text": text
+    });
+
+    json!({
+        contract_address: {
+            "post": {
+                "main": main_value.to_string(),
+            },
+            "index": {
+                "post": "{\"key\":\"main\",\"value\":{\"type\":\"md\"}}",
+            }
+        }
+    })
+}
+
+pub fn repost(post: Post) -> Promise {
+    social_db_contract()
+        .with_static_gas(env::prepaid_gas().saturating_div(4))
+        .with_attached_deposit(env::attached_deposit())
+        .set(repost_internal(post, env::current_account_id()))
+}
+
+#[cfg(test)]
+mod tests {
+    use crate::post::{IdeaV1, Post, PostBody, PostSnapshot, VersionedIdea};
+    use crate::repost::repost_internal;
+    use near_sdk::serde_json::json;
+
+    #[test]
+    pub fn check_formatting() {
+        let post = Post {
+            id: 0,
+            author_id: "neardevgov.near".parse().unwrap(),
+            likes: Default::default(),
+            snapshot: PostSnapshot {
+                editor_id: "neardevgov.near".parse().unwrap(),
+                timestamp: 0,
+                labels: Default::default(),
+                body: PostBody::Idea(VersionedIdea::V1(IdeaV1 { name: "A call for Zero Knowledge Work Group members!".to_string(), description: "We are excited to create a more formal Zero Knowledge Work Group (WG) to oversee official decisions on Zero Knowledge proposals. We’re looking for 3-7 experts to participate. Reply to the post if you’re interested in becoming a work group member.".to_string() })),
+            },
+            snapshot_history: vec![],
+        };
+
+        let call_args = repost_internal(post, "devhub.near".parse().unwrap());
+        let expected = json!({
+            "devhub.near": {
+                "post": {
+                  "main": "{\"type\":\"md\",\"text\":\"@neardevgov.near [Posted on DevHub](/devhub.near/widget/app?page=post&id=0)\\n## Idea: A call for Zero Knowledge Work Group members!\\nWe are excited to create a more formal Zero Knowledge Work Group (WG) to oversee official decisions on Zero Knowledge proposals. We’re looking for 3-7 experts to participate. Reply to the post if you’re interested in becoming a work group member.\"}"
+                },
+                "index": {
+                  "post": "{\"key\":\"main\",\"value\":{\"type\":\"md\"}}"
+                }
+              }
+        });
+        assert_eq!(call_args, expected);
+    }
+}
diff --git a/src/rfp/mod.rs b/src/rfp/mod.rs
new file mode 100644
index 0000000..7e94e34
--- /dev/null
+++ b/src/rfp/mod.rs
@@ -0,0 +1,285 @@
+pub mod repost;
+pub mod timeline;
+
+use std::collections::HashSet;
+
+pub use self::timeline::TimelineStatus;
+
+use crate::Contract;
+use crate::proposal::{Proposal, ProposalId, VersionedProposalBody};
+use crate::notify::get_text_mentions;
+use crate::str_serializers::*;
+
+use near_sdk::{env, require, near, AccountId, BlockHeight, Timestamp};
+
+pub type RFPId = u32;
+
+type PostTag = String;
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+#[serde(tag = "rfp_version")]
+pub enum VersionedRFP {
+    V0(RFP),
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+pub struct RFP {
+    pub id: RFPId,
+    pub author_id: AccountId,
+    #[serde(
+        serialize_with = "u64_dec_format::serialize",
+        deserialize_with = "u64_dec_format::deserialize"
+    )]
+    pub social_db_post_block_height: BlockHeight,
+    pub snapshot: RFPSnapshot,
+    // Excludes the current snapshot itself.
+    // Contains the block height when the RFP was added or edited.
+    pub snapshot_history: Vec<BlockHeight>,
+}
+
+impl From<VersionedRFP> for RFP {
+    fn from(vp: VersionedRFP) -> Self {
+        match vp {
+            VersionedRFP::V0(v0) => v0,
+        }
+    }
+}
+
+impl From<RFP> for VersionedRFP {
+    fn from(p: RFP) -> Self {
+        VersionedRFP::V0(p)
+    }
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+pub struct RFPSnapshot {
+    pub editor_id: AccountId,
+    #[serde(
+        serialize_with = "u64_dec_format::serialize",
+        deserialize_with = "u64_dec_format::deserialize"
+    )]
+    pub timestamp: Timestamp,
+    #[serde(
+        serialize_with = "u64_dec_format::serialize",
+        deserialize_with = "u64_dec_format::deserialize"
+    )]
+    pub block_height: BlockHeight,
+    pub labels: HashSet<PostTag>,
+    #[serde(flatten)]
+    pub body: VersionedRFPBody,
+    pub linked_proposals: HashSet<RFPId>,
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+pub struct RFPBodyV0 {
+    pub name: String,
+    pub summary: String,
+    pub description: String,
+    pub timeline: TimelineStatus,
+    #[serde(
+        serialize_with = "u64_dec_format::serialize",
+        deserialize_with = "u64_dec_format::deserialize"
+    )]
+    pub submission_deadline: Timestamp,
+}
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+#[serde(tag = "rfp_body_version")]
+pub enum VersionedRFPBody {
+    V0(RFPBodyV0),
+}
+
+impl From<VersionedRFPBody> for RFPBodyV0 {
+    fn from(solution: VersionedRFPBody) -> Self {
+        match solution {
+            VersionedRFPBody::V0(v0) => v0,
+        }
+    }
+}
+
+impl From<RFPBodyV0> for VersionedRFPBody {
+    fn from(p: RFPBodyV0) -> Self {
+        VersionedRFPBody::V0(p)
+    }
+}
+
+impl VersionedRFPBody {
+    pub fn latest_version(self) -> RFPBodyV0 {
+        self.into()
+    }
+}
+
+pub fn get_subscribers(proposal_body: &RFPBodyV0) -> Vec<String> {
+    let result = [
+        get_text_mentions(proposal_body.description.as_str()),
+        get_text_mentions(proposal_body.summary.as_str()),
+    ]
+    .concat();
+    result
+}
+
+enum LinkedProposalChangeOperation {
+    Add,
+    Remove,
+}
+
+
+impl Contract {
+    fn assert_can_link_unlink_rfp(&self, rfp_id: Option<RFPId>) {
+        if let Some(rfp_id) = rfp_id {
+            let rfp: RFP = self
+                .rfps
+                .get(rfp_id.into())
+                .unwrap_or_else(|| panic!("RFP id {} not found", rfp_id))
+                .into();
+            require!(
+                rfp.snapshot.body.latest_version().timeline.is_accepting_submissions() || self.is_allowed_to_write_rfps(env::predecessor_account_id()),
+                format!("The RFP {} is not in the Accepting Submissions state, so you can't link or unlink to this RFP", rfp_id)
+            );
+        }
+    }
+
+    fn get_rfp_labels(&self, rfp_id: RFPId) -> HashSet<String> {
+        let rfp: RFP = self
+            .rfps
+            .get(rfp_id.into())
+            .unwrap_or_else(|| panic!("RFP id {} not found", rfp_id))
+            .into();
+        rfp.snapshot.labels
+    }
+
+    pub(crate) fn get_linked_proposals_in_rfp(&self, rfp_id: RFPId) -> HashSet<ProposalId> {
+        let rfp: RFP = self.get_rfp(rfp_id).into();
+        rfp.snapshot.linked_proposals
+    }
+
+    fn change_linked_proposal_in_rfp(&mut self, rfp_id: RFPId, proposal_id: ProposalId, operation: LinkedProposalChangeOperation) {
+        let mut rfp: RFP = self.get_rfp(rfp_id).into();
+        let mut linked_proposals = rfp.snapshot.linked_proposals.clone();
+        match operation {
+            LinkedProposalChangeOperation::Add => {
+                linked_proposals.insert(proposal_id);
+            }
+            LinkedProposalChangeOperation::Remove => {
+                linked_proposals.remove(&proposal_id);
+            }
+        }
+        rfp.snapshot_history.push(rfp.snapshot.block_height);
+        let new_snapshot = RFPSnapshot {
+            editor_id: env::predecessor_account_id(),
+            timestamp: env::block_timestamp(),
+            block_height: env::block_height(),
+            labels: rfp.snapshot.labels,
+            body: rfp.snapshot.body,
+            linked_proposals: linked_proposals,
+        };
+        rfp.snapshot = new_snapshot;
+        self.rfps.replace(rfp_id.try_into().unwrap(), &rfp.clone().into());
+    }
+
+    fn add_linked_proposal_in_rfp(&mut self, rfp_id: RFPId, proposal_id: ProposalId) {
+        self.change_linked_proposal_in_rfp(rfp_id, proposal_id, LinkedProposalChangeOperation::Add);
+    }
+
+    fn remove_linked_proposal_in_rfp(&mut self, rfp_id: RFPId, proposal_id: ProposalId) {
+        self.change_linked_proposal_in_rfp(rfp_id, proposal_id, LinkedProposalChangeOperation::Remove);
+    }
+
+    pub(crate) fn update_and_check_rfp_link(
+        &mut self,
+        proposal_id: ProposalId,
+        new_proposal_body: VersionedProposalBody,
+        old_proposal_body: Option<VersionedProposalBody>,
+        labels: HashSet<String>,
+    ) -> HashSet<String> {
+        let mut labels = labels;
+        let new_body = new_proposal_body.clone().latest_version();
+        let old_rfp_id =
+            old_proposal_body.clone().map(|old| old.latest_version().linked_rfp).flatten();
+        if new_body.linked_rfp != old_rfp_id {
+            self.assert_can_link_unlink_rfp(new_body.linked_rfp);
+            self.assert_can_link_unlink_rfp(old_rfp_id);
+            if let Some(old_rfp_id) = old_rfp_id {
+                self.remove_linked_proposal_in_rfp(old_rfp_id, proposal_id);
+            }
+            if let Some(new_rfp_id) = new_body.linked_rfp {
+                self.add_linked_proposal_in_rfp(new_rfp_id, proposal_id);
+            }
+        }
+        if let Some(new_rfp_id) = new_body.linked_rfp {
+            labels = self.get_rfp_labels(new_rfp_id);
+        }
+        labels
+    }
+
+    pub(crate) fn edit_rfp_internal(
+        &mut self,
+        id: RFPId,
+        body: VersionedRFPBody,
+        labels: HashSet<String>,
+    ) -> RFPId {
+        let editor_id: AccountId = env::predecessor_account_id();
+        require!(
+            self.is_allowed_to_write_rfps(editor_id.clone()),
+            "The account is not allowed to edit RFPs"
+        );
+
+        let mut rfp: RFP = self.get_rfp(id).into();
+
+        let rfp_body = body.clone().latest_version();
+
+        if rfp_body.timeline.is_proposal_selected() {
+            let has_approved_proposal = self.get_rfp_linked_proposals(id)
+                .into_iter()
+                .filter_map(|proposal_id| self.proposals.get(proposal_id.into()))
+                .any(|proposal|  Into::<Proposal>::into(proposal).snapshot.body.latest_version().timeline.was_approved());
+            require!(has_approved_proposal, "Cannot change RFP status to Proposal Selected without an approved proposal linked to this RFP");
+        }
+
+        let old_snapshot = rfp.snapshot.clone();
+        let old_labels_set = old_snapshot.labels.clone();
+        let new_labels = labels;
+        rfp.snapshot_history.push(rfp.snapshot.block_height);
+        let new_snapshot = RFPSnapshot {
+            editor_id: env::predecessor_account_id(),
+            timestamp: env::block_timestamp(),
+            block_height: env::block_height(),
+            labels: new_labels.clone(),
+            body: body,
+            linked_proposals: old_snapshot.linked_proposals.clone(),
+        };
+        rfp.snapshot = new_snapshot;
+        self.rfps.replace(id.try_into().unwrap(), &rfp.clone().into());
+
+        // Update labels index.
+        let new_labels_set = new_labels;
+
+        if old_labels_set != new_labels_set {
+            for proposal_id in self.get_rfp_linked_proposals(id) {
+                self.update_proposal_labels(proposal_id, new_labels_set.clone());
+            }
+        }
+
+        let labels_to_remove = &old_labels_set - &new_labels_set;
+        let labels_to_add: HashSet<String> = &new_labels_set - &old_labels_set;
+        for label_to_remove in labels_to_remove {
+            let mut rfps = self.label_to_rfps.get(&label_to_remove).unwrap();
+            rfps.remove(&id);
+            self.label_to_rfps.insert(&label_to_remove, &rfps);
+        }
+
+        for label_to_add in labels_to_add {
+            let mut rfps = self.label_to_rfps.get(&label_to_add).unwrap_or_default();
+            rfps.insert(id);
+            self.label_to_rfps.insert(&label_to_add, &rfps);
+        }
+
+        crate::notify::notify_rfp_subscribers(&rfp, self.get_moderators());
+        id
+    }
+}
\ No newline at end of file
diff --git a/src/rfp/repost.rs b/src/rfp/repost.rs
new file mode 100644
index 0000000..11377e7
--- /dev/null
+++ b/src/rfp/repost.rs
@@ -0,0 +1,19 @@
+use crate::RFP;
+
+pub fn rfp_repost_text(rfp: RFP) -> String {
+    let rfp_link = format!("/bos.forum.potlock.near/widget/app?page=rfp&id={}", rfp.id);
+
+    let body = rfp.snapshot.body.latest_version();
+
+    let title = body.name;
+    let summary = body.summary;
+
+    let text = format!(
+        "A new Request for Proposals is published.\n\n———\n\n**Title**: “{title}“\n\n**Summary**:\n\n{summary}\n\n———\n\nRead the full RFP and participate [here]({rfp_link})",
+        rfp_link = rfp_link,
+        title = title,
+        summary = summary,
+    );
+
+    text
+}
diff --git a/src/rfp/timeline.rs b/src/rfp/timeline.rs
new file mode 100644
index 0000000..dcbb623
--- /dev/null
+++ b/src/rfp/timeline.rs
@@ -0,0 +1,25 @@
+use near_sdk::near;
+
+#[near(serializers=[borsh, json])]
+#[derive(Clone)]
+#[serde(tag = "status", rename_all = "SCREAMING_SNAKE_CASE")]
+pub enum TimelineStatus {
+    AcceptingSubmissions,
+    Evaluation,
+    ProposalSelected,
+    Cancelled,
+}
+
+impl TimelineStatus {
+    pub fn is_accepting_submissions(&self) -> bool {
+        matches!(self, TimelineStatus::AcceptingSubmissions)
+    }
+
+    pub fn is_cancelled(&self) -> bool {
+        matches!(self, TimelineStatus::Cancelled)
+    }
+
+    pub fn is_proposal_selected(&self) -> bool {
+        matches!(self, TimelineStatus::ProposalSelected)
+    }
+}
diff --git a/src/stats.rs b/src/stats.rs
new file mode 100644
index 0000000..56cf213
--- /dev/null
+++ b/src/stats.rs
@@ -0,0 +1,17 @@
+use near_sdk::serde::{Deserialize, Serialize};
+use near_sdk::{near, NearSchema};
+
+use crate::*;
+
+#[derive(Serialize, Deserialize, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+pub struct Stats {
+    pub num_posts: u64,
+}
+
+#[near]
+impl Contract {
+    pub fn get_stats(&self) -> Stats {
+        Stats { num_posts: self.posts.len() }
+    }
+}
diff --git a/src/str_serializers.rs b/src/str_serializers.rs
new file mode 100644
index 0000000..ebff306
--- /dev/null
+++ b/src/str_serializers.rs
@@ -0,0 +1,56 @@
+pub mod u128_dec_format {
+    use near_sdk::serde::de;
+    use near_sdk::serde::{Deserialize, Deserializer, Serializer};
+
+    pub fn serialize<S>(num: &u128, serializer: S) -> Result<S::Ok, S::Error>
+    where
+        S: Serializer,
+    {
+        serializer.serialize_str(&num.to_string())
+    }
+
+    pub fn deserialize<'de, D>(deserializer: D) -> Result<u128, D::Error>
+    where
+        D: Deserializer<'de>,
+    {
+        String::deserialize(deserializer)?.parse().map_err(de::Error::custom)
+    }
+}
+
+pub mod u64_dec_format {
+    use near_sdk::serde::de;
+    use near_sdk::serde::{Deserialize, Deserializer, Serializer};
+
+    pub fn serialize<S>(num: &u64, serializer: S) -> Result<S::Ok, S::Error>
+    where
+        S: Serializer,
+    {
+        serializer.serialize_str(&num.to_string())
+    }
+
+    pub fn deserialize<'de, D>(deserializer: D) -> Result<u64, D::Error>
+    where
+        D: Deserializer<'de>,
+    {
+        String::deserialize(deserializer)?.parse().map_err(de::Error::custom)
+    }
+}
+
+pub mod u32_dec_format {
+    use near_sdk::serde::de;
+    use near_sdk::serde::{Deserialize, Deserializer, Serializer};
+
+    pub fn serialize<S>(num: &u32, serializer: S) -> Result<S::Ok, S::Error>
+    where
+        S: Serializer,
+    {
+        serializer.serialize_str(&num.to_string())
+    }
+
+    pub fn deserialize<'de, D>(deserializer: D) -> Result<u32, D::Error>
+    where
+        D: Deserializer<'de>,
+    {
+        String::deserialize(deserializer)?.parse().map_err(de::Error::custom)
+    }
+}
diff --git a/src/web4/handler.rs b/src/web4/handler.rs
new file mode 100644
index 0000000..7763fcb
--- /dev/null
+++ b/src/web4/handler.rs
@@ -0,0 +1,694 @@
+use near_sdk::{
+    base64::{
+        alphabet,
+        engine::{self, general_purpose},
+        Engine,
+    },
+    env,
+};
+use serde_json::json;
+
+use crate::{
+    web4::types::{Web4Request, Web4Response},
+    Contract, Proposal,
+};
+
+pub const BASE64_ENGINE: engine::GeneralPurpose =
+    engine::GeneralPurpose::new(&alphabet::URL_SAFE, general_purpose::PAD);
+
+pub fn web4_get(contract: &Contract, request: Web4Request) -> Web4Response {
+    let current_account_id = env::current_account_id().to_string();
+    let path_parts: Vec<&str> = request.path.split('/').collect();
+
+    // A valid path provided by a legit web4 gateway always has '/', so there
+    // are always [0] and [1] elements, and [0] is always empty.
+    let page = path_parts[1];
+
+    let metadata_preload_url = format!(
+        "/web4/contract/social.near/get?keys.json=%5B%22{}/widget/app/metadata/**%22%5D",
+        &current_account_id
+    );
+
+    let mut app_name = String::from("near/dev/hub");
+    let mut title = String::new();
+    let mut description = String::from("The decentralized home base for NEAR builders");
+
+    let Some(preloads) = request.preloads else {
+        return Web4Response::PreloadUrls { preload_urls: [metadata_preload_url.clone()].to_vec() };
+    };
+
+    if let Some(Web4Response::Body { content_type: _, body }) = preloads.get(&metadata_preload_url) {
+        if let Ok(body_value) = serde_json::from_slice::<serde_json::Value>(
+            &BASE64_ENGINE.decode(body).unwrap()
+        ) {
+            if let Some(app_name_str) = body_value[&current_account_id]
+                ["widget"]["app"]["metadata"]["name"]
+                .as_str()
+            {
+                app_name = app_name_str.to_string();
+            }
+
+            if let Some(description_str) = body_value
+                [&current_account_id]["widget"]["app"]["metadata"]
+                ["description"]
+                .as_str()
+            {
+                description = description_str.to_string();
+            }
+        }
+    }
+
+    let mut image = format!(
+        "https://i.near.social/magic/large/https://near.social/magic/img/account/{}",
+        &current_account_id
+    );
+    let redirect_path;
+    let initial_props_json;
+
+    match (page, path_parts.get(2)) {
+        ("community", Some(handle)) => {
+            if let Some(community) = contract.get_community(handle.to_string()) {
+                title = format!(" - Community - {}", community.name);
+                description = community.description;
+                image = community.logo_url;
+            } else {
+                title = format!(" - Community - {}", handle);
+            }
+            redirect_path =
+                format!("{}/widget/app?page={}&handle={}", &current_account_id, page, handle);
+            initial_props_json = json!({"page": page, "handle": handle});
+        }
+        ("proposal", Some(id)) => {
+            if let Ok(id) = id.parse::<u32>() {
+                if let Some(versioned_proposal) = contract.proposals.get(id.into()) {
+                    let proposal_body =
+                        Proposal::from(versioned_proposal).snapshot.body.latest_version();
+                    title = format!(" - Proposal #{} - {}", id, proposal_body.name);
+                    description = proposal_body.summary;
+                } else {
+                    title = format!(" - Proposal #{}", id);
+                }
+            } else {
+                title = " - Proposals".to_string();
+            }
+            redirect_path =
+                format!("{}/widget/app?page={}&id={}", &current_account_id, page, id);
+            initial_props_json = json!({"page": page, "id": id});
+        }
+        _ => {
+            redirect_path = format!("{}/widget/app", &current_account_id);
+            initial_props_json = json!({"page": page});
+        }
+    }
+
+    let app_name = html_escape::encode_text(&app_name).to_string();
+    let title = html_escape::encode_text(&title).to_string();
+    let description = html_escape::encode_text(&description).to_string();
+
+    let body = format!(
+        r#"<!DOCTYPE html>
+<html>
+<head>
+    <title>{title}</title>
+    <meta charset="utf-8">
+    <meta name="viewport" content="width=device-width,initial-scale=1">
+    <meta property="og:url" content="{url}" />
+    <meta property="og:type" content="website" />
+    <meta property="og:title" content="{app_name}{title}" />
+    <meta property="og:description" content="{description}" />
+    <meta property="og:image" content="{image}" />
+
+    <meta name="twitter:card" content="summary_large_image">
+    <meta name="twitter:title" content="{app_name}{title}">
+    <meta name="twitter:description" content="{description}">
+    <meta name="twitter:image" content="{image}">
+    <script src="https://ipfs.web4.near.page/ipfs/bafybeic6aeztkdlthx5uwehltxmn5i6owm47b7b2jxbbpwmydv2mwxdfca/main.794b6347ae264789bc61.bundle.js"></script>
+    <script src="https://ipfs.web4.near.page/ipfs/bafybeic6aeztkdlthx5uwehltxmn5i6owm47b7b2jxbbpwmydv2mwxdfca/runtime.25b143da327a5371509f.bundle.js"></script>
+    <style>
+        @media screen and (max-width: 600px) {{
+            .gatewaylinks .nav-link {{
+                padding-top: 0px!important;
+                padding-bottom: 0px!important;
+                margin: 0px;
+            }}
+            .gatewaylinks img {{
+                height: 30px;
+            }}
+        }}
+    </style>
+</head>
+<body>
+<nav class="navbar navbar-expand-sm navbar-light bg-dark" style="display: flex; flex-wrap: nowrap; padding-left: 5px; padding-right: 5px; height: 73px; border-bottom: rgb(0, 236, 151) solid 5px;">
+    <a class="navbar-brand" href="/"><img src="https://i.near.social/magic/large/https://near.social/magic/img/account/{current_account_id}" style="height: 68px" /></a>
+    <p class="nav-text" style="flex-grow: 1"></p>
+    <p class="nav-text text-light" style="margin-top: 1rem; margin-right: 1rem">Choose your gateway</p>
+    <div class="navbar-nav gatewaylinks">
+        <a href="https://near.org/{redirect_path}" class="nav-link">
+            <img src="https://ipfs.web4.near.page/ipfs/bafybeia2ptgyoz7b6oxu3k57jmiras2pgigmw7a3cp6osjog67rndmf36y/nearorg.svg" />
+        </a>
+        <a href="https://near.social/{redirect_path}" class="nav-link">
+            <img src="https://ipfs.web4.near.page/ipfs/bafybeia2ptgyoz7b6oxu3k57jmiras2pgigmw7a3cp6osjog67rndmf36y/nearsocial.svg" />
+        </a>
+    </div>
+</nav>
+    <near-social-viewer src="{current_account_id}/widget/app" initialProps='{initial_props_json}'></near-social-viewer>
+</body>
+</html>"#,
+        url = redirect_path
+    );
+
+    Web4Response::Body {
+        content_type: "text/html; charset=UTF-8".to_owned(),
+        body: BASE64_ENGINE.encode(body),
+    }
+}
+
+#[cfg(all(test, not(target_arch = "wasm32")))]
+mod tests {
+    use std::collections::HashSet;
+
+    use super::web4_get;
+    use crate::{
+        web4::{handler::BASE64_ENGINE, types::Web4Response},
+        CommunityInputs, Contract, Proposal, ProposalBodyV0, ProposalSnapshot,
+        VersionedProposalBody,
+    };
+    use near_sdk::{
+        base64::Engine, serde_json::json, test_utils::VMContextBuilder, testing_env, NearToken,
+    };
+
+    const PRELOAD_URL: &str = "/web4/contract/social.near/get?keys.json=%5B%22not-only-devhub.near/widget/app/metadata/**%22%5D";
+
+    fn create_preload_result(title: String, description: String) -> serde_json::Value {
+        let body_string = serde_json::json!({"not-only-devhub.near":{"widget":{"app":{"metadata":{
+            "description":description,
+            "image":{"ipfs_cid":"bafkreido4srg4aj7l7yg2tz22nbu3ytdidjczdvottfr5ek6gqorwg6v74"},
+            "name":title,
+            "tags": {"devhub":"","communities":"","developer-governance":"","app":""}}}}}})
+        .to_string();
+
+        let body_base64 = BASE64_ENGINE.encode(body_string);
+        return serde_json::json!({
+                String::from(PRELOAD_URL): {
+                    "contentType": "application/json",
+                    "body": body_base64
+                }
+        });
+    }
+
+    fn view_test_env() {
+        let contract: String = "not-only-devhub.near".to_string();
+        let context =
+            VMContextBuilder::new().current_account_id(contract.try_into().unwrap()).build();
+
+        testing_env!(context);
+    }
+
+    #[test]
+    pub fn test_preload_url_response() {
+        view_test_env();
+        let contract = Contract::new();
+
+        let response_before_preload = web4_get(
+            &contract,
+            serde_json::from_value(serde_json::json!({
+                "path": "/"
+            }))
+            .unwrap(),
+        );
+        match response_before_preload {
+            Web4Response::PreloadUrls { preload_urls } => {
+                assert_eq!(PRELOAD_URL, preload_urls.get(0).unwrap())
+            }
+            _ => {
+                panic!("Should return Web4Response::PreloadUrls");
+            }
+        }
+    }
+
+    #[test]
+    pub fn test_response_with_preload_content() {
+        view_test_env();
+        let contract = Contract::new();
+
+        let response = web4_get(
+            &contract,
+            serde_json::from_value(serde_json::json!({
+                "path": "/",
+                "preloads": create_preload_result(String::from("NotOnlyDevHub"),String::from("A description of any devhub portal instance, not just devhub itself")),
+            }))
+            .unwrap(),
+        );
+        match response {
+            Web4Response::Body { content_type, body } => {
+                assert_eq!("text/html; charset=UTF-8", content_type);
+
+                let body_string = String::from_utf8(BASE64_ENGINE.decode(body).unwrap()).unwrap();
+
+                assert!(body_string.contains(
+                    "<meta property=\"og:description\" content=\"A description of any devhub portal instance, not just devhub itself\" />"
+                ));
+                assert!(body_string
+                    .contains("<meta property=\"og:title\" content=\"NotOnlyDevHub\" />"));
+            }
+            _ => {
+                panic!("Should return Web4Response::Body");
+            }
+        }
+    }
+
+    #[test]
+    pub fn test_response_with_empty_preload_content() {
+        view_test_env();
+        let contract = Contract::new();
+
+        let response = web4_get(
+            &contract,
+            serde_json::from_value(serde_json::json!({
+                "path": "/",
+                "preloads": {
+                        String::from(PRELOAD_URL): {
+                            "contentType": "application/json",
+                            "body": ""
+                        }
+                },
+            }))
+            .unwrap(),
+        );
+        match response {
+            Web4Response::Body { content_type, body } => {
+                assert_eq!("text/html; charset=UTF-8", content_type);
+
+                let body_string = String::from_utf8(BASE64_ENGINE.decode(body).unwrap()).unwrap();
+
+                assert!(body_string.contains(
+                    "<meta property=\"og:description\" content=\"The decentralized home base for NEAR builders\" />"
+                ));
+                assert!(body_string
+                    .contains("<meta property=\"og:title\" content=\"near/dev/hub\" />"));
+            }
+            _ => {
+                panic!("Should return Web4Response::Body");
+            }
+        }
+    }
+
+    #[test]
+    pub fn test_logo() {
+        view_test_env();
+        let contract = Contract::new();
+        let response = web4_get(
+            &contract,
+            serde_json::from_value(serde_json::json!({
+                "path": "/proposal/1",
+                "preloads": create_preload_result(String::from("title"), String::from("description")),
+            }))
+            .unwrap(),
+        );
+        match response {
+            Web4Response::Body { content_type, body } => {
+                assert_eq!("text/html; charset=UTF-8", content_type);
+
+                let body_string = String::from_utf8(BASE64_ENGINE.decode(body).unwrap()).unwrap();
+                assert!(body_string.contains("<a class=\"navbar-brand\" href=\"/\"><img src=\"https://i.near.social/magic/large/https://near.social/magic/img/account/not-only-devhub.near\" style=\"height: 68px\" /></a>"));
+                assert!(body_string.contains("<meta property=\"og:image\" content=\"https://i.near.social/magic/large/https://near.social/magic/img/account/not-only-devhub.near\" />"));
+                assert!(body_string.contains("<meta name=\"twitter:image\" content=\"https://i.near.social/magic/large/https://near.social/magic/img/account/not-only-devhub.near\">"));
+                let expected_initial_props_string =
+                    json!({"page": "proposal", "id": "1"}).to_string();
+                assert!(body_string.contains(&expected_initial_props_string));
+            }
+            _ => {
+                panic!("Should return Web4Response::Body");
+            }
+        }
+    }
+
+    #[test]
+    pub fn test_community_path() {
+        let signer = "bob.near".to_string();
+        let contract: String = "not-only-devhub.near".to_string();
+
+        let context = VMContextBuilder::new()
+            .signer_account_id(signer.clone().try_into().unwrap())
+            .current_account_id(contract.try_into().unwrap())
+            .attached_deposit(NearToken::from_near(4))
+            .build();
+
+        testing_env!(context);
+        let mut contract = Contract::new();
+
+        contract.create_community(CommunityInputs {
+            handle: String::from("webassemblymusic"),
+            name: String::from("WebAssembly Music"), 
+            description: String::from("Music stored forever in the NEAR blockchain"),tag: String::from("wasm"),
+            logo_url: String::from("https://ipfs.near.social/ipfs/bafybeiesrsf4fpdmlfgcnxpuxiqlgw2lk3bietdt25mvumrjk5yhf2c54e"),
+            banner_url: String::from("https://ipfs.near.social/ipfs/bafybeihsid3qgrb2dd4adsd4kuwe3pondtjr3u27ru6e2mbvabvm4rocru"),
+            bio_markdown: Some(String::from("Music stored forever in the NEAR blockchain"))
+        });
+
+        let response = web4_get(
+            &contract,
+            serde_json::from_value(serde_json::json!({
+                "path": "/community/webassemblymusic",
+                "preloads": create_preload_result(String::from("title"), String::from("description")),
+            }))
+            .unwrap(),
+        );
+        match response {
+            Web4Response::Body { content_type, body } => {
+                assert_eq!("text/html; charset=UTF-8", content_type);
+
+                let body_string = String::from_utf8(BASE64_ENGINE.decode(body).unwrap()).unwrap();
+
+                assert!(body_string.contains("<meta property=\"og:description\" content=\"Music stored forever in the NEAR blockchain\" />"));
+                assert!(body_string
+                    .contains("<meta name=\"twitter:title\" content=\"title - Community - WebAssembly Music\">"));
+                assert!(body_string.contains("https://near.social/not-only-devhub.near/widget/app?page=community&handle=webassemblymusic"));
+                let expected_initial_props_string =
+                    json!({"page": "community", "handle": "webassemblymusic"}).to_string();
+                assert!(body_string.contains(&expected_initial_props_string));
+            }
+            _ => {
+                panic!("Should return Web4Response::Body");
+            }
+        }
+    }
+
+    #[test]
+    pub fn test_web4_unknown_path() {
+        view_test_env();
+        let contract = Contract::new();
+        for unknown_path in &["/", "/unknown", "/unknown/path"] {
+            let response = web4_get(
+                &contract,
+                serde_json::from_value(serde_json::json!({
+                    "path": unknown_path,
+                    "preloads": create_preload_result(String::from("near/dev/hub"), String::from("The decentralized home base for NEAR builders")),
+                }))
+                .unwrap(),
+            );
+            match response {
+                Web4Response::Body { content_type, body } => {
+                    assert_eq!("text/html; charset=UTF-8", content_type);
+
+                    let body_string =
+                        String::from_utf8(BASE64_ENGINE.decode(body).unwrap()).unwrap();
+
+                    assert!(body_string.contains("<meta name=\"twitter:description\" content=\"The decentralized home base for NEAR builders\">"));
+                    assert!(body_string
+                        .contains("<meta name=\"twitter:title\" content=\"near/dev/hub\">"));
+                    assert!(
+                        body_string.contains("https://near.social/not-only-devhub.near/widget/app")
+                    );
+                }
+                _ => {
+                    panic!("Should return Web4Response::Body for '{}' path", unknown_path);
+                }
+            }
+        }
+    }
+
+    #[test]
+    pub fn test_web4_unknown_community() {
+        view_test_env();
+        let contract = Contract::new();
+        let response = web4_get(
+            &contract,
+            serde_json::from_value(serde_json::json!({
+                "path": "/community/blablablablabla",
+                "preloads": create_preload_result(String::from("near/dev/hub"), String::from("The decentralized home base for NEAR builders")),
+            }))
+            .unwrap(),
+        );
+        match response {
+            Web4Response::Body { content_type, body } => {
+                assert_eq!("text/html; charset=UTF-8", content_type);
+
+                let body_string = String::from_utf8(BASE64_ENGINE.decode(body).unwrap()).unwrap();
+
+                assert!(body_string.contains("<meta name=\"twitter:description\" content=\"The decentralized home base for NEAR builders\">"));
+                assert!(
+                    body_string.contains("<meta name=\"twitter:title\" content=\"near/dev/hub - Community - blablablablabla\">")
+                );
+                assert!(body_string.contains("https://near.social/not-only-devhub.near/widget/app"));
+                assert!(body_string.contains("https://near.org/not-only-devhub.near/widget/app"));
+                let expected_initial_props_string =
+                    json!({"page": "community", "handle": "blablablablabla"}).to_string();
+                assert!(body_string.contains(&expected_initial_props_string));
+            }
+            _ => {
+                panic!("Should return Web4Response::Body");
+            }
+        }
+    }
+
+    #[test]
+    pub fn test_web4_community_missing_handle() {
+        view_test_env();
+        let contract = Contract::new();
+        let response = web4_get(
+            &contract,
+            serde_json::from_value(serde_json::json!({
+                "path": "/community",
+                "preloads": create_preload_result(String::from("near/dev/hub"), String::from("The decentralized home base for NEAR builders")),
+            }))
+            .unwrap(),
+        );
+        match response {
+            Web4Response::Body { content_type, body } => {
+                assert_eq!("text/html; charset=UTF-8", content_type);
+
+                let body_string = String::from_utf8(BASE64_ENGINE.decode(body).unwrap()).unwrap();
+
+                assert!(body_string.contains("<meta name=\"twitter:description\" content=\"The decentralized home base for NEAR builders\">"));
+                assert!(
+                    body_string.contains("<meta name=\"twitter:title\" content=\"near/dev/hub\">")
+                );
+                assert!(body_string.contains("https://near.social/not-only-devhub.near/widget/app"));
+                assert!(body_string.contains("https://near.org/not-only-devhub.near/widget/app"));
+                let expected_initial_props_string = json!({"page": "community"}).to_string();
+                assert!(body_string.contains(&expected_initial_props_string));
+            }
+            _ => {
+                panic!("Should return Web4Response::Body");
+            }
+        }
+    }
+
+    #[test]
+    pub fn test_proposal_path() {
+        let signer = "bob.near".to_string();
+        let contract = "not-only-devhub.near".to_string();
+        let context = VMContextBuilder::new()
+            .signer_account_id(signer.clone().try_into().unwrap())
+            .current_account_id(contract.try_into().unwrap())
+            .build();
+
+        testing_env!(context);
+        let mut contract = Contract::new();
+
+        let proposal_body: ProposalBodyV0 = near_sdk::serde_json::from_value(json!({
+            "proposal_body_version": "V0",
+            "name": "The best proposal ever",
+            "description": "You should just understand why this is the best proposal",
+            "category": "Marketing",
+            "summary": "It is obvious why this proposal is so great",
+            "linked_proposals": [1, 3],
+            "requested_sponsorship_usd_amount": "1000000000",
+            "requested_sponsorship_paid_in_currency": "USDT",
+            "receiver_account": "polyprogrammist.near",
+            "supervisor": "frol.near",
+            "requested_sponsor": "neardevdao.near",
+            "payouts": [],
+            "timeline": {"status": "DRAFT"}
+        }))
+        .unwrap();
+        let proposal = Proposal {
+            id: 0,
+            author_id: "bob.near".parse().unwrap(),
+            social_db_post_block_height: 0u64,
+            snapshot: ProposalSnapshot {
+                editor_id: "bob.near".parse().unwrap(),
+                timestamp: 0,
+                labels: HashSet::new(),
+                body: VersionedProposalBody::V0(proposal_body),
+            },
+            snapshot_history: vec![],
+        };
+
+        contract.proposals.push(&proposal.clone().into());
+
+        let response = web4_get(
+            &contract,
+            serde_json::from_value(serde_json::json!({
+                "path": "/proposal/0",
+                "preloads": create_preload_result(String::from("near/dev/hub"), String::from("The decentralized home base for NEAR builders")),
+            }))
+            .unwrap(),
+        );
+        match response {
+            Web4Response::Body { content_type, body } => {
+                assert_eq!("text/html; charset=UTF-8", content_type);
+
+                let body_string = String::from_utf8(BASE64_ENGINE.decode(body).unwrap()).unwrap();
+
+                assert!(body_string.contains("<meta property=\"og:description\" content=\"It is obvious why this proposal is so great\" />"));
+                assert!(body_string
+                    .contains("<meta name=\"twitter:title\" content=\"near/dev/hub - Proposal #0 - The best proposal ever\">"));
+                assert!(body_string.contains(
+                    "https://near.social/not-only-devhub.near/widget/app?page=proposal&id=0"
+                ));
+                assert!(body_string.contains(
+                    "https://near.org/not-only-devhub.near/widget/app?page=proposal&id=0"
+                ));
+                let expected_initial_props_string =
+                    json!({"page": "proposal", "id": "0"}).to_string();
+                assert!(body_string.contains(&expected_initial_props_string));
+            }
+            _ => {
+                panic!("Should return Web4Response::Body");
+            }
+        }
+    }
+
+    #[test]
+    pub fn test_proposal_with_html_tag_in_summary() {
+        let signer = "bob.near".to_string();
+        let contract = "not-only-devhub.near".to_string();
+        let context = VMContextBuilder::new()
+            .signer_account_id(signer.clone().try_into().unwrap())
+            .current_account_id(contract.try_into().unwrap())
+            .build();
+
+        testing_env!(context);
+        let mut contract = Contract::new();
+
+        let proposal_body: ProposalBodyV0 = near_sdk::serde_json::from_value(json!({
+            "proposal_body_version": "V0",
+            "name": "The best proposal ever",
+            "description": "You should just understand why this is the best proposal",
+            "category": "Marketing",
+            "summary": "It is obvious why this <script>alert('hello');</script> proposal is so great",
+            "linked_proposals": [1, 3],
+            "requested_sponsorship_usd_amount": "1000000000",
+            "requested_sponsorship_paid_in_currency": "USDT",
+            "receiver_account": "polyprogrammist.near",
+            "supervisor": "frol.near",
+            "requested_sponsor": "neardevdao.near",
+            "payouts": [],
+            "timeline": {"status": "DRAFT"}
+        }))
+        .unwrap();
+        let proposal = Proposal {
+            id: 0,
+            author_id: "bob.near".parse().unwrap(),
+            social_db_post_block_height: 0u64,
+            snapshot: ProposalSnapshot {
+                editor_id: "bob.near".parse().unwrap(),
+                timestamp: 0,
+                labels: HashSet::new(),
+                body: VersionedProposalBody::V0(proposal_body),
+            },
+            snapshot_history: vec![],
+        };
+
+        contract.proposals.push(&proposal.clone().into());
+
+        let response = web4_get(
+            &contract,
+            serde_json::from_value(serde_json::json!({
+                "path": "/proposal/0",
+                "preloads": create_preload_result(String::from("near/dev/hub"), String::from("The decentralized home base for NEAR builders")),
+            }))
+            .unwrap(),
+        );
+        match response {
+            Web4Response::Body { content_type, body } => {
+                assert_eq!("text/html; charset=UTF-8", content_type);
+
+                let body_string = String::from_utf8(BASE64_ENGINE.decode(body).unwrap()).unwrap();
+
+                assert!(body_string.contains("<meta property=\"og:description\" content=\"It is obvious why this &lt;script&gt;alert('hello');&lt;/script&gt; proposal is so great\" />"));
+                assert!(body_string
+                    .contains("<meta name=\"twitter:title\" content=\"near/dev/hub - Proposal #0 - The best proposal ever\">"));
+                assert!(body_string.contains(
+                    "https://near.social/not-only-devhub.near/widget/app?page=proposal&id=0"
+                ));
+                assert!(body_string.contains(
+                    "https://near.org/not-only-devhub.near/widget/app?page=proposal&id=0"
+                ));
+                let expected_initial_props_string =
+                    json!({"page": "proposal", "id": "0"}).to_string();
+                assert!(body_string.contains(&expected_initial_props_string));
+            }
+            _ => {
+                panic!("Should return Web4Response::Body");
+            }
+        }
+    }
+
+    #[test]
+    pub fn test_proposal_path_unknown() {
+        view_test_env();
+        let contract = Contract::new();
+        let response = web4_get(
+            &contract,
+            serde_json::from_value(serde_json::json!({
+                "path": "/proposal/1",
+                "preloads": create_preload_result(String::from("near/dev/hub"), String::from("The decentralized home base for NEAR builders")),
+            }))
+            .unwrap(),
+        );
+        match response {
+            Web4Response::Body { content_type, body } => {
+                assert_eq!("text/html; charset=UTF-8", content_type);
+
+                let body_string = String::from_utf8(BASE64_ENGINE.decode(body).unwrap()).unwrap();
+
+                assert!(body_string.contains("<meta name=\"twitter:description\" content=\"The decentralized home base for NEAR builders\">"));
+                assert!(
+                    body_string.contains("<meta name=\"twitter:title\" content=\"near/dev/hub - Proposal #1\">")
+                );
+                assert!(body_string.contains("https://near.social/not-only-devhub.near/widget/app"));
+                let expected_initial_props_string =
+                    json!({"page": "proposal", "id": "1"}).to_string();
+                assert!(body_string.contains(&expected_initial_props_string));
+            }
+            _ => {
+                panic!("Should return Web4Response::Body");
+            }
+        }
+    }
+
+    #[test]
+    pub fn test_proposal_path_incomplete() {
+        view_test_env();
+        let contract = Contract::new();
+        let response = web4_get(
+            &contract,
+            serde_json::from_value(serde_json::json!({
+                "path": "/proposal",
+                "preloads": create_preload_result(String::from("near/dev/hub"), String::from("The decentralized home base for NEAR builders")),
+            }))
+            .unwrap(),
+        );
+        match response {
+            Web4Response::Body { content_type, body } => {
+                assert_eq!("text/html; charset=UTF-8", content_type);
+
+                let body_string = String::from_utf8(BASE64_ENGINE.decode(body).unwrap()).unwrap();
+
+                assert!(body_string.contains("<meta name=\"twitter:description\" content=\"The decentralized home base for NEAR builders\">"));
+                assert!(
+                    body_string.contains("<meta name=\"twitter:title\" content=\"near/dev/hub\">")
+                );
+                assert!(body_string.contains("https://near.social/not-only-devhub.near/widget/app"));
+                let expected_initial_props_string = json!({"page": "proposal"}).to_string();
+                assert!(body_string.contains(&expected_initial_props_string));
+            }
+            _ => {
+                panic!("Should return Web4Response::Body");
+            }
+        }
+    }
+}
diff --git a/src/web4/mod.rs b/src/web4/mod.rs
new file mode 100644
index 0000000..c2ce1d6
--- /dev/null
+++ b/src/web4/mod.rs
@@ -0,0 +1,2 @@
+pub mod handler;
+pub mod types;
diff --git a/src/web4/types.rs b/src/web4/types.rs
new file mode 100644
index 0000000..6b4c8b1
--- /dev/null
+++ b/src/web4/types.rs
@@ -0,0 +1,33 @@
+use near_sdk::serde::{Deserialize, Serialize};
+use near_sdk::NearSchema;
+
+#[derive(Debug, Serialize, Deserialize, NearSchema)]
+#[serde(crate = "near_sdk::serde")]
+pub struct Web4Request {
+    #[serde(rename = "accountId")]
+    pub account_id: Option<String>,
+    pub path: String,
+    #[serde(default)]
+    pub params: std::collections::HashMap<String, String>,
+    #[serde(default)]
+    pub query: std::collections::HashMap<String, Vec<String>>,
+    pub preloads: Option<std::collections::HashMap<String, Web4Response>>,
+}
+
+#[derive(Debug, Serialize, Deserialize, NearSchema, Clone)]
+#[serde(crate = "near_sdk::serde", untagged)]
+pub enum Web4Response {
+    Body {
+        #[serde(rename = "contentType")]
+        content_type: String,
+        body: String,
+    },
+    BodyUrl {
+        #[serde(rename = "bodyUrl")]
+        body_url: String,
+    },
+    PreloadUrls {
+        #[serde(rename = "preloadUrls")]
+        preload_urls: Vec<String>,
+    },
+}
diff --git a/test.sh b/test.sh
new file mode 100755
index 0000000..94b5c9a
--- /dev/null
+++ b/test.sh
@@ -0,0 +1,87 @@
+#!/bin/bash
+
+contract=i.zxcvn.testnet
+
+# near create-account $contract --masterAccount zxcvn.testnet --initialBalance 10
+# near deploy $contract res/devgovgigs.wasm --initFunction new --initArgs '{}'
+
+# for i in $(seq 1 2)
+# do
+# near call $contract add_post --accountId zxcvn.testnet --deposit 0.01 --args '{"parent_id":null,"body":{"post_type": "Idea","idea_version":"V1","name":"a'$i'","description":"aaa"},"labels":[]}'
+# near call $contract add_post --accountId zxcvn.testnet --deposit 0.01 --args '{"parent_id":null,"body":{"post_type": "Idea","idea_version":"V1","name":"b'$i'","description":"bbb"},"labels":[]}'
+# near call $contract add_post --accountId a.zxcvn.testnet --deposit 0.01 --args '{"parent_id":null,"body":{"post_type": "Idea","idea_version":"V1","name":"c'$i'","description":"ccc"},"labels":[]}'
+# near call $contract add_post --accountId zxcvn.testnet --deposit 0.01 --args '{"parent_id":null,"body":{"post_type": "Idea","idea_version":"V1","name":"d'$i'","description":"ddd"},"labels":[]}'
+# done
+
+# near deploy $contract res/devgovgigs.wasm
+
+# near call $contract unsafe_self_upgrade --accountId $contract --args $(base64 < res/devgovgigs.wasm ) --base64 --gas 300000000000000
+
+#near call contract.devhubopen.testnet unsafe_self_upgrade --accountId contract.devhubopen.testnet --args $(base64 < res/devgovgigs.wasm ) --base64 --gas 300000000000000
+
+# near call $contract unsafe_migrate --accountId $contract --gas 300000000000000
+
+# cargo near deploy forum.potlock.near with-init-call new json-args {} prepaid-gas '100.0 Tgas' attached-deposit '0 NEAR' network-config mainnet sign-with-plaintext-private-key --signer-public-key ed25519:H15VWKYXKsEG7dfeb2xWqHEjb4FsmZTuMPY7NjUoX6XT --signer-private-key ed25519:47JqUN9iC95vKWqvySupvfnBmnvnnreaLmWEtVUwKhw6grRLhhCNp6MeC5sonZ27Zvwk25Ymg7hggkSUjDaCXqFX send
+
+# near contract call-function  \
+#     as-transaction forum.potlock.near set_allowed_categories json-args '{"new_categories":["AI PGF"]}' \
+#     prepaid-gas '300 Tgas' \
+#     attached-deposit '0 NEAR' \
+#     sign-as forum.potlock.near  \
+#     network-config mainnet \
+#     sign-with-plaintext-private-key --signer-public-key ed25519:H15VWKYXKsEG7dfeb2xWqHEjb4FsmZTuMPY7NjUoX6XT --signer-private-key ed25519:47JqUN9iC95vKWqvySupvfnBmnvnnreaLmWEtVUwKhw6grRLhhCNp6MeC5sonZ27Zvwk25Ymg7hggkSUjDaCXqFX \
+#     send
+
+
+# near contract call-function \
+#     as-transaction forum.potlock.near set_global_labels json-args '{"labels":[{"title":"Bounty","value":"Bounty","color":[124,102,220]},{"title":"Quick Start","value":"Quick Start","color":[220,194,102]},{"title":"A small build","value":"A small build","color":[4,164,110]}]}' \
+#     prepaid-gas '300 Tgas' \
+#     attached-deposit '0 NEAR' \
+#     sign-as forum.potlock.near \
+#     network-config mainnet \
+#     sign-with-plaintext-private-key --signer-public-key ed25519:H15VWKYXKsEG7dfeb2xWqHEjb4FsmZTuMPY7NjUoX6XT --signer-private-key ed25519:47JqUN9iC95vKWqvySupvfnBmnvnnreaLmWEtVUwKhw6grRLhhCNp6MeC5sonZ27Zvwk25Ymg7hggkSUjDaCXqFX \
+#     send
+
+
+# near contract \
+#     call-function  \
+#     as-transaction forum.potlock.near edit_member json-args '{"member":"team:moderators","metadata":{"member_metadata_version":"V0","description":"The moderator group has permissions to create and edit RFPs, edit and manage proposals, and manage admins.","permissions":{"*":["use-labels","edit-post"]},"children":["megha19.near"],"parents":[]}}' \
+#     prepaid-gas '300 Tgas' \
+#     attached-deposit '0 NEAR' \
+#     sign-as forum.potlock.near  \
+#     network-config mainnet \
+#     sign-with-plaintext-private-key --signer-public-key ed25519:H15VWKYXKsEG7dfeb2xWqHEjb4FsmZTuMPY7NjUoX6XT --signer-private-key ed25519:47JqUN9iC95vKWqvySupvfnBmnvnnreaLmWEtVUwKhw6grRLhhCNp6MeC5sonZ27Zvwk25Ymg7hggkSUjDaCXqFX \
+#     send
+
+near contract \
+    # call-function  \
+    # as-transaction forum.potlock.near remove_member json-args '{"member": "team:moderators"}' \
+    # prepaid-gas '300 Tgas' \
+    # attached-deposit '0 NEAR' \
+    # sign-as forum.potlock.near  \
+    # network-config mainnet \
+    # sign-with-plaintext-private-key --signer-public-key ed25519:H15VWKYXKsEG7dfeb2xWqHEjb4FsmZTuMPY7NjUoX6XT --signer-private-key ed25519:47JqUN9iC95vKWqvySupvfnBmnvnnreaLmWEtVUwKhw6grRLhhCNp6MeC5sonZ27Zvwk25Ymg7hggkSUjDaCXqFX \
+    # send
+    
+
+# near contract \
+#     call-function  \
+#     as-transaction forum.potlock.near add_member json-args '{"member":"megha19.near","metadata":{"member_metadata_version":"V0","description":"The moderator group has permissions to create and edit RFPs, edit and manage proposals, and manage admins.","permissions":{"*":["use-labels","edit-post"]},"children":[],"parents":["team:moderators"]}}' \
+#     prepaid-gas '300 Tgas' \
+#     attached-deposit '0 NEAR' \
+#     sign-as forum.potlock.near  \
+#     network-config mainnet \
+#     sign-with-plaintext-private-key --signer-public-key ed25519:H15VWKYXKsEG7dfeb2xWqHEjb4FsmZTuMPY7NjUoX6XT --signer-private-key ed25519:47JqUN9iC95vKWqvySupvfnBmnvnnreaLmWEtVUwKhw6grRLhhCNp6MeC5sonZ27Zvwk25Ymg7hggkSUjDaCXqFX \
+#     send
+
+
+# cd discussions
+# cargo near build
+# cd ../community
+# cargo near build
+# cd ../community-factory
+# cargo near build
+# cd ..
+# cargo near build
+
+# cargo near deploy forum.potlock.near without-init-call network-config mainnet sign-with-plaintext-private-key --signer-public-key ed25519:H15VWKYXKsEG7dfeb2xWqHEjb4FsmZTuMPY7NjUoX6XT --signer-private-key ed25519:47JqUN9iC95vKWqvySupvfnBmnvnnreaLmWEtVUwKhw6grRLhhCNp6MeC5sonZ27Zvwk25Ymg7hggkSUjDaCXqFX send
\ No newline at end of file
diff --git a/tests/README.md b/tests/README.md
new file mode 100644
index 0000000..15a5993
--- /dev/null
+++ b/tests/README.md
@@ -0,0 +1,18 @@
+# Integration Test using near-workspaces-rs
+
+This codebase is designed to deploy and test the Devhub contract on a Sandbox node.
+
+## Dependencies
+
+- Rust: For writing the test suite.
+- `near-workspaces`: A custom library for handling contract calls.
+- `near_units`: For handling NEAR unit conversions.
+- `serde_json`: For JSON serialization and deserialization.
+
+### How to Run
+
+To run the test, use the following command:
+
+```bash
+cargo test
+```
diff --git a/tests/communities.rs b/tests/communities.rs
new file mode 100644
index 0000000..ddb0499
--- /dev/null
+++ b/tests/communities.rs
@@ -0,0 +1,344 @@
+mod test_env;
+
+use near_sdk::NearToken;
+use {crate::test_env::*, serde_json::json};
+
+#[tokio::test]
+async fn test_community_addon() -> anyhow::Result<()> {
+    // Initialize the devhub and near social contract on chain,
+    // contract is devhub contract instance.
+    let (contract, _, _) = init_contracts_from_res().await?;
+
+    let deposit_amount = NearToken::from_near(4);
+
+    // Add a community
+    let _create_community = contract
+        .call("create_community")
+        .args_json(json!({
+            "inputs": {
+                "handle": "gotham",
+                "name": "Gotham",
+                "tag": "some",
+                "description": "This is a test community.",
+                "bio_markdown": "This is a sample text about your community.\nYou can change it on the community configuration page.",
+                "logo_url": "https://ipfs.near.social/ipfs/bafkreibysr2mkwhb4j36h2t7mqwhynqdy4vzjfygfkfg65kuspd2bawauu",
+                "banner_url": "https://ipfs.near.social/ipfs/bafkreic4xgorjt6ha5z4s5e3hscjqrowe5ahd7hlfc5p4hb6kdfp6prgy4"
+            }
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    // Create add-on
+    let _ = contract
+        .call("create_addon")
+        .args_json(json!({"addon": {
+            "id": "CommunityAddOnId",
+            "title": "GitHub AddOn",
+            "description": "Current status of NEARCORE repo",
+            "view_widget": "custom-viewer-widget",
+            "configurator_widget": "github-configurator",
+            "icon": "bi bi-github",
+        }}))
+        .max_gas()
+        .transact()
+        .await?;
+
+    let _ = contract
+        .call("set_community_addons")
+        .args_json(json!({
+            "handle": "gotham",
+            "addons": [{
+                "id": "unique",
+                "addon_id": "CommunityAddOnId",
+                "display_name": "GitHub",
+                "enabled": true,
+                "parameters": ""
+            }]
+        }))
+        .max_gas()
+        .transact()
+        .await?;
+
+    let get_community: serde_json::Value = contract
+        .call("get_community")
+        .args_json(json!({
+            "handle" : "gotham"
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    assert_eq!(get_community["addons"][0]["display_name"].as_str(), Some("GitHub"));
+
+    Ok(())
+}
+
+#[tokio::test]
+async fn test_update_community() -> anyhow::Result<()> {
+    // Initialize the devhub and near social contract on chain,
+    // contract is devhub contract instance.
+    let (contract, _, _) = init_contracts_from_res().await?;
+
+    let deposit_amount = NearToken::from_near(4);
+
+    // Add a community
+    let _create_community = contract
+        .call("create_community")
+        .args_json(json!({
+            "inputs": {
+                "handle": "gotham",
+                "name": "Gotham",
+                "tag": "some",
+                "description": "This is a test community.",
+                "bio_markdown": "This is a sample text about your community.\nYou can change it on the community configuration page.",
+                "logo_url": "https://ipfs.near.social/ipfs/bafkreibysr2mkwhb4j36h2t7mqwhynqdy4vzjfygfkfg65kuspd2bawauu",
+                "banner_url": "https://ipfs.near.social/ipfs/bafkreic4xgorjt6ha5z4s5e3hscjqrowe5ahd7hlfc5p4hb6kdfp6prgy4"
+            }
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    let _update_community = contract
+        .call("update_community")
+        .args_json(json!({
+            "handle": "gotham",
+            "community": {
+                "admins": [],
+                "handle": "gotham",
+                "name": "Gotham2",
+                "tag": "other",
+                "description": "This is a test community.",
+                "bio_markdown": "This is a sample text about your community.\nYou can change it on the community configuration page.",
+                "logo_url": "https://ipfs.near.social/ipfs/bafkreibysr2mkwhb4j36h2t7mqwhynqdy4vzjfygfkfg65kuspd2bawauu",
+                "banner_url": "https://ipfs.near.social/ipfs/bafkreic4xgorjt6ha5z4s5e3hscjqrowe5ahd7hlfc5p4hb6kdfp6prgy4",
+                "addons": []
+            }
+        }))
+        .max_gas()
+        .transact()
+        .await?;
+
+    let get_community: serde_json::Value = contract
+        .call("get_community")
+        .args_json(json!({
+            "handle" : "gotham"
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    assert_eq!(get_community["tag"].as_str(), Some("other"));
+    assert_eq!(get_community["name"].as_str(), Some("Gotham2"));
+
+    Ok(())
+}
+
+#[tokio::test]
+async fn test_announcement() -> anyhow::Result<()> {
+    // Initialize the devhub and near social contract on chain,
+    // contract is devhub contract instance.
+    let (contract, worker, _) = init_contracts_from_res().await?;
+
+    let deposit_amount = NearToken::from_near(4);
+
+    // Add a community
+    let _create_community = contract
+        .call("create_community")
+        .args_json(json!({
+            "inputs": {
+                "handle": "gotham",
+                "name": "Gotham",
+                "tag": "some",
+                "description": "This is a test community.",
+                "bio_markdown": "This is a sample text about your community.\nYou can change it on the community configuration page.",
+                "logo_url": "https://ipfs.near.social/ipfs/bafkreibysr2mkwhb4j36h2t7mqwhynqdy4vzjfygfkfg65kuspd2bawauu",
+                "banner_url": "https://ipfs.near.social/ipfs/bafkreic4xgorjt6ha5z4s5e3hscjqrowe5ahd7hlfc5p4hb6kdfp6prgy4"
+            }
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    println!("{:?}", _create_community);
+
+    let community_account = "gotham.community.devhub.near".parse()?;
+
+    // assert community account exists
+    let _ = worker.view_account(&community_account).await?;
+
+    // create announcement
+    let create_announcement = contract
+        .call("set_community_socialdb")
+        .args_json(json!({
+            "handle": "gotham",
+            "data": {
+                "post": {
+                    "main": "{\"type\":\"md\",\"text\":\"what's up\"}"
+                },
+                "index": {
+                    "post": "{\"key\":\"main\",\"value\":{\"type\":\"md\"}}"
+                }
+            }
+        }))
+        .max_gas()
+        .transact()
+        .await?;
+
+    assert!(create_announcement.is_success());
+
+    let near_social_account = "social.near".parse()?;
+    let data: serde_json::Value = worker
+        .view(&near_social_account, "get")
+        .args_json(json!({"keys": ["gotham.community.devhub.near/**"]}))
+        .await?
+        .json()?;
+
+    assert_eq!(
+        data["gotham.community.devhub.near"]["post"]["main"].as_str(),
+        Some("{\"type\":\"md\",\"text\":\"what's up\"}")
+    );
+
+    // update community, intend to change name and logo
+    let _update_community = contract
+    .call("update_community")
+    .args_json(json!({
+        "handle": "gotham",
+        "community": {
+            "admins": [],
+            "handle": "gotham",
+            "name": "Gotham2",
+            "tag": "some",
+            "description": "This is a test community.",
+            "bio_markdown": "This is a sample text about your community.\nYou can change it on the community configuration page.",
+            "logo_url": "https://example.com/image.png",
+            "banner_url": "https://ipfs.near.social/ipfs/bafkreic4xgorjt6ha5z4s5e3hscjqrowe5ahd7hlfc5p4hb6kdfp6prgy4",
+            "addons": []
+        }
+    }))
+    .max_gas()
+    .transact()
+    .await?;
+
+    let near_social_account = "social.near".parse()?;
+    let data: serde_json::Value = worker
+        .view(&near_social_account, "get")
+        .args_json(json!({"keys": ["gotham.community.devhub.near/**"]}))
+        .await?
+        .json()?;
+
+    assert_eq!(data["gotham.community.devhub.near"]["profile"]["name"].as_str(), Some("Gotham2"));
+    assert_eq!(
+        data["gotham.community.devhub.near"]["profile"]["image"]["url"].as_str(),
+        Some("https://example.com/image.png")
+    );
+
+    Ok(())
+}
+
+#[tokio::test]
+async fn test_discussions() -> anyhow::Result<()> {
+    // Initialize the devhub and near social contract on chain,
+    // contract is devhub contract instance.
+    let (contract, worker, near_social) = init_contracts_from_res().await?;
+
+    let deposit_amount = NearToken::from_near(6);
+
+    // Add a community
+    let _ = contract
+        .call("create_community")
+        .args_json(json!({
+            "inputs": {
+                "handle": "gotham",
+                "name": "Gotham",
+                "tag": "some",
+                "description": "This is a test community.",
+                "bio_markdown": "This is a sample text about your community.\nYou can change it on the community configuration page.",
+                "logo_url": "https://ipfs.near.social/ipfs/bafkreibysr2mkwhb4j36h2t7mqwhynqdy4vzjfygfkfg65kuspd2bawauu",
+                "banner_url": "https://ipfs.near.social/ipfs/bafkreic4xgorjt6ha5z4s5e3hscjqrowe5ahd7hlfc5p4hb6kdfp6prgy4"
+            }
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    let community_account = "gotham.community.devhub.near".parse()?;
+    let discussions_account = "discussions.gotham.community.devhub.near".parse()?;
+
+    // assert community account exists
+    let _ = worker.view_account(&community_account).await?;
+    // assert discussions account exists
+    let _ = worker.view_account(&discussions_account).await?;
+
+    // grant write permission to discussions account from a user
+    let user = worker.dev_create_account().await?;
+
+    let deposit_amount = NearToken::from_near(1);
+
+    // user make a post on social.near
+    let create_post = user
+        .call(near_social.id(), "set")
+        .args_json(json!({
+            "data": {
+              user.id().to_string(): {
+                "post": {
+                    "main": "{\"type\":\"md\",\"text\":\"what's up\"}"
+                },
+                "index": {
+                    "post": "{\"key\":\"main\",\"value\":{\"type\":\"md\"}}"
+                }
+            }
+          }
+        }))
+        .deposit(deposit_amount)
+        .max_gas()
+        .transact()
+        .await?;
+
+    assert!(create_post.is_success());
+
+    let get_block_height: serde_json::Value = worker
+        .view(&near_social.id(), "get")
+        .args_json(json!({"keys": [format!("{}/**", user.id())], "options": {
+          "with_block_height": true,
+        }}))
+        .await?
+        .json()?;
+
+    let block_height = get_block_height[user.id().as_str()]["post"][":block"].clone();
+    assert!(block_height.is_number());
+
+    // create discussion as user
+    let repost_discussion = user
+        .call(contract.id(), "create_discussion")
+        .args_json(json!({
+            "handle": "gotham",
+            "block_height": block_height,
+        }))
+        .max_gas()
+        .transact()
+        .await?;
+
+    assert!(repost_discussion.is_success());
+
+    let discussion_data: serde_json::Value = worker
+        .view(&near_social.id(), "get")
+        .args_json(json!({"keys": ["discussions.gotham.community.devhub.near/index/**"]}))
+        .await?
+        .json()?;
+
+    let post_initiator = user.id().to_string();
+    let repost = format!("[{{\"key\":\"main\",\"value\":{{\"type\":\"repost\",\"item\":{{\"type\":\"social\",\"path\":\"{}/post/main\",\"blockHeight\":{}}}}}}},{{\"key\":{{\"type\":\"social\",\"path\":\"{}/post/main\",\"blockHeight\":{}}},\"value\":{{\"type\":\"repost\"}}}}]", post_initiator, block_height, post_initiator, block_height);
+
+    assert_eq!(
+        discussion_data["discussions.gotham.community.devhub.near"]["index"]["repost"].as_str(),
+        Some(repost.as_str())
+    );
+
+    Ok(())
+}
diff --git a/tests/migration.rs b/tests/migration.rs
new file mode 100644
index 0000000..fc33e24
--- /dev/null
+++ b/tests/migration.rs
@@ -0,0 +1,409 @@
+mod test_env;
+
+use near_sdk::NearToken;
+use {crate::test_env::*, serde_json::json};
+
+#[tokio::test]
+async fn test_deploy_contract_self_upgrade() -> anyhow::Result<()> {
+    // Test Flow:
+    // 1. Deploy devhub and near social contract on sandbox
+    // 2. Add all kinds of posts and add a community.
+    // 3. Upgrade the contract.
+    // 4. Get all the posts and community and check if migration was successful.
+
+    // Initialize the devhub and near social contract on chain,
+    // contract is devhub contract instance.
+    let contract = init_contracts_from_mainnet().await?;
+
+    let deposit_amount = NearToken::from_millinear(100);
+
+    // Add Posts
+    let add_idea_post = contract
+        .call("add_post")
+        .args_json(json!({
+            "parent_id": null,
+            "labels": [],
+            "body": {
+                "name": "This is a test idea.",
+                "description": "This is a test description.",
+                "post_type": "Idea",
+                "idea_version": "V1"
+            }
+        }))
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(add_idea_post.is_success());
+
+    let add_solution_v2_post = contract
+        .call("add_post")
+        .args_json(json!({
+            "parent_id": null,
+            "labels": [],
+            "body": {
+                "name": "Solution Test",
+                "description": "This is a test solution post.",
+                "post_type": "Solution",
+                "requested_sponsor": "neardevgov.near",
+                "requested_sponsorship_amount": "1000",
+                "requested_sponsorship_token": "NEAR",
+                "solution_version": "V2"
+            }
+        }))
+        .deposit(deposit_amount)
+        .max_gas()
+        .transact()
+        .await?;
+
+    assert!(add_solution_v2_post.is_success());
+
+    let add_comment_post = contract
+        .call("add_post")
+        .args_json(json!({
+            "parent_id": 0,
+            "labels": [],
+            "body": {
+                "description": "This is test Comment.",
+                "comment_version": "V2",
+                "post_type": "Comment"
+            }
+        }))
+        .deposit(deposit_amount)
+        .max_gas()
+        .transact()
+        .await?;
+
+    assert!(add_comment_post.is_success());
+
+    let add_attestation_post = contract
+        .call("add_post")
+        .args_json(json!({
+            "parent_id": 1,
+            "labels": [],
+            "body": {
+                "name": "Attestation",
+                "description": "Description",
+                "attestation_version": "V1",
+                "post_type": "Attestation"
+            }
+        }))
+        .deposit(deposit_amount)
+        .max_gas()
+        .transact()
+        .await?;
+
+    assert!(add_attestation_post.is_success());
+
+    let add_sponsorship_post_with_near = contract
+        .call("add_post")
+        .args_json(json!({
+            "parent_id": 1,
+            "labels": [],
+            "body": {
+                "name": "Contributor fellowship",
+                "description": "Funding approved",
+                "amount": "1000",
+                "sponsorship_token": "NEAR",
+                "supervisor": "john.near",
+                "sponsorship_version": "V1",
+                "post_type": "Sponsorship"
+            }
+        }))
+        .deposit(deposit_amount)
+        .max_gas()
+        .transact()
+        .await?;
+
+    assert!(add_sponsorship_post_with_near.is_success());
+
+    let add_sponsorship_post_with_usd = contract
+        .call("add_post")
+        .args_json(json!({
+            "parent_id": 1,
+            "labels": [],
+            "body": {
+                "name": "Contributor fellowship",
+                "description": "Funding approved",
+                "amount": "1000",
+                "sponsorship_token": "USD",
+                "supervisor": "john.near",
+                "sponsorship_version": "V1",
+                "post_type": "Sponsorship"
+            }
+        }))
+        .deposit(deposit_amount)
+        .max_gas()
+        .transact()
+        .await?;
+
+    assert!(add_sponsorship_post_with_usd.is_success());
+
+    let add_sponsorship_post_with_nep141 = contract
+        .call("add_post")
+        .args_json(json!({
+            "parent_id": 1,
+            "labels": [],
+            "body": {
+                "name": "Contributor fellowship",
+                "description": "Funding approved",
+                "amount": "1000",
+                "sponsorship_token": {
+                    "NEP141": {
+                        "address": "usdt.tether-token.near"
+                    }
+                },
+                "supervisor": "john.near",
+                "sponsorship_version": "V1",
+                "post_type": "Sponsorship"
+            }
+        }))
+        .deposit(deposit_amount)
+        .max_gas()
+        .transact()
+        .await?;
+
+    assert!(add_sponsorship_post_with_nep141.is_success());
+
+    // Add a community
+    let create_community = contract
+        .call("create_community")
+        .args_json(json!({
+            "inputs": {
+                "handle": "gotham",
+                "name": "Gotham",
+                "tag": "some",
+                "description": "This is a test community.",
+                "bio_markdown": "This is a sample text about your community.\nYou can change it on the community configuration page.",
+                "logo_url": "https://ipfs.near.social/ipfs/bafkreibysr2mkwhb4j36h2t7mqwhynqdy4vzjfygfkfg65kuspd2bawauu",
+                "banner_url": "https://ipfs.near.social/ipfs/bafkreic4xgorjt6ha5z4s5e3hscjqrowe5ahd7hlfc5p4hb6kdfp6prgy4"
+            }
+        }))
+        .deposit(NearToken::from_near(4))
+        .max_gas()
+        .transact()
+        .await?;
+
+    assert!(dbg!(create_community).is_success());
+
+    let _add_proposal = contract
+        .call("add_proposal")
+        .args_json(json!({
+            "body": {
+                "proposal_body_version": "V0",
+                "name": "another post",
+                "description": "some description",
+                "category": "Marketing",
+                "summary": "sum",
+                "linked_proposals": [1, 3],
+                "requested_sponsorship_usd_amount": "1000000000",
+                "requested_sponsorship_paid_in_currency": "USDT",
+                "receiver_account": "polyprogrammist.near",
+                "supervisor": "frol.near",
+                "requested_sponsor": "neardevdao.near",
+                "timeline": {"status": "DRAFT"}
+            },
+            "labels": ["test1", "test2"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    let _edit_proposal_timeline_payment = contract
+        .call("edit_proposal_timeline")
+        .args_json(json!({
+            "id": 0,
+            "timeline": {"status": "PAYMENT_PROCESSING", "kyc_verified": false, "test_transaction_sent": false, "request_for_trustees_created": false, "sponsor_requested_review": true, "reviewer_completed_attestation": false }
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    // Call self upgrade with current branch code
+    // compile the current code
+    let wasm = near_workspaces::compile_project("./").await?;
+
+    let mut contract_upgrade_result =
+        contract.call("unsafe_self_upgrade").args(wasm).max_gas().transact().await?;
+
+    while contract_upgrade_result.json::<String>()? == "needs-migration" {
+        contract_upgrade_result =
+            contract.call("unsafe_migrate").args_json(json!({})).max_gas().transact().await?;
+    }
+
+    let get_idea_post: serde_json::Value = contract
+        .call("get_post")
+        .args_json(json!({
+            "post_id" : 0
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    insta::assert_json_snapshot!(get_idea_post, {".snapshot.timestamp" => "[timestamp]"});
+
+    let get_solution_v2_post: serde_json::Value = contract
+        .call("get_post")
+        .args_json(json!({
+            "post_id" : 1
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    insta::assert_json_snapshot!(get_solution_v2_post, {".snapshot.timestamp" => "[timestamp]"});
+
+    let get_comment_posts: serde_json::Value = contract
+        .call("get_posts")
+        .args_json(json!({
+            "parent_id" : 0
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    insta::assert_json_snapshot!(get_comment_posts, {"[].snapshot.timestamp" => "[timestamp]"});
+
+    let get_attestation_sponsorship_posts: serde_json::Value = contract
+        .call("get_posts")
+        .args_json(json!({
+            "parent_id" : 1
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    insta::assert_json_snapshot!(get_attestation_sponsorship_posts, {"[].snapshot.timestamp" => "[timestamp]"});
+
+    let get_sponsorship_post_with_near: serde_json::Value = contract
+        .call("get_post")
+        .args_json(json!({
+            "post_id" : 4
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    insta::assert_json_snapshot!(get_sponsorship_post_with_near, {".snapshot.timestamp" => "[timestamp]"});
+
+    let get_sponsorship_post_with_usd: serde_json::Value = contract
+        .call("get_post")
+        .args_json(json!({
+            "post_id" : 5
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    insta::assert_json_snapshot!(get_sponsorship_post_with_usd, {".snapshot.timestamp" => "[timestamp]"});
+
+    let get_sponsorship_post_with_nep141: serde_json::Value = contract
+        .call("get_post")
+        .args_json(json!({
+            "post_id" : 6
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    insta::assert_json_snapshot!(get_sponsorship_post_with_nep141, {".snapshot.timestamp" => "[timestamp]"});
+
+    let get_community: serde_json::Value = contract
+        .call("get_community")
+        .args_json(json!({
+            "handle" : "gotham"
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    insta::assert_json_snapshot!(get_community);
+
+    let get_proposal: serde_json::Value = contract
+        .call("get_proposal")
+        .args_json(json!({
+            "proposal_id" : 0
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    insta::assert_json_snapshot!(get_proposal, {".snapshot.timestamp" => "[timestamp]", ".social_db_post_block_height" => "91", ".snapshot_history[0].timestamp" => "[timestamp]"});
+
+    let _set_global_labels = contract
+        .call("set_global_labels")
+        .args_json(json!({
+            "labels": [
+                {
+                    "value": "test1",
+                    "title": "test1 description",
+                    "color": [255, 0, 0]
+                },
+                {
+                    "value": "test2",
+                    "title": "test2 description",
+                    "color": [0, 255, 0]
+                },
+                {
+                    "value": "test3",
+                    "title": "test3 description",
+                    "color": [0, 0, 255]
+                }
+            ]
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    let _add_rfp = contract
+        .call("add_rfp")
+        .args_json(json!({
+            "body": {
+                "rfp_body_version": "V0",
+                "name": "Some RFP",
+                "description": "some description",
+                "summary": "sum",
+                "timeline": {"status": "ACCEPTING_SUBMISSIONS"},
+                "submission_deadline": "1707821848175250170"
+            },
+            "labels": ["test1", "test2"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    println!("_add_rfp: {:?}", _add_rfp);
+
+    let _add_proposal = contract
+        .call("add_proposal")
+        .args_json(json!({
+            "body": {
+                "proposal_body_version": "V0",
+                "name": "another post",
+                "description": "some description",
+                "category": "Marketing",
+                "summary": "sum",
+                "linked_proposals": [1, 3],
+                "requested_sponsorship_usd_amount": "1000000000",
+                "requested_sponsorship_paid_in_currency": "USDT",
+                "receiver_account": "polyprogrammist.near",
+                "supervisor": "frol.near",
+                "requested_sponsor": "neardevdao.near",
+                "timeline": {"status": "DRAFT"}
+            },
+            "labels": ["test1", "test2"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(_add_rfp.is_success());
+    assert!(_add_proposal.is_success());
+
+    Ok(())
+}
diff --git a/tests/proposals.rs b/tests/proposals.rs
new file mode 100644
index 0000000..2349203
--- /dev/null
+++ b/tests/proposals.rs
@@ -0,0 +1,663 @@
+mod test_env;
+
+use near_sdk::NearToken;
+use serde_json::Value;
+use {crate::test_env::*, serde_json::json};
+
+#[tokio::test]
+async fn test_proposal() -> anyhow::Result<()> {
+    // Initialize the devhub and near social contract on chain,
+    // contract is devhub contract instance.
+    let (contract, worker, near_social) = init_contracts_from_res().await?;
+
+    let deposit_amount = NearToken::from_near(2);
+
+    let add_idea_post = contract
+        .call("add_post")
+        .args_json(json!({
+            "parent_id": null,
+            "labels": [],
+            "body": {
+                "name": "This is a test idea.",
+                "description": "This is a test description.",
+                "post_type": "Idea",
+                "idea_version": "V1"
+            }
+        }))
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    println!("add idea post: {:?}", add_idea_post);
+    assert!(add_idea_post.is_success());
+
+
+    let _set_categories = contract
+        .call("set_allowed_categories")
+        .args_json(json!({"new_categories": ["Marketing", "Events"]}))
+        .max_gas()
+        .deposit(NearToken::from_near(1))
+        .transact()
+        .await?;
+
+    let _add_proposal = contract
+        .call("add_proposal")
+        .args_json(json!({
+            "body": {
+                "proposal_body_version": "V0",
+                "name": "another post",
+                "description": "some description",
+                "category": "Marketing",
+                "summary": "sum",
+                "linked_proposals": [1, 3],
+                "requested_sponsorship_usd_amount": "1000000000",
+                "requested_sponsorship_paid_in_currency": "USDT",
+                "receiver_account": "polyprogrammist.near",
+                "supervisor": "frol.near",
+                "requested_sponsor": "neardevdao.near",
+                "timeline": {"status": "DRAFT"}
+            },
+            "labels": ["test1", "test2"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    let get_proposal: serde_json::Value = contract
+        .call("get_proposal")
+        .args_json(json!({
+            "proposal_id" : 0
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    assert_eq!(get_proposal["snapshot"]["category"], "Marketing");
+
+    let social_db_post_block_height: u64 =
+        get_proposal["social_db_post_block_height"].as_str().unwrap().parse::<u64>()?;
+    assert!(social_db_post_block_height > 0);
+
+    let first_proposal_social_post = String::from_utf8(
+        near_social
+            .call("get")
+            .args_json(json!({"keys": [format!("{}/post/main", contract.id())]}))
+            .view()
+            .await?
+            .result,
+    )
+    .unwrap();
+
+    assert_eq!(first_proposal_social_post, "{\"devhub.near\":{\"post\":{\"main\":\"{\\\"type\\\":\\\"md\\\",\\\"text\\\":\\\"We have just received a new *Marketing* proposal.\\\\n\\\\n———\\\\n\\\\n**By**: @devhub.near\\\\n\\\\n**Title**: “another post“\\\\n\\\\n**Summary**:\\\\n\\\\nsum\\\\n\\\\n———\\\\n\\\\nRead the full proposal and share your feedback on [DevHub](/devhub.near/widget/app?page=proposal&id=0)\\\"}\"}}}");
+    let _edit_proposal_category = contract
+        .call("edit_proposal")
+        .args_json(json!({
+            "id": 0,
+            "body": {
+                "proposal_body_version": "V0",
+                "name": "another post",
+                "description": "some description",
+                "category": "Events",
+                "summary": "sum",
+                "linked_proposals": [1, 3],
+                "requested_sponsorship_usd_amount": "1000000000",
+                "requested_sponsorship_paid_in_currency": "USDT",
+                "receiver_account": "polyprogrammist.near",
+                "supervisor": "frol.near",
+                "requested_sponsor": "neardevdao.near",
+                "timeline": {"status": "REVIEW", "sponsor_requested_review": true, "reviewer_completed_attestation": false }
+            },
+            "labels": ["test1", "test2"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    let get_proposal_with_new_category: serde_json::Value = contract
+        .call("get_proposal")
+        .args_json(json!({
+            "proposal_id" : 0
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    assert_eq!(get_proposal_with_new_category["snapshot"]["category"], "Events");
+
+    let _add_second_proposal = contract
+        .call("add_proposal")
+        .args_json(json!({
+            "body": {
+                "proposal_body_version": "V0",
+                "name": "One more",
+                "description": "some description",
+                "category": "Events",
+                "summary": "sum",
+                "linked_proposals": [],
+                "requested_sponsorship_usd_amount": "200",
+                "requested_sponsorship_paid_in_currency": "NEAR",
+                "receiver_account": "polyprogrammist.near",
+                "supervisor": "frol.near",
+                "requested_sponsor": "neardevdao.near",
+                "timeline": {"status": "DRAFT"}
+            },
+            "labels": ["test3"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    let get_proposals =
+        contract.call("get_proposals").args_json(json!({})).view().await?.json::<Value>()?;
+
+    let proposals_array = get_proposals.as_array().unwrap();
+
+    assert_eq!(proposals_array.len(), 2);
+    assert_eq!(proposals_array.get(1).unwrap()["snapshot"]["name"], "One more");
+
+    let get_proposal_ids =
+        contract.call("get_all_proposal_ids").args_json(json!({})).view().await?.json::<Value>()?;
+
+    let proposal_ids = get_proposal_ids
+        .as_array()
+        .unwrap()
+        .iter()
+        .map(|x| x.clone().as_u64().unwrap())
+        .collect::<Vec<_>>();
+
+    let expected_ids: Vec<u64> = [0u64, 1u64].to_vec();
+
+    assert_eq!(proposal_ids, expected_ids);
+
+    let second_account = worker
+        .root_account()?
+        .create_subaccount("second")
+        .initial_balance(NearToken::from_near(20))
+        .transact()
+        .await?
+        .into_result()?;
+
+    let _second_author_add_proposal = second_account
+        .call(contract.id(), "add_proposal")
+        .args_json(json!({
+            "body": {
+                "proposal_body_version": "V0",
+                "name": "another author",
+                "description": "some description",
+                "category": "Events",
+                "summary": "sum",
+                "linked_proposals": [1, 3],
+                "requested_sponsorship_usd_amount": "1000000000",
+                "requested_sponsorship_paid_in_currency": "USDT",
+                "receiver_account": "polyprogrammist.near",
+                "supervisor": "frol.near",
+                "requested_sponsor": "neardevdao.near",
+                "timeline": {"status": "DRAFT"}
+            },
+            "labels": ["test2", "test3"],
+        }))
+        .max_gas()
+        .deposit(NearToken::from_near(1))
+        .transact()
+        .await?;
+
+    let second_proposal_social_post = String::from_utf8(
+        near_social
+            .call("get")
+            .args_json(json!({"keys": [format!("{}/post/main", contract.id())]}))
+            .view()
+            .await?
+            .result,
+    )
+    .unwrap();
+
+    assert_eq!(second_proposal_social_post, "{\"devhub.near\":{\"post\":{\"main\":\"{\\\"type\\\":\\\"md\\\",\\\"text\\\":\\\"We have just received a new *Events* proposal.\\\\n\\\\n———\\\\n\\\\n**By**: @second.test.near\\\\n\\\\n**Title**: “another author“\\\\n\\\\n**Summary**:\\\\n\\\\nsum\\\\n\\\\n———\\\\n\\\\nRead the full proposal and share your feedback on [DevHub](/devhub.near/widget/app?page=proposal&id=2)\\\"}\"}}}");
+
+    let get_second_author_proposal: serde_json::Value = contract
+        .call("get_proposal")
+        .args_json(json!({
+            "proposal_id" : 2
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    assert_eq!(get_second_author_proposal["author_id"], "second.test.near");
+
+    let get_proposals_by_author = contract
+        .call("get_proposals_by_author")
+        .args_json(json!({
+            "author": "devhub.near"
+        }))
+        .view()
+        .await?
+        .json::<Value>()?;
+
+    let proposals_array = get_proposals_by_author.as_array().unwrap();
+
+    assert_eq!(proposals_array.len(), 2);
+
+    let get_proposals_by_label = contract
+        .call("get_proposals_by_label")
+        .args_json(json!({
+            "label": "test2"
+        }))
+        .view()
+        .await?
+        .json::<Value>()?;
+
+    let proposal_ids_by_label = get_proposals_by_label
+        .as_array()
+        .unwrap()
+        .iter()
+        .map(|x| x.as_u64().unwrap())
+        .collect::<Vec<_>>();
+
+    let expected_ids: Vec<u64> = [0u64, 2u64].to_vec();
+    assert_eq!(proposal_ids_by_label, expected_ids);
+
+    let get_all_proposal_labels = contract
+        .call("get_all_proposal_labels")
+        .args_json(json!({}))
+        .view()
+        .await?
+        .json::<Value>()?;
+
+    let proposal_labels = get_all_proposal_labels
+        .as_array()
+        .unwrap()
+        .iter()
+        .map(|x| x.as_str().unwrap())
+        .collect::<Vec<_>>();
+
+    let expected_labels: Vec<&str> = ["test1", "test2", "test3"].to_vec();
+    assert_eq!(proposal_labels, expected_labels);
+
+    let get_all_proposal_authors = contract
+        .call("get_all_proposal_authors")
+        .args_json(json!({}))
+        .view()
+        .await?
+        .json::<Value>()?;
+
+    let proposal_authors = get_all_proposal_authors
+        .as_array()
+        .unwrap()
+        .iter()
+        .map(|x| x.as_str().unwrap())
+        .collect::<Vec<_>>();
+
+    let expected_authors: Vec<&str> = ["devhub.near", "second.test.near"].to_vec();
+    assert_eq!(proposal_authors, expected_authors);
+
+    let is_allowed_to_edit_proposal_false = contract
+        .call("is_allowed_to_edit_proposal")
+        .args_json(json!({
+            "proposal_id": 0,
+            "editor": "second.test.near"
+        }))
+        .view()
+        .await?
+        .json::<Value>()?;
+
+    assert!(!is_allowed_to_edit_proposal_false.as_bool().unwrap());
+
+    let is_allowed_to_edit_proposal_true = contract
+        .call("is_allowed_to_edit_proposal")
+        .args_json(json!({
+            "proposal_id": 0,
+            "editor": "devhub.near"
+        }))
+        .view()
+        .await?
+        .json::<Value>()?;
+
+    assert!(is_allowed_to_edit_proposal_true.as_bool().unwrap());
+
+    let get_all_allowed_proposal_labels = contract
+        .call("get_all_allowed_proposal_labels")
+        .args_json(json!({
+            "editor": "devhub.near"
+        }))
+        .view()
+        .await?
+        .json::<Value>()?;
+
+    let allowed_proposal_labels = get_all_allowed_proposal_labels
+        .as_array()
+        .unwrap()
+        .iter()
+        .map(|x| x.as_str().unwrap())
+        .collect::<Vec<_>>();
+
+    let expected_labels: Vec<&str> = ["test1", "test2", "test3"].to_vec();
+    assert_eq!(allowed_proposal_labels, expected_labels);
+
+    let add_proposal_incorrect_timeline_status = contract
+        .call("add_proposal")
+        .args_json(json!({
+            "body": {
+                "proposal_body_version": "V0",
+                "name": "another post",
+                "description": "some description",
+                "category": "Events",
+                "summary": "sum",
+                "linked_proposals": [],
+                "requested_sponsorship_usd_amount": "1000000000",
+                "requested_sponsorship_paid_in_currency": "USDT",
+                "receiver_account": "polyprogrammist.near",
+                "requested_sponsor": "neardevdao.near",
+                "timeline": {"status": "REVIEW", "sponsor_requested_review": true, "reviewer_completed_attestation": false }
+            },
+            "labels": ["test1", "test2"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+    assert!(add_proposal_incorrect_timeline_status.is_failure());
+
+    let edit_proposal_incorrect_timeline_status = second_account.call(contract.id(), "edit_proposal")
+        .args_json(json!({
+            "id": 2,
+            "body": {
+                "proposal_body_version": "V0",
+                "name": "another post",
+                "description": "some description",
+                "category": "Events",
+                "summary": "sum",
+                "linked_proposals": [1, 3],
+                "requested_sponsorship_usd_amount": "1000000000",
+                "requested_sponsorship_paid_in_currency": "USDT",
+                "receiver_account": "polyprogrammist.near",
+                "supervisor": "frol.near",
+                "requested_sponsor": "neardevdao.near",
+                "timeline": {"status": "REVIEW", "sponsor_requested_review": true, "reviewer_completed_attestation": false }
+            },
+            "labels": ["test1", "test2"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(edit_proposal_incorrect_timeline_status.is_failure());
+
+    let edit_proposal_to_review = second_account.call(contract.id(), "edit_proposal")
+        .args_json(json!({
+            "id": 2,
+            "body": {
+                "proposal_body_version": "V0",
+                "name": "another post",
+                "description": "some description",
+                "category": "Events",
+                "summary": "sum",
+                "linked_proposals": [1, 3],
+                "requested_sponsorship_usd_amount": "1000000000",
+                "requested_sponsorship_paid_in_currency": "USDT",
+                "receiver_account": "polyprogrammist.near",
+                "supervisor": "frol.near",
+                "requested_sponsor": "neardevdao.near",
+                "timeline": {"status": "REVIEW", "sponsor_requested_review": false, "reviewer_completed_attestation": false }
+            },
+            "labels": ["test1", "test2"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(edit_proposal_to_review.is_success());
+
+    let edit_proposal_to_cancelled: near_workspaces::result::ExecutionFinalResult = second_account.call(contract.id(), "edit_proposal")
+        .args_json(json!({
+            "id": 2,
+            "body": {
+                "proposal_body_version": "V0",
+                "name": "another post",
+                "description": "some description",
+                "category": "Events",
+                "summary": "sum",
+                "linked_proposals": [1, 3],
+                "requested_sponsorship_usd_amount": "1000000000",
+                "requested_sponsorship_paid_in_currency": "USDT",
+                "receiver_account": "polyprogrammist.near",
+                "supervisor": "frol.near",
+                "requested_sponsor": "neardevdao.near",
+                "timeline": {"status": "CANCELLED", "sponsor_requested_review": false, "reviewer_completed_attestation": false }
+            },
+            "labels": ["test1", "test2"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(edit_proposal_to_cancelled.is_success());
+
+    let set_categories_not_allowed = second_account
+        .call(contract.id(), "set_allowed_categories")
+        .args_json(json!({"new_categories": ["One", "Two"]}))
+        .max_gas()
+        .deposit(NearToken::from_near(1))
+        .transact()
+        .await?;
+
+    assert!(set_categories_not_allowed.is_failure());
+
+    let _set_categories = contract
+        .call("set_allowed_categories")
+        .args_json(json!({"new_categories": ["Two", "Three"]}))
+        .max_gas()
+        .deposit(NearToken::from_near(1))
+        .transact()
+        .await?;
+
+    let get_categories: serde_json::Value =
+        contract.call("get_allowed_categories").args_json(json!({})).view().await?.json()?;
+
+    let categories: Vec<String> = get_categories
+        .as_array()
+        .unwrap()
+        .iter()
+        .map(|x| String::from(x.clone().as_str().unwrap()))
+        .collect::<Vec<_>>();
+
+    assert_eq!(categories, vec!["Two", "Three"]);
+
+    let edit_proposal_incorrect_category = contract
+        .call("edit_proposal")
+        .args_json(json!({
+            "id": 0,
+            "body": {
+                "proposal_body_version": "V0",
+                "name": "another post",
+                "description": "some description",
+                "category": "bad cat",
+                "summary": "sum",
+                "linked_proposals": [1, 3],
+                "requested_sponsorship_usd_amount": "1000000000",
+                "requested_sponsorship_paid_in_currency": "USDT",
+                "receiver_account": "polyprogrammist.near",
+                "supervisor": "frol.near",
+                "requested_sponsor": "neardevdao.near",
+                "timeline": {"status": "REVIEW", "sponsor_requested_review": true, "reviewer_completed_attestation": false }
+            },
+            "labels": ["test1", "test2"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(edit_proposal_incorrect_category.is_failure());
+
+    let _edit_proposal_timeline_approved = contract
+        .call("edit_proposal")
+        .args_json(json!({
+            "id": 0,
+            "body": {
+                "proposal_body_version": "V0",
+                "name": "another post",
+                "description": "some description",
+                "category": "Three",
+                "summary": "sum",
+                "linked_proposals": [1, 3],
+                "requested_sponsorship_usd_amount": "1000000000",
+                "requested_sponsorship_paid_in_currency": "USDT",
+                "receiver_account": "polyprogrammist.near",
+                "supervisor": "frol.near",
+                "requested_sponsor": "neardevdao.near",
+                "timeline": {"status": "APPROVED", "sponsor_requested_review": true, "reviewer_completed_attestation": false }
+            },
+            "labels": ["test1", "test2"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(_edit_proposal_timeline_approved.is_success());
+
+    let edit_proposal_to_cancelled_incorrect: near_workspaces::result::ExecutionFinalResult = second_account.call(contract.id(), "edit_proposal")
+        .args_json(json!({
+            "id": 2,
+            "body": {
+                "proposal_body_version": "V0",
+                "name": "another post",
+                "description": "some description",
+                "category": "Events",
+                "summary": "sum",
+                "linked_proposals": [1, 3],
+                "requested_sponsorship_usd_amount": "1000000000",
+                "requested_sponsorship_paid_in_currency": "USDT",
+                "receiver_account": "polyprogrammist.near",
+                "supervisor": "frol.near",
+                "requested_sponsor": "neardevdao.near",
+                "timeline": {"status": "CANCELLED", "sponsor_requested_review": false, "reviewer_completed_attestation": false }
+            },
+            "labels": ["test1", "test2"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(edit_proposal_to_cancelled_incorrect.is_failure());
+
+    let _edit_proposal_timeline_rejected = contract
+        .call("edit_proposal_timeline")
+        .args_json(json!({
+            "id": 0,
+            "timeline": {"status": "REJECTED", "sponsor_requested_review": true, "reviewer_completed_attestation": false }
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(_edit_proposal_timeline_rejected.is_success());
+
+    let _edit_proposal_timeline_conditionally = contract
+        .call("edit_proposal_timeline")
+        .args_json(json!({
+            "id": 0,
+            "timeline": {"status": "APPROVED_CONDITIONALLY", "sponsor_requested_review": true, "reviewer_completed_attestation": false }
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(_edit_proposal_timeline_conditionally.is_success());
+
+    let _edit_proposal_timeline_payment = contract
+        .call("edit_proposal_timeline")
+        .args_json(json!({
+            "id": 0,
+            "timeline": {"status": "PAYMENT_PROCESSING", "kyc_verified": false, "test_transaction_sent": false, "request_for_trustees_created": false, "sponsor_requested_review": true, "reviewer_completed_attestation": false }
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(_edit_proposal_timeline_payment.is_success());
+
+    let _edit_proposal_timeline_funded = contract
+        .call("edit_proposal_timeline")
+        .args_json(json!({
+            "id": 0,
+            "timeline": {"status": "FUNDED", "trustees_released_payment": false, "kyc_verified": false, "test_transaction_sent": false, "request_for_trustees_created": false, "sponsor_requested_review": true, "reviewer_completed_attestation": false, "payouts": [ "https://nearblocks.io/txns/6UwrzrYqBhA3ft2mDHXtvpzEFwkWhvCauJS1FGKjG37p" ] }
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(_edit_proposal_timeline_funded.is_success());
+
+    let get_proposal: serde_json::Value = contract
+        .call("get_proposal")
+        .args_json(json!({
+            "proposal_id" : 0
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    assert_eq!(get_proposal["snapshot"]["timeline"]["status"], "FUNDED");
+
+    let _add_team = contract
+        .call("add_member")
+        .args_json(json!({
+            "member": "team:moderators",
+            "metadata": {
+                "member_metadata_version": "V0",
+                "children": [],
+                "description": "moderators",
+                "parents": [],
+                "permissions": {
+                    "*": ["use-labels", "edit-post"]
+                }
+            }
+        }))
+        .max_gas()
+        .deposit(NearToken::from_near(0))
+        .transact()
+        .await?;
+
+    let _add_member = contract
+        .call("add_member")
+        .args_json(json!({
+            "member": "second.test.near",
+            "metadata": {
+                "member_metadata_version": "V0",
+                "children": [],
+                "description": "One of the moderators",
+                "parents": ["team:moderators"],
+                "permissions": {}
+            }
+        }))
+        .max_gas()
+        .deposit(NearToken::from_near(0))
+        .transact()
+        .await?;
+
+    let is_allowed_to_edit_proposal_again = contract
+        .call("is_allowed_to_edit_proposal")
+        .args_json(json!({
+            "proposal_id": 0,
+            "editor": "second.test.near"
+        }))
+        .view()
+        .await?
+        .json::<Value>()?;
+
+    assert!(is_allowed_to_edit_proposal_again.as_bool().unwrap());
+
+    Ok(())
+}
diff --git a/tests/rfps.rs b/tests/rfps.rs
new file mode 100644
index 0000000..a6435ad
--- /dev/null
+++ b/tests/rfps.rs
@@ -0,0 +1,515 @@
+mod test_env;
+
+use near_sdk::NearToken;
+use serde_json::Value;
+use {crate::test_env::*, serde_json::json};
+
+#[tokio::test]
+async fn test_rfp() -> anyhow::Result<()> {
+    // Initialize the devhub and near social contract on chain,
+    // contract is devhub contract instance.
+    let (contract, worker, _) = init_contracts_from_res().await?;
+
+    let deposit_amount = NearToken::from_near(2);
+
+    let _set_global_labels = contract
+        .call("set_global_labels")
+        .args_json(json!({
+            "labels": [
+                {
+                    "value": "test1",
+                    "title": "test1 description",
+                    "color": [255, 0, 0]
+                },
+                {
+                    "value": "test2",
+                    "title": "test2 description",
+                    "color": [0, 255, 0]
+                },
+                {
+                    "value": "test3",
+                    "title": "test3 description",
+                    "color": [0, 0, 255]
+                }
+            ]
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    let _add_rfp = contract
+        .call("add_rfp")
+        .args_json(json!({
+            "body": {
+                "rfp_body_version": "V0",
+                "name": "Some RFP",
+                "description": "some description",
+                "summary": "sum",
+                "timeline": {"status": "ACCEPTING_SUBMISSIONS"},
+                "submission_deadline": "1707821848175250170"
+            },
+            "labels": ["test1", "test2"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    let get_rfp: serde_json::Value = contract
+        .call("get_rfp")
+        .args_json(json!({
+            "rfp_id" : 0
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    assert_eq!(get_rfp["snapshot"]["summary"], "sum");
+
+    let social_db_post_block_height: u64 =
+        get_rfp["social_db_post_block_height"].as_str().unwrap().parse::<u64>()?;
+    assert!(social_db_post_block_height > 0);
+
+    let _edit_rfp = contract
+        .call("edit_rfp")
+        .args_json(json!({
+            "id": 0,
+            "body": {
+                "rfp_body_version": "V0",
+                "name": "Some RFP",
+                "description": "another description",
+                "category": "Events",
+                "summary": "sum",
+                "timeline": {"status": "ACCEPTING_SUBMISSIONS"},
+                "submission_deadline": "1707821848175250170"
+            },
+            "labels": ["test1", "test2"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    let get_edited_rfp: serde_json::Value = contract
+        .call("get_rfp")
+        .args_json(json!({
+            "rfp_id" : 0
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    assert_eq!(get_edited_rfp["snapshot"]["description"], "another description");
+
+    let _add_second_rfp = contract
+        .call("add_rfp")
+        .args_json(json!({
+            "body": {
+                "rfp_body_version": "V0",
+                "name": "Another RFP",
+                "description": "another description",
+                "category": "Events",
+                "summary": "sum",
+                "timeline": {"status": "ACCEPTING_SUBMISSIONS"},
+                "submission_deadline": "1707821848175250170"
+            },
+            "labels": ["test3"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    let get_rfps = contract.call("get_rfps").args_json(json!({})).view().await?.json::<Value>()?;
+
+    let rfps_array = get_rfps.as_array().unwrap();
+
+    assert_eq!(rfps_array.len(), 2);
+    assert_eq!(rfps_array.get(1).unwrap()["snapshot"]["name"], "Another RFP");
+
+    let get_rfp_ids =
+        contract.call("get_all_rfp_ids").args_json(json!({})).view().await?.json::<Value>()?;
+
+    let rfp_ids = get_rfp_ids
+        .as_array()
+        .unwrap()
+        .iter()
+        .map(|x| x.clone().as_u64().unwrap())
+        .collect::<Vec<_>>();
+
+    let expected_ids: Vec<u64> = [0u64, 1u64].to_vec();
+
+    assert_eq!(rfp_ids, expected_ids);
+
+    let second_account = worker
+        .root_account()?
+        .create_subaccount("second")
+        .initial_balance(NearToken::from_near(20))
+        .transact()
+        .await?
+        .into_result()?;
+
+    let _second_author_add_rfp = second_account
+        .call(contract.id(), "add_rfp")
+        .args_json(json!({
+            "body": {
+                "rfp_body_version": "V0",
+                "name": "Another Author",
+                "description": "another description",
+                "category": "Events",
+                "summary": "sum",
+                "timeline": {"status": "ACCEPTING_SUBMISSIONS"},
+                "submission_deadline": "1707821848175250170"
+            },
+            "labels": ["test2", "test3"],
+        }))
+        .max_gas()
+        .deposit(NearToken::from_near(1))
+        .transact()
+        .await?;
+
+    assert!(_second_author_add_rfp.is_failure());
+
+    let get_rfps_by_label = contract
+        .call("get_rfps_by_label")
+        .args_json(json!({
+            "label": "test2"
+        }))
+        .view()
+        .await?
+        .json::<Value>()?;
+
+    let rfp_ids_by_label = get_rfps_by_label
+        .as_array()
+        .unwrap()
+        .iter()
+        .map(|x| x.as_u64().unwrap())
+        .collect::<Vec<_>>();
+
+    let expected_ids: Vec<u64> = [0u64].to_vec();
+    assert_eq!(rfp_ids_by_label, expected_ids);
+
+    let is_allowed_to_edit_rfp_false = contract
+        .call("is_allowed_to_write_rfps")
+        .args_json(json!({
+            "rfp_id": 0,
+            "editor": "second.test.near"
+        }))
+        .view()
+        .await?
+        .json::<Value>()?;
+
+    assert!(!is_allowed_to_edit_rfp_false.as_bool().unwrap());
+
+    let is_allowed_to_edit_rfp_true = contract
+        .call("is_allowed_to_write_rfps")
+        .args_json(json!({
+            "rfp_id": 0,
+            "editor": "devhub.near"
+        }))
+        .view()
+        .await?
+        .json::<Value>()?;
+
+    assert!(is_allowed_to_edit_rfp_true.as_bool().unwrap());
+
+    let _add_rfp_incorrect_label = contract
+        .call("add_rfp")
+        .args_json(json!({
+            "body": {
+                "rfp_body_version": "V0",
+                "name": "Some RFP",
+                "description": "some description",
+                "summary": "sum",
+                "timeline": {"status": "ACCEPTING_SUBMISSIONS"},
+                "submission_deadline": "1707821848175250170"
+            },
+            "labels": ["test4"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(_add_rfp_incorrect_label.is_failure());
+
+    let _add_rfp_proposal = second_account
+        .call(contract.id(), "add_proposal")
+        .args_json(json!({
+            "body": {
+                "proposal_body_version": "V0",
+                "name": "RFP-proposal",
+                "description": "some description",
+                "category": "Marketing",
+                "summary": "sum",
+                "linked_proposals": [1, 3],
+                "requested_sponsorship_usd_amount": "1000000000",
+                "requested_sponsorship_paid_in_currency": "USDT",
+                "receiver_account": "polyprogrammist.near",
+                "supervisor": "frol.near",
+                "requested_sponsor": "neardevdao.near",
+                "timeline": {"status": "DRAFT"},
+            },
+            "labels": ["test1"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    let _edit_proposal_linked_rfp_incorrect = contract
+        .call("edit_proposal_linked_rfp")
+        .args_json(json!({
+            "id": 0,
+            "rfp_id": 2,
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(_edit_proposal_linked_rfp_incorrect.is_failure());
+
+    let _edit_proposal_linked_rfp = second_account
+        .call(contract.id(), "edit_proposal_linked_rfp")
+        .args_json(json!({
+            "id": 0,
+            "rfp_id": 0,
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    let get_proposal: serde_json::Value = contract
+        .call("get_proposal")
+        .args_json(json!({
+            "proposal_id" : 0
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    let proposal_labels = get_proposal["snapshot"]["labels"]
+        .as_array()
+        .unwrap()
+        .iter()
+        .map(|x| x.as_str().unwrap())
+        .collect::<Vec<_>>();
+
+    let expected_labels: Vec<&str> = ["test1", "test2"].to_vec();
+    assert_eq!(proposal_labels, expected_labels);
+
+    assert_eq!(get_proposal["snapshot"]["linked_rfp"], 0);
+
+    let _edit_rfp_labels = contract
+        .call("edit_rfp")
+        .args_json(json!({
+            "id": 0,
+            "body": {
+                "rfp_body_version": "V0",
+                "name": "Some RFP",
+                "description": "some description",
+                "summary": "sum",
+                "timeline": {"status": "ACCEPTING_SUBMISSIONS"},
+                "submission_deadline": "1707821848175250170"
+            },
+            "labels": ["test2", "test3"],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    let get_proposal: serde_json::Value = contract
+        .call("get_proposal")
+        .args_json(json!({
+            "proposal_id" : 0
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    let proposal_labels = get_proposal["snapshot"]["labels"]
+        .as_array()
+        .unwrap()
+        .iter()
+        .map(|x| x.as_str().unwrap())
+        .collect::<Vec<_>>();
+
+    let expected_labels: Vec<&str> = ["test3", "test2"].to_vec();
+    assert_eq!(proposal_labels, expected_labels);
+
+    let edit_proposal = contract
+        .call("edit_proposal")
+        .args_json(json!({
+            "id": 0,
+            "body": {
+                "proposal_body_version": "V1",
+                "name": "RFP-proposal",
+                "description": "some description",
+                "category": "Marketing",
+                "summary": "sum",
+                "linked_proposals": [1, 3],
+                "requested_sponsorship_usd_amount": "1000000000",
+                "requested_sponsorship_paid_in_currency": "USDT",
+                "receiver_account": "polyprogrammist.near",
+                "supervisor": "frol.near",
+                "requested_sponsor": "neardevdao.near",
+                "timeline": {"status": "DRAFT"},
+                "linked_rfp": 0,
+            },
+            "labels": [],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    println!("edit_proposal: {:?}", edit_proposal);
+
+    assert!(edit_proposal.is_success());
+
+    let get_proposal: serde_json::Value = contract
+        .call("get_proposal")
+        .args_json(json!({
+            "proposal_id" : 0
+        }))
+        .view()
+        .await?
+        .json()?;
+
+    let proposal_labels = get_proposal["snapshot"]["labels"]
+        .as_array()
+        .unwrap()
+        .iter()
+        .map(|x| x.as_str().unwrap())
+        .collect::<Vec<_>>();
+
+    let expected_labels: Vec<&str> = ["test3", "test2"].to_vec();
+    assert_eq!(proposal_labels, expected_labels);
+
+    let _edit_rfp_timeline_evaluation = contract
+        .call("edit_rfp_timeline")
+        .args_json(json!({
+            "id": 0,
+            "timeline": {"status": "EVALUATION" }
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(_edit_rfp_timeline_evaluation.is_success());
+
+    let _edit_rfp_timeline_proposal_selected = contract
+        .call("edit_rfp_timeline")
+        .args_json(json!({
+            "id": 0,
+            "timeline": {"status": "PROPOSAL_SELECTED" }
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(_edit_rfp_timeline_proposal_selected.is_failure());
+
+    let _approve_proposal = contract
+        .call("edit_proposal_timeline")
+        .args_json(json!({
+            "id": 0,
+            "timeline": {"status": "APPROVED", "sponsor_requested_review": true, "reviewer_completed_attestation": false }
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    let _edit_rfp_timeline_proposal_selected = contract
+        .call("edit_rfp_timeline")
+        .args_json(json!({
+            "id": 0,
+            "timeline": {"status": "PROPOSAL_SELECTED" }
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(_edit_rfp_timeline_proposal_selected.is_success());
+
+    let _edit_rfp_timeline_accepting_submissions = contract
+        .call("edit_rfp_timeline")
+        .args_json(json!({
+            "id": 0,
+            "timeline": {"status": "ACCEPTING_SUBMISSIONS" }
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    let _edit_proposal_unlink_rfp = contract
+        .call("edit_proposal_linked_rfp")
+        .args_json(json!({
+            "id": 0,
+            "rfp_id": 1,
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    let _edit_rfp_timeline_cancelled = contract
+        .call("edit_rfp_timeline")
+        .args_json(json!({
+            "id": 0,
+            "timeline": {"status": "CANCELLED" }
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(_edit_rfp_timeline_cancelled.is_success());
+
+    let _edit_proposal_linked_rfp_incorrect_unlink = second_account
+        .call(contract.id(), "edit_proposal_linked_rfp")
+        .args_json(json!({
+            "id": 0,
+            "rfp_id": 1,
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    assert!(_edit_proposal_linked_rfp_incorrect_unlink.is_failure());
+
+    let get_global_labels =
+        contract.call("get_global_labels").args_json(json!({})).view().await?.json::<Value>()?;
+
+    let labels_array = get_global_labels.as_array().unwrap();
+
+    assert_eq!(labels_array.len(), 3);
+
+    let _cancel_rfp = contract
+        .call("cancel_rfp")
+        .args_json(json!({
+            "id": 0,
+            "proposals_to_cancel": [0],
+            "proposals_to_unlink": [],
+        }))
+        .max_gas()
+        .deposit(deposit_amount)
+        .transact()
+        .await?;
+
+    println!("_cancel_rfp: {:?}", _cancel_rfp);
+
+    assert!(_cancel_rfp.is_success());
+
+    Ok(())
+}
diff --git a/tests/test_env.rs b/tests/test_env.rs
new file mode 100644
index 0000000..2d19c68
--- /dev/null
+++ b/tests/test_env.rs
@@ -0,0 +1,112 @@
+use near_sdk::{AccountIdRef, NearToken};
+use near_workspaces::network::Sandbox;
+use near_workspaces::types::{AccessKey, KeyType, SecretKey};
+use near_workspaces::{Account, Worker};
+
+use serde_json::json;
+
+const DEVHUB_CONTRACT_PREFIX: &str = "devhub";
+const DEVHUB_CONTRACT: &AccountIdRef = AccountIdRef::new_or_panic("devhub.near");
+const DEVHUB_COMMUNITY_CONTRACT: &AccountIdRef =
+    AccountIdRef::new_or_panic("community.devhub.near");
+const COMMUNITY_FACTORY_PREFIX: &str = "community";
+const NEAR_SOCIAL: &AccountIdRef = AccountIdRef::new_or_panic("social.near");
+const _TEST_NEAR_SOCIAL: &AccountIdRef = AccountIdRef::new_or_panic("v1.social08.testnet");
+const TEST_SEED: &str = "testificate";
+const DEVHUB_CONTRACT_PATH: &str = "./target/near/devhub.wasm";
+const COMMUNITY_FACTORY_CONTRACT_PATH: &str =
+    "./community-factory/target/near/devhub_community_factory.wasm";
+
+#[allow(dead_code)]
+pub async fn init_contracts_from_mainnet() -> anyhow::Result<near_workspaces::Contract> {
+    let worker = near_workspaces::sandbox().await?;
+    let mainnet = near_workspaces::mainnet_archival().await?;
+
+    // NEAR social deployment
+    let near_social = worker
+        .import_contract(&NEAR_SOCIAL.to_owned(), &mainnet)
+        .initial_balance(NearToken::from_near(10000))
+        .transact()
+        .await?;
+    near_social.call("new").transact().await?.into_result()?;
+    near_social
+        .call("set_status")
+        .args_json(json!({
+            "status": "Live"
+        }))
+        .transact()
+        .await?
+        .into_result()?;
+
+    // Devhub contract deployment
+    let devhub_contract = worker
+        .import_contract(&DEVHUB_CONTRACT.to_owned(), &mainnet)
+        .initial_balance(NearToken::from_near(1000))
+        .transact()
+        .await?;
+    let outcome = devhub_contract.call("new").args_json(json!({})).transact().await?;
+    assert!(outcome.is_success());
+    assert!(format!("{:?}", outcome).contains("Migrated to version:"));
+
+    // Devhub Community contract deployment
+    worker
+        .import_contract(&DEVHUB_COMMUNITY_CONTRACT.to_owned(), &mainnet)
+        .initial_balance(NearToken::from_near(10))
+        .transact()
+        .await?;
+
+    Ok(devhub_contract)
+}
+
+#[allow(dead_code)]
+pub async fn init_contracts_from_res(
+) -> anyhow::Result<(near_workspaces::Contract, Worker<Sandbox>, near_workspaces::Contract)> {
+    let worker: Worker<Sandbox> = near_workspaces::sandbox().await?;
+    let mainnet = near_workspaces::mainnet_archival().await?;
+
+    // NEAR social deployment
+    let near_social = worker
+        .import_contract(&NEAR_SOCIAL.to_owned(), &mainnet)
+        .initial_balance(NearToken::from_near(10000))
+        .transact()
+        .await?;
+    near_social.call("new").transact().await?.into_result()?;
+    near_social
+        .call("set_status")
+        .args_json(json!({
+            "status": "Live"
+        }))
+        .transact()
+        .await?
+        .into_result()?;
+
+    let contract_wasm = std::fs::read(DEVHUB_CONTRACT_PATH)?;
+    let sk = SecretKey::from_seed(KeyType::ED25519, TEST_SEED);
+
+    let _test_near = worker.root_account()?;
+    let tla_near = Account::from_secret_key("near".parse()?, sk.clone(), &worker);
+    worker
+        .patch(tla_near.id())
+        .access_key(sk.public_key(), AccessKey::full_access())
+        .transact()
+        .await?;
+    let contract_account = tla_near
+        .create_subaccount(DEVHUB_CONTRACT_PREFIX)
+        .initial_balance(NearToken::from_near(100))
+        .transact()
+        .await?
+        .into_result()?;
+    let contract = contract_account.deploy(&contract_wasm).await?.into_result()?;
+    let _outcome = contract.call("new").args_json(json!({})).transact().await?;
+
+    let community_factory_account = contract_account
+        .create_subaccount(COMMUNITY_FACTORY_PREFIX)
+        .initial_balance(NearToken::from_near(10))
+        .transact()
+        .await?
+        .into_result()?;
+    let community_factory_wasm = std::fs::read(COMMUNITY_FACTORY_CONTRACT_PATH)?;
+    let _community_factory =
+        community_factory_account.deploy(&community_factory_wasm).await?.into_result()?;
+    Ok((contract, worker, near_social))
+}